{ // 获取包含Hugging Face文本的span元素 const spans = link.querySelectorAll('span.whitespace-nowrap, span.hidden.whitespace-nowrap'); spans.forEach(span => { if (span.textContent && span.textContent.trim().match(/Hugging\s*Face/i)) { span.textContent = 'AI快站'; } }); }); // 替换logo图片的alt属性 document.querySelectorAll('img[alt*="Hugging"], img[alt*="Face"]').forEach(img => { if (img.alt.match(/Hugging\s*Face/i)) { img.alt = 'AI快站 logo'; } }); } // 替换导航栏中的链接 function replaceNavigationLinks() { // 已替换标记,防止重复运行 if (window._navLinksReplaced) { return; } // 已经替换过的链接集合,防止重复替换 const replacedLinks = new Set(); // 只在导航栏区域查找和替换链接 const headerArea = document.querySelector('header') || document.querySelector('nav'); if (!headerArea) { return; } // 在导航区域内查找链接 const navLinks = headerArea.querySelectorAll('a'); navLinks.forEach(link => { // 如果已经替换过,跳过 if (replacedLinks.has(link)) return; const linkText = link.textContent.trim(); const linkHref = link.getAttribute('href') || ''; // 替换Spaces链接 - 仅替换一次 if ( (linkHref.includes('/spaces') || linkHref === '/spaces' || linkText === 'Spaces' || linkText.match(/^s*Spacess*$/i)) && linkText !== 'OCR模型免费转Markdown' && linkText !== 'OCR模型免费转Markdown' ) { link.textContent = 'OCR模型免费转Markdown'; link.href = 'https://fast360.xyz'; link.setAttribute('target', '_blank'); link.setAttribute('rel', 'noopener noreferrer'); replacedLinks.add(link); } // 删除Posts链接 else if ( (linkHref.includes('/posts') || linkHref === '/posts' || linkText === 'Posts' || linkText.match(/^s*Postss*$/i)) ) { if (link.parentNode) { link.parentNode.removeChild(link); } replacedLinks.add(link); } // 替换Docs链接 - 仅替换一次 else if ( (linkHref.includes('/docs') || linkHref === '/docs' || linkText === 'Docs' || linkText.match(/^s*Docss*$/i)) && linkText !== '模型下载攻略' ) { link.textContent = '模型下载攻略'; link.href = '/'; replacedLinks.add(link); } // 删除Enterprise链接 else if ( (linkHref.includes('/enterprise') || linkHref === '/enterprise' || linkText === 'Enterprise' || linkText.match(/^s*Enterprises*$/i)) ) { if (link.parentNode) { link.parentNode.removeChild(link); } replacedLinks.add(link); } }); // 查找可能嵌套的Spaces和Posts文本 const textNodes = []; function findTextNodes(element) { if (element.nodeType === Node.TEXT_NODE) { const text = element.textContent.trim(); if (text === 'Spaces' || text === 'Posts' || text === 'Enterprise') { textNodes.push(element); } } else { for (const child of element.childNodes) { findTextNodes(child); } } } // 只在导航区域内查找文本节点 findTextNodes(headerArea); // 替换找到的文本节点 textNodes.forEach(node => { const text = node.textContent.trim(); if (text === 'Spaces') { node.textContent = node.textContent.replace(/Spaces/g, 'OCR模型免费转Markdown'); } else if (text === 'Posts') { // 删除Posts文本节点 if (node.parentNode) { node.parentNode.removeChild(node); } } else if (text === 'Enterprise') { // 删除Enterprise文本节点 if (node.parentNode) { node.parentNode.removeChild(node); } } }); // 标记已替换完成 window._navLinksReplaced = true; } // 替换代码区域中的域名 function replaceCodeDomains() { // 特别处理span.hljs-string和span.njs-string元素 document.querySelectorAll('span.hljs-string, span.njs-string, span[class*="hljs-string"], span[class*="njs-string"]').forEach(span => { if (span.textContent && span.textContent.includes('huggingface.co')) { span.textContent = span.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 替换hljs-string类的span中的域名(移除多余的转义符号) document.querySelectorAll('span.hljs-string, span[class*="hljs-string"]').forEach(span => { if (span.textContent && span.textContent.includes('huggingface.co')) { span.textContent = span.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 替换pre和code标签中包含git clone命令的域名 document.querySelectorAll('pre, code').forEach(element => { if (element.textContent && element.textContent.includes('git clone')) { const text = element.innerHTML; if (text.includes('huggingface.co')) { element.innerHTML = text.replace(/huggingface.co/g, 'aifasthub.com'); } } }); // 处理特定的命令行示例 document.querySelectorAll('pre, code').forEach(element => { const text = element.innerHTML; if (text.includes('huggingface.co')) { // 针对git clone命令的专门处理 if (text.includes('git clone') || text.includes('GIT_LFS_SKIP_SMUDGE=1')) { element.innerHTML = text.replace(/huggingface.co/g, 'aifasthub.com'); } } }); // 特别处理模型下载页面上的代码片段 document.querySelectorAll('.flex.border-t, .svelte_hydrator, .inline-block').forEach(container => { const content = container.innerHTML; if (content && content.includes('huggingface.co')) { container.innerHTML = content.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 特别处理模型仓库克隆对话框中的代码片段 try { // 查找包含"Clone this model repository"标题的对话框 const cloneDialog = document.querySelector('.svelte_hydration_boundary, [data-target="MainHeader"]'); if (cloneDialog) { // 查找对话框中所有的代码片段和命令示例 const codeElements = cloneDialog.querySelectorAll('pre, code, span'); codeElements.forEach(element => { if (element.textContent && element.textContent.includes('huggingface.co')) { if (element.innerHTML.includes('huggingface.co')) { element.innerHTML = element.innerHTML.replace(/huggingface.co/g, 'aifasthub.com'); } else { element.textContent = element.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } } }); } // 更精确地定位克隆命令中的域名 document.querySelectorAll('[data-target]').forEach(container => { const codeBlocks = container.querySelectorAll('pre, code, span.hljs-string'); codeBlocks.forEach(block => { if (block.textContent && block.textContent.includes('huggingface.co')) { if (block.innerHTML.includes('huggingface.co')) { block.innerHTML = block.innerHTML.replace(/huggingface.co/g, 'aifasthub.com'); } else { block.textContent = block.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } } }); }); } catch (e) { // 错误处理但不打印日志 } } // 当DOM加载完成后执行替换 if (document.readyState === 'loading') { document.addEventListener('DOMContentLoaded', () => { replaceHeaderBranding(); replaceNavigationLinks(); replaceCodeDomains(); // 只在必要时执行替换 - 3秒后再次检查 setTimeout(() => { if (!window._navLinksReplaced) { console.log('[Client] 3秒后重新检查导航链接'); replaceNavigationLinks(); } }, 3000); }); } else { replaceHeaderBranding(); replaceNavigationLinks(); replaceCodeDomains(); // 只在必要时执行替换 - 3秒后再次检查 setTimeout(() => { if (!window._navLinksReplaced) { console.log('[Client] 3秒后重新检查导航链接'); replaceNavigationLinks(); } }, 3000); } // 增加一个MutationObserver来处理可能的动态元素加载 const observer = new MutationObserver(mutations => { // 检查是否导航区域有变化 const hasNavChanges = mutations.some(mutation => { // 检查是否存在header或nav元素变化 return Array.from(mutation.addedNodes).some(node => { if (node.nodeType === Node.ELEMENT_NODE) { // 检查是否是导航元素或其子元素 if (node.tagName === 'HEADER' || node.tagName === 'NAV' || node.querySelector('header, nav')) { return true; } // 检查是否在导航元素内部 let parent = node.parentElement; while (parent) { if (parent.tagName === 'HEADER' || parent.tagName === 'NAV') { return true; } parent = parent.parentElement; } } return false; }); }); // 只在导航区域有变化时执行替换 if (hasNavChanges) { // 重置替换状态,允许再次替换 window._navLinksReplaced = false; replaceHeaderBranding(); replaceNavigationLinks(); } }); // 开始观察document.body的变化,包括子节点 if (document.body) { observer.observe(document.body, { childList: true, subtree: true }); } else { document.addEventListener('DOMContentLoaded', () => { observer.observe(document.body, { childList: true, subtree: true }); }); } })(); \"\n stripped_text_from_html = get_text(html_content)\n assert stripped_text_from_html == 'test!\\nok man'\n\n\ndef test_check_basic_change_detection_functionality(client, live_server):\n set_original_response()\n live_server_setup(live_server)\n\n # Add our URL to the import page\n res = client.post(\n url_for(\"import_page\"),\n data={\"urls\": url_for('test_endpoint', _external=True)},\n follow_redirects=True\n )\n\n assert b\"1 Imported\" in res.data\n\n time.sleep(sleep_time_for_fetch_thread)\n\n # Do this a few times.. ensures we dont accidently set the status\n for n in range(3):\n client.get(url_for(\"api_watch_checknow\"), follow_redirects=True)\n\n # Give the thread time to pick it up\n time.sleep(sleep_time_for_fetch_thread)\n\n # It should report nothing found (no new 'unviewed' class)\n res = client.get(url_for(\"index\"))\n assert b'unviewed' not in res.data\n assert b'test-endpoint' in res.data\n\n # Default no password set, this stuff should be always available.\n\n assert b\"SETTINGS\" in res.data\n assert b\"BACKUP\" in res.data\n assert b\"IMPORT\" in res.data\n\n #####################\n\n # Check HTML conversion detected and workd\n res = client.get(\n url_for(\"preview_page\", uuid=\"first\"),\n follow_redirects=True\n )\n # Check this class does not appear (that we didnt see the actual source)\n assert b'foobar-detection' not in res.data\n\n # Make a change\n set_modified_response()\n\n res = urlopen(url_for('test_endpoint', _external=True))\n assert b'which has this one new line' in res.read()\n\n # Force recheck\n res = client.get(url_for(\"api_watch_checknow\"), follow_redirects=True)\n assert b'1 watches are queued for rechecking.' in res.data\n\n time.sleep(sleep_time_for_fetch_thread)\n\n # Now something should be ready, indicated by having a 'unviewed' class\n res = client.get(url_for(\"index\"))\n assert b'unviewed' in res.data\n\n # #75, and it should be in the RSS feed\n res = client.get(url_for(\"rss\"))\n expected_url = url_for('test_endpoint', _external=True)\n assert b' in settings\n res = client.post(\n url_for(\"settings_page\"),\n data={\"extract_title_as_title\": \"1\", \"minutes_between_check\": 180, 'fetch_backend': \"html_requests\"},\n follow_redirects=True\n )\n\n client.get(url_for(\"api_watch_checknow\"), follow_redirects=True)\n time.sleep(sleep_time_for_fetch_thread)\n\n res = client.get(url_for(\"index\"))\n assert b'unviewed' in res.data\n # It should have picked up the \n assert b'head title' in res.data\n\n #\n # Cleanup everything\n res = client.get(url_for(\"api_delete\", uuid=\"all\"), follow_redirects=True)\n assert b'Deleted' in res.data\n\n"},"avg_line_length":{"kind":"number","value":33.1705426357,"string":"33.170543"},"max_line_length":{"kind":"number","value":111,"string":"111"},"alphanum_fraction":{"kind":"number","value":0.6854405235,"string":"0.685441"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"shaikhspeare/changedetection.io"},"path":{"kind":"string","value":"changedetectionio/tests/test_backend.py"},"size":{"kind":"number","value":4279,"string":"4,279"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8719,"cells":{"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\n\"\"\"\nkay.ext.gaema.urls\n\n:Copyright: (c) 2009 Takashi Matsuo <tmatsuo@candit.jp>\n All rights reserved.\n:license: BSD, see LICENSE for more details.\n\"\"\"\n\nfrom kay.routing import (\n ViewGroup, Rule\n)\n\nview_groups = [\n ViewGroup(\n Rule('/login/<service>', endpoint='login',\n view='kay.ext.gaema.views.login'),\n Rule('/logout/<service>', endpoint='logout',\n view='kay.ext.gaema.views.logout'),\n Rule('/marketplace_login/a/<domain>', endpoint='marketplace_login',\n view='kay.ext.gaema.views.marketplace_login'),\n Rule('/marketplace_logout/<domain>', endpoint='marketplace_logout',\n view='kay.ext.gaema.views.marketplace_logout'),\n Rule('/select_service/<targets>', endpoint='select_service',\n view='kay.ext.gaema.views.select_service'),\n )\n]\n"},"avg_line_length":{"kind":"number","value":28.9310344828,"string":"28.931034"},"max_line_length":{"kind":"number","value":71,"string":"71"},"alphanum_fraction":{"kind":"number","value":0.6495828367,"string":"0.649583"},"licenses":{"kind":"list like","value":["Apache-2.0","BSD-3-Clause"],"string":"[\n \"Apache-2.0\",\n \"BSD-3-Clause\"\n]"},"repository_name":{"kind":"string","value":"IanLewis/kay"},"path":{"kind":"string","value":"kay/ext/gaema/urls.py"},"size":{"kind":"number","value":839,"string":"839"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8720,"cells":{"content":{"kind":"string","value":"from django.db import models\n\nclass Rice(models.Model):\n state_name=models.CharField(\"state_name\",max_length=255)\n distict_name=models.CharField(\"distict_name\",max_length=255)\n crop_year=models.IntegerField(\"crop_year\")\n season=models.CharField(\"season\",max_length=255)\n crop=models.CharField(\"crop\",max_length=255)\n temperature=models.FloatField(\"temperature\")\n precipitation=models.FloatField(\"precipitation\")\n humidity=models.IntegerField(\"humidity\")\n area=models.IntegerField(\"area\")\n production=models.FloatField(\"production\")"},"avg_line_length":{"kind":"number","value":43.1538461538,"string":"43.153846"},"max_line_length":{"kind":"number","value":64,"string":"64"},"alphanum_fraction":{"kind":"number","value":0.7700534759,"string":"0.770053"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"blitz-cmd/Rice-Crop-Yield-Prediction"},"path":{"kind":"string","value":"Rice_Crop_Yield_Prediction/models.py"},"size":{"kind":"number","value":561,"string":"561"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8721,"cells":{"content":{"kind":"string","value":"\"\"\"\nAsyncio using Asyncio.Task to execute three math function in parallel\n\"\"\"\nimport asyncio\n\n@asyncio.coroutine\ndef factorial(number):\n f = 1\n for i in range(2, number+1):\n print(\"Asyncio.Task: Compute factorial(%s)\" % (i))\n yield from asyncio.sleep(1)\n f *= i\n print(\"Asyncio.Task - factorial(%s) = %s\" % (number, f))\n\n@asyncio.coroutine\ndef fibonacci(number):\n a, b = 0, 1\n for i in range(number):\n print(\"Asyncio.Task: Compute fibonacci (%s)\" % (i))\n yield from asyncio.sleep(1)\n a, b = b, a + b\n print(\"Asyncio.Task - fibonacci(%s) = %s\" % (number, a))\n\n@asyncio.coroutine\ndef binomialCoeff(n, k):\n result = 1\n for i in range(1, k+1):\n result = result * (n-i+1) / i\n print(\"Asyncio.Task: Compute binomialCoeff (%s)\" % (i))\n yield from asyncio.sleep(1)\n print(\"Asyncio.Task - binomialCoeff(%s , %s) = %s\" % (n,k,result))\n\nif __name__ == \"__main__\":\n tasks = [asyncio.Task(factorial(10)),\n asyncio.Task(fibonacci(10)),\n asyncio.Task(binomialCoeff(20,10))]\n loop = asyncio.get_event_loop()\n loop.run_until_complete(asyncio.wait(tasks))\n loop.close()\n"},"avg_line_length":{"kind":"number","value":29.45,"string":"29.45"},"max_line_length":{"kind":"number","value":70,"string":"70"},"alphanum_fraction":{"kind":"number","value":0.6001697793,"string":"0.60017"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"jsdnhk/python-parallel-programming-cookbook-code"},"path":{"kind":"string","value":"Chapter 4/asyncio_Task.py"},"size":{"kind":"number","value":1178,"string":"1,178"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8722,"cells":{"content":{"kind":"string","value":"# Copyright 2015 Pants project contributors (see CONTRIBUTORS.md).\n# Licensed under the Apache License, Version 2.0 (see LICENSE).\n\nimport unittest\nfrom dataclasses import dataclass\nfrom textwrap import dedent\nfrom typing import Dict\n\nfrom pants.engine.fs import FileContent\nfrom pants.option.config import Config, TomlSerializer\n\n\n@dataclass(frozen=True)\nclass ConfigFile:\n content: str\n default_values: Dict\n expected_options: Dict\n\n\nFILE_1 = ConfigFile(\n content=dedent(\n \"\"\"\n [DEFAULT]\n name = \"%(env.NAME)s\"\n answer = 42\n scale = 1.2\n path = \"/a/b/%(answer)s\"\n embed = \"%(path)s::%(name)s\"\n disclaimer = '''\n Let it be known\n that.'''\n\n [a]\n # TODO: once TOML releases its new version with support for heterogenous lists, we should be\n # able to rewrite this to `[1, 2, 3, \"%(answer)s\"`. See\n # https://github.com/toml-lang/toml/issues/665.\n list = [\"1\", \"2\", \"3\", \"%(answer)s\"]\n list2.add = [7, 8, 9]\n list3.remove = [\"x\", \"y\", \"z\"]\n\n [b]\n preempt = true\n\n [c]\n name = \"overridden_from_default\"\n interpolated_from_section = \"%(name)s is interpolated\"\n recursively_interpolated_from_section = \"%(interpolated_from_section)s (again)\"\n\n [d.dict_val]\n # Make sure we don't misinterpret `add` and `remove` as list options.\n add = 0\n remove = 0\n nested = { nested_key = 'foo' }\n\n [list_merging]\n list1 = []\n list2 = [1, 2]\n list3.add = [3, 4]\n list4.remove = [5]\n list5 = [6, 7]\n \"\"\"\n ),\n default_values={\n \"name\": \"foo\",\n \"answer\": 42,\n \"scale\": 1.2,\n \"path\": \"/a/b/42\",\n \"embed\": \"/a/b/42::foo\",\n \"disclaimer\": \"Let it be known\\nthat.\",\n },\n expected_options={\n \"a\": {\"list\": '[\"1\", \"2\", \"3\", \"42\"]', \"list2\": \"+[7, 8, 9]\", \"list3\": '-[\"x\", \"y\", \"z\"]'},\n \"b\": {\"preempt\": \"True\"},\n \"c\": {\n \"name\": \"overridden_from_default\",\n \"interpolated_from_section\": \"overridden_from_default is interpolated\",\n \"recursively_interpolated_from_section\": \"overridden_from_default is interpolated (again)\",\n },\n \"d\": {\"dict_val\": \"{'add': 0, 'remove': 0, 'nested': {'nested_key': 'foo'}\"},\n \"list_merging\": {\n \"list1\": \"[]\",\n \"list2\": \"[1, 2]\",\n \"list3\": \"+[3, 4]\",\n \"list4\": \"-[5]\",\n \"list5\": \"[6, 7]\",\n },\n },\n)\n\n\nFILE_2 = ConfigFile(\n content=dedent(\n \"\"\"\n [a]\n fast = true\n\n [b]\n preempt = false\n\n [d]\n list.add = [0, 1]\n list.remove = [8, 9]\n\n [empty_section]\n\n [list_merging]\n list1 = [11, 22]\n list2.add = [33]\n list3.add = [8, 9]\n list3.remove = [4, 55]\n list4 = [66]\n list6.add = [77, 88]\n \"\"\"\n ),\n default_values={},\n expected_options={\n \"a\": {\"fast\": \"True\"},\n \"b\": {\"preempt\": \"False\"},\n \"d\": {\"list\": \"+[0, 1],-[8, 9]\"},\n \"empty_section\": {},\n \"list_merging\": {\n \"list1\": \"[11, 22]\",\n \"list2\": \"+[33]\",\n \"list3\": \"+[8, 9],-[4, 55]\",\n \"list4\": \"[66]\",\n \"list6\": \"+[77, 88]\",\n },\n },\n)\n\n\ndef _setup_config() -> Config:\n parsed_config = Config.load(\n file_contents=[\n FileContent(\"file1.toml\", FILE_1.content.encode()),\n FileContent(\"file2.toml\", FILE_2.content.encode()),\n ],\n seed_values={\"buildroot\": \"fake_buildroot\"},\n env={\"NAME\": \"foo\"},\n )\n assert [\"file1.toml\", \"file2.toml\"] == parsed_config.sources()\n return parsed_config\n\n\nclass ConfigTest(unittest.TestCase):\n def setUp(self) -> None:\n self.config = _setup_config()\n self.default_seed_values = Config._determine_seed_values(\n seed_values={\"buildroot\": \"fake_buildroot\"},\n env={\"NAME\": \"foo\"},\n )\n self.expected_combined_values: dict[str, dict[str, list[str]]] = {\n \"a\": {\n \"list\": ['[\"1\", \"2\", \"3\", \"42\"]'],\n \"list2\": [\"+[7, 8, 9]\"],\n \"list3\": ['-[\"x\", \"y\", \"z\"]'],\n \"fast\": [\"True\"],\n },\n \"b\": {\"preempt\": [\"True\", \"False\"]},\n \"c\": {\n \"name\": [\"overridden_from_default\"],\n \"interpolated_from_section\": [\"overridden_from_default is interpolated\"],\n \"recursively_interpolated_from_section\": [\n \"overridden_from_default is interpolated (again)\"\n ],\n },\n \"d\": {\n \"dict_val\": [\"{'add': 0, 'remove': 0, 'nested': {'nested_key': 'foo'}}\"],\n \"list\": [\"+[0, 1],-[8, 9]\"],\n },\n \"empty_section\": {},\n \"list_merging\": {\n \"list1\": [\"[]\", \"[11, 22]\"],\n \"list2\": [\"[1, 2]\", \"+[33]\"],\n \"list3\": [\"+[3, 4]\", \"+[8, 9],-[4, 55]\"],\n \"list4\": [\"-[5]\", \"[66]\"],\n \"list5\": [\"[6, 7]\"],\n \"list6\": [\"+[77, 88]\"],\n },\n }\n\n def test_default_values(self) -> None:\n # This is used in `options_bootstrapper.py` to ignore default values when validating options.\n file1_values = self.config.values[0]\n file2_values = self.config.values[1]\n # NB: string interpolation should only happen when calling _ConfigValues.get_value(). The\n # values for _ConfigValues.defaults are not yet interpolated.\n default_file1_values_unexpanded = {\n **FILE_1.default_values,\n \"name\": \"%(env.NAME)s\",\n \"path\": \"/a/b/%(answer)s\",\n \"embed\": \"%(path)s::%(name)s\",\n }\n assert file1_values.defaults == {\n **self.default_seed_values,\n **default_file1_values_unexpanded,\n }\n assert file2_values.defaults == self.default_seed_values\n\n def test_get(self) -> None:\n # Check the DEFAULT section\n # N.B.: All values read from config files are read as str and only later converted by the\n # options parser to the expected destination type; so we ensure we're comparing strings\n # here.\n for option, value in self.default_seed_values.items():\n # Both config files have the seed values.\n assert self.config.get(section=\"DEFAULT\", option=option) == [str(value), str(value)]\n for option, value in FILE_1.default_values.items():\n # Only FILE_1 has explicit DEFAULT values.\n assert self.config.get(section=\"DEFAULT\", option=option) == [str(value)]\n\n # Check the combined values.\n for section, section_values in self.expected_combined_values.items():\n for option, value_list in section_values.items():\n assert self.config.get(section=section, option=option) == value_list\n\n def test_empty(self) -> None:\n config = Config.load([])\n assert config.sources() == []\n\n\ndef test_toml_serializer() -> None:\n original_values: Dict = {\n \"GLOBAL\": {\n \"truthy\": True,\n \"falsy\": False,\n \"int\": 0,\n \"float\": 0.0,\n \"word\": \"hello there\",\n \"listy\": [\"a\", \"b\", \"c\"],\n \"map\": {\"a\": 0, \"b\": 1},\n },\n \"some-subsystem\": {\"o\": \"\"},\n }\n assert TomlSerializer(original_values).normalize() == {\n \"GLOBAL\": {**original_values[\"GLOBAL\"], \"map\": \"{'a': 0, 'b': 1}\"},\n \"some-subsystem\": {\"o\": \"\"},\n }\n\n\ndef test_toml_serializer_list_add_remove() -> None:\n original_values = {\"GLOBAL\": {\"backend_packages.add\": [\"added\"]}}\n assert TomlSerializer(original_values).normalize() == { # type: ignore[arg-type]\n \"GLOBAL\": {\"backend_packages\": \"+['added']\"}\n }\n"},"avg_line_length":{"kind":"number","value":32.1585365854,"string":"32.158537"},"max_line_length":{"kind":"number","value":103,"string":"103"},"alphanum_fraction":{"kind":"number","value":0.5067627354,"string":"0.506763"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"wonlay/pants"},"path":{"kind":"string","value":"src/python/pants/option/config_test.py"},"size":{"kind":"number","value":7911,"string":"7,911"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8723,"cells":{"content":{"kind":"string","value":"import contextlib\nimport logging\n\nfrom cStringIO import StringIO\n\nfrom teuthology import misc\nfrom teuthology.job_status import set_status\nfrom teuthology.orchestra import run\n\n\nlog = logging.getLogger(__name__)\n\n\n@contextlib.contextmanager\ndef syslog(ctx, config):\n \"\"\"\n start syslog / stop syslog on exit.\n \"\"\"\n if ctx.archive is None:\n # disable this whole feature if we're not going to archive the data\n # anyway\n yield\n return\n\n log.info('Starting syslog monitoring...')\n\n archive_dir = misc.get_archive_dir(ctx)\n log_dir = '{adir}/syslog'.format(adir=archive_dir)\n run.wait(\n ctx.cluster.run(\n args=['mkdir', '-p', '-m0755', '--', log_dir],\n wait=False,\n )\n )\n\n CONF = '/etc/rsyslog.d/80-cephtest.conf'\n kern_log = '{log_dir}/kern.log'.format(log_dir=log_dir)\n misc_log = '{log_dir}/misc.log'.format(log_dir=log_dir)\n conf_lines = [\n 'kern.* -{kern_log};RSYSLOG_FileFormat'.format(kern_log=kern_log),\n '*.*;kern.none -{misc_log};RSYSLOG_FileFormat'.format(\n misc_log=misc_log),\n ]\n conf_fp = StringIO('\\n'.join(conf_lines))\n try:\n for rem in ctx.cluster.remotes.iterkeys():\n log_context = 'system_u:object_r:var_log_t:s0'\n for log_path in (kern_log, misc_log):\n rem.run(args='touch %s' % log_path)\n rem.chcon(log_path, log_context)\n misc.sudo_write_file(\n remote=rem,\n path=CONF,\n data=conf_fp,\n )\n conf_fp.seek(0)\n run.wait(\n ctx.cluster.run(\n args=[\n 'sudo',\n 'service',\n # a mere reload (SIGHUP) doesn't seem to make\n # rsyslog open the files\n 'rsyslog',\n 'restart',\n ],\n wait=False,\n ),\n )\n\n yield\n finally:\n log.info('Shutting down syslog monitoring...')\n\n run.wait(\n ctx.cluster.run(\n args=[\n 'sudo',\n 'rm',\n '-f',\n '--',\n CONF,\n run.Raw('&&'),\n 'sudo',\n 'service',\n 'rsyslog',\n 'restart',\n ],\n wait=False,\n ),\n )\n # race condition: nothing actually says rsyslog had time to\n # flush the file fully. oh well.\n\n log.info('Checking logs for errors...')\n for rem in ctx.cluster.remotes.iterkeys():\n log.debug('Checking %s', rem.name)\n r = rem.run(\n args=[\n 'egrep', '--binary-files=text',\n '\\\\bBUG\\\\b|\\\\bINFO\\\\b|\\\\bDEADLOCK\\\\b',\n run.Raw('{adir}/syslog/*.log'.format(adir=archive_dir)),\n run.Raw('|'),\n 'grep', '-v', 'task .* blocked for more than .* seconds',\n run.Raw('|'),\n 'grep', '-v', 'lockdep is turned off',\n run.Raw('|'),\n 'grep', '-v', 'trying to register non-static key',\n run.Raw('|'),\n 'grep', '-v', 'DEBUG: fsize', # xfs_fsr\n run.Raw('|'),\n 'grep', '-v', 'CRON', # ignore cron noise\n run.Raw('|'),\n 'grep', '-v', 'BUG: bad unlock balance detected', # #6097\n run.Raw('|'),\n 'grep', '-v', 'inconsistent lock state', # FIXME see #2523\n run.Raw('|'),\n 'grep', '-v', '*** DEADLOCK ***', # part of lockdep output\n run.Raw('|'),\n 'grep', '-v',\n # FIXME see #2590 and #147\n 'INFO: possible irq lock inversion dependency detected',\n run.Raw('|'),\n 'grep', '-v',\n 'INFO: NMI handler (perf_event_nmi_handler) took too long to run', # noqa\n run.Raw('|'),\n 'grep', '-v', 'INFO: recovery required on readonly',\n run.Raw('|'),\n 'grep', '-v', 'ceph-create-keys: INFO',\n run.Raw('|'),\n 'egrep', '-v', '\\\\bsalt-master\\\\b|\\\\bsalt-minion\\\\b|\\\\bsalt-api\\\\b',\n run.Raw('|'),\n 'head', '-n', '1',\n ],\n stdout=StringIO(),\n )\n stdout = r.stdout.getvalue()\n if stdout != '':\n log.error('Error in syslog on %s: %s', rem.name, stdout)\n set_status(ctx.summary, 'fail')\n if 'failure_reason' not in ctx.summary:\n ctx.summary['failure_reason'] = \\\n \"'{error}' in syslog\".format(error=stdout)\n\n log.info('Compressing syslogs...')\n run.wait(\n ctx.cluster.run(\n args=[\n 'find',\n '{adir}/syslog'.format(adir=archive_dir),\n '-name',\n '*.log',\n '-print0',\n run.Raw('|'),\n 'sudo',\n 'xargs',\n '-0',\n '--no-run-if-empty',\n '--',\n 'gzip',\n '--',\n ],\n wait=False,\n ),\n )\n"},"avg_line_length":{"kind":"number","value":33.7891566265,"string":"33.789157"},"max_line_length":{"kind":"number","value":94,"string":"94"},"alphanum_fraction":{"kind":"number","value":0.4154038153,"string":"0.415404"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"dzedro/teuthology"},"path":{"kind":"string","value":"teuthology/task/internal/syslog.py"},"size":{"kind":"number","value":5609,"string":"5,609"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8724,"cells":{"content":{"kind":"string","value":"#https://www.codechef.com/problems/DECINC\nn = int(input())\nif(n%4==0):\n print(n+1)\nelse:\n print(n-1)"},"avg_line_length":{"kind":"number","value":17.6666666667,"string":"17.666667"},"max_line_length":{"kind":"number","value":41,"string":"41"},"alphanum_fraction":{"kind":"number","value":0.6132075472,"string":"0.613208"},"licenses":{"kind":"list like","value":["Unlicense"],"string":"[\n \"Unlicense\"\n]"},"repository_name":{"kind":"string","value":"27Anurag/Competitive-programing-hacktoberfest-2021"},"path":{"kind":"string","value":"CodeChef/DECINC_Decrement OR Increment.py"},"size":{"kind":"number","value":106,"string":"106"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8725,"cells":{"content":{"kind":"string","value":"r\"\"\"Distributed TensorFlow with Monitored Training Session.\n\nThis implements the 1a image recognition benchmark task, see https://mlbench.readthedocs.io/en/latest/benchmark-tasks.html#a-image-classification-resnet-cifar-10\nfor more details\n\nAdapted from official tutorial::\n\n https://www.tensorflow.org/deploy/distributed\n\nLaunch::\n\n mpirun -n 3 --allow-run-as-root python ....\n\n\"\"\"\nimport argparse\nimport logging\nimport os\n\nimport tensorflow as tf\nfrom mlbench_core.controlflow.tensorflow.train_validation import train_round, \\\n validation_round\nfrom mlbench_core.dataset.imagerecognition.tensorflow.cifar10 import \\\n DatasetCifar\nfrom mlbench_core.evaluation.goals import task1_time_to_accuracy_light_goal, \\\n task1_time_to_accuracy_goal\nfrom mlbench_core.evaluation.tensorflow.criterion import \\\n softmax_cross_entropy_with_logits_v2_l2_regularized\nfrom mlbench_core.evaluation.tensorflow.metrics import TopKAccuracy\nfrom mlbench_core.lr_scheduler.tensorflow.lr import manual_stepping\nfrom mlbench_core.models.tensorflow.resnet_model import Cifar10Model\nfrom mlbench_core.utils import Tracker\n\n\ndef define_graph(inputs, labels, is_training, batch_size, replicas_to_aggregate):\n \"\"\"\n Define graph for synchronized training.\n \"\"\"\n model = Cifar10Model(\n resnet_size=20,\n data_format='channels_last',\n resnet_version=2,\n dtype=tf.float32)\n\n logits = model(inputs, is_training)\n\n loss = softmax_cross_entropy_with_logits_v2_l2_regularized(\n logits=logits,\n labels=labels,\n l2=2e-4,\n # Exclude BN weights from L2 regularizer\n loss_filter_fn=lambda name: 'batch_normalization' not in name)\n\n # Use Top K accuracy as metrics\n metrics = [\n TopKAccuracy(logits, labels, topk=1),\n TopKAccuracy(logits, labels, topk=5),\n ]\n\n global_step = tf.train.get_or_create_global_step()\n\n # scheduling learning steps.\n lr_scheduler = manual_stepping(\n global_step=global_step,\n boundaries=[32000 // replicas_to_aggregate,\n 48000 // replicas_to_aggregate],\n rates=[0.1, 0.01, 0.001],\n warmup=False)\n\n # Define the optimizer\n optimizer_ = tf.train.MomentumOptimizer(\n learning_rate=lr_scheduler,\n momentum=0.9,\n use_nesterov=True)\n\n # Wrap optimizer with `SyncReplicasOptimizer`\n optimizer = tf.train.SyncReplicasOptimizer(\n optimizer_,\n replicas_to_aggregate=replicas_to_aggregate,\n total_num_replicas=replicas_to_aggregate)\n\n hooks = [\n optimizer.make_session_run_hook((rank == 0), num_tokens=0)\n ]\n\n # The update for batch normalization.\n update_ops = tf.get_collection(tf.GraphKeys.UPDATE_OPS)\n with tf.control_dependencies(update_ops):\n # Not all of the processes contribute one update. Some faster procs can push more updates.\n grads_and_vars = list(optimizer.compute_gradients(\n loss, tf.trainable_variables()))\n\n train_op = optimizer.apply_gradients(\n grads_and_vars, global_step=global_step)\n\n return train_op, loss, metrics, hooks\n\n\ndef main(is_ps, run_id, rank, world_size, cluster_spec, batch_size,\n replicas_to_aggregate, light_target=False):\n logging.info(\"Initial.\")\n\n job_name = \"ps\" if is_ps else \"worker\"\n\n cluster = tf.train.ClusterSpec(cluster_spec)\n\n gpu_options = tf.GPUOptions(allow_growth=True,\n per_process_gpu_memory_fraction=0.2)\n\n session_conf = tf.ConfigProto(\n gpu_options=gpu_options,\n allow_soft_placement=True,\n log_device_placement=False)\n\n server = tf.train.Server(\n cluster, job_name=job_name, task_index=rank, config=session_conf)\n\n if is_ps:\n server.join()\n else:\n # Pin variables to parameter server.\n device_fn = tf.train.replica_device_setter(\n ps_tasks=None,\n ps_device=\"/job:ps\",\n worker_device=\"/job:{}/task:{}/device:GPU:{}\".format(\n job_name, rank, rank),\n merge_devices=True,\n cluster=cluster,\n ps_ops=None,\n ps_strategy=None)\n\n with tf.Graph().as_default():\n with tf.device(device_fn):\n data_loader = DatasetCifar(\n dataset='cifar-10',\n dataset_root='/datasets',\n batch_size=batch_size,\n world_size=world_size,\n rank=rank,\n seed=42,\n tf_dtype=tf.float32)\n\n train_op, loss, metrics, hooks = define_graph(\n data_loader.inputs,\n data_loader.labels,\n data_loader.training,\n batch_size,\n replicas_to_aggregate)\n\n local_init_op = tf.group(\n tf.local_variables_initializer(),\n data_loader.train_init_op,\n data_loader.validation_init_op)\n\n scaffold = tf.train.Scaffold(\n init_op=None,\n init_feed_dict=None,\n init_fn=None,\n ready_op=None,\n ready_for_local_init_op=None,\n local_init_op=local_init_op)\n\n lr_tensor_name = tf.get_default_graph().get_tensor_by_name(\"learning_rate:0\")\n\n with tf.train.MonitoredTrainingSession(config=session_conf,\n master=server.target,\n scaffold=scaffold,\n is_chief=(rank == 0),\n checkpoint_dir=None,\n save_checkpoint_secs=None,\n save_summaries_steps=None,\n stop_grace_period_secs=5,\n hooks=hooks) as sess:\n\n logging.info(\"Begin training.\")\n\n final_epoch = 164\n\n if light_target:\n goal = task1_time_to_accuracy_light_goal()\n else:\n goal = task1_time_to_accuracy_goal()\n\n tracker = Tracker(metrics, run_id, rank, goal=goal)\n tracker.start()\n\n for i_epoch in range(final_epoch):\n logging.debug(\"=> Epoch {}\".format(i_epoch))\n\n train_round(sess, data_loader.train_init_op, train_op,\n loss, metrics, batch_size,\n data_loader.num_batches_per_epoch_for_train,\n tracker, lr_tensor=lr_tensor_name,\n lr_scheduler_level='epoch')\n\n validation_round(sess, data_loader.validation_init_op,\n loss, metrics, batch_size,\n data_loader.num_batches_per_epoch_for_eval,\n tracker)\n tracker.epoch_end()\n\n if tracker.goal_reached:\n print(\"Goal Reached!\")\n return\n\n logging.info(\"Finish.\")\n\n\ndef configure_logger(log_dir, is_ps, rank):\n logger = logging.getLogger('')\n logger.setLevel(logging.DEBUG)\n\n formatter = logging.Formatter(\n '{:6} rank={} : %(message)s'.format(\"ps\" if is_ps else \"worker\", rank),\n \"%Y-%m-%d %H:%M:%S\")\n\n ch = logging.StreamHandler()\n ch.setLevel(logging.DEBUG)\n ch.setFormatter(formatter)\n logger.addHandler(ch)\n\n log_name = '{}-{}.log'.format(\"ps\" if is_ps else \"worker\", rank)\n log_name = os.path.join(log_dir, log_name)\n if os.path.exists(log_name):\n os.remove(log_name)\n\n fh = logging.FileHandler(log_name)\n fh.setLevel(logging.DEBUG)\n fh.setFormatter(formatter)\n logger.addHandler(fh)\n\n\nif __name__ == \"__main__\":\n parser = argparse.ArgumentParser(description='Process run parameters')\n parser.add_argument('--run_id', type=str, help='The id of the run')\n parser.add_argument('--hosts', type=str, help='The hosts participating in this run')\n parser.add_argument('--light', action='store_true', default=False,\n help='Train to light target metric goal')\n args = parser.parse_args()\n\n rank = int(os.environ['OMPI_COMM_WORLD_RANK'])\n size = int(os.environ['OMPI_COMM_WORLD_SIZE'])\n\n hosts = args.hosts.split(\",\")\n\n if len(hosts) < 2:\n raise ValueError(\"At least 2 pods are needed for this benchmark (1 parameter server, 1 worker)\")\n\n workers = [h + \":22222\" for h in hosts[1:]]\n ps = hosts[0] + \":22222\" # First worker is the parameter server\n\n cluster_spec = {\"worker\": workers,\n \"ps\": [ps]}\n\n # Parse role in the cluster by rank.\n is_ps = rank < len(cluster_spec['ps'])\n rank = rank if is_ps else rank - len(cluster_spec['ps'])\n world_size = size - len(cluster_spec['ps'])\n\n # Configure Logging\n if not os.path.exists('/mlbench'):\n os.makedirs('/mlbench')\n configure_logger('/mlbench', is_ps, rank)\n\n batch_size = 128\n replicas_to_aggregate = len(cluster_spec['worker'])\n\n main(is_ps, args.run_id, rank, world_size, cluster_spec,\n batch_size, replicas_to_aggregate, light_target=args.light)\n"},"avg_line_length":{"kind":"number","value":35.2007434944,"string":"35.200743"},"max_line_length":{"kind":"number","value":161,"string":"161"},"alphanum_fraction":{"kind":"number","value":0.5984792481,"string":"0.598479"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"mlbench/mlbench-benchmarks"},"path":{"kind":"string","value":"tensorflow/imagerecognition/openmpi-cifar10-resnet20-all-reduce/main.py"},"size":{"kind":"number","value":9469,"string":"9,469"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8726,"cells":{"content":{"kind":"string","value":"from pathlib import Path, PurePath\n\n\nclass Directory:\n\n def __init__(self, path_in_image, path_out_image, path_out_file):\n self.__path_in_image = path_in_image\n self.__path_out_image = path_out_image\n self.__path_out_file = path_out_file\n self.__allowed_image_extension = ['.jpg', '.jpeg', '.png']\n\n @property\n def get_path_in_image(self):\n return self.__path_in_image\n\n @property\n def get_path_out_image(self):\n return self.__path_out_image\n\n @property\n def get_path_out_file(self):\n return self.__path_out_file\n\n @property\n def get_allowed_image_extension(self):\n return self.__allowed_image_extension\n\n def get_images(self):\n file_path_list = []\n\n for file in self.get_path_in_image.iterdir():\n if file.is_file():\n for image_extension in self.get_allowed_image_extension:\n if file.suffix == image_extension:\n file_path_list.append(PurePath.joinpath(\n self.get_path_in_image, file))\n return file_path_list\n\n def move_decoded_image(self, path, operation_id):\n file_extension = path.suffix\n new_file_name = operation_id + file_extension\n Path.rename(path, self.get_path_out_image / new_file_name)\n"},"avg_line_length":{"kind":"number","value":30.7674418605,"string":"30.767442"},"max_line_length":{"kind":"number","value":72,"string":"72"},"alphanum_fraction":{"kind":"number","value":0.6636432351,"string":"0.663643"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"paaarx/tax_receipt"},"path":{"kind":"string","value":"tax_receipt/directory.py"},"size":{"kind":"number","value":1323,"string":"1,323"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8727,"cells":{"content":{"kind":"string","value":"# ===============================================================================\n# Copyright 2014 Jake Ross\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n# ===============================================================================\n\n# ============= enthought library imports =======================\nfrom __future__ import absolute_import\nfrom traits.api import List\n\n# ============= standard library imports ========================\n# ============= local library imports ==========================\nfrom pychron.loggable import Loggable\n\n\nclass BaseTagModel(Loggable):\n items = List\n\n\n# ============= EOF =============================================\n"},"avg_line_length":{"kind":"number","value":37.3225806452,"string":"37.322581"},"max_line_length":{"kind":"number","value":81,"string":"81"},"alphanum_fraction":{"kind":"number","value":0.5436473639,"string":"0.543647"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"ASUPychron/pychron"},"path":{"kind":"string","value":"pychron/pipeline/tagging/base_tags.py"},"size":{"kind":"number","value":1157,"string":"1,157"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8728,"cells":{"content":{"kind":"string","value":"import time\nimport types\nimport unittest\n\nfrom unittest.mock import (\n call, _Call, create_autospec, MagicMock,\n Mock, ANY, _CallList, patch, PropertyMock\n)\n\nfrom datetime import datetime\n\nclass SomeClass(object):\n def one(self, a, b):\n pass\n def two(self):\n pass\n def three(self, a=None):\n pass\n\n\n\nclass AnyTest(unittest.TestCase):\n\n def test_any(self):\n self.assertEqual(ANY, object())\n\n mock = Mock()\n mock(ANY)\n mock.assert_called_with(ANY)\n\n mock = Mock()\n mock(foo=ANY)\n mock.assert_called_with(foo=ANY)\n\n def test_repr(self):\n self.assertEqual(repr(ANY), '<ANY>')\n self.assertEqual(str(ANY), '<ANY>')\n\n\n def test_any_and_datetime(self):\n mock = Mock()\n mock(datetime.now(), foo=datetime.now())\n\n mock.assert_called_with(ANY, foo=ANY)\n\n\n def test_any_mock_calls_comparison_order(self):\n mock = Mock()\n d = datetime.now()\n class Foo(object):\n def __eq__(self, other):\n return False\n def __ne__(self, other):\n return True\n\n for d in datetime.now(), Foo():\n mock.reset_mock()\n\n mock(d, foo=d, bar=d)\n mock.method(d, zinga=d, alpha=d)\n mock().method(a1=d, z99=d)\n\n expected = [\n call(ANY, foo=ANY, bar=ANY),\n call.method(ANY, zinga=ANY, alpha=ANY),\n call(), call().method(a1=ANY, z99=ANY)\n ]\n self.assertEqual(expected, mock.mock_calls)\n self.assertEqual(mock.mock_calls, expected)\n\n\n\nclass CallTest(unittest.TestCase):\n\n def test_call_with_call(self):\n kall = _Call()\n self.assertEqual(kall, _Call())\n self.assertEqual(kall, _Call(('',)))\n self.assertEqual(kall, _Call(((),)))\n self.assertEqual(kall, _Call(({},)))\n self.assertEqual(kall, _Call(('', ())))\n self.assertEqual(kall, _Call(('', {})))\n self.assertEqual(kall, _Call(('', (), {})))\n self.assertEqual(kall, _Call(('foo',)))\n self.assertEqual(kall, _Call(('bar', ())))\n self.assertEqual(kall, _Call(('baz', {})))\n self.assertEqual(kall, _Call(('spam', (), {})))\n\n kall = _Call(((1, 2, 3),))\n self.assertEqual(kall, _Call(((1, 2, 3),)))\n self.assertEqual(kall, _Call(('', (1, 2, 3))))\n self.assertEqual(kall, _Call(((1, 2, 3), {})))\n self.assertEqual(kall, _Call(('', (1, 2, 3), {})))\n\n kall = _Call(((1, 2, 4),))\n self.assertNotEqual(kall, _Call(('', (1, 2, 3))))\n self.assertNotEqual(kall, _Call(('', (1, 2, 3), {})))\n\n kall = _Call(('foo', (1, 2, 4),))\n self.assertNotEqual(kall, _Call(('', (1, 2, 4))))\n self.assertNotEqual(kall, _Call(('', (1, 2, 4), {})))\n self.assertNotEqual(kall, _Call(('bar', (1, 2, 4))))\n self.assertNotEqual(kall, _Call(('bar', (1, 2, 4), {})))\n\n kall = _Call(({'a': 3},))\n self.assertEqual(kall, _Call(('', (), {'a': 3})))\n self.assertEqual(kall, _Call(('', {'a': 3})))\n self.assertEqual(kall, _Call(((), {'a': 3})))\n self.assertEqual(kall, _Call(({'a': 3},)))\n\n\n def test_empty__Call(self):\n args = _Call()\n\n self.assertEqual(args, ())\n self.assertEqual(args, ('foo',))\n self.assertEqual(args, ((),))\n self.assertEqual(args, ('foo', ()))\n self.assertEqual(args, ('foo',(), {}))\n self.assertEqual(args, ('foo', {}))\n self.assertEqual(args, ({},))\n\n\n def test_named_empty_call(self):\n args = _Call(('foo', (), {}))\n\n self.assertEqual(args, ('foo',))\n self.assertEqual(args, ('foo', ()))\n self.assertEqual(args, ('foo',(), {}))\n self.assertEqual(args, ('foo', {}))\n\n self.assertNotEqual(args, ((),))\n self.assertNotEqual(args, ())\n self.assertNotEqual(args, ({},))\n self.assertNotEqual(args, ('bar',))\n self.assertNotEqual(args, ('bar', ()))\n self.assertNotEqual(args, ('bar', {}))\n\n\n def test_call_with_args(self):\n args = _Call(((1, 2, 3), {}))\n\n self.assertEqual(args, ((1, 2, 3),))\n self.assertEqual(args, ('foo', (1, 2, 3)))\n self.assertEqual(args, ('foo', (1, 2, 3), {}))\n self.assertEqual(args, ((1, 2, 3), {}))\n\n\n def test_named_call_with_args(self):\n args = _Call(('foo', (1, 2, 3), {}))\n\n self.assertEqual(args, ('foo', (1, 2, 3)))\n self.assertEqual(args, ('foo', (1, 2, 3), {}))\n\n self.assertNotEqual(args, ((1, 2, 3),))\n self.assertNotEqual(args, ((1, 2, 3), {}))\n\n\n def test_call_with_kwargs(self):\n args = _Call(((), dict(a=3, b=4)))\n\n self.assertEqual(args, (dict(a=3, b=4),))\n self.assertEqual(args, ('foo', dict(a=3, b=4)))\n self.assertEqual(args, ('foo', (), dict(a=3, b=4)))\n self.assertEqual(args, ((), dict(a=3, b=4)))\n\n\n def test_named_call_with_kwargs(self):\n args = _Call(('foo', (), dict(a=3, b=4)))\n\n self.assertEqual(args, ('foo', dict(a=3, b=4)))\n self.assertEqual(args, ('foo', (), dict(a=3, b=4)))\n\n self.assertNotEqual(args, (dict(a=3, b=4),))\n self.assertNotEqual(args, ((), dict(a=3, b=4)))\n\n\n def test_call_with_args_call_empty_name(self):\n args = _Call(((1, 2, 3), {}))\n self.assertEqual(args, call(1, 2, 3))\n self.assertEqual(call(1, 2, 3), args)\n self.assertIn(call(1, 2, 3), [args])\n\n\n def test_call_ne(self):\n self.assertNotEqual(_Call(((1, 2, 3),)), call(1, 2))\n self.assertFalse(_Call(((1, 2, 3),)) != call(1, 2, 3))\n self.assertTrue(_Call(((1, 2), {})) != call(1, 2, 3))\n\n\n def test_call_non_tuples(self):\n kall = _Call(((1, 2, 3),))\n for value in 1, None, self, int:\n self.assertNotEqual(kall, value)\n self.assertFalse(kall == value)\n\n\n def test_repr(self):\n self.assertEqual(repr(_Call()), 'call()')\n self.assertEqual(repr(_Call(('foo',))), 'call.foo()')\n\n self.assertEqual(repr(_Call(((1, 2, 3), {'a': 'b'}))),\n \"call(1, 2, 3, a='b')\")\n self.assertEqual(repr(_Call(('bar', (1, 2, 3), {'a': 'b'}))),\n \"call.bar(1, 2, 3, a='b')\")\n\n self.assertEqual(repr(call), 'call')\n self.assertEqual(str(call), 'call')\n\n self.assertEqual(repr(call()), 'call()')\n self.assertEqual(repr(call(1)), 'call(1)')\n self.assertEqual(repr(call(zz='thing')), \"call(zz='thing')\")\n\n self.assertEqual(repr(call().foo), 'call().foo')\n self.assertEqual(repr(call(1).foo.bar(a=3).bing),\n 'call().foo.bar().bing')\n self.assertEqual(\n repr(call().foo(1, 2, a=3)),\n \"call().foo(1, 2, a=3)\"\n )\n self.assertEqual(repr(call()()), \"call()()\")\n self.assertEqual(repr(call(1)(2)), \"call()(2)\")\n self.assertEqual(\n repr(call()().bar().baz.beep(1)),\n \"call()().bar().baz.beep(1)\"\n )\n\n\n def test_call(self):\n self.assertEqual(call(), ('', (), {}))\n self.assertEqual(call('foo', 'bar', one=3, two=4),\n ('', ('foo', 'bar'), {'one': 3, 'two': 4}))\n\n mock = Mock()\n mock(1, 2, 3)\n mock(a=3, b=6)\n self.assertEqual(mock.call_args_list,\n [call(1, 2, 3), call(a=3, b=6)])\n\n def test_attribute_call(self):\n self.assertEqual(call.foo(1), ('foo', (1,), {}))\n self.assertEqual(call.bar.baz(fish='eggs'),\n ('bar.baz', (), {'fish': 'eggs'}))\n\n mock = Mock()\n mock.foo(1, 2 ,3)\n mock.bar.baz(a=3, b=6)\n self.assertEqual(mock.method_calls,\n [call.foo(1, 2, 3), call.bar.baz(a=3, b=6)])\n\n\n def test_extended_call(self):\n result = call(1).foo(2).bar(3, a=4)\n self.assertEqual(result, ('().foo().bar', (3,), dict(a=4)))\n\n mock = MagicMock()\n mock(1, 2, a=3, b=4)\n self.assertEqual(mock.call_args, call(1, 2, a=3, b=4))\n self.assertNotEqual(mock.call_args, call(1, 2, 3))\n\n self.assertEqual(mock.call_args_list, [call(1, 2, a=3, b=4)])\n self.assertEqual(mock.mock_calls, [call(1, 2, a=3, b=4)])\n\n mock = MagicMock()\n mock.foo(1).bar()().baz.beep(a=6)\n\n last_call = call.foo(1).bar()().baz.beep(a=6)\n self.assertEqual(mock.mock_calls[-1], last_call)\n self.assertEqual(mock.mock_calls, last_call.call_list())\n\n\n def test_call_list(self):\n mock = MagicMock()\n mock(1)\n self.assertEqual(call(1).call_list(), mock.mock_calls)\n\n mock = MagicMock()\n mock(1).method(2)\n self.assertEqual(call(1).method(2).call_list(),\n mock.mock_calls)\n\n mock = MagicMock()\n mock(1).method(2)(3)\n self.assertEqual(call(1).method(2)(3).call_list(),\n mock.mock_calls)\n\n mock = MagicMock()\n int(mock(1).method(2)(3).foo.bar.baz(4)(5))\n kall = call(1).method(2)(3).foo.bar.baz(4)(5).__int__()\n self.assertEqual(kall.call_list(), mock.mock_calls)\n\n\n def test_call_any(self):\n self.assertEqual(call, ANY)\n\n m = MagicMock()\n int(m)\n self.assertEqual(m.mock_calls, [ANY])\n self.assertEqual([ANY], m.mock_calls)\n\n\n def test_two_args_call(self):\n args = _Call(((1, 2), {'a': 3}), two=True)\n self.assertEqual(len(args), 2)\n self.assertEqual(args[0], (1, 2))\n self.assertEqual(args[1], {'a': 3})\n\n other_args = _Call(((1, 2), {'a': 3}))\n self.assertEqual(args, other_args)\n\n def test_call_with_name(self):\n self.assertEqual(_Call((), 'foo')[0], 'foo')\n self.assertEqual(_Call((('bar', 'barz'),),)[0], '')\n self.assertEqual(_Call((('bar', 'barz'), {'hello': 'world'}),)[0], '')\n\n\nclass SpecSignatureTest(unittest.TestCase):\n\n def _check_someclass_mock(self, mock):\n self.assertRaises(AttributeError, getattr, mock, 'foo')\n mock.one(1, 2)\n mock.one.assert_called_with(1, 2)\n self.assertRaises(AssertionError,\n mock.one.assert_called_with, 3, 4)\n self.assertRaises(TypeError, mock.one, 1)\n\n mock.two()\n mock.two.assert_called_with()\n self.assertRaises(AssertionError,\n mock.two.assert_called_with, 3)\n self.assertRaises(TypeError, mock.two, 1)\n\n mock.three()\n mock.three.assert_called_with()\n self.assertRaises(AssertionError,\n mock.three.assert_called_with, 3)\n self.assertRaises(TypeError, mock.three, 3, 2)\n\n mock.three(1)\n mock.three.assert_called_with(1)\n\n mock.three(a=1)\n mock.three.assert_called_with(a=1)\n\n\n def test_basic(self):\n mock = create_autospec(SomeClass)\n self._check_someclass_mock(mock)\n mock = create_autospec(SomeClass())\n self._check_someclass_mock(mock)\n\n\n def test_create_autospec_return_value(self):\n def f():\n pass\n mock = create_autospec(f, return_value='foo')\n self.assertEqual(mock(), 'foo')\n\n class Foo(object):\n pass\n\n mock = create_autospec(Foo, return_value='foo')\n self.assertEqual(mock(), 'foo')\n\n\n def test_autospec_reset_mock(self):\n m = create_autospec(int)\n int(m)\n m.reset_mock()\n self.assertEqual(m.__int__.call_count, 0)\n\n\n def test_mocking_unbound_methods(self):\n class Foo(object):\n def foo(self, foo):\n pass\n p = patch.object(Foo, 'foo')\n mock_foo = p.start()\n Foo().foo(1)\n\n mock_foo.assert_called_with(1)\n\n\n def test_create_autospec_unbound_methods(self):\n # see mock issue 128\n # this is expected to fail until the issue is fixed\n return\n class Foo(object):\n def foo(self):\n pass\n\n klass = create_autospec(Foo)\n instance = klass()\n self.assertRaises(TypeError, instance.foo, 1)\n\n # Note: no type checking on the \"self\" parameter\n klass.foo(1)\n klass.foo.assert_called_with(1)\n self.assertRaises(TypeError, klass.foo)\n\n\n def test_create_autospec_keyword_arguments(self):\n class Foo(object):\n a = 3\n m = create_autospec(Foo, a='3')\n self.assertEqual(m.a, '3')\n\n\n def test_create_autospec_keyword_only_arguments(self):\n def foo(a, *, b=None):\n pass\n\n m = create_autospec(foo)\n m(1)\n m.assert_called_with(1)\n self.assertRaises(TypeError, m, 1, 2)\n\n m(2, b=3)\n m.assert_called_with(2, b=3)\n\n\n def test_function_as_instance_attribute(self):\n obj = SomeClass()\n def f(a):\n pass\n obj.f = f\n\n mock = create_autospec(obj)\n mock.f('bing')\n mock.f.assert_called_with('bing')\n\n\n def test_spec_as_list(self):\n # because spec as a list of strings in the mock constructor means\n # something very different we treat a list instance as the type.\n mock = create_autospec([])\n mock.append('foo')\n mock.append.assert_called_with('foo')\n\n self.assertRaises(AttributeError, getattr, mock, 'foo')\n\n class Foo(object):\n foo = []\n\n mock = create_autospec(Foo)\n mock.foo.append(3)\n mock.foo.append.assert_called_with(3)\n self.assertRaises(AttributeError, getattr, mock.foo, 'foo')\n\n\n def test_attributes(self):\n class Sub(SomeClass):\n attr = SomeClass()\n\n sub_mock = create_autospec(Sub)\n\n for mock in (sub_mock, sub_mock.attr):\n self._check_someclass_mock(mock)\n\n\n def test_builtin_functions_types(self):\n # we could replace builtin functions / methods with a function\n # with *args / **kwargs signature. Using the builtin method type\n # as a spec seems to work fairly well though.\n class BuiltinSubclass(list):\n def bar(self, arg):\n pass\n sorted = sorted\n attr = {}\n\n mock = create_autospec(BuiltinSubclass)\n mock.append(3)\n mock.append.assert_called_with(3)\n self.assertRaises(AttributeError, getattr, mock.append, 'foo')\n\n mock.bar('foo')\n mock.bar.assert_called_with('foo')\n self.assertRaises(TypeError, mock.bar, 'foo', 'bar')\n self.assertRaises(AttributeError, getattr, mock.bar, 'foo')\n\n mock.sorted([1, 2])\n mock.sorted.assert_called_with([1, 2])\n self.assertRaises(AttributeError, getattr, mock.sorted, 'foo')\n\n mock.attr.pop(3)\n mock.attr.pop.assert_called_with(3)\n self.assertRaises(AttributeError, getattr, mock.attr, 'foo')\n\n\n def test_method_calls(self):\n class Sub(SomeClass):\n attr = SomeClass()\n\n mock = create_autospec(Sub)\n mock.one(1, 2)\n mock.two()\n mock.three(3)\n\n expected = [call.one(1, 2), call.two(), call.three(3)]\n self.assertEqual(mock.method_calls, expected)\n\n mock.attr.one(1, 2)\n mock.attr.two()\n mock.attr.three(3)\n\n expected.extend(\n [call.attr.one(1, 2), call.attr.two(), call.attr.three(3)]\n )\n self.assertEqual(mock.method_calls, expected)\n\n\n def test_magic_methods(self):\n class BuiltinSubclass(list):\n attr = {}\n\n mock = create_autospec(BuiltinSubclass)\n self.assertEqual(list(mock), [])\n self.assertRaises(TypeError, int, mock)\n self.assertRaises(TypeError, int, mock.attr)\n self.assertEqual(list(mock), [])\n\n self.assertIsInstance(mock['foo'], MagicMock)\n self.assertIsInstance(mock.attr['foo'], MagicMock)\n\n\n def test_spec_set(self):\n class Sub(SomeClass):\n attr = SomeClass()\n\n for spec in (Sub, Sub()):\n mock = create_autospec(spec, spec_set=True)\n self._check_someclass_mock(mock)\n\n self.assertRaises(AttributeError, setattr, mock, 'foo', 'bar')\n self.assertRaises(AttributeError, setattr, mock.attr, 'foo', 'bar')\n\n\n def test_descriptors(self):\n class Foo(object):\n @classmethod\n def f(cls, a, b):\n pass\n @staticmethod\n def g(a, b):\n pass\n\n class Bar(Foo):\n pass\n\n class Baz(SomeClass, Bar):\n pass\n\n for spec in (Foo, Foo(), Bar, Bar(), Baz, Baz()):\n mock = create_autospec(spec)\n mock.f(1, 2)\n mock.f.assert_called_once_with(1, 2)\n\n mock.g(3, 4)\n mock.g.assert_called_once_with(3, 4)\n\n\n def test_recursive(self):\n class A(object):\n def a(self):\n pass\n foo = 'foo bar baz'\n bar = foo\n\n A.B = A\n mock = create_autospec(A)\n\n mock()\n self.assertFalse(mock.B.called)\n\n mock.a()\n mock.B.a()\n self.assertEqual(mock.method_calls, [call.a(), call.B.a()])\n\n self.assertIs(A.foo, A.bar)\n self.assertIsNot(mock.foo, mock.bar)\n mock.foo.lower()\n self.assertRaises(AssertionError, mock.bar.lower.assert_called_with)\n\n\n def test_spec_inheritance_for_classes(self):\n class Foo(object):\n def a(self, x):\n pass\n class Bar(object):\n def f(self, y):\n pass\n\n class_mock = create_autospec(Foo)\n\n self.assertIsNot(class_mock, class_mock())\n\n for this_mock in class_mock, class_mock():\n this_mock.a(x=5)\n this_mock.a.assert_called_with(x=5)\n this_mock.a.assert_called_with(5)\n self.assertRaises(TypeError, this_mock.a, 'foo', 'bar')\n self.assertRaises(AttributeError, getattr, this_mock, 'b')\n\n instance_mock = create_autospec(Foo())\n instance_mock.a(5)\n instance_mock.a.assert_called_with(5)\n instance_mock.a.assert_called_with(x=5)\n self.assertRaises(TypeError, instance_mock.a, 'foo', 'bar')\n self.assertRaises(AttributeError, getattr, instance_mock, 'b')\n\n # The return value isn't isn't callable\n self.assertRaises(TypeError, instance_mock)\n\n instance_mock.Bar.f(6)\n instance_mock.Bar.f.assert_called_with(6)\n instance_mock.Bar.f.assert_called_with(y=6)\n self.assertRaises(AttributeError, getattr, instance_mock.Bar, 'g')\n\n instance_mock.Bar().f(6)\n instance_mock.Bar().f.assert_called_with(6)\n instance_mock.Bar().f.assert_called_with(y=6)\n self.assertRaises(AttributeError, getattr, instance_mock.Bar(), 'g')\n\n\n def test_inherit(self):\n class Foo(object):\n a = 3\n\n Foo.Foo = Foo\n\n # class\n mock = create_autospec(Foo)\n instance = mock()\n self.assertRaises(AttributeError, getattr, instance, 'b')\n\n attr_instance = mock.Foo()\n self.assertRaises(AttributeError, getattr, attr_instance, 'b')\n\n # instance\n mock = create_autospec(Foo())\n self.assertRaises(AttributeError, getattr, mock, 'b')\n self.assertRaises(TypeError, mock)\n\n # attribute instance\n call_result = mock.Foo()\n self.assertRaises(AttributeError, getattr, call_result, 'b')\n\n\n def test_builtins(self):\n # used to fail with infinite recursion\n create_autospec(1)\n\n create_autospec(int)\n create_autospec('foo')\n create_autospec(str)\n create_autospec({})\n create_autospec(dict)\n create_autospec([])\n create_autospec(list)\n create_autospec(set())\n create_autospec(set)\n create_autospec(1.0)\n create_autospec(float)\n create_autospec(1j)\n create_autospec(complex)\n create_autospec(False)\n create_autospec(True)\n\n\n def test_function(self):\n def f(a, b):\n pass\n\n mock = create_autospec(f)\n self.assertRaises(TypeError, mock)\n mock(1, 2)\n mock.assert_called_with(1, 2)\n mock.assert_called_with(1, b=2)\n mock.assert_called_with(a=1, b=2)\n\n f.f = f\n mock = create_autospec(f)\n self.assertRaises(TypeError, mock.f)\n mock.f(3, 4)\n mock.f.assert_called_with(3, 4)\n mock.f.assert_called_with(a=3, b=4)\n\n\n def test_skip_attributeerrors(self):\n class Raiser(object):\n def __get__(self, obj, type=None):\n if obj is None:\n raise AttributeError('Can only be accessed via an instance')\n\n class RaiserClass(object):\n raiser = Raiser()\n\n @staticmethod\n def existing(a, b):\n return a + b\n\n s = create_autospec(RaiserClass)\n self.assertRaises(TypeError, lambda x: s.existing(1, 2, 3))\n s.existing(1, 2)\n self.assertRaises(AttributeError, lambda: s.nonexisting)\n\n # check we can fetch the raiser attribute and it has no spec\n obj = s.raiser\n obj.foo, obj.bar\n\n\n def test_signature_class(self):\n class Foo(object):\n def __init__(self, a, b=3):\n pass\n\n mock = create_autospec(Foo)\n\n self.assertRaises(TypeError, mock)\n mock(1)\n mock.assert_called_once_with(1)\n mock.assert_called_once_with(a=1)\n self.assertRaises(AssertionError, mock.assert_called_once_with, 2)\n\n mock(4, 5)\n mock.assert_called_with(4, 5)\n mock.assert_called_with(a=4, b=5)\n self.assertRaises(AssertionError, mock.assert_called_with, a=5, b=4)\n\n\n def test_class_with_no_init(self):\n # this used to raise an exception\n # due to trying to get a signature from object.__init__\n class Foo(object):\n pass\n create_autospec(Foo)\n\n\n def test_signature_callable(self):\n class Callable(object):\n def __init__(self, x, y):\n pass\n def __call__(self, a):\n pass\n\n mock = create_autospec(Callable)\n mock(1, 2)\n mock.assert_called_once_with(1, 2)\n mock.assert_called_once_with(x=1, y=2)\n self.assertRaises(TypeError, mock, 'a')\n\n instance = mock(1, 2)\n self.assertRaises(TypeError, instance)\n instance(a='a')\n instance.assert_called_once_with('a')\n instance.assert_called_once_with(a='a')\n instance('a')\n instance.assert_called_with('a')\n instance.assert_called_with(a='a')\n\n mock = create_autospec(Callable(1, 2))\n mock(a='a')\n mock.assert_called_once_with(a='a')\n self.assertRaises(TypeError, mock)\n mock('a')\n mock.assert_called_with('a')\n\n\n def test_signature_noncallable(self):\n class NonCallable(object):\n def __init__(self):\n pass\n\n mock = create_autospec(NonCallable)\n instance = mock()\n mock.assert_called_once_with()\n self.assertRaises(TypeError, mock, 'a')\n self.assertRaises(TypeError, instance)\n self.assertRaises(TypeError, instance, 'a')\n\n mock = create_autospec(NonCallable())\n self.assertRaises(TypeError, mock)\n self.assertRaises(TypeError, mock, 'a')\n\n\n def test_create_autospec_none(self):\n class Foo(object):\n bar = None\n\n mock = create_autospec(Foo)\n none = mock.bar\n self.assertNotIsInstance(none, type(None))\n\n none.foo()\n none.foo.assert_called_once_with()\n\n\n def test_autospec_functions_with_self_in_odd_place(self):\n class Foo(object):\n def f(a, self):\n pass\n\n a = create_autospec(Foo)\n a.f(10)\n a.f.assert_called_with(10)\n a.f.assert_called_with(self=10)\n a.f(self=10)\n a.f.assert_called_with(10)\n a.f.assert_called_with(self=10)\n\n\n def test_autospec_data_descriptor(self):\n class Descriptor(object):\n def __init__(self, value):\n self.value = value\n\n def __get__(self, obj, cls=None):\n if obj is None:\n return self\n return self.value\n\n def __set__(self, obj, value):\n pass\n\n class MyProperty(property):\n pass\n\n class Foo(object):\n __slots__ = ['slot']\n\n @property\n def prop(self):\n return 3\n\n @MyProperty\n def subprop(self):\n return 4\n\n desc = Descriptor(42)\n\n foo = create_autospec(Foo)\n\n def check_data_descriptor(mock_attr):\n # Data descriptors don't have a spec.\n self.assertIsInstance(mock_attr, MagicMock)\n mock_attr(1, 2, 3)\n mock_attr.abc(4, 5, 6)\n mock_attr.assert_called_once_with(1, 2, 3)\n mock_attr.abc.assert_called_once_with(4, 5, 6)\n\n # property\n check_data_descriptor(foo.prop)\n # property subclass\n check_data_descriptor(foo.subprop)\n # class __slot__\n check_data_descriptor(foo.slot)\n # plain data descriptor\n check_data_descriptor(foo.desc)\n\n\n def test_autospec_on_bound_builtin_function(self):\n meth = types.MethodType(time.ctime, time.time())\n self.assertIsInstance(meth(), str)\n mocked = create_autospec(meth)\n\n # no signature, so no spec to check against\n mocked()\n mocked.assert_called_once_with()\n mocked.reset_mock()\n mocked(4, 5, 6)\n mocked.assert_called_once_with(4, 5, 6)\n\n\nclass TestCallList(unittest.TestCase):\n\n def test_args_list_contains_call_list(self):\n mock = Mock()\n self.assertIsInstance(mock.call_args_list, _CallList)\n\n mock(1, 2)\n mock(a=3)\n mock(3, 4)\n mock(b=6)\n\n for kall in call(1, 2), call(a=3), call(3, 4), call(b=6):\n self.assertIn(kall, mock.call_args_list)\n\n calls = [call(a=3), call(3, 4)]\n self.assertIn(calls, mock.call_args_list)\n calls = [call(1, 2), call(a=3)]\n self.assertIn(calls, mock.call_args_list)\n calls = [call(3, 4), call(b=6)]\n self.assertIn(calls, mock.call_args_list)\n calls = [call(3, 4)]\n self.assertIn(calls, mock.call_args_list)\n\n self.assertNotIn(call('fish'), mock.call_args_list)\n self.assertNotIn([call('fish')], mock.call_args_list)\n\n\n def test_call_list_str(self):\n mock = Mock()\n mock(1, 2)\n mock.foo(a=3)\n mock.foo.bar().baz('fish', cat='dog')\n\n expected = (\n \"[call(1, 2),\\n\"\n \" call.foo(a=3),\\n\"\n \" call.foo.bar(),\\n\"\n \" call.foo.bar().baz('fish', cat='dog')]\"\n )\n self.assertEqual(str(mock.mock_calls), expected)\n\n\n def test_propertymock(self):\n p = patch('%s.SomeClass.one' % __name__, new_callable=PropertyMock)\n mock = p.start()\n try:\n SomeClass.one\n mock.assert_called_once_with()\n\n s = SomeClass()\n s.one\n mock.assert_called_with()\n self.assertEqual(mock.mock_calls, [call(), call()])\n\n s.one = 3\n self.assertEqual(mock.mock_calls, [call(), call(), call(3)])\n finally:\n p.stop()\n\n\n def test_propertymock_returnvalue(self):\n m = MagicMock()\n p = PropertyMock()\n type(m).foo = p\n\n returned = m.foo\n p.assert_called_once_with()\n self.assertIsInstance(returned, MagicMock)\n self.assertNotIsInstance(returned, PropertyMock)\n\n\nif __name__ == '__main__':\n unittest.main()\n"},"avg_line_length":{"kind":"number","value":29.3727560718,"string":"29.372756"},"max_line_length":{"kind":"number","value":80,"string":"80"},"alphanum_fraction":{"kind":"number","value":0.5593543284,"string":"0.559354"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"4nkitd/pyAutomation"},"path":{"kind":"string","value":"Mark_attandance_py_selenium/py/App/Python/Lib/unittest/test/testmock/testhelpers.py"},"size":{"kind":"number","value":27816,"string":"27,816"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8729,"cells":{"content":{"kind":"string","value":"# Generated by Django 3.2.4 on 2021-08-06 15:38\n\nfrom django.db import migrations\n\n\nclass Migration(migrations.Migration):\n\n dependencies = [\n ('blog', '0002_alter_tag_tag_name'),\n ]\n\n operations = [\n migrations.RemoveField(\n model_name='comment',\n name='subject',\n ),\n ]\n"},"avg_line_length":{"kind":"number","value":18.1666666667,"string":"18.166667"},"max_line_length":{"kind":"number","value":47,"string":"47"},"alphanum_fraction":{"kind":"number","value":0.5902140673,"string":"0.590214"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"Gandabh/E-commerce-Site"},"path":{"kind":"string","value":"blog/migrations/0003_remove_comment_subject.py"},"size":{"kind":"number","value":327,"string":"327"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8730,"cells":{"content":{"kind":"string","value":"# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n\n\"\"\" Binary code class for Fermion-qubit mappings (arXiv:1712.07067) \"\"\"\n\nimport copy\n\nimport numpy\nimport scipy\nimport scipy.sparse\n\nfrom openfermion.ops import BinaryPolynomial\n\n\ndef shift_decoder(decoder, shift_constant):\n \"\"\" Shifts the indices of a decoder by a constant.\n\n Args:\n decoder (iterable): list of BinaryPolynomial; the decoder\n shift_constant (int): the qubit index that corresponds to the offset.\n\n Returns (list): list of BinaryPolynomial shifted decoder\n \"\"\"\n decode_shifted = []\n if not isinstance(shift_constant, (numpy.int64, numpy.int32, int)):\n raise TypeError('the shift to the decoder must be integer. got {}'\n 'of type {}'.format(shift_constant,\n type(shift_constant)))\n for entry in decoder:\n tmp_entry = copy.deepcopy(entry)\n tmp_entry.shift(shift_constant)\n decode_shifted.append(tmp_entry)\n return decode_shifted\n\n\ndef double_decoding(decoder_1, decoder_2):\n \"\"\" Concatenates two decodings\n\n Args:\n decoder_1 (iterable): list of BinaryPolynomial\n decoding of the outer code layer\n decoder_2 (iterable): list of BinaryPolynomial\n decoding of the inner code layer\n\n Returns (list): list of BinaryPolynomial the decoding defined by\n w -> decoder_1( decoder_2(w) )\n \"\"\"\n doubled_decoder = []\n for entry in decoder_1:\n tmp_sum = 0\n for summand in entry.terms:\n tmp_term = BinaryPolynomial('1')\n for factor in summand:\n if isinstance(factor, (numpy.int32, numpy.int64, int)):\n tmp_term *= decoder_2[factor]\n tmp_sum = tmp_term + tmp_sum\n doubled_decoder += [tmp_sum]\n return doubled_decoder\n\n\nclass BinaryCodeError(Exception):\n pass\n\n\nclass BinaryCode(object):\n \"\"\"The BinaryCode class provides a representation of an encoding-decoding\n pair for binary vectors of different lengths, where the decoding is allowed\n to be non-linear.\n\n As the occupation number of fermionic mode is effectively binary,\n a length-N vector (v) of binary number can be utilized to describe\n a configuration of a many-body fermionic state on N modes.\n An n-qubit product state configuration \\|w0> \\|w1> \\|w2> ... \\|wn-1>,\n on the other hand is described by a length-n binary vector\n w=(w0, w1, ..., wn-1). To map a subset of N-Orbital Fermion states\n to n-qubit states we define a binary code, which consists of a\n (here: linear) encoding (e) and a (non-linear) decoding (d), such\n that for every v from that subset, w = e(v) is a length-n binary\n vector with d(w) = v. This can be used to save qubits given a\n Hamiltonian that dictates such a subset, otherwise n=N.\n\n Two binary codes (e,d) and (e',d') can construct a third code (e\",d\")\n by two possible operations:\n\n Concatenation: (e\",d\") = (e,d) * (e',d')\n which means e\": v\" -> e'( e(v\") ) and d\": w\" -> d( d'(w\") )\n where n\" = n' and N\" = N, with n = N' as necessary condition.\n\n Appendage: (e\",d\") = (e,d) + (e',d')\n which means e\": (v + v') -> e(v) + e'(v') and d\": (w + w') -> d(w) + d'(\n w')\n where the addition is to be understood as appending two vectors together,\n so N\" = N' + N and n\" = n + n'.\n\n Appending codes is particularly useful when considering segment codes or\n segmented transforms.\n\n A BinaryCode-instance is initialized by BinaryCode(A,d),\n given the encoding (e) as n x N array or matrix-like nested lists A,\n such that e(v) = (A v) mod 2. The decoding d is an array or a list\n input of length N, which has entries either of type BinaryPolynomial, or of\n valid type for an input of the BinaryPolynomial-constructor.\n\n The signs + and \\*, += and \\*= are overloaded to implement concatenation\n and appendage on BinaryCode-objects.\n\n NOTE: multiplication of a BinaryCode with an integer yields a\n multiple appending of the same code, the multiplication with another\n BinaryCode their concatenation.\n\n Attributes:\n decoder (list): list of BinaryPolynomial: Outputs the decoding\n functions as components.\n encoder (scipy.sparse.csc_matrix): Outputs A, the linear matrix that\n implements the encoding function.\n n_modes (int): Outputs the number of modes.\n n_qubits (int): Outputs the number of qubits.\n \"\"\"\n\n def __init__(self, encoding, decoding):\n \"\"\" Initialization of a binary code.\n\n Args:\n encoding (np.ndarray or list): nested lists or binary 2D-array\n decoding (array or list): list of BinaryPolynomial (list or str).\n\n Raises:\n TypeError: non-list, array like encoding or decoding, unsuitable\n BinaryPolynomial generators,\n BinaryCodeError: in case of decoder/encoder size mismatch or\n decoder size, qubits indexed mismatch\n \"\"\"\n if not isinstance(encoding, (numpy.ndarray, list)):\n raise TypeError('encoding must be a list or array.')\n\n if not isinstance(decoding, (numpy.ndarray, list)):\n raise TypeError('decoding must be a list or array.')\n\n self.encoder = scipy.sparse.csc_matrix(encoding)\n self.n_qubits, self.n_modes = numpy.shape(encoding)\n\n if self.n_modes != len(decoding):\n raise BinaryCodeError(\n 'size mismatch, decoder and encoder should have the same'\n ' first dimension')\n\n decoder_qubits = set()\n self.decoder = []\n\n for symbolic_binary in decoding:\n if isinstance(symbolic_binary, (tuple, list, str, int,\n numpy.int32, numpy.int64)):\n symbolic_binary = BinaryPolynomial(symbolic_binary)\n if isinstance(symbolic_binary, BinaryPolynomial):\n self.decoder.append(symbolic_binary)\n decoder_qubits = decoder_qubits | set(\n symbolic_binary.enumerate_qubits())\n else:\n raise TypeError(\n 'decoder component provided '\n 'is not a suitable for BinaryPolynomial',\n symbolic_binary)\n\n if len(decoder_qubits) != self.n_qubits:\n raise BinaryCodeError(\n 'decoder and encoder provided has different number of qubits')\n\n if max(decoder_qubits) + 1 > self.n_qubits:\n raise BinaryCodeError('decoder is not indexing some qubits. Qubits'\n 'indexed are: {}'.format(decoder_qubits))\n\n def __iadd__(self, appendix):\n \"\"\" In-place appending a binary code with +=.\n\n Args:\n appendix (BinaryCode): The code to append to the present one.\n\n Returns (BinaryCode): A global binary code with size\n (n_modes1 + n_modes2), (n_qubits1,n_qubits2)\n\n Raises:\n TypeError: Appendix must be a BinaryCode.\n \"\"\"\n if not isinstance(appendix, BinaryCode):\n raise TypeError('argument must be a BinaryCode.')\n\n self.decoder = numpy.append(self.decoder,\n shift_decoder(appendix.decoder,\n self.n_qubits)).tolist()\n self.encoder = scipy.sparse.bmat([[self.encoder, None],\n [None, appendix.encoder]])\n self.n_qubits, self.n_modes = numpy.shape(self.encoder)\n return self\n\n def __add__(self, appendix):\n \"\"\"Appends two binary codes via addition +.\n\n Args:\n appendix (BinaryCode): The code to append to the present one.\n\n Returns (BinaryCode): global binary code\n \"\"\"\n twin = copy.deepcopy(self)\n twin += appendix\n return twin\n\n def __imul__(self, factor):\n \"\"\"In-place code concatenation or appendage via *= .\n Multiplication with integer will yield appendage, otherwise\n concatenation.\n\n Args:\n factor (int or BinaryCode): the BinaryCode to concatenate. In case\n of int, it will append the code to itself factor times.\n\n Returns (BinaryCode): segmented or concatenated code\n\n Raises:\n TypeError: factor must be an integer or a BinaryCode\n BinaryCodeError: size mismatch between self and factor\n ValueError: in case of an integer factor that is < 1\n \"\"\"\n if not isinstance(factor, (BinaryCode, numpy.int32, numpy.int64, int)):\n raise TypeError('argument must be a BinaryCode or integer')\n\n if isinstance(factor, BinaryCode):\n if self.n_qubits != factor.n_modes:\n raise BinaryCodeError(\n 'size mismatch between inner and outer code layer')\n\n self.decoder = double_decoding(self.decoder, factor.decoder)\n self.encoder = factor.encoder.dot(self.encoder)\n self.n_qubits, self.n_modes = numpy.shape(self.encoder)\n return self\n\n elif isinstance(factor, (numpy.int32, numpy.int64, int)):\n if factor < 1:\n raise ValueError('integer factor has to be positive, '\n 'non-zero ')\n\n self.encoder = scipy.sparse.kron(\n scipy.sparse.identity(factor, format='csc', dtype=int),\n self.encoder, 'csc')\n tmp_decoder = self.decoder\n for index in numpy.arange(1, factor):\n self.decoder = numpy.append(self.decoder,\n shift_decoder(tmp_decoder,\n index *\n self.n_qubits))\n self.n_qubits *= factor\n self.n_modes *= factor\n return self\n\n def __mul__(self, factor):\n \"\"\" Concatenation of two codes or appendage the same code factor times\n in case of integer factor.\n\n Args:\n factor (int or BinaryCode): the BinaryCode to concatenate. In case\n of int, it will append the code to itself factor times.\n\n Returns (BinaryCode): segmented or concatenated code\n \"\"\"\n twin = copy.deepcopy(self)\n twin *= factor\n return twin\n\n def __rmul__(self, factor):\n \"\"\" Appending the same code factor times.\n\n Args:\n factor (int): integer defining number of appendages.\n\n Returns (BinaryCode): Segmented code.\n\n Raises:\n TypeError: factor must be an integer\n \"\"\"\n if isinstance(factor, (numpy.int32, numpy.int64, int)):\n return self * factor\n else:\n raise TypeError('the left multiplier must be an integer to a'\n 'BinaryCode. Was given {} of '\n 'type {}'.format(factor, type(factor)))\n\n def __str__(self):\n \"\"\" Return an easy-to-read string representation.\"\"\"\n string_return = [list(map(list, self.encoder.toarray()))]\n\n dec_str = '['\n for term in self.decoder:\n dec_str += term.__str__() + ','\n dec_str = dec_str[:-1]\n string_return.append(dec_str + ']')\n return str(string_return)\n\n def __repr__(self):\n return str(self)\n"},"avg_line_length":{"kind":"number","value":38.7662337662,"string":"38.766234"},"max_line_length":{"kind":"number","value":79,"string":"79"},"alphanum_fraction":{"kind":"number","value":0.6051088777,"string":"0.605109"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"0tt3r/OpenFermion"},"path":{"kind":"string","value":"src/openfermion/ops/_binary_code.py"},"size":{"kind":"number","value":11940,"string":"11,940"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8731,"cells":{"content":{"kind":"string","value":"from concurrent.futures import ThreadPoolExecutor, CancelledError\nfrom aiomysql import create_pool\nfrom asyncio import ensure_future, gather, sleep\nfrom pymysql.err import OperationalError\nfrom logging import getLogger\nfrom sanic import Sanic\nfrom sanic.request import Request\nfrom sanic.response import json\nfrom sanic.exceptions import abort\nfrom kiwi.database.DataAccessor import DataAccessor\nfrom kiwi.Recommender import Recommender\nfrom kiwi.config import read_mysql_config, read_config\nfrom kiwi.TransferTypes import create_vote\nfrom kiwi.AsyncContentWrapper import AsyncContentWrapper\nfrom kiwi.ContentEngine import ContentEngine\nfrom kiwi.ActivationCalculator import ActivationCalculator\nimport time\n\napp = Sanic(__name__)\n\n\ndef create_accessor(context):\n return DataAccessor(conn=context)\n\n\nasync def repeated_pool(loop, sleeper, tries):\n n = 1\n while n <= tries:\n try:\n return await create_pool(**read_mysql_config()._asdict(),\n autocommit=True,\n loop=loop,\n pool_recycle=600)\n except OperationalError as e:\n getLogger('root').warn(e)\n getLogger('root').warn(\"Waiting {}s before retry\".format(sleeper))\n await sleep(sleeper)\n n += 1\n return await create_pool(**read_mysql_config()._asdict(),\n autocommit=True,\n loop=loop,\n pool_recycle=600)\n\n\nasync def retrain(context, loop):\n print(\"Start training...\")\n start = time.time()\n async with context.pool.acquire() as conn:\n accessor = create_accessor(conn)\n content_frame = await accessor.get_content_frame()\n rating_frame = await accessor.get_vote_frame()\n print(\"Collected data in {}\".format(time.time() - start))\n algorithm = ContentEngine(\n content_frame,\n rating_frame)\n predictor = AsyncContentWrapper(\n loop, context.executor, algorithm)\n await predictor.fit()\n print(\"Completed training in {}s\".format(time.time() - start))\n context.algorithm = algorithm\n context.predictor = predictor\n\n\n@app.listener(\"before_server_start\")\nasync def setup(context, loop):\n context.executor = ThreadPoolExecutor()\n context.pool = await repeated_pool(loop, 5, 10)\n await retrain(context, loop)\n\n\n@app.middleware(\"request\")\nasync def generate_accessor(request):\n request['conn'] = await app.pool.acquire()\n request['accessor'] = create_accessor(request['conn'])\n\n\n@app.middleware(\"response\")\nasync def teardown_accessor(request, response):\n await request['conn'].ensure_closed()\n app.pool.release(request['conn'])\n\n\n@app.listener(\"before_server_stop\")\nasync def teardown(context, loop):\n context.run_retrain = False\n context.executor.shutdown()\n context.pool.close()\n await context.pool.wait_closed()\n\n\n@app.get('/recommendation')\nasync def recommend(request):\n '''\n Gets recommendations for user\n Expects args in query string form -> user=x&count=n\n Returns json object {posts, unvoted, user, meta}\n '''\n args = request.raw_args\n recommender = Recommender(\n app.predictor, request['accessor'], read_config())\n posts = await recommender.recommend_for(args['user'],\n int(args.get('count', 10)))\n return json(posts)\n\n\n@app.post('/feedback')\nasync def feedback(request: Request):\n '''Stores the feedback for a recommended post. Will return a information object on success and an empty object on failure.\n Think about returning 409-Conflict on failure instead, because the empty object can cause an issue in engine service.'''\n vote = request.json['vote']\n config = read_config()\n recommender = Recommender(\n app.predictor, request['accessor'], config)\n try:\n vote_result = await recommender.store_feedback(\n create_vote(vote, config['positive_cutoff']))\n return json(vote_result)\n except KeyError:\n abort(400, \"Unknown user\")\n\n\n@app.post('/content')\nasync def content(request: Request):\n '''\n Inserts posts into the database. The request needs the format\n { \"posts\": [{\"id\": string, \"tags\": string}]}.\n Returns the amout of inserted items and 200-OK.\n '''\n filtered_posts = [(post['id'], post['tags'])\n for post in request.json['posts']]\n inserted = await request['accessor'].add_content(filtered_posts)\n if inserted > 0:\n ensure_future(retrain(app, app.loop))\n return json({\"inserted_count\": inserted})\n\n\n@app.get('/predict')\nasync def predict(request: Request):\n recommender = Recommender(\n app.predictor, request['accessor'], read_config())\n user = request.raw_args['user']\n item = request.raw_args['item']\n result = await recommender.predict(user, item)\n return json(result)\n\n\n@app.get('/activation')\nasync def activation(request: Request):\n '''\n Returns the activation value for the given set of heuristics\n '''\n heuristics = request.json['heuristics']\n try:\n utv = await app.predictor.get_user_taste_vector(heuristics[\"user\"])\n except KeyError:\n utv = None\n\n ac = ActivationCalculator(heuristics, request['accessor'])\n a = await ac.get_activation(utv)\n\n return json({\"activation\": a, 'received_heuristics': heuristics})\n\n\n@app.post('/training')\nasync def training(request: Request):\n votes = request.json['votes']\n config = read_config()\n do_retrain = request.json.get('retrain', False)\n inserted_user = await request['accessor'].batch_register_users(\n {str(vote[0]) for vote in votes})\n inserted = await request['accessor'].insert_votes(\n (str(vote[0]), str(vote[1]), 1 if float(vote[2]) > config['positive_cutoff'] else -1) for vote in votes)\n if do_retrain:\n ensure_future(retrain(app, app.loop))\n return json({\n 'inserted_users': inserted_user,\n 'inserted_votes': inserted})\n\n\nif __name__ == '__main__':\n app.run(host='0.0.0.0', port=8000)\n"},"avg_line_length":{"kind":"number","value":33.4615384615,"string":"33.461538"},"max_line_length":{"kind":"number","value":126,"string":"126"},"alphanum_fraction":{"kind":"number","value":0.6692939245,"string":"0.669294"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"bubblegumsoldier/kiwi"},"path":{"kind":"string","value":"kiwi-content/kiwi/app.py"},"size":{"kind":"number","value":6090,"string":"6,090"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8732,"cells":{"content":{"kind":"string","value":"import click\nimport subprocess\nimport os\n\n@click.group()\ndef cli():\n ...\n\n\n@cli.command()\ndef deploy():\n click.echo(\"Running chalice deploy\")\n output = subprocess.check_output(f\"source {os.environ['VIRTUAL_ENV']}/bin/activate && chalice deploy\",shell=True)\n click.echo(output)\n click.echo(os.environ[\"VIRTUAL_ENV\"])\n\n\n"},"avg_line_length":{"kind":"number","value":18.5,"string":"18.5"},"max_line_length":{"kind":"number","value":117,"string":"117"},"alphanum_fraction":{"kind":"number","value":0.6936936937,"string":"0.693694"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"foretheta/whatsup"},"path":{"kind":"string","value":"scripts/whatsup.py"},"size":{"kind":"number","value":333,"string":"333"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8733,"cells":{"content":{"kind":"string","value":"# tested\n\nfrom boa.builtins import take\n\n\ndef Main(amount):\n\n str1 = 'helloworld1234567'\n\n str2 = take(str1, amount)\n\n return str2\n"},"avg_line_length":{"kind":"number","value":10.7692307692,"string":"10.769231"},"max_line_length":{"kind":"number","value":30,"string":"30"},"alphanum_fraction":{"kind":"number","value":0.6642857143,"string":"0.664286"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"CityOfZion/neo-boa"},"path":{"kind":"string","value":"boa_test/example/TakeTest.py"},"size":{"kind":"number","value":140,"string":"140"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8734,"cells":{"content":{"kind":"string","value":"# Copyright 2020 Huawei Technologies Co., Ltd\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n# ==============================================================================\nimport sys\nimport pytest\nimport numpy as np\nimport pandas as pd\nimport mindspore.dataset as de\nfrom mindspore import log as logger\nimport mindspore.dataset.transforms.vision.c_transforms as vision\n\n\ndef test_numpy_slices_list_1():\n logger.info(\"Test Slicing a 1D list.\")\n\n np_data = [1, 2, 3]\n ds = de.NumpySlicesDataset(np_data, shuffle=False)\n\n for i, data in enumerate(ds):\n assert data[0] == np_data[i]\n\n\ndef test_numpy_slices_list_2():\n logger.info(\"Test Slicing a 2D list into 1D list.\")\n\n np_data = [[1, 2], [3, 4]]\n ds = de.NumpySlicesDataset(np_data, column_names=[\"col1\"], shuffle=False)\n\n for i, data in enumerate(ds):\n assert np.equal(data[0], np_data[i]).all()\n\n\ndef test_numpy_slices_list_3():\n logger.info(\"Test Slicing list in the first dimension.\")\n\n np_data = [[[1, 2], [3, 4]], [[5, 6], [7, 8]]]\n ds = de.NumpySlicesDataset(np_data, column_names=[\"col1\"], shuffle=False)\n\n for i, data in enumerate(ds):\n assert np.equal(data[0], np_data[i]).all()\n\n\ndef test_numpy_slices_list_append():\n logger.info(\"Test reading data of image list.\")\n\n DATA_DIR = [\"../data/dataset/test_tf_file_3_images/train-0000-of-0001.data\"]\n resize_height, resize_width = 2, 2\n\n data1 = de.TFRecordDataset(DATA_DIR)\n resize_op = vision.Resize((resize_height, resize_width))\n data1 = data1.map(input_columns=[\"image\"], operations=[vision.Decode(True), resize_op])\n\n res = []\n for data in data1.create_dict_iterator():\n res.append(data[\"image\"])\n\n ds = de.NumpySlicesDataset(res, column_names=[\"col1\"], shuffle=False)\n\n for i, data in enumerate(ds):\n assert np.equal(data, res[i]).all()\n\n\ndef test_numpy_slices_dict_1():\n logger.info(\"Test Dictionary structure data.\")\n\n np_data = {\"a\": [1, 2], \"b\": [3, 4]}\n ds = de.NumpySlicesDataset(np_data, shuffle=False)\n res = [[1, 3], [2, 4]]\n\n for i, data in enumerate(ds):\n assert data[0] == res[i][0]\n assert data[1] == res[i][1]\n\n\ndef test_numpy_slices_tuple_1():\n logger.info(\"Test slicing a list of tuple.\")\n\n np_data = [([1, 2], [3, 4]), ([11, 12], [13, 14]), ([21, 22], [23, 24])]\n ds = de.NumpySlicesDataset(np_data, shuffle=False)\n\n for i, data in enumerate(ds):\n assert np.equal(data, np_data[i]).all()\n\n assert sum([1 for _ in ds]) == 3\n\n\ndef test_numpy_slices_tuple_2():\n logger.info(\"Test slicing a tuple of list.\")\n\n np_data = ([1, 2], [3, 4], [5, 6])\n expected = [[1, 3, 5], [2, 4, 6]]\n ds = de.NumpySlicesDataset(np_data, shuffle=False)\n\n for i, data in enumerate(ds):\n assert np.equal(data, expected[i]).all()\n\n assert sum([1 for _ in ds]) == 2\n\n\ndef test_numpy_slices_tuple_3():\n logger.info(\"Test reading different dimension of tuple data.\")\n features, labels = np.random.sample((5, 2)), np.random.sample((5, 1))\n data = (features, labels)\n\n ds = de.NumpySlicesDataset(data, column_names=[\"col1\", \"col2\"], shuffle=False)\n\n for i, data in enumerate(ds):\n assert np.equal(data[0], features[i]).all()\n assert data[1] == labels[i]\n\n\ndef test_numpy_slices_csv_value():\n logger.info(\"Test loading value of csv file.\")\n csv_file = \"../data/dataset/testNumpySlicesDataset/heart.csv\"\n\n df = pd.read_csv(csv_file)\n target = df.pop(\"target\")\n df.pop(\"state\")\n np_data = (df.values, target.values)\n\n ds = de.NumpySlicesDataset(np_data, column_names=[\"col1\", \"col2\"], shuffle=False)\n\n for i, data in enumerate(ds):\n assert np.equal(np_data[0][i], data[0]).all()\n assert np.equal(np_data[1][i], data[1]).all()\n\n\ndef test_numpy_slices_csv_dict():\n logger.info(\"Test loading csv file as dict.\")\n\n csv_file = \"../data/dataset/testNumpySlicesDataset/heart.csv\"\n df = pd.read_csv(csv_file)\n df.pop(\"state\")\n res = df.values\n\n ds = de.NumpySlicesDataset(dict(df), shuffle=False)\n\n for i, data in enumerate(ds):\n assert np.equal(data, res[i]).all()\n\n\ndef test_numpy_slices_num_samplers():\n logger.info(\"Test num_samplers.\")\n\n np_data = [[1, 2], [3, 4], [5, 6], [7, 8], [9, 10], [11, 12], [13, 14], [15, 16]]\n ds = de.NumpySlicesDataset(np_data, shuffle=False, num_samples=2)\n\n for i, data in enumerate(ds):\n assert np.equal(data[0], np_data[i]).all()\n\n assert sum([1 for _ in ds]) == 2\n\n\ndef test_numpy_slices_distributed_sampler():\n logger.info(\"Test distributed sampler.\")\n\n np_data = [[1, 2], [3, 4], [5, 6], [7, 8], [9, 10], [11, 12], [13, 14], [15, 16]]\n ds = de.NumpySlicesDataset(np_data, shuffle=False, shard_id=0, num_shards=4)\n\n for i, data in enumerate(ds):\n assert np.equal(data[0], np_data[i * 4]).all()\n\n assert sum([1 for _ in ds]) == 2\n\n\ndef test_numpy_slices_distributed_shard_limit():\n logger.info(\"Test Slicing a 1D list.\")\n\n np_data = [1, 2, 3]\n num = sys.maxsize\n with pytest.raises(ValueError) as err:\n de.NumpySlicesDataset(np_data, num_shards=num, shard_id=0, shuffle=False)\n assert \"Input num_shards is not within the required interval of (1 to 2147483647).\" in str(err.value)\n\n\ndef test_numpy_slices_distributed_zero_shard():\n logger.info(\"Test Slicing a 1D list.\")\n\n np_data = [1, 2, 3]\n with pytest.raises(ValueError) as err:\n de.NumpySlicesDataset(np_data, num_shards=0, shard_id=0, shuffle=False)\n assert \"Input num_shards is not within the required interval of (1 to 2147483647).\" in str(err.value)\n\n\ndef test_numpy_slices_sequential_sampler():\n logger.info(\"Test numpy_slices_dataset with SequentialSampler and repeat.\")\n\n np_data = [[1, 2], [3, 4], [5, 6], [7, 8], [9, 10], [11, 12], [13, 14], [15, 16]]\n ds = de.NumpySlicesDataset(np_data, sampler=de.SequentialSampler()).repeat(2)\n\n for i, data in enumerate(ds):\n assert np.equal(data[0], np_data[i % 8]).all()\n\n\ndef test_numpy_slices_invalid_column_names_type():\n logger.info(\"Test incorrect column_names input\")\n np_data = [1, 2, 3]\n\n with pytest.raises(TypeError) as err:\n de.NumpySlicesDataset(np_data, column_names=[1], shuffle=False)\n assert \"Argument column_names[0] with value 1 is not of type (<class 'str'>,).\" in str(err.value)\n\n\ndef test_numpy_slices_invalid_column_names_string():\n logger.info(\"Test incorrect column_names input\")\n np_data = [1, 2, 3]\n\n with pytest.raises(ValueError) as err:\n de.NumpySlicesDataset(np_data, column_names=[\"\"], shuffle=False)\n assert \"column_names[0] should not be empty\" in str(err.value)\n\n\ndef test_numpy_slices_invalid_empty_column_names():\n logger.info(\"Test incorrect column_names input\")\n np_data = [1, 2, 3]\n\n with pytest.raises(ValueError) as err:\n de.NumpySlicesDataset(np_data, column_names=[], shuffle=False)\n assert \"column_names should not be empty\" in str(err.value)\n\n\ndef test_numpy_slices_invalid_empty_data_column():\n logger.info(\"Test incorrect column_names input\")\n np_data = []\n\n with pytest.raises(ValueError) as err:\n de.NumpySlicesDataset(np_data, shuffle=False)\n assert \"Argument data cannot be empty\" in str(err.value)\n\n\nif __name__ == \"__main__\":\n test_numpy_slices_list_1()\n test_numpy_slices_list_2()\n test_numpy_slices_list_3()\n test_numpy_slices_list_append()\n test_numpy_slices_dict_1()\n test_numpy_slices_tuple_1()\n test_numpy_slices_tuple_2()\n test_numpy_slices_tuple_3()\n test_numpy_slices_csv_value()\n test_numpy_slices_csv_dict()\n test_numpy_slices_num_samplers()\n test_numpy_slices_distributed_sampler()\n test_numpy_slices_distributed_shard_limit()\n test_numpy_slices_distributed_zero_shard()\n test_numpy_slices_sequential_sampler()\n test_numpy_slices_invalid_column_names_type()\n test_numpy_slices_invalid_column_names_string()\n test_numpy_slices_invalid_empty_column_names()\n test_numpy_slices_invalid_empty_data_column()\n"},"avg_line_length":{"kind":"number","value":32.4427480916,"string":"32.442748"},"max_line_length":{"kind":"number","value":105,"string":"105"},"alphanum_fraction":{"kind":"number","value":0.6756470588,"string":"0.675647"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"Gavin-Hoang/mindspore"},"path":{"kind":"string","value":"tests/ut/python/dataset/test_dataset_numpy_slices.py"},"size":{"kind":"number","value":8500,"string":"8,500"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8735,"cells":{"content":{"kind":"string","value":"\"\"\" Bu kod MQTT den alir FireBase e atar \"\"\"\r\nimport firebase_admin\r\nfrom firebase_admin import credentials\r\nfrom firebase_admin import firestore\r\nimport paho.mqtt.client as mqtt\r\nfrom time import sleep\r\nimport json\r\nimport sys\r\n\r\nFb_Coll = \"color\" \r\ndef main():\r\n\r\n x = open(\"../ip.json\")\r\n data_ = json.load(x)\r\n ip = data_[\"ip\"]\r\n x.close()\r\n\r\n cred = credentials.Certificate(\"../Login.json\")\r\n firebase_admin.initialize_app(cred)\r\n Server = ip\r\n db = firestore.client()\r\n\r\n def on_connect(client, userdata, flags, rc):\r\n print(\"Connected with result code \"+str(rc))\r\n client.subscribe(\"/blue\") \r\n print(\"Topics Subscribed Successfully\")\r\n\r\n \r\n def on_message(client, userdata, msg):\r\n \r\n topic = msg.topic\r\n data = msg.payload.decode('UTF-8')\r\n print(\"Mqtt'den: Topic: {}, Message: {}\".format(topic,data))\r\n \r\n if topic ==\"/blue\":\r\n db.collection(Fb_Coll).document(\"color\").update({ topic: data })\r\n \r\n\r\n print(\"SEND\")\r\n sleep(1)\r\n\r\n client = mqtt.Client()\r\n client.connect(Server, 1883, 60) \r\n client.on_connect = on_connect\r\n client.on_message = on_message\r\n\r\n client.loop_forever() \r\n\r\n\r\nif __name__ == \"__main__\":\r\n try:\r\n main()\r\n\r\n except KeyboardInterrupt:\r\n print(\"\\nPrograms was stopped\") \r\n sys.exit()\r\n\r\n"},"avg_line_length":{"kind":"number","value":24.3448275862,"string":"24.344828"},"max_line_length":{"kind":"number","value":77,"string":"77"},"alphanum_fraction":{"kind":"number","value":0.5807365439,"string":"0.580737"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"KJPOUNDY132/mqtt_to_firebase"},"path":{"kind":"string","value":"MyAwsomeMainCode/send_.py"},"size":{"kind":"number","value":1412,"string":"1,412"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8736,"cells":{"content":{"kind":"string","value":"#\n# SPDX-FileCopyrightText: Copyright (c) 1993-2022 NVIDIA CORPORATION & AFFILIATES. All rights reserved.\n# SPDX-License-Identifier: Apache-2.0\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n#\n\n# Utility functions for building/saving/loading TensorRT Engine\nimport sys\nimport os\n\nimport tensorrt as trt\nimport pycuda.driver as cuda\nimport numpy as np\n\nfrom utils.modeldata import ModelData\n\n# ../../common.py\nsys.path.insert(1,\n os.path.join(\n os.path.dirname(os.path.realpath(__file__)),\n os.pardir,\n os.pardir\n )\n)\nfrom common import HostDeviceMem\n\n\ndef allocate_buffers(engine):\n \"\"\"Allocates host and device buffer for TRT engine inference.\n\n This function is similair to the one in ../../common.py, but\n converts network outputs (which are np.float32) appropriately\n before writing them to Python buffer. This is needed, since\n TensorRT plugins doesn't support output type description, and\n in our particular case, we use NMS plugin as network output.\n\n Args:\n engine (trt.ICudaEngine): TensorRT engine\n\n Returns:\n inputs [HostDeviceMem]: engine input memory\n outputs [HostDeviceMem]: engine output memory\n bindings [int]: buffer to device bindings\n stream (cuda.Stream): cuda stream for engine inference synchronization\n \"\"\"\n inputs = []\n outputs = []\n bindings = []\n stream = cuda.Stream()\n\n # Current NMS implementation in TRT only supports DataType.FLOAT but\n # it may change in the future, which could brake this sample here\n # when using lower precision [e.g. NMS output would not be np.float32\n # anymore, even though this is assumed in binding_to_type]\n binding_to_type = {\"Input\": np.float32, \"NMS\": np.float32, \"NMS_1\": np.int32}\n\n for binding in engine:\n size = trt.volume(engine.get_binding_shape(binding)) * engine.max_batch_size\n dtype = binding_to_type[str(binding)]\n # Allocate host and device buffers\n host_mem = cuda.pagelocked_empty(size, dtype)\n device_mem = cuda.mem_alloc(host_mem.nbytes)\n # Append the device buffer to device bindings.\n bindings.append(int(device_mem))\n # Append to the appropriate list.\n if engine.binding_is_input(binding):\n inputs.append(HostDeviceMem(host_mem, device_mem))\n else:\n outputs.append(HostDeviceMem(host_mem, device_mem))\n return inputs, outputs, bindings, stream\n\ndef build_engine(uff_model_path, trt_logger, trt_engine_datatype=trt.DataType.FLOAT, batch_size=1, silent=False):\n with trt.Builder(trt_logger) as builder, builder.create_network() as network, builder.create_builder_config() as config, trt.UffParser() as parser, trt.Runtime(trt_logger) as runtime:\n config.max_workspace_size = 1 << 30\n if trt_engine_datatype == trt.DataType.HALF:\n config.set_flag(trt.BuilderFlag.FP16)\n builder.max_batch_size = batch_size\n\n parser.register_input(ModelData.INPUT_NAME, ModelData.INPUT_SHAPE)\n parser.register_output(\"MarkOutput_0\")\n parser.parse(uff_model_path, network)\n\n if not silent:\n print(\"Building TensorRT engine. This may take few minutes.\")\n\n plan = builder.build_serialized_network(network, config)\n return runtime.deserialize_cuda_engine(plan)\n\ndef save_engine(engine, engine_dest_path):\n buf = engine.serialize()\n with open(engine_dest_path, 'wb') as f:\n f.write(buf)\n\ndef load_engine(trt_runtime, engine_path):\n with open(engine_path, 'rb') as f:\n engine_data = f.read()\n engine = trt_runtime.deserialize_cuda_engine(engine_data)\n return engine\n"},"avg_line_length":{"kind":"number","value":37.6909090909,"string":"37.690909"},"max_line_length":{"kind":"number","value":187,"string":"187"},"alphanum_fraction":{"kind":"number","value":0.7134587554,"string":"0.713459"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"GreyZzzzzzXh/TensorRT"},"path":{"kind":"string","value":"samples/python/uff_ssd/utils/engine.py"},"size":{"kind":"number","value":4146,"string":"4,146"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8737,"cells":{"content":{"kind":"string","value":"class CouponNotFoundException(Exception):\n pass"},"avg_line_length":{"kind":"number","value":25,"string":"25"},"max_line_length":{"kind":"number","value":41,"string":"41"},"alphanum_fraction":{"kind":"number","value":0.82,"string":"0.82"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"daniellima/desafio-lojaintegrada"},"path":{"kind":"string","value":"src/app/coupon/coupon_not_found_exception.py"},"size":{"kind":"number","value":50,"string":"50"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8738,"cells":{"content":{"kind":"string","value":"from .imports import *\n\n\ndef rainbow_to_vector(r, timeformat='h'):\n \"\"\" Convert Rainbow object to np.arrays\n Parameters\n ----------\n r : Rainbow object\n chromatic Rainbow object to convert into array format\n timeformat : str\n (optional, default='hours')\n The time format to use (seconds, minutes, hours, days etc.)\n Returns\n ----------\n rflux : np.array\n flux (MJy/sr) [n_wavelengths x n_integrations]\n rfluxe : np.array\n flux error (MJy/sr) [n_wavelengths x n_integrations]\n rtime : np.array\n time (BJD_TDB, houra) [n_integrations]\n rwavel : np.array\n wavelength (microns) [n_wavelengths]\n \"\"\"\n secondformat = ['second', 'seconds', 'sec', 's']\n minuteformat = ['minute', 'minutes', 'min', 'm']\n hourformat = ['hour', 'hours', 'h']\n dayformat = ['day', 'days', 'd']\n yearformat = ['year', 'years', 'y']\n\n rflux = r.fluxlike['flux'] # flux (MJy/sr) : [n_wavelengths x n_integrations]\n rfluxe = r.fluxlike['uncertainty'] # flux error (MJy/sr) : [n_wavelengths x n_integrations]\n rtime = r.timelike['time'] # time (BJD_TDB, hours) : [n_integrations]\n rwavel = r.wavelike['wavelength'] # wavelength (microns) : [n_wavelengths]\n\n # change the time array into the requested format (e.g. seconds, minutes, days etc.)\n if timeformat in secondformat:\n rtime = rtime * 3600\n elif timeformat in minuteformat:\n rtime = rtime * 60\n elif timeformat in hourformat:\n # hours is the default time setting\n pass\n elif timeformat in dayformat:\n rtime = rtime / 24.\n elif timeformat in yearformat:\n rtime = rtime / (24 * 365.)\n else:\n warnings.warn(\"Unrecognised Time Format!\")\n return\n\n return rflux, rfluxe, rtime, rwavel\n\n\ndef rainbow_to_df(r, timeformat='h'):\n \"\"\" Convert Rainbow object to pandas dataframe\n Parameters\n ----------\n r : Rainbow object\n chromatic Rainbow object to convert into pandas df format\n timeformat : str\n (optional, default='hours')\n The time format to use (seconds, minutes, hours, days etc.)\n Returns\n ----------\n pd.DataFrame\n \"\"\"\n rflux, rfluxe, rtime, rwavel = rainbow_to_vector(r, timeformat)\n x, y = np.meshgrid(rtime.to_value(), rwavel.to_value())\n rainbow_dict = {f\"Time ({timeformat})\": x.ravel(), \"Wavelength (microns)\": y.ravel(), \"Flux\": rflux.ravel(),\n \"Flux Error\": rfluxe.ravel()}\n df = pd.DataFrame(rainbow_dict)\n return df\n\n\ndef bin_data(jd, y, mins_jd):\n t = np.array(jd)\n\n split = []\n sorted_t = t\n sorted_y = y\n start = sorted_t[0]\n nextbin = sorted_t[np.absolute(sorted_t - start) > mins_jd]\n\n while nextbin != []:\n start = start + mins_jd\n ind_st = np.argmax(sorted_t > start)\n if len(split) > 0:\n if ind_st != split[-1]:\n split.append(ind_st)\n time = sorted_t[ind_st:]\n # need to add defn for time here?\n else:\n split.append(ind_st)\n time = sorted_t[ind_st:]\n nextbin = time[np.absolute(time - start) > mins_jd]\n\n times = np.split(sorted_t, split)\n ys = np.split(sorted_y, split)\n\n bins = np.zeros(len(times))\n binned_y = np.zeros(len(times))\n binned_err = np.zeros(len(times))\n\n for i in range(len(times)):\n if len(ys[i]) > 0:\n try:\n bins[i] = np.nanmean(times[i])\n binned_y[i] = np.nanmean(ys[i])\n n = len(times[i])\n # standard error in the median:\n # binned_err[i] = 1.253 * np.nanstd(ys[i]) / np.sqrt(n)\n binned_err[i] = np.nanstd(ys[i]) / np.sqrt(n)\n except Exception as e:\n print(e)\n pass\n\n bin_t = bins[binned_y != 0]\n bin_e = binned_err[binned_y != 0]\n bin_y = binned_y[binned_y != 0]\n\n return bin_t, bin_y, bin_e\n\n\ndef find_nearest(array, value):\n # array = np.asarray(array)\n idx = (np.abs(array - value)).argmin()\n return idx\n\ndef remove_nans(arr_with_nans,*otherarrs):\n nanfree_arrs = []\n for arr in otherarrs:\n nanfree_arrs.append(arr[~np.isnan(arr_with_nans)])\n arr_without_nans = arr_with_nans[~np.isnan(arr_with_nans)]\n return arr_without_nans, nanfree_arrs"},"avg_line_length":{"kind":"number","value":32.9104477612,"string":"32.910448"},"max_line_length":{"kind":"number","value":112,"string":"112"},"alphanum_fraction":{"kind":"number","value":0.5780045351,"string":"0.578005"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"catrionamurray/chromatic_fitting"},"path":{"kind":"string","value":"src/utils.py"},"size":{"kind":"number","value":4410,"string":"4,410"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8739,"cells":{"content":{"kind":"string","value":"\"\"\"\r\nThis test will initialize the display using displayio\r\nand draw a solid red background\r\n\"\"\"\r\n\r\nimport board\r\nimport displayio\r\nfrom adafruit_st7735r import ST7735R\r\n\r\nspi = board.SPI()\r\ntft_cs = board.D5\r\ntft_dc = board.D6\r\n\r\ndisplayio.release_displays()\r\ndisplay_bus = displayio.FourWire(spi, command=tft_dc, chip_select=tft_cs, reset=board.D9)\r\n\r\ndisplay = ST7735R(display_bus, width=128, height=160, bgr=True)\r\n\r\n# Make the display context\r\nsplash = displayio.Group(max_size=10)\r\ndisplay.show(splash)\r\n\r\ncolor_bitmap = displayio.Bitmap(128, 160, 1)\r\ncolor_palette = displayio.Palette(1)\r\ncolor_palette[0] = 0xFF0000\r\n\r\nbg_sprite = displayio.TileGrid(color_bitmap,\r\n pixel_shader=color_palette,\r\n x=0, y=0)\r\nsplash.append(bg_sprite)\r\n\r\nwhile True:\r\n pass\r\n"},"avg_line_length":{"kind":"number","value":24.2941176471,"string":"24.294118"},"max_line_length":{"kind":"number","value":90,"string":"90"},"alphanum_fraction":{"kind":"number","value":0.6900726392,"string":"0.690073"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"jadudm/feather-isa"},"path":{"kind":"string","value":"infra/libs-400rc2-20190512/examples/st7735r_128x160_simpletest.py"},"size":{"kind":"number","value":826,"string":"826"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8740,"cells":{"content":{"kind":"string","value":"#!/usr/bin/env python3\n# Copyright (c) 2014-2016 The Bitcoin Core developers\n# Distributed under the MIT software license, see the accompanying\n# file COPYING or http://www.opensource.org/licenses/mit-license.php.\n\"\"\"Test wallet import RPCs.\n\nTest rescan behavior of importaddress, importpubkey, importprivkey, and\nimportmulti RPCs with different types of keys and rescan options.\n\nIn the first part of the test, node 0 creates an address for each type of\nimport RPC call and sends BTC to it. Then other nodes import the addresses,\nand the test makes listtransactions and getbalance calls to confirm that the\nimporting node either did or did not execute rescans picking up the send\ntransactions.\n\nIn the second part of the test, node 0 sends more BTC to each address, and the\ntest makes more listtransactions and getbalance calls to confirm that the\nimporting nodes pick up the new transactions regardless of whether rescans\nhappened previously.\n\"\"\"\n\nfrom test_framework.test_framework import BitcoinTestFramework\nfrom test_framework.util import (assert_raises_rpc_error, connect_nodes, sync_blocks, assert_equal, set_node_times)\n\nimport collections\nimport enum\nimport itertools\nimport sys\n\nCall = enum.Enum(\"Call\", \"single multi\")\nData = enum.Enum(\"Data\", \"address pub priv\")\nRescan = enum.Enum(\"Rescan\", \"no yes late_timestamp\")\n\n\nclass Variant(collections.namedtuple(\"Variant\", \"call data rescan prune\")):\n \"\"\"Helper for importing one key and verifying scanned transactions.\"\"\"\n\n def try_rpc(self, func, *args, **kwargs):\n if self.expect_disabled:\n assert_raises_rpc_error(-4, \"Rescan is disabled in pruned mode\", func, *args, **kwargs)\n else:\n return func(*args, **kwargs)\n\n def do_import(self, timestamp):\n \"\"\"Call one key import RPC.\"\"\"\n\n if self.call == Call.single:\n if self.data == Data.address:\n response = self.try_rpc(self.node.importaddress, self.address[\"address\"], self.label,\n self.rescan == Rescan.yes)\n elif self.data == Data.pub:\n response = self.try_rpc(self.node.importpubkey, self.address[\"pubkey\"], self.label,\n self.rescan == Rescan.yes)\n elif self.data == Data.priv:\n response = self.try_rpc(self.node.importprivkey, self.key, self.label, self.rescan == Rescan.yes)\n assert_equal(response, None)\n\n elif self.call == Call.multi:\n response = self.node.importmulti([{\n \"scriptPubKey\": {\n \"address\": self.address[\"address\"]\n },\n \"timestamp\": timestamp + TIMESTAMP_WINDOW + (1 if self.rescan == Rescan.late_timestamp else 0),\n \"pubkeys\": [self.address[\"pubkey\"]] if self.data == Data.pub else [],\n \"keys\": [self.key] if self.data == Data.priv else [],\n \"label\": self.label,\n \"watchonly\": self.data != Data.priv\n }], {\"rescan\": self.rescan in (Rescan.yes, Rescan.late_timestamp)})\n assert_equal(response, [{\"success\": True}])\n\n def check(self, txid=None, amount=None, confirmations=None):\n \"\"\"Verify that getbalance/listtransactions return expected values.\"\"\"\n\n balance = self.node.getbalance(self.label, 0, False, True)\n assert_equal(balance, self.expected_balance)\n\n txs = self.node.listtransactions(self.label, 10000, 0, True)\n assert_equal(len(txs), self.expected_txs)\n\n if txid is not None:\n tx, = [tx for tx in txs if tx[\"txid\"] == txid]\n assert_equal(tx[\"account\"], self.label)\n assert_equal(tx[\"address\"], self.address[\"address\"])\n assert_equal(tx[\"amount\"], amount)\n assert_equal(tx[\"category\"], \"receive\")\n assert_equal(tx[\"label\"], self.label)\n assert_equal(tx[\"txid\"], txid)\n assert_equal(tx[\"confirmations\"], confirmations)\n assert_equal(\"trusted\" not in tx, True)\n # Verify the transaction is correctly marked watchonly depending on\n # whether the transaction pays to an imported public key or\n # imported private key. The test setup ensures that transaction\n # inputs will not be from watchonly keys (important because\n # involvesWatchonly will be true if either the transaction output\n # or inputs are watchonly).\n if self.data != Data.priv:\n assert_equal(tx[\"involvesWatchonly\"], True)\n else:\n assert_equal(\"involvesWatchonly\" not in tx, True)\n\n\n# List of Variants for each way a key or address could be imported.\nIMPORT_VARIANTS = [Variant(*variants) for variants in itertools.product(Call, Data, Rescan, (False, True))]\n\n# List of nodes to import keys to. Half the nodes will have pruning disabled,\n# half will have it enabled. Different nodes will be used for imports that are\n# expected to cause rescans, and imports that are not expected to cause\n# rescans, in order to prevent rescans during later imports picking up\n# transactions associated with earlier imports. This makes it easier to keep\n# track of expected balances and transactions.\nImportNode = collections.namedtuple(\"ImportNode\", \"prune rescan\")\nIMPORT_NODES = [ImportNode(*fields) for fields in itertools.product((False, True), repeat=2)]\n\n# Rescans start at the earliest block up to 2 hours before the key timestamp.\nTIMESTAMP_WINDOW = 2 * 60 * 60\n\n\nclass ImportRescanTest(BitcoinTestFramework):\n def set_test_params(self):\n self.num_nodes = 2 + len(IMPORT_NODES)\n\n def setup_network(self):\n extra_args = [[] for _ in range(self.num_nodes)]\n for i, import_node in enumerate(IMPORT_NODES, 2):\n if import_node.prune:\n # txindex is enabled by default in Dash and needs to be disabled for import-rescan.py\n extra_args[i] += [\"-prune=1\", \"-txindex=0\", \"-reindex\"]\n\n self.add_nodes(self.num_nodes, extra_args, stderr=sys.stdout)\n self.start_nodes()\n for i in range(1, self.num_nodes):\n connect_nodes(self.nodes[i], 0)\n\n def run_test(self):\n # Create one transaction on node 0 with a unique amount and label for\n # each possible type of wallet import RPC.\n for i, variant in enumerate(IMPORT_VARIANTS):\n variant.label = \"label {} {}\".format(i, variant)\n variant.address = self.nodes[1].validateaddress(self.nodes[1].getnewaddress(variant.label))\n variant.key = self.nodes[1].dumpprivkey(variant.address[\"address\"])\n variant.initial_amount = 10 - (i + 1) / 4.0\n variant.initial_txid = self.nodes[0].sendtoaddress(variant.address[\"address\"], variant.initial_amount)\n\n # Generate a block containing the initial transactions, then another\n # block further in the future (past the rescan window).\n self.nodes[0].generate(1)\n assert_equal(self.nodes[0].getrawmempool(), [])\n timestamp = self.nodes[0].getblockheader(self.nodes[0].getbestblockhash())[\"time\"]\n set_node_times(self.nodes, timestamp + TIMESTAMP_WINDOW + 1)\n self.nodes[0].generate(1)\n self.sync_blocks()\n\n # For each variation of wallet key import, invoke the import RPC and\n # check the results from getbalance and listtransactions.\n for variant in IMPORT_VARIANTS:\n variant.expect_disabled = variant.rescan == Rescan.yes and variant.prune and variant.call == Call.single\n expect_rescan = variant.rescan == Rescan.yes and not variant.expect_disabled\n variant.node = self.nodes[2 + IMPORT_NODES.index(ImportNode(variant.prune, expect_rescan))]\n variant.do_import(timestamp)\n if expect_rescan:\n variant.expected_balance = variant.initial_amount\n variant.expected_txs = 1\n variant.check(variant.initial_txid, variant.initial_amount, 2)\n else:\n variant.expected_balance = 0\n variant.expected_txs = 0\n variant.check()\n\n # Create new transactions sending to each address.\n for i, variant in enumerate(IMPORT_VARIANTS):\n variant.sent_amount = 10 - (2 * i + 1) / 8.0\n variant.sent_txid = self.nodes[0].sendtoaddress(variant.address[\"address\"], variant.sent_amount)\n\n # Generate a block containing the new transactions.\n self.nodes[0].generate(1)\n assert_equal(self.nodes[0].getrawmempool(), [])\n self.sync_blocks()\n\n # Check the latest results from getbalance and listtransactions.\n for variant in IMPORT_VARIANTS:\n if not variant.expect_disabled:\n variant.expected_balance += variant.sent_amount\n variant.expected_txs += 1\n variant.check(variant.sent_txid, variant.sent_amount, 1)\n else:\n variant.check()\n\nif __name__ == \"__main__\":\n ImportRescanTest().main()\n"},"avg_line_length":{"kind":"number","value":47.6315789474,"string":"47.631579"},"max_line_length":{"kind":"number","value":116,"string":"116"},"alphanum_fraction":{"kind":"number","value":0.6543646409,"string":"0.654365"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"BlueScionic/vivarium"},"path":{"kind":"string","value":"test/functional/import-rescan.py"},"size":{"kind":"number","value":9050,"string":"9,050"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8741,"cells":{"content":{"kind":"string","value":"shisu_risto = [1, 0, 2]\nkazu_risto = [1, 4, 6]\ntou_risto = []\n\nfor ai in range(len(shisu_risto)):\n tou_risto.append(kazu_risto[shisu_risto[ai]])\n\nprint(tou_risto)\n\n"},"avg_line_length":{"kind":"number","value":16.7,"string":"16.7"},"max_line_length":{"kind":"number","value":49,"string":"49"},"alphanum_fraction":{"kind":"number","value":0.6826347305,"string":"0.682635"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"ALFA-group/neural-program-comprehension"},"path":{"kind":"string","value":"stimuli/Python/one_file_per_item/jap/33_# math_for 15.py"},"size":{"kind":"number","value":167,"string":"167"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8742,"cells":{"content":{"kind":"string","value":"#\n# -------------------------------------------------------------------------\n# Copyright (c) 2018 Intel Corporation Intellectual Property\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n#\n# -------------------------------------------------------------------------\n#\n\"\"\"Test case for RootController /\"\"\"\n\nimport json\nfrom conductor import version\nfrom conductor.tests.unit.api import base_api\n\n\nclass TestRoot(base_api.BaseApiTest):\n\n def test_get_index(self):\n actual_response = self.app.get('/')\n req_json_file = './conductor/tests/unit/api/controller/versions.json'\n expected_response = json.loads(open(req_json_file).read())\n\n versions = expected_response.get('versions')\n for version_obj in versions:\n version_obj['version'] = \"of-has:{}\".format(version.version_info.version_string())\n\n self.assertEqual(200, actual_response.status_int)\n self.assertJsonEqual(expected_response,\n json.loads(actual_response.body.decode()))\n"},"avg_line_length":{"kind":"number","value":38.4,"string":"38.4"},"max_line_length":{"kind":"number","value":94,"string":"94"},"alphanum_fraction":{"kind":"number","value":0.6393229167,"string":"0.639323"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"onap/optf-has"},"path":{"kind":"string","value":"conductor/conductor/tests/unit/api/controller/test_root.py"},"size":{"kind":"number","value":1536,"string":"1,536"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8743,"cells":{"content":{"kind":"string","value":"from apollo.viewsets import UserViewSet\nfrom applications.assets.viewsets import EquipmentViewSet, ServiceViewSet\nfrom applications.business.viewsets import BusinessViewSet, BusinessMembershipViewSet\nfrom applications.charge_list.viewsets import ChargeListViewSet, ActivityChargeViewSet, \\\n ActivityChargeActivityCountViewSet, TimeChargeViewSet, UnitChargeViewSet\nfrom applications.price_list.viewsets import PriceListViewSet, ActivityPriceListItemViewSet, TimePriceListItemViewSet, \\\n UnitPriceListItemViewSet, PriceListItemEquipmentViewSet, PriceListItemServiceViewSet\nfrom applications.station.viewsets import StationViewSet, StationBusinessViewSet, StationRentalViewSet\nfrom applications.terms_of_service.viewsets import TermsOfServiceViewSet\nfrom rest_framework.routers import DefaultRouter\n\n# Internal API Definition\nrouter = DefaultRouter()\n\nrouter.register(r'account/user', UserViewSet, base_name='user')\nrouter.register(r'account/terms_of_service', TermsOfServiceViewSet, base_name='terms-of-service')\nrouter.register(r'business/business', BusinessViewSet, base_name='business')\nrouter.register(r'business/business_membership', BusinessMembershipViewSet, base_name='business-membership')\nrouter.register(r'equipment/equipment', EquipmentViewSet, base_name='equipment')\nrouter.register(r'equipment/service', ServiceViewSet, base_name='service')\nrouter.register(r'station/station', StationViewSet, base_name='station')\nrouter.register(r'station/station_business', StationBusinessViewSet, base_name='station-business')\nrouter.register(r'station/station_rental', StationRentalViewSet, base_name='station-rental')\nrouter.register(r'price_list/price_list', PriceListViewSet, base_name='price-list')\nrouter.register(r'price_list/activity_item', ActivityPriceListItemViewSet, base_name='activity-price-list-item')\nrouter.register(r'price_list/time_item', TimePriceListItemViewSet, base_name='time-price-list-item')\nrouter.register(r'price_list/unit_item', UnitPriceListItemViewSet, base_name='unit-price-list-item')\nrouter.register(r'price_list/equipment_relation', PriceListItemEquipmentViewSet, base_name='price-list-item-equipment')\nrouter.register(r'price_list/service_relation', PriceListItemServiceViewSet, base_name='price-list-item-service')\nrouter.register(r'charge_list/charge_list', ChargeListViewSet, base_name='charge-list')\nrouter.register(r'charge_list/activity_charge', ActivityChargeViewSet, base_name='activity-charge')\nrouter.register(r'charge_list/activity_charge_activity_count', ActivityChargeActivityCountViewSet,\n base_name='activity-charge-activity-count')\nrouter.register(r'charge_list/time_charge', TimeChargeViewSet, base_name='time-charge')\nrouter.register(r'charge_list/unit_charge', UnitChargeViewSet, base_name='unit-charge')\n\n"},"avg_line_length":{"kind":"number","value":75.1621621622,"string":"75.162162"},"max_line_length":{"kind":"number","value":120,"string":"120"},"alphanum_fraction":{"kind":"number","value":0.848256023,"string":"0.848256"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"awwong1/apollo"},"path":{"kind":"string","value":"apollo/router.py"},"size":{"kind":"number","value":2781,"string":"2,781"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8744,"cells":{"content":{"kind":"string","value":"from whey.mixin import BuilderMixin\n\nclass GettextMixin:\n\tdef build_messages(self: BuilderMixin):\n\t\tfrom babel.messages.mofile import write_mo\n\t\tfrom babel.messages.pofile import read_po\n\n\t\tlocales = self.pkgdir / \"locales\"\n\t\tif self.verbose:\n\t\t\tprint(\" Building messages\")\n\n\t\tfor po in locales.glob(\"*/LC_MESSAGES/pm2hw.po\"):\n\t\t\twith po.open(\"rt\", encoding=\"UTF-8\") as f:\n\t\t\t\tcatalog = read_po(f, po.parts[-3], po.stem)\n\n\t\t\tmo = self.build_dir / po.relative_to(self.project_dir).with_suffix(\".mo\")\n\t\t\tmo.parent.maybe_make(parents=True)\n\t\t\twith mo.open(\"wb\") as f:\n\t\t\t\twrite_mo(f, catalog)\n\t\t\tself.report_written(mo)\n\n\t\t\tif self.verbose:\n\t\t\t\tprint(\" Wrote language file:\", mo)\n\n\n# class SDistBuilder(GettextMixin, builder.SDistBuilder):\n# \tdef call_additional_hooks(self):\n# \t\tself.build_messages()\n\n\n# class WheelBuilder(GettextMixin, builder.WheelBuilder):\n# \tdef call_additional_hooks(self):\n# \t\tself.build_messages()\n"},"avg_line_length":{"kind":"number","value":27.2058823529,"string":"27.205882"},"max_line_length":{"kind":"number","value":76,"string":"76"},"alphanum_fraction":{"kind":"number","value":0.7189189189,"string":"0.718919"},"licenses":{"kind":"list like","value":["MPL-2.0"],"string":"[\n \"MPL-2.0\"\n]"},"repository_name":{"kind":"string","value":"bedwardly-down/pm2hw"},"path":{"kind":"string","value":"build_hooks.py"},"size":{"kind":"number","value":925,"string":"925"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8745,"cells":{"content":{"kind":"string","value":"# coding: utf-8\n\"\"\"\n\n\"\"\"\n\nfrom copy import deepcopy\nimport datetime\nimport io\nimport json\nimport math\nimport os\nimport zipfile\n\nimport flask\nimport flask_login\nimport itsdangerous\nimport werkzeug.utils\nfrom flask_babel import _\n\nfrom . import frontend\nfrom .. import logic\nfrom .. import models\nfrom .. import db\nfrom ..logic import user_log, object_log, comments, object_sorting\nfrom ..logic.actions import get_action, get_actions, get_action_type, get_action_types\nfrom ..logic.action_type_translations import get_action_types_with_translations_in_language, \\\n get_action_type_with_translation_in_language\nfrom ..logic.action_translations import get_action_with_translation_in_language\nfrom ..logic.action_permissions import get_user_action_permissions, get_sorted_actions_for_user\nfrom ..logic.object_permissions import Permissions, get_user_object_permissions, object_is_public, get_object_permissions_for_users, set_object_public, set_user_object_permissions, set_group_object_permissions, set_project_object_permissions, get_objects_with_permissions, get_object_info_with_permissions, get_object_permissions_for_groups, get_object_permissions_for_projects, request_object_permissions\nfrom ..logic.datatypes import JSONEncoder\nfrom ..logic.instrument_translations import get_instrument_with_translation_in_language\nfrom ..logic.users import get_user, get_users, get_users_by_name\nfrom ..logic.schemas import validate, generate_placeholder\nfrom ..logic.settings import get_user_settings, set_user_settings\nfrom ..logic.object_search import generate_filter_func, wrap_filter_func\nfrom ..logic.groups import get_group, get_user_groups\nfrom ..logic.objects import create_object, create_object_batch, update_object, get_object, get_object_versions\nfrom ..logic.object_log import ObjectLogEntryType\nfrom ..logic.projects import get_project, get_user_projects, get_user_project_permissions\nfrom ..logic.locations import get_location, get_object_ids_at_location, get_object_location_assignment, get_object_location_assignments, get_locations, assign_location_to_object, get_locations_tree\nfrom ..logic.languages import get_language_by_lang_code, get_language, get_languages, Language, get_user_language\nfrom ..logic.files import FileLogEntryType\nfrom ..logic.errors import GroupDoesNotExistError, ObjectDoesNotExistError, UserDoesNotExistError, ActionDoesNotExistError, ValidationError, ProjectDoesNotExistError, LocationDoesNotExistError, ActionTypeDoesNotExistError\nfrom ..logic.notebook_templates import get_notebook_templates\nfrom .objects_forms import ObjectPermissionsForm, ObjectForm, ObjectVersionRestoreForm, ObjectUserPermissionsForm, CommentForm, ObjectGroupPermissionsForm, ObjectProjectPermissionsForm, FileForm, FileInformationForm, FileHidingForm, ObjectLocationAssignmentForm, ExternalLinkForm, ObjectPublicationForm, CopyPermissionsForm\nfrom ..utils import object_permissions_required\nfrom .utils import jinja_filter, generate_qrcode\nfrom .object_form_parser import parse_form_data\nfrom .labels import create_labels, PAGE_SIZES, DEFAULT_PAPER_FORMAT, HORIZONTAL_LABEL_MARGIN, VERTICAL_LABEL_MARGIN, mm\nfrom . import pdfexport\nfrom .utils import check_current_user_is_not_readonly\nfrom ..logic.utils import get_translated_text\n\n__author__ = 'Florian Rhiem <f.rhiem@fz-juelich.de>'\n\n\ndef on_unauthorized(object_id):\n permissions_by_user = get_object_permissions_for_users(object_id)\n has_grant_user = any(\n Permissions.GRANT in permissions\n for permissions in permissions_by_user.values()\n )\n return flask.render_template('objects/unauthorized.html', object_id=object_id, has_grant_user=has_grant_user), 403\n\n\n@frontend.route('/objects/')\n@flask_login.login_required\ndef objects():\n object_ids = flask.request.args.get('ids', '')\n objects = []\n display_properties = []\n display_property_titles = {}\n user_language_id = logic.languages.get_user_language(flask_login.current_user).id\n if 'display_properties' in flask.request.args:\n for property_info in flask.request.args.get('display_properties', '').split(','):\n if ':' in property_info:\n property_name, property_title = property_info.split(':', 1)\n else:\n property_name, property_title = property_info, property_info\n if property_name not in display_properties:\n display_properties.append(property_name)\n display_property_titles[property_name] = property_title\n name_only = True\n if object_ids:\n object_ids = object_ids.split(',')\n try:\n object_ids = [int(object_id) for object_id in object_ids]\n except ValueError:\n object_ids = []\n\n readable_object_ids = []\n for object_id in object_ids:\n if Permissions.READ in get_user_object_permissions(object_id, user_id=flask_login.current_user.id):\n readable_object_ids.append(object_id)\n object_ids = readable_object_ids\n for object_id in object_ids:\n try:\n objects.append(get_object(object_id))\n except logic.errors.ObjectDoesNotExistError:\n pass\n action_id = None\n action = None\n action_type = None\n project_id = None\n location_id = None\n location = None\n user = None\n user_id = None\n doi = None\n object_ids_at_location = None\n project = None\n group = None\n group_id = None\n query_string = ''\n use_advanced_search = False\n must_use_advanced_search = False\n advanced_search_had_error = False\n search_notes = []\n search_tree = None\n limit = None\n offset = None\n pagination_enabled = True\n num_objects_found = len(objects)\n sorting_property_name = None\n sorting_order_name = None\n else:\n pagination_enabled = True\n try:\n user_id = int(flask.request.args.get('user', ''))\n user = get_user(user_id)\n except ValueError:\n user_id = None\n user = None\n except UserDoesNotExistError:\n user_id = None\n user = None\n if user_id is not None:\n user_permissions = {\n 'read': Permissions.READ,\n 'write': Permissions.WRITE,\n 'grant': Permissions.GRANT\n }.get(flask.request.args.get('user_permissions', '').lower())\n else:\n user_permissions = None\n try:\n doi = logic.publications.simplify_doi(flask.request.args.get('doi', ''))\n except logic.errors.InvalidDOIError:\n doi = None\n try:\n location_id = int(flask.request.args.get('location', ''))\n location = get_location(location_id)\n object_ids_at_location = get_object_ids_at_location(location_id)\n except ValueError:\n location_id = None\n location = None\n object_ids_at_location = None\n except LocationDoesNotExistError:\n location_id = None\n location = None\n object_ids_at_location = None\n try:\n action_id = int(flask.request.args.get('action', ''))\n except ValueError:\n action_id = None\n if action_id is not None:\n action = get_action_with_translation_in_language(action_id, user_language_id, use_fallback=True)\n action_type = get_action_type_with_translation_in_language(action.type_id, user_language_id)\n action_schema = action.schema\n if not display_properties:\n display_properties = action_schema.get('displayProperties', [])\n for property_name in display_properties:\n display_property_titles[property_name] = action_schema['properties'][property_name]['title']\n else:\n action = None\n action_type_id = flask.request.args.get('t', '')\n if action_type_id is not None:\n try:\n action_type_id = int(action_type_id)\n except ValueError:\n # ensure old links still function\n action_type_id = {\n 'samples': models.ActionType.SAMPLE_CREATION,\n 'measurements': models.ActionType.MEASUREMENT,\n 'simulations': models.ActionType.SIMULATION\n }.get(action_type_id, None)\n if action_type_id is not None:\n try:\n action_type = get_action_type_with_translation_in_language(\n action_type_id=action_type_id,\n language_id=user_language_id\n )\n except ActionTypeDoesNotExistError:\n action_type = None\n else:\n action_type = None\n project_permissions = None\n if display_properties:\n name_only = False\n try:\n project_id = int(flask.request.args.get('project', ''))\n except ValueError:\n project_id = None\n if project_id is not None:\n if Permissions.READ not in get_user_project_permissions(project_id=project_id, user_id=flask_login.current_user.id, include_groups=True):\n return flask.abort(403)\n project = get_project(project_id)\n project_permissions = {\n 'read': Permissions.READ,\n 'write': Permissions.WRITE,\n 'grant': Permissions.GRANT\n }.get(flask.request.args.get('project_permissions', '').lower())\n else:\n project = None\n\n group_permissions = None\n try:\n group_id = int(flask.request.args.get('group', ''))\n except ValueError:\n group_id = None\n if group_id is not None:\n try:\n group = logic.groups.get_group(group_id)\n group_member_ids = logic.groups.get_group_member_ids(group_id)\n except logic.errors.GroupDoesNotExistError:\n group = None\n else:\n if flask_login.current_user.id not in group_member_ids:\n return flask.abort(403)\n else:\n group = None\n if group is not None:\n group_permissions = {\n 'read': Permissions.READ,\n 'write': Permissions.WRITE,\n 'grant': Permissions.GRANT\n }.get(flask.request.args.get('group_permissions', '').lower())\n else:\n group_permissions = None\n\n if flask.request.args.get('limit', '') == 'all':\n limit = None\n else:\n try:\n limit = int(flask.request.args.get('limit', ''))\n except ValueError:\n limit = None\n else:\n if limit <= 0:\n limit = None\n elif limit >= 1000:\n limit = 1000\n\n # default objects per page\n if limit is None:\n limit = get_user_settings(flask_login.current_user.id)['OBJECTS_PER_PAGE']\n else:\n set_user_settings(flask_login.current_user.id, {'OBJECTS_PER_PAGE': limit})\n\n try:\n offset = int(flask.request.args.get('offset', ''))\n except ValueError:\n offset = None\n else:\n if offset < 0:\n offset = None\n elif offset > 100000000:\n offset = 100000000\n if limit is not None and offset is None:\n offset = 0\n\n sorting_order_name = flask.request.args.get('order', None)\n if sorting_order_name == 'asc':\n sorting_order = object_sorting.ascending\n elif sorting_order_name == 'desc':\n sorting_order = object_sorting.descending\n else:\n sorting_order = None\n\n sorting_property_name = flask.request.args.get('sortby', None)\n\n if sorting_order is None:\n if sorting_property_name is None:\n sorting_order_name = 'desc'\n sorting_order = object_sorting.descending\n else:\n sorting_order_name = 'asc'\n sorting_order = object_sorting.ascending\n if sorting_property_name is None:\n sorting_property_name = '_object_id'\n else:\n name_only = False\n if sorting_property_name == '_object_id':\n sorting_property = object_sorting.object_id()\n elif sorting_property_name == '_creation_date':\n sorting_property = object_sorting.creation_date()\n elif sorting_property_name == '_last_modification_date':\n sorting_property = object_sorting.last_modification_date()\n else:\n sorting_property = object_sorting.property_value(sorting_property_name)\n\n sorting_function = sorting_order(sorting_property)\n\n query_string = flask.request.args.get('q', '')\n if query_string:\n name_only = False\n search_tree = None\n use_advanced_search = flask.request.args.get('advanced', None) is not None\n must_use_advanced_search = use_advanced_search\n advanced_search_had_error = False\n additional_search_notes = []\n if not use_advanced_search and query_string:\n if user_id is None:\n users = get_users_by_name(query_string)\n if len(users) == 1:\n user = users[0]\n user_id = user.id\n query_string = ''\n elif len(users) > 1:\n additional_search_notes.append(('error', \"There are multiple users with this name.\", 0, 0))\n if doi is None and query_string.startswith('doi:'):\n try:\n doi = logic.publications.simplify_doi(query_string)\n query_string = ''\n except logic.errors.InvalidDOIError:\n pass\n try:\n filter_func, search_tree, use_advanced_search = generate_filter_func(query_string, use_advanced_search)\n except Exception:\n # TODO: ensure that advanced search does not cause exceptions\n if use_advanced_search:\n advanced_search_had_error = True\n\n def filter_func(data, search_notes):\n \"\"\" Return all objects\"\"\"\n search_notes.append(('error', \"Unable to parse search expression\", 0, len(query_string)))\n return False\n else:\n raise\n filter_func, search_notes = wrap_filter_func(filter_func)\n search_notes.extend(additional_search_notes)\n if user_id is None or user_permissions is not None:\n object_ids_for_user = None\n else:\n object_ids_for_user = user_log.get_user_related_object_ids(user_id)\n if doi is None:\n object_ids_for_doi = None\n else:\n object_ids_for_doi = logic.publications.get_object_ids_linked_to_doi(doi)\n if use_advanced_search and not must_use_advanced_search:\n search_notes.append(('info', _(\"The advanced search was used automatically. Search for \\\"%(query_string)s\\\" to use the simple search.\", query_string=query_string), 0, 0))\n try:\n object_ids = None\n if object_ids_at_location is not None:\n if object_ids is None:\n object_ids = set()\n object_ids = object_ids.union(object_ids_at_location)\n if object_ids_for_user is not None:\n if object_ids is None:\n object_ids = set()\n object_ids = object_ids.union(object_ids_for_user)\n if object_ids_for_doi is not None:\n if object_ids is None:\n object_ids = set()\n object_ids = object_ids.union(object_ids_for_doi)\n if object_ids is not None:\n pagination_enabled = False\n limit = None\n offset = None\n if object_ids is not None and not object_ids:\n objects = []\n num_objects_found = 0\n else:\n num_objects_found_list = []\n objects = get_objects_with_permissions(\n user_id=flask_login.current_user.id,\n permissions=Permissions.READ,\n filter_func=filter_func,\n sorting_func=sorting_function,\n limit=limit,\n offset=offset,\n action_id=action_id,\n action_type_id=action_type.id if action_type is not None else None,\n other_user_id=user_id,\n other_user_permissions=user_permissions,\n project_id=project_id,\n project_permissions=project_permissions,\n group_id=group_id,\n group_permissions=group_permissions,\n object_ids=object_ids,\n num_objects_found=num_objects_found_list,\n name_only=name_only\n )\n num_objects_found = num_objects_found_list[0]\n except Exception as e:\n search_notes.append(('error', \"Error during search: {}\".format(e), 0, 0))\n objects = []\n num_objects_found = 0\n if any(note[0] == 'error' for note in search_notes):\n objects = []\n advanced_search_had_error = True\n\n cached_actions = {}\n cached_users = {}\n\n for i, obj in enumerate(objects):\n if obj.version_id == 0:\n original_object = obj\n else:\n original_object = get_object(object_id=obj.object_id, version_id=0)\n if obj.action_id not in cached_actions:\n cached_actions[obj.action_id] = get_action(obj.action_id)\n if obj.user_id not in cached_users:\n cached_users[obj.user_id] = get_user(obj.user_id)\n if original_object.user_id not in cached_users:\n cached_users[original_object.user_id] = get_user(original_object.user_id)\n objects[i] = {\n 'object_id': obj.object_id,\n 'created_by': cached_users[original_object.user_id],\n 'created_at': original_object.utc_datetime,\n 'modified_by': cached_users[obj.user_id],\n 'last_modified_at': obj.utc_datetime,\n 'data': obj.data,\n 'schema': obj.schema,\n 'action': cached_actions[obj.action_id],\n 'display_properties': {}\n }\n\n for property_name in display_properties:\n if property_name not in objects[i]['data'] or '_type' not in objects[i]['data'][property_name] or property_name not in objects[i]['schema']['properties']:\n objects[i]['display_properties'][property_name] = None\n continue\n objects[i]['display_properties'][property_name] = (objects[i]['data'][property_name], objects[i]['schema']['properties'][property_name])\n if action_id is None:\n show_action = True\n else:\n show_action = False\n\n def build_modified_url(**kwargs):\n return flask.url_for(\n '.objects',\n **{k: v for k, v in flask.request.args.items() if k not in kwargs},\n **kwargs\n )\n\n action_ids = {\n object['action'].id for object in objects\n }\n action_translations = {}\n for id in action_ids:\n action_translations[id] = logic.action_translations.get_action_translation_for_action_in_language(\n action_id=id,\n language_id=user_language_id,\n use_fallback=True\n )\n\n return flask.render_template(\n 'objects/objects.html',\n objects=objects,\n display_properties=display_properties,\n display_property_titles=display_property_titles,\n search_query=query_string,\n action=action,\n action_translations=action_translations,\n action_id=action_id,\n action_type=action_type,\n project=project,\n project_id=project_id,\n group=group,\n group_id=group_id,\n location_id=location_id,\n location=location,\n user_id=user_id,\n user=user,\n doi=doi,\n get_object_if_current_user_has_read_permissions=get_object_if_current_user_has_read_permissions,\n get_instrument_translation_for_instrument_in_language=logic.instrument_translations.get_instrument_translation_for_instrument_in_language,\n build_modified_url=build_modified_url,\n sorting_property=sorting_property_name,\n sorting_order=sorting_order_name,\n limit=limit,\n offset=offset,\n pagination_enabled=pagination_enabled,\n num_objects_found=num_objects_found,\n show_action=show_action,\n use_advanced_search=use_advanced_search,\n must_use_advanced_search=must_use_advanced_search,\n advanced_search_had_error=advanced_search_had_error,\n search_notes=search_notes,\n search_tree=search_tree\n )\n\n\n@jinja_filter\ndef to_datatype(obj):\n return json.loads(json.dumps(obj), object_hook=JSONEncoder.object_hook)\n\n\ndef get_sub_data_and_schema(data, schema, id_prefix):\n sub_data = data\n sub_schema = schema\n try:\n for key in id_prefix.split('__'):\n if sub_schema['type'] == 'array':\n key = int(key)\n sub_schema = sub_schema['items']\n elif sub_schema['type'] == 'object':\n sub_schema = sub_schema['properties'][key]\n else:\n raise ValueError('invalid type')\n if isinstance(key, int):\n while key >= len(sub_data):\n sub_data.append(generate_placeholder(sub_schema))\n elif key not in sub_data:\n sub_data[key] = generate_placeholder(sub_schema)\n sub_data = sub_data[key]\n if sub_schema['type'] != 'array':\n raise ValueError('invalid type')\n except (ValueError, KeyError, IndexError, TypeError):\n # TODO: error handling/logging?\n raise ValueError('invalid action')\n return sub_data, sub_schema\n\n\ndef apply_action_to_form_data(action, form_data):\n new_form_data = form_data\n action_id_prefix, action_index, action_type = action[len('action_'):].rsplit('__', 2)\n if action_type == 'delete':\n deleted_item_index = int(action_index)\n parent_id_prefix = action_id_prefix\n new_form_data = {}\n for name in form_data:\n if not name.startswith(parent_id_prefix + '__'):\n new_form_data[name] = form_data[name]\n else:\n item_index, id_suffix = name[len(parent_id_prefix) + 2:].split('__', 1)\n item_index = int(item_index)\n if item_index < deleted_item_index:\n new_form_data[name] = form_data[name]\n if item_index > deleted_item_index:\n new_name = parent_id_prefix + '__' + str(item_index - 1) + '__' + id_suffix\n new_form_data[new_name] = form_data[name]\n return new_form_data\n\n\ndef apply_action_to_data(action, data, schema):\n action_id_prefix, action_index, action_type = action[len('action_'):].rsplit('__', 2)\n if action_type not in ('add', 'delete', 'addcolumn', 'deletecolumn'):\n raise ValueError('invalid action')\n sub_data, sub_schema = get_sub_data_and_schema(data, schema, action_id_prefix.split('__', 1)[1])\n if action_type in ('addcolumn', 'deletecolumn') and (sub_schema[\"style\"] != \"table\" or sub_schema[\"items\"][\"type\"] != \"array\"):\n raise ValueError('invalid action')\n num_existing_items = len(sub_data)\n if action_type == 'add':\n if 'maxItems' not in sub_schema or num_existing_items < sub_schema[\"maxItems\"]:\n sub_data.append(generate_placeholder(sub_schema[\"items\"]))\n if isinstance(sub_data[-1], list) and sub_schema.get('style') == 'table':\n num_existing_columns = sub_schema[\"items\"].get(\"minItems\", 0)\n for row in sub_data:\n num_existing_columns = max(num_existing_columns, len(row))\n while len(sub_data[-1]) < num_existing_columns:\n sub_data[-1].append(None)\n elif action_type == 'delete':\n action_index = int(action_index)\n if ('minItems' not in sub_schema or num_existing_items > sub_schema[\"minItems\"]) and action_index < num_existing_items:\n del sub_data[action_index]\n else:\n num_existing_columns = sub_schema[\"items\"].get(\"minItems\", 0)\n for row in sub_data:\n num_existing_columns = max(num_existing_columns, len(row))\n if action_type == 'addcolumn':\n if 'maxItems' not in sub_schema[\"items\"] or num_existing_columns < sub_schema[\"items\"][\"maxItems\"]:\n num_existing_columns += 1\n for row in sub_data:\n while len(row) < num_existing_columns:\n row.append(generate_placeholder(sub_schema[\"items\"][\"items\"]))\n elif action_type == 'deletecolumn':\n if num_existing_columns > sub_schema.get(\"minItems\", 0):\n num_existing_columns -= 1\n for row in sub_data:\n while len(row) > num_existing_columns:\n del row[-1]\n\n\ndef show_object_form(object, action, previous_object=None, should_upgrade_schema=False, placeholder_data=None):\n if object is None and previous_object is None:\n data = generate_placeholder(action.schema)\n if placeholder_data:\n for path, value in placeholder_data.items():\n try:\n sub_data = data\n for step in path[:-1]:\n sub_data = sub_data[step]\n sub_data[path[-1]] = value\n except Exception:\n # Ignore invalid placeholder data\n pass\n elif object is None and previous_object is not None:\n data = logic.schemas.copy_data(previous_object.data, previous_object.schema)\n else:\n data = object.data\n previous_object_schema = None\n mode = 'edit'\n if should_upgrade_schema:\n mode = 'upgrade'\n assert object is not None\n schema = action.schema\n data, upgrade_warnings = logic.schemas.convert_to_schema(object.data, object.schema, action.schema)\n for upgrade_warning in upgrade_warnings:\n flask.flash(upgrade_warning, 'warning')\n elif object is not None:\n schema = object.schema\n elif previous_object is not None:\n schema = previous_object.schema\n previous_object_schema = schema\n else:\n schema = action.schema\n\n if action is not None and action.instrument is not None and flask_login.current_user in action.instrument.responsible_users:\n may_create_log_entry = True\n create_log_entry_default = action.instrument.create_log_entry_default\n instrument_log_categories = logic.instrument_log_entries.get_instrument_log_categories(action.instrument.id)\n if 'create_instrument_log_entry' in flask.request.form:\n category_ids = []\n for category_id in flask.request.form.getlist('instrument_log_categories'):\n try:\n if int(category_id) in [category.id for category in instrument_log_categories]:\n category_ids.append(int(category_id))\n except Exception:\n pass\n else:\n category_ids = None\n else:\n instrument_log_categories = None\n category_ids = None\n create_log_entry_default = None\n may_create_log_entry = False\n\n permissions_for_group_id = None\n permissions_for_project_id = None\n copy_permissions_object_id = None\n if object is None:\n if flask.request.form.get('permissions_method') == 'copy_permissions' and flask.request.form.get('copy_permissions_object_id'):\n copy_permissions_object_id = flask.request.form.get('copy_permissions_object_id')\n try:\n copy_permissions_object_id = int(copy_permissions_object_id)\n if Permissions.READ not in get_user_object_permissions(copy_permissions_object_id, flask_login.current_user.id):\n flask.flash(_(\"Unable to copy permissions. Default permissions will be applied.\"), 'error')\n copy_permissions_object_id = None\n except Exception:\n flask.flash(_(\"Unable to copy permissions. Default permissions will be applied.\"), 'error')\n copy_permissions_object_id = None\n elif flask.request.form.get('permissions_method') == 'permissions_for_group' and flask.request.form.get('permissions_for_group_group_id'):\n permissions_for_group_id = flask.request.form.get('permissions_for_group_group_id')\n try:\n permissions_for_group_id = int(permissions_for_group_id)\n if flask_login.current_user.id not in logic.groups.get_group_member_ids(permissions_for_group_id):\n flask.flash(_(\"Unable to grant permissions to basic group. Default permissions will be applied.\"), 'error')\n permissions_for_group_id = None\n except Exception:\n flask.flash(_(\"Unable to grant permissions to basic group. Default permissions will be applied.\"), 'error')\n permissions_for_group_id = None\n elif flask.request.form.get('permissions_method') == 'permissions_for_project' and flask.request.form.get('permissions_for_project_project_id'):\n permissions_for_project_id = flask.request.form.get('permissions_for_project_project_id')\n try:\n permissions_for_project_id = int(permissions_for_project_id)\n if flask_login.current_user.id not in logic.projects.get_project_member_user_ids_and_permissions(permissions_for_project_id, include_groups=True):\n flask.flash(_(\"Unable to grant permissions to project group. Default permissions will be applied.\"), 'error')\n permissions_for_project_id = None\n except Exception:\n flask.flash(_(\"Unable to grant permissions to project group. Default permissions will be applied.\"), 'error')\n permissions_for_project_id = None\n\n if previous_object is not None:\n action_id = previous_object.action_id\n previous_object_id = previous_object.id\n has_grant_for_previous_object = Permissions.GRANT in get_user_object_permissions(user_id=flask_login.current_user.id, object_id=previous_object_id)\n else:\n action_id = action.id\n previous_object_id = None\n has_grant_for_previous_object = False\n errors = []\n object_errors = {}\n form_data = {}\n previous_actions = []\n serializer = itsdangerous.URLSafeSerializer(flask.current_app.config['SECRET_KEY'])\n form = ObjectForm()\n if flask.request.method != 'GET' and form.validate_on_submit():\n raw_form_data = {key: flask.request.form.getlist(key) for key in flask.request.form}\n form_data = {k: v[0] for k, v in raw_form_data.items()}\n if 'input_num_batch_objects' in form_data:\n try:\n num_objects_in_batch = int(form_data['input_num_batch_objects'])\n except ValueError:\n try:\n # The form allows notations like '1.2e1' for '12', however\n # Python can only parse these as floats\n num_objects_in_batch = float(form_data['input_num_batch_objects'])\n if num_objects_in_batch == int(num_objects_in_batch):\n num_objects_in_batch = int(num_objects_in_batch)\n else:\n raise\n except ValueError:\n errors.append('input_num_batch_objects')\n num_objects_in_batch = None\n else:\n form_data['input_num_batch_objects'] = str(num_objects_in_batch)\n else:\n form_data['input_num_batch_objects'] = str(num_objects_in_batch)\n else:\n num_objects_in_batch = None\n\n if 'previous_actions' in flask.request.form:\n try:\n previous_actions = serializer.loads(flask.request.form['previous_actions'])\n except itsdangerous.BadData:\n flask.abort(400)\n\n if \"action_submit\" in form_data:\n # The object name might need the batch number to match the pattern\n if schema.get('batch', False) and num_objects_in_batch is not None:\n name_suffix_format = schema.get('batch_name_format', '{:d}')\n try:\n name_suffix_format.format(1)\n except (ValueError, KeyError):\n name_suffix_format = '{:d}'\n if name_suffix_format:\n example_name_suffix = name_suffix_format.format(1)\n else:\n example_name_suffix = ''\n if 'object__name__text' in form_data:\n batch_base_name = form_data['object__name__text']\n raw_form_data['object__name__text'] = [batch_base_name + example_name_suffix]\n else:\n enabled_languages = form_data.get('object__name__text_languages', [])\n if 'en' not in enabled_languages:\n enabled_languages.append('en')\n for language_code in enabled_languages:\n batch_base_name = form_data.get('object__name__text_' + language_code, '')\n raw_form_data['object__name__text_' + language_code] = [batch_base_name + example_name_suffix]\n else:\n batch_base_name = None\n name_suffix_format = None\n object_data, object_errors = parse_form_data(raw_form_data, schema)\n errors += object_errors\n if object_data is not None and not errors:\n try:\n validate(object_data, schema)\n except ValidationError:\n # TODO: proper logging\n print('object schema validation failed')\n # TODO: handle error\n flask.abort(400)\n for markdown in logic.markdown_to_html.get_markdown_from_object_data(object_data):\n markdown_as_html = logic.markdown_to_html.markdown_to_safe_html(markdown)\n logic.markdown_images.mark_referenced_markdown_images_as_permanent(markdown_as_html)\n if object is None:\n if schema.get('batch', False) and num_objects_in_batch is not None:\n if 'name' in object_data and 'text' in object_data['name'] and name_suffix_format is not None and batch_base_name is not None:\n data_sequence = []\n for i in range(1, num_objects_in_batch + 1):\n if name_suffix_format:\n name_suffix = name_suffix_format.format(i)\n else:\n name_suffix = ''\n object_data['name']['text'] = batch_base_name + name_suffix\n data_sequence.append(deepcopy(object_data))\n else:\n data_sequence = [object_data] * num_objects_in_batch\n objects = create_object_batch(\n action_id=action.id,\n data_sequence=data_sequence,\n user_id=flask_login.current_user.id,\n copy_permissions_object_id=copy_permissions_object_id,\n permissions_for_group_id=permissions_for_group_id,\n permissions_for_project_id=permissions_for_project_id\n )\n object_ids = [object.id for object in objects]\n if category_ids is not None:\n log_entry = logic.instrument_log_entries.create_instrument_log_entry(\n instrument_id=action.instrument.id,\n user_id=flask_login.current_user.id,\n content='',\n category_ids=category_ids\n )\n for object_id in object_ids:\n logic.instrument_log_entries.create_instrument_log_object_attachment(\n instrument_log_entry_id=log_entry.id,\n object_id=object_id\n )\n flask.flash(_('The objects were created successfully.'), 'success')\n return flask.redirect(flask.url_for('.objects', ids=','.join([str(object_id) for object_id in object_ids])))\n else:\n object = create_object(\n action_id=action.id,\n data=object_data,\n user_id=flask_login.current_user.id,\n previous_object_id=previous_object_id,\n schema=previous_object_schema,\n copy_permissions_object_id=copy_permissions_object_id,\n permissions_for_group_id=permissions_for_group_id,\n permissions_for_project_id=permissions_for_project_id\n )\n if category_ids is not None:\n log_entry = logic.instrument_log_entries.create_instrument_log_entry(\n instrument_id=action.instrument.id,\n user_id=flask_login.current_user.id,\n content='',\n category_ids=category_ids\n )\n logic.instrument_log_entries.create_instrument_log_object_attachment(\n instrument_log_entry_id=log_entry.id,\n object_id=object.id\n )\n flask.flash(_('The object was created successfully.'), 'success')\n else:\n if object_data != object.data or schema != object.schema:\n update_object(object_id=object.id, user_id=flask_login.current_user.id, data=object_data, schema=schema)\n flask.flash(_('The object was updated successfully.'), 'success')\n return flask.redirect(flask.url_for('.object', object_id=object.id))\n elif any(name.startswith('action_object__') and (name.endswith('__delete') or name.endswith('__add') or name.endswith('__addcolumn') or name.endswith('__deletecolumn')) for name in form_data):\n action = [name for name in form_data if name.startswith('action_')][0]\n previous_actions.append(action)\n\n if previous_actions:\n try:\n for action in previous_actions:\n apply_action_to_data(action, data, schema)\n form_data = apply_action_to_form_data(previous_actions[-1], form_data)\n except ValueError:\n flask.abort(400)\n\n if not flask.current_app.config[\"LOAD_OBJECTS_IN_BACKGROUND\"]:\n referencable_objects = get_objects_with_permissions(\n user_id=flask_login.current_user.id,\n permissions=Permissions.READ\n )\n if object is not None:\n referencable_objects = [\n referencable_object\n for referencable_object in referencable_objects\n if referencable_object.object_id != object.object_id\n ]\n\n else:\n referencable_objects = []\n existing_objects = []\n sorted_actions = get_sorted_actions_for_user(\n user_id=flask_login.current_user.id\n )\n\n action_type_id_by_action_id = {}\n for action_type in get_action_types():\n for action in get_actions(action_type.id):\n action_type_id_by_action_id[action.id] = action_type.id\n\n tags = [{'name': tag.name, 'uses': tag.uses} for tag in logic.tags.get_tags()]\n users = get_users(exclude_hidden=True)\n users.sort(key=lambda user: user.id)\n\n english = get_language(Language.ENGLISH)\n\n if object is None:\n if not flask.current_app.config[\"LOAD_OBJECTS_IN_BACKGROUND\"]:\n existing_objects = get_objects_with_permissions(\n user_id=flask_login.current_user.id,\n permissions=Permissions.GRANT\n )\n\n user_groups = logic.groups.get_user_groups(flask_login.current_user.id)\n user_projects = logic.projects.get_user_projects(flask_login.current_user.id, include_groups=True)\n\n return flask.render_template(\n 'objects/forms/form_create.html',\n action_id=action_id,\n schema=schema,\n data=data,\n errors=errors,\n object_errors=object_errors,\n form_data=form_data,\n previous_actions=serializer.dumps(previous_actions),\n form=form,\n can_copy_permissions=True,\n existing_objects=existing_objects,\n user_groups=user_groups,\n user_projects=user_projects,\n referencable_objects=referencable_objects,\n sorted_actions=sorted_actions,\n action_type_id_by_action_id=action_type_id_by_action_id,\n get_object_if_current_user_has_read_permissions=get_object_if_current_user_has_read_permissions,\n ActionType=models.ActionType,\n datetime=datetime,\n tags=tags,\n users=users,\n may_create_log_entry=may_create_log_entry,\n instrument_log_categories=instrument_log_categories,\n create_log_entry_default=create_log_entry_default,\n previous_object_id=previous_object_id,\n has_grant_for_previous_object=has_grant_for_previous_object,\n languages=get_languages(only_enabled_for_input=True),\n ENGLISH=english\n )\n else:\n return flask.render_template(\n 'objects/forms/form_edit.html',\n schema=schema,\n data=data,\n object_id=object.object_id,\n errors=errors,\n object_errors=object_errors,\n form_data=form_data,\n previous_actions=serializer.dumps(previous_actions),\n form=form,\n referencable_objects=referencable_objects,\n sorted_actions=sorted_actions,\n get_object_if_current_user_has_read_permissions=get_object_if_current_user_has_read_permissions,\n action_type_id_by_action_id=action_type_id_by_action_id,\n ActionType=models.ActionType,\n datetime=datetime,\n tags=tags,\n users=users,\n mode=mode,\n languages=get_languages(),\n ENGLISH=english\n )\n\n\ndef build_object_location_assignment_confirmation_url(object_location_assignment_id: int) -> None:\n confirmation_url = flask.url_for(\n 'frontend.accept_responsibility_for_object',\n t=logic.security_tokens.generate_token(\n object_location_assignment_id,\n salt='confirm_responsibility',\n secret_key=flask.current_app.config['SECRET_KEY']\n ),\n _external=True\n )\n return confirmation_url\n\n\ndef get_project_if_it_exists(project_id):\n try:\n return get_project(project_id)\n except logic.errors.ProjectDoesNotExistError:\n return None\n\n\ndef show_inline_edit(obj, action):\n # Set view attributes\n related_objects_tree = logic.object_relationships.build_related_objects_tree(obj.id, flask_login.current_user.id)\n\n user_language_id = get_user_language(flask_login.current_user).id\n english = get_language(Language.ENGLISH)\n\n object_id = obj.id\n\n user_permissions = get_user_object_permissions(object_id=object_id, user_id=flask_login.current_user.id)\n user_may_grant = Permissions.GRANT in user_permissions\n user_may_use_as_template = Permissions.READ in get_user_action_permissions(obj.action_id, user_id=flask_login.current_user.id)\n\n new_schema_available = True if action.schema != obj.schema else False\n\n instrument = get_instrument_with_translation_in_language(action.instrument_id,\n user_language_id) if action.instrument else None\n object_type = get_action_type_with_translation_in_language(\n action_type_id=action.type_id,\n language_id=user_language_id\n ).translation.object_name\n object_log_entries = object_log.get_object_log_entries(object_id=obj.id, user_id=flask_login.current_user.id)\n\n dataverse_enabled = bool(flask.current_app.config['DATAVERSE_URL'])\n if dataverse_enabled:\n dataverse_url = logic.dataverse_export.get_dataverse_url(obj.id)\n show_dataverse_export = not dataverse_url\n else:\n dataverse_url = None\n show_dataverse_export = False\n\n serializer = itsdangerous.URLSafeTimedSerializer(flask.current_app.config['SECRET_KEY'], salt='mobile-upload')\n token = serializer.dumps([flask_login.current_user.id, object_id])\n mobile_upload_url = flask.url_for('.mobile_file_upload', object_id=object_id, token=token, _external=True)\n mobile_upload_qrcode = generate_qrcode(mobile_upload_url, should_cache=False)\n object_url = flask.url_for('.object', object_id=object_id, _external=True)\n object_qrcode = generate_qrcode(object_url, should_cache=True)\n\n location_form = ObjectLocationAssignmentForm()\n locations_map, locations_tree = get_locations_tree()\n locations = [('-1', '—')]\n unvisited_location_ids_prefixes_and_subtrees = [(location_id, '', locations_tree[location_id]) for location_id in\n locations_tree]\n while unvisited_location_ids_prefixes_and_subtrees:\n location_id, prefix, subtree = unvisited_location_ids_prefixes_and_subtrees.pop(0)\n location = locations_map[location_id]\n locations.append(\n (str(location_id), '{}{} (#{})'.format(prefix, get_translated_text(location.name), location.id)))\n for location_id in sorted(subtree, key=lambda location_id: get_translated_text(locations_map[location_id].name),\n reverse=True):\n unvisited_location_ids_prefixes_and_subtrees.insert(\n 0, (location_id, f'{prefix}{get_translated_text(location.name)} / ', subtree[location_id])\n )\n\n location_form.location.choices = locations\n possible_responsible_users = [('-1', '—')]\n for user in logic.users.get_users(exclude_hidden=True):\n possible_responsible_users.append((str(user.id), '{} (#{})'.format(user.name, user.id)))\n location_form.responsible_user.choices = possible_responsible_users\n\n measurement_actions = logic.action_translations.get_actions_with_translation_in_language(user_language_id,\n models.ActionType.MEASUREMENT,\n use_fallback=True)\n favorite_action_ids = logic.favorites.get_user_favorite_action_ids(flask_login.current_user.id)\n favorite_measurement_actions = [\n action\n for action in measurement_actions\n if action.id in favorite_action_ids and not action.is_hidden\n ]\n # Sort by: instrument name (independent actions first), action name\n favorite_measurement_actions.sort(key=lambda action: (\n action.user.name.lower() if action.user else '',\n get_instrument_with_translation_in_language(action.instrument_id,\n user_language_id).translation.name.lower() if action.instrument else '',\n action.translation.name.lower()\n ))\n\n publication_form = ObjectPublicationForm()\n\n object_publications = logic.publications.get_publications_for_object(object_id=obj.id)\n user_may_link_publication = True\n\n notebook_templates = get_notebook_templates(\n object_id=obj.id,\n data=obj.data,\n schema=obj.schema,\n user_id=flask_login.current_user.id\n )\n\n linked_project = logic.projects.get_project_linked_to_object(object_id)\n\n object_languages = logic.languages.get_languages_in_object_data(obj.data)\n languages = []\n for lang_code in object_languages:\n languages.append(get_language_by_lang_code(lang_code))\n\n all_languages = get_languages()\n metadata_language = flask.request.args.get('language', None)\n if not any(\n language.lang_code == metadata_language\n for language in languages\n ):\n metadata_language = None\n\n view_kwargs = {\n \"template_mode\": \"inline_edit\",\n \"show_object_type_and_id_on_object_page_text\": get_user_settings(flask_login.current_user.id)[\"SHOW_OBJECT_TYPE_AND_ID_ON_OBJECT_PAGE\"],\n \"show_object_title\": get_user_settings(flask_login.current_user.id)[\"SHOW_OBJECT_TITLE\"],\n \"measurement_type_name\": logic.action_type_translations.get_action_type_translation_for_action_type_in_language(\n action_type_id=logic.actions.models.ActionType.MEASUREMENT,\n language_id=logic.languages.get_user_language(flask_login.current_user).id,\n use_fallback=True\n ).name,\n \"metadata_language\": metadata_language,\n \"languages\": languages,\n \"all_languages\": all_languages,\n \"SUPPORTED_LOCALES\": logic.locale.SUPPORTED_LOCALES,\n \"ENGLISH\": english,\n \"object_type\": object_type,\n \"action\": action,\n \"action_type\": get_action_type_with_translation_in_language(action.type_id, user_language_id),\n \"instrument\": instrument,\n \"schema\": obj.schema,\n \"data\": obj.data,\n \"object_log_entries\": object_log_entries,\n \"ObjectLogEntryType\": ObjectLogEntryType,\n \"last_edit_datetime\": obj.utc_datetime,\n \"last_edit_user\": get_user(obj.user_id),\n \"object_id\": object_id,\n \"user_may_edit\": True,\n \"user_may_comment\": True,\n \"comments\": comments.get_comments_for_object(object_id),\n \"comment_form\": CommentForm(),\n \"files\": logic.files.get_files_for_object(object_id),\n \"file_source_instrument_exists\": False,\n \"file_source_jupyterhub_exists\": False,\n \"file_form\": FileForm(),\n \"external_link_form\": ExternalLinkForm(),\n \"external_link_invalid\": 'invalid_link' in flask.request.args,\n \"mobile_upload_url\": mobile_upload_url,\n \"mobile_upload_qrcode\": mobile_upload_qrcode,\n \"notebook_templates\": notebook_templates,\n \"object_qrcode\": object_qrcode,\n \"object_url\": object_url,\n \"restore_form\": None,\n \"version_id\": obj.version_id,\n \"user_may_grant\": user_may_grant,\n \"favorite_measurement_actions\": favorite_measurement_actions,\n \"FileLogEntryType\": FileLogEntryType,\n \"file_information_form\": FileInformationForm(),\n \"file_hiding_form\": FileHidingForm(),\n \"new_schema_available\": new_schema_available,\n \"related_objects_tree\": related_objects_tree,\n \"object_publications\": object_publications,\n \"user_may_link_publication\": user_may_link_publication,\n \"user_may_use_as_template\": user_may_use_as_template,\n \"show_dataverse_export\": show_dataverse_export,\n \"dataverse_url\": dataverse_url,\n \"publication_form\": publication_form,\n \"get_object\": get_object,\n \"get_object_if_current_user_has_read_permissions\": get_object_if_current_user_has_read_permissions,\n \"get_object_location_assignment\": get_object_location_assignment,\n \"get_user\": get_user,\n \"get_location\": get_location,\n \"PAGE_SIZES\": PAGE_SIZES,\n \"HORIZONTAL_LABEL_MARGIN\": HORIZONTAL_LABEL_MARGIN,\n \"VERTICAL_LABEL_MARGIN\": VERTICAL_LABEL_MARGIN,\n \"mm\": mm,\n \"object_location_assignments\": get_object_location_assignments(object_id),\n \"build_object_location_assignment_confirmation_url\": build_object_location_assignment_confirmation_url,\n \"user_may_assign_location\": True,\n \"location_form\": location_form,\n \"project\": linked_project,\n \"get_project\": get_project_if_it_exists,\n \"get_action_type\": get_action_type,\n \"get_action_type_with_translation_in_language\": get_action_type_with_translation_in_language,\n \"get_instrument_with_translation_in_language\": get_instrument_with_translation_in_language\n }\n\n # form kwargs\n if action is not None and action.instrument is not None and flask_login.current_user in action.instrument.responsible_users:\n instrument_log_categories = logic.instrument_log_entries.get_instrument_log_categories(action.instrument.id)\n if 'create_instrument_log_entry' in flask.request.form:\n category_ids = []\n for category_id in flask.request.form.getlist('instrument_log_categories'):\n try:\n if int(category_id) in [category.id for category in instrument_log_categories]:\n category_ids.append(int(category_id))\n except Exception:\n pass\n\n errors = []\n object_errors = {}\n form_data = {}\n previous_actions = []\n serializer = itsdangerous.URLSafeSerializer(flask.current_app.config['SECRET_KEY'])\n form = ObjectForm()\n if flask.request.method != 'GET' and form.validate_on_submit():\n raw_form_data = {key: flask.request.form.getlist(key) for key in flask.request.form}\n form_data = {k: v[0] for k, v in raw_form_data.items()}\n if 'input_num_batch_objects' in form_data:\n try:\n num_objects_in_batch = int(form_data['input_num_batch_objects'])\n except ValueError:\n try:\n # The form allows notations like '1.2e1' for '12', however\n # Python can only parse these as floats\n num_objects_in_batch = float(form_data['input_num_batch_objects'])\n if num_objects_in_batch == int(num_objects_in_batch):\n num_objects_in_batch = int(num_objects_in_batch)\n else:\n raise\n except ValueError:\n errors.append('input_num_batch_objects')\n else:\n form_data['input_num_batch_objects'] = str(num_objects_in_batch)\n else:\n form_data['input_num_batch_objects'] = str(num_objects_in_batch)\n\n if 'previous_actions' in flask.request.form:\n try:\n previous_actions = serializer.loads(flask.request.form['previous_actions'])\n except itsdangerous.BadData:\n flask.abort(400)\n\n if not flask.current_app.config[\"LOAD_OBJECTS_IN_BACKGROUND\"]:\n referencable_objects = get_objects_with_permissions(\n user_id=flask_login.current_user.id,\n permissions=Permissions.READ\n )\n if object is not None:\n referencable_objects = [\n referencable_object\n for referencable_object in referencable_objects\n if referencable_object.object_id != object_id\n ]\n\n else:\n referencable_objects = []\n\n sorted_actions = get_sorted_actions_for_user(\n user_id=flask_login.current_user.id\n )\n for action in sorted_actions:\n db.session.expunge(action)\n\n action_type_id_by_action_id = {}\n for action_type in get_action_types():\n for action in get_actions(action_type.id):\n action_type_id_by_action_id[action.id] = action_type.id\n\n tags = [{'name': tag.name, 'uses': tag.uses} for tag in logic.tags.get_tags()]\n users = get_users(exclude_hidden=True)\n users.sort(key=lambda user: user.id)\n\n english = get_language(Language.ENGLISH)\n\n form_kwargs = {\n \"errors\": errors,\n \"object_errors\": object_errors,\n \"form_data\": form_data,\n \"previous_actions\": serializer.dumps(previous_actions),\n \"form\": form,\n \"referencable_objects\": referencable_objects,\n \"sorted_actions\": sorted_actions,\n \"action_type_id_by_action_id\": action_type_id_by_action_id,\n \"ActionType\": models.ActionType,\n \"datetime\": datetime,\n \"tags\": tags,\n \"users\": users,\n \"mode\": 'edit',\n \"languages\": get_languages(),\n \"ENGLISH\": english\n }\n\n kwargs = {**view_kwargs, **form_kwargs}\n\n return flask.render_template('objects/inline_edit/inline_edit_base.html', **kwargs)\n\n\ndef get_object_if_current_user_has_read_permissions(object_id):\n user_id = flask_login.current_user.id\n try:\n permissions = get_user_object_permissions(object_id, user_id)\n except ObjectDoesNotExistError:\n return None\n if Permissions.READ not in permissions:\n return None\n return get_object(object_id)\n\n\n@frontend.route('/objects/<int:object_id>', methods=['GET', 'POST'])\n@object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized)\ndef object(object_id):\n object = get_object(object_id=object_id)\n related_objects_tree = logic.object_relationships.build_related_objects_tree(object_id, flask_login.current_user.id)\n\n user_language_id = get_user_language(flask_login.current_user).id\n english = get_language(Language.ENGLISH)\n\n object_languages = set()\n user_permissions = get_user_object_permissions(object_id=object_id, user_id=flask_login.current_user.id)\n user_may_edit = Permissions.WRITE in user_permissions\n user_may_grant = Permissions.GRANT in user_permissions\n user_may_use_as_template = Permissions.READ in get_user_action_permissions(object.action_id, user_id=flask_login.current_user.id)\n\n action = get_action_with_translation_in_language(object.action_id, user_language_id, use_fallback=True)\n if action.schema != object.schema:\n new_schema_available = True\n else:\n new_schema_available = False\n if not user_may_edit and flask.request.args.get('mode', '') == 'edit':\n return flask.abort(403)\n if not user_may_edit and flask.request.args.get('mode', '') == 'upgrade':\n return flask.abort(403)\n if not flask.current_app.config['DISABLE_INLINE_EDIT']:\n if not user_may_edit and flask.request.args.get('mode', '') == 'inline_edit':\n return flask.abort(403)\n if user_may_edit and flask.request.method == 'GET' and flask.request.args.get('mode', '') in {'', 'inline_edit'}:\n return show_inline_edit(object, get_action(object.action_id))\n if flask.request.method == 'GET' and flask.request.args.get('mode', '') not in ('edit', 'upgrade'):\n instrument = get_instrument_with_translation_in_language(action.instrument_id, user_language_id) if action.instrument else None\n object_type = get_action_type_with_translation_in_language(\n action_type_id=action.type_id,\n language_id=user_language_id\n ).translation.object_name\n object_log_entries = object_log.get_object_log_entries(object_id=object_id, user_id=flask_login.current_user.id)\n\n dataverse_enabled = bool(flask.current_app.config['DATAVERSE_URL'])\n if dataverse_enabled:\n dataverse_url = logic.dataverse_export.get_dataverse_url(object_id)\n show_dataverse_export = user_may_grant and not dataverse_url\n else:\n dataverse_url = None\n show_dataverse_export = False\n\n if user_may_edit:\n serializer = itsdangerous.URLSafeTimedSerializer(flask.current_app.config['SECRET_KEY'], salt='mobile-upload')\n token = serializer.dumps([flask_login.current_user.id, object_id])\n mobile_upload_url = flask.url_for('.mobile_file_upload', object_id=object_id, token=token, _external=True)\n mobile_upload_qrcode = generate_qrcode(mobile_upload_url, should_cache=False)\n else:\n mobile_upload_url = None\n mobile_upload_qrcode = None\n\n object_url = flask.url_for('.object', object_id=object_id, _external=True)\n object_qrcode = generate_qrcode(object_url, should_cache=True)\n\n location_form = ObjectLocationAssignmentForm()\n locations_map, locations_tree = get_locations_tree()\n locations = [('-1', '—')]\n unvisited_location_ids_prefixes_and_subtrees = [(location_id, '', locations_tree[location_id]) for location_id in locations_tree]\n while unvisited_location_ids_prefixes_and_subtrees:\n location_id, prefix, subtree = unvisited_location_ids_prefixes_and_subtrees.pop(0)\n location = locations_map[location_id]\n locations.append((str(location_id), '{}{} (#{})'.format(prefix, get_translated_text(location.name), location.id)))\n for location_id in sorted(subtree, key=lambda location_id: get_translated_text(locations_map[location_id].name), reverse=True):\n unvisited_location_ids_prefixes_and_subtrees.insert(0, (location_id, '{}{} / '.format(prefix, get_translated_text(location.name)), subtree[location_id]))\n\n location_form.location.choices = locations\n possible_responsible_users = [('-1', '—')]\n for user in logic.users.get_users(exclude_hidden=True):\n possible_responsible_users.append((str(user.id), '{} (#{})'.format(user.name, user.id)))\n location_form.responsible_user.choices = possible_responsible_users\n\n measurement_actions = logic.action_translations.get_actions_with_translation_in_language(user_language_id, models.ActionType.MEASUREMENT, use_fallback=True)\n favorite_action_ids = logic.favorites.get_user_favorite_action_ids(flask_login.current_user.id)\n favorite_measurement_actions = [\n action\n for action in measurement_actions\n if action.id in favorite_action_ids and not action.is_hidden\n ]\n # Sort by: instrument name (independent actions first), action name\n favorite_measurement_actions.sort(key=lambda action: (\n action.user.name.lower() if action.user else '',\n get_instrument_with_translation_in_language(action.instrument_id, user_language_id).translation.name.lower() if action.instrument else '',\n action.translation.name.lower()\n ))\n\n publication_form = ObjectPublicationForm()\n\n object_publications = logic.publications.get_publications_for_object(object_id=object.id)\n user_may_link_publication = Permissions.WRITE in user_permissions\n\n notebook_templates = get_notebook_templates(\n object_id=object.id,\n data=object.data,\n schema=object.schema,\n user_id=flask_login.current_user.id\n )\n\n linked_project = logic.projects.get_project_linked_to_object(object_id)\n\n object_languages = logic.languages.get_languages_in_object_data(object.data)\n languages = []\n for lang_code in object_languages:\n languages.append(get_language_by_lang_code(lang_code))\n\n all_languages = get_languages()\n metadata_language = flask.request.args.get('language', None)\n if not any(\n language.lang_code == metadata_language\n for language in languages\n ):\n metadata_language = None\n return flask.render_template(\n 'objects/view/base.html',\n template_mode=\"view\",\n show_object_type_and_id_on_object_page_text=get_user_settings(flask_login.current_user.id)[\"SHOW_OBJECT_TYPE_AND_ID_ON_OBJECT_PAGE\"],\n show_object_title=get_user_settings(flask_login.current_user.id)[\"SHOW_OBJECT_TITLE\"],\n measurement_type_name=logic.action_type_translations.get_action_type_translation_for_action_type_in_language(\n action_type_id=logic.actions.models.ActionType.MEASUREMENT,\n language_id=logic.languages.get_user_language(flask_login.current_user).id,\n use_fallback=True\n ).name,\n metadata_language=metadata_language,\n languages=languages,\n all_languages=all_languages,\n SUPPORTED_LOCALES=logic.locale.SUPPORTED_LOCALES,\n ENGLISH=english,\n object_type=object_type,\n action=action,\n action_type=get_action_type_with_translation_in_language(action.type_id, user_language_id),\n instrument=instrument,\n schema=object.schema,\n data=object.data,\n object_log_entries=object_log_entries,\n ObjectLogEntryType=ObjectLogEntryType,\n last_edit_datetime=object.utc_datetime,\n last_edit_user=get_user(object.user_id),\n object_id=object_id,\n user_may_edit=user_may_edit,\n user_may_comment=user_may_edit,\n comments=comments.get_comments_for_object(object_id),\n comment_form=CommentForm(),\n files=logic.files.get_files_for_object(object_id),\n file_source_instrument_exists=False,\n file_source_jupyterhub_exists=False,\n file_form=FileForm(),\n external_link_form=ExternalLinkForm(),\n external_link_invalid='invalid_link' in flask.request.args,\n mobile_upload_url=mobile_upload_url,\n mobile_upload_qrcode=mobile_upload_qrcode,\n notebook_templates=notebook_templates,\n object_qrcode=object_qrcode,\n object_url=object_url,\n restore_form=None,\n version_id=object.version_id,\n user_may_grant=user_may_grant,\n favorite_measurement_actions=favorite_measurement_actions,\n FileLogEntryType=FileLogEntryType,\n file_information_form=FileInformationForm(),\n file_hiding_form=FileHidingForm(),\n new_schema_available=new_schema_available,\n related_objects_tree=related_objects_tree,\n object_publications=object_publications,\n user_may_link_publication=user_may_link_publication,\n user_may_use_as_template=user_may_use_as_template,\n show_dataverse_export=show_dataverse_export,\n dataverse_url=dataverse_url,\n publication_form=publication_form,\n get_object=get_object,\n get_object_if_current_user_has_read_permissions=get_object_if_current_user_has_read_permissions,\n get_object_location_assignment=get_object_location_assignment,\n get_user=get_user,\n get_location=get_location,\n PAGE_SIZES=PAGE_SIZES,\n HORIZONTAL_LABEL_MARGIN=HORIZONTAL_LABEL_MARGIN,\n VERTICAL_LABEL_MARGIN=VERTICAL_LABEL_MARGIN,\n mm=mm,\n object_location_assignments=get_object_location_assignments(object_id),\n build_object_location_assignment_confirmation_url=build_object_location_assignment_confirmation_url,\n user_may_assign_location=user_may_edit,\n location_form=location_form,\n project=linked_project,\n get_project=get_project_if_it_exists,\n get_action_type=get_action_type,\n get_action_type_with_translation_in_language=get_action_type_with_translation_in_language,\n get_instrument_with_translation_in_language=get_instrument_with_translation_in_language\n )\n check_current_user_is_not_readonly()\n if flask.request.args.get('mode', '') == 'upgrade':\n should_upgrade_schema = True\n else:\n should_upgrade_schema = False\n return show_object_form(object, action=get_action(object.action_id), should_upgrade_schema=should_upgrade_schema)\n\n\n@frontend.route('/objects/<int:object_id>/dc.rdf')\n@frontend.route('/objects/<int:object_id>/versions/<int:version_id>/dc.rdf')\n@object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized)\ndef object_rdf(object_id, version_id=None):\n rdf_xml = logic.rdf.generate_rdf(flask_login.current_user.id, object_id, version_id)\n return flask.Response(\n rdf_xml,\n mimetype='application/rdf+xml',\n )\n\n\n@frontend.route('/objects/<int:object_id>/label')\n@object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized)\ndef print_object_label(object_id):\n mode = flask.request.args.get('mode', 'mixed')\n if mode == 'fixed-width':\n create_mixed_labels = False\n create_long_labels = False\n include_qrcode_in_long_labels = None\n paper_format = flask.request.args.get('width-paper-format', '')\n if paper_format not in PAGE_SIZES:\n paper_format = DEFAULT_PAPER_FORMAT\n maximum_width = math.floor(PAGE_SIZES[paper_format][0] / mm - 2 * HORIZONTAL_LABEL_MARGIN)\n maximum_height = math.floor(PAGE_SIZES[paper_format][1] / mm - 2 * VERTICAL_LABEL_MARGIN)\n ghs_classes_side_by_side = 'side-by-side' in flask.request.args\n label_minimum_width = 20\n if ghs_classes_side_by_side:\n label_minimum_width = 40\n try:\n label_width = float(flask.request.args.get('label-width', '20'))\n except ValueError:\n label_width = 0\n if math.isnan(label_width):\n label_width = 0\n if label_width < label_minimum_width:\n label_width = label_minimum_width\n if label_width > maximum_width:\n label_width = maximum_width\n try:\n label_minimum_height = float(flask.request.args.get('label-minimum-height', '0'))\n except ValueError:\n label_minimum_height = 0\n if math.isnan(label_minimum_height):\n label_minimum_height = 0\n if label_minimum_height < 0:\n label_minimum_height = 0\n if label_minimum_height > maximum_height:\n label_minimum_height = maximum_height\n qrcode_width = 18\n centered = 'centered' in flask.request.args\n elif mode == 'minimum-height':\n create_mixed_labels = False\n create_long_labels = True\n paper_format = flask.request.args.get('height-paper-format', '')\n if paper_format not in PAGE_SIZES:\n paper_format = DEFAULT_PAPER_FORMAT\n maximum_width = math.floor(PAGE_SIZES[paper_format][0] / mm - 2 * HORIZONTAL_LABEL_MARGIN)\n include_qrcode_in_long_labels = 'include-qrcode' in flask.request.args\n label_width = 0\n label_minimum_height = 0\n try:\n label_minimum_width = float(flask.request.args.get('label-minimum-width', '0'))\n except ValueError:\n label_minimum_width = 0\n if math.isnan(label_minimum_width):\n label_minimum_width = 0\n if label_minimum_width < 0:\n label_minimum_width = 0\n if label_minimum_width > maximum_width:\n label_minimum_width = maximum_width\n qrcode_width = 0\n ghs_classes_side_by_side = None\n centered = None\n else:\n create_mixed_labels = True\n create_long_labels = None\n include_qrcode_in_long_labels = None\n paper_format = flask.request.args.get('mixed-paper-format', '')\n if paper_format not in PAGE_SIZES:\n paper_format = DEFAULT_PAPER_FORMAT\n label_width = 0\n label_minimum_height = 0\n qrcode_width = 0\n label_minimum_width = 0\n ghs_classes_side_by_side = None\n centered = None\n\n object = get_object(object_id=object_id)\n object_log_entries = object_log.get_object_log_entries(object_id=object_id, user_id=flask_login.current_user.id)\n for object_log_entry in object_log_entries:\n if object_log_entry.type in (ObjectLogEntryType.CREATE_OBJECT, ObjectLogEntryType.CREATE_BATCH):\n creation_date = object_log_entry.utc_datetime.strftime('%Y-%m-%d')\n creation_user = get_user(object_log_entry.user_id).name\n break\n else:\n creation_date = _('Unknown')\n creation_user = _('Unknown')\n if 'created' in object.data and '_type' in object.data['created'] and object.data['created']['_type'] == 'datetime':\n creation_date = object.data['created']['utc_datetime'].split(' ')[0]\n if 'name' in object.data and '_type' in object.data['name'] and object.data['name']['_type'] == 'text':\n object_name = get_translated_text(object.data['name']['text'])\n else:\n object_name = _('Unknown Object')\n\n object_url = flask.url_for('.object', object_id=object_id, _external=True)\n\n if 'hazards' in object.data and '_type' in object.data['hazards'] and object.data['hazards']['_type'] == 'hazards':\n hazards = object.data['hazards']['hazards']\n else:\n hazards = []\n\n pdf_data = create_labels(\n object_id=object_id,\n object_name=object_name,\n object_url=object_url,\n creation_user=creation_user,\n creation_date=creation_date,\n ghs_classes=hazards,\n paper_format=paper_format,\n create_mixed_labels=create_mixed_labels,\n create_long_labels=create_long_labels,\n include_qrcode_in_long_labels=include_qrcode_in_long_labels,\n label_width=label_width,\n label_minimum_height=label_minimum_height,\n label_minimum_width=label_minimum_width,\n qrcode_width=qrcode_width,\n ghs_classes_side_by_side=ghs_classes_side_by_side,\n centered=centered\n )\n return flask.send_file(\n io.BytesIO(pdf_data),\n mimetype='application/pdf',\n cache_timeout=-1\n )\n\n\n@frontend.route('/objects/<int:object_id>/comments/', methods=['POST'])\n@object_permissions_required(Permissions.WRITE)\ndef post_object_comments(object_id):\n check_current_user_is_not_readonly()\n comment_form = CommentForm()\n if comment_form.validate_on_submit():\n content = comment_form.content.data\n comments.create_comment(object_id=object_id, user_id=flask_login.current_user.id, content=content)\n flask.flash(_('Successfully posted a comment.'), 'success')\n else:\n flask.flash(_('Please enter a comment text.'), 'error')\n return flask.redirect(flask.url_for('.object', object_id=object_id))\n\n\n@frontend.route('/objects/search/')\n@flask_login.login_required\ndef search():\n actions = get_sorted_actions_for_user(\n user_id=flask_login.current_user.id\n )\n user_language_id = get_user_language(flask_login.current_user).id\n\n action_types = get_action_types_with_translations_in_language(user_language_id)\n search_paths = {}\n search_paths_by_action = {}\n search_paths_by_action_type = {}\n for action_type in action_types:\n search_paths_by_action_type[action_type.id] = {}\n for action in actions:\n search_paths_by_action[action.id] = {}\n if action.type_id not in search_paths_by_action_type:\n search_paths_by_action_type[action.type_id] = {}\n for property_path, property_type in logic.schemas.utils.get_property_paths_for_schema(\n schema=action.schema,\n valid_property_types={'text', 'bool', 'quantity', 'datetime'}\n ).items():\n property_path = '.'.join(\n key if key is not None else '?'\n for key in property_path\n )\n search_paths_by_action[action.id][property_path] = [property_type]\n if property_path not in search_paths_by_action_type[action.type_id]:\n search_paths_by_action_type[action.type_id][property_path] = [property_type]\n elif property_type not in search_paths_by_action_type[action.type_id][property_path]:\n search_paths_by_action_type[action.type_id][property_path].append(property_type)\n if property_path not in search_paths:\n search_paths[property_path] = [property_type]\n elif property_type not in search_paths[property_path]:\n search_paths[property_path].append(property_type)\n return flask.render_template(\n 'search.html',\n search_paths=search_paths,\n search_paths_by_action=search_paths_by_action,\n search_paths_by_action_type=search_paths_by_action_type,\n actions=actions,\n action_types=action_types,\n datetime=datetime\n ), 200, {\n 'Cache-Control': 'no-cache, no-store, must-revalidate',\n 'Pragma': 'no-cache',\n 'Expires': '0'\n }\n\n\n@frontend.route('/objects/referencable')\n@flask_login.login_required\ndef referencable_objects():\n required_perm = Permissions.READ\n if 'required_perm' in flask.request.args:\n try:\n required_perm = Permissions.from_name(flask.request.args['required_perm'])\n except ValueError:\n try:\n required_perm = Permissions(int(flask.request.args['required_perm']))\n except ValueError:\n return {\n \"message\": \"argument {} is not a valid permission.\".format(flask.request.args['required_perm'])\n }, 400\n\n referencable_objects = get_object_info_with_permissions(\n user_id=flask_login.current_user.id,\n permissions=required_perm,\n )\n\n def dictify(x):\n return {\n 'id': x.object_id,\n 'text': flask.escape('{} (#{})'.format(get_translated_text(x.name_json), x.object_id)),\n 'action_id': x.action_id,\n 'max_permission': x.max_permission,\n 'tags': [flask.escape(tag) for tag in x.tags['tags']] if x.tags and isinstance(x.tags, dict) and x.tags.get('_type') == 'tags' and x.tags.get('tags') else []\n }\n\n return {'referencable_objects': [dictify(x) for x in referencable_objects]}\n\n\n@frontend.route('/objects/<int:object_id>/permissions/request', methods=['POST'])\n@flask_login.login_required\ndef object_permissions_request(object_id):\n current_permissions = get_user_object_permissions(object_id=object_id, user_id=flask_login.current_user.id)\n if Permissions.READ in current_permissions:\n flask.flash(_('You already have permissions to access this object.'), 'error')\n return flask.redirect(flask.url_for('.object', object_id=object_id))\n request_object_permissions(flask_login.current_user.id, object_id)\n flask.flash(_('Your request for permissions has been sent.'), 'success')\n return flask.redirect(flask.url_for('.objects'))\n\n\n@frontend.route('/objects/<int:object_id>/locations/', methods=['POST'])\n@object_permissions_required(Permissions.WRITE)\ndef post_object_location(object_id):\n check_current_user_is_not_readonly()\n location_form = ObjectLocationAssignmentForm()\n location_form.location.choices = [('-1', '—')] + [\n (str(location.id), '{} (#{})'.format(location.name, location.id))\n for location in get_locations()\n ]\n possible_responsible_users = [('-1', '—')]\n for user in logic.users.get_users(exclude_hidden=True):\n possible_responsible_users.append((str(user.id), '{} (#{})'.format(user.name, user.id)))\n location_form.responsible_user.choices = possible_responsible_users\n if location_form.validate_on_submit():\n location_id = int(location_form.location.data)\n if location_id < 0:\n location_id = None\n responsible_user_id = int(location_form.responsible_user.data)\n if responsible_user_id < 0:\n responsible_user_id = None\n description = location_form.description.data\n try:\n description = json.loads(description)\n except Exception:\n description = {}\n valid_description = {'en': ''}\n for language_code, description_text in description.items():\n if not isinstance(language_code, str):\n continue\n try:\n language = get_language_by_lang_code(language_code)\n except logic.errors.LanguageDoesNotExistError:\n continue\n if not language.enabled_for_input:\n continue\n valid_description[language_code] = description_text\n description = valid_description\n if location_id is not None or responsible_user_id is not None:\n assign_location_to_object(object_id, location_id, responsible_user_id, flask_login.current_user.id, description)\n flask.flash(_('Successfully assigned a new location to this object.'), 'success')\n else:\n flask.flash(_('Please select a location or a responsible user.'), 'error')\n else:\n flask.flash(_('Please select a location or a responsible user.'), 'error')\n return flask.redirect(flask.url_for('.object', object_id=object_id))\n\n\n@frontend.route('/objects/<int:object_id>/publications/', methods=['POST'])\n@object_permissions_required(Permissions.WRITE)\ndef post_object_publication(object_id):\n check_current_user_is_not_readonly()\n publication_form = ObjectPublicationForm()\n if publication_form.validate_on_submit():\n doi = publication_form.doi.data\n title = publication_form.title.data\n object_name = publication_form.object_name.data\n if title is not None:\n title = title.strip()\n if not title:\n title = None\n if object_name is not None:\n object_name = object_name.strip()\n if not object_name:\n object_name = None\n existing_publication = ([\n publication\n for publication in logic.publications.get_publications_for_object(object_id)\n if publication.doi == doi\n ] or [None])[0]\n if existing_publication is not None and existing_publication.title == title and existing_publication.object_name == object_name:\n flask.flash(_('This object has already been linked to this publication.'), 'info')\n else:\n logic.publications.link_publication_to_object(user_id=flask_login.current_user.id, object_id=object_id, doi=doi, title=title, object_name=object_name)\n if existing_publication is None:\n flask.flash(_('Successfully linked this object to a publication.'), 'success')\n else:\n flask.flash(_('Successfully updated the information for this publication.'), 'success')\n else:\n flask.flash(_('Please enter a valid DOI for the publication you want to link this object to.'), 'error')\n return flask.redirect(flask.url_for('.object', object_id=object_id))\n\n\n@frontend.route('/objects/<int:object_id>/export')\n@object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized)\ndef export_data(object_id):\n object_ids = [object_id]\n file_extension = flask.request.args.get('format', '.pdf')\n if file_extension != '.pdf' and file_extension not in logic.export.FILE_FORMATS:\n return flask.abort(400)\n if 'object_ids' in flask.request.args:\n try:\n object_ids = json.loads(flask.request.args['object_ids'])\n object_ids = [int(i) for i in object_ids]\n if any((Permissions.READ not in get_user_object_permissions(i, flask_login.current_user.id)) for i in object_ids):\n return flask.abort(400)\n except Exception:\n return flask.abort(400)\n if not object_ids:\n return flask.abort(400)\n if file_extension == '.pdf':\n sections = pdfexport.SECTIONS\n if 'sections' in flask.request.args:\n try:\n sections = sections.intersection(json.loads(flask.request.args['sections']))\n except Exception:\n return flask.abort(400)\n if 'language' in flask.request.args:\n try:\n lang_code = flask.request.args['language']\n if lang_code not in logic.locale.SUPPORTED_LOCALES:\n raise ValueError()\n language = logic.languages.get_language_by_lang_code(lang_code)\n if not language.enabled_for_user_interface:\n raise ValueError()\n except Exception:\n lang_code = 'en'\n else:\n lang_code = 'en'\n pdf_data = pdfexport.create_pdfexport(object_ids, sections, lang_code)\n file_bytes = io.BytesIO(pdf_data)\n elif file_extension in logic.export.FILE_FORMATS:\n file_bytes = logic.export.FILE_FORMATS[file_extension][1](flask_login.current_user.id, object_ids=object_ids)\n else:\n file_bytes = None\n if file_bytes:\n return flask.Response(\n file_bytes,\n 200,\n headers={\n 'Content-Disposition': f'attachment; filename=sampledb_export{file_extension}',\n 'Content-Type': 'application/pdf' if file_extension == '.pdf' else logic.export.FILE_FORMATS[file_extension][2]\n }\n )\n return flask.abort(500)\n\n\n@frontend.route('/objects/<int:object_id>/files/')\n@object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized)\ndef object_files(object_id):\n files = logic.files.get_files_for_object(object_id)\n zip_bytes = io.BytesIO()\n with zipfile.ZipFile(zip_bytes, 'w') as zip_file:\n for file in files:\n if file.is_hidden:\n continue\n if file.storage in {'local', 'database'}:\n try:\n file_bytes = file.open(read_only=True).read()\n except Exception:\n pass\n else:\n zip_file.writestr(os.path.basename(file.original_file_name), file_bytes)\n return flask.Response(\n zip_bytes.getvalue(),\n 200,\n headers={\n 'Content-Type': 'application/zip',\n 'Content-Disposition': f'attachment; filename=object_{object_id}_files.zip'\n }\n )\n\n\n@frontend.route('/objects/<int:object_id>/files/<int:file_id>', methods=['GET'])\n@object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized)\ndef object_file(object_id, file_id):\n file = logic.files.get_file_for_object(object_id, file_id)\n if file is None:\n return flask.abort(404)\n if file.is_hidden:\n return flask.abort(403)\n if file.storage in ('local', 'database'):\n if 'preview' in flask.request.args:\n file_extension = os.path.splitext(file.original_file_name)[1]\n mime_type = flask.current_app.config.get('MIME_TYPES', {}).get(file_extension, None)\n if mime_type is not None:\n return flask.send_file(file.open(), mimetype=mime_type, last_modified=file.utc_datetime)\n return flask.send_file(file.open(), as_attachment=True, attachment_filename=file.original_file_name, last_modified=file.utc_datetime)\n # TODO: better error handling\n return flask.abort(404)\n\n\n@frontend.route('/objects/<int:object_id>/files/<int:file_id>', methods=['POST'])\n@object_permissions_required(Permissions.WRITE)\ndef update_file_information(object_id, file_id):\n check_current_user_is_not_readonly()\n form = FileInformationForm()\n if not form.validate_on_submit():\n return flask.abort(400)\n title = form.title.data\n description = form.description.data\n try:\n logic.files.update_file_information(\n object_id=object_id,\n file_id=file_id,\n user_id=flask_login.current_user.id,\n title=title,\n description=description\n )\n except logic.errors.FileDoesNotExistError:\n return flask.abort(404)\n return flask.redirect(flask.url_for('.object', object_id=object_id, _anchor='file-{}'.format(file_id)))\n\n\n@frontend.route('/objects/<int:object_id>/files/<int:file_id>/hide', methods=['POST'])\n@object_permissions_required(Permissions.WRITE)\ndef hide_file(object_id, file_id):\n check_current_user_is_not_readonly()\n form = FileHidingForm()\n if not form.validate_on_submit():\n return flask.abort(400)\n reason = form.reason.data\n try:\n logic.files.hide_file(\n object_id=object_id,\n file_id=file_id,\n user_id=flask_login.current_user.id,\n reason=reason\n )\n except logic.errors.FileDoesNotExistError:\n return flask.abort(404)\n flask.flash(_('The file was hidden successfully.'), 'success')\n return flask.redirect(flask.url_for('.object', object_id=object_id, _anchor='file-{}'.format(file_id)))\n\n\n@frontend.route('/objects/<int:object_id>/files/mobile_upload/<token>', methods=['GET'])\ndef mobile_file_upload(object_id: int, token: str):\n serializer = itsdangerous.URLSafeTimedSerializer(flask.current_app.config['SECRET_KEY'], salt='mobile-upload')\n try:\n user_id, object_id = serializer.loads(token, max_age=15 * 60)\n except itsdangerous.BadSignature:\n return flask.abort(400)\n try:\n user = logic.users.get_user(user_id)\n except UserDoesNotExistError:\n return flask.abort(403)\n if user.is_readonly:\n return flask.abort(403)\n return flask.render_template('mobile_upload.html')\n\n\n@frontend.route('/objects/<int:object_id>/files/mobile_upload/<token>', methods=['POST'])\ndef post_mobile_file_upload(object_id: int, token: str):\n serializer = itsdangerous.URLSafeTimedSerializer(flask.current_app.config['SECRET_KEY'], salt='mobile-upload')\n try:\n user_id, object_id = serializer.loads(token, max_age=15 * 60)\n except itsdangerous.BadSignature:\n return flask.abort(400)\n try:\n user = logic.users.get_user(user_id)\n except UserDoesNotExistError:\n return flask.abort(403)\n if user.is_readonly:\n return flask.abort(403)\n files = flask.request.files.getlist('file_input')\n if not files:\n return flask.redirect(\n flask.url_for(\n '.mobile_file_upload',\n object_id=object_id,\n token=token\n )\n )\n for file_storage in files:\n file_name = werkzeug.utils.secure_filename(file_storage.filename)\n logic.files.create_database_file(object_id, user_id, file_name, lambda stream: file_storage.save(dst=stream))\n return flask.render_template('mobile_upload_success.html')\n\n\n@frontend.route('/objects/<int:object_id>/files/', methods=['POST'])\n@object_permissions_required(Permissions.WRITE)\ndef post_object_files(object_id):\n check_current_user_is_not_readonly()\n external_link_form = ExternalLinkForm()\n file_form = FileForm()\n if file_form.validate_on_submit():\n file_source = file_form.file_source.data\n if file_source == 'local':\n files = flask.request.files.getlist(file_form.local_files.name)\n for file_storage in files:\n file_name = werkzeug.utils.secure_filename(file_storage.filename)\n logic.files.create_database_file(object_id, flask_login.current_user.id, file_name, lambda stream: file_storage.save(dst=stream))\n flask.flash(_('Successfully uploaded files.'), 'success')\n else:\n flask.flash(_('Failed to upload files.'), 'error')\n elif external_link_form.validate_on_submit():\n url = external_link_form.url.data\n logic.files.create_url_file(object_id, flask_login.current_user.id, url)\n flask.flash(_('Successfully posted link.'), 'success')\n elif external_link_form.errors:\n flask.flash(_('Failed to post link.'), 'error')\n return flask.redirect(flask.url_for('.object', object_id=object_id, invalid_link=True, _anchor='anchor-post-link'))\n else:\n flask.flash(_('Failed to upload files.'), 'error')\n return flask.redirect(flask.url_for('.object', object_id=object_id))\n\n\n@frontend.route('/objects/new', methods=['GET', 'POST'])\n@flask_login.login_required\ndef new_object():\n check_current_user_is_not_readonly()\n action_id = flask.request.args.get('action_id', None)\n previous_object_id = flask.request.args.get('previous_object_id', None)\n if not action_id and not previous_object_id:\n # TODO: handle error\n return flask.abort(404)\n\n sample_id = flask.request.args.get('sample_id', None)\n\n previous_object = None\n action = None\n if previous_object_id:\n try:\n previous_object = get_object(previous_object_id)\n except ObjectDoesNotExistError:\n flask.flash(_(\"This object does not exist.\"), 'error')\n return flask.abort(404)\n if Permissions.READ not in get_user_object_permissions(user_id=flask_login.current_user.id, object_id=previous_object_id):\n flask.flash(_(\"You do not have the required permissions to use this object as a template.\"), 'error')\n return flask.abort(403)\n if action_id:\n if action_id != str(previous_object.action_id):\n flask.flash(_(\"This object was created with a different action.\"), 'error')\n return flask.abort(400)\n else:\n action_id = previous_object.action_id\n if action_id:\n try:\n action = get_action(action_id)\n except ActionDoesNotExistError:\n flask.flash(_(\"This action does not exist.\"), 'error')\n return flask.abort(404)\n if Permissions.READ not in get_user_action_permissions(action_id, user_id=flask_login.current_user.id):\n flask.flash(_(\"You do not have the required permissions to use this action.\"), 'error')\n return flask.abort(403)\n\n placeholder_data = {}\n\n if sample_id is not None:\n try:\n sample_id = int(sample_id)\n except ValueError:\n sample_id = None\n else:\n if sample_id <= 0:\n sample_id = None\n if sample_id is not None:\n try:\n logic.objects.get_object(sample_id)\n except logic.errors.ObjectDoesNotExistError:\n sample_id = None\n if sample_id is not None:\n if action.schema.get('properties', {}).get('sample', {}).get('type', '') == 'sample':\n placeholder_data = {\n ('sample', ): {'_type': 'sample', 'object_id': sample_id}\n }\n\n # TODO: check instrument permissions\n return show_object_form(None, action, previous_object, placeholder_data=placeholder_data)\n\n\n@frontend.route('/objects/<int:object_id>/versions/')\n@object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized)\ndef object_versions(object_id):\n object = get_object(object_id=object_id)\n if object is None:\n return flask.abort(404)\n object_versions = get_object_versions(object_id=object_id)\n object_versions.sort(key=lambda object_version: -object_version.version_id)\n return flask.render_template('objects/object_versions.html', get_user=get_user, object=object, object_versions=object_versions)\n\n\n@frontend.route('/objects/<int:object_id>/versions/<int:version_id>')\n@object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized)\ndef object_version(object_id, version_id):\n user_language_id = logic.languages.get_user_language(flask_login.current_user).id\n english = get_language(Language.ENGLISH)\n object = get_object(object_id=object_id, version_id=version_id)\n form = None\n user_permissions = get_user_object_permissions(object_id=object_id, user_id=flask_login.current_user.id)\n if Permissions.WRITE in user_permissions:\n current_object = get_object(object_id=object_id)\n if current_object.version_id != version_id:\n form = ObjectVersionRestoreForm()\n user_may_grant = Permissions.GRANT in user_permissions\n action = get_action_with_translation_in_language(object.action_id, user_language_id, use_fallback=True)\n action_type = get_action_type_with_translation_in_language(action.type_id, user_language_id)\n instrument = get_instrument_with_translation_in_language(action.instrument_id, user_language_id) if action.instrument_id else None\n\n object_languages = logic.languages.get_languages_in_object_data(object.data)\n languages = []\n for lang_code in object_languages:\n languages.append(get_language_by_lang_code(lang_code))\n\n metadata_language = flask.request.args.get('language', None)\n if not any(\n language.lang_code == metadata_language\n for language in languages\n ):\n metadata_language = None\n return flask.render_template(\n 'objects/view/base.html',\n template_mode=\"view\",\n show_object_type_and_id_on_object_page_text=get_user_settings(flask_login.current_user.id)[\"SHOW_OBJECT_TYPE_AND_ID_ON_OBJECT_PAGE\"],\n show_object_title=get_user_settings(flask_login.current_user.id)[\"SHOW_OBJECT_TITLE\"],\n languages=languages,\n metadata_language=metadata_language,\n ENGLISH=english,\n is_archived=True,\n object_type=action_type.translation.object_name,\n action=action,\n action_type=action_type,\n instrument=instrument,\n schema=object.schema,\n data=object.data,\n last_edit_datetime=object.utc_datetime,\n last_edit_user=get_user(object.user_id),\n get_object_if_current_user_has_read_permissions=get_object_if_current_user_has_read_permissions,\n object_id=object_id,\n version_id=version_id,\n link_version_specific_rdf=True,\n restore_form=form,\n get_user=get_user,\n user_may_grant=user_may_grant,\n get_action_type=get_action_type,\n get_action_type_with_translation_in_language=get_action_type_with_translation_in_language,\n )\n\n\n@frontend.route('/objects/<int:object_id>/versions/<int:version_id>/restore', methods=['GET', 'POST'])\n@object_permissions_required(Permissions.WRITE)\ndef restore_object_version(object_id, version_id):\n if version_id < 0 or object_id < 0:\n return flask.abort(404)\n try:\n current_object = get_object(object_id=object_id)\n except ObjectDoesNotExistError:\n return flask.abort(404)\n if current_object.version_id <= version_id:\n return flask.abort(404)\n form = ObjectVersionRestoreForm()\n if form.validate_on_submit():\n logic.objects.restore_object_version(object_id=object_id, version_id=version_id, user_id=flask_login.current_user.id)\n return flask.redirect(flask.url_for('.object', object_id=object_id))\n return flask.render_template('objects/restore_object_version.html', object_id=object_id, version_id=version_id, restore_form=form)\n\n\n@frontend.route('/objects/<int:object_id>/permissions')\n@object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized)\ndef object_permissions(object_id):\n check_current_user_is_not_readonly()\n object = get_object(object_id)\n action = get_action(object.action_id)\n instrument = action.instrument\n user_permissions = get_object_permissions_for_users(object_id=object_id, include_instrument_responsible_users=False, include_groups=False, include_projects=False, include_readonly=False, include_admin_permissions=False)\n group_permissions = get_object_permissions_for_groups(object_id=object_id, include_projects=False)\n project_permissions = get_object_permissions_for_projects(object_id=object_id)\n public_permissions = Permissions.READ if object_is_public(object_id) else Permissions.NONE\n suggested_user_id = flask.request.args.get('add_user_id', '')\n try:\n suggested_user_id = int(suggested_user_id)\n except ValueError:\n suggested_user_id = None\n if Permissions.GRANT in get_user_object_permissions(object_id=object_id, user_id=flask_login.current_user.id):\n user_permission_form_data = []\n for user_id, permissions in user_permissions.items():\n if user_id is None:\n continue\n user_permission_form_data.append({'user_id': user_id, 'permissions': permissions.name.lower()})\n group_permission_form_data = []\n for group_id, permissions in group_permissions.items():\n if group_id is None:\n continue\n group_permission_form_data.append({'group_id': group_id, 'permissions': permissions.name.lower()})\n project_permission_form_data = []\n for project_id, permissions in project_permissions.items():\n if project_id is None:\n continue\n project_permission_form_data.append({'project_id': project_id, 'permissions': permissions.name.lower()})\n edit_user_permissions_form = ObjectPermissionsForm(public_permissions=public_permissions.name.lower(), user_permissions=user_permission_form_data, group_permissions=group_permission_form_data, project_permissions=project_permission_form_data)\n users = get_users(exclude_hidden=True)\n users = [user for user in users if user.id not in user_permissions]\n add_user_permissions_form = ObjectUserPermissionsForm()\n groups = get_user_groups(flask_login.current_user.id)\n groups = [group for group in groups if group.id not in group_permissions]\n add_group_permissions_form = ObjectGroupPermissionsForm()\n projects = get_user_projects(flask_login.current_user.id, include_groups=True)\n projects = [project for project in projects if project.id not in project_permissions]\n add_project_permissions_form = ObjectProjectPermissionsForm()\n copy_permissions_form = CopyPermissionsForm()\n if not flask.current_app.config[\"LOAD_OBJECTS_IN_BACKGROUND\"]:\n existing_objects = get_objects_with_permissions(\n user_id=flask_login.current_user.id,\n permissions=Permissions.GRANT\n )\n copy_permissions_form.object_id.choices = [\n (str(existing_object.id), existing_object.data['name']['text'])\n for existing_object in existing_objects\n if existing_object.id != object_id\n ]\n if len(copy_permissions_form.object_id.choices) == 0:\n copy_permissions_form = None\n else:\n copy_permissions_form.object_id.choices = []\n else:\n edit_user_permissions_form = None\n add_user_permissions_form = None\n add_group_permissions_form = None\n add_project_permissions_form = None\n copy_permissions_form = None\n users = []\n groups = []\n projects = []\n\n acceptable_project_ids = {\n project.id\n for project in projects\n }\n\n all_projects = logic.projects.get_projects()\n all_projects_by_id = {\n project.id: project\n for project in all_projects\n }\n\n if not flask.current_app.config['DISABLE_SUBPROJECTS']:\n project_id_hierarchy_list = logic.projects.get_project_id_hierarchy_list(list(all_projects_by_id))\n project_id_hierarchy_list = [\n (level, project_id, project_id in acceptable_project_ids)\n for level, project_id in project_id_hierarchy_list\n ]\n else:\n project_id_hierarchy_list = [\n (0, project.id, project.id in acceptable_project_ids)\n for project in sorted(all_projects, key=lambda project: project.id)\n ]\n return flask.render_template(\n 'objects/object_permissions.html',\n instrument=instrument,\n action=action,\n object=object,\n user_permissions=user_permissions,\n group_permissions=group_permissions,\n project_permissions=project_permissions,\n public_permissions=public_permissions,\n get_user=get_user,\n Permissions=Permissions,\n form=edit_user_permissions_form,\n users=users,\n groups=groups,\n projects_by_id=all_projects_by_id,\n project_id_hierarchy_list=project_id_hierarchy_list,\n show_projects_form=len(acceptable_project_ids) > 0,\n add_user_permissions_form=add_user_permissions_form,\n add_group_permissions_form=add_group_permissions_form,\n get_group=get_group,\n add_project_permissions_form=add_project_permissions_form,\n copy_permissions_form=copy_permissions_form,\n get_project=get_project,\n suggested_user_id=suggested_user_id\n )\n\n\n@frontend.route('/objects/<int:object_id>/permissions', methods=['POST'])\n@object_permissions_required(Permissions.GRANT)\ndef update_object_permissions(object_id):\n edit_user_permissions_form = ObjectPermissionsForm()\n add_user_permissions_form = ObjectUserPermissionsForm()\n add_group_permissions_form = ObjectGroupPermissionsForm()\n add_project_permissions_form = ObjectProjectPermissionsForm()\n copy_permissions_form = CopyPermissionsForm()\n if 'copy_permissions' in flask.request.form:\n if not flask.current_app.config[\"LOAD_OBJECTS_IN_BACKGROUND\"]:\n existing_objects = get_objects_with_permissions(\n user_id=flask_login.current_user.id,\n permissions=Permissions.GRANT\n )\n copy_permissions_form.object_id.choices = [\n (str(existing_object.id), existing_object.data['name']['text'])\n for existing_object in existing_objects\n if existing_object.id != object_id\n ]\n else:\n copy_permissions_form.object_id.choices = []\n if copy_permissions_form.validate_on_submit():\n logic.object_permissions.copy_permissions(object_id, int(copy_permissions_form.object_id.data))\n logic.object_permissions.set_user_object_permissions(object_id, flask_login.current_user.id, Permissions.GRANT)\n flask.flash(_(\"Successfully copied object permissions.\"), 'success')\n elif 'edit_user_permissions' in flask.request.form and edit_user_permissions_form.validate_on_submit():\n set_object_public(object_id, edit_user_permissions_form.public_permissions.data == 'read')\n for user_permissions_data in edit_user_permissions_form.user_permissions.data:\n user_id = user_permissions_data['user_id']\n try:\n get_user(user_id)\n except UserDoesNotExistError:\n continue\n permissions = Permissions.from_name(user_permissions_data['permissions'])\n set_user_object_permissions(object_id=object_id, user_id=user_id, permissions=permissions)\n for group_permissions_data in edit_user_permissions_form.group_permissions.data:\n group_id = group_permissions_data['group_id']\n try:\n get_group(group_id)\n except GroupDoesNotExistError:\n continue\n permissions = Permissions.from_name(group_permissions_data['permissions'])\n set_group_object_permissions(object_id=object_id, group_id=group_id, permissions=permissions)\n for project_permissions_data in edit_user_permissions_form.project_permissions.data:\n project_id = project_permissions_data['project_id']\n try:\n get_project(project_id)\n except ProjectDoesNotExistError:\n continue\n permissions = Permissions.from_name(project_permissions_data['permissions'])\n set_project_object_permissions(object_id=object_id, project_id=project_id, permissions=permissions)\n user_log.edit_object_permissions(user_id=flask_login.current_user.id, object_id=object_id)\n flask.flash(_(\"Successfully updated object permissions.\"), 'success')\n elif 'add_user_permissions' in flask.request.form and add_user_permissions_form.validate_on_submit():\n user_id = add_user_permissions_form.user_id.data\n permissions = Permissions.from_name(add_user_permissions_form.permissions.data)\n object_permissions = get_object_permissions_for_users(object_id=object_id, include_instrument_responsible_users=False, include_groups=False, include_projects=False, include_admin_permissions=False)\n assert permissions in [Permissions.READ, Permissions.WRITE, Permissions.GRANT]\n assert user_id not in object_permissions\n user_log.edit_object_permissions(user_id=flask_login.current_user.id, object_id=object_id)\n set_user_object_permissions(object_id=object_id, user_id=user_id, permissions=permissions)\n flask.flash(_(\"Successfully updated object permissions.\"), 'success')\n elif 'add_group_permissions' in flask.request.form and add_group_permissions_form.validate_on_submit():\n group_id = add_group_permissions_form.group_id.data\n permissions = Permissions.from_name(add_group_permissions_form.permissions.data)\n object_permissions = get_object_permissions_for_groups(object_id=object_id)\n assert permissions in [Permissions.READ, Permissions.WRITE, Permissions.GRANT]\n assert group_id not in object_permissions\n user_log.edit_object_permissions(user_id=flask_login.current_user.id, object_id=object_id)\n set_group_object_permissions(object_id=object_id, group_id=group_id, permissions=permissions)\n flask.flash(_(\"Successfully updated object permissions.\"), 'success')\n elif 'add_project_permissions' in flask.request.form and add_project_permissions_form.validate_on_submit():\n project_id = add_project_permissions_form.project_id.data\n permissions = Permissions.from_name(add_project_permissions_form.permissions.data)\n object_permissions = get_object_permissions_for_projects(object_id=object_id)\n assert permissions in [Permissions.READ, Permissions.WRITE, Permissions.GRANT]\n assert project_id not in object_permissions\n user_log.edit_object_permissions(user_id=flask_login.current_user.id, object_id=object_id)\n set_project_object_permissions(object_id=object_id, project_id=project_id, permissions=permissions)\n flask.flash(_(\"Successfully updated object permissions.\"), 'success')\n else:\n flask.flash(_(\"A problem occurred while changing the object permissions. Please try again.\"), 'error')\n return flask.redirect(flask.url_for('.object_permissions', object_id=object_id))\n"},"avg_line_length":{"kind":"number","value":47.4103225806,"string":"47.410323"},"max_line_length":{"kind":"number","value":405,"string":"405"},"alphanum_fraction":{"kind":"number","value":0.6649429823,"string":"0.664943"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"sciapp/sampledb"},"path":{"kind":"string","value":"sampledb/frontend/objects.py"},"size":{"kind":"number","value":110241,"string":"110,241"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8746,"cells":{"content":{"kind":"string","value":"from decimal import Decimal, ROUND_DOWN\nfrom time import time\n\n\ndef elapsed(t0=0.0):\n \"\"\"get elapsed time from the give time\n\n Returns:\n now: the absolute time now\n dt_str: elapsed time in string\n \"\"\"\n now = time()\n dt = now - t0\n dt_sec = Decimal(str(dt)).quantize(Decimal('.0001'), rounding=ROUND_DOWN)\n if dt_sec <= 1:\n dt_str = str(dt_sec) + ' second'\n else:\n dt_str = str(dt_sec) + ' seconds'\n return now, dt_str\n"},"avg_line_length":{"kind":"number","value":23.85,"string":"23.85"},"max_line_length":{"kind":"number","value":77,"string":"77"},"alphanum_fraction":{"kind":"number","value":0.6037735849,"string":"0.603774"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"mhdella/andes"},"path":{"kind":"string","value":"andes/utils/time.py"},"size":{"kind":"number","value":477,"string":"477"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8747,"cells":{"content":{"kind":"string","value":"_base_ = './fcn_r50-d8_512x1024_40k_cityscapes.py'\nmodel = dict(pretrained='open-mmlab://resnet101_v1c', backbone=dict(depth=101))\n"},"avg_line_length":{"kind":"number","value":43.6666666667,"string":"43.666667"},"max_line_length":{"kind":"number","value":79,"string":"79"},"alphanum_fraction":{"kind":"number","value":0.7786259542,"string":"0.778626"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"1171000410/mmsegmentation"},"path":{"kind":"string","value":"configs/fcn/fcn_r101-d8_512x1024_40k_cityscapes.py"},"size":{"kind":"number","value":131,"string":"131"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8748,"cells":{"content":{"kind":"string","value":"# Copyright 2019 Splunk, Inc.\n#\n# Use of this source code is governed by a BSD-2-clause-style\n# license that can be found in the LICENSE-BSD2 file or at\n# https://opensource.org/licenses/BSD-2-Clause\n\nfrom jinja2 import Environment\n\nfrom .sendmessage import *\nfrom .splunkutils import *\nfrom .timeutils import *\n\nimport pytest\n\nenv = Environment()\n\n# time format for Apr 5 22:51:54 2021\n# <187>{{ arubadate }} {{ host }} authmgr[4130]: <124198> <4130> <ERRS> <{{ host }} 10.10.10.10> {00:00:00:00:00:00-??} Missing server in attribute list, auth=VPN, utype=L3.\n# <187>{{ arubadate }} {{ host }} stm[4133]: <399803> <4133> <ERRS> <{{ host }} 10.10.10.10> An internal system error has occurred at file sapm_ap_mgmt.c function sapm_get_img_build_version_str line 11853 error stat /mswitch/sap/mips64.ari failed: No such file or directory.\n# <188>{{ arubadate }} {{ host }} wms[4096]: <126005> <4096> <WARN> <{{ host }} 10.10.10.10> |ids| Interfering AP: The system classified an access point (BSSID 00:0e:8e:96:f4:32 and SSID on CHANNEL 36) as interfering. Additional Info: Detector-AP-Name:00:0b:86:9e:6b:5f; Detector-AP-MAC:24:de:c6:70:2c:90; Detector-AP-Radio:1.\n# <191>{{ arubadate }} 10.10.10.10 dnsmasq: reading /etc/resolv.conf\n\ntestdata = [\n \"<187>{{ arubadate }} {{ host }} authmgr[4130]: <124198> <4130> <ERRS> <{{ host }} 10.10.10.10> {00:00:00:00:00:00-??} Missing server in attribute list, auth=VPN, utype=L3.\",\n \"<187>{{ arubadate }} {{ host }} stm[4133]: <399803> <4133> <ERRS> <{{ host }} 10.10.10.10> An internal system error has occurred at file sapm_ap_mgmt.c function sapm_get_img_build_version_str line 11853 error stat /mswitch/sap/mips64.ari failed: No such file or directory.\",\n \"<188>{{ arubadate }} {{ host }} wms[4096]: <126005> <4096> <WARN> <{{ host }} 10.10.10.10> |ids| Interfering AP: The system classified an access point (BSSID 00:0e:8e:96:f4:32 and SSID on CHANNEL 36) as interfering. Additional Info: Detector-AP-Name:00:0b:86:9e:6b:5f; Detector-AP-MAC:24:de:c6:70:2c:90; Detector-AP-Radio:1.\",\n \"<188>{{ arubadate }} {{ host }} sapd[1362]: <127037> <WARN> |AP 00:0b:86:eb:4e:32@10.10.10.10 sapd| |ids-ap| AP(04:bd:88:8a:3a:60): Station Associated to Rogue AP: An AP detected a client a4:8d:3b:ae:68:68 associated to a rogue access point (BSSID 98:1e:19:31:63:b6 and SSID MySpectrumWiFib0-2G on CHANNEL 11).\",\n]\n\n\n@pytest.mark.parametrize(\"event\", testdata)\ndef test_aruba(\n record_property, setup_wordlist, get_host_key, setup_splunk, setup_sc4s, event\n):\n host = get_host_key\n\n dt = datetime.datetime.now()\n iso, bsd, time, date, tzoffset, tzname, epoch = time_operations(dt)\n arubadate = dt.strftime(\"%b %d %H:%M:%S %Y\")\n\n # Tune time functions\n epoch = epoch[:-7]\n\n mt = env.from_string(event + \"\\n\")\n message = mt.render(mark=\"<188>\", bsd=bsd, host=host, arubadate=arubadate)\n\n sendsingle(message, setup_sc4s[0], setup_sc4s[1][514])\n\n st = env.from_string(\n 'search index=netops _time={{ epoch }} sourcetype=\"aruba:syslog\" host={{ host }}'\n )\n search = st.render(epoch=epoch, host=host)\n\n resultCount, eventCount = splunk_single(setup_splunk, search)\n\n record_property(\"host\", host)\n record_property(\"resultCount\", resultCount)\n record_property(\"message\", message)\n\n assert resultCount == 1\n"},"avg_line_length":{"kind":"number","value":54.2459016393,"string":"54.245902"},"max_line_length":{"kind":"number","value":332,"string":"332"},"alphanum_fraction":{"kind":"number","value":0.6860078574,"string":"0.686008"},"licenses":{"kind":"list like","value":["BSD-2-Clause","CC0-1.0"],"string":"[\n \"BSD-2-Clause\",\n \"CC0-1.0\"\n]"},"repository_name":{"kind":"string","value":"iainrose/splunk-connect-for-syslog"},"path":{"kind":"string","value":"tests/test_aruba.py"},"size":{"kind":"number","value":3309,"string":"3,309"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8749,"cells":{"content":{"kind":"string","value":"#!/usr/bin/env python\n\"\"\"Django's command-line utility for administrative tasks.\"\"\"\nimport os\nimport sys\n\n\ndef main():\n os.environ.setdefault('DJANGO_SETTINGS_MODULE', 'hackcrisis.settings')\n try:\n from django.core.management import execute_from_command_line\n except ImportError as exc:\n raise ImportError(\n \"Couldn't import Django. Are you sure it's installed and \"\n \"available on your PYTHONPATH environment variable? Did you \"\n \"forget to activate a virtual environment?\"\n ) from exc\n execute_from_command_line(sys.argv)\n\n\nif __name__ == '__main__':\n main()\n"},"avg_line_length":{"kind":"number","value":28.6363636364,"string":"28.636364"},"max_line_length":{"kind":"number","value":74,"string":"74"},"alphanum_fraction":{"kind":"number","value":0.6841269841,"string":"0.684127"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"jakubzadrozny/hackcrisis"},"path":{"kind":"string","value":"manage.py"},"size":{"kind":"number","value":630,"string":"630"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8750,"cells":{"content":{"kind":"string","value":"# This script fetches Atelier 801 translation file and adds the required IDs into our own translation files\n\nimport sys\nfrom urllib.request import urlopen\nimport zlib\nfrom string import Template\nimport json\n\nif len(sys.argv) < 2:\n\tprint(\"Please pass in lang code for first arguement\")\n\texit()\nlang = sys.argv[1]\nurl = 'https://www.transformice.com/langues/tfm-'+lang+'.gz'\n\n# Fetch file\nresponse = urlopen(url)\nfiledata = response.read()\nfiledata = zlib.decompress(filedata)\nfiledata = bytes.decode(filedata)\n\n# Parse file\nfiledata = filedata.split(\"\\n-\\n\")\ni18n = {}\nfor data in filedata:\n\tif(not data): continue\n\tkey,val = data.split(\"=\", 1)\n\ti18n[key] = val\n\n# Use data to do the actual thing this tool is for\n\ndef desc(key, arg1=None):\n\tif(arg1 != None):\n\t\treturn i18n[key].replace(\"%1\", arg1)\n\treturn i18n[key]\n\ntransKeys = [\n\t\"C_GuideSprirituel\",\n\t\"C_MaitresseDuVent\",\n\t\"C_Mecanicienne\",\n\t\"C_Sauvageonne\",\n\t\"C_Physicienne\",\n\n\t\"C_14\", \"C_14_T\",\n\t\"C_11\", \"C_11_T\",\n\t\"C_12\", \"C_12_T\",\n\t\"C_13\", \"C_13_T\",\n\t\"C_8\", \"C_8_T\",\n\t\"C_9\", \"C_9_T\",\n\t\"C_10\", \"C_10_T\",\n\t\"C_5\", \"C_5_T\",\n\t\"C_6\", \"C_6_T\",\n\t\"C_7\", \"C_7_T\",\n\t\"C_2\", \"C_2_T\",\n\t\"C_3\", \"C_3_T\",\n\t\"C_4\", \"C_4_T\",\n\t\"C_0\", \"C_0_T\",\n\t\"C_1\", \"C_1_T\",\n\t\"C_34\", \"C_34_T\",\n\t\"C_31\", \"C_31_T\",\n\t\"C_32\", \"C_32_T\",\n\t\"C_33\", \"C_33_T\",\n\t\"C_28\", \"C_28_T\",\n\t\"C_29\", \"C_29_T\",\n\t\"C_30\", \"C_30_T\",\n\t\"C_25\", \"C_25_T\",\n\t\"C_26\", \"C_26_T\",\n\t\"C_27\", \"C_27_T\",\n\t\"C_22\", \"C_22_T\",\n\t\"C_23\", \"C_23_T\",\n\t\"C_24\", \"C_24_T\",\n\t\"C_20\", \"C_20_T\",\n\t\"C_21\", \"C_21_T\",\n\t\"C_54\", \"C_54_T\",\n\t\"C_51\", \"C_51_T\",\n\t\"C_52\", \"C_52_T\",\n\t\"C_53\", \"C_53_T\",\n\t\"C_48\", \"C_48_T\",\n\t\"C_49\", \"C_49_T\",\n\t\"C_50\", \"C_50_T\",\n\t\"C_45\", \"C_45_T\",\n\t\"C_46\", \"C_46_T\",\n\t\"C_47\", \"C_47_T\",\n\t\"C_42\", \"C_42_T\",\n\t\"C_43\", \"C_43_T\",\n\t\"C_44\", \"C_44_T\",\n\t\"C_40\", \"C_40_T\",\n\t\"C_41\", \"C_41_T\",\n\t\"C_94\", \"C_94_T\",\n\t\"C_80\", \"C_80_T\",\n\t\"C_93\", \"C_93_T\",\n\t\"C_70\", \"C_70_T\",\n\t\"C_72\", \"C_72_T\",\n\t\"C_81\", \"C_81_T\",\n\t\"C_92\", \"C_92_T\",\n\t\"C_66\", \"C_66_T\",\n\t\"C_71\", \"C_71_T\",\n\t\"C_73\", \"C_73_T\",\n\t\"C_68\", \"C_68_T\",\n\t\"C_88\", \"C_88_T\",\n\t\"C_84\", \"C_84_T\",\n\t\"C_86\", \"C_86_T\",\n\t\"C_89\", \"C_89_T\",\n\t\"C_91\", \"C_91_T\",\n\t\"C_83\", \"C_83_T\",\n\t\"C_85\", \"C_85_T\",\n\t\"C_90\", \"C_90_T\",\n\t\"C_63\", \"C_63_T\",\n\t\"C_74\", \"C_74_T\",\n\t\"C_87\", \"C_87_T\",\n\t\"C_82\", \"C_82_T\",\n\t\"C_60\", \"C_60_T\",\n\t\"C_64\", \"C_64_T\",\n\t\"C_65\", \"C_65_T\",\n\t\"C_69\", \"C_69_T\",\n\t\"C_67\", \"C_67_T\",\n\t\"C_61\", \"C_61_T\",\n\t\"C_62\", \"C_62_T\",\n]\n\ni18nToWrite = {}\nfor key in transKeys:\n\ti18nToWrite[key] = i18n[key]\n\nwith open(lang+'.json', 'w') as outfile:\n\t# outfile.write(i18nToWrite)\n\tjson.dump(i18nToWrite, outfile, indent=4)"},"avg_line_length":{"kind":"number","value":20.0158730159,"string":"20.015873"},"max_line_length":{"kind":"number","value":107,"string":"107"},"alphanum_fraction":{"kind":"number","value":0.607850912,"string":"0.607851"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"fewfre/TransformiceSkillTreeBuilder"},"path":{"kind":"string","value":"i18n/_tfm_trans_to_skilldata.py"},"size":{"kind":"number","value":2522,"string":"2,522"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8751,"cells":{"content":{"kind":"string","value":"#!/usr/bin/env python\n__author__ = ('Duy Tin Truong (duytin.truong@unitn.it), '\n 'Aitor Blanco Miguez (aitor.blancomiguez@unitn.it)')\n__version__ = '3.0'\n__date__ = '21 Feb 2020'\n\nimport argparse as ap\nimport dendropy\nfrom io import StringIO\nimport re\nfrom collections import defaultdict\nimport matplotlib.colors as colors\nimport subprocess\n\n\ndef read_params():\n p = ap.ArgumentParser()\n p.add_argument('-t', '--ifn_tree',\n required=True,\n default=None,\n type=str,\n help='The input tree in newick format.')\n p.add_argument('-m', '--colorized_metadata',\n required=False,\n default='unset',\n type=str,\n help='The metadata field to colorize. Default \"unset\".')\n p.add_argument('--fig_size',\n required=False,\n default=8,\n type=float,\n help='The figure size. Default \"8\".')\n p.add_argument('--legend_marker_size',\n required=False,\n default=20,\n type=int,\n help='The legend marker size. Default \"20\".'\n )\n p.add_argument('--legend_font_size',\n required=False,\n default=10,\n type=int,\n help='The legend font size. Default \"10\".'\n )\n p.add_argument('--legend_marker_edge_width',\n required=False,\n default=0.2,\n type=float,\n help='The legend marker edge width. Default \"0.2\".'\n )\n p.add_argument('--leaf_marker_size',\n required=False,\n default=20,\n type=int,\n help='The legend marker size. Default \"20\".'\n )\n p.add_argument('--leaf_marker_edge_width',\n required=False,\n default=0.2,\n type=float,\n help='The legend marker edge width. Default \"0.2\".'\n )\n p.add_argument('--dpi',\n required=False,\n default=300,\n type=int,\n help='The figure dpi.')\n p.add_argument('--figure_extension',\n required=False,\n default='.png',\n type=str,\n help='The figure extension. Default \".png\".')\n p.add_argument('--ofn_prefix',\n required=False,\n default=None,\n type=str,\n help='The prefix of output files.')\n return p.parse_args()\n\ndef run(cmd):\n print (cmd)\n subprocess.call(cmd.split())\n\ndef main():\n args = read_params()\n tree = dendropy.Tree.get_from_path(args.ifn_tree, schema='newick',\n preserve_underscores=True)\n tree.reroot_at_midpoint()\n count = 0\n metadatas = set([])\n node2metadata = {}\n for node in tree.preorder_node_iter():\n nodestr = node.__getattribute__(\"taxon\").__str__().strip(\"'\")\n if node.is_leaf():\n if '.' in nodestr:\n nodestr = nodestr.replace('.',',')\n node.taxon = dendropy.Taxon(label=nodestr)\n substrs = re.findall(\n '%s-[a-zA-Z0-9.]*'%args.colorized_metadata,\n nodestr)\n if substrs:\n md = substrs[0].replace(args.colorized_metadata + '-', '')\n metadatas.add(md)\n node2metadata[nodestr] = md\n else:\n count += 1\n node.taxon = dendropy.Taxon(label='node_%d'%count)\n metadatas = sorted(list(metadatas))\n color_names = list(colors.cnames.keys())\n metadata2color = {}\n for i, md in enumerate(metadatas):\n metadata2color[md] = color_names[i % len(color_names)]\n\n if not args.ofn_prefix:\n args.ofn_prefix = args.ifn_tree\n ofn_tree = args.ofn_prefix + '.graphlantree'\n tree.write_to_path(ofn_tree, 'newick')\n ofn_annot = args.ofn_prefix + '.annot'\n with open(ofn_annot, 'w') as ofile:\n #ofile.write('clade_separation\\t0\\n')\n ofile.write('branch_bracket_width\\t0\\n')\n #ofile.write('clade_separation\\t0.15\\n')\n ofile.write('branch_bracket_depth\\t0\\n')\n #ofile.write('branch_thickness\\t1.25\\n')\n ofile.write('annotation_background_width\\t0\\n')\n\n # legend\n ofile.write('#legends\\n')\n ofile.write('class_legend_font_size\\t%d\\n'%args.legend_font_size)\n\n for md in metadata2color:\n ofile.write('%s\\tclade_marker_size\\t%d\\n'%(md, args.legend_marker_size))\n ofile.write('%s\\tclade_marker_color\\t%s\\n'%(md, metadata2color[md]))\n ofile.write('%s\\tclade_marker_edge_width\\t%f\\n'%(md, args.legend_marker_edge_width))\n\n # remove intermedate nodes\n for node in tree.preorder_node_iter():\n if not node.is_leaf():\n nodestr = node.__getattribute__(\"taxon\").__str__().strip(\"'\")\n ofile.write('%s\\tclade_marker_size\\t0\\n'%(nodestr))\n\n # colorize leaf nodes\n for node in tree.seed_node.leaf_nodes():\n nodestr = node.__getattribute__(\"taxon\").__str__().strip(\"'\")\n if nodestr in node2metadata:\n leaf_color = metadata2color[node2metadata[nodestr]]\n ofile.write('%s\\tclade_marker_size\\t%d\\n'%(nodestr, args.leaf_marker_size))\n ofile.write('%s\\tclade_marker_color\\t%s\\n'%(nodestr, leaf_color))\n ofile.write('%s\\tclade_marker_edge_width\\t%f\\n'%(nodestr, args.leaf_marker_edge_width))\n\n ofn_xml = args.ofn_prefix + '.xml'\n cmd = 'graphlan_annotate.py --annot %s %s %s'%(ofn_annot, ofn_tree, ofn_xml)\n run(cmd)\n\n ofn_fig = args.ofn_prefix + args.figure_extension\n cmd = 'graphlan.py %s %s --dpi %d --size %f'%(ofn_xml, ofn_fig, args.dpi, args.fig_size)\n run(cmd)\n\n print ('Output file: %s'%ofn_fig)\n\nif __name__ == '__main__':\n main()\n"},"avg_line_length":{"kind":"number","value":37.527607362,"string":"37.527607"},"max_line_length":{"kind":"number","value":103,"string":"103"},"alphanum_fraction":{"kind":"number","value":0.5425862351,"string":"0.542586"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"Adrian-Howard/MetaPhlAn"},"path":{"kind":"string","value":"metaphlan/utils/plot_tree_graphlan.py"},"size":{"kind":"number","value":6117,"string":"6,117"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8752,"cells":{"content":{"kind":"string","value":"from django.db import models\nfrom django.urls import reverse \nimport uuid # Required for unique book instances\n\n\nclass Genre(models.Model):\n \"\"\"\n Model representing a book genre (e.g. Science Fiction, Non Fiction).\n \"\"\"\n name = models.CharField(max_length=200, \n help_text=\"Enter a book genre (e.g. Science Fiction, French Poetry etc.)\")\n\n\n def __str__(self):\n \"\"\"\n String for representing the Model object (in Admin site etc.)\n \"\"\"\n return self.name\n\n\nclass Language(models.Model):\n \"\"\"\n Model representing a Language (e.g. Russian, English etc.)\n \"\"\"\n name = models.CharField(max_length=200, \n help_text=\"Enter a book language (e.g. Russian, English etc.)\")\n\n\n def __str__(self):\n \"\"\"\n String for representing the Model object (in Admin site etc.)\n \"\"\"\n return self.name\n\n\nclass Book(models.Model):\n \"\"\"\n Model representing a book (but not a specific copy of a book).\n \"\"\"\n title = models.CharField(max_length=200)\n author = models.ForeignKey('Author', on_delete=models.SET_NULL, null=True)\n # Foreign Key used because book can only have one author, but authors can have multiple books\n # Author as a string rather than object because it hasn't been declared yet in the file.\n summary = models.TextField(max_length=1000, help_text=\"Enter a brief description of the book\")\n isbn = models.CharField('ISBN',max_length=13, \n help_text='13 Character <a href=\"https://www.isbn-international.org/content/what-isbn\">ISBN number</a>')\n genre = models.ManyToManyField(Genre, help_text=\"Select a genre for this book\")\n # ManyToManyField used because genre can contain many books. Books can cover many genres.\n # Genre class has already been defined so we can specify the object above.\n language = models.ForeignKey('Language', on_delete=models.SET_NULL, null=True)\n\n\n def __str__(self):\n \"\"\"\n String for representing the Model object.\n \"\"\"\n return self.title\n\n\n def get_absolute_url(self):\n \"\"\"\n Returns the url to access a particular book instance.\n \"\"\"\n return reverse('book-detail', args=[str(self.id)])\n\n\nclass BookInstance(models.Model):\n \"\"\"\n Model representing a specific copy of a book (i.e. that can be borrowed from the library).\n \"\"\"\n id = models.UUIDField(primary_key=True, default=uuid.uuid4, help_text=\"Unique ID for this particular book across whole library\")\n book = models.ForeignKey('Book', on_delete=models.SET_NULL, null=True)\n imprint = models.CharField(max_length=200)\n due_back = models.DateField(null=True, blank=True)\n\n LOAN_STATUS = (\n ('m', 'Maintenance'),\n ('o', 'On loan'),\n ('a', 'Available'),\n ('r', 'Reserved'),\n )\n\n status = models.CharField(max_length=1, choices=LOAN_STATUS, blank=True, default='m', help_text='Book availability')\n\n\n class Meta:\n ordering = [\"due_back\"]\n\n\n def __str__(self):\n \"\"\"\n String for representing the Model object\n \"\"\"\n return '{0} ({1})'.format(self.id, self.book.title)\n\n\nclass Author(models.Model):\n \"\"\"\n Model representing an author.\n \"\"\"\n first_name = models.CharField(max_length=100)\n last_name = models.CharField(max_length=100)\n date_of_birth = models.DateField(null=True, blank=True)\n date_of_death = models.DateField('Died', null=True, blank=True)\n\n def get_absolute_url(self):\n \"\"\"\n Returns the url to access a particular author instance.\n \"\"\"\n return reverse('author-detail', args=[str(self.id)])\n\n\n def __str__(self):\n \"\"\"\n String for representing the Model object.\n \"\"\"\n return '{0} ({1})'.format(self.last_name, self.first_name)\n"},"avg_line_length":{"kind":"number","value":32.0847457627,"string":"32.084746"},"max_line_length":{"kind":"number","value":132,"string":"132"},"alphanum_fraction":{"kind":"number","value":0.6510829371,"string":"0.651083"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"zhekazuev/mozilla-django-learning"},"path":{"kind":"string","value":"src/locallibrary/catalog/models.py"},"size":{"kind":"number","value":3786,"string":"3,786"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8753,"cells":{"content":{"kind":"string","value":"# --------------\nimport pandas as pd\nimport numpy as np\nfrom sklearn.cross_validation import train_test_split\n# code starts here\ndf = pd.read_csv(path)\ndf.head()\nX = df[['ages','num_reviews','piece_count','play_star_rating','review_difficulty','star_rating','theme_name','val_star_rating','country']]\ny = df['list_price']\nX_train,X_test,y_train,y_test = train_test_split(X,y,random_state = 6, test_size = 0.3)\n# code ends here\n\n\n\n# --------------\nimport matplotlib.pyplot as plt\nimport pandas as pd\nimport numpy as np\nimport matplotlib.pyplot as plt\nimport seaborn as sns\nimport warnings\n# code starts here \n\ncols = X_train.columns\n#cols= list(X_train.columns.values)\n\n\nsns.pairplot(df)\n\n# code ends here\n\n\n\n# --------------\n# Code starts here\ncorr = X_train.corr()\nprint(corr)\nX_train.drop(['play_star_rating', 'val_star_rating'], axis = 1,inplace = True) \nX_test.drop(['play_star_rating', 'val_star_rating'], axis = 1,inplace = True)\n# Code ends here\n\n\n# --------------\nfrom sklearn.linear_model import LinearRegression\nfrom sklearn.metrics import mean_squared_error, r2_score\nimport math\n# Code starts here\nregressor = LinearRegression()\nregressor.fit(X_train,y_train)\ny_pred = regressor.predict(X_test)\n\ndef metrics(actual,pred):\n print('Mean Squared Error', mean_squared_error(actual,pred))\n print('R-Squared', r2_score(actual,pred))\nmetrics(y_test,y_pred)\nmse = 2106.7634311857673\nr2 = 0.7747160273433752\n# Code ends here\n\n\n# --------------\n# Code starts here\nresidual = y_test - y_pred\nplt.hist(residual)\n\n\n\n# Code ends here\n\n\n"},"avg_line_length":{"kind":"number","value":21.7042253521,"string":"21.704225"},"max_line_length":{"kind":"number","value":138,"string":"138"},"alphanum_fraction":{"kind":"number","value":0.720311486,"string":"0.720311"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"iamacityzen/ga-learner-dsmp-repo"},"path":{"kind":"string","value":"Making-first-prediction-using-linear-regression/code.py"},"size":{"kind":"number","value":1541,"string":"1,541"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8754,"cells":{"content":{"kind":"string","value":"from dgl.data import CoraGraphDataset, CiteseerGraphDataset, PubmedGraphDataset\n\ndef load(name):\n if name == 'cora':\n dataset = CoraGraphDataset()\n elif name == 'citeseer':\n dataset = CiteseerGraphDataset()\n elif name == 'pubmed':\n dataset = PubmedGraphDataset()\n\n graph = dataset[0]\n\n train_mask = graph.ndata.pop('train_mask')\n test_mask = graph.ndata.pop('test_mask')\n\n feat = graph.ndata.pop('feat')\n labels = graph.ndata.pop('label')\n\n return graph, feat, labels, train_mask, test_mask"},"avg_line_length":{"kind":"number","value":28.3157894737,"string":"28.315789"},"max_line_length":{"kind":"number","value":79,"string":"79"},"alphanum_fraction":{"kind":"number","value":0.6672862454,"string":"0.667286"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"905355494/dgl"},"path":{"kind":"string","value":"examples/pytorch/grace/dataset.py"},"size":{"kind":"number","value":538,"string":"538"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8755,"cells":{"content":{"kind":"string","value":"from enum import IntEnum\nfrom typing import Dict, Union, Callable, Any\n\nfrom cereal import log, car\nimport cereal.messaging as messaging\nfrom common.realtime import DT_CTRL\nfrom selfdrive.config import Conversions as CV\nfrom selfdrive.locationd.calibrationd import MIN_SPEED_FILTER\n\nAlertSize = log.ControlsState.AlertSize\nAlertStatus = log.ControlsState.AlertStatus\nVisualAlert = car.CarControl.HUDControl.VisualAlert\nAudibleAlert = car.CarControl.HUDControl.AudibleAlert\nEventName = car.CarEvent.EventName\n\n\n# Alert priorities\nclass Priority(IntEnum):\n LOWEST = 0\n LOWER = 1\n LOW = 2\n MID = 3\n HIGH = 4\n HIGHEST = 5\n\n\n# Event types\nclass ET:\n ENABLE = 'enable'\n PRE_ENABLE = 'preEnable'\n NO_ENTRY = 'noEntry'\n WARNING = 'warning'\n USER_DISABLE = 'userDisable'\n SOFT_DISABLE = 'softDisable'\n IMMEDIATE_DISABLE = 'immediateDisable'\n PERMANENT = 'permanent'\n\n\n# get event name from enum\nEVENT_NAME = {v: k for k, v in EventName.schema.enumerants.items()}\n\n\nclass Events:\n def __init__(self):\n self.events = []\n self.static_events = []\n self.events_prev = dict.fromkeys(EVENTS.keys(), 0)\n\n @property\n def names(self):\n return self.events\n\n def __len__(self):\n return len(self.events)\n\n def add(self, event_name, static=False):\n if static:\n self.static_events.append(event_name)\n self.events.append(event_name)\n\n def clear(self):\n self.events_prev = {k: (v + 1 if k in self.events else 0) for k, v in self.events_prev.items()}\n self.events = self.static_events.copy()\n\n def any(self, event_type):\n for e in self.events:\n if event_type in EVENTS.get(e, {}).keys():\n return True\n return False\n\n def create_alerts(self, event_types, callback_args=None):\n if callback_args is None:\n callback_args = []\n\n ret = []\n for e in self.events:\n types = EVENTS[e].keys()\n for et in event_types:\n if et in types:\n alert = EVENTS[e][et]\n if not isinstance(alert, Alert):\n alert = alert(*callback_args)\n\n if DT_CTRL * (self.events_prev[e] + 1) >= alert.creation_delay:\n alert.alert_type = f\"{EVENT_NAME[e]}/{et}\"\n alert.event_type = et\n ret.append(alert)\n return ret\n\n def add_from_msg(self, events):\n for e in events:\n self.events.append(e.name.raw)\n\n def to_msg(self):\n ret = []\n for event_name in self.events:\n event = car.CarEvent.new_message()\n event.name = event_name\n for event_type in EVENTS.get(event_name, {}).keys():\n setattr(event, event_type, True)\n ret.append(event)\n return ret\n\n\nclass Alert:\n def __init__(self,\n alert_text_1: str,\n alert_text_2: str,\n alert_status: log.ControlsState.AlertStatus,\n alert_size: log.ControlsState.AlertSize,\n alert_priority: Priority,\n visual_alert: car.CarControl.HUDControl.VisualAlert,\n audible_alert: car.CarControl.HUDControl.AudibleAlert,\n duration_sound: float,\n duration_hud_alert: float,\n duration_text: float,\n alert_rate: float = 0.,\n creation_delay: float = 0.):\n\n self.alert_text_1 = alert_text_1\n self.alert_text_2 = alert_text_2\n self.alert_status = alert_status\n self.alert_size = alert_size\n self.alert_priority = alert_priority\n self.visual_alert = visual_alert\n self.audible_alert = audible_alert\n\n self.duration_sound = duration_sound\n self.duration_hud_alert = duration_hud_alert\n self.duration_text = duration_text\n\n self.alert_rate = alert_rate\n self.creation_delay = creation_delay\n\n self.start_time = 0.\n self.alert_type = \"\"\n self.event_type = None\n\n def __str__(self) -> str:\n return f\"{self.alert_text_1}/{self.alert_text_2} {self.alert_priority} {self.visual_alert} {self.audible_alert}\"\n\n def __gt__(self, alert2) -> bool:\n return self.alert_priority > alert2.alert_priority\n\n\nclass NoEntryAlert(Alert):\n def __init__(self, alert_text_2, audible_alert=AudibleAlert.chimeError,\n visual_alert=VisualAlert.none, duration_hud_alert=2.):\n super().__init__(\"오픈파일럿 사용불가\", alert_text_2, AlertStatus.normal,\n AlertSize.mid, Priority.LOW, visual_alert,\n audible_alert, .4, duration_hud_alert, 3.)\n\n\nclass SoftDisableAlert(Alert):\n def __init__(self, alert_text_2):\n super().__init__(\"핸들을 즉시 잡아주세요\", alert_text_2,\n AlertStatus.userPrompt, AlertSize.full,\n Priority.MID, VisualAlert.steerRequired,\n AudibleAlert.chimeError, .1, 2., 2.),\n\n\nclass ImmediateDisableAlert(Alert):\n def __init__(self, alert_text_2, alert_text_1=\"핸들을 즉시 잡아주세요\"):\n super().__init__(alert_text_1, alert_text_2,\n AlertStatus.critical, AlertSize.full,\n Priority.HIGHEST, VisualAlert.steerRequired,\n AudibleAlert.chimeWarningRepeat, 2.2, 3., 4.),\n\n\nclass EngagementAlert(Alert):\n def __init__(self, audible_alert=True):\n super().__init__(\"\", \"\",\n AlertStatus.normal, AlertSize.none,\n Priority.MID, VisualAlert.none,\n audible_alert, .2, 0., 0.),\n\n\nclass NormalPermanentAlert(Alert):\n def __init__(self, alert_text_1: str, alert_text_2: str, duration_text: float = 0.2):\n super().__init__(alert_text_1, alert_text_2,\n AlertStatus.normal, AlertSize.mid if len(alert_text_2) else AlertSize.small,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., duration_text),\n\n\n# ********** alert callback functions **********\ndef below_steer_speed_alert(CP: car.CarParams, sm: messaging.SubMaster, metric: bool) -> Alert:\n speed = int(round(CP.minSteerSpeed * (CV.MS_TO_KPH if metric else CV.MS_TO_MPH)))\n unit = \"km/h\" if metric else \"mph\"\n return Alert(\n \"핸들을 잡아주세요\",\n \"%d %s 이상의 속도에서 자동조향됩니다\" % (speed, unit),\n AlertStatus.userPrompt, AlertSize.mid,\n Priority.MID, VisualAlert.steerRequired, AudibleAlert.none, 0., 0.4, .3)\n\n\ndef calibration_incomplete_alert(CP: car.CarParams, sm: messaging.SubMaster, metric: bool) -> Alert:\n speed = int(MIN_SPEED_FILTER * (CV.MS_TO_KPH if metric else CV.MS_TO_MPH))\n unit = \"km/h\" if metric else \"mph\"\n return Alert(\n \"캘리브레이션 진행중입니다 : %d%%\" % sm['liveCalibration'].calPerc,\n \"속도를 %d %s 이상으로 주행해주세요\" % (speed, unit),\n AlertStatus.normal, AlertSize.mid,\n Priority.LOWEST, VisualAlert.none, AudibleAlert.none, 0., 0., .2)\n\n\ndef no_gps_alert(CP: car.CarParams, sm: messaging.SubMaster, metric: bool) -> Alert:\n gps_integrated = sm['pandaState'].pandaType in [log.PandaState.PandaType.uno, log.PandaState.PandaType.dos]\n return Alert(\n \"GPS 수신불량\",\n \"GPS 연결상태 및 안테나를 점검하세요\" if gps_integrated else \"GPS 안테나를 점검하세요\",\n AlertStatus.normal, AlertSize.mid,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2, creation_delay=300.)\n\n\ndef wrong_car_mode_alert(CP: car.CarParams, sm: messaging.SubMaster, metric: bool) -> Alert:\n text = \"크루즈 비활성상태\"\n if CP.carName == \"honda\":\n text = \"메인 스위치 OFF\"\n return NoEntryAlert(text, duration_hud_alert=0.)\n\n\ndef startup_fuzzy_fingerprint_alert(CP: car.CarParams, sm: messaging.SubMaster, metric: bool) -> Alert:\n return Alert(\n \"WARNING: No Exact Match on Car Model\",\n f\"Closest Match: {CP.carFingerprint.title()[:40]}\",\n AlertStatus.userPrompt, AlertSize.mid,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., 15.)\n\ndef auto_lane_change_alert(CP: car.CarParams, sm: messaging.SubMaster, metric: bool) -> Alert:\n alc_timer = sm['lateralPlan'].autoLaneChangeTimer\n return Alert(\n \"자동차선변경이 %d초 뒤에 시작됩니다\" % alc_timer,\n \"차선의 차량을 확인하세요\",\n AlertStatus.normal, AlertSize.mid,\n Priority.LOWER, VisualAlert.steerRequired, AudibleAlert.none, 0., .1, .1, alert_rate=0.75)\n\n\ndef joystick_alert(CP: car.CarParams, sm: messaging.SubMaster, metric: bool) -> Alert:\n axes = sm['testJoystick'].axes\n gb, steer = list(axes)[:2] if len(axes) else (0., 0.)\n return Alert(\n \"Joystick Mode\",\n f\"Gas: {round(gb * 100.)}%, Steer: {round(steer * 100.)}%\",\n AlertStatus.normal, AlertSize.mid,\n Priority.LOW, VisualAlert.none, AudibleAlert.none, 0., 0., .1)\n\n\nEVENTS: Dict[int, Dict[str, Union[Alert, Callable[[Any, messaging.SubMaster, bool], Alert]]]] = {\n # ********** events with no alerts **********\n\n # ********** events only containing alerts displayed in all states **********\n\n EventName.joystickDebug: {\n ET.WARNING: joystick_alert,\n ET.PERMANENT: Alert(\n \"조이스틱 모드\",\n \"\",\n AlertStatus.normal, AlertSize.small,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., 0.1),\n },\n\n EventName.controlsInitializing: {\n ET.NO_ENTRY: NoEntryAlert(\"Controls Initializing\"),\n },\n\n EventName.startup: {\n ET.PERMANENT: Alert(\n \"오픈파일럿 사용준비 완료\",\n \"항상 핸들을 잡고 도로를 주시하세요\",\n AlertStatus.normal, AlertSize.mid,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., 3.),\n },\n\n EventName.startupMaster: {\n ET.PERMANENT: Alert(\n \"오픈파일럿 사용준비 완료\",\n \"항상 핸들을 잡고 도로를 주시하세요\",\n AlertStatus.userPrompt, AlertSize.mid,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., 3.),\n },\n\n # Car is recognized, but marked as dashcam only\n EventName.startupNoControl: {\n ET.PERMANENT: Alert(\n \"대시캠 모드\",\n \"항상 핸들을 잡고 도로를 주시하세요\",\n AlertStatus.normal, AlertSize.mid,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., 15.),\n },\n\n # Car is not recognized\n EventName.startupNoCar: {\n ET.PERMANENT: Alert(\n \"대시캠 모드 : 호환되지않는 차량\",\n \"항상 핸들을 잡고 도로를 주시하세요\",\n AlertStatus.normal, AlertSize.mid,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., 15.),\n },\n\n # openpilot uses the version strings from various ECUs to detect the correct car model.\n # Usually all ECUs are recognized and an exact match to a car model can be made. Sometimes\n # one or two ECUs have unrecognized versions, but the others are present in the database.\n # If openpilot is confident about the match to a car model, it fingerprints anyway.\n # In this case an alert is thrown since there is a small chance the wrong car was detected\n # and the user should pay extra attention.\n # This alert can be prevented by adding all ECU firmware version to openpilot:\n # https://github.com/commaai/openpilot/wiki/Fingerprinting\n EventName.startupFuzzyFingerprint: {\n ET.PERMANENT: startup_fuzzy_fingerprint_alert,\n },\n\n EventName.startupNoFw: {\n ET.PERMANENT: Alert(\n \"차량 인식 불가\",\n \"모든 연결을 확인해 보세요\",\n AlertStatus.userPrompt, AlertSize.mid,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., 15.),\n },\n\n EventName.dashcamMode: {\n ET.PERMANENT: Alert(\n \"대시캠 모드\",\n \"\",\n AlertStatus.normal, AlertSize.small,\n Priority.LOWEST, VisualAlert.none, AudibleAlert.none, 0., 0., .2),\n },\n\n EventName.invalidLkasSetting: {\n ET.PERMANENT: Alert(\n \"차량 LKAS 버튼 상태확인\",\n \"차량 LKAS 버튼 OFF후 활성화됩니다\",\n AlertStatus.normal, AlertSize.mid,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2),\n },\n\n # Some features or cars are marked as community features. If openpilot\n # detects the use of a community feature it switches to dashcam mode\n # until these features are allowed using a toggle in settings.\n EventName.communityFeatureDisallowed: {\n # LOW priority to overcome Cruise Error\n ET.PERMANENT: Alert(\n \"커뮤니티 기능 감지됨\",\n \"개발자설정에서 커뮤니티 기능을 활성화해주세요\",\n AlertStatus.normal, AlertSize.mid,\n Priority.LOW, VisualAlert.none, AudibleAlert.none, 0., 0., .2),\n },\n\n # openpilot doesn't recognize the car. This switches openpilot into a\n # read-only mode. This can be solved by adding your fingerprint.\n # See https://github.com/commaai/openpilot/wiki/Fingerprinting for more information\n EventName.carUnrecognized: {\n ET.PERMANENT: Alert(\n \"대시캠 모드\",\n \"차량인식 불가 - 핑거프린트를 확인하세요\",\n AlertStatus.normal, AlertSize.mid,\n Priority.LOWEST, VisualAlert.none, AudibleAlert.none, 0., 0., .2),\n },\n\n EventName.stockAeb: {\n ET.PERMANENT: Alert(\n \"브레이크!\",\n \"추돌 위험\",\n AlertStatus.critical, AlertSize.full,\n Priority.HIGHEST, VisualAlert.fcw, AudibleAlert.none, 1., 2., 2.),\n ET.NO_ENTRY: NoEntryAlert(\"Stock AEB: Risk of Collision\"),\n },\n\n EventName.stockFcw: {\n ET.PERMANENT: Alert(\n \"브레이크!\",\n \"추돌 위험\",\n AlertStatus.critical, AlertSize.full,\n Priority.HIGHEST, VisualAlert.fcw, AudibleAlert.none, 1., 2., 2.),\n ET.NO_ENTRY: NoEntryAlert(\"Stock FCW: Risk of Collision\"),\n },\n\n EventName.fcw: {\n ET.PERMANENT: Alert(\n \"브레이크!\",\n \"추돌 위험\",\n AlertStatus.critical, AlertSize.full,\n Priority.HIGHEST, VisualAlert.fcw, AudibleAlert.chimeWarningRepeat, 1., 2., 2.),\n },\n\n EventName.ldw: {\n ET.PERMANENT: Alert(\n \"핸들을 잡아주세요\",\n \"차선이탈 감지됨\",\n AlertStatus.userPrompt, AlertSize.mid,\n Priority.LOW, VisualAlert.ldw, AudibleAlert.chimePrompt, 1., 2., 3.),\n },\n\n # ********** events only containing alerts that display while engaged **********\n\n EventName.gasPressed: {\n ET.PRE_ENABLE: Alert(\n \"가속패달감지시 오픈파일럿은 브레이크를 사용하지않습니다\",\n \"\",\n AlertStatus.normal, AlertSize.small,\n Priority.LOWEST, VisualAlert.none, AudibleAlert.none, .0, .0, .1, creation_delay=1.),\n },\n\n # openpilot tries to learn certain parameters about your car by observing\n # how the car behaves to steering inputs from both human and openpilot driving.\n # This includes:\n # - steer ratio: gear ratio of the steering rack. Steering angle divided by tire angle\n # - tire stiffness: how much grip your tires have\n # - angle offset: most steering angle sensors are offset and measure a non zero angle when driving straight\n # This alert is thrown when any of these values exceed a sanity check. This can be caused by\n # bad alignment or bad sensor data. If this happens consistently consider creating an issue on GitHub\n EventName.vehicleModelInvalid: {\n ET.NO_ENTRY: NoEntryAlert(\"Vehicle Parameter Identification Failed\"),\n ET.SOFT_DISABLE: SoftDisableAlert(\"Vehicle Parameter Identification Failed\"),\n ET.WARNING: Alert(\n \"차량 매개변수 식별 오류\",\n \"\",\n AlertStatus.normal, AlertSize.small,\n Priority.LOWEST, VisualAlert.steerRequired, AudibleAlert.none, .0, .0, .1),\n },\n\n EventName.steerTempUnavailableUserOverride: {\n ET.WARNING: Alert(\n \"핸들을 잡아주세요\",\n \"조향제어 일시적으로 사용불가\",\n AlertStatus.userPrompt, AlertSize.small,\n Priority.LOW, VisualAlert.steerRequired, AudibleAlert.chimePrompt, 1., 1., 1.),\n },\n\n EventName.preDriverDistracted: {\n ET.WARNING: Alert(\n \"도로를 주시하세요 : 운전자 도로주시 불안\",\n \"\",\n AlertStatus.normal, AlertSize.small,\n Priority.LOW, VisualAlert.steerRequired, AudibleAlert.none, .0, .1, .1),\n },\n\n EventName.promptDriverDistracted: {\n ET.WARNING: Alert(\n \"도로를 주시하세요\",\n \"운전자 도로주시 불안\",\n AlertStatus.userPrompt, AlertSize.mid,\n Priority.MID, VisualAlert.steerRequired, AudibleAlert.chimeWarning2Repeat, .1, .1, .1),\n },\n\n EventName.driverDistracted: {\n ET.WARNING: Alert(\n \"조향제어가 강제로 해제됩니다\",\n \"운전자 도로주시 불안\",\n AlertStatus.critical, AlertSize.full,\n Priority.HIGH, VisualAlert.steerRequired, AudibleAlert.chimeWarningRepeat, .1, .1, .1),\n },\n\n EventName.preDriverUnresponsive: {\n ET.WARNING: Alert(\n \"핸들을 잡아주세요 : 운전자 인식 불가\",\n \"\",\n AlertStatus.normal, AlertSize.small,\n Priority.LOW, VisualAlert.steerRequired, AudibleAlert.none, .0, .1, .1, alert_rate=0.75),\n },\n\n EventName.promptDriverUnresponsive: {\n ET.WARNING: Alert(\n \"핸들을 잡아주세요\",\n \"운전자 응답하지않음\",\n AlertStatus.userPrompt, AlertSize.mid,\n Priority.MID, VisualAlert.steerRequired, AudibleAlert.chimeWarning2Repeat, .1, .1, .1),\n },\n\n EventName.driverUnresponsive: {\n ET.WARNING: Alert(\n \"조향제어가 강제로 해제됩니다\",\n \"운전자 응답하지않음\",\n AlertStatus.critical, AlertSize.full,\n Priority.HIGH, VisualAlert.steerRequired, AudibleAlert.chimeWarningRepeat, .1, .1, .1),\n },\n\n EventName.manualRestart: {\n ET.WARNING: Alert(\n \"핸들을 잡아주세요\",\n \"수동으로 재활성화하세요\",\n AlertStatus.userPrompt, AlertSize.mid,\n Priority.LOW, VisualAlert.none, AudibleAlert.none, 0., 0., .2),\n },\n\n EventName.resumeRequired: {\n ET.WARNING: Alert(\n \"앞차량 멈춤\",\n \"앞차가 출발하면 자동 재출발\",\n AlertStatus.userPrompt, AlertSize.mid,\n Priority.LOW, VisualAlert.none, AudibleAlert.none, 0., 0., .2),\n },\n\n EventName.belowSteerSpeed: {\n ET.WARNING: below_steer_speed_alert,\n },\n\n EventName.preLaneChangeLeft: {\n ET.WARNING: Alert(\n \"차선을 변경합니다\",\n \"좌측차선의 차량을 확인하세요\",\n AlertStatus.normal, AlertSize.mid,\n Priority.LOW, VisualAlert.steerRequired, AudibleAlert.none, .0, .1, .1, alert_rate=0.75),\n },\n\n EventName.preLaneChangeRight: {\n ET.WARNING: Alert(\n \"차선을 변경합니다\",\n \"우측차선의 차량을 확인하세요\",\n AlertStatus.normal, AlertSize.mid,\n Priority.LOW, VisualAlert.steerRequired, AudibleAlert.none, .0, .1, .1, alert_rate=0.75),\n },\n\n EventName.laneChangeBlocked: {\n ET.WARNING: Alert(\n \"후측방 차량감지\",\n \"차선에 차량이 감지되니 대기하세요\",\n AlertStatus.userPrompt, AlertSize.mid,\n Priority.LOW, VisualAlert.steerRequired, AudibleAlert.chimePrompt, .1, .1, .1),\n },\n\n EventName.laneChange: {\n ET.WARNING: Alert(\n \"차선을 변경합니다\",\n \"후측방 차량에 주의하세요\",\n AlertStatus.normal, AlertSize.mid,\n Priority.LOW, VisualAlert.steerRequired, AudibleAlert.none, .0, .1, .1),\n },\n\n EventName.steerSaturated: {\n ET.WARNING: Alert(\n \"핸들을 잡아주세요\",\n \"조향제어 제한을 초과함\",\n AlertStatus.userPrompt, AlertSize.mid,\n Priority.LOW, VisualAlert.steerRequired, AudibleAlert.chimePrompt, 1., 1., 1.),\n },\n\n # Thrown when the fan is driven at >50% but is not rotating\n EventName.fanMalfunction: {\n ET.PERMANENT: NormalPermanentAlert(\"FAN 오작동\", \"하드웨어를 점검하세요\"),\n },\n\n # Camera is not outputting frames at a constant framerate\n EventName.cameraMalfunction: {\n ET.PERMANENT: NormalPermanentAlert(\"\", \"\"),\n },\n\n # Unused\n EventName.gpsMalfunction: {\n ET.PERMANENT: NormalPermanentAlert(\"GPS Malfunction\", \"Contact Support\"),\n },\n\n # When the GPS position and localizer diverge the localizer is reset to the\n # current GPS position. This alert is thrown when the localizer is reset\n # more often than expected.\n EventName.localizerMalfunction: {\n ET.PERMANENT: NormalPermanentAlert(\"Localizer unstable\", \"Contact Support\"),\n },\n\n # ********** events that affect controls state transitions **********\n\n EventName.pcmEnable: {\n ET.ENABLE: EngagementAlert(AudibleAlert.chimeEngage),\n },\n\n EventName.buttonEnable: {\n ET.ENABLE: EngagementAlert(AudibleAlert.chimeEngage),\n },\n\n EventName.pcmDisable: {\n ET.USER_DISABLE: EngagementAlert(AudibleAlert.chimeDisengage),\n },\n\n EventName.buttonCancel: {\n ET.USER_DISABLE: EngagementAlert(AudibleAlert.chimeDisengage),\n },\n\n EventName.brakeHold: {\n ET.USER_DISABLE: EngagementAlert(AudibleAlert.chimeDisengage),\n ET.NO_ENTRY: NoEntryAlert(\"브레이크 감지됨\"),\n },\n\n EventName.parkBrake: {\n ET.USER_DISABLE: EngagementAlert(AudibleAlert.chimeDisengage),\n ET.NO_ENTRY: NoEntryAlert(\"주차 브레이크를 해제하세요\"),\n },\n\n EventName.pedalPressed: {\n ET.USER_DISABLE: EngagementAlert(AudibleAlert.chimeDisengage),\n ET.NO_ENTRY: NoEntryAlert(\"브레이크 감지됨\",\n visual_alert=VisualAlert.brakePressed),\n },\n\n EventName.wrongCarMode: {\n ET.USER_DISABLE: EngagementAlert(AudibleAlert.chimeDisengage),\n ET.NO_ENTRY: wrong_car_mode_alert,\n },\n\n EventName.wrongCruiseMode: {\n ET.USER_DISABLE: EngagementAlert(AudibleAlert.chimeDisengage),\n ET.NO_ENTRY: NoEntryAlert(\"어뎁티브크루즈를 활성화하세요\"),\n },\n\n EventName.steerTempUnavailable: {\n ET.SOFT_DISABLE: SoftDisableAlert(\"조향제어 일시적으로 사용불가\"),\n ET.NO_ENTRY: NoEntryAlert(\"조향제어 일시적으로 사용불가\",\n duration_hud_alert=0.),\n },\n\n EventName.outOfSpace: {\n ET.PERMANENT: Alert(\n \"저장공간 부족\",\n \"\",\n AlertStatus.normal, AlertSize.small,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2),\n ET.NO_ENTRY: NoEntryAlert(\"저장공간 부족\",\n duration_hud_alert=0.),\n },\n\n EventName.belowEngageSpeed: {\n ET.NO_ENTRY: NoEntryAlert(\"속도를 높여주세요\"),\n },\n\n EventName.sensorDataInvalid: {\n ET.PERMANENT: Alert(\n \"장치 센서 오류\",\n \"장치 점검후 재가동세요\",\n AlertStatus.normal, AlertSize.mid,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2, creation_delay=1.),\n ET.NO_ENTRY: NoEntryAlert(\"장치 센서 오류\"),\n },\n\n EventName.noGps: {\n ET.PERMANENT: no_gps_alert,\n },\n\n EventName.soundsUnavailable: {\n ET.PERMANENT: NormalPermanentAlert(\"스피커가 감지되지않습니다\", \"이온을 재부팅 해주세요\"),\n ET.NO_ENTRY: NoEntryAlert(\"스피커가 감지되지않습니다\"),\n },\n\n EventName.tooDistracted: {\n ET.NO_ENTRY: NoEntryAlert(\"방해 수준이 너무높음\"),\n },\n\n EventName.overheat: {\n ET.PERMANENT: Alert(\n \"장치 과열됨\",\n \"\",\n AlertStatus.normal, AlertSize.small,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2),\n ET.SOFT_DISABLE: SoftDisableAlert(\"장치 과열됨\"),\n ET.NO_ENTRY: NoEntryAlert(\"장치 과열됨\"),\n },\n\n EventName.wrongGear: {\n ET.SOFT_DISABLE: SoftDisableAlert(\"기어를 [D]로 변경하세요\"),\n ET.NO_ENTRY: NoEntryAlert(\"기어를 [D]로 변경하세요\"),\n },\n\n # This alert is thrown when the calibration angles are outside of the acceptable range.\n # For example if the device is pointed too much to the left or the right.\n # Usually this can only be solved by removing the mount from the windshield completely,\n # and attaching while making sure the device is pointed straight forward and is level.\n # See https://comma.ai/setup for more information\n EventName.calibrationInvalid: {\n ET.PERMANENT: NormalPermanentAlert(\"캘리브레이션 오류\", \"장치 위치변경후 캘리브레이션을 다시하세요\"),\n ET.SOFT_DISABLE: SoftDisableAlert(\"캘리브레이션 오류 : 장치 위치변경후 캘리브레이션을 다시하세요\"),\n ET.NO_ENTRY: NoEntryAlert(\"캘리브레이션 오류 : 장치 위치변경후 캘리브레이션을 다시하세요\"),\n },\n\n EventName.calibrationIncomplete: {\n ET.PERMANENT: calibration_incomplete_alert,\n ET.SOFT_DISABLE: SoftDisableAlert(\"캘리브레이션 진행중입니다\"),\n ET.NO_ENTRY: NoEntryAlert(\"캘리브레이션 진행중입니다\"),\n },\n\n EventName.doorOpen: {\n ET.SOFT_DISABLE: SoftDisableAlert(\"도어 열림\"),\n ET.NO_ENTRY: NoEntryAlert(\"도어 열림\"),\n },\n\n EventName.seatbeltNotLatched: {\n ET.SOFT_DISABLE: SoftDisableAlert(\"안전벨트를 착용해주세요\"),\n ET.NO_ENTRY: NoEntryAlert(\"안전벨트를 착용해주세요\"),\n },\n\n EventName.espDisabled: {\n ET.SOFT_DISABLE: SoftDisableAlert(\"ESP 꺼짐\"),\n ET.NO_ENTRY: NoEntryAlert(\"ESP 꺼짐\"),\n },\n\n EventName.lowBattery: {\n ET.SOFT_DISABLE: SoftDisableAlert(\"배터리 부족\"),\n ET.NO_ENTRY: NoEntryAlert(\"배터리 부족\"),\n },\n\n # Different openpilot services communicate between each other at a certain\n # interval. If communication does not follow the regular schedule this alert\n # is thrown. This can mean a service crashed, did not broadcast a message for\n # ten times the regular interval, or the average interval is more than 10% too high.\n EventName.commIssue: {\n ET.SOFT_DISABLE: SoftDisableAlert(\"장치 프로세스 통신오류\"),\n ET.NO_ENTRY: NoEntryAlert(\"장치 프로세스 통신오류\",\n audible_alert=AudibleAlert.chimeDisengage),\n },\n\n # Thrown when manager detects a service exited unexpectedly while driving\n EventName.processNotRunning: {\n ET.NO_ENTRY: NoEntryAlert(\"시스템 오작동: 이온을 재부팅 하세요\",\n audible_alert=AudibleAlert.chimeDisengage),\n },\n\n EventName.radarFault: {\n ET.SOFT_DISABLE: SoftDisableAlert(\"레이더 오류 : 차량을 재가동하세요\"),\n ET.NO_ENTRY : NoEntryAlert(\"레이더 오류 : 차량을 재가동하세요\"),\n },\n\n # Every frame from the camera should be processed by the model. If modeld\n # is not processing frames fast enough they have to be dropped. This alert is\n # thrown when over 20% of frames are dropped.\n EventName.modeldLagging: {\n ET.SOFT_DISABLE: SoftDisableAlert(\"주행모델 지연됨\"),\n ET.NO_ENTRY : NoEntryAlert(\"주행모델 지연됨\"),\n },\n\n # Besides predicting the path, lane lines and lead car data the model also\n # predicts the current velocity and rotation speed of the car. If the model is\n # very uncertain about the current velocity while the car is moving, this\n # usually means the model has trouble understanding the scene. This is used\n # as a heuristic to warn the driver.\n EventName.posenetInvalid: {\n ET.SOFT_DISABLE: SoftDisableAlert(\"차선인식상태가 좋지않으니 주의운전하세요\"),\n ET.NO_ENTRY: NoEntryAlert(\"차선인식상태가 좋지않으니 주의운전하세요\"),\n },\n\n # When the localizer detects an acceleration of more than 40 m/s^2 (~4G) we\n # alert the driver the device might have fallen from the windshield.\n EventName.deviceFalling: {\n ET.SOFT_DISABLE: SoftDisableAlert(\"장치가 마운트에서 떨어짐\"),\n ET.NO_ENTRY: NoEntryAlert(\"장치가 마운트에서 떨어짐\"),\n },\n\n EventName.lowMemory: {\n ET.SOFT_DISABLE: SoftDisableAlert(\"메모리 부족 : 장치를 재가동하세요\"),\n ET.PERMANENT: NormalPermanentAlert(\"메모리 부족\", \"장치를 재가동하세요\"),\n ET.NO_ENTRY : NoEntryAlert(\"메모리 부족 : 장치를 재가동하세요\",\n audible_alert=AudibleAlert.chimeDisengage),\n },\n\n EventName.accFaulted: {\n ET.IMMEDIATE_DISABLE: ImmediateDisableAlert(\"크루즈 오류\"),\n ET.PERMANENT: NormalPermanentAlert(\"크루즈 오류\", \"\"),\n ET.NO_ENTRY: NoEntryAlert(\"크루즈 오류\"),\n },\n\n EventName.controlsMismatch: {\n ET.IMMEDIATE_DISABLE: ImmediateDisableAlert(\"컨트롤 불일치\"),\n },\n\n EventName.roadCameraError: {\n ET.PERMANENT: NormalPermanentAlert(\"Road Camera Error\", \"\",\n duration_text=10.),\n },\n\n EventName.driverCameraError: {\n ET.PERMANENT: NormalPermanentAlert(\"Driver Camera Error\", \"\",\n duration_text=10.),\n },\n\n EventName.wideRoadCameraError: {\n ET.PERMANENT: NormalPermanentAlert(\"Wide Road Camera Error\", \"\",\n duration_text=10.),\n },\n\n # Sometimes the USB stack on the device can get into a bad state\n # causing the connection to the panda to be lost\n EventName.usbError: {\n ET.SOFT_DISABLE: SoftDisableAlert(\"USB 에러: 이온을 재부팅 하세요\"),\n ET.PERMANENT: NormalPermanentAlert(\"USB 에러: 이온을 재부팅 하세요\", \"\"),\n ET.NO_ENTRY: NoEntryAlert(\"USB 에러: 이온을 재부팅 하세요\"),\n },\n\n # This alert can be thrown for the following reasons:\n # - No CAN data received at all\n # - CAN data is received, but some message are not received at the right frequency\n # If you're not writing a new car port, this is usually cause by faulty wiring\n EventName.canError: {\n ET.IMMEDIATE_DISABLE: ImmediateDisableAlert(\"CAN 오류 : 하드웨어를 점검하세요\"),\n ET.PERMANENT: Alert(\n \"CAN 오류 : 하드웨어를 점검하세요\",\n \"\",\n AlertStatus.normal, AlertSize.small,\n Priority.LOW, VisualAlert.none, AudibleAlert.none, 0., 0., .2, creation_delay=1.),\n ET.NO_ENTRY: NoEntryAlert(\"CAN 오류 : 하드웨어를 점검하세요\"),\n },\n\n EventName.steerUnavailable: {\n ET.IMMEDIATE_DISABLE: ImmediateDisableAlert(\"LKAS 오류 : 차량을 재가동하세요\"),\n ET.PERMANENT: Alert(\n \"LKAS 오류 : 차량을 재가동하세요\",\n \"\",\n AlertStatus.normal, AlertSize.small,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2),\n ET.NO_ENTRY: NoEntryAlert(\"LKAS 오류 : 차량을 재가동하세요\"),\n },\n\n EventName.brakeUnavailable: {\n ET.IMMEDIATE_DISABLE: ImmediateDisableAlert(\"Cruise Fault: Restart the Car\"),\n ET.PERMANENT: Alert(\n \"크루즈 오류 : 차량을 재가동하세요\",\n \"\",\n AlertStatus.normal, AlertSize.small,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2),\n ET.NO_ENTRY: NoEntryAlert(\"크루즈 오류 : 차량을 재가동하세요\"),\n },\n\n EventName.reverseGear: {\n ET.PERMANENT: Alert(\n \"기어 [R] 상태\",\n \"\",\n AlertStatus.normal, AlertSize.full,\n Priority.LOWEST, VisualAlert.none, AudibleAlert.none, 0., 0., .2, creation_delay=0.5),\n ET.SOFT_DISABLE: SoftDisableAlert(\"기어 [R] 상태\"),\n ET.NO_ENTRY: NoEntryAlert(\"기어 [R] 상태\"),\n },\n\n # On cars that use stock ACC the car can decide to cancel ACC for various reasons.\n # When this happens we can no long control the car so the user needs to be warned immediately.\n EventName.cruiseDisabled: {\n ET.IMMEDIATE_DISABLE: ImmediateDisableAlert(\"크루즈 꺼짐\"),\n },\n\n # For planning the trajectory Model Predictive Control (MPC) is used. This is\n # an optimization algorithm that is not guaranteed to find a feasible solution.\n # If no solution is found or the solution has a very high cost this alert is thrown.\n EventName.plannerError: {\n ET.SOFT_DISABLE: SoftDisableAlert(\"플래너 솔루션 오류\"),\n ET.NO_ENTRY: NoEntryAlert(\"플래너 솔루션 오류\"),\n },\n\n # When the relay in the harness box opens the CAN bus between the LKAS camera\n # and the rest of the car is separated. When messages from the LKAS camera\n # are received on the car side this usually means the relay hasn't opened correctly\n # and this alert is thrown.\n EventName.relayMalfunction: {\n ET.IMMEDIATE_DISABLE: ImmediateDisableAlert(\"하네스 오작동\"),\n ET.PERMANENT: NormalPermanentAlert(\"하네스 오작동\", \"하드웨어를 점검하세요\"),\n ET.NO_ENTRY: NoEntryAlert(\"하네스 오작동\"),\n },\n\n EventName.noTarget: {\n ET.IMMEDIATE_DISABLE: Alert(\n \"오픈파일럿 사용불가\",\n \"근접 앞차량이 없습니다\",\n AlertStatus.normal, AlertSize.mid,\n Priority.HIGH, VisualAlert.none, AudibleAlert.chimeDisengage, .4, 2., 3.),\n ET.NO_ENTRY: NoEntryAlert(\"No Close Lead Car\"),\n },\n\n EventName.speedTooLow: {\n ET.IMMEDIATE_DISABLE: Alert(\n \"오픈파일럿 사용불가\",\n \"속도를 높이고 재가동하세요\",\n AlertStatus.normal, AlertSize.mid,\n Priority.HIGH, VisualAlert.none, AudibleAlert.chimeDisengage, .4, 2., 3.),\n },\n\n # When the car is driving faster than most cars in the training data the model outputs can be unpredictable\n EventName.speedTooHigh: {\n ET.WARNING: Alert(\n \"속도가 너무 높습니다\",\n \"속도를 줄여주세요\",\n AlertStatus.userPrompt, AlertSize.mid,\n Priority.HIGH, VisualAlert.steerRequired, AudibleAlert.chimeWarning2Repeat, 2.2, 3., 4.),\n ET.NO_ENTRY: Alert(\n \"속도가 너무 높습니다\",\n \"속도를 줄이고 재가동하세요\",\n AlertStatus.normal, AlertSize.mid,\n Priority.LOW, VisualAlert.none, AudibleAlert.chimeError, .4, 2., 3.),\n },\n\n EventName.lowSpeedLockout: {\n ET.PERMANENT: Alert(\n \"크루즈 오류 : 차량을 재가동하세요\",\n \"\",\n AlertStatus.normal, AlertSize.small,\n Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2),\n ET.NO_ENTRY: NoEntryAlert(\"크루즈 오류 : 차량을 재가동하세요\"),\n },\n \n EventName.turningIndicatorOn: {\n ET.WARNING: Alert(\n \"방향지시등 동작중에는 핸들을 잡아주세요\",\n \"\",\n AlertStatus.userPrompt, AlertSize.small,\n Priority.LOW, VisualAlert.none, AudibleAlert.none, .0, .0, .2),\n },\n\n EventName.autoLaneChange: {\n ET.WARNING: auto_lane_change_alert,\n },\n\n EventName.slowingDownSpeed: {\n ET.PERMANENT: Alert(\"속도를 조절합니다\",\"\", AlertStatus.normal, AlertSize.small,\n Priority.MID, VisualAlert.none, AudibleAlert.none, 0., .1, .1),\n },\n\n EventName.slowingDownSpeedSound: {\n ET.PERMANENT: Alert(\"속도를 조절합니다\",\"\", AlertStatus.normal, AlertSize.small,\n Priority.HIGH, VisualAlert.none, AudibleAlert.chimeSlowingDownSpeed, 2., 2., 2.),\n },\n\n}\n"},"avg_line_length":{"kind":"number","value":33.8763676149,"string":"33.876368"},"max_line_length":{"kind":"number","value":116,"string":"116"},"alphanum_fraction":{"kind":"number","value":0.67454704,"string":"0.674547"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"agegold/neokii_KR-1"},"path":{"kind":"string","value":"selfdrive/controls/lib/events.py"},"size":{"kind":"number","value":34085,"string":"34,085"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8756,"cells":{"content":{"kind":"string","value":"import numpy as np\nimport h5py\nimport argparse\nimport imageio\nimport tqdm\nimport os\nfrom glob import glob\n\n\ndef main(args):\n \"\"\"Main function to parse in Nuclei Dataset from Kaggle and store as HDF5\n\n Parameters\n ----------\n args: ArgumentParser()\n input_dir: str\n directory of the Nuclei data\n output_dir: str\n path to the HDF5 output directory\n \"\"\"\n\n # create hdf5 \n hdf5_fn = h5py.File(os.path.join(args.output_dir, \"data_360.hdf5\"), \"a\")\n\n # get all data directory\n data_dirs = glob(os.path.join(args.input_dir, \"*/\"))\n\n with tqdm.tqdm(total=len(data_dirs), unit=\"folder\") as progress_bar:\n for path in data_dirs:\n\n data_name = path.split(\"/\")[-2]\n x, y, masks = parse_data(path)\n\n # TODO only use majority size for now\n if x is None:\n progress_bar.update(1)\n continue\n\n # stack x and y together\n y = np.expand_dims(y, axis=0)\n data = np.vstack((x,y,masks))\n\n hdf5_fn.create_dataset(str(data_name), data=data, dtype=np.float, chunks=True)\n progress_bar.update(1)\n hdf5_fn.close()\n\n\ndef parse_data(path):\n\n # define data folders\n x_path = os.path.join(path, \"images/\")\n y_path = os.path.join(path, \"masks/\")\n\n # get all data paths \n x_file = glob(os.path.join(x_path, \"*.png\"))[0]\n y_files = glob(os.path.join(y_path, \"*.png\"))\n\n # parse in data\n x = imageio.imread(x_file)\n\n # TODO only using majority shape\n if x.shape != (256, 256, 4):\n return None, None, None\n\n masks = np.array([imageio.imread(y) for y in y_files])\n y = np.zeros_like(masks[0])\n for y_raw in masks:\n y = np.maximum(y, y_raw)\n\n # normalize\n x = x / 255.0\n y = y / 255.0\n masks = masks / 255.0\n\n # fix dimentions\n x = np.transpose(x, (2,0,1)) # channels first\n\n return x, y, masks\n\n\nif __name__ == \"__main__\":\n\n parser = argparse.ArgumentParser()\n\n parser.add_argument('--input_dir', type=str)\n parser.add_argument('--output_dir', type=str)\n\n args = parser.parse_args()\n\n main(args)\n"},"avg_line_length":{"kind":"number","value":23.8791208791,"string":"23.879121"},"max_line_length":{"kind":"number","value":90,"string":"90"},"alphanum_fraction":{"kind":"number","value":0.5881270133,"string":"0.588127"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"marshuang80/CellSegmentation"},"path":{"kind":"string","value":"process_data/nuclei_create_hdf5.py"},"size":{"kind":"number","value":2173,"string":"2,173"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8757,"cells":{"content":{"kind":"string","value":"#11_Duplicate in an array N+1 integer\r\n\r\n\"\"\"\r\n\r\nGiven an array of n elements that contains elements from 0 to n-1, with any of these numbers appearing any number of times. Find these repeating numbers in O(n) and using only constant memory space.\r\n\r\nExample: \r\n\r\nInput : n = 7 and array[] = {1, 2, 3, 6, 3, 6, 1}\r\nOutput: 1, 3, 6\r\n\r\nExplanation: The numbers 1 , 3 and 6 appears more\r\nthan once in the array.\r\n\r\nInput : n = 5 and array[] = {1, 2, 3, 4 ,3}\r\nOutput: 3\r\n\r\nExplanation: The number 3 appears more than once\r\nin the array.\r\n\r\n\"\"\"\r\n\r\n\"\"\"\r\nAlgorithm:\r\n\r\n 1. Traverse the array from start to end.\r\n\r\n 2. For every element,\r\n take its absolute value and\r\n if the abs(array[i])‘th element is positive, the element has not encountered before,\r\n else if negative the element has been encountered before print the absolute value of the current element.\r\nComplexity Analysis: \r\n\r\nTime Complexity: O(n), only one traversal is needed, so time complexity is O(n)\r\nAuxiliary Space: O(1), no extra space is required, so space complexity is constant\r\n \r\n\"\"\"\r\ndef printRepeating(arr, size):\r\n print(\"The repeating elements are :\")\r\n for i in range(0,size):\r\n if arr[abs(arr[i])] > 0:\r\n arr[abs(arr[i])] =-arr[abs(arr[i])]\r\n else:\r\n print(abs(arr[i]), end=\" \")\r\n\r\n\r\narr = [1,2,3,1,3,6,6]\r\narr_size = len(arr)\r\n\r\nprintRepeating(arr, arr_size)\r\n\r\n\r\n"},"avg_line_length":{"kind":"number","value":26.641509434,"string":"26.641509"},"max_line_length":{"kind":"number","value":199,"string":"199"},"alphanum_fraction":{"kind":"number","value":0.6402266289,"string":"0.640227"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"iamParvezKhan25/Data-Structure-Algorithm"},"path":{"kind":"string","value":"11_Duplicate in an array N+1 integer.py"},"size":{"kind":"number","value":1414,"string":"1,414"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8758,"cells":{"content":{"kind":"string","value":"# Copyright (c) OpenMMLab. All rights reserved.\nimport torch\nfrom torch.nn.parallel.distributed import (DistributedDataParallel,\n _find_tensors)\n\nfrom mmcv import print_log\nfrom mmcv.utils import TORCH_VERSION, digit_version\nfrom .scatter_gather import scatter_kwargs\n\n\nclass MMDistributedDataParallel(DistributedDataParallel):\n \"\"\"The DDP module that supports DataContainer.\n\n MMDDP has two main differences with PyTorch DDP:\n\n - It supports a custom type :class:`DataContainer` which allows more\n flexible control of input data.\n - It implement two APIs ``train_step()`` and ``val_step()``.\n \"\"\"\n\n def to_kwargs(self, inputs, kwargs, device_id):\n # Use `self.to_kwargs` instead of `self.scatter` in pytorch1.8\n # to move all tensors to device_id\n return scatter_kwargs(inputs, kwargs, [device_id], dim=self.dim)\n\n def scatter(self, inputs, kwargs, device_ids):\n return scatter_kwargs(inputs, kwargs, device_ids, dim=self.dim)\n\n def train_step(self, *inputs, **kwargs):\n \"\"\"train_step() API for module wrapped by DistributedDataParallel.\n\n This method is basically the same as\n ``DistributedDataParallel.forward()``, while replacing\n ``self.module.forward()`` with ``self.module.train_step()``.\n It is compatible with PyTorch 1.1 - 1.5.\n \"\"\"\n\n # In PyTorch >= 1.7, ``reducer._rebuild_buckets()`` is moved from the\n # end of backward to the beginning of forward.\n if ('parrots' not in TORCH_VERSION\n and digit_version(TORCH_VERSION) >= digit_version('1.7')\n and self.reducer._rebuild_buckets()):\n print_log(\n 'Reducer buckets have been rebuilt in this iteration.',\n logger='mmcv')\n\n if ('parrots' not in TORCH_VERSION\n and digit_version(TORCH_VERSION) >= digit_version('1.11.0')):\n if self._check_sync_bufs_pre_fwd():\n self._sync_buffers()\n else:\n if (getattr(self, 'require_forward_param_sync', False)\n and self.require_forward_param_sync):\n self._sync_params()\n\n if self.device_ids:\n inputs, kwargs = self.scatter(inputs, kwargs, self.device_ids)\n if len(self.device_ids) == 1:\n output = self.module.train_step(*inputs[0], **kwargs[0])\n else:\n outputs = self.parallel_apply(\n self._module_copies[:len(inputs)], inputs, kwargs)\n output = self.gather(outputs, self.output_device)\n else:\n output = self.module.train_step(*inputs, **kwargs)\n\n if ('parrots' not in TORCH_VERSION\n and digit_version(TORCH_VERSION) >= digit_version('1.11.0')):\n if self._check_sync_bufs_post_fwd():\n self._sync_buffers()\n\n if (torch.is_grad_enabled()\n and getattr(self, 'require_backward_grad_sync', False)\n and self.require_backward_grad_sync):\n if self.find_unused_parameters:\n self.reducer.prepare_for_backward(list(_find_tensors(output)))\n else:\n self.reducer.prepare_for_backward([])\n else:\n if ('parrots' not in TORCH_VERSION\n and digit_version(TORCH_VERSION) > digit_version('1.2')):\n self.require_forward_param_sync = False\n return output\n\n def val_step(self, *inputs, **kwargs):\n \"\"\"val_step() API for module wrapped by DistributedDataParallel.\n\n This method is basically the same as\n ``DistributedDataParallel.forward()``, while replacing\n ``self.module.forward()`` with ``self.module.val_step()``.\n It is compatible with PyTorch 1.1 - 1.5.\n \"\"\"\n # In PyTorch >= 1.7, ``reducer._rebuild_buckets()`` is moved from the\n # end of backward to the beginning of forward.\n if ('parrots' not in TORCH_VERSION\n and digit_version(TORCH_VERSION) >= digit_version('1.7')\n and self.reducer._rebuild_buckets()):\n print_log(\n 'Reducer buckets have been rebuilt in this iteration.',\n logger='mmcv')\n\n if ('parrots' not in TORCH_VERSION\n and digit_version(TORCH_VERSION) >= digit_version('1.11.0')):\n if self._check_sync_bufs_pre_fwd():\n self._sync_buffers()\n else:\n if (getattr(self, 'require_forward_param_sync', False)\n and self.require_forward_param_sync):\n self._sync_params()\n\n if self.device_ids:\n inputs, kwargs = self.scatter(inputs, kwargs, self.device_ids)\n if len(self.device_ids) == 1:\n output = self.module.val_step(*inputs[0], **kwargs[0])\n else:\n outputs = self.parallel_apply(\n self._module_copies[:len(inputs)], inputs, kwargs)\n output = self.gather(outputs, self.output_device)\n else:\n output = self.module.val_step(*inputs, **kwargs)\n\n if ('parrots' not in TORCH_VERSION\n and digit_version(TORCH_VERSION) >= digit_version('1.11.0')):\n if self._check_sync_bufs_post_fwd():\n self._sync_buffers()\n\n if (torch.is_grad_enabled()\n and getattr(self, 'require_backward_grad_sync', False)\n and self.require_backward_grad_sync):\n if self.find_unused_parameters:\n self.reducer.prepare_for_backward(list(_find_tensors(output)))\n else:\n self.reducer.prepare_for_backward([])\n else:\n if ('parrots' not in TORCH_VERSION\n and digit_version(TORCH_VERSION) > digit_version('1.2')):\n self.require_forward_param_sync = False\n return output\n"},"avg_line_length":{"kind":"number","value":42.5683453237,"string":"42.568345"},"max_line_length":{"kind":"number","value":78,"string":"78"},"alphanum_fraction":{"kind":"number","value":0.6030082812,"string":"0.603008"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"BIGWangYuDong/mmcv"},"path":{"kind":"string","value":"mmcv/parallel/distributed.py"},"size":{"kind":"number","value":5917,"string":"5,917"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8759,"cells":{"content":{"kind":"string","value":"import datetime\nimport json\nimport logging\nimport re\nimport time\n\nfrom google.appengine.ext import db\n# from google.appengine.ext.db import djangoforms\nfrom google.appengine.api import mail\nfrom google.appengine.api import memcache\nfrom google.appengine.api import urlfetch\nfrom google.appengine.api import taskqueue\nfrom google.appengine.api import users\n\nimport settings\nimport util\n\n#from django.forms import ModelForm\nfrom collections import OrderedDict\nfrom django import forms\n# import google.appengine.ext.django as django\n\n\nSIMPLE_TYPES = (int, long, float, bool, dict, basestring, list)\n\nWEBCOMPONENTS = 1\nMISC = 2\nSECURITY = 3\nMULTIMEDIA = 4\nDOM = 5\nFILE = 6\nOFFLINE = 7\nDEVICE = 8\nCOMMUNICATION = 9\nJAVASCRIPT = 10\nNETWORKING = 11\nINPUT = 12\nPERFORMANCE = 13\nGRAPHICS = 14\nCSS = 15\nHOUDINI = 16\nSERVICEWORKER = 17\nWEBRTC = 18\nLAYERED = 19\n\nFEATURE_CATEGORIES = {\n CSS: 'CSS',\n WEBCOMPONENTS: 'Web Components',\n MISC: 'Misc',\n SECURITY: 'Security',\n MULTIMEDIA: 'Multimedia',\n DOM: 'DOM',\n FILE: 'File APIs',\n OFFLINE: 'Offline / Storage',\n DEVICE: 'Device',\n COMMUNICATION: 'Realtime / Communication',\n JAVASCRIPT: 'JavaScript',\n NETWORKING: 'Network / Connectivity',\n INPUT: 'User input',\n PERFORMANCE: 'Performance',\n GRAPHICS: 'Graphics',\n HOUDINI: 'Houdini',\n SERVICEWORKER: 'Service Worker',\n WEBRTC: 'Web RTC',\n LAYERED: 'Layered APIs',\n }\n\n# Intent stages and mapping from stage to stage name.\nINTENT_NONE = 0\nINTENT_IMPLEMENT = 1\nINTENT_EXPERIMENT = 2\nINTENT_EXTEND_TRIAL = 3\nINTENT_IMPLEMENT_SHIP = 4\nINTENT_SHIP = 5\nINTENT_REMOVE = 6\n\nINTENT_STAGES = {\n INTENT_NONE: 'None',\n INTENT_IMPLEMENT: 'Prototype',\n INTENT_EXPERIMENT: 'Experiment',\n INTENT_EXTEND_TRIAL: 'Extend Origin Trial',\n INTENT_IMPLEMENT_SHIP: 'Implement and Ship',\n INTENT_SHIP: 'Ship',\n INTENT_REMOVE: 'Remove',\n}\n\nNO_ACTIVE_DEV = 1\nPROPOSED = 2\nIN_DEVELOPMENT = 3\nBEHIND_A_FLAG = 4\nENABLED_BY_DEFAULT = 5\nDEPRECATED = 6\nREMOVED = 7\nORIGIN_TRIAL = 8\nINTERVENTION = 9\nNO_LONGER_PURSUING = 1000 # insure bottom of list\n\n# Ordered dictionary, make sure the order of this dictionary matches that of\n# the sorted list above!\nIMPLEMENTATION_STATUS = OrderedDict()\nIMPLEMENTATION_STATUS[NO_ACTIVE_DEV] = 'No active development'\nIMPLEMENTATION_STATUS[PROPOSED] = 'Proposed'\nIMPLEMENTATION_STATUS[IN_DEVELOPMENT] = 'In development'\nIMPLEMENTATION_STATUS[BEHIND_A_FLAG] = 'Behind a flag'\nIMPLEMENTATION_STATUS[ENABLED_BY_DEFAULT] = 'Enabled by default'\nIMPLEMENTATION_STATUS[DEPRECATED] = 'Deprecated'\nIMPLEMENTATION_STATUS[REMOVED] = 'Removed'\nIMPLEMENTATION_STATUS[ORIGIN_TRIAL] = 'Origin trial'\nIMPLEMENTATION_STATUS[INTERVENTION] = 'Browser Intervention'\nIMPLEMENTATION_STATUS[NO_LONGER_PURSUING] = 'No longer pursuing'\n\nMAJOR_NEW_API = 1\nMAJOR_MINOR_NEW_API = 2\nSUBSTANTIVE_CHANGES = 3\nMINOR_EXISTING_CHANGES = 4\nEXTREMELY_SMALL_CHANGE = 5\n\nFOOTPRINT_CHOICES = {\n MAJOR_NEW_API: ('A major new independent API (e.g. adding a large # '\n 'independent concepts with many methods/properties/objects)'),\n MAJOR_MINOR_NEW_API: ('Major changes to an existing API OR a minor new '\n 'independent API (e.g. adding a large # of new '\n 'methods/properties or introducing new concepts to '\n 'augment an existing API)'),\n SUBSTANTIVE_CHANGES: ('Substantive changes to an existing API (e.g. small '\n 'number of new methods/properties)'),\n MINOR_EXISTING_CHANGES: (\n 'Minor changes to an existing API (e.g. adding a new keyword/allowed '\n 'argument to a property/method)'),\n EXTREMELY_SMALL_CHANGE: ('Extremely small tweaks to an existing API (e.g. '\n 'how existing keywords/arguments are interpreted)'),\n }\n\nMAINSTREAM_NEWS = 1\nWARRANTS_ARTICLE = 2\nIN_LARGER_ARTICLE = 3\nSMALL_NUM_DEVS = 4\nSUPER_SMALL = 5\n\nVISIBILITY_CHOICES = {\n MAINSTREAM_NEWS: 'Likely in mainstream tech news',\n WARRANTS_ARTICLE: 'Will this feature generate articles on sites like developers.google.com/web/',\n IN_LARGER_ARTICLE: 'Covered as part of a larger article but not on its own',\n SMALL_NUM_DEVS: 'Only a very small number of web developers will care',\n SUPER_SMALL: \"So small it doesn't need to be covered in this dashboard\",\n }\n\nSHIPPED = 1\nIN_DEV = 2\nPUBLIC_SUPPORT = 3\nMIXED_SIGNALS = 4\nNO_PUBLIC_SIGNALS = 5\nPUBLIC_SKEPTICISM = 6\nOPPOSED = 7\n\nVENDOR_VIEWS = {\n SHIPPED: 'Shipped',\n IN_DEV: 'In development',\n PUBLIC_SUPPORT: 'Public support',\n MIXED_SIGNALS: 'Mixed public signals',\n NO_PUBLIC_SIGNALS: 'No public signals',\n PUBLIC_SKEPTICISM: 'Public skepticism',\n OPPOSED: 'Opposed',\n }\n\nDEFACTO_STD = 1\nESTABLISHED_STD = 2\nWORKING_DRAFT = 3\nEDITORS_DRAFT = 4\nPUBLIC_DISCUSSION = 5\nNO_STD_OR_DISCUSSION = 6\n\nSTANDARDIZATION = {\n DEFACTO_STD: 'De-facto standard',\n ESTABLISHED_STD: 'Established standard',\n WORKING_DRAFT: 'Working draft or equivalent',\n EDITORS_DRAFT: \"Editor's draft\",\n PUBLIC_DISCUSSION: 'Public discussion',\n NO_STD_OR_DISCUSSION: 'No public standards discussion',\n }\n\nDEV_STRONG_POSITIVE = 1\nDEV_POSITIVE = 2\nDEV_MIXED_SIGNALS = 3\nDEV_NO_SIGNALS = 4\nDEV_NEGATIVE = 5\nDEV_STRONG_NEGATIVE = 6\n\nWEB_DEV_VIEWS = {\n DEV_STRONG_POSITIVE: 'Strongly positive',\n DEV_POSITIVE: 'Positive',\n DEV_MIXED_SIGNALS: 'Mixed signals',\n DEV_NO_SIGNALS: 'No signals',\n DEV_NEGATIVE: 'Negative',\n DEV_STRONG_NEGATIVE: 'Strongly negative',\n }\n\ndef del_none(d):\n \"\"\"\n Delete dict keys with None values, and empty lists, recursively.\n \"\"\"\n for key, value in d.items():\n if value is None or (isinstance(value, list) and len(value) == 0):\n del d[key]\n elif isinstance(value, dict):\n del_none(value)\n return d\n\ndef list_to_chunks(l, n):\n \"\"\"Yield successive n-sized chunk lists from l.\"\"\"\n for i in xrange(0, len(l), n):\n yield l[i:i + n]\n\n\nclass DictModel(db.Model):\n # def to_dict(self):\n # return dict([(p, unicode(getattr(self, p))) for p in self.properties()])\n\n def format_for_template(self):\n d = self.to_dict()\n d['id'] = self.key().id()\n return d\n\n def to_dict(self):\n output = {}\n\n for key, prop in self.properties().iteritems():\n value = getattr(self, key)\n\n if value is None or isinstance(value, SIMPLE_TYPES):\n output[key] = value\n elif isinstance(value, datetime.date):\n # Convert date/datetime to ms-since-epoch (\"new Date()\").\n #ms = time.mktime(value.utctimetuple())\n #ms += getattr(value, 'microseconds', 0) / 1000\n #output[key] = int(ms)\n output[key] = unicode(value)\n elif isinstance(value, db.GeoPt):\n output[key] = {'lat': value.lat, 'lon': value.lon}\n elif isinstance(value, db.Model):\n output[key] = to_dict(value)\n elif isinstance(value, users.User):\n output[key] = value.email()\n else:\n raise ValueError('cannot encode ' + repr(prop))\n\n return output\n\n\nclass BlinkComponent(DictModel):\n\n DEFAULT_COMPONENT = 'Blink'\n COMPONENTS_URL = 'https://blinkcomponents-b48b5.firebaseapp.com'\n COMPONENTS_ENDPOINT = '%s/blinkcomponents' % COMPONENTS_URL\n WF_CONTENT_ENDPOINT = '%s/wfcomponents' % COMPONENTS_URL\n\n name = db.StringProperty(required=True, default=DEFAULT_COMPONENT)\n created = db.DateTimeProperty(auto_now_add=True)\n updated = db.DateTimeProperty(auto_now=True)\n\n @property\n def subscribers(self):\n return FeatureOwner.all().filter('blink_components = ', self.key()).order('name').fetch(None)\n\n @property\n def owners(self):\n return FeatureOwner.all().filter('primary_blink_components = ', self.key()).order('name').fetch(None)\n\n @classmethod\n def fetch_all_components(self, update_cache=False):\n \"\"\"Returns the list of blink components from live endpoint if unavailable in the cache.\"\"\"\n key = '%s|blinkcomponents' % (settings.MEMCACHE_KEY_PREFIX)\n\n components = memcache.get(key)\n if components is None or update_cache:\n components = []\n result = urlfetch.fetch(self.COMPONENTS_ENDPOINT, deadline=60)\n if result.status_code == 200:\n components = sorted(json.loads(result.content))\n memcache.set(key, components)\n else:\n logging.error('Fetching blink components returned: %s' % result.status_code)\n return components\n\n @classmethod\n def fetch_wf_content_for_components(self, update_cache=False):\n \"\"\"Returns the /web content that use each blink component.\"\"\"\n key = '%s|wfcomponents' % (settings.MEMCACHE_KEY_PREFIX)\n\n components = memcache.get(key)\n if components is None or update_cache:\n components = {}\n result = urlfetch.fetch(self.WF_CONTENT_ENDPOINT, deadline=60)\n if result.status_code == 200:\n components = json.loads(result.content)\n memcache.set(key, components)\n else:\n logging.error('Fetching /web blink components content returned: %s' % result.status_code)\n return components\n\n @classmethod\n def update_db(self):\n \"\"\"Updates the db with new Blink components from the json endpoint\"\"\"\n self.fetch_wf_content_for_components(update_cache=True) # store /web content in memcache\n new_components = self.fetch_all_components(update_cache=True)\n existing_comps = self.all().fetch(None)\n for name in new_components:\n if not len([x.name for x in existing_comps if x.name == name]):\n logging.info('Adding new BlinkComponent: ' + name)\n c = BlinkComponent(name=name)\n c.put()\n\n @classmethod\n def get_by_name(self, component_name):\n \"\"\"Fetch blink component with given name.\"\"\"\n q = self.all()\n q.filter('name =', component_name)\n component = q.fetch(1)\n if not component:\n logging.error('%s is an unknown BlinkComponent.' % (component_name))\n return None\n return component[0]\n\n\n# UMA metrics.\nclass StableInstance(DictModel):\n created = db.DateTimeProperty(auto_now_add=True)\n updated = db.DateTimeProperty(auto_now=True)\n\n property_name = db.StringProperty(required=True)\n bucket_id = db.IntegerProperty(required=True)\n date = db.DateProperty(verbose_name='When the data was fetched',\n required=True)\n #hits = db.IntegerProperty(required=True)\n #total_pages = db.IntegerProperty()\n day_percentage = db.FloatProperty()\n rolling_percentage = db.FloatProperty()\n\n\nclass AnimatedProperty(StableInstance):\n pass\n\n\nclass FeatureObserver(StableInstance):\n pass\n\n\n# Feature dashboard.\nclass Feature(DictModel):\n \"\"\"Container for a feature.\"\"\"\n\n DEFAULT_MEMCACHE_KEY = '%s|features' % (settings.MEMCACHE_KEY_PREFIX)\n MAX_CHUNK_SIZE = 500 # max num features to save for each memcache chunk.\n\n @classmethod\n def get_feature_chunk_memcache_keys(self, key_prefix):\n num_features = len(Feature.all().fetch(limit=None, keys_only=True))\n l = list_to_chunks(range(0, num_features), self.MAX_CHUNK_SIZE)\n return ['%s|chunk%s' % (key_prefix, i) for i,val in enumerate(l)]\n\n @classmethod\n def set_feature_chunk_memcache_keys(self, key_prefix, feature_list):\n chunks = list_to_chunks(feature_list, self.MAX_CHUNK_SIZE)\n vals = []\n for i, chunk in enumerate(chunks):\n vals.append(('%s|chunk%s' % (key_prefix, i), chunk))\n # d = OrderedDict(sorted(dict(vals).items(), key=lambda t: t[0]))\n d = dict(vals)\n return d\n\n @classmethod\n def _first_of_milestone(self, feature_list, milestone, start=0):\n for i in xrange(start, len(feature_list)):\n f = feature_list[i]\n if (str(f['shipped_milestone']) == str(milestone) or\n f['impl_status_chrome'] == str(milestone)):\n return i\n elif (f['shipped_milestone'] == None and\n str(f['shipped_android_milestone']) == str(milestone)):\n return i\n\n return -1\n\n @classmethod\n def _first_of_milestone_v2(self, feature_list, milestone, start=0):\n for i in xrange(start, len(feature_list)):\n f = feature_list[i]\n desktop_milestone = f['browsers']['chrome'].get('desktop', None)\n android_milestone = f['browsers']['chrome'].get('android', None)\n status = f['browsers']['chrome']['status'].get('text', None)\n\n if (str(desktop_milestone) == str(milestone) or status == str(milestone)):\n return i\n elif (desktop_milestone == None and str(android_milestone) == str(milestone)):\n return i\n\n return -1\n\n @classmethod\n def _annotate_first_of_milestones(self, feature_list, version=None):\n try:\n omaha_data = util.get_omaha_data()\n\n win_versions = omaha_data[0]['versions']\n\n # Find the latest canary major version from the list of windows versions.\n canary_versions = [x for x in win_versions if x.get('channel') and x.get('channel').startswith('canary')]\n LATEST_VERSION = int(canary_versions[0].get('version').split('.')[0])\n\n milestones = range(1, LATEST_VERSION + 1)\n milestones.reverse()\n versions = [\n IMPLEMENTATION_STATUS[NO_ACTIVE_DEV],\n IMPLEMENTATION_STATUS[PROPOSED],\n IMPLEMENTATION_STATUS[IN_DEVELOPMENT],\n IMPLEMENTATION_STATUS[DEPRECATED],\n ]\n versions.extend(milestones)\n versions.append(IMPLEMENTATION_STATUS[NO_LONGER_PURSUING])\n\n first_of_milestone_func = Feature._first_of_milestone\n if version == 2:\n first_of_milestone_func = Feature._first_of_milestone_v2\n\n last_good_idx = 0\n for i, ver in enumerate(versions):\n idx = first_of_milestone_func(feature_list, ver, start=last_good_idx)\n if idx != -1:\n feature_list[idx]['first_of_milestone'] = True\n last_good_idx = idx\n except Exception as e:\n logging.error(e)\n\n def format_for_template(self, version=None):\n d = self.to_dict()\n\n if version == 2:\n if self.is_saved():\n d['id'] = self.key().id()\n else:\n d['id'] = None\n d['category'] = FEATURE_CATEGORIES[self.category]\n if self.intent_stage is not None:\n d['intent_stage'] = INTENT_STAGES[self.intent_stage]\n d['created'] = {\n 'by': d.pop('created_by', None),\n 'when': d.pop('created', None),\n }\n d['updated'] = {\n 'by': d.pop('updated_by', None),\n 'when': d.pop('updated', None),\n }\n d['standards'] = {\n 'spec': d.pop('spec_link', None),\n 'status': {\n 'text': STANDARDIZATION[self.standardization],\n 'val': d.pop('standardization', None),\n },\n 'visibility': {\n 'text': VISIBILITY_CHOICES[self.visibility],\n 'val': d.pop('visibility', None),\n },\n 'footprint': {\n 'val': d.pop('footprint', None),\n #'text': FOOTPRINT_CHOICES[self.footprint]\n }\n }\n d['resources'] = {\n 'samples': d.pop('sample_links', []),\n 'docs': d.pop('doc_links', []),\n }\n d['tags'] = d.pop('search_tags', [])\n d['browsers'] = {\n 'chrome': {\n 'bug': d.pop('bug_url', None),\n 'blink_components': d.pop('blink_components', []),\n 'owners': d.pop('owner', []),\n 'origintrial': self.impl_status_chrome == ORIGIN_TRIAL,\n 'intervention': self.impl_status_chrome == INTERVENTION,\n 'prefixed': d.pop('prefixed', False),\n 'flag': self.impl_status_chrome == BEHIND_A_FLAG,\n 'status': {\n 'text': IMPLEMENTATION_STATUS[self.impl_status_chrome],\n 'val': d.pop('impl_status_chrome', None)\n },\n 'desktop': d.pop('shipped_milestone', None),\n 'android': d.pop('shipped_android_milestone', None),\n 'webview': d.pop('shipped_webview_milestone', None),\n 'ios': d.pop('shipped_ios_milestone', None),\n },\n 'ff': {\n 'view': {\n 'text': VENDOR_VIEWS[self.ff_views],\n 'val': d.pop('ff_views', None),\n 'url': d.pop('ff_views_link', None),\n 'notes': d.pop('ff_views_notes', None),\n }\n },\n 'edge': {\n 'view': {\n 'text': VENDOR_VIEWS[self.ie_views],\n 'val': d.pop('ie_views', None),\n 'url': d.pop('ie_views_link', None),\n 'notes': d.pop('ie_views_notes', None),\n }\n },\n 'safari': {\n 'view': {\n 'text': VENDOR_VIEWS[self.safari_views],\n 'val': d.pop('safari_views', None),\n 'url': d.pop('safari_views_link', None),\n 'notes': d.pop('safari_views_notes', None),\n }\n },\n 'webdev': {\n 'view': {\n 'text': WEB_DEV_VIEWS[self.web_dev_views],\n 'val': d.pop('web_dev_views', None),\n 'url': d.pop('web_dev_views_link', None),\n 'notes': d.pop('web_dev_views_notes', None),\n }\n }\n }\n\n if self.shipped_milestone:\n d['browsers']['chrome']['status']['milestone_str'] = self.shipped_milestone\n elif self.shipped_milestone is None and self.shipped_android_milestone:\n d['browsers']['chrome']['status']['milestone_str'] = self.shipped_android_milestone\n else:\n d['browsers']['chrome']['status']['milestone_str'] = d['browsers']['chrome']['status']['text']\n\n del d['created']\n\n del_none(d) # Further prune response by removing null/[] values.\n\n else:\n if self.is_saved():\n d['id'] = self.key().id()\n else:\n d['id'] = None\n d['category'] = FEATURE_CATEGORIES[self.category]\n if self.intent_stage is not None:\n d['intent_stage'] = INTENT_STAGES[self.intent_stage]\n d['visibility'] = VISIBILITY_CHOICES[self.visibility]\n d['impl_status_chrome'] = IMPLEMENTATION_STATUS[self.impl_status_chrome]\n d['meta'] = {\n 'origintrial': self.impl_status_chrome == ORIGIN_TRIAL,\n 'intervention': self.impl_status_chrome == INTERVENTION,\n 'needsflag': self.impl_status_chrome == BEHIND_A_FLAG,\n }\n if self.shipped_milestone:\n d['meta']['milestone_str'] = self.shipped_milestone\n elif self.shipped_milestone is None and self.shipped_android_milestone:\n d['meta']['milestone_str'] = self.shipped_android_milestone\n else:\n d['meta']['milestone_str'] = d['impl_status_chrome']\n d['ff_views'] = {'value': self.ff_views,\n 'text': VENDOR_VIEWS[self.ff_views]}\n d['ie_views'] = {'value': self.ie_views,\n 'text': VENDOR_VIEWS[self.ie_views]}\n d['safari_views'] = {'value': self.safari_views,\n 'text': VENDOR_VIEWS[self.safari_views]}\n d['standardization'] = {'value': self.standardization,\n 'text': STANDARDIZATION[self.standardization]}\n d['web_dev_views'] = {'value': self.web_dev_views,\n 'text': WEB_DEV_VIEWS[self.web_dev_views]}\n\n return d\n\n def format_for_edit(self):\n d = self.to_dict()\n #d['id'] = self.key().id\n d['owner'] = ', '.join(self.owner)\n d['explainer_links'] = '\\r\\n'.join(self.explainer_links)\n d['doc_links'] = '\\r\\n'.join(self.doc_links)\n d['sample_links'] = '\\r\\n'.join(self.sample_links)\n d['search_tags'] = ', '.join(self.search_tags)\n d['blink_components'] = self.blink_components[0] #TODO: support more than one component.\n return d\n\n @classmethod\n def get_all(self, limit=None, order='-updated', filterby=None,\n update_cache=False):\n KEY = '%s|%s|%s' % (Feature.DEFAULT_MEMCACHE_KEY, order, limit)\n\n # TODO(ericbidelman): Support more than one filter.\n if filterby is not None:\n s = ('%s%s' % (filterby[0], filterby[1])).replace(' ', '')\n KEY += '|%s' % s\n\n feature_list = memcache.get(KEY)\n\n if feature_list is None or update_cache:\n query = Feature.all().order(order) #.order('name')\n\n # TODO(ericbidelman): Support more than one filter.\n if filterby:\n query.filter(filterby[0], filterby[1])\n\n features = query.fetch(limit)\n\n feature_list = [f.format_for_template() for f in features]\n\n memcache.set(KEY, feature_list)\n\n return feature_list\n\n @classmethod\n def get_all_with_statuses(self, statuses, update_cache=False):\n if not statuses:\n return []\n\n KEY = '%s|%s' % (Feature.DEFAULT_MEMCACHE_KEY, sorted(statuses))\n\n feature_list = memcache.get(KEY)\n\n if feature_list is None or update_cache:\n # There's no way to do an OR in a single datastore query, and there's a\n # very good chance that the self.get_all() results will already be in\n # memcache, so use an array comprehension to grab the features we\n # want from the array of everything.\n feature_list = [feature for feature in self.get_all(update_cache=update_cache)\n if feature['impl_status_chrome'] in statuses]\n memcache.set(KEY, feature_list)\n\n return feature_list\n\n @classmethod\n def get_feature(self, feature_id, update_cache=False):\n KEY = '%s|%s' % (Feature.DEFAULT_MEMCACHE_KEY, feature_id)\n feature = memcache.get(KEY)\n\n if feature is None or update_cache:\n unformatted_feature = Feature.get_by_id(feature_id)\n if unformatted_feature:\n feature = unformatted_feature.format_for_template()\n feature['updated_display'] = unformatted_feature.updated.strftime(\"%Y-%m-%d\")\n feature['new_crbug_url'] = unformatted_feature.new_crbug_url()\n memcache.set(KEY, feature)\n\n return feature\n\n @classmethod\n def get_chronological(self, limit=None, update_cache=False, version=None):\n KEY = '%s|%s|%s|%s' % (Feature.DEFAULT_MEMCACHE_KEY,\n 'cronorder', limit, version)\n\n keys = Feature.get_feature_chunk_memcache_keys(KEY)\n feature_list = memcache.get_multi(keys)\n\n # If we didn't get the expected number of chunks back (or a cache update\n # was requested), do a db query.\n if len(feature_list.keys()) != len(keys) or update_cache:\n # Features with no active, in dev, proposed features.\n q = Feature.all()\n q.order('impl_status_chrome')\n q.order('name')\n q.filter('impl_status_chrome <=', IN_DEVELOPMENT)\n pre_release = q.fetch(None)\n\n # Shipping features. Exclude features that do not have a desktop\n # shipping milestone.\n q = Feature.all()\n q.order('-shipped_milestone')\n q.order('name')\n q.filter('shipped_milestone !=', None)\n shipping_features = q.fetch(None)\n\n # Features with an android shipping milestone but no desktop milestone.\n q = Feature.all()\n q.order('-shipped_android_milestone')\n q.order('name')\n q.filter('shipped_milestone =', None)\n android_only_shipping_features = q.fetch(None)\n\n # No longer pursuing features.\n q = Feature.all()\n q.order('impl_status_chrome')\n q.order('name')\n q.filter('impl_status_chrome =', NO_LONGER_PURSUING)\n no_longer_pursuing_features = q.fetch(None)\n\n shipping_features.extend(android_only_shipping_features)\n\n shipping_features = [f for f in shipping_features if (IN_DEVELOPMENT < f.impl_status_chrome < NO_LONGER_PURSUING)]\n\n def getSortingMilestone(feature):\n feature._sort_by_milestone = (feature.shipped_milestone or\n feature.shipped_android_milestone)\n return feature\n\n # Sort the feature list on either Android shipping milestone or desktop\n # shipping milestone, depending on which is specified. If a desktop\n # milestone is defined, that will take default.\n shipping_features = map(getSortingMilestone, shipping_features)\n\n # First sort by name, then sort by feature milestone (latest first).\n shipping_features.sort(key=lambda f: f.name, reverse=False)\n shipping_features.sort(key=lambda f: f._sort_by_milestone, reverse=True)\n\n # Constructor the proper ordering.\n pre_release.extend(shipping_features)\n pre_release.extend(no_longer_pursuing_features)\n\n feature_list = [f.format_for_template(version) for f in pre_release]\n\n self._annotate_first_of_milestones(feature_list, version=version)\n\n # Memcache doesn't support saving values > 1MB. Break up features list into\n # chunks so we don't hit the limit.\n memcache.set_multi(Feature.set_feature_chunk_memcache_keys(KEY, feature_list))\n else:\n temp_feature_list = []\n # Reconstruct feature list by ordering chunks.\n for key in sorted(feature_list.keys()):\n temp_feature_list.extend(feature_list[key])\n feature_list = temp_feature_list\n\n return feature_list\n\n @classmethod\n def get_shipping_samples(self, limit=None, update_cache=False):\n KEY = '%s|%s|%s' % (Feature.DEFAULT_MEMCACHE_KEY, 'samples', limit)\n\n feature_list = memcache.get(KEY)\n\n if feature_list is None or update_cache:\n # Get all shipping features. Ordered by shipping milestone (latest first).\n q = Feature.all()\n q.filter('impl_status_chrome IN', [ENABLED_BY_DEFAULT, ORIGIN_TRIAL, INTERVENTION])\n q.order('-impl_status_chrome')\n q.order('-shipped_milestone')\n q.order('name')\n features = q.fetch(None)\n\n # Get non-shipping features (sans removed or deprecated ones) and\n # append to bottom of list.\n q = Feature.all()\n q.filter('impl_status_chrome <', ENABLED_BY_DEFAULT)\n q.order('-impl_status_chrome')\n q.order('-shipped_milestone')\n q.order('name')\n others = q.fetch(None)\n features.extend(others)\n\n # Filter out features without sample links.\n feature_list = [f.format_for_template() for f in features\n if len(f.sample_links)]\n\n memcache.set(KEY, feature_list)\n\n return feature_list\n\n def crbug_number(self):\n if not self.bug_url:\n return\n m = re.search(r'[\\/|?id=]([0-9]+)$', self.bug_url)\n if m:\n return m.group(1)\n\n def new_crbug_url(self):\n url = 'https://bugs.chromium.org/p/chromium/issues/entry'\n params = ['components=' + self.blink_components[0] or BlinkComponent.DEFAULT_COMPONENT]\n crbug_number = self.crbug_number()\n if crbug_number and self.impl_status_chrome in (\n NO_ACTIVE_DEV,\n PROPOSED,\n IN_DEVELOPMENT,\n BEHIND_A_FLAG,\n ORIGIN_TRIAL,\n INTERVENTION):\n params.append('blocking=' + crbug_number)\n if self.owner:\n params.append('cc=' + ','.join(self.owner))\n return url + '?' + '&'.join(params)\n\n def __init__(self, *args, **kwargs):\n super(Feature, self).__init__(*args, **kwargs)\n\n # Stash existing values when entity is created so we can diff property\n # values later in put() to know what's changed. https://stackoverflow.com/a/41344898\n for prop_name, prop in self.properties().iteritems():\n old_val = getattr(self, prop_name, None)\n setattr(self, '_old_' + prop_name, old_val)\n\n def __notify_feature_subscribers_of_changes(self, is_update):\n \"\"\"Async notifies subscribers of new features and property changes to features by\n posting to a task queue.\"\"\"\n # Diff values to see what properties have changed.\n changed_props = []\n for prop_name, prop in self.properties().iteritems():\n new_val = getattr(self, prop_name, None)\n old_val = getattr(self, '_old_' + prop_name, None)\n if new_val != old_val:\n changed_props.append({\n 'prop_name': prop_name, 'old_val': old_val, 'new_val': new_val})\n\n payload = json.dumps({\n 'changes': changed_props,\n 'is_update': is_update,\n 'feature': self.format_for_template(version=2)\n })\n\n # Create task to email subscribers.\n queue = taskqueue.Queue()#name='emailer')\n task = taskqueue.Task(method=\"POST\", url='/tasks/email-subscribers',\n target='notifier', payload=payload)\n queue.add(task)\n\n # Create task to send push notifications\n queue = taskqueue.Queue()\n task = taskqueue.Task(method=\"POST\", url='/tasks/send_notifications',\n target='notifier', payload=payload)\n queue.add(task)\n\n\n def put(self, **kwargs):\n is_update = self.is_saved()\n key = super(Feature, self).put(**kwargs)\n self.__notify_feature_subscribers_of_changes(is_update)\n return key\n\n # Metadata.\n created = db.DateTimeProperty(auto_now_add=True)\n updated = db.DateTimeProperty(auto_now=True)\n updated_by = db.UserProperty(auto_current_user=True)\n created_by = db.UserProperty(auto_current_user_add=True)\n\n intent_template_use_count = db.IntegerProperty(default = 0)\n\n # General info.\n category = db.IntegerProperty(required=True)\n name = db.StringProperty(required=True)\n intent_stage = db.IntegerProperty(default=0)\n summary = db.StringProperty(required=True, multiline=True)\n intent_to_implement_url = db.LinkProperty()\n origin_trial_feedback_url = db.LinkProperty()\n\n # A list of intent threads in the format \"date|subject|url\"\n intent_threads = db.StringListProperty()\n motivation = db.StringProperty(multiline=True)\n\n # Chromium details.\n bug_url = db.LinkProperty()\n blink_components = db.StringListProperty(required=True, default=[BlinkComponent.DEFAULT_COMPONENT])\n\n impl_status_chrome = db.IntegerProperty(required=True)\n shipped_milestone = db.IntegerProperty()\n shipped_android_milestone = db.IntegerProperty()\n shipped_ios_milestone = db.IntegerProperty()\n shipped_webview_milestone = db.IntegerProperty()\n\n owner = db.ListProperty(db.Email)\n footprint = db.IntegerProperty()\n interop_compat_risks = db.StringProperty(multiline=True)\n ergonomics_risks = db.StringProperty(multiline=True)\n activation_risks = db.StringProperty(multiline=True)\n security_risks = db.StringProperty(multiline=True)\n debuggability = db.StringProperty(multiline=True)\n all_platforms = db.BooleanProperty()\n all_platforms_descr = db.StringProperty(multiline=True)\n wpt = db.BooleanProperty()\n wpt_descr = db.StringProperty(multiline=True)\n\n visibility = db.IntegerProperty(required=True)\n\n #webbiness = db.IntegerProperty() # TODO: figure out what this is\n\n # Standards details.\n standardization = db.IntegerProperty(required=True)\n spec_link = db.LinkProperty()\n tag_review = db.StringProperty(multiline=True)\n prefixed = db.BooleanProperty()\n\n explainer_links = db.StringListProperty()\n\n ff_views = db.IntegerProperty(required=True, default=NO_PUBLIC_SIGNALS)\n ie_views = db.IntegerProperty(required=True, default=NO_PUBLIC_SIGNALS)\n safari_views = db.IntegerProperty(required=True, default=NO_PUBLIC_SIGNALS)\n web_dev_views = db.IntegerProperty(required=True)\n\n ff_views_link = db.LinkProperty()\n ie_views_link = db.LinkProperty()\n safari_views_link = db.LinkProperty()\n web_dev_views_link = db.LinkProperty()\n\n ff_views_notes = db.StringProperty(multiline=True)\n ie_views_notes = db.StringProperty(multiline=True)\n safari_views_notes = db.StringProperty(multiline=True)\n web_dev_views_notes = db.StringProperty(multiline=True)\n\n doc_links = db.StringListProperty()\n sample_links = db.StringListProperty()\n #tests = db.StringProperty()\n\n search_tags = db.StringListProperty()\n\n comments = db.StringProperty(multiline=True)\n\n experiment_goals = db.StringProperty(multiline=True)\n experiment_timeline = db.StringProperty(multiline=True)\n experiment_risks = db.StringProperty(multiline=True)\n experiment_extension_reason = db.StringProperty(multiline=True)\n ongoing_constraints = db.StringProperty(multiline=True)\n\nclass PlaceholderCharField(forms.CharField):\n\n def __init__(self, *args, **kwargs):\n #super(forms.CharField, self).__init__(*args, **kwargs)\n\n attrs = {}\n if kwargs.get('placeholder'):\n attrs['placeholder'] = kwargs.get('placeholder')\n del kwargs['placeholder']\n\n label = kwargs.get('label') or ''\n if label:\n del kwargs['label']\n\n self.max_length = kwargs.get('max_length') or None\n\n super(forms.CharField, self).__init__(label=label,\n widget=forms.TextInput(attrs=attrs), *args, **kwargs)\n\n\n# class PlaceholderForm(forms.Form):\n# def __init__(self, *args, **kwargs):\n# super(PlaceholderForm, self).__init__(*args, **kwargs)\n\n# for field_name in self.fields:\n# field = self.fields.get(field_name)\n# if field:\n# if type(field.widget) in (forms.TextInput, forms.DateInput):\n# field.widget = forms.TextInput(attrs={'placeholder': field.label})\n\n\nclass FeatureForm(forms.Form):\n\n SHIPPED_HELP_TXT = ('First milestone to ship with this '\n 'status. Applies to: Enabled by default, Behind a flag, '\n 'Origin trial, Browser Intervention, and Deprecated. If '\n 'the flag is \\'test\\' rather than \\'experimental\\' set '\n 'status to In development.')\n\n # Note that the \"required\" argument in the following field definitions only\n # mean so much in practice. There's various code in js/admin/feature_form.js,\n # including intentStageChanged(), that adjusts what fields are required (as\n # well as visible at all). IOW, when making changes to what form fields are or\n # are not required, look both in the definitions here as well as in\n # js/admin/feature_form.js and make sure the code works as intended.\n\n #name = PlaceholderCharField(required=True, placeholder='Feature name')\n name = forms.CharField(required=True, label='Feature',\n help_text='Capitalize only the first letter and the beginnings of proper nouns.')\n\n summary = forms.CharField(label='', required=True,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 500}),\n help_text='Provide a one sentence description followed by one or two lines explaining how this feature helps web developers.')\n\n category = forms.ChoiceField(required=True, help_text='Select the most specific category. If unsure, leave as \"%s\".' % FEATURE_CATEGORIES[MISC],\n initial=MISC,\n choices=sorted(FEATURE_CATEGORIES.items(), key=lambda x: x[1]))\n\n intent_stage = forms.ChoiceField(required=True, label='Intent stage', help_text='Select the appropriate intent stage.',\n initial=INTENT_IMPLEMENT,\n choices=INTENT_STAGES.items())\n\n current_user_email = users.get_current_user().email if users.get_current_user() else None\n owner = forms.CharField(initial=current_user_email, required=True, label='Contact emails',\n help_text='Comma separated list of full email addresses. Prefer @chromium.org.')\n\n summary = forms.CharField(label='Feature summary', required=True, max_length=500,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 500}),\n help_text='Summarize the feature using complete sentences as you would to an external developer using the feature.')\n\n motivation = forms.CharField(label='Motivation', required=True,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}),\n help_text='Explain why the web needs this change. It may be useful to describe what web developers are forced to do without it. When possible, include links to back up your claims in the explainer.')\n\n explainer_links = forms.CharField(label='Explainer link(s)', required=False,\n widget=forms.Textarea(attrs={'rows': 4, 'cols': 50, 'maxlength': 500}),\n help_text='Link to explainer(s) (one URL per line). You should have at least an explainer in hand and have shared it on a public forum before sending an Intent to Prototype in order to enable discussion with other browser vendors, standards bodies, or other interested parties.')\n\n intent_to_implement_url = forms.URLField(required=False, label='Intent to Prototype link',\n help_text='Link to the \"Intent to Prototype\" discussion thread.')\n\n origin_trial_feedback_url = forms.URLField(required=False, label='Origin Trial feedback summary',\n help_text='If your feature was available as an Origin Trial, link to a summary of usage and developer feedback. If not, leave this empty.')\n\n doc_links = forms.CharField(label='Doc link(s)', required=False,\n widget=forms.Textarea(attrs={'rows': 4, 'cols': 50, 'maxlength': 500}),\n help_text='Links to design doc(s) (one URL per line), if and when available. [This is not required to send out an Intent to Prototype. Please update the intent thread with the design doc when ready]. An explainer and/or design doc is sufficient to start this process. [Note: Please include links and data, where possible, to support any claims.]')\n\n standardization = forms.ChoiceField(\n label='Standardization', choices=STANDARDIZATION.items(),\n initial=EDITORS_DRAFT,\n help_text=(\"The standardization status of the API. In bodies that don't \"\n \"use this nomenclature, use the closest equivalent.\"))\n\n spec_link = forms.URLField(required=False, label='Spec link',\n help_text=\"Link to spec, if and when available. Please update the chromestatus.com entry and the intent thread(s) with the spec link when available.\")\n\n tag_review = forms.CharField(label='TAG Review', required=True,\n widget=forms.Textarea(attrs={'rows': 2, 'cols': 50, 'maxlength': 1480}),\n help_text='Link(s) to TAG review(s), or explanation why this is not needed.')\n\n interop_compat_risks = forms.CharField(label='Interoperability and Compatibility Risks', required=True,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}),\n help_text='Describe the degree of <a target=\"_blank\" href=\"https://sites.google.com/a/chromium.org/dev/blink?pli=1#TOC-Policy-for-shipping-and-removing-web-platform-API-features\">interoperability risk</a>. For a new feature, the main risk is that it fails to become an interoperable part of the web platform if other browsers do not implement it. For a removal, please review our <a target=\"_blank\" href=\"https://docs.google.com/document/d/1RC-pBBvsazYfCNNUSkPqAVpSpNJ96U8trhNkfV0v9fk/edit\">principles of web compatibility</a>.')\n\n safari_views = forms.ChoiceField(label='Safari views',\n choices=VENDOR_VIEWS.items(),\n initial=NO_PUBLIC_SIGNALS)\n safari_views_link = forms.URLField(required=False, label='',\n help_text='Citation link.')\n safari_views_notes = forms.CharField(required=False, label='',\n widget=forms.Textarea(attrs={'rows': 2, 'cols': 50, 'placeholder': 'Notes', 'maxlength': 1480}))\n\n ff_views = forms.ChoiceField(label='Firefox views',\n choices=VENDOR_VIEWS.items(),\n initial=NO_PUBLIC_SIGNALS)\n ff_views_link = forms.URLField(required=False, label='',\n help_text='Citation link.')\n ff_views_notes = forms.CharField(required=False, label='',\n widget=forms.Textarea(attrs={'rows': 2, 'cols': 50, 'placeholder': 'Notes', 'maxlength': 1480}))\n\n ie_views = forms.ChoiceField(label='Edge',\n choices=VENDOR_VIEWS.items(),\n initial=NO_PUBLIC_SIGNALS)\n ie_views_link = forms.URLField(required=False, label='',\n help_text='Citation link.')\n ie_views_notes = forms.CharField(required=False, label='',\n widget=forms.Textarea(attrs={'rows': 2, 'cols': 50, 'placeholder': 'Notes', 'maxlength': 1480}))\n\n web_dev_views = forms.ChoiceField(\n label='Web / Framework developer views',\n choices=WEB_DEV_VIEWS.items(),\n initial=DEV_NO_SIGNALS,\n help_text='If unsure, default to \"No signals\".')\n\n web_dev_views_link = forms.URLField(required=False, label='',\n help_text='Citation link.')\n web_dev_views_notes = forms.CharField(required=False, label='',\n widget=forms.Textarea(attrs={'rows': 2, 'cols': 50, 'placeholder': 'Notes', 'maxlength': 1480}),\n help_text='Reference known representative examples of opinion, both positive and negative.')\n\n ergonomics_risks = forms.CharField(label='Ergonomics Risks', required=False,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}),\n help_text='Are there any other platform APIs this feature will frequently be used in tandem with? Could the default usage of this API make it hard for Chrome to maintain good performance (i.e. synchronous return, must run on a certain thread, guaranteed return timing)?')\n\n activation_risks = forms.CharField(label='Activation Risks', required=False,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}),\n help_text='Will it be challenging for developers to take advantage of this feature immediately, as-is? Would this feature benefit from having polyfills, significant documentation and outreach, and/or libraries built on top of it to make it easier to use?')\n\n security_risks = forms.CharField(label='Security Risks', required=False,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}),\n help_text='List any security considerations that were taken into account when deigning this feature.')\n\n experiment_goals = forms.CharField(label='Experiment Goals', required=False,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}),\n help_text='Which pieces of the API surface are you looking to gain insight on? What metrics/measurement/feedback will you be using to validate designs? Double check that your experiment makes sense given that a large developer (e.g. a Google product or Facebook) likely can\\'t use it in production due to the limits enforced by origin trials.\\n\\nIf Intent to Extend Origin Trial, highlight new/different areas for experimentation. Should not be an exact copy of goals from the first Intent to Experiment.')\n\n experiment_timeline = forms.CharField(label='Experiment Timeline', required=False,\n widget=forms.Textarea(attrs={'rows': 2, 'cols': 50, 'maxlength': 1480}),\n help_text='When does the experiment start and expire?')\n\n experiment_risks = forms.CharField(label='Experiment Risks', required=False,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}),\n help_text='When this experiment comes to an end are there any risks to the sites that were using it, for example losing access to important storage due to an experimental storage API?')\n\n experiment_extension_reason = forms.CharField(label='Experiment Extension Reason', required=False,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}),\n help_text='If this is a repeat experiment, link to the previous Intent to Experiment thread and explain why you want to extend this experiment.')\n\n ongoing_constraints = forms.CharField(label='Ongoing Constraints', required=False,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}),\n help_text='Do you anticipate adding any ongoing technical constraints to the codebase while implementing this feature? We prefer to avoid features which require or assume a specific architecture. For most features, the answer here is \"None.\"')\n\n debuggability = forms.CharField(label='Debuggability', required=False,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}),\n help_text='Description of the desired DevTools debugging support for your feature. Consider emailing the <a href=\"https://groups.google.com/forum/?fromgroups#!forum/google-chrome-developer-tools\">google-chrome-developer-tools</a> list for additional help. For new language features in V8 specifically, refer to the debugger support checklist. If your feature doesn\\'t require changes to DevTools in order to provide a good debugging experience, feel free to leave this section empty.')\n\n all_platforms = forms.BooleanField(required=False, initial=False, label='Supported on all platforms?',\n help_text='Will this feature be supported on all six Blink platforms (Windows, Mac, Linux, Chrome OS, Android, and Android WebView)?')\n\n all_platforms_descr = forms.CharField(label='Platform Support Explanation', required=False,\n widget=forms.Textarea(attrs={'rows': 2, 'cols': 50, 'maxlength': 2000}),\n help_text='Explanation for why this feature is, or is not, supported on all platforms.')\n\n wpt = forms.BooleanField(required=False, initial=False, label='Web Platform Tests', help_text='Is this feature fully tested in Web Platform Tests?')\n\n wpt_descr = forms.CharField(label='Web Platform Tests Description', required=True,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}),\n help_text='Please link to the <a href=\"https://wpt.fyi/results\">results on wpt.fyi</a>. If any part of the feature is not tested by web-platform-tests, please include links to issues, e.g. a web-platform-tests issue with the \"infra\" label explaining why a certain thing cannot be tested (<a href=\"https://github.com/w3c/web-platform-tests/issues/3867\">example</a>), a spec issue for some change that would make it possible to test. (<a href=\"https://github.com/whatwg/fullscreen/issues/70\">example</a>), or a Chromium issue to upstream some existing tests (<a href=\"https://bugs.chromium.org/p/chromium/issues/detail?id=695486\">example</a>).')\n\n sample_links = forms.CharField(label='Samples links', required=False,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 500}),\n help_text='Links to samples (one URL per line).')\n\n bug_url = forms.URLField(required=False, label='Tracking bug URL',\n help_text='Tracking bug url (https://bugs.chromium.org/...). This bug should have \"Type=Feature\" set and be world readable.')\n\n blink_components = forms.ChoiceField(\n required=True,\n label='Blink component',\n help_text='Select the most specific component. If unsure, leave as \"%s\".' % BlinkComponent.DEFAULT_COMPONENT,\n choices=[(x, x) for x in BlinkComponent.fetch_all_components()],\n initial=[BlinkComponent.DEFAULT_COMPONENT])\n\n impl_status_chrome = forms.ChoiceField(required=True,\n label='Status in Chromium', choices=IMPLEMENTATION_STATUS.items())\n\n #shipped_milestone = PlaceholderCharField(required=False,\n # placeholder='First milestone the feature shipped with this status (either enabled by default or experimental)')\n shipped_milestone = forms.IntegerField(required=False, label='',\n help_text='Desktop:<br/>' + SHIPPED_HELP_TXT)\n\n shipped_android_milestone = forms.IntegerField(required=False, label='',\n help_text='Chrome for Android:</br/>' + SHIPPED_HELP_TXT)\n\n shipped_ios_milestone = forms.IntegerField(required=False, label='',\n help_text='Chrome for iOS (RARE):<br/>' + SHIPPED_HELP_TXT)\n\n shipped_webview_milestone = forms.IntegerField(required=False, label='',\n help_text='Android WebView:<br/>' + SHIPPED_HELP_TXT)\n\n prefixed = forms.BooleanField(required=False, initial=False, label='Prefixed?')\n\n footprint = forms.ChoiceField(label='Technical footprint',\n choices=FOOTPRINT_CHOICES.items(), initial=MAJOR_MINOR_NEW_API)\n\n visibility = forms.ChoiceField(\n label='Developer visibility',\n choices=VISIBILITY_CHOICES.items(),\n initial=WARRANTS_ARTICLE,\n help_text=('How much press / media / web developer buzz will this '\n 'feature generate?'))\n\n search_tags = forms.CharField(label='Search tags', required=False,\n help_text='Comma separated keywords used only in search')\n\n comments = forms.CharField(label='Comments', required=False,\n widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}),\n help_text='Additional comments, caveats, info...')\n\n class Meta:\n model = Feature\n #exclude = ('shipped_webview_milestone',)\n\n def __init__(self, *args, **keyargs):\n super(FeatureForm, self).__init__(*args, **keyargs)\n\n meta = getattr(self, 'Meta', None)\n exclude = getattr(meta, 'exclude', [])\n\n for field_name in exclude:\n if field_name in self.fields:\n del self.fields[field_name]\n\n for field, val in self.fields.iteritems():\n if val.required:\n self.fields[field].widget.attrs['required'] = 'required'\n\n\nclass AppUser(DictModel):\n \"\"\"Describes a user for whitelisting.\"\"\"\n\n #user = db.UserProperty(required=True, verbose_name='Google Account')\n email = db.EmailProperty(required=True)\n #is_admin = db.BooleanProperty(default=False)\n created = db.DateTimeProperty(auto_now_add=True)\n updated = db.DateTimeProperty(auto_now=True)\n\n\ndef list_with_component(l, component):\n return [x for x in l if x.id() == component.key().id()]\n\ndef list_without_component(l, component):\n return [x for x in l if x.id() != component.key().id()]\n\n\nclass FeatureOwner(DictModel):\n \"\"\"Describes subscribers of a web platform feature.\"\"\"\n created = db.DateTimeProperty(auto_now_add=True)\n updated = db.DateTimeProperty(auto_now=True)\n name = db.StringProperty(required=True)\n email = db.EmailProperty(required=True)\n twitter = db.StringProperty()\n blink_components = db.ListProperty(db.Key)\n primary_blink_components = db.ListProperty(db.Key)\n watching_all_features = db.BooleanProperty(default=False)\n\n # def __eq__(self, other):\n # return self.key().id() == other.key().id()\n\n def add_to_component_subscribers(self, component_name):\n \"\"\"Adds the user to the list of Blink component subscribers.\"\"\"\n c = BlinkComponent.get_by_name(component_name)\n if c:\n # Add the user if they're not already in the list.\n if not len(list_with_component(self.blink_components, c)):\n self.blink_components.append(c.key())\n return self.put()\n return None\n\n def remove_from_component_subscribers(self, component_name, remove_as_owner=False):\n \"\"\"Removes the user from the list of Blink component subscribers or as the owner\n of the component.\"\"\"\n c = BlinkComponent.get_by_name(component_name)\n if c:\n if remove_as_owner:\n self.primary_blink_components = list_without_component(self.primary_blink_components, c)\n else:\n self.blink_components = list_without_component(self.blink_components, c)\n self.primary_blink_components = list_without_component(self.primary_blink_components, c)\n return self.put()\n return None\n\n def add_as_component_owner(self, component_name):\n \"\"\"Adds the user as the Blink component owner.\"\"\"\n c = BlinkComponent.get_by_name(component_name)\n if c:\n # Update both the primary list and blink components subscribers if the\n # user is not already in them.\n self.add_to_component_subscribers(component_name)\n if not len(list_with_component(self.primary_blink_components, c)):\n self.primary_blink_components.append(c.key())\n return self.put()\n return None\n\n def remove_as_component_owner(self, component_name):\n return self.remove_from_component_subscribers(component_name, remove_as_owner=True)\n\n\nclass HistogramModel(db.Model):\n \"\"\"Container for a histogram.\"\"\"\n\n bucket_id = db.IntegerProperty(required=True)\n property_name = db.StringProperty(required=True)\n\n MAX_CHUNK_SIZE = 500 # max num features to save for each memcache chunk.\n\n @classmethod\n def get_property_chunk_memcache_keys(self, property_class, key_prefix):\n num_props = len(property_class.all().fetch(limit=None, keys_only=True))\n l = list_to_chunks(range(0, num_props), self.MAX_CHUNK_SIZE)\n return ['%s|chunk%s' % (key_prefix, i) for i,val in enumerate(l)]\n\n @classmethod\n def set_property_chunk_memcache_keys(self, key_prefix, pop_list):\n chunks = list_to_chunks(pop_list, self.MAX_CHUNK_SIZE)\n vals = []\n for i, chunk in enumerate(chunks):\n vals.append(('%s|chunk%s' % (key_prefix, i), chunk))\n d = dict(vals)\n return d\n\n @classmethod\n def get_all(self):\n output = {}\n buckets = self.all().fetch(None)\n for bucket in buckets:\n output[bucket.bucket_id] = bucket.property_name\n return output\n\nclass CssPropertyHistogram(HistogramModel):\n pass\n\nclass FeatureObserverHistogram(HistogramModel):\n pass\n"},"avg_line_length":{"kind":"number","value":40.3666404406,"string":"40.36664"},"max_line_length":{"kind":"number","value":649,"string":"649"},"alphanum_fraction":{"kind":"number","value":0.6931937785,"string":"0.693194"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"cwilso/chromium-dashboard"},"path":{"kind":"string","value":"models.py"},"size":{"kind":"number","value":51306,"string":"51,306"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8760,"cells":{"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\nimport time\n\nfrom pymongo import MongoClient\n\nfrom config import MONGO_CONFIG\n\ndef get_current_time(format_str: str = '%Y-%m-%d %H:%M:%S'):\n \"\"\"\n 获取当前时间,默认为 2020-01-01 00:00:00 格式\n :param format_str: 格式\n :return:\n \"\"\"\n return time.strftime(format_str, time.localtime())\n\nclass MongoDb:\n\n def __init__(self):\n \"\"\"初始化\n 初始化 mongo db\n \"\"\"\n mongo_uri = 'mongodb://%s:%s@%s:%s' % (\n MONGO_CONFIG['user'],\n MONGO_CONFIG['pwd'],\n MONGO_CONFIG['host'],\n MONGO_CONFIG['port'])\n self.mongo = MongoClient(mongo_uri)\n self.sogou_db = self.mongo['sogou_dev']\n self.sogou_search_col = self.sogou_db['sogou_search_results']\n # self.task_db = self.mongo['sogou_tast']\n\n def update_sogou_login_cookie(self, username, cookie):\n \"\"\"\n 更新搜狗微信登录 cookie 信息\n :param username:\n :param cookie:\n :return:\n \"\"\"\n col = self.sogou_db['sogou_login_cookies']\n ctime = get_current_time()\n find_obj = {\n 'nickname': username,\n 'is_valid': 1,\n }\n\n login_item = col.find_one(find_obj)\n\n print(login_item)\n\n # 插入新数据\n if not login_item:\n cookie = 'DESC=0; %s' % cookie\n col.insert_one({\n 'cookie': cookie,\n 'nickname': username,\n 'device': '0',\n 'state': 'normal',\n 'c_time': ctime,\n 'm_time': ctime,\n 'is_valid': 1,\n 'failures': 0,\n })\n return\n\n # 更新原有数据\n cookie = 'DESC=%s; %s' % (login_item['device'], cookie)\n col.update_one(find_obj, {\n '$set': {\n 'state': 'normal',\n 'cookie': cookie,\n 'c_time': ctime,\n 'm_time': ctime,\n 'failures': 0,\n }\n })\n\n def insert_sogou_search_result(self, result):\n \"\"\"\n 保存搜狗搜索信息\n :param results: 结果数组\n \"\"\"\n ctime = get_current_time()\n\n find_obj = {\n 'id': result['id'],\n 'is_valid': 1\n }\n\n search_item = self.sogou_search_col.find_one(find_obj)\n\n print(search_item)\n \n new_result = result\n # 插入新数据\n if not search_item:\n new_result[\"c_time\"] = ctime\n new_result[\"m_time\"] = ctime\n new_result[\"is_valid\"] = 1\n self.sogou_search_col.insert_one(new_result)\n return\n\n # 更新原有数据\n new_result[\"m_time\"] = ctime\n self.sogou_search_col.update_one(find_obj, {\n '$set': new_result\n })"},"avg_line_length":{"kind":"number","value":25.5514018692,"string":"25.551402"},"max_line_length":{"kind":"number","value":69,"string":"69"},"alphanum_fraction":{"kind":"number","value":0.4930504755,"string":"0.49305"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"matiastang/selenium-learning"},"path":{"kind":"string","value":"src/sogou_wechat/mongoDB.py"},"size":{"kind":"number","value":2862,"string":"2,862"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8761,"cells":{"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\n# PLEASE DO NOT EDIT THIS FILE, IT IS GENERATED AND WILL BE OVERWRITTEN:\n# https://github.com/ccxt/ccxt/blob/master/CONTRIBUTING.md#how-to-contribute-code\n\nfrom ccxt.base.exchange import Exchange\nfrom ccxt.base.errors import ExchangeError\nfrom ccxt.base.errors import AuthenticationError\nfrom ccxt.base.errors import BadRequest\nfrom ccxt.base.errors import OrderNotFound\nfrom ccxt.base.errors import InvalidNonce\nfrom ccxt.base.decimal_to_precision import TICK_SIZE\nfrom ccxt.base.precise import Precise\n\n\nclass bitso(Exchange):\n\n def describe(self):\n return self.deep_extend(super(bitso, self).describe(), {\n 'id': 'bitso',\n 'name': 'Bitso',\n 'countries': ['MX'], # Mexico\n 'rateLimit': 2000, # 30 requests per minute\n 'version': 'v3',\n 'has': {\n 'CORS': None,\n 'spot': True,\n 'margin': False,\n 'swap': False,\n 'future': False,\n 'option': False,\n 'addMargin': False,\n 'cancelOrder': True,\n 'createOrder': True,\n 'createReduceOnlyOrder': False,\n 'fetchBalance': True,\n 'fetchBorrowRate': False,\n 'fetchBorrowRateHistories': False,\n 'fetchBorrowRateHistory': False,\n 'fetchBorrowRates': False,\n 'fetchBorrowRatesPerSymbol': False,\n 'fetchDepositAddress': True,\n 'fetchFundingFee': False,\n 'fetchFundingFees': True,\n 'fetchFundingHistory': False,\n 'fetchFundingRate': False,\n 'fetchFundingRateHistory': False,\n 'fetchFundingRates': False,\n 'fetchIndexOHLCV': False,\n 'fetchLeverage': False,\n 'fetchMarkets': True,\n 'fetchMarkOHLCV': False,\n 'fetchMyTrades': True,\n 'fetchOHLCV': True,\n 'fetchOpenOrders': True,\n 'fetchOrder': True,\n 'fetchOrderBook': True,\n 'fetchOrderTrades': True,\n 'fetchPosition': False,\n 'fetchPositions': False,\n 'fetchPositionsRisk': False,\n 'fetchPremiumIndexOHLCV': False,\n 'fetchTicker': True,\n 'fetchTrades': True,\n 'fetchTradingFee': False,\n 'fetchTradingFees': True,\n 'fetchTransfer': False,\n 'fetchTransfers': False,\n 'reduceMargin': False,\n 'setLeverage': False,\n 'setMarginMode': False,\n 'setPositionMode': False,\n 'transfer': False,\n 'withdraw': True,\n },\n 'urls': {\n 'logo': 'https://user-images.githubusercontent.com/51840849/87295554-11f98280-c50e-11ea-80d6-15b3bafa8cbf.jpg',\n 'api': 'https://api.bitso.com',\n 'www': 'https://bitso.com',\n 'doc': 'https://bitso.com/api_info',\n 'fees': 'https://bitso.com/fees',\n 'referral': 'https://bitso.com/?ref=itej',\n },\n 'precisionMode': TICK_SIZE,\n 'options': {\n 'precision': {\n 'XRP': 0.000001,\n 'MXN': 0.01,\n 'TUSD': 0.01,\n },\n 'defaultPrecision': 0.00000001,\n },\n 'timeframes': {\n '1m': '60',\n '5m': '300',\n '15m': '900',\n '30m': '1800',\n '1h': '3600',\n '4h': '14400',\n '12h': '43200',\n '1d': '86400',\n '1w': '604800',\n },\n 'api': {\n 'public': {\n 'get': [\n 'available_books',\n 'ticker',\n 'order_book',\n 'trades',\n 'ohlc',\n ],\n },\n 'private': {\n 'get': [\n 'account_status',\n 'balance',\n 'fees',\n 'fundings',\n 'fundings/{fid}',\n 'funding_destination',\n 'kyc_documents',\n 'ledger',\n 'ledger/trades',\n 'ledger/fees',\n 'ledger/fundings',\n 'ledger/withdrawals',\n 'mx_bank_codes',\n 'open_orders',\n 'order_trades/{oid}',\n 'orders/{oid}',\n 'user_trades',\n 'user_trades/{tid}',\n 'withdrawals/',\n 'withdrawals/{wid}',\n ],\n 'post': [\n 'bitcoin_withdrawal',\n 'debit_card_withdrawal',\n 'ether_withdrawal',\n 'ripple_withdrawal',\n 'bcash_withdrawal',\n 'litecoin_withdrawal',\n 'orders',\n 'phone_number',\n 'phone_verification',\n 'phone_withdrawal',\n 'spei_withdrawal',\n 'ripple_withdrawal',\n 'bcash_withdrawal',\n 'litecoin_withdrawal',\n ],\n 'delete': [\n 'orders/{oid}',\n 'orders/all',\n ],\n },\n },\n 'exceptions': {\n '0201': AuthenticationError, # Invalid Nonce or Invalid Credentials\n '104': InvalidNonce, # Cannot perform request - nonce must be higher than 1520307203724237\n '0304': BadRequest, # {\"success\":false,\"error\":{\"code\":\"0304\",\"message\":\"The field time_bucket() is either invalid or missing\"}}\n },\n })\n\n def fetch_markets(self, params={}):\n response = self.publicGetAvailableBooks(params)\n #\n # {\n # \"success\":true,\n # \"payload\":[\n # {\n # \"book\":\"btc_mxn\",\n # \"minimum_price\":\"500\",\n # \"maximum_price\":\"10000000\",\n # \"minimum_amount\":\"0.00005\",\n # \"maximum_amount\":\"500\",\n # \"minimum_value\":\"5\",\n # \"maximum_value\":\"10000000\",\n # \"tick_size\":\"0.01\",\n # \"fees\":{\n # \"flat_rate\":{\"maker\":\"0.500\",\"taker\":\"0.650\"},\n # \"structure\":[\n # {\"volume\":\"1500000\",\"maker\":\"0.00500\",\"taker\":\"0.00650\"},\n # {\"volume\":\"2000000\",\"maker\":\"0.00490\",\"taker\":\"0.00637\"},\n # {\"volume\":\"5000000\",\"maker\":\"0.00480\",\"taker\":\"0.00624\"},\n # {\"volume\":\"7000000\",\"maker\":\"0.00440\",\"taker\":\"0.00572\"},\n # {\"volume\":\"10000000\",\"maker\":\"0.00420\",\"taker\":\"0.00546\"},\n # {\"volume\":\"15000000\",\"maker\":\"0.00400\",\"taker\":\"0.00520\"},\n # {\"volume\":\"35000000\",\"maker\":\"0.00370\",\"taker\":\"0.00481\"},\n # {\"volume\":\"50000000\",\"maker\":\"0.00300\",\"taker\":\"0.00390\"},\n # {\"volume\":\"150000000\",\"maker\":\"0.00200\",\"taker\":\"0.00260\"},\n # {\"volume\":\"250000000\",\"maker\":\"0.00100\",\"taker\":\"0.00130\"},\n # {\"volume\":\"9999999999\",\"maker\":\"0.00000\",\"taker\":\"0.00130\"},\n # ]\n # }\n # },\n # ]\n # }\n markets = self.safe_value(response, 'payload')\n result = []\n for i in range(0, len(markets)):\n market = markets[i]\n id = self.safe_string(market, 'book')\n baseId, quoteId = id.split('_')\n base = baseId.upper()\n quote = quoteId.upper()\n base = self.safe_currency_code(base)\n quote = self.safe_currency_code(quote)\n fees = self.safe_value(market, 'fees', {})\n flatRate = self.safe_value(fees, 'flat_rate', {})\n takerString = self.safe_string(flatRate, 'taker')\n makerString = self.safe_string(flatRate, 'maker')\n taker = self.parse_number(Precise.string_div(takerString, '100'))\n maker = self.parse_number(Precise.string_div(makerString, '100'))\n feeTiers = self.safe_value(fees, 'structure', [])\n fee = {\n 'taker': taker,\n 'maker': maker,\n 'percentage': True,\n 'tierBased': True,\n }\n takerFees = []\n makerFees = []\n for j in range(0, len(feeTiers)):\n tier = feeTiers[j]\n volume = self.safe_number(tier, 'volume')\n takerFee = self.safe_number(tier, 'taker')\n makerFee = self.safe_number(tier, 'maker')\n takerFees.append([volume, takerFee])\n makerFees.append([volume, makerFee])\n if j == 0:\n fee['taker'] = takerFee\n fee['maker'] = makerFee\n tiers = {\n 'taker': takerFees,\n 'maker': makerFees,\n }\n fee['tiers'] = tiers\n defaultPricePrecision = self.safe_number(self.options['precision'], quote, self.options['defaultPrecision'])\n result.append(self.extend({\n 'id': id,\n 'symbol': base + '/' + quote,\n 'base': base,\n 'quote': quote,\n 'settle': None,\n 'baseId': baseId,\n 'quoteId': quoteId,\n 'settleId': None,\n 'type': 'spot',\n 'spot': True,\n 'margin': False,\n 'swap': False,\n 'future': False,\n 'option': False,\n 'active': None,\n 'contract': False,\n 'linear': None,\n 'inverse': None,\n 'taker': taker,\n 'maker': maker,\n 'contractSize': None,\n 'expiry': None,\n 'expiryDatetime': None,\n 'strike': None,\n 'optionType': None,\n 'precision': {\n 'amount': self.safe_number(self.options['precision'], base, self.options['defaultPrecision']),\n 'price': self.safe_number(market, 'tick_size', defaultPricePrecision),\n },\n 'limits': {\n 'leverage': {\n 'min': None,\n 'max': None,\n },\n 'amount': {\n 'min': self.safe_number(market, 'minimum_amount'),\n 'max': self.safe_number(market, 'maximum_amount'),\n },\n 'price': {\n 'min': self.safe_number(market, 'minimum_price'),\n 'max': self.safe_number(market, 'maximum_price'),\n },\n 'cost': {\n 'min': self.safe_number(market, 'minimum_value'),\n 'max': self.safe_number(market, 'maximum_value'),\n },\n },\n 'info': market,\n }, fee))\n return result\n\n def parse_balance(self, response):\n payload = self.safe_value(response, 'payload', {})\n balances = self.safe_value(payload, 'balances')\n result = {\n 'info': response,\n 'timestamp': None,\n 'datetime': None,\n }\n for i in range(0, len(balances)):\n balance = balances[i]\n currencyId = self.safe_string(balance, 'currency')\n code = self.safe_currency_code(currencyId)\n account = self.account()\n account['free'] = self.safe_string(balance, 'available')\n account['used'] = self.safe_string(balance, 'locked')\n account['total'] = self.safe_string(balance, 'total')\n result[code] = account\n return self.safe_balance(result)\n\n def fetch_balance(self, params={}):\n self.load_markets()\n response = self.privateGetBalance(params)\n #\n # {\n # \"success\": True,\n # \"payload\": {\n # \"balances\": [\n # {\n # \"currency\": \"bat\",\n # \"available\": \"0.00000000\",\n # \"locked\": \"0.00000000\",\n # \"total\": \"0.00000000\",\n # \"pending_deposit\": \"0.00000000\",\n # \"pending_withdrawal\": \"0.00000000\"\n # },\n # {\n # \"currency\": \"bch\",\n # \"available\": \"0.00000000\",\n # \"locked\": \"0.00000000\",\n # \"total\": \"0.00000000\",\n # \"pending_deposit\": \"0.00000000\",\n # \"pending_withdrawal\": \"0.00000000\"\n # },\n # ],\n # },\n # }\n #\n return self.parse_balance(response)\n\n def fetch_order_book(self, symbol, limit=None, params={}):\n self.load_markets()\n request = {\n 'book': self.market_id(symbol),\n }\n response = self.publicGetOrderBook(self.extend(request, params))\n orderbook = self.safe_value(response, 'payload')\n timestamp = self.parse8601(self.safe_string(orderbook, 'updated_at'))\n return self.parse_order_book(orderbook, symbol, timestamp, 'bids', 'asks', 'price', 'amount')\n\n def parse_ticker(self, ticker, market=None):\n #\n # {\n # \"high\":\"37446.85\",\n # \"last\":\"36599.54\",\n # \"created_at\":\"2022-01-28T12:06:11+00:00\",\n # \"book\":\"btc_usdt\",\n # \"volume\":\"7.29075419\",\n # \"vwap\":\"36579.1564400307\",\n # \"low\":\"35578.52\",\n # \"ask\":\"36574.76\",\n # \"bid\":\"36538.22\",\n # \"change_24\":\"-105.64\"\n # }\n #\n symbol = self.safe_symbol(None, market)\n timestamp = self.parse8601(self.safe_string(ticker, 'created_at'))\n vwap = self.safe_string(ticker, 'vwap')\n baseVolume = self.safe_string(ticker, 'volume')\n quoteVolume = Precise.string_mul(baseVolume, vwap)\n last = self.safe_string(ticker, 'last')\n return self.safe_ticker({\n 'symbol': symbol,\n 'timestamp': timestamp,\n 'datetime': self.iso8601(timestamp),\n 'high': self.safe_string(ticker, 'high'),\n 'low': self.safe_string(ticker, 'low'),\n 'bid': self.safe_string(ticker, 'bid'),\n 'bidVolume': None,\n 'ask': self.safe_string(ticker, 'ask'),\n 'askVolume': None,\n 'vwap': vwap,\n 'open': None,\n 'close': last,\n 'last': last,\n 'previousClose': None,\n 'change': None,\n 'percentage': None,\n 'average': None,\n 'baseVolume': baseVolume,\n 'quoteVolume': quoteVolume,\n 'info': ticker,\n }, market, False)\n\n def fetch_ticker(self, symbol, params={}):\n self.load_markets()\n market = self.market(symbol)\n request = {\n 'book': market['id'],\n }\n response = self.publicGetTicker(self.extend(request, params))\n ticker = self.safe_value(response, 'payload')\n #\n # {\n # \"success\":true,\n # \"payload\":{\n # \"high\":\"37446.85\",\n # \"last\":\"37051.96\",\n # \"created_at\":\"2022-01-28T17:03:29+00:00\",\n # \"book\":\"btc_usdt\",\n # \"volume\":\"6.16176186\",\n # \"vwap\":\"36582.6293169472\",\n # \"low\":\"35578.52\",\n # \"ask\":\"37083.62\",\n # \"bid\":\"37039.66\",\n # \"change_24\":\"478.45\"\n # }\n # }\n #\n return self.parse_ticker(ticker, market)\n\n def fetch_ohlcv(self, symbol, timeframe='1m', since=None, limit=None, params={}):\n self.load_markets()\n market = self.market(symbol)\n request = {\n 'book': market['id'],\n 'time_bucket': self.timeframes[timeframe],\n }\n if since is not None:\n request['start'] = since\n if limit is not None:\n duration = self.parse_timeframe(timeframe)\n request['end'] = self.sum(since, duration * limit * 1000)\n elif limit is not None:\n now = self.milliseconds()\n request['end'] = now\n request['start'] = now - self.parse_timeframe(timeframe) * 1000 * limit\n response = self.publicGetOhlc(self.extend(request, params))\n #\n # {\n # \"success\":true,\n # \"payload\": [\n # {\n # \"bucket_start_time\":1648219140000,\n # \"first_trade_time\":1648219154990,\n # \"last_trade_time\":1648219189441,\n # \"first_rate\":\"44958.60\",\n # \"last_rate\":\"44979.88\",\n # \"min_rate\":\"44957.33\",\n # \"max_rate\":\"44979.88\",\n # \"trade_count\":8,\n # \"volume\":\"0.00082814\",\n # \"vwap\":\"44965.02\"\n # },\n # ]\n # }\n #\n payload = self.safe_value(response, 'payload', [])\n return self.parse_ohlcvs(payload, market, timeframe, since, limit)\n\n def parse_ohlcv(self, ohlcv, market=None, timeframe='1m'):\n #\n # {\n # \"bucket_start_time\":1648219140000,\n # \"first_trade_time\":1648219154990,\n # \"last_trade_time\":1648219189441,\n # \"first_rate\":\"44958.60\",\n # \"last_rate\":\"44979.88\",\n # \"min_rate\":\"44957.33\",\n # \"max_rate\":\"44979.88\",\n # \"trade_count\":8,\n # \"volume\":\"0.00082814\",\n # \"vwap\":\"44965.02\"\n # },\n #\n return [\n self.safe_integer(ohlcv, 'bucket_start_time'),\n self.safe_number(ohlcv, 'first_rate'),\n self.safe_number(ohlcv, 'max_rate'),\n self.safe_number(ohlcv, 'min_rate'),\n self.safe_number(ohlcv, 'last_rate'),\n self.safe_number(ohlcv, 'volume'),\n ]\n\n def parse_trade(self, trade, market=None):\n #\n # fetchTrades(public)\n #\n # {\n # \"book\": \"btc_usdt\",\n # \"created_at\": \"2021-11-24T12:14:53+0000\",\n # \"amount\": \"0.00026562\",\n # \"maker_side\": \"sell\",\n # \"price\": \"56471.55\",\n # \"tid\": \"52557338\"\n # }\n #\n # fetchMyTrades(private)\n #\n # {\n # \"book\": \"btc_usdt\",\n # \"created_at\": \"2021-11-24T12:31:03+0000\",\n # \"minor\": \"11.30356000\",\n # \"major\": \"-0.00020000\",\n # \"fees_amount\": \"0.01119052\",\n # \"fees_currency\": \"usdt\",\n # \"minor_currency\": \"usdt\",\n # \"major_currency\": \"btc\",\n # \"oid\": \"djTzMIWx2Vi3iMjl\",\n # \"tid\": \"52559051\",\n # \"price\": \"56517.80\",\n # \"side\": \"sell\",\n # \"maker_side\": \"buy\"\n # }\n #\n # fetchOrderTrades(private)\n #\n # {\n # \"book\": \"btc_usdt\",\n # \"created_at\": \"2021-11-24T12:30:52+0000\",\n # \"minor\": \"-11.33047916\",\n # \"major\": \"0.00020020\",\n # \"fees_amount\": \"0.00000020\",\n # \"fees_currency\": \"btc\",\n # \"minor_currency\": \"usdt\",\n # \"major_currency\": \"btc\",\n # \"oid\": \"O0D2zcljjjQF5xlG\",\n # \"tid\": \"52559030\",\n # \"price\": \"56595.80\",\n # \"side\": \"buy\",\n # \"maker_side\": \"sell\"\n # }\n #\n timestamp = self.parse8601(self.safe_string(trade, 'created_at'))\n marketId = self.safe_string(trade, 'book')\n symbol = self.safe_symbol(marketId, market, '_')\n side = self.safe_string_2(trade, 'side', 'maker_side')\n makerSide = self.safe_string(trade, 'maker_side')\n takerOrMaker = None\n if side == makerSide:\n takerOrMaker = 'maker'\n else:\n takerOrMaker = 'taker'\n amount = self.safe_string_2(trade, 'amount', 'major')\n if amount is not None:\n amount = Precise.string_abs(amount)\n fee = None\n feeCost = self.safe_string(trade, 'fees_amount')\n if feeCost is not None:\n feeCurrencyId = self.safe_string(trade, 'fees_currency')\n feeCurrency = self.safe_currency_code(feeCurrencyId)\n fee = {\n 'cost': feeCost,\n 'currency': feeCurrency,\n }\n cost = self.safe_string(trade, 'minor')\n if cost is not None:\n cost = Precise.string_abs(cost)\n price = self.safe_string(trade, 'price')\n orderId = self.safe_string(trade, 'oid')\n id = self.safe_string(trade, 'tid')\n return self.safe_trade({\n 'id': id,\n 'info': trade,\n 'timestamp': timestamp,\n 'datetime': self.iso8601(timestamp),\n 'symbol': symbol,\n 'order': orderId,\n 'type': None,\n 'side': side,\n 'takerOrMaker': takerOrMaker,\n 'price': price,\n 'amount': amount,\n 'cost': cost,\n 'fee': fee,\n }, market)\n\n def fetch_trades(self, symbol, since=None, limit=None, params={}):\n self.load_markets()\n market = self.market(symbol)\n request = {\n 'book': market['id'],\n }\n response = self.publicGetTrades(self.extend(request, params))\n return self.parse_trades(response['payload'], market, since, limit)\n\n def fetch_trading_fees(self, params={}):\n self.load_markets()\n response = self.privateGetFees(params)\n #\n # {\n # success: True,\n # payload: {\n # fees: [\n # {\n # book: 'btc_mxn',\n # fee_percent: '0.6500',\n # fee_decimal: '0.00650000',\n # taker_fee_percent: '0.6500',\n # taker_fee_decimal: '0.00650000',\n # maker_fee_percent: '0.5000',\n # maker_fee_decimal: '0.00500000',\n # volume_currency: 'mxn',\n # current_volume: '0.00',\n # next_volume: '1500000.00',\n # next_maker_fee_percent: '0.490',\n # next_taker_fee_percent: '0.637',\n # nextVolume: '1500000.00',\n # nextFee: '0.490',\n # nextTakerFee: '0.637'\n # },\n # ...\n # ],\n # deposit_fees: [\n # {\n # currency: 'btc',\n # method: 'rewards',\n # fee: '0.00',\n # is_fixed: False\n # },\n # ...\n # ],\n # withdrawal_fees: {\n # ada: '0.20958100',\n # bch: '0.00009437',\n # ars: '0',\n # btc: '0.00001209',\n # ...\n # }\n # }\n # }\n #\n payload = self.safe_value(response, 'payload', {})\n fees = self.safe_value(payload, 'fees', [])\n result = {}\n for i in range(0, len(fees)):\n fee = fees[i]\n marketId = self.safe_string(fee, 'book')\n symbol = self.safe_symbol(marketId, None, '_')\n result[symbol] = {\n 'info': fee,\n 'symbol': symbol,\n 'maker': self.safe_number(fee, 'maker_fee_decimal'),\n 'taker': self.safe_number(fee, 'taker_fee_decimal'),\n 'percentage': True,\n 'tierBased': True,\n }\n return result\n\n def fetch_my_trades(self, symbol=None, since=None, limit=25, params={}):\n self.load_markets()\n market = self.market(symbol)\n # the don't support fetching trades starting from a date yet\n # use the `marker` extra param for that\n # self is not a typo, the variable name is 'marker'(don't confuse with 'market')\n markerInParams = ('marker' in params)\n # warn the user with an exception if the user wants to filter\n # starting from since timestamp, but does not set the trade id with an extra 'marker' param\n if (since is not None) and not markerInParams:\n raise ExchangeError(self.id + ' fetchMyTrades does not support fetching trades starting from a timestamp with the `since` argument, use the `marker` extra param to filter starting from an integer trade id')\n # convert it to an integer unconditionally\n if markerInParams:\n params = self.extend(params, {\n 'marker': int(params['marker']),\n })\n request = {\n 'book': market['id'],\n 'limit': limit, # default = 25, max = 100\n # 'sort': 'desc', # default = desc\n # 'marker': id, # integer id to start from\n }\n response = self.privateGetUserTrades(self.extend(request, params))\n return self.parse_trades(response['payload'], market, since, limit)\n\n def create_order(self, symbol, type, side, amount, price=None, params={}):\n self.load_markets()\n request = {\n 'book': self.market_id(symbol),\n 'side': side,\n 'type': type,\n 'major': self.amount_to_precision(symbol, amount),\n }\n if type == 'limit':\n request['price'] = self.price_to_precision(symbol, price)\n response = self.privatePostOrders(self.extend(request, params))\n id = self.safe_string(response['payload'], 'oid')\n return {\n 'info': response,\n 'id': id,\n }\n\n def cancel_order(self, id, symbol=None, params={}):\n self.load_markets()\n request = {\n 'oid': id,\n }\n return self.privateDeleteOrdersOid(self.extend(request, params))\n\n def parse_order_status(self, status):\n statuses = {\n 'partial-fill': 'open', # self is a common substitution in ccxt\n 'completed': 'closed',\n }\n return self.safe_string(statuses, status, status)\n\n def parse_order(self, order, market=None):\n id = self.safe_string(order, 'oid')\n side = self.safe_string(order, 'side')\n status = self.parse_order_status(self.safe_string(order, 'status'))\n marketId = self.safe_string(order, 'book')\n symbol = self.safe_symbol(marketId, market, '_')\n orderType = self.safe_string(order, 'type')\n timestamp = self.parse8601(self.safe_string(order, 'created_at'))\n price = self.safe_string(order, 'price')\n amount = self.safe_string(order, 'original_amount')\n remaining = self.safe_string(order, 'unfilled_amount')\n clientOrderId = self.safe_string(order, 'client_id')\n return self.safe_order({\n 'info': order,\n 'id': id,\n 'clientOrderId': clientOrderId,\n 'timestamp': timestamp,\n 'datetime': self.iso8601(timestamp),\n 'lastTradeTimestamp': None,\n 'symbol': symbol,\n 'type': orderType,\n 'timeInForce': None,\n 'postOnly': None,\n 'side': side,\n 'price': price,\n 'stopPrice': None,\n 'amount': amount,\n 'cost': None,\n 'remaining': remaining,\n 'filled': None,\n 'status': status,\n 'fee': None,\n 'average': None,\n 'trades': None,\n }, market)\n\n def fetch_open_orders(self, symbol=None, since=None, limit=25, params={}):\n self.load_markets()\n market = self.market(symbol)\n # the don't support fetching trades starting from a date yet\n # use the `marker` extra param for that\n # self is not a typo, the variable name is 'marker'(don't confuse with 'market')\n markerInParams = ('marker' in params)\n # warn the user with an exception if the user wants to filter\n # starting from since timestamp, but does not set the trade id with an extra 'marker' param\n if (since is not None) and not markerInParams:\n raise ExchangeError(self.id + ' fetchOpenOrders does not support fetching orders starting from a timestamp with the `since` argument, use the `marker` extra param to filter starting from an integer trade id')\n # convert it to an integer unconditionally\n if markerInParams:\n params = self.extend(params, {\n 'marker': int(params['marker']),\n })\n request = {\n 'book': market['id'],\n 'limit': limit, # default = 25, max = 100\n # 'sort': 'desc', # default = desc\n # 'marker': id, # integer id to start from\n }\n response = self.privateGetOpenOrders(self.extend(request, params))\n orders = self.parse_orders(response['payload'], market, since, limit)\n return orders\n\n def fetch_order(self, id, symbol=None, params={}):\n self.load_markets()\n response = self.privateGetOrdersOid({\n 'oid': id,\n })\n payload = self.safe_value(response, 'payload')\n if isinstance(payload, list):\n numOrders = len(response['payload'])\n if numOrders == 1:\n return self.parse_order(payload[0])\n raise OrderNotFound(self.id + ': The order ' + id + ' not found.')\n\n def fetch_order_trades(self, id, symbol=None, since=None, limit=None, params={}):\n self.load_markets()\n market = self.market(symbol)\n request = {\n 'oid': id,\n }\n response = self.privateGetOrderTradesOid(self.extend(request, params))\n return self.parse_trades(response['payload'], market)\n\n def fetch_deposit_address(self, code, params={}):\n self.load_markets()\n currency = self.currency(code)\n request = {\n 'fund_currency': currency['id'],\n }\n response = self.privateGetFundingDestination(self.extend(request, params))\n address = self.safe_string(response['payload'], 'account_identifier')\n tag = None\n if address.find('?dt=') >= 0:\n parts = address.split('?dt=')\n address = self.safe_string(parts, 0)\n tag = self.safe_string(parts, 1)\n self.check_address(address)\n return {\n 'currency': code,\n 'address': address,\n 'tag': tag,\n 'network': None,\n 'info': response,\n }\n\n def fetch_funding_fees(self, params={}):\n self.load_markets()\n response = self.privateGetFees(params)\n #\n # {\n # success: True,\n # payload: {\n # fees: [\n # {\n # book: 'btc_mxn',\n # fee_percent: '0.6500',\n # fee_decimal: '0.00650000',\n # taker_fee_percent: '0.6500',\n # taker_fee_decimal: '0.00650000',\n # maker_fee_percent: '0.5000',\n # maker_fee_decimal: '0.00500000',\n # volume_currency: 'mxn',\n # current_volume: '0.00',\n # next_volume: '1500000.00',\n # next_maker_fee_percent: '0.490',\n # next_taker_fee_percent: '0.637',\n # nextVolume: '1500000.00',\n # nextFee: '0.490',\n # nextTakerFee: '0.637'\n # },\n # ...\n # ],\n # deposit_fees: [\n # {\n # currency: 'btc',\n # method: 'rewards',\n # fee: '0.00',\n # is_fixed: False\n # },\n # ...\n # ],\n # withdrawal_fees: {\n # ada: '0.20958100',\n # bch: '0.00009437',\n # ars: '0',\n # btc: '0.00001209',\n # ...\n # }\n # }\n # }\n #\n payload = self.safe_value(response, 'payload', {})\n depositFees = self.safe_value(payload, 'deposit_fees', [])\n deposit = {}\n for i in range(0, len(depositFees)):\n depositFee = depositFees[i]\n currencyId = self.safe_string(depositFee, 'currency')\n code = self.safe_currency_code(currencyId)\n deposit[code] = self.safe_number(depositFee, 'fee')\n withdraw = {}\n withdrawalFees = self.safe_value(payload, 'withdrawal_fees', [])\n currencyIds = list(withdrawalFees.keys())\n for i in range(0, len(currencyIds)):\n currencyId = currencyIds[i]\n code = self.safe_currency_code(currencyId)\n withdraw[code] = self.safe_number(withdrawalFees, currencyId)\n return {\n 'info': response,\n 'deposit': deposit,\n 'withdraw': withdraw,\n }\n\n def withdraw(self, code, amount, address, tag=None, params={}):\n tag, params = self.handle_withdraw_tag_and_params(tag, params)\n self.check_address(address)\n self.load_markets()\n methods = {\n 'BTC': 'Bitcoin',\n 'ETH': 'Ether',\n 'XRP': 'Ripple',\n 'BCH': 'Bcash',\n 'LTC': 'Litecoin',\n }\n currency = self.currency(code)\n method = methods[code] if (code in methods) else None\n if method is None:\n raise ExchangeError(self.id + ' not valid withdraw coin: ' + code)\n request = {\n 'amount': amount,\n 'address': address,\n 'destination_tag': tag,\n }\n classMethod = 'privatePost' + method + 'Withdrawal'\n response = getattr(self, classMethod)(self.extend(request, params))\n #\n # {\n # \"success\": True,\n # \"payload\": [\n # {\n # \"wid\": \"c5b8d7f0768ee91d3b33bee648318688\",\n # \"status\": \"pending\",\n # \"created_at\": \"2016-04-08T17:52:31.000+00:00\",\n # \"currency\": \"btc\",\n # \"method\": \"Bitcoin\",\n # \"amount\": \"0.48650929\",\n # \"details\": {\n # \"withdrawal_address\": \"18MsnATiNiKLqUHDTRKjurwMg7inCrdNEp\",\n # \"tx_hash\": \"d4f28394693e9fb5fffcaf730c11f32d1922e5837f76ca82189d3bfe30ded433\"\n # }\n # },\n # ]\n # }\n #\n payload = self.safe_value(response, 'payload', [])\n first = self.safe_value(payload, 0)\n return self.parse_transaction(first, currency)\n\n def parse_transaction(self, transaction, currency=None):\n #\n # withdraw\n #\n # {\n # \"wid\": \"c5b8d7f0768ee91d3b33bee648318688\",\n # \"status\": \"pending\",\n # \"created_at\": \"2016-04-08T17:52:31.000+00:00\",\n # \"currency\": \"btc\",\n # \"method\": \"Bitcoin\",\n # \"amount\": \"0.48650929\",\n # \"details\": {\n # \"withdrawal_address\": \"18MsnATiNiKLqUHDTRKjurwMg7inCrdNEp\",\n # \"tx_hash\": \"d4f28394693e9fb5fffcaf730c11f32d1922e5837f76ca82189d3bfe30ded433\"\n # }\n # }\n #\n currency = self.safe_currency(None, currency)\n return {\n 'id': self.safe_string(transaction, 'wid'),\n 'txid': None,\n 'timestamp': None,\n 'datetime': None,\n 'network': None,\n 'addressFrom': None,\n 'address': None,\n 'addressTo': None,\n 'amount': None,\n 'type': None,\n 'currency': currency['code'],\n 'status': None,\n 'updated': None,\n 'tagFrom': None,\n 'tag': None,\n 'tagTo': None,\n 'comment': None,\n 'fee': None,\n 'info': transaction,\n }\n\n def sign(self, path, api='public', method='GET', params={}, headers=None, body=None):\n endpoint = '/' + self.version + '/' + self.implode_params(path, params)\n query = self.omit(params, self.extract_params(path))\n if method == 'GET':\n if query:\n endpoint += '?' + self.urlencode(query)\n url = self.urls['api'] + endpoint\n if api == 'private':\n self.check_required_credentials()\n nonce = str(self.nonce())\n request = ''.join([nonce, method, endpoint])\n if method != 'GET':\n if query:\n body = self.json(query)\n request += body\n signature = self.hmac(self.encode(request), self.encode(self.secret))\n auth = self.apiKey + ':' + nonce + ':' + signature\n headers = {\n 'Authorization': 'Bitso ' + auth,\n 'Content-Type': 'application/json',\n }\n return {'url': url, 'method': method, 'body': body, 'headers': headers}\n\n def handle_errors(self, httpCode, reason, url, method, headers, body, response, requestHeaders, requestBody):\n if response is None:\n return # fallback to default error handler\n if 'success' in response:\n #\n # {\"success\":false,\"error\":{\"code\":104,\"message\":\"Cannot perform request - nonce must be higher than 1520307203724237\"}}\n #\n success = self.safe_value(response, 'success', False)\n if isinstance(success, str):\n if (success == 'true') or (success == '1'):\n success = True\n else:\n success = False\n if not success:\n feedback = self.id + ' ' + self.json(response)\n error = self.safe_value(response, 'error')\n if error is None:\n raise ExchangeError(feedback)\n code = self.safe_string(error, 'code')\n self.throw_exactly_matched_exception(self.exceptions, code, feedback)\n raise ExchangeError(feedback)\n"},"avg_line_length":{"kind":"number","value":39.9672619048,"string":"39.967262"},"max_line_length":{"kind":"number","value":220,"string":"220"},"alphanum_fraction":{"kind":"number","value":0.4543152878,"string":"0.454315"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"AsquaredXIV/ccxt"},"path":{"kind":"string","value":"python/ccxt/bitso.py"},"size":{"kind":"number","value":40287,"string":"40,287"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8762,"cells":{"content":{"kind":"string","value":"# list all object store access policies\nres = client.get_object_store_access_policies()\nprint(res)\nif type(res) == pypureclient.responses.ValidResponse:\n print(list(res.items))\n# Valid fields: continuation_token, filter, ids, limit, names, offset, sort\n# See section \"Common Fields\" for examples\n"},"avg_line_length":{"kind":"number","value":37.375,"string":"37.375"},"max_line_length":{"kind":"number","value":75,"string":"75"},"alphanum_fraction":{"kind":"number","value":0.7759197324,"string":"0.77592"},"licenses":{"kind":"list like","value":["BSD-2-Clause"],"string":"[\n \"BSD-2-Clause\"\n]"},"repository_name":{"kind":"string","value":"Flav-STOR-WL/py-pure-client"},"path":{"kind":"string","value":"docs/source/examples/FB2.0/get_object_store_access_policies.py"},"size":{"kind":"number","value":299,"string":"299"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8763,"cells":{"content":{"kind":"string","value":"import logging\nimport urllib.parse\nfrom typing import Any, Dict, Optional, Type, Union\n\nfrom globus_sdk import config, exc, utils\nfrom globus_sdk.authorizers import GlobusAuthorizer\nfrom globus_sdk.paging import PaginatorTable\nfrom globus_sdk.response import GlobusHTTPResponse\nfrom globus_sdk.scopes import ScopeBuilder\nfrom globus_sdk.transport import RequestsTransport\n\nlog = logging.getLogger(__name__)\n\n\nclass BaseClient:\n r\"\"\"\n Abstract base class for clients with error handling for Globus APIs.\n\n :param authorizer: A ``GlobusAuthorizer`` which will generate Authorization headers\n :type authorizer: :class:`GlobusAuthorizer\\\n <globus_sdk.authorizers.base.GlobusAuthorizer>`\n :param app_name: Optional \"nice name\" for the application. Has no bearing on the\n semantics of client actions. It is just passed as part of the User-Agent\n string, and may be useful when debugging issues with the Globus Team\n :type app_name: str\n :param transport_params: Options to pass to the transport for this client\n :type transport_params: dict\n\n All other parameters are for internal use and should be ignored.\n \"\"\"\n # service name is used to lookup a service URL from config\n service_name: str = \"_base\"\n # path under the client base URL\n base_path: str = \"/\"\n\n #: the class for errors raised by this client on HTTP 4xx and 5xx errors\n #: this can be set in subclasses, but must always be a subclass of GlobusError\n error_class: Type[exc.GlobusAPIError] = exc.GlobusAPIError\n\n #: the type of Transport which will be used, defaults to ``RequestsTransport``\n transport_class: Type[RequestsTransport] = RequestsTransport\n\n #: the scopes for this client may be present as a ``ScopeBuilder``\n scopes: Optional[ScopeBuilder] = None\n\n def __init__(\n self,\n *,\n environment: Optional[str] = None,\n base_url: Optional[str] = None,\n authorizer: Optional[GlobusAuthorizer] = None,\n app_name: Optional[str] = None,\n transport_params: Optional[Dict[str, Any]] = None,\n ):\n # explicitly check the `service_name` to ensure that it was set\n #\n # unfortunately, we can't rely on declaring BaseClient as an ABC because it\n # doesn't have any abstract methods\n #\n # if we declare `service_name` without a value, we get AttributeError on access\n # instead of the (desired) TypeError when instantiating a BaseClient because\n # it's abstract\n if self.service_name == \"_base\":\n raise NotImplementedError(\n \"Cannot instantiate clients which do not set a 'service_name'\"\n )\n log.info(\n f'Creating client of type {type(self)} for service \"{self.service_name}\"'\n )\n\n # if an environment was passed, it will be used, but otherwise lookup\n # the env var -- and in the special case of `production` translate to\n # `default`, regardless of the source of that value\n # logs the environment when it isn't `default`\n self.environment = config.get_environment_name(environment)\n\n self.transport = self.transport_class(**(transport_params or {}))\n log.debug(f\"initialized transport of type {type(self.transport)}\")\n\n if not self.service_name and not base_url:\n raise ValueError(\"Either service_name or base_url must be set\")\n\n self.base_url = utils.slash_join(\n config.get_service_url(self.service_name, environment=self.environment)\n if base_url is None\n else base_url,\n self.base_path,\n )\n\n self.authorizer = authorizer\n\n # set application name if given\n self._app_name = None\n if app_name is not None:\n self.app_name = app_name\n\n # setup paginated methods\n self.paginated = PaginatorTable(self)\n\n @property\n def app_name(self) -> Optional[str]:\n return self._app_name\n\n @app_name.setter\n def app_name(self, value: str) -> None:\n self._app_name = self.transport.user_agent = value\n\n @utils.classproperty\n def resource_server(cls) -> Optional[str]:\n \"\"\"\n The resource_server name for the API and scopes associated with this client.\n\n This information is pulled from the ``scopes`` attribute of the client class.\n If the client does not have associated scopes, this value will be ``None``.\n \"\"\"\n if cls.scopes is None:\n return None\n return cls.scopes.resource_server\n\n def get(\n self,\n path: str,\n *,\n query_params: Optional[Dict[str, Any]] = None,\n headers: Optional[Dict[str, str]] = None,\n ) -> GlobusHTTPResponse:\n \"\"\"\n Make a GET request to the specified path.\n\n See :py:meth:`~.BaseClient.request` for details on the various parameters.\n\n :return: :class:`GlobusHTTPResponse \\\n <globus_sdk.response.GlobusHTTPResponse>` object\n \"\"\"\n log.debug(f\"GET to {path} with query_params {query_params}\")\n return self.request(\"GET\", path, query_params=query_params, headers=headers)\n\n def post(\n self,\n path: str,\n *,\n query_params: Optional[Dict[str, Any]] = None,\n data: Union[None, Dict[str, Any], utils.PayloadWrapper] = None,\n headers: Optional[Dict[str, str]] = None,\n encoding: Optional[str] = None,\n ) -> GlobusHTTPResponse:\n \"\"\"\n Make a POST request to the specified path.\n\n See :py:meth:`~.BaseClient.request` for details on the various parameters.\n\n :return: :class:`GlobusHTTPResponse \\\n <globus_sdk.response.GlobusHTTPResponse>` object\n \"\"\"\n log.debug(f\"POST to {path} with query_params {query_params}\")\n return self.request(\n \"POST\",\n path,\n query_params=query_params,\n data=data,\n headers=headers,\n encoding=encoding,\n )\n\n def delete(\n self,\n path: str,\n *,\n query_params: Optional[Dict[str, Any]] = None,\n headers: Optional[Dict[str, str]] = None,\n ) -> GlobusHTTPResponse:\n \"\"\"\n Make a DELETE request to the specified path.\n\n See :py:meth:`~.BaseClient.request` for details on the various parameters.\n\n :return: :class:`GlobusHTTPResponse \\\n <globus_sdk.response.GlobusHTTPResponse>` object\n \"\"\"\n log.debug(f\"DELETE to {path} with query_params {query_params}\")\n return self.request(\"DELETE\", path, query_params=query_params, headers=headers)\n\n def put(\n self,\n path: str,\n *,\n query_params: Optional[Dict[str, Any]] = None,\n data: Union[None, Dict[str, Any], utils.PayloadWrapper] = None,\n headers: Optional[Dict[str, str]] = None,\n encoding: Optional[str] = None,\n ) -> GlobusHTTPResponse:\n \"\"\"\n Make a PUT request to the specified path.\n\n See :py:meth:`~.BaseClient.request` for details on the various parameters.\n\n :return: :class:`GlobusHTTPResponse \\\n <globus_sdk.response.GlobusHTTPResponse>` object\n \"\"\"\n log.debug(f\"PUT to {path} with query_params {query_params}\")\n return self.request(\n \"PUT\",\n path,\n query_params=query_params,\n data=data,\n headers=headers,\n encoding=encoding,\n )\n\n def patch(\n self,\n path: str,\n *,\n query_params: Optional[Dict[str, Any]] = None,\n data: Union[None, Dict[str, Any], utils.PayloadWrapper] = None,\n headers: Optional[Dict[str, str]] = None,\n encoding: Optional[str] = None,\n ) -> GlobusHTTPResponse:\n \"\"\"\n Make a PATCH request to the specified path.\n\n See :py:meth:`~.BaseClient.request` for details on the various parameters.\n\n :return: :class:`GlobusHTTPResponse \\\n <globus_sdk.response.GlobusHTTPResponse>` object\n \"\"\"\n log.debug(f\"PATCH to {path} with query_params {query_params}\")\n return self.request(\n \"PATCH\",\n path,\n query_params=query_params,\n data=data,\n headers=headers,\n encoding=encoding,\n )\n\n def request(\n self,\n method: str,\n path: str,\n *,\n query_params: Optional[Dict[str, Any]] = None,\n data: Union[None, Dict[str, Any], utils.PayloadWrapper] = None,\n headers: Optional[Dict[str, str]] = None,\n encoding: Optional[str] = None,\n ) -> GlobusHTTPResponse:\n \"\"\"\n Send an HTTP request\n\n :param method: HTTP request method, as an all caps string\n :type method: str\n :param path: Path for the request, with or without leading slash\n :type path: str\n :param query_params: Parameters to be encoded as a query string\n :type query_params: dict, optional\n :param headers: HTTP headers to add to the request\n :type headers: dict\n :param data: Data to send as the request body. May pass through encoding.\n :type data: dict or str\n :param encoding: A way to encode request data. \"json\", \"form\", and \"text\"\n are all valid values. Custom encodings can be used only if they are\n registered with the transport. By default, strings get \"text\" behavior and\n all other objects get \"json\".\n :type encoding: str\n\n :return: :class:`GlobusHTTPResponse \\\n <globus_sdk.response.GlobusHTTPResponse>` object\n \"\"\"\n # prepare data...\n # copy headers if present\n rheaders = {**headers} if headers else {}\n\n # if a client is asked to make a request against a full URL, not just the path\n # component, then do not resolve the path, simply pass it through as the URL\n if path.startswith(\"https://\") or path.startswith(\"http://\"):\n url = path\n else:\n url = utils.slash_join(self.base_url, urllib.parse.quote(path))\n\n # make the request\n log.debug(\"request will hit URL: %s\", url)\n r = self.transport.request(\n method=method,\n url=url,\n data=data.data if isinstance(data, utils.PayloadWrapper) else data,\n query_params=query_params,\n headers=rheaders,\n encoding=encoding,\n authorizer=self.authorizer,\n )\n log.debug(\"request made to URL: %s\", r.url)\n\n if 200 <= r.status_code < 400:\n log.debug(f\"request completed with response code: {r.status_code}\")\n return GlobusHTTPResponse(r, self)\n\n log.debug(f\"request completed with (error) response code: {r.status_code}\")\n raise self.error_class(r)\n"},"avg_line_length":{"kind":"number","value":36.1337792642,"string":"36.133779"},"max_line_length":{"kind":"number","value":87,"string":"87"},"alphanum_fraction":{"kind":"number","value":0.6231951129,"string":"0.623195"},"licenses":{"kind":"list like","value":["ECL-2.0","Apache-2.0"],"string":"[\n \"ECL-2.0\",\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"rudyardrichter/globus-sdk-python"},"path":{"kind":"string","value":"src/globus_sdk/client.py"},"size":{"kind":"number","value":10804,"string":"10,804"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8764,"cells":{"content":{"kind":"string","value":"#!/Users/drpaneas/Virtualenvs/linuxed/bin/python2.7\n\n# $Id: rst2pseudoxml.py 4564 2006-05-21 20:44:42Z wiemann $\n# Author: David Goodger <goodger@python.org>\n# Copyright: This module has been placed in the public domain.\n\n\"\"\"\nA minimal front end to the Docutils Publisher, producing pseudo-XML.\n\"\"\"\n\ntry:\n import locale\n locale.setlocale(locale.LC_ALL, '')\nexcept:\n pass\n\nfrom docutils.core import publish_cmdline, default_description\n\n\ndescription = ('Generates pseudo-XML from standalone reStructuredText '\n 'sources (for testing purposes). ' + default_description)\n\npublish_cmdline(description=description)\n"},"avg_line_length":{"kind":"number","value":26.4166666667,"string":"26.416667"},"max_line_length":{"kind":"number","value":73,"string":"73"},"alphanum_fraction":{"kind":"number","value":0.7444794953,"string":"0.744479"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"drpaneas/linuxed.gr"},"path":{"kind":"string","value":"bin/rst2pseudoxml.py"},"size":{"kind":"number","value":634,"string":"634"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8765,"cells":{"content":{"kind":"string","value":"from django.urls import re_path\n\nfrom ..views import OptionsExportView, OptionsView\n\nurlpatterns = [\n re_path(r'^$', OptionsView.as_view(), name='options'),\n re_path(r'^export/(?P<format>[a-z]+)/$', OptionsExportView.as_view(), name='options_export'),\n]\n"},"avg_line_length":{"kind":"number","value":28.8888888889,"string":"28.888889"},"max_line_length":{"kind":"number","value":97,"string":"97"},"alphanum_fraction":{"kind":"number","value":0.7038461538,"string":"0.703846"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"GeoinformationSystems/rdmo"},"path":{"kind":"string","value":"rdmo/options/urls/__init__.py"},"size":{"kind":"number","value":260,"string":"260"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8766,"cells":{"content":{"kind":"string","value":"\"\"\"Identifiers for objects in Robustness Gym.\"\"\"\nfrom __future__ import annotations\n\nimport ast\nimport json\nfrom typing import Any, Callable, List, Union\n\n# from robustnessgym.core.tools import persistent_hash\n\n\nclass Identifier:\n \"\"\"Class for creating identifiers for objects in Robustness Gym.\"\"\"\n\n def __init__(\n self,\n _name: str,\n _index: Union[str, int] = None,\n **kwargs,\n ):\n\n self._name = _name\n self._index = str(_index) if _index is not None else None\n self._parameters = kwargs\n\n # Add the parameter\n for param, value in self.parameters.items():\n self.add_parameter(param, value)\n\n @property\n def name(self):\n \"\"\"Base name.\"\"\"\n return self._name\n\n @property\n def index(self):\n \"\"\"Index associated with the identifier.\"\"\"\n return self._index\n\n @property\n def parameters(self):\n \"\"\"Additional parameters contained in the identifier.\"\"\"\n return self._parameters\n\n @classmethod\n def range(cls, n: int, _name: str, **kwargs) -> List[Identifier]:\n \"\"\"Create a list of identifiers, with index varying from 1 to `n`.\"\"\"\n\n if n > 1:\n return [cls(_name=_name, _index=i, **kwargs) for i in range(1, n + 1)]\n return [cls(_name=_name, **kwargs)]\n\n def __call__(self, **kwargs):\n \"\"\"Call the identifier with additional parameters to return a new\n identifier.\"\"\"\n ident = Identifier.loads(self.dumps())\n for parameter, value in kwargs.items():\n ident.add_parameter(parameter, value)\n return ident\n\n def __repr__(self):\n params = \", \".join([f\"{k}={v}\" for k, v in self.parameters.items()])\n if self.index is not None:\n return (\n f\"{self.name}-{self.index}({params})\"\n if len(params) > 0\n else f\"{self.name}-{self.index}\"\n )\n return f\"{self.name}({params})\" if len(params) > 0 else f\"{self.name}\"\n\n def __hash__(self):\n # return persistent_hash(str(self))\n return hash(str(self))\n\n def __eq__(self, other: Union[Identifier, str]):\n return str(self) == str(other)\n\n def dumps(self):\n \"\"\"Dump the identifier to JSON.\"\"\"\n return json.dumps(self.__dict__)\n\n @staticmethod\n def _parse_args(s: str):\n \"\"\"https://stackoverflow.com/questions/49723047/parsing-a-string-as-a-\n python-argument-list.\"\"\"\n args = \"f({})\".format(s)\n tree = ast.parse(args)\n funccall = tree.body[0].value\n # return {arg.arg: ast.literal_eval(arg.value) for arg in funccall.keywords}\n params = {}\n for arg in funccall.keywords:\n try:\n params[arg.arg] = ast.literal_eval(arg.value)\n except ValueError:\n params[arg.arg] = arg.value.id\n return params\n\n @classmethod\n def parse(cls, s: str) -> Identifier:\n \"\"\"Parse in an identifier from string.\"\"\"\n # Parse out the various components\n if \"(\" in s:\n name_index, params = s.split(\"(\")\n params = params.split(\")\")[0]\n else:\n name_index = s\n params = None\n\n # Create the name and index\n if \"-\" in name_index:\n name, index = name_index.split(\"-\")[:-1], name_index.split(\"-\")[-1]\n name = \"-\".join(name)\n if index.isnumeric():\n index = int(index)\n else:\n name = \"-\".join([name, index])\n index = None\n else:\n name = name_index\n index = None\n\n # Parse out the params\n if params is not None:\n params = cls._parse_args(params)\n else:\n params = {}\n\n return cls(_name=name, _index=index, **params)\n\n def without(self, *params) -> Identifier:\n \"\"\"Returns an identifier without `params`.\"\"\"\n return Identifier(\n self.name,\n self.index,\n **{k: v for k, v in self.parameters.items() if k not in set(params)},\n )\n\n @classmethod\n def loads(cls, s: str):\n \"\"\"Load the identifier from JSON.\"\"\"\n identifier = Identifier(_name=\"\")\n identifier.__dict__ = json.loads(s)\n return identifier\n\n def add_parameter(self, parameter: str, value: Any) -> None:\n \"\"\"Add a parameter to the identifier.\"\"\"\n if isinstance(value, Callable):\n self.parameters[parameter] = \".\".join(\n [str(value.__module__), str(value.__name__)]\n )\n else:\n self.parameters[parameter] = value\n\n\n# Assign Id as an alias for the Identifier class\nId = Identifier\n"},"avg_line_length":{"kind":"number","value":30.25,"string":"30.25"},"max_line_length":{"kind":"number","value":84,"string":"84"},"alphanum_fraction":{"kind":"number","value":0.5592286501,"string":"0.559229"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"ANarayan/robustness-gym"},"path":{"kind":"string","value":"robustnessgym/core/identifier.py"},"size":{"kind":"number","value":4719,"string":"4,719"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8767,"cells":{"content":{"kind":"string","value":"# Copyright 2013-2022 Lawrence Livermore National Security, LLC and other\n# Spack Project Developers. See the top-level COPYRIGHT file for details.\n#\n# SPDX-License-Identifier: (Apache-2.0 OR MIT)\n\nfrom spack import *\n\n\nclass RAbind(RPackage):\n \"\"\"\n Combine Multidimensional Arrays.\n\n Combine multidimensional arrays into a single array. This is a\n generalization of 'cbind' and 'rbind'. Works with vectors, matrices, and\n higher-dimensional arrays. Also provides functions 'adrop', 'asub', and\n 'afill' for manipulating, extracting and replacing data in arrays.\"\"\"\n\n cran = \"abind\"\n\n version('1.4-5', sha256='3a3ace5afbcb86e56889efcebf3bf5c3bb042a282ba7cc4412d450bb246a3f2c')\n version('1.4-3', sha256='b6c255878c1ab81701ae701f34546e88be115629b984ac4272e311fa3c0ea6ce')\n\n depends_on('r@1.5.0:', type=('build', 'run'))\n"},"avg_line_length":{"kind":"number","value":35.3333333333,"string":"35.333333"},"max_line_length":{"kind":"number","value":95,"string":"95"},"alphanum_fraction":{"kind":"number","value":0.7429245283,"string":"0.742925"},"licenses":{"kind":"list like","value":["ECL-2.0","Apache-2.0","MIT-0","MIT"],"string":"[\n \"ECL-2.0\",\n \"Apache-2.0\",\n \"MIT-0\",\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"FJ-NaokiMatsumura/spack"},"path":{"kind":"string","value":"var/spack/repos/builtin/packages/r-abind/package.py"},"size":{"kind":"number","value":848,"string":"848"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8768,"cells":{"content":{"kind":"string","value":"import numpy as np\nimport torch\n\n\ndef get_sinusoid_encoding_table(n_position, d_hid, padding_idx=None):\n ''' Sinusoid position encoding table '''\n\n def cal_angle(position, hid_idx):\n return position / np.power(10000, 2 * (hid_idx // 2) / d_hid)\n\n def get_posi_angle_vec(position):\n return [cal_angle(position, hid_j) for hid_j in range(d_hid)]\n\n sinusoid_table = np.array([get_posi_angle_vec(pos_i) for pos_i in range(n_position)])\n\n sinusoid_table[:, 0::2] = np.sin(sinusoid_table[:, 0::2]) # dim 2i\n sinusoid_table[:, 1::2] = np.cos(sinusoid_table[:, 1::2]) # dim 2i+1\n\n if padding_idx is not None:\n # zero vector for padding dimension\n sinusoid_table[padding_idx] = 0.\n\n return torch.FloatTensor(sinusoid_table)"},"avg_line_length":{"kind":"number","value":33.3913043478,"string":"33.391304"},"max_line_length":{"kind":"number","value":89,"string":"89"},"alphanum_fraction":{"kind":"number","value":0.6848958333,"string":"0.684896"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"MrSchnappi/RL-for-Question-Generation"},"path":{"kind":"string","value":"src/onqg/utils/sinusoid.py"},"size":{"kind":"number","value":768,"string":"768"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8769,"cells":{"content":{"kind":"string","value":"from unittest import TestCase\n\n\nclass TestNumbers2Words(TestCase):\n from numbers2words import numbers2words\n\n # 1-10\n def test_one(self):\n self.assertEqual(numbers2words(1), \"one\")\n\n def test_two(self):\n self.assertEqual(numbers2words(2), \"two\")\n\n def test_three(self):\n self.assertEqual(numbers2words(3), \"three\")\n\n def test_four(self):\n self.assertEqual(numbers2words(4), \"four\")\n\n def test_five(self):\n self.assertEqual(numbers2words(5), \"five\")\n\n def test_six(self):\n self.assertEqual(numbers2words(6), \"six\")\n\n def test_seven(self):\n self.assertEqual(numbers2words(7), \"seven\")\n\n def test_eight(self):\n self.assertEqual(numbers2words(8), \"eight\")\n\n def test_nine(self):\n self.assertEqual(numbers2words(9), \"nine\")\n\n def test_ten(self):\n self.assertEqual(numbers2words(10), \"ten\")\n\n # 11-20\n def test_eleven(self):\n self.assertEqual(numbers2words(11), \"eleven\")\n\n def test_twelve(self):\n self.assertEqual(numbers2words(12), \"twelve\")\n\n def test_thirteen(self):\n self.assertEqual(numbers2words(13), \"thirteen\")\n\n def test_fourteen(self):\n self.assertEqual(numbers2words(14), \"fourteen\")\n\n def test_fifteen(self):\n self.assertEqual(numbers2words(15), \"fifteen\")\n\n def test_sixteen(self):\n self.assertEqual(numbers2words(16), \"sixteen\")\n\n def test_seventeen(self):\n self.assertEqual(numbers2words(17), \"seventeen\")\n\n def test_eighteen(self):\n self.assertEqual(numbers2words(18), \"eighteen\")\n\n def test_nineteen(self):\n self.assertEqual(numbers2words(19), \"nineteen\")\n\n def test_twenty(self):\n self.assertEqual(numbers2words(20), \"twenty\")\n\n\n"},"avg_line_length":{"kind":"number","value":23.2142857143,"string":"23.214286"},"max_line_length":{"kind":"number","value":52,"string":"52"},"alphanum_fraction":{"kind":"number","value":0.7101538462,"string":"0.710154"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"gnuchu/n2w"},"path":{"kind":"string","value":"tests/test_n2w.py"},"size":{"kind":"number","value":1625,"string":"1,625"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8770,"cells":{"content":{"kind":"string","value":"# Copyright 2018 The TensorFlow Authors. All Rights Reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n# ==============================================================================\n\"\"\"Common util functions and classes used by both keras cifar and imagenet.\"\"\"\nfrom __future__ import absolute_import\nfrom __future__ import division\nfrom __future__ import print_function\n\nimport os\n\nfrom absl import flags\nimport numpy as np\nimport tensorflow as tf\n\nfrom tensorflow.python.keras.optimizer_v2 import gradient_descent as gradient_descent_v2\nimport tensorflow_model_optimization as tfmot\nfrom official.utils.flags import core as flags_core\nfrom official.utils.misc import keras_utils\n\nFLAGS = flags.FLAGS\nBASE_LEARNING_RATE = 0.1 # This matches Jing's version.\nTRAIN_TOP_1 = 'training_accuracy_top_1'\nLR_SCHEDULE = [ # (multiplier, epoch to start) tuples\n (1.0, 5), (0.1, 30), (0.01, 60), (0.001, 80)\n]\n\n\ndef learning_rate_schedule(current_epoch,\n current_batch,\n steps_per_epoch,\n batch_size):\n \"\"\"Handles linear scaling rule, gradual warmup, and LR decay.\n\n Scale learning rate at epoch boundaries provided in LR_SCHEDULE by the\n provided scaling factor.\n\n Args:\n current_epoch: integer, current epoch indexed from 0.\n current_batch: integer, current batch in the current epoch, indexed from 0.\n steps_per_epoch: integer, number of steps in an epoch.\n batch_size: integer, total batch sized.\n\n Returns:\n Adjusted learning rate.\n \"\"\"\n initial_lr = BASE_LEARNING_RATE * batch_size / 256\n epoch = current_epoch + float(current_batch) / steps_per_epoch\n warmup_lr_multiplier, warmup_end_epoch = LR_SCHEDULE[0]\n if epoch < warmup_end_epoch:\n # Learning rate increases linearly per step.\n return initial_lr * warmup_lr_multiplier * epoch / warmup_end_epoch\n for mult, start_epoch in LR_SCHEDULE:\n if epoch >= start_epoch:\n learning_rate = initial_lr * mult\n else:\n break\n return learning_rate\n\n\nclass LearningRateBatchScheduler(tf.keras.callbacks.Callback):\n \"\"\"Callback to update learning rate on every batch (not epoch boundaries).\n\n N.B. Only support Keras optimizers, not TF optimizers.\n\n Attributes:\n schedule: a function that takes an epoch index and a batch index as input\n (both integer, indexed from 0) and returns a new learning rate as\n output (float).\n \"\"\"\n\n def __init__(self, schedule, batch_size, steps_per_epoch):\n super(LearningRateBatchScheduler, self).__init__()\n self.schedule = schedule\n self.steps_per_epoch = steps_per_epoch\n self.batch_size = batch_size\n self.epochs = -1\n self.prev_lr = -1\n\n def on_epoch_begin(self, epoch, logs=None):\n if not hasattr(self.model.optimizer, 'learning_rate'):\n raise ValueError('Optimizer must have a \"learning_rate\" attribute.')\n self.epochs += 1\n\n def on_batch_begin(self, batch, logs=None):\n \"\"\"Executes before step begins.\"\"\"\n lr = self.schedule(self.epochs,\n batch,\n self.steps_per_epoch,\n self.batch_size)\n if not isinstance(lr, (float, np.float32, np.float64)):\n raise ValueError('The output of the \"schedule\" function should be float.')\n if lr != self.prev_lr:\n self.model.optimizer.learning_rate = lr # lr should be a float here\n self.prev_lr = lr\n tf.compat.v1.logging.debug(\n 'Epoch %05d Batch %05d: LearningRateBatchScheduler '\n 'change learning rate to %s.', self.epochs, batch, lr)\n\n\nclass PiecewiseConstantDecayWithWarmup(\n tf.keras.optimizers.schedules.LearningRateSchedule):\n \"\"\"Piecewise constant decay with warmup schedule.\"\"\"\n\n def __init__(self, batch_size, epoch_size, warmup_epochs, boundaries,\n multipliers, compute_lr_on_cpu=True, name=None):\n super(PiecewiseConstantDecayWithWarmup, self).__init__()\n if len(boundaries) != len(multipliers) - 1:\n raise ValueError('The length of boundaries must be 1 less than the '\n 'length of multipliers')\n\n base_lr_batch_size = 256\n steps_per_epoch = epoch_size // batch_size\n\n self.rescaled_lr = BASE_LEARNING_RATE * batch_size / base_lr_batch_size\n self.step_boundaries = [float(steps_per_epoch) * x for x in boundaries]\n self.lr_values = [self.rescaled_lr * m for m in multipliers]\n self.warmup_steps = warmup_epochs * steps_per_epoch\n self.compute_lr_on_cpu = compute_lr_on_cpu\n self.name = name\n\n self.learning_rate_ops_cache = {}\n\n def __call__(self, step):\n if tf.executing_eagerly():\n return self._get_learning_rate(step)\n\n # In an eager function or graph, the current implementation of optimizer\n # repeatedly call and thus create ops for the learning rate schedule. To\n # avoid this, we cache the ops if not executing eagerly.\n graph = tf.compat.v1.get_default_graph()\n if graph not in self.learning_rate_ops_cache:\n if self.compute_lr_on_cpu:\n with tf.device('/device:CPU:0'):\n self.learning_rate_ops_cache[graph] = self._get_learning_rate(step)\n else:\n self.learning_rate_ops_cache[graph] = self._get_learning_rate(step)\n return self.learning_rate_ops_cache[graph]\n\n def _get_learning_rate(self, step):\n \"\"\"Compute learning rate at given step.\"\"\"\n with tf.compat.v1.name_scope(self.name, 'PiecewiseConstantDecayWithWarmup',\n [self.rescaled_lr, self.step_boundaries,\n self.lr_values, self.warmup_steps,\n self.compute_lr_on_cpu]):\n def warmup_lr(step):\n return self.rescaled_lr * (\n tf.cast(step, tf.float32) / tf.cast(self.warmup_steps, tf.float32))\n def piecewise_lr(step):\n return tf.compat.v1.train.piecewise_constant(\n step, self.step_boundaries, self.lr_values)\n return tf.cond(step < self.warmup_steps,\n lambda: warmup_lr(step),\n lambda: piecewise_lr(step))\n\n def get_config(self):\n return {\n 'rescaled_lr': self.rescaled_lr,\n 'step_boundaries': self.step_boundaries,\n 'lr_values': self.lr_values,\n 'warmup_steps': self.warmup_steps,\n 'compute_lr_on_cpu': self.compute_lr_on_cpu,\n 'name': self.name\n }\n\n\ndef get_optimizer(learning_rate=0.1):\n \"\"\"Returns optimizer to use.\"\"\"\n # The learning_rate is overwritten at the beginning of each step by callback.\n return gradient_descent_v2.SGD(learning_rate=learning_rate, momentum=0.9)\n\n\n# TODO(hongkuny,haoyuzhang): make cifar model use_tensor_lr to clean up code.\ndef get_callbacks(\n steps_per_epoch,\n learning_rate_schedule_fn=None,\n pruning_method=None,\n enable_checkpoint_and_export=False,\n model_dir=None):\n \"\"\"Returns common callbacks.\"\"\"\n time_callback = keras_utils.TimeHistory(FLAGS.batch_size, FLAGS.log_steps)\n callbacks = [time_callback]\n\n if not FLAGS.use_tensor_lr and learning_rate_schedule_fn:\n lr_callback = LearningRateBatchScheduler(\n learning_rate_schedule_fn,\n batch_size=FLAGS.batch_size,\n steps_per_epoch=steps_per_epoch)\n callbacks.append(lr_callback)\n\n if FLAGS.enable_tensorboard:\n tensorboard_callback = tf.keras.callbacks.TensorBoard(\n log_dir=FLAGS.model_dir)\n callbacks.append(tensorboard_callback)\n\n if FLAGS.profile_steps:\n profiler_callback = keras_utils.get_profiler_callback(\n FLAGS.model_dir,\n FLAGS.profile_steps,\n FLAGS.enable_tensorboard,\n steps_per_epoch)\n callbacks.append(profiler_callback)\n\n is_pruning_enabled = pruning_method is not None\n if is_pruning_enabled:\n callbacks.append(tfmot.sparsity.keras.UpdatePruningStep())\n if model_dir is not None:\n callbacks.append(tfmot.sparsity.keras.PruningSummaries(\n log_dir=model_dir, profile_batch=0))\n\n if enable_checkpoint_and_export:\n if model_dir is not None:\n ckpt_full_path = os.path.join(model_dir, 'model.ckpt-{epoch:04d}')\n callbacks.append(\n tf.keras.callbacks.ModelCheckpoint(ckpt_full_path,\n save_weights_only=True))\n return callbacks\n\n\ndef build_stats(history, eval_output, callbacks):\n \"\"\"Normalizes and returns dictionary of stats.\n\n Args:\n history: Results of the training step. Supports both categorical_accuracy\n and sparse_categorical_accuracy.\n eval_output: Output of the eval step. Assumes first value is eval_loss and\n second value is accuracy_top_1.\n callbacks: a list of callbacks which might include a time history callback\n used during keras.fit.\n\n Returns:\n Dictionary of normalized results.\n \"\"\"\n stats = {}\n if eval_output:\n stats['accuracy_top_1'] = eval_output[1].item()\n stats['eval_loss'] = eval_output[0].item()\n\n if history and history.history:\n train_hist = history.history\n # Gets final loss from training.\n stats['loss'] = train_hist['loss'][-1].item()\n # Gets top_1 training accuracy.\n if 'categorical_accuracy' in train_hist:\n stats[TRAIN_TOP_1] = train_hist['categorical_accuracy'][-1].item()\n elif 'sparse_categorical_accuracy' in train_hist:\n stats[TRAIN_TOP_1] = train_hist['sparse_categorical_accuracy'][-1].item()\n\n if not callbacks:\n return stats\n\n # Look for the time history callback which was used during keras.fit\n for callback in callbacks:\n if isinstance(callback, keras_utils.TimeHistory):\n timestamp_log = callback.timestamp_log\n stats['step_timestamp_log'] = timestamp_log\n stats['train_finish_time'] = callback.train_finish_time\n if len(timestamp_log) > 1:\n stats['avg_exp_per_second'] = (\n callback.batch_size * callback.log_steps *\n (len(callback.timestamp_log)-1) /\n (timestamp_log[-1].timestamp - timestamp_log[0].timestamp))\n return stats\n\n\ndef define_keras_flags(\n dynamic_loss_scale=True,\n model=False,\n optimizer=False,\n pretrained_filepath=False):\n \"\"\"Define flags for Keras models.\"\"\"\n flags_core.define_base(clean=True, num_gpu=True, run_eagerly=True,\n train_epochs=True, epochs_between_evals=True,\n distribution_strategy=True)\n flags_core.define_performance(num_parallel_calls=False,\n synthetic_data=True,\n dtype=True,\n all_reduce_alg=True,\n num_packs=True,\n tf_gpu_thread_mode=True,\n datasets_num_private_threads=True,\n dynamic_loss_scale=dynamic_loss_scale,\n loss_scale=True,\n fp16_implementation=True,\n tf_data_experimental_slack=True,\n enable_xla=True,\n force_v2_in_keras_compile=True,\n training_dataset_cache=True)\n flags_core.define_image()\n flags_core.define_benchmark()\n flags_core.define_distribution()\n flags.adopt_module_key_flags(flags_core)\n\n flags.DEFINE_boolean(name='enable_eager', default=False, help='Enable eager?')\n flags.DEFINE_boolean(name='skip_eval', default=False, help='Skip evaluation?')\n # TODO(b/135607288): Remove this flag once we understand the root cause of\n # slowdown when setting the learning phase in Keras backend.\n flags.DEFINE_boolean(\n name='set_learning_phase_to_train', default=True,\n help='If skip eval, also set Keras learning phase to 1 (training).')\n flags.DEFINE_boolean(\n name='explicit_gpu_placement', default=False,\n help='If not using distribution strategy, explicitly set device scope '\n 'for the Keras training loop.')\n flags.DEFINE_boolean(name='use_trivial_model', default=False,\n help='Whether to use a trivial Keras model.')\n flags.DEFINE_boolean(name='report_accuracy_metrics', default=True,\n help='Report metrics during training and evaluation.')\n flags.DEFINE_boolean(name='use_tensor_lr', default=False,\n help='Use learning rate tensor instead of a callback.')\n flags.DEFINE_boolean(\n name='enable_tensorboard', default=False,\n help='Whether to enable Tensorboard callback.')\n flags.DEFINE_integer(\n name='train_steps', default=None,\n help='The number of steps to run for training. If it is larger than '\n '# batches per epoch, then use # batches per epoch. This flag will be '\n 'ignored if train_epochs is set to be larger than 1. ')\n flags.DEFINE_string(\n name='profile_steps', default=None,\n help='Save profiling data to model dir at given range of global steps. The '\n 'value must be a comma separated pair of positive integers, specifying '\n 'the first and last step to profile. For example, \"--profile_steps=2,4\" '\n 'triggers the profiler to process 3 steps, starting from the 2nd step. '\n 'Note that profiler has a non-trivial performance overhead, and the '\n 'output file can be gigantic if profiling many steps.')\n flags.DEFINE_boolean(\n name='batchnorm_spatial_persistent', default=True,\n help='Enable the spacial persistent mode for CuDNN batch norm kernel.')\n flags.DEFINE_boolean(\n name='enable_get_next_as_optional', default=False,\n help='Enable get_next_as_optional behavior in DistributedIterator.')\n flags.DEFINE_boolean(\n name='enable_checkpoint_and_export', default=False,\n help='Whether to enable a checkpoint callback and export the savedmodel.')\n flags.DEFINE_string(\n name='tpu', default='', help='TPU address to connect to.')\n flags.DEFINE_integer(\n name='steps_per_loop',\n default=500,\n help='Number of steps per training loop. Only training step happens '\n 'inside the loop. Callbacks will not be called inside. Will be capped at '\n 'steps per epoch.')\n flags.DEFINE_boolean(\n name='use_tf_while_loop',\n default=True,\n help='Whether to build a tf.while_loop inside the training loop on the '\n 'host. Setting it to True is critical to have peak performance on '\n 'TPU.')\n flags.DEFINE_boolean(\n name='use_tf_keras_layers', default=False,\n help='Whether to use tf.keras.layers instead of tf.python.keras.layers.'\n 'It only changes imagenet resnet model layers for now. This flag is '\n 'a temporal flag during transition to tf.keras.layers. Do not use this '\n 'flag for external usage. this will be removed shortly.')\n\n if model:\n flags.DEFINE_string('model', 'resnet50_v1.5',\n 'Name of model preset. (mobilenet, resnet50_v1.5)')\n if optimizer:\n flags.DEFINE_string('optimizer', 'resnet50_default',\n 'Name of optimizer preset. '\n '(mobilenet_default, resnet50_default)')\n # TODO(kimjaehong): Replace as general hyper-params not only for mobilenet.\n flags.DEFINE_float('initial_learning_rate_per_sample', 0.00007,\n 'Initial value of learning rate per sample for '\n 'mobilenet_default.')\n flags.DEFINE_float('lr_decay_factor', 0.94,\n 'Learning rate decay factor for mobilenet_default.')\n flags.DEFINE_float('num_epochs_per_decay', 2.5,\n 'Number of epochs per decay for mobilenet_default.')\n if pretrained_filepath:\n flags.DEFINE_string('pretrained_filepath', '',\n 'Pretrained file path.')\n\n\ndef get_synth_data(height, width, num_channels, num_classes, dtype):\n \"\"\"Creates a set of synthetic random data.\n\n Args:\n height: Integer height that will be used to create a fake image tensor.\n width: Integer width that will be used to create a fake image tensor.\n num_channels: Integer depth that will be used to create a fake image tensor.\n num_classes: Number of classes that should be represented in the fake labels\n tensor\n dtype: Data type for features/images.\n\n Returns:\n A tuple of tensors representing the inputs and labels.\n\n \"\"\"\n # Synthetic input should be within [0, 255].\n inputs = tf.random.truncated_normal([height, width, num_channels],\n dtype=dtype,\n mean=127,\n stddev=60,\n name='synthetic_inputs')\n labels = tf.random.uniform([1],\n minval=0,\n maxval=num_classes - 1,\n dtype=tf.int32,\n name='synthetic_labels')\n return inputs, labels\n\n\ndef define_pruning_flags():\n \"\"\"Define flags for pruning methods.\"\"\"\n flags.DEFINE_string('pruning_method', None,\n 'Pruning method.'\n 'None (no pruning) or polynomial_decay.')\n flags.DEFINE_float('pruning_initial_sparsity', 0.0,\n 'Initial sparsity for pruning.')\n flags.DEFINE_float('pruning_final_sparsity', 0.5,\n 'Final sparsity for pruning.')\n flags.DEFINE_integer('pruning_begin_step', 0,\n 'Begin step for pruning.')\n flags.DEFINE_integer('pruning_end_step', 100000,\n 'End step for pruning.')\n flags.DEFINE_integer('pruning_frequency', 100,\n 'Frequency for pruning.')\n\n\ndef get_synth_input_fn(height, width, num_channels, num_classes,\n dtype=tf.float32, drop_remainder=True):\n \"\"\"Returns an input function that returns a dataset with random data.\n\n This input_fn returns a data set that iterates over a set of random data and\n bypasses all preprocessing, e.g. jpeg decode and copy. The host to device\n copy is still included. This used to find the upper throughput bound when\n tuning the full input pipeline.\n\n Args:\n height: Integer height that will be used to create a fake image tensor.\n width: Integer width that will be used to create a fake image tensor.\n num_channels: Integer depth that will be used to create a fake image tensor.\n num_classes: Number of classes that should be represented in the fake labels\n tensor\n dtype: Data type for features/images.\n drop_remainder: A boolean indicates whether to drop the remainder of the\n batches. If True, the batch dimension will be static.\n\n Returns:\n An input_fn that can be used in place of a real one to return a dataset\n that can be used for iteration.\n \"\"\"\n # pylint: disable=unused-argument\n def input_fn(is_training, data_dir, batch_size, *args, **kwargs):\n \"\"\"Returns dataset filled with random data.\"\"\"\n inputs, labels = get_synth_data(height=height,\n width=width,\n num_channels=num_channels,\n num_classes=num_classes,\n dtype=dtype)\n # Cast to float32 for Keras model.\n labels = tf.cast(labels, dtype=tf.float32)\n data = tf.data.Dataset.from_tensors((inputs, labels)).repeat()\n\n # `drop_remainder` will make dataset produce outputs with known shapes.\n data = data.batch(batch_size, drop_remainder=drop_remainder)\n data = data.prefetch(buffer_size=tf.data.experimental.AUTOTUNE)\n return data\n\n return input_fn\n\n\ndef set_cudnn_batchnorm_mode():\n \"\"\"Set CuDNN batchnorm mode for better performance.\n\n Note: Spatial Persistent mode may lead to accuracy losses for certain\n models.\n \"\"\"\n if FLAGS.batchnorm_spatial_persistent:\n os.environ['TF_USE_CUDNN_BATCHNORM_SPATIAL_PERSISTENT'] = '1'\n else:\n os.environ.pop('TF_USE_CUDNN_BATCHNORM_SPATIAL_PERSISTENT', None)\n"},"avg_line_length":{"kind":"number","value":41.6995884774,"string":"41.699588"},"max_line_length":{"kind":"number","value":88,"string":"88"},"alphanum_fraction":{"kind":"number","value":0.6739366427,"string":"0.673937"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"Anku5hk/models"},"path":{"kind":"string","value":"official/vision/image_classification/common.py"},"size":{"kind":"number","value":20266,"string":"20,266"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8771,"cells":{"content":{"kind":"string","value":"import collections\nimport itertools\nfrom trie_class import Trie\nimport sys\nimport timeit\n\n\ndef load_dataset(filename):\n\n dataset = [sorted(int(n) for n in i.strip().split())\n for i in open(filename).readlines()]\n size = len(dataset)\n\n print('Size of the Dataset : ', size)\n\n total_len = 0\n\n for i in range(len(dataset)):\n total_len = total_len + len(dataset[i])\n\n avg_len = total_len / size\n print('Average Transaction Length : ', avg_len)\n\n # print(dataset)\n return dataset\n\n\ndef find_frequent_1_itemsets(dataset, min_sup):\n # print('1 - item func : min sup :', min_sup)\n\n frequency = dict(collections.Counter(\n itertools.chain.from_iterable(dataset)))\n\n L1 = dict()\n\n for item, freq in frequency.items():\n if freq >= min_sup:\n L1[item] = freq\n\n # print(L1)\n return L1\n\n# Input : L_k (k : itemset size)\n\n\ndef apriori_gen(L: list, k):\n # Self Join Step\n L_next = list()\n\n for l1 in L:\n for l2 in L:\n if len(set(l1) & set(l2)) == (k - 1):\n L_next.append(sorted(list(set(l1) | set(l2))))\n\n # Removing Duplicates\n L_set = set(tuple(x) for x in L_next)\n L_k1 = [list(x) for x in L_set]\n\n L_k1.sort(key=lambda x: L_next.index(x))\n L_k1_tuple = [tuple(i) for i in L_k1]\n info={'join':len(L_k1)}\n\n # Prune Step\n for c in L_k1_tuple:\n if has_infrequent_subset(c, L):\n L_k1.remove(list(c))\n\n info['prune'] = len(L_k1)\n # Returns list of lists [L_k + 1]\n return info,L_k1\n\n\ndef has_infrequent_subset(candidate: tuple, L: list):\n for subset in list(itertools.combinations(candidate, len(candidate) - 1)):\n if list(subset) not in L:\n return True\n\n return False\n\n\ndef apriori(db: list, min_sup):\n min_sup = (len(db) * min_sup) // 100\n # print('Apriori - min sup :', min_sup)\n\n levels = list()\n Levels_info = list()\n\n L1 = find_frequent_1_itemsets(db, min_sup)\n # print('L-1 :', L1)\n\n if bool(L1) == False:\n print('No 1-Itemset Satisfies Given Minimum Support Threshold')\n return None\n\n # Creating list of 1-itemset(list itself)\n _L1 = [[k] for k in L1.keys()]\n _L1 = sorted(_L1)\n\n # print('L1 :', L1)\n\n levels.append(_L1)\n Levels_info.append({'join': len(_L1), 'prune': len(_L1)})\n # print('Levels :', levels)\n\n while True:\n info,candidates = apriori_gen(levels[-1], len(levels[-1][0]))\n\n trie = Trie(db)\n trie.build_trie(candidates)\n trie.assign_frequency()\n\n L = list()\n\n # print('Func : Min Sup -', min_sup)\n\n for itemset in candidates:\n # print(itemset, trie.get_candidate_freq(itemset), trie.get_candidate_freq(itemset) >= min_sup)\n if trie.get_candidate_freq(itemset) >= min_sup:\n # print(itemset, trie.get_candidate_freq(itemset), trie.get_candidate_freq(itemset) >= min_sup)\n L.append(sorted(itemset))\n\n if not L:\n break\n\n levels.append(L)\n Levels_info.append(info)\n\n return Levels_info,levels\n\n\nif __name__ == \"__main__\":\n db = load_dataset(str(sys.argv[1]))\n min_sup = float(sys.argv[2])\n\n print('Dataset :', str(sys.argv[1]))\n print('Min Support :', min_sup, '%')\n print('Min Support Count :', (len(db) * min_sup) // 100)\n\n start = timeit.default_timer()\n\n info, L = apriori(db, min_sup)\n\n stop = timeit.default_timer()\n pattern_total,join_total,prune_total = 0,0,0\n print('Level', ' After Join', ' After Pruning', ' Frequent Itemsets')\n if L is not None:\n for i in range(len(L)):\n print()\n print((i + 1), info[i]['join'], info[i]['prune'], len(L[i]), sep='\\t\\t')\n pattern_total+=len(L[i])\n join_total+=info[i]['join']\n prune_total+= info[i]['prune']\n # print((i + 1), '- Frequent Itemsets :', L[i])\n print('\\nTotal', join_total, prune_total, pattern_total, sep='\\t\\t')\n print('\\nTime: ', stop - start, \" seconds\")\n"},"avg_line_length":{"kind":"number","value":25.8717948718,"string":"25.871795"},"max_line_length":{"kind":"number","value":111,"string":"111"},"alphanum_fraction":{"kind":"number","value":0.5882061447,"string":"0.588206"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"saif-mahmud/Data-Mining-Lab"},"path":{"kind":"string","value":"Frequent Pattern Mining/apriori.py"},"size":{"kind":"number","value":4036,"string":"4,036"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8772,"cells":{"content":{"kind":"string","value":"\"\"\"Spamming Module\r\n{i}spam <no of msgs> <msg>\r\n\r\nNote:- Don't use to much\"\"\" \r\n\r\n# Copyright (C) 2019 The Raphielscape Company LLC.\r\n#\r\n# Licensed under the Raphielscape Public License, Version 1.b (the \"License\");\r\n# you may not use this file except in compliance with the License.\r\n#\r\n\r\nfrom asyncio import wait\r\n\r\nfrom telethon import events\r\n\r\n\r\n\r\n@ItzSjDude(outgoing=True, pattern=r\"spam\")\r\nasync def spammer(e):\r\n if not e.text[0].isalpha() and e.text[0] not in (\"/\", \"#\", \"@\", \"!\"):\r\n message = e.text\r\n counter = int(message[6:8])\r\n spam_message = str(e.text[8:])\r\n\r\n await wait(\r\n [e.respond(spam_message) for i in range(counter)]\r\n )\r\n\r\n await e.delete()\r\n if LOGGER:\r\n await e.client.send_message(\r\n LOGGER_GROUP,\r\n \"#SPAM \\n\\n\"\r\n \"Spam was executed successfully\"\r\n )\r\n"},"avg_line_length":{"kind":"number","value":25.5277777778,"string":"25.527778"},"max_line_length":{"kind":"number","value":79,"string":"79"},"alphanum_fraction":{"kind":"number","value":0.5571273123,"string":"0.557127"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"xditya/PikaBotPlugins"},"path":{"kind":"string","value":"plugins/spam.py"},"size":{"kind":"number","value":919,"string":"919"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8773,"cells":{"content":{"kind":"string","value":"# stdlib\nimport json\nfrom typing import List\nfrom typing import NoReturn\nfrom typing import Optional\n\n# third party\nfrom fastapi import APIRouter\nfrom fastapi import Depends\nfrom fastapi import File\nfrom fastapi import Form\nfrom fastapi import UploadFile\nfrom loguru import logger\nfrom starlette import status\nfrom starlette.exceptions import HTTPException\n\n# grid absolute\nfrom grid.api.dependencies.current_user import get_current_user\nfrom grid.api.users.models import ApplicantStatus\nfrom grid.api.users.models import User\nfrom grid.api.users.models import UserCandidate\nfrom grid.api.users.models import UserCreate\nfrom grid.api.users.models import UserPrivate\nfrom grid.api.users.models import UserUpdate\n\n# relative\nfrom . import syft as syft_user_messages\n\n\ndef raise_generic_private_error() -> NoReturn:\n raise HTTPException(\n status_code=status.HTTP_500_INTERNAL_SERVER_ERROR,\n detail=\"There was an error processing your request.\",\n )\n\n\nrouter = APIRouter()\n\n\n@router.get(\"/me\", response_model=User, name=\"users:me\", status_code=status.HTTP_200_OK)\ndef get_self(current_user: UserPrivate = Depends(get_current_user)) -> User:\n return current_user\n\n\n# TODO: Syft should return the newly created user and the response model should be User.\n@router.post(\"\", name=\"users:create\", status_code=status.HTTP_201_CREATED)\nasync def create_user_grid(\n current_user: UserPrivate = Depends(get_current_user),\n new_user: str = Form(...),\n file: Optional[UploadFile] = File(None),\n) -> str:\n if file:\n pdf_file = file.file.read() # type: ignore\n else:\n pdf_file = b\"\"\n\n dict_user = json.loads(new_user)\n dict_user[\"daa_pdf\"] = pdf_file\n user_schema = UserCreate(**dict_user)\n try:\n return syft_user_messages.create_user(user_schema, current_user)\n except Exception as err:\n logger.error(err)\n raise_generic_private_error()\n\n\n@router.get(\"/applicants\", name=\"users:applicants\", status_code=status.HTTP_201_CREATED)\nasync def get_all_candidates(\n current_user: UserPrivate = Depends(get_current_user),\n) -> List[UserCandidate]:\n try:\n return syft_user_messages.get_user_requests(current_user)\n except Exception as err:\n logger.error(err)\n raise_generic_private_error()\n\n\n@router.patch(\n \"/applicants/{candidate_id}\",\n name=\"users:applicants:process\",\n status_code=status.HTTP_201_CREATED,\n)\nasync def process_applicant_request(\n candidate_id: int,\n request_status: ApplicantStatus,\n current_user: UserPrivate = Depends(get_current_user),\n) -> str:\n try:\n return syft_user_messages.process_applicant_request(\n current_user=current_user,\n candidate_id=candidate_id,\n status=request_status.status,\n )\n except Exception as err:\n logger.error(err)\n raise_generic_private_error()\n\n\n@router.get(\n \"\",\n response_model=List[User],\n name=\"users:read_all\",\n status_code=status.HTTP_200_OK,\n)\nasync def get_all_users_grid(\n current_user: UserPrivate = Depends(get_current_user),\n) -> List[User]:\n try:\n return syft_user_messages.get_all_users(current_user)\n except Exception as err:\n logger.error(err)\n raise_generic_private_error()\n\n\n@router.get(\n \"/{user_id}\",\n response_model=User,\n name=\"users:read_one\",\n status_code=status.HTTP_200_OK,\n)\nasync def get_user_grid(\n user_id: int, current_user: UserPrivate = Depends(get_current_user)\n) -> User:\n try:\n return syft_user_messages.get_user(user_id, current_user)\n except Exception as err:\n logger.error(err)\n raise_generic_private_error()\n\n\n@router.patch(\n \"/{user_id}\",\n name=\"users:update\",\n status_code=status.HTTP_204_NO_CONTENT,\n)\nasync def update_user_grid(\n user_id: int,\n updated_user: UserUpdate,\n current_user: UserPrivate = Depends(get_current_user),\n) -> None:\n try:\n syft_user_messages.update_user(user_id, current_user, updated_user)\n except Exception as err:\n logger.error(err)\n raise_generic_private_error()\n\n\n@router.delete(\n \"/{user_id}\", name=\"users:delete\", status_code=status.HTTP_204_NO_CONTENT\n)\nasync def delete_user_grid(\n user_id: int, current_user: UserPrivate = Depends(get_current_user)\n) -> None:\n try:\n syft_user_messages.delete_user(user_id, current_user)\n except Exception as err:\n logger.error(err)\n raise_generic_private_error()\n"},"avg_line_length":{"kind":"number","value":28.0691823899,"string":"28.069182"},"max_line_length":{"kind":"number","value":88,"string":"88"},"alphanum_fraction":{"kind":"number","value":0.7257450146,"string":"0.725745"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"BearerPipelineTest/PySyft"},"path":{"kind":"string","value":"packages/grid/backend/grid/api/users/routes.py"},"size":{"kind":"number","value":4463,"string":"4,463"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8774,"cells":{"content":{"kind":"string","value":"# Configuration file for the Sphinx documentation builder.\n#\n# This file only contains a selection of the most common options. For a full\n# list see the documentation:\n# https://www.sphinx-doc.org/en/master/usage/configuration.html\n\n# -- Path setup --------------------------------------------------------------\n\n# If extensions (or modules to document with autodoc) are in another directory,\n# add these directories to sys.path here. If the directory is relative to the\n# documentation root, use os.path.abspath to make it absolute, like shown here.\n#\nimport os\nimport sys\nsys.path.insert(0, os.path.abspath('../../../yara_scanner'))\n\n\n# -- Project information -----------------------------------------------------\n\nproject = 'yara-scanner'\ncopyright = '2020, John Davison'\nauthor = 'John Davison'\n\n# The full version, including alpha/beta/rc tags\nrelease = '1.0.14'\n\n\n# -- General configuration ---------------------------------------------------\n\n# Add any Sphinx extension module names here, as strings. They can be\n# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom\n# ones.\nextensions = [\n 'sphinx.ext.autodoc',\n 'sphinx.ext.intersphinx'\n]\n\n# Add any paths that contain templates here, relative to this directory.\ntemplates_path = ['_templates']\n\n# List of patterns, relative to source directory, that match files and\n# directories to ignore when looking for source files.\n# This pattern also affects html_static_path and html_extra_path.\nexclude_patterns = []\n\n\n# -- Options for HTML output -------------------------------------------------\n\n# The theme to use for HTML and HTML Help pages. See the documentation for\n# a list of builtin themes.\n#\nhtml_theme = 'alabaster'\n\n# Add any paths that contain custom static files (such as style sheets) here,\n# relative to this directory. They are copied after the builtin static files,\n# so a file named \"default.css\" will overwrite the builtin \"default.css\".\nhtml_static_path = ['_static']\n\nintersphinx_mapping = {'python': ('https://docs.python.org/3', None)}\n# Both the class’ and the __init__ method’s docstring are concatenated and inserted.\nautoclass_content = 'both'\n\nautodoc_inherit_docstrings = False\n\n"},"avg_line_length":{"kind":"number","value":33.6307692308,"string":"33.630769"},"max_line_length":{"kind":"number","value":84,"string":"84"},"alphanum_fraction":{"kind":"number","value":0.6742909424,"string":"0.674291"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"2d4d/yara_scanner"},"path":{"kind":"string","value":"docs/source/conf.py"},"size":{"kind":"number","value":2190,"string":"2,190"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8775,"cells":{"content":{"kind":"string","value":"import json\nimport os\nimport numpy as np\nimport tensorflow.compat.v1 as tf\nimport argparse\nfrom tqdm import tqdm\nimport model\nfrom encode_bpe import BPEEncoder_ja\n\nif int(tf.__version__[0]) > 1:\n from model import HParams as HParams\nelse:\n from tensorflow.contrib.training import HParams\n\nparser = argparse.ArgumentParser()\nparser.add_argument('--model', type=str, default='gpt2ja-medium')\nparser.add_argument('--context', type=str, required=True)\nparser.add_argument('--gpu', type=str, default='0')\nargs = parser.parse_args()\n\nwith open('ja-bpe.txt', encoding='utf-8') as f:\n bpe = f.read().split('\\n')\n\nwith open('emoji.json', encoding='utf-8') as f:\n emoji = json.loads(f.read())\n\nenc = BPEEncoder_ja(bpe, emoji)\nn_vocab = len(enc)\n\nif os.path.isfile(args.model+'/hparams.json'):\n with open(args.model+'/hparams.json', encoding='utf-8') as f:\n params = json.loads(f.read())\n hparams = HParams(**params)\nelif 'small' in args.model:\n hparams = HParams(**{\n \"n_vocab\": n_vocab,\n \"n_ctx\": 1024,\n \"n_embd\": 768,\n \"n_head\": 12,\n \"n_layer\": 12\n })\nelif 'medium' in args.model:\n hparams = HParams(**{\n \"n_vocab\": n_vocab,\n \"n_ctx\": 1024,\n \"n_embd\": 1024,\n \"n_head\": 16,\n \"n_layer\": 24\n })\nelif 'large' in args.model:\n hparams = HParams(**{\n \"n_vocab\": n_vocab,\n \"n_ctx\": 1024,\n \"n_embd\": 1280,\n \"n_head\": 20,\n \"n_layer\": 36\n })\nelse:\n raise ValueError('invalid model name.')\n\nconfig = tf.ConfigProto()\nif int(args.gpu) >= 0:\n config.gpu_options.allow_growth = True\n config.gpu_options.visible_device_list = args.gpu\nwith tf.Session(config=config,graph=tf.Graph()) as sess:\n context = tf.placeholder(tf.int32, [1, None])\n output = model.model(hparams=hparams, X=context, past=None, reuse=tf.AUTO_REUSE)\n\n saver = tf.train.Saver()\n ckpt = tf.train.latest_checkpoint(args.model)\n saver.restore(sess, ckpt)\n\n context_tokens = enc.encode(args.context)\n out = sess.run(output, feed_dict={\n context: [context_tokens]\n })\n output = out['h_flat'][-1]\n print(output.tolist())\n"},"avg_line_length":{"kind":"number","value":26.9493670886,"string":"26.949367"},"max_line_length":{"kind":"number","value":84,"string":"84"},"alphanum_fraction":{"kind":"number","value":0.6486613434,"string":"0.648661"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"july-language/gpt2-japanese"},"path":{"kind":"string","value":"gpt2-transform.py"},"size":{"kind":"number","value":2129,"string":"2,129"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8776,"cells":{"content":{"kind":"string","value":"from pathlib import Path\nfrom datetime import datetime, timedelta\nfrom src.settings import envs\nfrom airflow import DAG\nfrom airflow.models import Variable\nfrom airflow.operators.python_operator import PythonOperator\nfrom airflow.utils.dates import days_ago\nfrom airflow.hooks.postgres_hook import PostgresHook\nimport logging\nfrom src.settings import log_config\nimport shutil\n\n# Setting up module from __file__ as the interpreter sets __name__ as __main__ when the source file is executed as\n# main program\nlogger = logging.getLogger(name=__file__.replace(envs.PROJECT_ROOT, '').replace('/', '.')[1:-3])\n\n# these args will get passed on to each operator\n# you can override them on a per-task basis during operator initialization\ndefault_args = {\n 'owner': 'airflow',\n 'depends_on_past': False,\n 'start_date': days_ago(7),\n 'email': ['airflow@airflow.com'],\n 'email_on_failure': False,\n 'email_on_retry': False,\n 'retries': 0,\n 'retry_delay': timedelta(minutes=5),\n 'catchup': False\n}\n\nDAG_ID = '{p.parent.name}_{p.stem}'.format(p=Path(__file__))\nPARAMS = Variable.get(DAG_ID, deserialize_json=True)\nSCHEDULE_INTERVAL = PARAMS.get('schedule_interval') or None\nDAYS_TO_RETAIN = PARAMS.get('days_to_retain', 60)\nTABLES = (\"xcom\", \"task_instance\", \"sla_miss\", \"log\", \"dag_run\", \"task_fail\", \"task_reschedule\")\nLOG_DIR = '/usr/local/airflow/logs'\n\ndag = DAG(\n DAG_ID,\n default_args=default_args,\n description='BT Bill Clean Up DAGs Metadata and Logs',\n schedule_interval=SCHEDULE_INTERVAL,\n max_active_runs=1\n)\n\n\ndef clean_dags_logs():\n hook = PostgresHook(postgres_conn_id=\"airflow_postgres\")\n dag_files = Path(Path(__file__).parent).glob('*.py')\n dags = ['{p.parent.name}_{p.stem}'.format(p=p) for p in dag_files]\n dags = [d for d in dags if d != DAG_ID]\n\n execution_date = datetime.date(datetime.now()) - timedelta(days=DAYS_TO_RETAIN)\n p = Path(LOG_DIR)\n for d in dags:\n logger.info(\"Cleaning up meta tables for {}\".format(d))\n for t in TABLES:\n sql = \"delete from {} where dag_id='{}' and execution_date < '{}'\".format(t, d, execution_date)\n hook.run(sql, True)\n logger.info('Cleaning up log folder for {}'.format(d))\n for path in list(p.glob('{}/*/*'.format(d))):\n log_date = str(path).split('/')[-1]\n log_date = log_date.split('T')[0]\n log_date = datetime.date(datetime.strptime(log_date, '%Y-%m-%d'))\n if log_date < execution_date:\n logger.info('Deleting dir {}'.format(str(path.absolute())))\n shutil.rmtree(str(path.absolute()))\n\n\nclean_up = PythonOperator(\n task_id='clean_up',\n python_callable=clean_dags_logs,\n dag=dag)\n\ndag >> clean_up\n"},"avg_line_length":{"kind":"number","value":36.0526315789,"string":"36.052632"},"max_line_length":{"kind":"number","value":114,"string":"114"},"alphanum_fraction":{"kind":"number","value":0.6857664234,"string":"0.685766"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"Mahe1980/btb"},"path":{"kind":"string","value":"src/airflow_dags/dags/btb/house_keeping.py"},"size":{"kind":"number","value":2740,"string":"2,740"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8777,"cells":{"content":{"kind":"string","value":"from abc import ABC\nfrom asyncio import Lock as AsyncLock\nfrom collections import ChainMap, OrderedDict\nfrom dataclasses import dataclass, field\nfrom datetime import timedelta\nfrom functools import partial, wraps\nfrom hashlib import sha256\nimport inspect\nfrom pathlib import Path\nimport pickle\nfrom sqlite3 import connect, Connection\nfrom textwrap import dedent\nfrom time import time\nfrom threading import Lock as SyncLock\nfrom typing import Any, Callable, Hashable, Mapping, Optional, Tuple, Type, Union\nfrom weakref import finalize, WeakSet\n\n\nDecoratee = Union[Callable, Type]\nKeygen = Callable[..., Any]\n\n\nclass Pickler(ABC):\n\n @staticmethod\n def dumps(_str: str) -> str:\n ... # pragma: no cover\n\n @staticmethod\n def loads(_bytes: bytes) -> Any:\n ... # pragma: no cover\n\n\nclass _MemoZeroValue:\n pass\n\n\n@dataclass\nclass _MemoReturnState:\n called: bool = False\n raised: bool = False\n value: Any = _MemoZeroValue\n\n\n@dataclass(frozen=True)\nclass _MemoBase:\n t0: Optional[float]\n memo_return_state: _MemoReturnState = field(init=False, default_factory=_MemoReturnState)\n\n\n@dataclass(frozen=True)\nclass _AsyncMemo(_MemoBase):\n async_lock: AsyncLock = field(init=False, default_factory=lambda: AsyncLock())\n\n\n@dataclass(frozen=True)\nclass _SyncMemo(_MemoBase):\n sync_lock: SyncLock = field(init=False, default_factory=lambda: SyncLock())\n\n\n_Memo = Union[_AsyncMemo, _SyncMemo]\n\n\n@dataclass(frozen=True)\nclass _MemoizeBase:\n db: Optional[Connection]\n default_kwargs: Mapping[str, Any]\n duration: Optional[timedelta]\n fn: Callable\n keygen: Optional[Keygen]\n pickler: Pickler = field(hash=False)\n size: Optional[int]\n\n expire_order: OrderedDict = field(init=False, default_factory=OrderedDict, hash=False)\n memos: OrderedDict = field(init=False, default_factory=OrderedDict, hash=False)\n\n def __post_init__(self) -> None:\n if self.db is not None:\n self.db.isolation_level = None\n\n self.db.execute(dedent(f'''\n CREATE TABLE IF NOT EXISTS `{self.table_name}` (\n k TEXT PRIMARY KEY,\n t0 FLOAT,\n t FLOAT,\n v TEXT NOT NULL\n )\n '''))\n if self.duration:\n self.db.execute(dedent(f'''\n DELETE FROM `{self.table_name}`\n WHERE t0 < {time() - self.duration.total_seconds()}\n '''))\n\n if self.size:\n res = self.db.execute(\n f\"SELECT t FROM `{self.table_name}` ORDER BY t DESC LIMIT {self.size}\"\n ).fetchall()\n if res:\n (min_t,) = res[-1]\n self.db.execute(f\"DELETE FROM `{self.table_name}` WHERE t < {min_t}\")\n for k, t0, t, v in self.db.execute(\n f\"SELECT k, t0, t, v FROM `{self.table_name}` ORDER BY t\"\n ).fetchall():\n memo = self.make_memo(t0=t0)\n memo.memo_return_state.called = True\n memo.memo_return_state.value = self.pickler.loads(v)\n self.memos[k] = memo\n if self.duration:\n for k, t0 in self.db.execute(\n f\"SELECT k, t0 FROM `{self.table_name}` ORDER BY t0\"\n ).fetchall():\n self.expire_order[k] = ...\n\n def __len__(self) -> int:\n return len(self.memos)\n\n @property\n def table_name(self) -> str:\n # noinspection PyUnresolvedReferences\n return (\n f'{self.fn.__code__.co_filename}'\n f':{self.fn.__code__.co_name}'\n f':{self.fn.__code__.co_firstlineno}'\n )\n\n def bind_key_lifetime(self, raw_key: Tuple[Any, ...], key: Union[int, str]) -> None:\n for raw_key_part in raw_key:\n if (raw_key_part is not None) and (type(raw_key_part).__hash__ is object.__hash__):\n finalize(raw_key_part, self.reset_key, key)\n\n def default_keygen(self, *args, **kwargs) -> Tuple[Hashable, ...]:\n \"\"\"Returns all params (args, kwargs, and missing default kwargs) for function as kwargs.\"\"\"\n\n return tuple(self.get_args_as_kwargs(*args, **kwargs).values())\n\n def get_args_as_kwargs(self, *args, **kwargs) -> Mapping[str, Any]:\n args_as_kwargs = {}\n for k, v in zip(self.default_kwargs, args):\n args_as_kwargs[k] = v\n return ChainMap(args_as_kwargs, kwargs, self.default_kwargs)\n\n def get_memo(self, key: Union[int, str], insert: bool) -> Optional[_Memo]:\n try:\n memo = self.memos[key] = self.memos.pop(key)\n if self.duration is not None and memo.t0 < time() - self.duration.total_seconds():\n self.expire_order.pop(key)\n raise ValueError('value expired')\n except (KeyError, ValueError):\n if not insert:\n return None\n elif self.duration is None:\n t0 = None\n else:\n t0 = time()\n # The value has no significance. We're using the dict entirely for ordering keys.\n self.expire_order[key] = ...\n\n memo = self.memos[key] = self.make_memo(t0=t0)\n\n return memo\n\n def expire_one_memo(self) -> None:\n k = None\n if (\n (self.expire_order is not None) and\n (len(self.expire_order) > 0) and\n (\n self.memos[next(iter(self.expire_order))].t0 <\n time() - self.duration.total_seconds()\n )\n ):\n (k, _) = self.expire_order.popitem(last=False)\n self.memos.pop(k)\n elif self.size is not None and self.size < len(self.memos):\n (k, _) = self.memos.popitem(last=False)\n if (self.db is not None) and (k is not None):\n self.db.execute(f\"DELETE FROM `{self.table_name}` WHERE k = '{k}'\")\n\n def finalize_memo(self, memo: _Memo, key: Union[int, str]) -> Any:\n if memo.memo_return_state.raised:\n raise memo.memo_return_state.value\n elif (self.db is not None) and (self.memos[key] is memo):\n value = self.pickler.dumps(memo.memo_return_state.value)\n self.db.execute(\n dedent(f'''\n INSERT OR REPLACE INTO `{self.table_name}`\n (k, t0, t, v)\n VALUES\n (?, ?, ?, ?)\n '''),\n (\n key,\n memo.t0,\n time(),\n value\n )\n )\n return memo.memo_return_state.value\n\n def get_key(self, raw_key: Tuple[Hashable, ...]) -> Union[int, str]:\n if self.db is None:\n key = hash(raw_key)\n else:\n key = sha256(str(raw_key).encode()).hexdigest()\n\n return key\n\n @staticmethod\n def make_memo(t0: Optional[float]) -> _Memo: # pragma: no cover\n raise NotImplemented\n\n def reset(self) -> None:\n object.__setattr__(self, 'expire_order', OrderedDict())\n object.__setattr__(self, 'memos', OrderedDict())\n if self.db is not None:\n self.db.execute(f\"DELETE FROM `{self.table_name}`\")\n\n def reset_key(self, key: Union[int, str]) -> None:\n if key in self.memos:\n self.memos.pop(key)\n if self.duration is not None:\n self.expire_order.pop(key)\n if self.db is not None:\n self.db.execute(f\"DELETE FROM `{self.table_name}` WHERE k == '{key}'\")\n\n\n@dataclass(frozen=True)\nclass _AsyncMemoize(_MemoizeBase):\n\n async def get_raw_key(self, *args, **kwargs) -> Tuple[Hashable, ...]:\n if self.keygen is None:\n raw_key = self.default_keygen(*args, **kwargs)\n else:\n raw_key = self.keygen(**self.get_args_as_kwargs(*args, **kwargs))\n if isinstance(raw_key, tuple):\n raw_key = list(raw_key)\n else:\n raw_key = [raw_key]\n\n for i, v in enumerate(raw_key):\n if inspect.isawaitable(v):\n raw_key[i] = await v\n raw_key = tuple(raw_key)\n\n return raw_key\n\n def get_behavior(self, *, insert: bool, update: bool) -> Callable:\n def get_call(*, fn: Callable) -> Callable:\n\n @wraps(self.fn)\n async def call(*args, **kwargs) -> Any:\n raw_key = await self.get_raw_key(*args, **kwargs)\n key = self.get_key(raw_key)\n\n memo: _AsyncMemo = self.get_memo(key, insert=insert)\n if memo is None:\n return await fn(*args, **kwargs)\n\n self.expire_one_memo()\n\n async with memo.async_lock:\n if (\n (insert and not memo.memo_return_state.called) or\n (update and memo.memo_return_state.value is not _MemoZeroValue)\n ):\n memo.memo_return_state.called = True\n try:\n memo.memo_return_state.value = await fn(*args, **kwargs)\n except Exception as e:\n memo.memo_return_state.raised = True\n memo.memo_return_state.value = e\n\n self.bind_key_lifetime(raw_key, key)\n\n return self.finalize_memo(memo=memo, key=key)\n\n return call\n return get_call\n\n async def insert(self, *args, **kwargs) -> Any:\n return await self.get_behavior(insert=True, update=False)(fn=self.fn)(*args, **kwargs)\n\n def update(self, *args, **kwargs) -> Callable:\n\n async def to(value: Any) -> Any:\n async def fn(*_args, **_kwargs) -> Any:\n return value\n\n return await self.get_behavior(insert=False, update=True)(fn=fn)(*args, **kwargs)\n\n return to\n\n def upsert(self, *args, **kwargs) -> Callable:\n\n async def to(value: Any) -> Any:\n async def fn(*_args, **_kwargs) -> Any:\n return value\n\n return await self.get_behavior(insert=True, update=True)(fn=fn)(*args, **kwargs)\n\n return to\n\n async def remove(self, *args, **kwargs) -> None:\n raw_key = await self.get_raw_key(*args, **kwargs)\n key = self.get_key(raw_key)\n self.reset_key(key)\n\n def get_decorator(self) -> Callable:\n\n async def decorator(*args, **kwargs) -> Any:\n return await self.insert(*args, **kwargs)\n\n decorator.memoize = self\n\n return decorator\n\n @staticmethod\n def make_memo(t0: Optional[float]) -> _AsyncMemo:\n return _AsyncMemo(t0=t0)\n\n\n@dataclass(frozen=True)\nclass _SyncMemoize(_MemoizeBase):\n\n _sync_lock: SyncLock = field(init=False, default_factory=lambda: SyncLock())\n\n def get_raw_key(self, *args, **kwargs) -> Tuple[Hashable, ...]:\n if self.keygen is None:\n raw_key = self.default_keygen(*args, **kwargs)\n else:\n raw_key = self.keygen(**self.get_args_as_kwargs(*args, **kwargs))\n if not isinstance(raw_key, tuple):\n raw_key = [raw_key]\n raw_key = tuple(raw_key)\n\n return raw_key\n\n def get_behavior(self, *, insert: bool, update: bool) -> Callable:\n def get_call(*, fn: Callable) -> Callable:\n\n @wraps(self.fn)\n def call(*args, **kwargs) -> Any:\n raw_key = self.get_raw_key(*args, **kwargs)\n key = self.get_key(raw_key)\n\n with self._sync_lock:\n memo: _SyncMemo = self.get_memo(key, insert=insert)\n if memo is None:\n return fn(*args, **kwargs)\n\n self.expire_one_memo()\n\n with memo.sync_lock:\n if (\n (insert and not memo.memo_return_state.called) or\n (update and memo.memo_return_state.value is not _MemoZeroValue)\n ):\n memo.memo_return_state.called = True\n try:\n memo.memo_return_state.value = fn(*args, **kwargs)\n except Exception as e:\n memo.memo_return_state.raised = True\n memo.memo_return_state.value = e\n\n self.bind_key_lifetime(raw_key, key)\n\n return self.finalize_memo(memo=memo, key=key)\n\n return call\n\n return get_call\n\n def insert(self, *args, **kwargs) -> Any:\n return self.get_behavior(insert=True, update=False)(fn=self.fn)(*args, **kwargs)\n\n def update(self, *args, **kwargs) -> Callable:\n\n def to(value: Any) -> Any:\n def fn(*_args, **_kwargs) -> Any:\n return value\n\n return self.get_behavior(insert=False, update=True)(fn=fn)(*args, **kwargs)\n\n return to\n\n def upsert(self, *args, **kwargs) -> Callable:\n\n def to(value: Any) -> Any:\n def fn(*_args, **_kwargs) -> Any:\n return value\n\n return self.get_behavior(insert=True, update=True)(fn=fn)(*args, **kwargs)\n\n return to\n\n def remove(self, *args, **kwargs) -> None:\n raw_key = self.get_raw_key(*args, **kwargs)\n key = self.get_key(raw_key)\n self.reset_key(key)\n\n def get_decorator(self) -> Callable:\n\n def decorator(*args, **kwargs) -> Any:\n return self.insert(*args, **kwargs)\n\n decorator.memoize = self\n\n return decorator\n\n @staticmethod\n def make_memo(t0: Optional[float]) -> _SyncMemo:\n return _SyncMemo(t0=t0)\n\n def reset(self) -> None:\n with self._sync_lock:\n super().reset()\n\n def reset_key(self, key: Union[int, str]) -> None:\n with self._sync_lock:\n super().reset_key(key)\n\n\nclass _Memoize:\n \"\"\"Decorates a function call and caches return value for given inputs.\n - If `db_path` is provided, memos will persist on disk and reloaded during initialization.\n - If `duration` is provided, memos will only be valid for given `duration`.\n - If `keygen` is provided, memo hash keys will be created with given `keygen`.\n - If `pickler` is provided, persistent memos will (de)serialize using given `pickler`.\n - If `size` is provided, LRU memo will be evicted if current count exceeds given `size`.\n\n ### Examples\n\n - Body will run once for unique input `bar` and result is cached.\n ```python3\n @memoize\n def foo(bar) -> Any: ...\n\n foo(1) # Function actually called. Result cached.\n foo(1) # Function not called. Cached result returned.\n foo(2) # Function actually called. Result cached.\n ```\n\n - Same as above, but async.\n ```python3\n @memoize\n async def foo(bar) -> Any: ...\n\n # Concurrent calls from the same event loop are safe. Only one call is generated. The\n # other nine calls in this example wait for the result.\n await asyncio.gather(*[foo(1) for _ in range(10)])\n ```\n\n - Classes may be memoized.\n ```python3\n @memoize\n Class Foo:\n def init(self, _): ...\n\n Foo(1) # Instance is actually created.\n Foo(1) # Instance not created. Cached instance returned.\n Foo(2) # Instance is actually created.\n ```\n\n - Calls `foo(1)`, `foo(bar=1)`, and `foo(1, baz='baz')` are equivalent and only cached once.\n ```python3\n @memoize\n def foo(bar, baz='baz'): ...\n ```\n\n - Only 2 items are cached. Acts as an LRU.\n ```python3\n @memoize(size=2)\n def foo(bar) -> Any: ...\n\n foo(1) # LRU cache order [foo(1)]\n foo(2) # LRU cache order [foo(1), foo(2)]\n foo(1) # LRU cache order [foo(2), foo(1)]\n foo(3) # LRU cache order [foo(1), foo(3)], foo(2) is evicted to keep cache size at 2\n ```\n\n - Items are evicted after 1 minute.\n ```python3\n @memoize(duration=datetime.timedelta(minutes=1))\n def foo(bar) -> Any: ...\n\n foo(1) # Function actually called. Result cached.\n foo(1) # Function not called. Cached result returned.\n sleep(61)\n foo(1) # Function actually called. Cached result was too old.\n ```\n\n - Memoize can be explicitly reset through the function's `.memoize` attribute\n ```python3\n @memoize\n def foo(bar) -> Any: ...\n\n foo(1) # Function actually called. Result cached.\n foo(1) # Function not called. Cached result returned.\n foo.memoize.reset()\n foo(1) # Function actually called. Cache was emptied.\n ```\n\n - Current cache length can be accessed through the function's `.memoize` attribute\n ```python3\n @memoize\n def foo(bar) -> Any: ...\n\n foo(1)\n foo(2)\n len(foo.memoize) # returns 2\n ```\n\n - Alternate memo hash function can be specified. The inputs must match the function's.\n ```python3\n Class Foo:\n @memoize(keygen=lambda self, a, b, c: (a, b, c)) # Omit 'self' from hash key.\n def bar(self, a, b, c) -> Any: ...\n\n a, b = Foo(), Foo()\n\n # Hash key will be (a, b, c)\n a.bar(1, 2, 3) # LRU cache order [Foo.bar(a, 1, 2, 3)]\n\n # Hash key will again be (a, b, c)\n # Be aware, in this example the returned result comes from a.bar(...), not b.bar(...).\n b.bar(1, 2, 3) # Function not called. Cached result returned.\n ```\n\n - If part of the returned key from keygen is awaitable, it will be awaited.\n ```python3\n async def awaitable_key_part() -> Hashable: ...\n\n @memoize(keygen=lambda bar: (bar, awaitable_key_part()))\n async def foo(bar) -> Any: ...\n ```\n\n - If the memoized function is async and any part of the key is awaitable, it is awaited.\n ```python3\n async def morph_a(a: int) -> int: ...\n\n @memoize(keygen=lambda a, b, c: (morph_a(a), b, c))\n def foo(a, b, c) -> Any: ...\n ```\n\n - Properties can be memoized.\n ```python3\n Class Foo:\n @property\n @memoize\n def bar(self) -> Any: ...\n\n a = Foo()\n a.bar # Function actually called. Result cached.\n a.bar # Function not called. Cached result returned.\n\n b = Foo() # Memoize uses 'self' parameter in hash. 'b' does not share returns with 'a'\n b.bar # Function actually called. Result cached.\n b.bar # Function not called. Cached result returned.\n ```\n\n - Be careful with eviction on instance methods. Memoize is not instance-specific.\n ```python3\n Class Foo:\n @memoize(size=1)\n def bar(self, baz) -> Any: ...\n\n a, b = Foo(), Foo()\n a.bar(1) # LRU cache order [Foo.bar(a, 1)]\n b.bar(1) # LRU cache order [Foo.bar(b, 1)], Foo.bar(a, 1) is evicted\n a.bar(1) # Foo.bar(a, 1) is actually called and cached again.\n ```\n\n - Values can persist to disk and be reloaded when memoize is initialized again.\n ```python3\n @memoize(db_path=Path.home() / '.memoize')\n def foo(a) -> Any: ...\n\n foo(1) # Function actually called. Result cached.\n\n # Process is restarted. Upon restart, the state of the memoize decorator is reloaded.\n\n foo(1) # Function not called. Cached result returned.\n ```\n\n - If not applied to a function, calling the decorator returns a partial application.\n ```python3\n memoize_db = memoize(db_path=Path.home() / '.memoize')\n\n @memoize_db(size=1)\n def foo(a) -> Any: ...\n\n @memoize_db(duration=datetime.timedelta(hours=1))\n def bar(b) -> Any: ...\n ```\n\n - Comparison equality does not affect memoize. Only hash equality matters.\n ```python3\n # Inherits object.__hash__\n class Foo:\n # Don't be fooled. memoize only cares about the hash.\n def __eq__(self, other: Foo) -> bool:\n return True\n\n @memoize\n def bar(foo: Foo) -> Any: ...\n\n foo0, foo1 = Foo(), Foo()\n assert foo0 == foo1\n bar(foo0) # Function called. Result cached.\n bar(foo1) # Function called again, despite equality, due to different hash.\n ```\n\n ### A warning about arguments that inherit `object.__hash__`:\n\n It doesn't make sense to keep a memo if it's impossible to generate the same input again. Inputs\n that inherit the default `object.__hash__` are unique based on their id, and thus, their\n location in memory. If such inputs are garbage-collected, they are gone forever. For that\n reason, when those inputs are garbage collected, `memoize` will drop memos created using those\n inputs.\n\n - Memo lifetime is bound to the lifetime of any arguments that inherit `object.__hash__`.\n ```python3\n # Inherits object.__hash__\n class Foo:\n ...\n\n @memoize\n def bar(foo: Foo) -> Any: ...\n\n bar(Foo()) # Memo is immediately deleted since Foo() is garbage collected.\n\n foo = Foo()\n bar(foo) # Memo isn't deleted until foo is deleted.\n del foo # Memo is deleted at the same time as foo.\n ```\n\n - Types that have specific, consistent hash functions (int, str, etc.) won't cause problems.\n ```python3\n @memoize\n def foo(a: int, b: str, c: Tuple[int, ...], d: range) -> Any: ...\n\n foo(1, 'bar', (1, 2, 3), range(42)) # Function called. Result cached.\n foo(1, 'bar', (1, 2, 3), range(42)) # Function not called. Cached result returned.\n ```\n\n - Classmethods rely on classes, which inherit from `object.__hash__`. However, classes are\n almost never garbage collected until a process exits so memoize will work as expected.\n\n ```python3\n class Foo:\n @classmethod\n @memoize\n def bar(cls) -> Any: ...\n\n foo = Foo()\n foo.bar() # Function called. Result cached.\n foo.bar() # Function not called. Cached result returned.\n\n del foo # Memo not cleared since lifetime is bound to class Foo.\n\n foo = Foo()\n foo.bar() # Function not called. Cached result returned.\n foo.bar() # Function not called. Cached result returned.\n ```\n\n - Long-lasting object instances that inherit from `object.__hash__`.\n\n ```python3\n class Foo:\n\n @memoize\n def bar(self) -> Any: ...\n\n foo = Foo()\n foo.bar() # Function called. Result cached.\n\n # foo instance is kept around somewhere and used later.\n foo.bar() # Function not called. Cached result returned.\n ```\n\n - Custom pickler may be specified for unpickleable return types.\n\n ```python3\n import dill\n\n @memoize(db_path='~/.memoize`, pickler=dill)\n def foo() -> Callable[[], None]:\n return lambda: None\n ```\n \"\"\"\n\n _all_decorators = WeakSet()\n\n @staticmethod\n def __call__(\n _decoratee: Optional[Decoratee] = None,\n *,\n db_path: Optional[Path] = None,\n duration: Optional[Union[int, float, timedelta]] = None,\n keygen: Optional[Keygen] = None,\n pickler: Optional[Pickler] = None,\n size: Optional[int] = None,\n ) -> Union[Decoratee]:\n if _decoratee is None:\n return partial(memoize, db_path=db_path, duration=duration, keygen=keygen, pickler=pickler, size=size)\n\n if inspect.isclass(_decoratee):\n assert db_path is None, 'Class memoization not allowed with db.'\n\n class WrappedMeta(type(_decoratee)):\n # noinspection PyMethodParameters\n @memoize(duration=duration, size=size)\n def __call__(cls, *args, **kwargs):\n return super().__call__(*args, **kwargs)\n\n class Wrapped(_decoratee, metaclass=WrappedMeta):\n pass\n\n return type(_decoratee.__name__, (Wrapped,), {'__doc__': _decoratee.__doc__})\n\n db = connect(f'{db_path}') if db_path is not None else None\n duration = timedelta(seconds=duration) if isinstance(duration, (int, float)) else duration\n assert (duration is None) or (duration.total_seconds() > 0)\n pickler = pickle if pickler is None else pickler\n assert (size is None) or (size > 0)\n fn = _decoratee\n default_kwargs: Mapping[str, Any] = {\n k: v.default for k, v in inspect.signature(fn).parameters.items()\n }\n\n if inspect.iscoroutinefunction(_decoratee):\n decorator_cls = _AsyncMemoize\n else:\n decorator_cls = _SyncMemoize\n\n # noinspection PyArgumentList\n decorator = decorator_cls(\n db=db,\n default_kwargs=default_kwargs,\n duration=duration,\n fn=fn,\n keygen=keygen,\n pickler=pickler,\n size=size,\n ).get_decorator()\n\n _Memoize._all_decorators.add(decorator)\n\n return wraps(_decoratee)(decorator)\n\n @staticmethod\n def reset_all() -> None:\n for decorator in _Memoize._all_decorators:\n decorator.memoize.reset()\n\n\nmemoize = _Memoize()\n"},"avg_line_length":{"kind":"number","value":33.5454545455,"string":"33.545455"},"max_line_length":{"kind":"number","value":114,"string":"114"},"alphanum_fraction":{"kind":"number","value":0.5643926004,"string":"0.564393"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"cevans87/atools"},"path":{"kind":"string","value":"atools/_memoize_decorator.py"},"size":{"kind":"number","value":25461,"string":"25,461"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8778,"cells":{"content":{"kind":"string","value":"import os\nimport math\nimport logging\n\nfrom pyaxe import config as config_util\nfrom pyaxe.axeerror import aXeError\n\n# make sure there is a logger\n_log = logging.getLogger(__name__)\n\nclass ConfigList:\n \"\"\"Configuration File Object\"\"\"\n def __init__(self, keylist, header=None):\n \"\"\"\n Initializes the ConfigList object by tranfsforming\n a list of keywords into a structured list including\n beams descriptions\n\n keylist: list\n List of configuration keys\n header: str\n the header string\n \"\"\"\n # beam indices which might be found the file\n idents = ['A', 'B', 'C', 'D', 'E', 'F', 'G', 'H', 'I', 'J', 'K',\n 'L', 'M', 'N', 'O', 'P', 'Q']\n\n # create the (visible) dictionary\n self.beams = {}\n\n # create the hidden beam list\n self._beams = []\n\n # store the header\n self.header = header\n\n # load the general required keywords\n self.gkeys = self._find_gkeys(keylist)\n\n # try to load beams as long as there\n # are keywords and as long as there\n # are candidate beam numbers\n iindex = 0\n while (len(keylist) > 0 and iindex < len(idents)):\n try:\n # try to load a beam\n self._beams.append(ConfigBeam(idents[iindex], keylist))\n self.beams[idents[iindex]] = self._beams[iindex]\n\n except BeamNotFound:\n # no information on this beam is in the file\n pass\n\n # enhance the counter\n iindex += 1\n\n # inform about the useless keywords\n if len(keylist) > 0:\n _log.info('\\nDispensable Keywords: ')\n for key in keylist:\n _log.info(key)\n\n def __str__(self):\n \"\"\"String method for the class\n\n The method transforms the configuration\n file object into its string representation.\n\n Returns\n -------\n a string representation of the object\n \"\"\"\n # take the string of the header\n rstring = str(self.header) + '\\n'\n\n # add the strings for the global keys\n for key in self.gkeys:\n rstring += str(key)\n\n for beam in self._beams:\n rstring += str(beam)\n\n # return the total string\n return rstring\n\n def __delitem__(self, item):\n\n # find the index of the requested item\n index = self._find_gkey(item)\n\n # check whether the item was found\n if index > -1:\n del self.gkeys[index]\n\n def __getitem__(self, item):\n\n # find the index of the requested item\n index = self._find_gkey(item)\n\n # check whether the item was found\n if index > -1:\n # return the identified item\n return self.gkeys[index].keyvalue\n else:\n if item in self.beams.keys():\n return self.beams[item]\n else:\n # return NULL\n return None\n\n def _find_gkey(self, item):\n\n # set the default return value\n found = -1\n\n # go over all items\n for index in range(len(self.gkeys)):\n # check whether it is the right item\n if self.gkeys[index].keyword == item:\n # set the return value to the index\n found = index\n\n # return the result\n return found\n\n def _load_file(self, filename):\n \"\"\"Configuration file --> keyword list\n\n The method load a configuration file and\n extract all valid keyword-keyvalue-comment information\n from it. The keyword-keyvalue pairs are\n organized and returned as a list of\n configuration key objects.\n\n @param filename: name of the configuration file\n @type filename: String\n\n @return: list of ConfKey's\n @rtype: [ConfKey]\n \"\"\"\n # initialize the liust\n keylist = []\n\n # open the file and parse through it\n fopen = open(filename, 'r')\n for line in fopen:\n # strip the line\n str_line = line.strip()\n\n # check whether the line contains a keyword\n if len(str_line) and str_line[0] != '#':\n # create and append the keyword\n keylist.append(self._key_from_line(str_line))\n\n # close the file\n fopen.close()\n\n # return the list\n return keylist\n\n def _get_gkey_index(self, keyword):\n \"\"\"Retrieve the index of a global keyword\n\n The method searches for the index of\n a requested keyword in the list of global\n keywords. If the keyword does not exists,\n the index -1 is returned\n\n Parameters\n ----------\n keyword: str\n name of the requested keyword\n\n Returns\n -------\n index: int\n the index of the keyword\n \"\"\"\n # initialize the return value\n kindex = -1\n\n # go over all keys\n for index in range(len(self.gkeys)):\n # check whether the current key matches\n if self.gkeys[index].keyword == keyword:\n # return it if it matches\n return index\n\n # return the default\n return kindex\n\n def _key_from_line(self, line):\n \"\"\"Creates a keyword from a line\n\n The method extracts the konfiguration keyword,\n the associated value and, if present,\n a comment from a line in the configuration file.\n A configuration key object representing the extracted\n keyword is created and returned.\n\n Parameters\n ----------\n line: list\n line to analyze\n\n Returns\n -------\n configuration key object\n \"\"\"\n # split the line into items\n items = line.split()\n\n # for more than one item the\n # first item is the keyword\n if len(items) > 1:\n keyword = items[0].strip()\n\n # check for a comment\n cpos = line.rfind(';')\n if cpos < 0:\n # evaluate the keyvalue\n keyvalue = line[line.find(keyword)+len(keyword):].strip()\n comment = None\n else:\n # evalute keyvalue and comment\n tmp_val = line[line.find(keyword)+len(keyword):].strip()\n keyvalue = tmp_val.split(';')[0].strip()\n comment = tmp_val.split(';')[1].strip()\n else:\n # something's wrong here\n err_msg = 'Only one item in: ' + line + ' !'\n raise aXeError(err_msg)\n\n # create and return the keyword\n return ConfKey(keyword, keyvalue, comment)\n\n def _find_gkeys(self, keylist):\n \"\"\"Finds and extracts the global keywords\n\n The method finds the all predefined global keywords in\n a keyword list. The list of global keywords is\n returned. Their counterparts in the input keyword list\n are deleted.\n\n Parameters\n ----------\n keylist: list\n list of keywords\n\n Returns\n -------\n keys: list\n global keywords\n \"\"\"\n gkeywords = ['INSTRUMENT', 'CAMERA', 'TELAREA',\n 'SCIENCE_EXT', 'ERRORS_EXT',\n 'DQ_EXT', 'OPTKEY1', 'OPTVAL1', 'FFNAME', 'DQMASK',\n 'DRZRESOLA', 'DRZSCALE', 'DRZLAMB0', 'DRZXINI',\n 'DRZROOT', 'EXPTIME', 'WEIGHT_EXT', 'DRZPFRAC',\n 'DRZPSCALE', 'DRZKERNEL', 'MODEL_EXT', 'VARIANCE_EXT',\n 'RDNOISE', 'PSFCOEFFS', 'PSFRANGE', 'IPIXFUNCTION',\n 'POBJSIZE', 'SMFACTOR']\n\n # initialize the global keylist\n # and the list with indices to be deleted\n gkeys = []\n dindex = []\n\n # go over the keylist read in,\n # keeping and index variable\n iindex = 0\n for key in keylist:\n\n # identify the current keyword in the\n # list of possible ones\n if key.keyword in gkeywords:\n\n # store the index\n dindex.append(iindex)\n\n # create and append the new keyword\n gkeys.append(ConfKey(key.keyword, key.keyvalue, key.comment))\n\n iindex += 1\n\n # delete the input keywords which\n # have been 'used'\n dindex.sort()\n dindex.reverse()\n for index in dindex:\n del keylist[index]\n\n # return the list of global keys\n return gkeys\n\n def _check_gfiles(self):\n \"\"\"Checks whether all files exist\n\n The method checks whether the files whose names\n are within the class data do exist or not.\n An error is reported in case that the files\n do not exist.\n \"\"\"\n # list of the root of all\n # global keys indicating a file\n fkeys = ['FFNAME']\n\n # go over all file keywords\n for key in fkeys:\n\n # identify the keyword in the list\n index = self._get_gkey_index(key)\n\n # check for existence\n if index > -1:\n\n # extract the keyvalue\n kvalue = self.gkeys[index].keyvalue\n\n # if the keyvalue is NOT None but the file does not exist\n if ((kvalue.upper() is not 'NONE') and\n (not os.path.isfile(config_util.getCONF(kvalue)))):\n # report an error\n err_msg = (\"The file: {0:s} does not exist!\"\n .format(config_util.getCONF(kvalue)))\n raise aXeError(err_msg)\n\n def get_gkey(self, keyword):\n \"\"\"Retrieve a requested global keyword\n\n The method searches the list of global keywords\n for a fitting keyword. In case that the requested\n keyword exists, it is returned.\n If not 'None' is returned\n\n Parameters\n ----------\n keyword: str\n name of the requested keyword\n\n Returns\n -------\n key: str or None\n the requested keyword or 'None'\n \"\"\"\n # initialize the return value\n rkey = None\n\n # search for the index in the keyword list\n index = self._get_gkey_index(keyword)\n\n # check whether the keyword exists\n if index > -1:\n # return the keyword\n return self.gkeys[index]\n else:\n # return the default\n return rkey\n\n def add_gkey(self, keyword, keyvalue, comment=None):\n \"\"\"Add global keyword\n\n The method adds a keyword to the list of global\n keywords. In case that the keyword just exists,\n it is overwritten, otherwise it is appended\n to the global keyword list.\n\n Parameters\n ----------\n keyword: str\n name of the requested keyword\n keyvalue: any\n value of the requested keyword\n comment: str\n comment for the keyword\n \"\"\"\n\n # search for the index in the keyword list\n index = self._get_gkey_index(keyword)\n\n if index > -1:\n # if it matches, copy the data\n self.gkeys[index].keyvalue = keyvalue\n self.gkeys[index].comment = comment\n else:\n # the keyword does not yet exist, just create and add it\n self.gkeys.append(ConfKey(keyword, keyvalue, comment))\n\n # def drizzle_check(self):\n # \"\"\"Check for drizzle keywords\n\n # The method assures that all necessary drizzle keywords\n # are present. Nonexisting keywords are added with default\n # values. Finally the value for the drizzle kernel is checked\n # against all valid values.\n\n # Returns\n # -------\n # bool: True if the drizzle kernel is valid\n # \"\"\"\n # # list with all valid kernels\n # kernels = ['square', 'point', 'turbo', 'gaussian', 'tophat',\n # 'lanczos2', 'lanczos3']\n\n # # make sure that some important drizzle keywords are there\n\n # pself = self.setdefault('DRZPSCALE', 1.0)\n # pfrac = self.setdefault('DRZPFRAC', 1.0)\n # dkernel = self.setdefault('DRZKERNEL', 'square')\n # droot = self.setdefault('DRZROOT', 'aXedrizzle')\n\n # # check for valid drizzle kernel\n # if dkernel not in kernels:\n # return False\n # return True\n\n # def setdefault(self, keyword, keyvalue, comment=None):\n # \"\"\"Add global keyword\n\n # The method mimics the setdefault method for dictionary\n # objects. A keyword is added with the given value and\n # comment, but only in case that it does not yet exist.\n # If it exists, nothing is done\n\n # Parameters\n # ----------\n # keyword: str\n # name of the requested keyword\n # keyvalue: any\n # value of the requested keyword\n # comment: str\n # comment for the keyword\n\n # Returns\n # -------\n # The keyword value\n # \"\"\"\n\n # # search for the index in the keyword list\n # index = self._get_gkey_index(keyword)\n\n # if index < 0:\n # # the keyword does not yet exist, just create and add it\n # self.gkeys.append(ConfKey(keyword, keyvalue, comment))\n # # extract the keyvalue\n # value = self.gkeys[-1].keyvalue\n # else:\n # # extract the keyvalue\n # value = self.gkeys[index].keyvalue\n\n # # return the keyvalue\n # return value\n\n def get_gvalue(self, keyword):\n \"\"\"Retrieve a requested global keyword value\n\n The method returns the value of the keyword\n which matches the requested value.\n If there is no matching keyword, 'None'\n is returned.\n\n Parameters\n ----------\n keyword: str\n name of the requested keyword\n\n Returns\n -------\n The keyword value\n \"\"\"\n\n # set the default return value\n rvalue = None\n\n # search for the keyword\n key = self.get_gkey(keyword)\n\n # check whether it is non-NULL\n if key:\n # extract the value\n rvalue = key.keyvalue\n\n # return the value\n return rvalue\n\n def writeto(self, filename):\n \"\"\"Save the object to a file\n\n The method saves the object to a file\n with name specified in the input.\n\n Parameters\n ----------\n filename: str\n name of the file\n \"\"\"\n # destroy the old file\n if os.path.isfile(filename):\n os.unlink(filename)\n\n # open the new file\n ofile = open(filename, 'w')\n\n # write the string to the file\n ofile.write(str(self))\n\n # close the file\n ofile.close()\n\n def flush(self):\n \"\"\"Save the object back to file\n\n The method saves the object back to a file\n with the identical filename it was read from.\n \"\"\"\n # just use the more general method\n self.writeto(self.filename)\n\n def check_files(self, check_glob=True):\n \"\"\"Checks whether all files exist\n\n The method checks whether the files whose names\n are within the class data do exist or not.\n An error is reported in case that the files\n do not exist.\n \"\"\"\n n_sens = 0\n\n # check global files if desired\n if check_glob:\n self._check_gfiles()\n\n # create the (visible) dictionary\n for bkey in self.beams.keys():\n n_sens += self.beams[bkey].check_files()\n\n # return the number\n # of existing sensitivity files\n return n_sens\n\n\nclass ConfigFile(ConfigList):\n \"\"\"Configuration File Object\"\"\"\n def __init__(self, filename=None):\n \"\"\"\n Initializes the ConfigFile object either\n by reading in a configuration file\n or by creating a default configuration file\n\n Parameters\n ----------\n filename: str\n name of the configuration file\n \"\"\"\n _log.info(f\"Initializing configfile with {filename}\")\n # check if a filename is given\n if filename is None:\n # load the default\n _log.info('No file given, can do nothing!!')\n else:\n # safe the file name\n self.filename = filename\n\n # create a keyword list\n keylist = self._load_file(filename)\n\n # load the header\n header = ConfHeader(filename)\n\n super(ConfigFile, self).__init__(keylist, header)\n\n def _get_simul_name(self):\n \"\"\"Get the filename used in aXeSIM\"\"\"\n # just add '.simul' and return the result\n return self.filename + '.simul'\n\n def confirm_extrkeys(self):\n \"\"\"Confirm that all keywords for the extraction exist\"\"\"\n # default is true!\n extr_ready = 1\n\n # check existence of 'POBJSIZE'\n if self['POBJSIZE'] is None:\n extr_ready = 0\n # check for reasonable value\n elif float(self['POBJSIZE']) < 0.0:\n extr_ready = 0\n\n # check existence of 'SMFACTOR'\n if self['SMFACTOR'] is None:\n extr_ready = 0\n # check for reasonable value\n elif float(self['SMFACTOR']) < 0.0:\n extr_ready = 0\n\n # return the value\n return extr_ready\n\n def confirm_lambda_psf(self):\n \"\"\"Check whether a 'lambda_psf' value is needed, provide one\"\"\"\n # check whether 'lambda_psf' is needed\n if ((self['PSFCOEFFS'] is not None) and\n (self['PSFRANGE'] is not None)):\n # split the term\n psf_range = self['PSFRANGE'].split()\n\n # extract the defined range as float\n lambda_min = float(psf_range[0])\n lambda_max = float(psf_range[1])\n\n # make 'lambda_psf' to the mean value\n lambda_psf = 0.5 * (lambda_max + lambda_min)\n else:\n # leave it at None\n lambda_psf = None\n\n # return the value\n return lambda_psf\n\n def axesim_prep(self):\n \"\"\"Removes modifies some keywords\"\"\"\n # derive the new configuration file name\n new_name = self._get_simul_name()\n\n # check whether the science extension has other\n # than the allowed values\n if self['SCIENCE_EXT'] != 'SCI' and self['SCIENCE_EXT'] != '2':\n\n # find the index of the sceicne extension\n index = self._find_gkey('SCIENCE_EXT')\n\n # check whether the item was found\n if index > -1:\n # set it to the allowed value\n self.gkeys[index].keyvalue = 'SCI'\n\n # check whether the telesocpe are is known\n if self['TELAREA'] is None:\n # set the telescope are to the\n # Hubble default\n self.add_gkey('TELAREA', 45238.93)\n\n index = 1\n while self['OPTKEY'+str(index)] is not None:\n del self['OPTKEY'+str(index)]\n del self['OPTVAL'+str(index)]\n index += 1\n\n # just make sure that\n # the error=- and dq-\n # extensions are set\n self.add_gkey('ERRORS_EXT', 'ERR')\n self.add_gkey('DQ_EXT', 'DQ')\n\n # write the file back\n self.writeto(new_name)\n\n # return the baseic filename of the\n # simulation configuration file\n return os.path.basename(new_name)\n\nclass ConfigBeam:\n \"\"\"Configuration Beam object\"\"\"\n def __init__(self, ident=None, keylist=None):\n \"\"\"\n A configuration beam object is intialized. This is done\n by either extracting the relevant keywords for a certain\n beam from a keyword list or creating a default beam.\n\n Parameters\n ----------\n ident: char\n beam identification\n keylist: list\n list of keywords\n \"\"\"\n\n # check if a filename is given\n if ident is None or keylist is None:\n # load the default\n _log.info('No ID or no keywords given, can do nothing!!')\n else:\n # try to load the beam keywords\n try:\n # store the ident\n self.ident = ident\n\n # load the general beam keywords\n self.beamkeys = self._find_beamkeys(ident, keylist)\n\n # load the trace keywords\n self.trace = ConfigTrace(ident, keylist)\n\n # load the dispersion keywords\n self.disp = ConfigDisp(ident, keylist)\n\n # catch a pure CKeyNotFound exception\n # which is raised if a beam is competely\n # absent in the keyword list\n except CKeyNotFound:\n raise BeamNotFound(ident)\n\n def __str__(self):\n \"\"\"String method for the class\n\n The method transforms theconfiguration\n beam object into its string representation.\n \"\"\"\n # initialize the return string\n rstring = (\"\\n#-----------\\n#\\n# Beam {0:s}:\\n#\\n#-----------\\n\"\n .format(str(self.ident)))\n\n # add the strings for the global keys\n for key in self.beamkeys:\n rstring += str(key)\n\n # add the string for the trace\n rstring += str(self.trace)\n\n # add the string for the dispersion\n # solution\n rstring += str(self.disp)\n\n # return the total string\n return rstring\n\n def __getitem__(self, item):\n\n full_item = item + self.ident\n\n rvalue = self.get_bvalue(full_item)\n\n return rvalue\n\n def __setitem__(self, item, value):\n\n full_item = item + self.ident\n\n index = self._get_bkey_index(full_item)\n\n if index > -1:\n self.beamkeys[index].keyvalue = value\n\n def _find_beamkeys(self, ident, keylist):\n \"\"\"Load the global beam keywords\n\n The method extracts all global beam keywords\n from a keyword list. The extracted keywords are returned\n as a list. They are removed from the input list.\n\n Parameters\n ----------\n ident: char\n beam identification\n keylist: list\n list of keywords\n \"\"\"\n\n # list of the root of all globale\n # beamword keys\n bkeys = ['BEAM', 'MMAG_EXTRACT_', 'MMAG_MARK_', 'XOFF_',\n 'YOFF_', 'SENSITIVITY_']\n\n # list of optional keywords\n okeys = ['PSF_OFFSET_']\n\n # appen the beam identifier to the\n # keyword roots to get a list of keywords\n # to search for\n id_keys = []\n for key in bkeys:\n id_keys.append(key + ident)\n\n # initiate and fill\n # collect a list of optional keywords\n opt_keys = []\n for key in okeys:\n opt_keys.append(key + ident)\n\n # here is some kind of extra\n # keyword\n # ekey = 'DLD1P_' + ident + '_PRANGE'\n opt_keys.append('DLD1P_' + ident + '_PRANGE')\n\n # initialize the global keylist\n # and the list with indices to be deleted\n bkeys = []\n dindex = []\n\n # go over the keylist read in,\n # keeping and index variable\n iindex = 0\n nfound = 0\n for key in keylist:\n\n # identify the current keyword in the\n # list of possible ones\n if key.keyword in id_keys:\n\n # store the index\n dindex.append(iindex)\n\n # create and append the new keyword\n bkeys.append(ConfKey(key.keyword,\n key.keyvalue, key.comment))\n\n # enhance the nuber of keywords found\n nfound += 1\n\n elif key.keyword in opt_keys:\n # store the index\n dindex.append(iindex)\n\n # create and append the new keyword\n bkeys.append(ConfKey(key.keyword,\n key.keyvalue, key.comment))\n\n # enhance the index\n iindex += 1\n\n # check whether all keywords were found\n if nfound < len(id_keys):\n # raise an exeption if not\n raise CKeyNotFound('general')\n\n # delete the input keywords which\n # have been 'used'\n dindex.sort()\n dindex.reverse()\n for iindex in dindex:\n del keylist[iindex]\n\n # return the list of global keys\n return bkeys\n\n def _get_bkey_index(self, keyword):\n \"\"\"Retrieve the index of a beam keyword\n\n The method searches for the index of\n a requested keyword in the list of beam\n keywords. If the keyword does not exists,\n the index -1 is returned\n\n Parameters\n ----------\n keyword: str\n name of the requested keyword\n\n Returns\n -------\n index: int\n the index of the keyword\n \"\"\"\n # initialize the return value\n bindex = -1\n\n # go over all keys\n for index in range(len(self.beamkeys)):\n # check whether the current key matches\n if self.beamkeys[index].keyword == keyword:\n # return it if it matches\n return index\n\n # return the default\n return bindex\n\n def get_bkey(self, keyword):\n \"\"\"Retrieve a requested beam keyword\n\n The method searches the list of beam keywords\n for a fitting keyword. In case that the requested\n keyword exists, it is returned.\n If not 'None' is returned\n\n Parameters\n ----------\n keyword: str\n name of the requested keyword\n\n Returns\n -------\n key: str or None\n the requested keyword or 'None'\n \"\"\"\n # initialize the return value\n rkey = None\n\n # search for the index in the keyword list\n index = self._get_bkey_index(keyword)\n\n # ckeck whehter the keyword exists\n if index > -1:\n # return the keyword\n return self.beamkeys[index]\n else:\n # return the default\n return rkey\n\n def get_bvalue(self, keyword):\n \"\"\"Retrieve a requested beam-keyword value\n\n The method returns the value of the keyword\n which matches the requested value.\n If there is no matching keyword, 'None'\n is returned.\n\n Parameters\n ----------\n keyword: str\n name of the requested keyword\n\n Returns\n -------\n key: str or None\n the requested keyword or 'None'\n \"\"\"\n # set the default return value\n rvalue = None\n\n # search for the keyword\n key = self.get_bkey(keyword)\n\n # check whether it is non-NULL\n if key:\n # extract the value\n rvalue = key.keyvalue\n\n # return the value\n return rvalue\n\n def check_files(self):\n \"\"\"Checks whether all files exist\n\n The method checks whether the files whose names\n are within the class data do exist or not.\n An error is reported in case that the files\n do not exist.\n\n \"\"\"\n n_sens = 0\n\n # list of the root of all\n # beamword keys indicating a file\n fkeys = ['SENSITIVITY_']\n\n # append the beam identifier to the\n # keyword roots to get the full keyname\n for key in fkeys:\n full_keyword = key + self.ident\n\n # go over all beam keys\n for bkey in self.beamkeys:\n\n # check whether the current keyword is right\n # and whether the keyvalue is not 'None'\n if ((bkey.keyword is full_keyword) and\n (bkey.keyvalue.upper() is not 'NONE')):\n # check for the file\n if not os.path.isfile(config_util.getCONF(bkey.keyvalue)):\n # report an error\n err_msg = (\"The file: {0:s} does not exist!\"\n .format(config_util.getCONF(bkey.keyvalue)))\n raise aXeError(err_msg)\n else:\n n_sens += 1\n\n return n_sens\n\n\nclass TwoDimPolyN:\n \"\"\"Object for a polynomial with 2D variance\"\"\"\n def __str__(self):\n \"\"\"The method transforms the 2D polynomial object into its str\n representation.\n\n Returns\n -------\n object: str\n string representation of the object\n \"\"\"\n # initialize the return string\n rstring = str(self.norder)\n\n for key in self.twodkeys:\n rstring += str(key)\n\n # return the total string\n return rstring\n\n def __getitem__(self, index):\n \"\"\"Getindex method for the class\n\n The operator method which is called\n when an index is requested on a\n class instace\n test = kkk[0]\n\n Parameters\n ----------\n index: int\n the index to address\n Returns\n -------\n key : ConfListKey\n the indexed object\n \"\"\"\n # check whether the index exists\n if index > len(self.twodkeys)-1:\n # raise an exception\n err_msg = \"Index: {0:s} does not exist!\".format(str(index))\n raise aXeError(err_msg)\n\n # return the indexed object\n return self.twodkeys[index]\n\n def __setitem__(self, index, obj):\n \"\"\"Setindex method for the class\n\n The operator method which is called\n when the index of a class instance is\n set to a value.\n kkk[0] = test\n\n Parameters\n ----------\n index: int\n the index to address\n obj: ConfListKey\n description of the object content\n \"\"\"\n # check whether the index exists\n if (index > (len(self.twodkeys))-1):\n # raise an exception\n err_msg = 'Index ' + str(index) + ' does not exist!'\n raise aXeError(err_msg)\n # check whether the input type is correct\n elif (not isinstance(type(self[0]), obj)):\n # raise an exception\n err_msg = (\"Object: {0:s} has wrong type: {1:s}!\"\n .format(str(obj), str(type(obj))))\n raise aXeError(err_msg)\n\n # set the index to the input object\n self.twodkeys[index] = obj\n\n def _find_order(self, prefix, ident, keylist):\n \"\"\"Find the keyword with the polynomial order\n\n The method finds and extracts the keyword\n indicating the polynomial degree from\n a keyword list. The keyword is returned.\n\n Parameters\n ----------\n prefix: str\n keyword prefix\n ident: char\n beam identification\n keylist: list\n list of keywords\n\n Returns\n -------\n keyword: str\n keyword with number of orders\n \"\"\"\n # create the name of the keyword with the\n # polynomial order\n order_key = prefix + 'ORDER_' + ident\n\n # extract and return the keyword from the\n # keyword list\n return self._find_key(order_key, keylist)\n\n def _find_twodkeys(self, prefix, ident, keylist):\n \"\"\"Find the all 2D polynomial keywords\n\n Given a prefix and a beam identifier the method\n extracts all orders of the 2D polynomial which\n describes the trace or dispersion. The number\n of orders expected is taken from the object data.\n\n Parameters\n ----------\n prefix: str\n keyword prefix\n ident: char\n beam identification\n keylist: list\n list of keywords\n\n Returns\n -------\n keys: list\n list of keywords\n \"\"\"\n\n # initialize an empty list\n twodkeys = []\n\n # for each expected keyword\n for ii in range(int(self.norder.keyvalue)+1):\n # form the keyword name\n twodkey = prefix + ident + '_' + str(ii)\n\n # extract the new keyword\n newkey = self._find_key(twodkey, keylist, 1)\n\n if self._check_twodkey(newkey):\n # extract the keyword and append it to the list\n twodkeys.append(newkey)\n else:\n raise CKeyLengthWrong(ident, twodkey)\n\n # return the list\n return twodkeys\n\n def _find_key(self, keyword, keylist, lkey=0):\n \"\"\"Extract a certain keyword from the list\n\n The methods searches for a particular keyword\n in a keyword list. If found, the keyword is\n copied and destroied in the input list.\n If not found, an exception is fired.\n\n Parameters\n ----------\n keyword: str\n the keyword name\n keylist: list\n list of keywords\n\n Returns\n -------\n keyword: str\n the extracted keyword\n \"\"\"\n\n # initialize the index\n iindex = 0\n\n # set indicator to \"not found\"\n found = -1\n\n # go over all keys in the list\n for key in keylist:\n\n # checke whether the keyword is the desired one\n if key.keyword == keyword:\n # create a list keyword if desired\n if lkey:\n nkey = ConfListKey(key.keyword, key.keyvalue, key.comment)\n else:\n nkey = ConfKey(key.keyword, key.keyvalue, key.comment)\n\n # store the index\n found = iindex\n\n # enhance the index\n iindex += 1\n\n # fire an exception if nothing was found\n if found < 0:\n raise CKeyNotFound(keyword)\n # delete the keyword from the inlist\n else:\n del keylist[found]\n\n # return the keyword\n return nkey\n\n def _check_twodkey(self, inkey):\n \"\"\"Check the length of the a field dependent keyword\n\n Field dependent keywords such as the polynimial\n coefficients in the trace description and dispersion\n solution must have a certain number of values,\n which is:\n n = m^2/2 + m/2\n The method checks whether the number of values\n is in agreement with this.\n\n @param inkey: the keyword name\n @type inkey: ConfListKey\n\n @return: 1/0\n @rtype: int\n \"\"\"\n\n # determine the length of the list\n n = float(len(inkey.kvallist))\n\n # compute the 'order' of the xy-dependence\n m = (-1.0 + math.sqrt(1.0+8.0*n))/2.0\n\n # chech whether the 'order' is integer\n if math.fabs(m-int(m)) > 1.0e-16:\n # no integer -> key length wrong\n return 0\n\n # integer -> key length correct\n return 1\n\n def str_header(self, description):\n \"\"\"Create a header string\n\n The method offers to the subclasses the possibility\n to have a meaningful string header before the\n actual data string.\n\n Parameters\n ----------\n @param description: description of the object content\n @type description: string\n @return: the header string\n @rtype: string\n \"\"\"\n # pre-decoration\n rstring = '\\n#\\n# '\n\n # add description\n rstring += description\n\n # add post-decoration\n rstring += ':\\n#\\n'\n\n # return the result\n return rstring\n\n\nclass ConfigTrace(TwoDimPolyN):\n \"\"\"Configuration Beam object\"\"\"\n def __init__(self, ident=None, keylist=None):\n \"\"\"The method initializes a configuration beam\n\n object for a given beam identifier.\n All necessary keywords are extracted from\n an input keyword list.\n In case of missing keywords an exception\n is fired.\n\n Parameters\n ----------\n ident: char\n beam identification\n keylist: list\n list of keywords\n \"\"\"\n\n # try to read in the keywords\n try:\n self.ident = ident\n self.norder = self._find_order('DYDX_', ident, keylist)\n self.twodkeys = self._find_twodkeys('DYDX_', ident, keylist)\n\n # raise an exception if keywords are missing\n except CKeyNotFound as e:\n raise TraceNotFound(ident, e.keyword)\n except CKeyLengthWrong as e:\n _log.info('Field dependent keyword: ' + e.keyword)\n\n def __str__(self):\n \"\"\"Returns string representation of the object\"\"\"\n # create the label or description\n description = 'Trace description for Beam ' + str(self.ident)\n\n # get the string header\n rstring = super(ConfigTrace, self).str_header(description)\n\n # get the data string\n rstring += super(ConfigTrace, self).__str__()\n\n # return the result\n return rstring\n\n\nclass ConfigDisp(TwoDimPolyN):\n \"\"\"Configuration Beam object\"\"\"\n def __init__(self, ident=None, keylist=None):\n \"\"\"The method initializes a configuration dispersion\n\n object for a given beam identifier.\n All necessary keywords are extracted from\n an input keyword list.\n In case of missing keywords an exception\n is fired.\n\n Parameters\n ----------\n ident: char\n beam identification\n keylist: list\n list of keywords\n \"\"\"\n # try to read in the keywords\n try:\n self.ident = ident\n self.norder = self._find_order('DISP_', ident, keylist)\n self.twodkeys = self._find_twodkeys('DLDP_', ident, keylist)\n # raise an exception if keywords are missing\n except CKeyNotFound as e:\n try:\n self.twodkeys = self._find_twodkeys('DLD1P_', ident, keylist)\n # raise an exception if keywords are missing\n except CKeyNotFound as e:\n raise DispNotFound(ident, e.keyword)\n except CKeyLengthWrong as e:\n _log.info('\\nField dependent keyword: {0:s} has wrong length!'\n .format(e.keyword))\n raise DispNotFound(ident, e.keyword)\n except CKeyLengthWrong as e:\n _log.info('\\nField dependent keyword: {0:s} has wrong length!'\n .format(e.keyword))\n raise DispNotFound(ident, e.keyword)\n\n def __str__(self):\n \"\"\"return string representation of the object\"\"\"\n # create the label or description\n description = 'Dispersion solution for Beam ' + str(self.ident)\n\n # get the string header\n rstring = super(ConfigDisp, self).str_header(description)\n\n # get the data string\n rstring += super(ConfigDisp, self).__str__()\n\n # return the result\n return rstring\n\n\nclass DefConfHeader:\n \"\"\"Default header for a configuration file\"\"\"\n def __init__(self):\n self.header = []\n self.header.append(\"#-----------------------------------------------\"\n \"------------\\n# Default configuration file for aXe\"\n \"\\n#\\n#-------------------------------------------\"\n \"---------------\")\n\n def __str__(self):\n \"\"\"returns string representation of the object\"\"\"\n rstring = ''\n for line in self.header:\n rstring += line\n\n return rstring\n\n\nclass ConfHeader(DefConfHeader):\n \"\"\"Header class for the configuration file\"\"\"\n def __init__(self, filename=None):\n \"\"\"Initializes the configuration header class\n\n The method extracts the header from a configuration\n file. If no filename is provided, a default\n header is created.\n\n Parameters\n ----------\n filename: str\n name of the configuration file\n \"\"\"\n # no filename -> default header\n if filename is None:\n super(ConfHeader, self).__init__()\n else:\n # initialize the data list\n self.header = []\n\n # intialize the start pointer\n start = 1\n\n # open and parse through the file\n fopen = open(filename, 'r')\n for line in fopen:\n # check whether the start pointer is still set\n if start:\n # strip the line\n str_line = line.strip()\n\n # check whether the first character\n # is a comment, which qualifies\n # the line as part of the header\n if ((len(str_line) > 0) and (str_line[0] is '#')):\n # append the line to the header data\n self.header.append(line.strip()+'\\n')\n else:\n # set the starter pointer to 0,\n # thus indicating the end of the header\n start = 0\n # close the file\n fopen.close\n\n\nclass ConfKey:\n \"\"\"Class for a keyword in a configuration file\n\n This keyword class is a light, but yet versatile\n and important class to strore a keyword entry in a\n configuration file. All important values are\n directly read from the object attributes.\n \"\"\"\n def __init__(self, keyword, keyvalue, comment=None):\n \"\"\"Constructor for the keyword class\n\n The keyword instance is created using\n all input values.\n\n Parameter\n ---------\n keyword: str\n the keword name\n keyvalue: str\n the keyword value\n comment: str\n the keyword comment\n \"\"\"\n self.keyword = keyword\n self.keyvalue = keyvalue\n self.comment = comment\n\n def __str__(self):\n \"\"\"String method for the class\n\n The method creats and returns\n the string representation of the\n keyword.\n\n Returns\n -------\n obj: str\n string representation of the object\n \"\"\"\n rstring = self.keyword + ' ' + str(self.keyvalue)\n if self.comment is not None:\n rstring = rstring + ' ; ' + self.comment\n\n rstring += '\\n'\n\n return rstring\n\n\nclass ConfListKey(ConfKey):\n \"\"\"Class for a keyword list\n\n The keyword list class is a subclass derived from the\n keyword class. In the keyword list class has as an\n additional attribute the keyvalues transformed to a list\n of floats.\n \"\"\"\n def __init__(self, keyword, keyvalue, comment=None):\n \"\"\"Constructor for the keyword list class\n\n Initializer for the keyword list class.\n The keyword instance is created using\n all input values.\n\n Parameters\n ----------\n keyword: str\n the keword name\n keyvalue: str\n the keyword values\n comment: str\n the keyword comment\n \"\"\"\n # initialize the keyvalue list\n self.kvallist = []\n\n # create a traditional keyword instance\n super(ConfListKey, self).__init__(keyword, keyvalue, comment)\n\n # split the string keyvalue\n vlist = self.keyvalue.split()\n for value in vlist:\n # append the floats to the list\n self.kvallist.append(float(value))\n\n def __getitem__(self, index):\n \"\"\"Getindex method for the class\n\n The operator method which is called\n when an index is requested on a\n class instace\n test = kkk[0]\n\n Parameters\n ----------\n index: int\n the index to address\n\n Returns\n -------\n obj: float\n the indexed object\n \"\"\"\n # check whether the index exists\n if index > len(self.kvallist)-1:\n # raise an exception\n err_msg = 'Index: ' + str(index) + ' does not exist!'\n raise aXeError(err_msg)\n\n # return the indexed object\n return self.kvallist[index]\n\n def __setitem__(self, index, obj):\n \"\"\"Setindex method for the class\n\n The operator method which is called\n when the index of a class instance is\n set to a value.\n kkk[0] = test\n\n Parameters\n ----------\n index: int\n the index to address\n obj: list\n description of the object content\n \"\"\"\n # check whether the index exists\n if index > len(self.kvallist)-1:\n # raise an exception\n err_msg = 'Index ' + str(index) + ' does not exist!'\n raise aXeError(err_msg)\n # check whether the input type is correct\n elif not (isinstance(type(self[0]), obj)):\n # raise an exception\n err_msg = (\"Object: {0:s} has wrong type: {1:s}!\"\n .format(str(obj), str(type(obj))))\n raise aXeError(err_msg)\n\n # set the index to the input object\n self.kvallist[index] = obj\n\n def __str__(self):\n \"\"\"returns the string representation of the keyword.\"\"\"\n # first comes the keyword\n rstring = self.keyword\n\n # append the keyvalues using a default format\n for value in self.kvallist:\n rstring = rstring + ' %12.6g' % value\n\n # append the comment\n if self.comment is not None:\n rstring = rstring + ' ; ' + self.comment\n\n # append a linefeed\n rstring += '\\n'\n\n # return the complete string\n return rstring\n\n\nclass ConfError(Exception):\n \"\"\"Base class for exceptions in this module\"\"\"\n pass\n\n\nclass CKeyNotFound(ConfError):\n \"\"\"Error for missing keyword\"\"\"\n def __init__(self, keyword):\n self.keyword = keyword\n\n\nclass BeamNotFound(ConfError):\n \"\"\"Error for unknown beam \"\"\"\n def __init__(self, ident):\n self.ident = ident\n\n\nclass TraceNotFound(ConfError):\n \"\"\"Error for unknown trace\"\"\"\n def __init__(self, ident, keyword=None):\n self.ident = ident\n self.keyword = keyword\n\n\nclass DispNotFound(ConfError):\n \"\"\"Error for unknown dispersion\"\"\"\n def __init__(self, ident, keyword=None):\n self.ident = ident\n self.keyword = keyword\n\n\nclass CKeyLengthWrong(ConfError):\n \"\"\"Error for wrong lengt in KeywordList\"\"\"\n def __init__(self, ident, keyword=None):\n self.ident = ident\n self.keyword = keyword\n"},"avg_line_length":{"kind":"number","value":29.0986180905,"string":"29.098618"},"max_line_length":{"kind":"number","value":79,"string":"79"},"alphanum_fraction":{"kind":"number","value":0.5483432272,"string":"0.548343"},"licenses":{"kind":"list like","value":["BSD-3-Clause"],"string":"[\n \"BSD-3-Clause\"\n]"},"repository_name":{"kind":"string","value":"sosey/pyaxe"},"path":{"kind":"string","value":"pyaxe/axesrc/configfile.py"},"size":{"kind":"number","value":46325,"string":"46,325"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8779,"cells":{"content":{"kind":"string","value":"# from imports import *\n# import random\n\n# class Docs(commands.Cog):\n# def __init__(self, bot):\n# self.bot = bot\n\n# self.bot.loop.create_task(self.__ainit__())\n\n# async def __ainit__(self):\n# await self.bot.wait_until_ready()\n# self.scraper = AsyncScraper(session = self.bot.session)\n\n# async def rtfm_lookup(self, program = None, *, args = None):\n\n# rtfm_dictionary = {\n# \t\t\"fusion.py\": \"https://fusion.senarc.org/en/master/\",\n# \"development\" : \"https://fusion.senarc.org/en/development/\"\n# }\n\n# if not args:\n# return rtfm_dictionary.get(program)\n\n# else:\n# url = rtfm_dictionary.get(program)\n\n# results = await self.scraper.search(args, page=url)\n\n# if not results:\n# return f\"Could not find anything with {args}.\"\n\n# else:\n# return results\n\n# def reference(self, message):\n# reference = message.reference\n\n# if reference and isinstance(reference.resolved, discord.Message):\n# \t return reference.resolved.to_reference()\n\n# return None\n\n# async def rtfm_send(self, ctx, results):\n\n# if isinstance(results, str):\n# await ctx.send(results, allowed_mentions = discord.AllowedMentions.none())\n\n# else:\n# embed = discord.Embed(color = random.randint(0, 16777215))\n\n# results = results[:10]\n# embed.description = \"\\n\".join(f\"[`{result}`]({value})\" for result, value in results)\n\n# reference = self.reference(ctx.message)\n# await ctx.send(embed=embed, reference = reference)\n\n# @commands.group(slash_interaction=True, aliases=[\"rtd\", \"rtfs\"], brief=\"Search for attributes from docs.\")\n# async def rtfm(self, ctx, *, args = None):\n\n# await ctx.trigger_typing()\n# results = await self.rtfm_lookup(program = \"fusion.py\", args = args)\n# await self.rtfm_send(ctx, results)\n\n# @rtfm.command(slash_interaction=True, brief = \"a command using doc_search to look up at development's docs\")\n# async def development(self, ctx, *, args = None):\n\n# await ctx.trigger_typing()\n# results = await self.rtfm_lookup(program=\"development\", args = args)\n# await self.rtfm_send(ctx, results)\n\n# def setup(bot):\n# \tbot.add_cog(Docs(bot))\n"},"avg_line_length":{"kind":"number","value":30.0821917808,"string":"30.082192"},"max_line_length":{"kind":"number","value":112,"string":"112"},"alphanum_fraction":{"kind":"number","value":0.6511839709,"string":"0.651184"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"BenitzCoding/Utility-Bot"},"path":{"kind":"string","value":"cogs/docs.py"},"size":{"kind":"number","value":2196,"string":"2,196"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8780,"cells":{"content":{"kind":"string","value":"import typer\nfrom typing import Optional\nfrom article_ripper import get_document, html_to_md\n\napp = typer.Typer()\n\n\n@app.command()\ndef fun(url: str, out: Optional[str] = None) -> None:\n doc = get_document(url)\n doc_summary = doc.summary()\n if out is None:\n print(doc_summary)\n else:\n with open(out, \"w\") as f:\n f.write(doc_summary)\n\n\ndef run() -> None:\n app()\n\n\nif __name__ == \"__main__\":\n run()\n"},"avg_line_length":{"kind":"number","value":17.56,"string":"17.56"},"max_line_length":{"kind":"number","value":53,"string":"53"},"alphanum_fraction":{"kind":"number","value":0.6241457859,"string":"0.624146"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"nozwock/article-ripper"},"path":{"kind":"string","value":"src/article_ripper/cli.py"},"size":{"kind":"number","value":439,"string":"439"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8781,"cells":{"content":{"kind":"string","value":"from django.conf.urls import url, include\n\nimport binder.router # noqa\nimport binder.websocket # noqa\nimport binder.views # noqa\nimport binder.history # noqa\nimport binder.models # noqa\nimport binder.plugins.token_auth.views # noqa\nfrom binder.plugins.views.multi_request import multi_request_view\nfrom .views import animal, caretaker, costume, custom, zoo, contact_person, gate # noqa\n\nrouter = binder.router.Router().register(binder.views.ModelView)\nroom_controller = binder.websocket.RoomController().register(binder.views.ModelView)\n\nurlpatterns = [\n\turl(r'^custom/route', custom.custom, name='custom'),\n\t# url(r'^user/$', custom.user, name='user'),\n\turl(r'^multi/$', multi_request_view, name='multi_request'),\n\turl(r'^', include(router.urls)),\n\turl(r'^', binder.views.api_catchall, name='catchall'),\n]\n\n# FIXME: Hmm, this is a bit hackish. Especially here. But where else?\nbinder.models.install_history_signal_handlers(binder.models.BinderModel)\n"},"avg_line_length":{"kind":"number","value":38.04,"string":"38.04"},"max_line_length":{"kind":"number","value":87,"string":"87"},"alphanum_fraction":{"kind":"number","value":0.7686645636,"string":"0.768665"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"BBooijLiewes/django-binder"},"path":{"kind":"string","value":"tests/testapp/urls.py"},"size":{"kind":"number","value":951,"string":"951"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8782,"cells":{"content":{"kind":"string","value":"from .brand import BrandDataset, Brand\nfrom .vehicle_id import VehicleIDDataset\nfrom .comp_cars import CompCarsDataset\n# from .veri import VeriDataset\nfrom .box_cars import BoxCars116kDataset\n# from .vric import VRICDataset\nfrom .cars196 import Cars196Dataset"},"avg_line_length":{"kind":"number","value":37,"string":"37"},"max_line_length":{"kind":"number","value":40,"string":"40"},"alphanum_fraction":{"kind":"number","value":0.8455598456,"string":"0.84556"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"piyengar/vehicle-predictor"},"path":{"kind":"string","value":"experiments/brand/dataset/__init__.py"},"size":{"kind":"number","value":259,"string":"259"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8783,"cells":{"content":{"kind":"string","value":"\"\"\"Certbot constants.\"\"\"\nimport os\nimport logging\n\nfrom acme import challenges\n\n\nSETUPTOOLS_PLUGINS_ENTRY_POINT = \"certbot.plugins\"\n\"\"\"Setuptools entry point group name for plugins.\"\"\"\n\nOLD_SETUPTOOLS_PLUGINS_ENTRY_POINT = \"letsencrypt.plugins\"\n\"\"\"Plugins Setuptools entry point before rename.\"\"\"\n\nCLI_DEFAULTS = dict(\n config_files=[\n \"/etc/letsencrypt/cli.ini\",\n # http://freedesktop.org/wiki/Software/xdg-user-dirs/\n os.path.join(os.environ.get(\"XDG_CONFIG_HOME\", \"~/.config\"),\n \"letsencrypt\", \"cli.ini\"),\n ],\n dry_run=False,\n verbose_count=-int(logging.INFO / 10),\n server=\"https://acme-v01.api.letsencrypt.org/directory\",\n rsa_key_size=2048,\n rollback_checkpoints=1,\n config_dir=\"/etc/letsencrypt\",\n work_dir=\"/var/lib/letsencrypt\",\n logs_dir=\"/var/log/letsencrypt\",\n no_verify_ssl=False,\n http01_port=challenges.HTTP01Response.PORT,\n http01_address=\"\",\n tls_sni_01_port=challenges.TLSSNI01Response.PORT,\n tls_sni_01_address=\"\",\n\n auth_cert_path=\"./cert.pem\",\n auth_chain_path=\"./chain.pem\",\n strict_permissions=False,\n debug_challenges=False,\n)\nSTAGING_URI = \"https://acme-staging.api.letsencrypt.org/directory\"\n\n# The set of reasons for revoking a certificate is defined in RFC 5280 in\n# section 5.3.1. The reasons that users are allowed to submit are restricted to\n# those accepted by the ACME server implementation. They are listed in\n# `letsencrypt.boulder.revocation.reasons.go`.\nREVOCATION_REASONS = {\n \"unspecified\": 0,\n \"keycompromise\": 1,\n \"affiliationchanged\": 3,\n \"superseded\": 4,\n \"cessationofoperation\": 5}\n\n\"\"\"Defaults for CLI flags and `.IConfig` attributes.\"\"\"\n\nQUIET_LOGGING_LEVEL = logging.WARNING\n\"\"\"Logging level to use in quiet mode.\"\"\"\n\nRENEWER_DEFAULTS = dict(\n renewer_enabled=\"yes\",\n renew_before_expiry=\"30 days\",\n # This value should ensure that there is never a deployment delay by\n # default.\n deploy_before_expiry=\"99 years\",\n)\n\"\"\"Defaults for renewer script.\"\"\"\n\n\nENHANCEMENTS = [\"redirect\", \"http-header\", \"ocsp-stapling\", \"spdy\"]\n\"\"\"List of possible :class:`certbot.interfaces.IInstaller`\nenhancements.\n\nList of expected options parameters:\n- redirect: None\n- http-header: TODO\n- ocsp-stapling: certificate chain file path\n- spdy: TODO\n\n\"\"\"\n\nARCHIVE_DIR = \"archive\"\n\"\"\"Archive directory, relative to `IConfig.config_dir`.\"\"\"\n\nCONFIG_DIRS_MODE = 0o755\n\"\"\"Directory mode for ``.IConfig.config_dir`` et al.\"\"\"\n\nACCOUNTS_DIR = \"accounts\"\n\"\"\"Directory where all accounts are saved.\"\"\"\n\nBACKUP_DIR = \"backups\"\n\"\"\"Directory (relative to `IConfig.work_dir`) where backups are kept.\"\"\"\n\nCSR_DIR = \"csr\"\n\"\"\"See `.IConfig.csr_dir`.\"\"\"\n\nIN_PROGRESS_DIR = \"IN_PROGRESS\"\n\"\"\"Directory used before a permanent checkpoint is finalized (relative to\n`IConfig.work_dir`).\"\"\"\n\nKEY_DIR = \"keys\"\n\"\"\"Directory (relative to `IConfig.config_dir`) where keys are saved.\"\"\"\n\nLIVE_DIR = \"live\"\n\"\"\"Live directory, relative to `IConfig.config_dir`.\"\"\"\n\nTEMP_CHECKPOINT_DIR = \"temp_checkpoint\"\n\"\"\"Temporary checkpoint directory (relative to `IConfig.work_dir`).\"\"\"\n\nRENEWAL_CONFIGS_DIR = \"renewal\"\n\"\"\"Renewal configs directory, relative to `IConfig.config_dir`.\"\"\"\n\nFORCE_INTERACTIVE_FLAG = \"--force-interactive\"\n\"\"\"Flag to disable TTY checking in IDisplay.\"\"\"\n\nEFF_SUBSCRIBE_URI = \"https://supporters.eff.org/subscribe/certbot\"\n\"\"\"EFF URI used to submit the e-mail address of users who opt-in.\"\"\"\n"},"avg_line_length":{"kind":"number","value":29.5948275862,"string":"29.594828"},"max_line_length":{"kind":"number","value":79,"string":"79"},"alphanum_fraction":{"kind":"number","value":0.718904748,"string":"0.718905"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"Randagio13/certbot"},"path":{"kind":"string","value":"certbot/constants.py"},"size":{"kind":"number","value":3433,"string":"3,433"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8784,"cells":{"content":{"kind":"string","value":"# Copyright 2021 Canonical Ltd.\n# See LICENSE file for licensing details.\n\nfrom pathlib import Path\nfrom subprocess import check_output\nfrom time import sleep\n\nimport pytest\nimport yaml\nfrom selenium import webdriver\nfrom selenium.common.exceptions import JavascriptException, WebDriverException\nfrom selenium.webdriver.firefox.options import Options\nfrom selenium.webdriver.support.ui import WebDriverWait\n\n\nMETADATA = yaml.safe_load(Path(\"./metadata.yaml\").read_text())\n\n\n@pytest.mark.abort_on_fail\nasync def test_build_and_deploy(ops_test):\n my_charm = await ops_test.build_charm(\".\")\n image_path = METADATA[\"resources\"][\"oci-image\"][\"upstream-source\"]\n\n await ops_test.model.deploy(my_charm, resources={\"oci-image\": image_path})\n\n charm_name = METADATA[\"name\"]\n await ops_test.model.wait_for_idle(\n [charm_name],\n raise_on_blocked=True,\n raise_on_error=True,\n timeout=300,\n )\n assert ops_test.model.applications[charm_name].units[0].workload_status == \"waiting\"\n assert (\n ops_test.model.applications[charm_name].units[0].workload_status_message\n == \"Waiting for kubeflow-profiles relation data\"\n )\n\n\n@pytest.mark.abort_on_fail\nasync def test_add_profile_relation(ops_test):\n charm_name = METADATA[\"name\"]\n # TODO: Point kubeflow-profiles to latest/stable when Rev 54 or higher are promoted\n await ops_test.model.deploy(\"kubeflow-profiles\", channel=\"latest/edge\")\n await ops_test.model.add_relation(\"kubeflow-profiles\", charm_name)\n await ops_test.model.wait_for_idle(\n [\"kubeflow-profiles\", charm_name],\n status=\"active\",\n raise_on_blocked=True,\n raise_on_error=True,\n timeout=300,\n )\n\n\nasync def test_status(ops_test):\n charm_name = METADATA[\"name\"]\n assert ops_test.model.applications[charm_name].units[0].workload_status == \"active\"\n\n\ndef fix_queryselector(elems):\n \"\"\"Workaround for web components breaking querySelector.\n\n Because someone thought it was a good idea to just yeet the moral equivalent\n of iframes everywhere over a single page 🤦\n\n Shadow DOM was a terrible idea and everyone involved should feel professionally\n ashamed of themselves. Every problem it tried to solved could and should have\n been solved in better ways that don't break the DOM.\n \"\"\"\n\n selectors = '\").shadowRoot.querySelector(\"'.join(elems)\n return 'return document.querySelector(\"' + selectors + '\")'\n\n\n@pytest.fixture()\nasync def driver(request, ops_test):\n status = yaml.safe_load(\n check_output(\n [\"juju\", \"status\", \"-m\", ops_test.model_full_name, \"--format=yaml\"]\n )\n )\n endpoint = status[\"applications\"][\"kubeflow-dashboard\"][\"address\"]\n application = ops_test.model.applications[\"kubeflow-dashboard\"]\n config = await application.get_config()\n port = config[\"port\"][\"value\"]\n url = f\"http://{endpoint}.nip.io:{port}/\"\n options = Options()\n options.headless = True\n\n with webdriver.Firefox(options=options) as driver:\n wait = WebDriverWait(driver, 180, 1, (JavascriptException, StopIteration))\n for _ in range(60):\n try:\n driver.get(url)\n break\n except WebDriverException:\n sleep(5)\n else:\n driver.get(url)\n\n yield driver, wait, url\n\n driver.get_screenshot_as_file(f\"/tmp/selenium-{request.node.name}.png\")\n\n\ndef test_links(driver):\n driver, wait, url = driver\n\n # Ensure that sidebar links are set up properly\n links = [\n \"/jupyter/\",\n \"/katib/\",\n \"/pipeline/#/experiments\",\n \"/pipeline/#/pipelines\",\n \"/pipeline/#/runs\",\n \"/pipeline/#/recurringruns\",\n # Removed temporarily until https://warthogs.atlassian.net/browse/KF-175 is fixed\n # \"/pipeline/#/artifacts\",\n # \"/pipeline/#/executions\",\n \"/volumes/\",\n \"/tensorboards/\",\n ]\n\n for link in links:\n print(\"Looking for link: %s\" % link)\n script = fix_queryselector([\"main-page\", f\"iframe-link[href='{link}']\"])\n wait.until(lambda x: x.execute_script(script))\n\n # Ensure that quick links are set up properly\n links = [\n \"/pipeline/\",\n \"/pipeline/#/runs\",\n \"/jupyter/new?namespace=kubeflow\",\n \"/katib/\",\n ]\n\n for link in links:\n print(\"Looking for link: %s\" % link)\n script = fix_queryselector(\n [\n \"main-page\",\n \"dashboard-view\",\n f\"iframe-link[href='{link}']\",\n ]\n )\n wait.until(lambda x: x.execute_script(script))\n\n # Ensure that doc links are set up properly\n links = [\n \"https://charmed-kubeflow.io/docs/kubeflow-basics\",\n \"https://microk8s.io/docs/addon-kubeflow\",\n \"https://www.kubeflow.org/docs/started/requirements/\",\n ]\n\n for link in links:\n print(\"Looking for link: %s\" % link)\n script = fix_queryselector(\n [\n \"main-page\",\n \"dashboard-view\",\n f\"a[href='{link}']\",\n ]\n )\n wait.until(lambda x: x.execute_script(script))\n"},"avg_line_length":{"kind":"number","value":31.3575757576,"string":"31.357576"},"max_line_length":{"kind":"number","value":89,"string":"89"},"alphanum_fraction":{"kind":"number","value":0.6399304213,"string":"0.63993"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"VariableDeclared/kubeflow-dashboard-operator"},"path":{"kind":"string","value":"tests/integration/test_charm.py"},"size":{"kind":"number","value":5177,"string":"5,177"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8785,"cells":{"content":{"kind":"string","value":"# Copyright (c) 2017 Sofia Ira Ktena <ira.ktena@imperial.ac.uk>\n#\n# Permission is hereby granted, free of charge, to any person obtaining a copy\n# of this software and associated documentation files (the \"Software\"), to deal\n# in the Software without restriction, including without limitation the rights\n# to use, copy, modify, merge, publish, distribute, sublicense, and/or sell\n# copies of the Software, and to permit persons to whom the Software is\n# furnished to do so, subject to the following conditions:\n#\n# The above copyright notice and this permission notice shall be included in all\n# copies or substantial portions of the Software.\n\n\nimport os\n\nimport csv\nimport numpy as np\nimport scipy.io as sio\n\nfrom sklearn.covariance import GraphLassoCV\nimport nilearn\nfrom nilearn import connectome\n\n\n# Output path\nsave_path = '/vol/dhcp-hcp-data/ABIDE'\n\n# Number of subjects\nnum_subjects = 1000\n\n# Selected pipeline\npipeline = 'cpac'\n\n# Files to fetch\nderivatives = ['rois_ho']\n\n# Get the root folder\nroot_folder = os.path.join(save_path, 'ABIDE_pcp/cpac/filt_noglobal')\n\n\ndef get_ids(num_subjects=None, short=True):\n \"\"\"\n num_subjects : number of subject IDs to get\n short : True of False, specifies whether to get short or long subject IDs\n\n return:\n subject_IDs : list of subject IDs (length num_subjects)\n \"\"\"\n\n if short:\n subject_IDs = np.loadtxt(os.path.join(root_folder, 'subject_IDs.txt'), dtype=int)\n subject_IDs = subject_IDs.astype(str)\n else:\n subject_IDs = np.loadtxt(os.path.join(root_folder, 'full_IDs.txt'), dtype=str)\n\n if num_subjects is not None:\n subject_IDs = subject_IDs[:num_subjects]\n\n return subject_IDs\n\n\ndef fetch_filenames(subject_list, file_type):\n \"\"\"\n subject_list : list of short subject IDs in string format\n file_type : must be one of the available file types\n\n returns:\n\n filenames : list of filetypes (same length as subject_list)\n \"\"\"\n\n # Specify file mappings for the possible file types\n filemapping = {'func_preproc': '_func_preproc.nii.gz',\n 'rois_aal': '_rois_aal.1D',\n 'rois_cc200': '_rois_cc200.1D',\n 'rois_ho': '_rois_ho.1D'}\n\n # The list to be filled\n filenames = []\n\n # Load subject ID lists\n subject_IDs = get_ids(short=True)\n subject_IDs = subject_IDs.tolist()\n full_IDs = get_ids(short=False)\n\n # Fill list with requested file paths\n for s in subject_list:\n try:\n if file_type in filemapping:\n idx = subject_IDs.index(s)\n pattern = full_IDs[idx] + filemapping[file_type]\n else:\n pattern = s + file_type\n\n filenames.append(os.path.join(root_folder, s, pattern))\n except ValueError:\n # Return N/A if subject ID is not found\n filenames.append('N/A')\n\n return filenames\n\n\ndef fetch_subject_files(subjectID):\n \"\"\"\n subjectID : short subject ID for which list of available files are fetched\n\n returns:\n\n onlyfiles : list of absolute paths for available subject files\n \"\"\"\n\n # Load subject ID lists\n subject_IDs = get_ids(short=True)\n subject_IDs = subject_IDs.tolist()\n full_IDs = get_ids(short=False)\n\n try:\n idx = subject_IDs.index(subjectID)\n subject_folder = os.path.join(root_folder, subjectID)\n onlyfiles = [os.path.join(subject_folder, f) for f in os.listdir(subject_folder)\n if os.path.isfile(os.path.join(subject_folder, f))]\n except ValueError:\n onlyfiles = []\n\n return onlyfiles\n\n\ndef fetch_conn_matrices(subject_list, atlas_name, kind):\n \"\"\"\n subject_list : list of short subject IDs in string format\n atlas_name : the atlas based on which the timeseries are generated e.g. aal, cc200\n kind : the kind of correlation used to estimate the matrices, i.e.\n\n returns:\n connectivity : list of square connectivity matrices, one for each subject in subject_list\n \"\"\"\n\n conn_files = fetch_filenames(subject_list,\n '_' + atlas_name + '_' + kind.replace(' ', '_') + '.mat')\n\n conn_matrices = []\n\n for fl in conn_files:\n print(\"Reading connectivity file %s\" % fl)\n try:\n mat = sio.loadmat(fl)['connectivity']\n conn_matrices.append(mat)\n except IOError:\n print(\"File %s does not exist\" % fl)\n\n return conn_matrices\n\n\ndef get_timeseries(subject_list, atlas_name):\n \"\"\"\n subject_list : list of short subject IDs in string format\n atlas_name : the atlas based on which the timeseries are generated e.g. aal, cc200\n\n returns:\n ts : list of timeseries arrays, each of shape (timepoints x regions)\n \"\"\"\n\n ts_files = fetch_filenames(subject_list, 'rois_' + atlas_name)\n\n ts = []\n\n for fl in ts_files:\n print(\"Reading timeseries file %s\" % fl)\n ts.append(np.loadtxt(fl, skiprows=0))\n\n return ts\n\n\ndef norm_timeseries(ts_list):\n \"\"\"\n ts_list : list of timeseries arrays, each of shape (timepoints x regions)\n\n returns:\n norm_ts : list of normalised timeseries arrays, same shape as ts_list\n \"\"\"\n\n norm_ts = []\n\n for ts in ts_list:\n norm_ts.append(nilearn.signal.clean(ts, detrend=False))\n\n return norm_ts\n\n\ndef subject_connectivity(timeseries, subject, atlas_name, kind, save=True, save_path=root_folder):\n \"\"\"\n timeseries : timeseries table for subject (timepoints x regions)\n subject : the subject short ID\n atlas_name : name of the atlas used\n kind : the kind of connectivity to be used, e.g. lasso, partial correlation, correlation\n save : save the connectivity matrix to a file\n save_path : specify path to save the matrix if different from subject folder\n\n returns:\n connectivity : connectivity matrix (regions x regions)\n \"\"\"\n\n print(\"Estimating %s matrix for subject %s\" % (kind, subject))\n\n if kind == 'lasso':\n # Graph Lasso estimator\n covariance_estimator = GraphLassoCV(verbose=1)\n covariance_estimator.fit(timeseries)\n connectivity = covariance_estimator.covariance_\n print('Covariance matrix has shape {0}.'.format(connectivity.shape))\n\n elif kind in ['tangent', 'partial correlation', 'correlation']:\n conn_measure = connectome.ConnectivityMeasure(kind=kind)\n connectivity = conn_measure.fit_transform([timeseries])[0]\n\n if save:\n subject_file = os.path.join(save_path, subject,\n subject + '_' + atlas_name + '_' + kind.replace(' ', '_') + '.mat')\n sio.savemat(subject_file, {'connectivity': connectivity})\n\n return connectivity\n\n\ndef group_connectivity(timeseries, subject_list, atlas_name, kind, save=True, save_path=root_folder):\n \"\"\"\n timeseries : list of timeseries tables for subjects (timepoints x regions)\n subject_list : the subject short IDs list\n atlas_name : name of the atlas used\n kind : the kind of connectivity to be used, e.g. lasso, partial correlation, correlation\n save : save the connectivity matrix to a file\n save_path : specify path to save the matrix if different from subject folder\n\n returns:\n connectivity : connectivity matrix (regions x regions)\n \"\"\"\n\n if kind == 'lasso':\n # Graph Lasso estimator\n covariance_estimator = GraphLassoCV(verbose=1)\n connectivity_matrices = []\n\n for i, ts in enumerate(timeseries):\n covariance_estimator.fit(ts)\n connectivity = covariance_estimator.covariance_\n connectivity_matrices.append(connectivity)\n print('Covariance matrix has shape {0}.'.format(connectivity.shape))\n\n elif kind in ['tangent', 'partial correlation', 'correlation']:\n conn_measure = connectome.ConnectivityMeasure(kind=kind)\n connectivity_matrices = conn_measure.fit_transform(timeseries)\n\n if save:\n for i, subject in enumerate(subject_list):\n subject_file = os.path.join(save_path, subject_list[i],\n subject_list[i] + '_' + atlas_name + '_' + kind.replace(' ', '_') + '.mat')\n sio.savemat(subject_file, {'connectivity': connectivity_matrices[i]})\n print(\"Saving connectivity matrix to %s\" % subject_file)\n\n return connectivity_matrices\n\n\ndef get_subject_label(subject_list, label_name):\n \"\"\"\n subject_list : the subject short IDs list\n label_name : name of the label to be retrieved\n\n returns:\n label : dictionary of subject labels\n \"\"\"\n\n label = {}\n\n with open(os.path.join(save_path, 'ABIDE_pcp/Phenotypic_V1_0b_preprocessed1.csv')) as csvfile:\n reader = csv.DictReader(csvfile)\n\n for row in reader:\n if row['subject'] in subject_list:\n label[row['subject']] = row[label_name]\n\n return label\n\n\ndef load_all_networks(subject_list, kind, atlas_name=\"aal\"):\n \"\"\"\n subject_list : the subject short IDs list\n kind : the kind of connectivity to be used, e.g. lasso, partial correlation, correlation\n atlas_name : name of the atlas used\n\n returns:\n all_networks : list of connectivity matrices (regions x regions)\n \"\"\"\n\n all_networks = []\n\n for subject in subject_list:\n fl = os.path.join(root_folder, subject,\n subject + \"_\" + atlas_name + \"_\" + kind + \".mat\")\n matrix = sio.loadmat(fl)['connectivity']\n\n if atlas_name == 'ho':\n matrix = np.delete(matrix, 82, axis=0)\n matrix = np.delete(matrix, 82, axis=1)\n\n all_networks.append(matrix)\n # all_networks=np.array(all_networks)\n\n return all_networks\n\n\ndef get_net_vectors(subject_list, kind, atlas_name=\"aal\"):\n \"\"\"\n subject_list : the subject short IDs list\n kind : the kind of connectivity to be used, e.g. lasso, partial correlation, correlation\n atlas_name : name of the atlas used\n\n returns:\n matrix : matrix of connectivity vectors (num_subjects x num_connections)\n \"\"\"\n\n # This is an alternative implementation\n networks = load_all_networks(subject_list, kind, atlas_name=atlas_name)\n # Get Fisher transformed matrices\n norm_networks = [np.arctanh(mat) for mat in networks]\n # Get upper diagonal indices\n idx = np.triu_indices_from(norm_networks[0], 1)\n # Get vectorised matrices\n vec_networks = [mat[idx] for mat in norm_networks]\n # Each subject should be a row of the matrix\n matrix = np.vstack(vec_networks)\n\n return matrix\n\n\ndef get_atlas_coords(atlas_name='ho'):\n \"\"\"\n atlas_name : name of the atlas used\n\n returns:\n matrix : matrix of roi 3D coordinates in MNI space (num_rois x 3)\n \"\"\"\n\n coords_file = os.path.join(root_folder, atlas_name + '_coords.csv')\n coords = np.loadtxt(coords_file, delimiter=',')\n\n if atlas_name == 'ho':\n coords = np.delete(coords, 82, axis=0)\n\n return coords"},"avg_line_length":{"kind":"number","value":32.2413793103,"string":"32.241379"},"max_line_length":{"kind":"number","value":115,"string":"115"},"alphanum_fraction":{"kind":"number","value":0.6482174688,"string":"0.648217"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"HoganZhang/gcn_metric_learning"},"path":{"kind":"string","value":"lib/abide_utils.py"},"size":{"kind":"number","value":11220,"string":"11,220"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8786,"cells":{"content":{"kind":"string","value":"from typing import List\n\nimport numpy as np\n\n\ndef mask_nan(arrays: List[np.ndarray]) -> List[np.ndarray]:\n \"\"\"\n Drop indices from equal-sized arrays if the element at that index is NaN in\n any of the input arrays.\n\n Parameters\n ----------\n arrays : List[np.ndarray]\n list of ndarrays containing NaNs, to be masked\n\n Returns\n -------\n List[np.ndarray]\n masked arrays (free of NaNs)\n\n Notes\n -----\n This function find the indices where one or more elements is NaN in one or\n more of the input arrays, then drops those indices from all arrays.\n For example:\n >> a = np.array([0, 1, np.nan, 3])\n >> b = np.array([np.nan, 5, np.nan, 7])\n >> c = np.array([8, 9, 10, 11])\n >> mask_nan([a, b, c])\n [array([ 1., 3.]), array([ 5., 7.]), array([ 9, 11])]\n\n \"\"\"\n n = arrays[0].size\n assert all(a.size == n for a in arrays[1:])\n mask = np.array([False] * n)\n for arr in arrays:\n mask = np.logical_or(mask, np.isnan(arr))\n return [arr[np.where(~mask)[0]] for arr in arrays]\n"},"avg_line_length":{"kind":"number","value":27.1282051282,"string":"27.128205"},"max_line_length":{"kind":"number","value":79,"string":"79"},"alphanum_fraction":{"kind":"number","value":0.5812854442,"string":"0.581285"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"jbburt/jburt"},"path":{"kind":"string","value":"jburt/mask.py"},"size":{"kind":"number","value":1058,"string":"1,058"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8787,"cells":{"content":{"kind":"string","value":"# Copyright 2016 Google Inc. All rights reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n\n\"\"\"Pure Python crypto-related routines for oauth2client.\n\nUses the ``rsa``, ``pyasn1`` and ``pyasn1_modules`` packages\nto parse PEM files storing PKCS#1 or PKCS#8 keys as well as\ncertificates.\n\"\"\"\n\nfrom pyasn1.codec.der import decoder\nfrom pyasn1_modules import pem\nfrom pyasn1_modules.rfc2459 import Certificate\nfrom pyasn1_modules.rfc5208 import PrivateKeyInfo\nimport rsa\nimport sixm\n\nfrom oauth2client import _helpers\n\n\n_PKCS12_ERROR = r\"\"\"\\\nPKCS12 format is not supported by the RSA library.\nEither install PyOpenSSL, or please convert .p12 format\nto .pem format:\n $ cat key.p12 | \\\n > openssl pkcs12 -nodes -nocerts -passin pass:notasecret | \\\n > openssl rsa > key.pem\n\"\"\"\n\n_POW2 = (128, 64, 32, 16, 8, 4, 2, 1)\n_PKCS1_MARKER = ('-----BEGIN RSA PRIVATE KEY-----',\n '-----END RSA PRIVATE KEY-----')\n_PKCS8_MARKER = ('-----BEGIN PRIVATE KEY-----',\n '-----END PRIVATE KEY-----')\n_PKCS8_SPEC = PrivateKeyInfo()\n\n\ndef _bit_list_to_bytes(bit_list):\n \"\"\"Converts an iterable of 1's and 0's to bytes.\n\n Combines the list 8 at a time, treating each group of 8 bits\n as a single byte.\n \"\"\"\n num_bits = len(bit_list)\n byte_vals = bytearray()\n for start in sixm.moves.xrange(0, num_bits, 8):\n curr_bits = bit_list[start:start + 8]\n char_val = sum(val * digit\n for val, digit in zip(_POW2, curr_bits))\n byte_vals.append(char_val)\n return bytes(byte_vals)\n\n\nclass RsaVerifier(object):\n \"\"\"Verifies the signature on a message.\n\n Args:\n pubkey: rsa.key.PublicKey (or equiv), The public key to verify with.\n \"\"\"\n\n def __init__(self, pubkey):\n self._pubkey = pubkey\n\n def verify(self, message, signature):\n \"\"\"Verifies a message against a signature.\n\n Args:\n message: string or bytes, The message to verify. If string, will be\n encoded to bytes as utf-8.\n signature: string or bytes, The signature on the message. If\n string, will be encoded to bytes as utf-8.\n\n Returns:\n True if message was signed by the private key associated with the\n public key that this object was constructed with.\n \"\"\"\n message = _helpers._to_bytes(message, encoding='utf-8')\n try:\n return rsa.pkcs1.verify(message, signature, self._pubkey)\n except (ValueError, rsa.pkcs1.VerificationError):\n return False\n\n @classmethod\n def from_string(cls, key_pem, is_x509_cert):\n \"\"\"Construct an RsaVerifier instance from a string.\n\n Args:\n key_pem: string, public key in PEM format.\n is_x509_cert: bool, True if key_pem is an X509 cert, otherwise it\n is expected to be an RSA key in PEM format.\n\n Returns:\n RsaVerifier instance.\n\n Raises:\n ValueError: if the key_pem can't be parsed. In either case, error\n will begin with 'No PEM start marker'. If\n ``is_x509_cert`` is True, will fail to find the\n \"-----BEGIN CERTIFICATE-----\" error, otherwise fails\n to find \"-----BEGIN RSA PUBLIC KEY-----\".\n \"\"\"\n key_pem = _helpers._to_bytes(key_pem)\n if is_x509_cert:\n der = rsa.pem.load_pem(key_pem, 'CERTIFICATE')\n asn1_cert, remaining = decoder.decode(der, asn1Spec=Certificate())\n if remaining != b'':\n raise ValueError('Unused bytes', remaining)\n\n cert_info = asn1_cert['tbsCertificate']['subjectPublicKeyInfo']\n key_bytes = _bit_list_to_bytes(cert_info['subjectPublicKey'])\n pubkey = rsa.PublicKey.load_pkcs1(key_bytes, 'DER')\n else:\n pubkey = rsa.PublicKey.load_pkcs1(key_pem, 'PEM')\n return cls(pubkey)\n\n\nclass RsaSigner(object):\n \"\"\"Signs messages with a private key.\n\n Args:\n pkey: rsa.key.PrivateKey (or equiv), The private key to sign with.\n \"\"\"\n\n def __init__(self, pkey):\n self._key = pkey\n\n def sign(self, message):\n \"\"\"Signs a message.\n\n Args:\n message: bytes, Message to be signed.\n\n Returns:\n string, The signature of the message for the given key.\n \"\"\"\n message = _helpers._to_bytes(message, encoding='utf-8')\n return rsa.pkcs1.sign(message, self._key, 'SHA-256')\n\n @classmethod\n def from_string(cls, key, password='notasecret'):\n \"\"\"Construct an RsaSigner instance from a string.\n\n Args:\n key: string, private key in PEM format.\n password: string, password for private key file. Unused for PEM\n files.\n\n Returns:\n RsaSigner instance.\n\n Raises:\n ValueError if the key cannot be parsed as PKCS#1 or PKCS#8 in\n PEM format.\n \"\"\"\n key = _helpers._from_bytes(key) # pem expects str in Py3\n marker_id, key_bytes = pem.readPemBlocksFromFile(\n sixm.StringIO(key), _PKCS1_MARKER, _PKCS8_MARKER)\n\n if marker_id == 0:\n pkey = rsa.key.PrivateKey.load_pkcs1(key_bytes,\n format='DER')\n elif marker_id == 1:\n key_info, remaining = decoder.decode(\n key_bytes, asn1Spec=_PKCS8_SPEC)\n if remaining != b'':\n raise ValueError('Unused bytes', remaining)\n pkey_info = key_info.getComponentByName('privateKey')\n pkey = rsa.key.PrivateKey.load_pkcs1(pkey_info.asOctets(),\n format='DER')\n else:\n raise ValueError('No key could be detected.')\n\n return cls(pkey)\n"},"avg_line_length":{"kind":"number","value":34.4324324324,"string":"34.432432"},"max_line_length":{"kind":"number","value":79,"string":"79"},"alphanum_fraction":{"kind":"number","value":0.609733124,"string":"0.609733"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"giangpvit/googledrivepythonsample"},"path":{"kind":"string","value":"test/lib/oauth2client/_pure_python_crypt.py"},"size":{"kind":"number","value":6370,"string":"6,370"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8788,"cells":{"content":{"kind":"string","value":"def findDecision(obj): #obj[0]: Passanger, obj[1]: Coupon, obj[2]: Education, obj[3]: Occupation, obj[4]: Restaurant20to50, obj[5]: Distance\n\t# {\"feature\": \"Passanger\", \"instances\": 34, \"metric_value\": 0.9774, \"depth\": 1}\n\tif obj[0]<=1:\n\t\t# {\"feature\": \"Restaurant20to50\", \"instances\": 22, \"metric_value\": 0.7732, \"depth\": 2}\n\t\tif obj[4]<=3.0:\n\t\t\t# {\"feature\": \"Education\", \"instances\": 21, \"metric_value\": 0.7025, \"depth\": 3}\n\t\t\tif obj[2]<=2:\n\t\t\t\t# {\"feature\": \"Occupation\", \"instances\": 16, \"metric_value\": 0.8113, \"depth\": 4}\n\t\t\t\tif obj[3]<=10:\n\t\t\t\t\t# {\"feature\": \"Coupon\", \"instances\": 13, \"metric_value\": 0.6194, \"depth\": 5}\n\t\t\t\t\tif obj[1]>2:\n\t\t\t\t\t\t# {\"feature\": \"Distance\", \"instances\": 7, \"metric_value\": 0.8631, \"depth\": 6}\n\t\t\t\t\t\tif obj[5]<=2:\n\t\t\t\t\t\t\treturn 'False'\n\t\t\t\t\t\telif obj[5]>2:\n\t\t\t\t\t\t\treturn 'False'\n\t\t\t\t\t\telse: return 'False'\n\t\t\t\t\telif obj[1]<=2:\n\t\t\t\t\t\treturn 'False'\n\t\t\t\t\telse: return 'False'\n\t\t\t\telif obj[3]>10:\n\t\t\t\t\t# {\"feature\": \"Coupon\", \"instances\": 3, \"metric_value\": 0.9183, \"depth\": 5}\n\t\t\t\t\tif obj[1]<=2:\n\t\t\t\t\t\treturn 'True'\n\t\t\t\t\telif obj[1]>2:\n\t\t\t\t\t\treturn 'False'\n\t\t\t\t\telse: return 'False'\n\t\t\t\telse: return 'True'\n\t\t\telif obj[2]>2:\n\t\t\t\treturn 'False'\n\t\t\telse: return 'False'\n\t\telif obj[4]>3.0:\n\t\t\treturn 'True'\n\t\telse: return 'True'\n\telif obj[0]>1:\n\t\t# {\"feature\": \"Coupon\", \"instances\": 12, \"metric_value\": 0.8113, \"depth\": 2}\n\t\tif obj[1]>0:\n\t\t\t# {\"feature\": \"Occupation\", \"instances\": 11, \"metric_value\": 0.684, \"depth\": 3}\n\t\t\tif obj[3]<=20:\n\t\t\t\t# {\"feature\": \"Restaurant20to50\", \"instances\": 10, \"metric_value\": 0.469, \"depth\": 4}\n\t\t\t\tif obj[4]>1.0:\n\t\t\t\t\treturn 'True'\n\t\t\t\telif obj[4]<=1.0:\n\t\t\t\t\t# {\"feature\": \"Education\", \"instances\": 4, \"metric_value\": 0.8113, \"depth\": 5}\n\t\t\t\t\tif obj[2]<=1:\n\t\t\t\t\t\treturn 'True'\n\t\t\t\t\telif obj[2]>1:\n\t\t\t\t\t\t# {\"feature\": \"Distance\", \"instances\": 2, \"metric_value\": 1.0, \"depth\": 6}\n\t\t\t\t\t\tif obj[5]<=2:\n\t\t\t\t\t\t\treturn 'True'\n\t\t\t\t\t\telse: return 'True'\n\t\t\t\t\telse: return 'True'\n\t\t\t\telse: return 'True'\n\t\t\telif obj[3]>20:\n\t\t\t\treturn 'False'\n\t\t\telse: return 'False'\n\t\telif obj[1]<=0:\n\t\t\treturn 'False'\n\t\telse: return 'False'\n\telse: return 'True'\n"},"avg_line_length":{"kind":"number","value":34.5081967213,"string":"34.508197"},"max_line_length":{"kind":"number","value":140,"string":"140"},"alphanum_fraction":{"kind":"number","value":0.5643705463,"string":"0.564371"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"apcarrik/kaggle"},"path":{"kind":"string","value":"duke-cs671-fall21-coupon-recommendation/outputs/rules/RF/6_features/numtrees_30/rule_0.py"},"size":{"kind":"number","value":2105,"string":"2,105"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8789,"cells":{"content":{"kind":"string","value":"import AnalysisModule as Ass\nimport GraphFunctions as Gfs\nimport yfinance as yf\nimport DatabaseStocks as Ds\n\nlistOfStocksToAnalyze = Ds.get_lists()\n\nmacdproposedbuylist = []\nmacdproposedselllist = []\nproposedbuylist = []\nproposedselllist = []\n\nfor stock in listOfStocksToAnalyze:\n # print(stock)\n StockData = yf.Ticker(stock).history(period=\"1y\")\n if Ass.macd_potential_buy(StockData) and Ass.is_stock_rising(StockData):\n macdproposedbuylist.append(stock)\n print(\"MACD Something you might wanna buy is \" + stock)\n continue\n\n if Ass.macd_potential_sell(StockData) and Ass.is_stock_falling(StockData):\n macdproposedselllist.append(stock)\n print(\"MACD Something you might wanna sell is \" + stock)\n\n if Ass.sma_potential_buy(StockData):\n proposedbuylist.append(stock)\n print(\"Something you might wanna buy is \" + stock)\n continue\n\n if Ass.sma_potential_sell(StockData):\n proposedselllist.append(stock)\n print(\"Something you might wanna sell is \" + stock)\n\nprint(macdproposedselllist)\nprint(macdproposedbuylist)\n\nfor stock in macdproposedbuylist:\n StockData = yf.Ticker(stock).history(period=\"1y\")\n Gfs.draw_macd_buy(StockData, \"BUY \" + stock)\n\nfor stock in macdproposedselllist:\n StockData = yf.Ticker(stock).history(period=\"1y\")\n Gfs.draw_macd_sell(StockData, \"SELL \" + stock)\n\nfor stock in proposedbuylist:\n StockData = yf.Ticker(stock).history(period=\"1y\")\n Gfs.draw_macd_buy(StockData, \"BUY MA \" + stock)\n\nfor stock in proposedselllist:\n StockData = yf.Ticker(stock).history(period=\"1y\")\n Gfs.draw_macd_sell(StockData, \"SELL MA \" + stock)\n"},"avg_line_length":{"kind":"number","value":31.75,"string":"31.75"},"max_line_length":{"kind":"number","value":78,"string":"78"},"alphanum_fraction":{"kind":"number","value":0.7244094488,"string":"0.724409"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"VaseSimion/Finance"},"path":{"kind":"string","value":"workfile.py"},"size":{"kind":"number","value":1651,"string":"1,651"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8790,"cells":{"content":{"kind":"string","value":"#!/usr/bin/env python\n\nfrom __future__ import absolute_import\nfrom __future__ import division\nfrom __future__ import print_function\n\nimport os\nfrom yolov2_ros.srv import *\nimport rospy\nfrom copy import deepcopy\nfrom core import YOLO\nfrom vision_msgs.msg import Detection2DArray, Detection2D, BoundingBox2D, ObjectHypothesisWithPose\nfrom geometry_msgs.msg import PoseWithCovariance, Pose2D\nfrom std_msgs.msg import Header\nfrom sensor_msgs.msg import Image\nfrom cv_bridge import CvBridge, CvBridgeError\n\nos.environ[\"CUDA_DEVICE_ORDER\"]=\"PCI_BUS_ID\"\nos.environ[\"CUDA_VISIBLE_DEVICES\"]=\"0\"\nos.environ['TF_CPP_MIN_LOG_LEVEL'] = '3' \n\nclass YoloServer(object):\n def __init__(self):\n self.bridge = CvBridge()\n\n self.n_gpu = rospy.get_param('~n_gpu', default=1)\n self.backend = rospy.get_param('~backend', default='full_yolo') # Either 'tiny_yolo', full_yolo, 'mobile_net, 'squeeze_net', or 'inception3'\n self.backend_path = rospy.get_param('~weights_path') # Weights directory\n self.input_size = rospy.get_param('~input_size', default=416) # DO NOT change this. 416 is default for YOLO.\n self.labels = rospy.get_param('~labels') # Eg: ['trafficcone', 'person', 'dog']\n self.max_number_detections = rospy.get_param('~max_number_detections', default=5) # Max number of detections\n self.anchors = rospy.get_param('~anchors', default=[0.57273, 0.677385, 1.87446, # The anchors to use. Use the anchor generator and copy these into the config.\n 2.06253, 3.33843, 5.47434, 7.88282, \n 3.52778, 9.77052, 9.16828])\n self.weights_path = rospy.get_param('~weights_path', default='../weights/full_yolo.h5') # Path to the weights.h5 file\n self.weight_file = rospy.get_param('~weight_file')\n\n self.yolo = YOLO(\n n_gpu=self.n_gpu,\n backend = self.backend,\n backend_path=self.backend_path,\n input_size = self.input_size, \n labels = self.labels, \n max_box_per_image = self.max_number_detections,\n anchors = self.anchors\n )\n\n self.yolo.load_weights(self.weights_path + '/' + self.weight_file)\n\n rospy.loginfo('YOLO detector ready...')\n\n s = rospy.Service('yolo_detect', YoloDetect, self._handle_yolo_detect, buff_size=10000000)\n\n s.spin()\n\n def _handle_yolo_detect(self, req):\n cv_image = None\n detection_array = Detection2DArray()\n detections = []\n boxes = None\n \n try:\n cv_image = self.bridge.imgmsg_to_cv2(req.image, \"bgr8\")\n except CvBridgeError as e:\n rospy.logerr(e)\n try:\n boxes = self.yolo.predict(cv_image)\n except SystemError:\n pass\n # rospy.loginfo('Found {} boxes'.format(len(boxes)))\n for box in boxes:\n detection = Detection2D()\n results = []\n bbox = BoundingBox2D()\n center = Pose2D()\n\n detection.header = Header()\n detection.header.stamp = rospy.get_rostime()\n # detection.source_img = deepcopy(req.image)\n\n labels = box.get_all_labels()\n for i in range(0,len(labels)):\n object_hypothesis = ObjectHypothesisWithPose()\n object_hypothesis.id = i\n object_hypothesis.score = labels[i]\n results.append(object_hypothesis)\n \n detection.results = results\n\n x, y = box.get_xy_center()\n center.x = x\n center.y = y\n center.theta = 0.0\n bbox.center = center\n\n size_x, size_y = box.get_xy_extents()\n bbox.size_x = size_x\n bbox.size_y = size_y\n\n detection.bbox = bbox\n\n detections.append(detection)\n\n detection_array.header = Header()\n detection_array.header.stamp = rospy.get_rostime()\n detection_array.detections = detections\n\n return YoloDetectResponse(detection_array)\n\nif __name__ == '__main__':\n rospy.init_node('yolo_server')\n \n try:\n ys = YoloServer()\n except rospy.ROSInterruptException:\n pass"},"avg_line_length":{"kind":"number","value":37.8534482759,"string":"37.853448"},"max_line_length":{"kind":"number","value":175,"string":"175"},"alphanum_fraction":{"kind":"number","value":0.5991801412,"string":"0.59918"},"licenses":{"kind":"list like","value":["BSD-3-Clause"],"string":"[\n \"BSD-3-Clause\"\n]"},"repository_name":{"kind":"string","value":"diggerdata/yolov2_ros"},"path":{"kind":"string","value":"scripts/yolo_server.py"},"size":{"kind":"number","value":4391,"string":"4,391"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8791,"cells":{"content":{"kind":"string","value":"from . import IGGrid\n\ndef get():\n return IGGrid.IGGrid()\n\n"},"avg_line_length":{"kind":"number","value":10.1666666667,"string":"10.166667"},"max_line_length":{"kind":"number","value":26,"string":"26"},"alphanum_fraction":{"kind":"number","value":0.6557377049,"string":"0.655738"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"bertrandboudaud/imagegraph"},"path":{"kind":"string","value":"nodes/IGGrid/__init__.py"},"size":{"kind":"number","value":61,"string":"61"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8792,"cells":{"content":{"kind":"string","value":"from django.urls import path, include\nfrom . import views\n\napp_name = 'test_app'\n\nurlpatterns = [\n path('', views.index, name='index'),\n]"},"avg_line_length":{"kind":"number","value":17.5,"string":"17.5"},"max_line_length":{"kind":"number","value":40,"string":"40"},"alphanum_fraction":{"kind":"number","value":0.6857142857,"string":"0.685714"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"nosu23/docker-gunicorn-django-example"},"path":{"kind":"string","value":"gunicorn/src/test_app/urls.py"},"size":{"kind":"number","value":140,"string":"140"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8793,"cells":{"content":{"kind":"string","value":"#!/usr/bin/env python3\n# Copyright (c) 2018 The Bitcoin Core developers\n# Copyright (c) 2017 The Raven Core developers\n# Copyright (c) 2018 The Rito Core developers\n# Distributed under the MIT software license, see the accompanying\n# file COPYING or http://www.opensource.org/licenses/mit-license.php.\n\"\"\"Test compact blocks (BIP 152).\n\nVersion 1 compact blocks are pre-segwit (txids)\nVersion 2 compact blocks are post-segwit (wtxids)\n\"\"\"\n\nfrom test_framework.mininode import *\nfrom test_framework.test_framework import RitoTestFramework\nfrom test_framework.util import *\nfrom test_framework.blocktools import create_block, create_coinbase, add_witness_commitment\nfrom test_framework.script import CScript, OP_TRUE\n\n# TestNode: A peer we use to send messages to ritod, and store responses.\nclass TestNode(NodeConnCB):\n def __init__(self):\n super().__init__()\n self.last_sendcmpct = []\n self.block_announced = False\n # Store the hashes of blocks we've seen announced.\n # This is for synchronizing the p2p message traffic,\n # so we can eg wait until a particular block is announced.\n self.announced_blockhashes = set()\n\n def on_sendcmpct(self, conn, message):\n self.last_sendcmpct.append(message)\n\n def on_cmpctblock(self, conn, message):\n self.block_announced = True\n self.last_message[\"cmpctblock\"].header_and_shortids.header.calc_sha256()\n self.announced_blockhashes.add(self.last_message[\"cmpctblock\"].header_and_shortids.header.sha256)\n\n def on_headers(self, conn, message):\n self.block_announced = True\n for x in self.last_message[\"headers\"].headers:\n x.calc_sha256()\n self.announced_blockhashes.add(x.sha256)\n\n def on_inv(self, conn, message):\n for x in self.last_message[\"inv\"].inv:\n if x.type == 2:\n self.block_announced = True\n self.announced_blockhashes.add(x.hash)\n\n # Requires caller to hold mininode_lock\n def received_block_announcement(self):\n return self.block_announced\n\n def clear_block_announcement(self):\n with mininode_lock:\n self.block_announced = False\n self.last_message.pop(\"inv\", None)\n self.last_message.pop(\"headers\", None)\n self.last_message.pop(\"cmpctblock\", None)\n\n def get_headers(self, locator, hashstop):\n msg = msg_getheaders()\n msg.locator.vHave = locator\n msg.hashstop = hashstop\n self.connection.send_message(msg)\n\n def send_header_for_blocks(self, new_blocks):\n headers_message = msg_headers()\n headers_message.headers = [CBlockHeader(b) for b in new_blocks]\n self.send_message(headers_message)\n\n def request_headers_and_sync(self, locator, hashstop=0):\n self.clear_block_announcement()\n self.get_headers(locator, hashstop)\n wait_until(self.received_block_announcement, timeout=30, lock=mininode_lock)\n self.clear_block_announcement()\n\n # Block until a block announcement for a particular block hash is\n # received.\n def wait_for_block_announcement(self, block_hash, timeout=30):\n def received_hash():\n return (block_hash in self.announced_blockhashes)\n wait_until(received_hash, timeout=timeout, lock=mininode_lock)\n\n def send_await_disconnect(self, message, timeout=30):\n \"\"\"Sends a message to the node and wait for disconnect.\n\n This is used when we want to send a message into the node that we expect\n will get us disconnected, eg an invalid block.\"\"\"\n self.send_message(message)\n wait_until(lambda: not self.connected, timeout=timeout, lock=mininode_lock)\n\nclass CompactBlocksTest(RitoTestFramework):\n def set_test_params(self):\n self.setup_clean_chain = True\n # Node0 = pre-segwit, node1 = segwit-aware\n self.num_nodes = 2\n self.extra_args = [[\"-vbparams=segwit:0:0\"], [\"-txindex\"]]\n self.utxos = []\n\n def build_block_on_tip(self, node, segwit=False):\n height = node.getblockcount()\n tip = node.getbestblockhash()\n mtp = node.getblockheader(tip)['mediantime']\n block = create_block(int(tip, 16), create_coinbase(height + 1), mtp + 1)\n block.nVersion = 4\n if segwit:\n add_witness_commitment(block)\n block.solve()\n return block\n\n # Create 10 more anyone-can-spend utxo's for testing.\n def make_utxos(self):\n # Doesn't matter which node we use, just use node0.\n block = self.build_block_on_tip(self.nodes[0])\n self.test_node.send_and_ping(msg_block(block))\n assert(int(self.nodes[0].getbestblockhash(), 16) == block.sha256)\n self.nodes[0].generate(100)\n\n total_value = block.vtx[0].vout[0].nValue\n out_value = total_value // 10\n tx = CTransaction()\n tx.vin.append(CTxIn(COutPoint(block.vtx[0].sha256, 0), b''))\n for i in range(10):\n tx.vout.append(CTxOut(out_value, CScript([OP_TRUE])))\n tx.rehash()\n\n block2 = self.build_block_on_tip(self.nodes[0])\n block2.vtx.append(tx)\n block2.hashMerkleRoot = block2.calc_merkle_root()\n block2.solve()\n self.test_node.send_and_ping(msg_block(block2))\n assert_equal(int(self.nodes[0].getbestblockhash(), 16), block2.sha256)\n self.utxos.extend([[tx.sha256, i, out_value] for i in range(10)])\n return\n\n # Test \"sendcmpct\" (between peers preferring the same version):\n # - No compact block announcements unless sendcmpct is sent.\n # - If sendcmpct is sent with version > preferred_version, the message is ignored.\n # - If sendcmpct is sent with boolean 0, then block announcements are not\n # made with compact blocks.\n # - If sendcmpct is then sent with boolean 1, then new block announcements\n # are made with compact blocks.\n # If old_node is passed in, request compact blocks with version=preferred-1\n # and verify that it receives block announcements via compact block.\n def test_sendcmpct(self, node, test_node, preferred_version, old_node=None):\n # Make sure we get a SENDCMPCT message from our peer\n def received_sendcmpct():\n return (len(test_node.last_sendcmpct) > 0)\n wait_until(received_sendcmpct, timeout=30, lock=mininode_lock)\n with mininode_lock:\n # Check that the first version received is the preferred one\n assert_equal(test_node.last_sendcmpct[0].version, preferred_version)\n # And that we receive versions down to 1.\n assert_equal(test_node.last_sendcmpct[-1].version, 1)\n test_node.last_sendcmpct = []\n\n tip = int(node.getbestblockhash(), 16)\n\n def check_announcement_of_new_block(node, peer, predicate):\n peer.clear_block_announcement()\n block_hash = int(node.generate(1)[0], 16)\n peer.wait_for_block_announcement(block_hash, timeout=30)\n assert(peer.block_announced)\n\n with mininode_lock:\n assert predicate(peer), (\n \"block_hash={!r}, cmpctblock={!r}, inv={!r}\".format(\n block_hash, peer.last_message.get(\"cmpctblock\", None), peer.last_message.get(\"inv\", None)))\n\n # We shouldn't get any block announcements via cmpctblock yet.\n check_announcement_of_new_block(node, test_node, lambda p: \"cmpctblock\" not in p.last_message)\n\n # Try one more time, this time after requesting headers.\n test_node.request_headers_and_sync(locator=[tip])\n check_announcement_of_new_block(node, test_node, lambda p: \"cmpctblock\" not in p.last_message and \"inv\" in p.last_message)\n\n # Test a few ways of using sendcmpct that should NOT\n # result in compact block announcements.\n # Before each test, sync the headers chain.\n test_node.request_headers_and_sync(locator=[tip])\n\n # Now try a SENDCMPCT message with too-high version\n sendcmpct = msg_sendcmpct()\n sendcmpct.version = preferred_version+1\n sendcmpct.announce = True\n test_node.send_and_ping(sendcmpct)\n check_announcement_of_new_block(node, test_node, lambda p: \"cmpctblock\" not in p.last_message)\n\n # Headers sync before next test.\n test_node.request_headers_and_sync(locator=[tip])\n\n # Now try a SENDCMPCT message with valid version, but announce=False\n sendcmpct.version = preferred_version\n sendcmpct.announce = False\n test_node.send_and_ping(sendcmpct)\n check_announcement_of_new_block(node, test_node, lambda p: \"cmpctblock\" not in p.last_message)\n\n # Headers sync before next test.\n test_node.request_headers_and_sync(locator=[tip])\n\n # Finally, try a SENDCMPCT message with announce=True\n sendcmpct.version = preferred_version\n sendcmpct.announce = True\n test_node.send_and_ping(sendcmpct)\n check_announcement_of_new_block(node, test_node, lambda p: \"cmpctblock\" in p.last_message)\n\n # Try one more time (no headers sync should be needed!)\n check_announcement_of_new_block(node, test_node, lambda p: \"cmpctblock\" in p.last_message)\n\n # Try one more time, after turning on sendheaders\n test_node.send_and_ping(msg_sendheaders())\n check_announcement_of_new_block(node, test_node, lambda p: \"cmpctblock\" in p.last_message)\n\n # Try one more time, after sending a version-1, announce=false message.\n sendcmpct.version = preferred_version-1\n sendcmpct.announce = False\n test_node.send_and_ping(sendcmpct)\n check_announcement_of_new_block(node, test_node, lambda p: \"cmpctblock\" in p.last_message)\n\n # Now turn off announcements\n sendcmpct.version = preferred_version\n sendcmpct.announce = False\n test_node.send_and_ping(sendcmpct)\n check_announcement_of_new_block(node, test_node, lambda p: \"cmpctblock\" not in p.last_message and \"headers\" in p.last_message)\n\n if old_node is not None:\n # Verify that a peer using an older protocol version can receive\n # announcements from this node.\n sendcmpct.version = preferred_version-1\n sendcmpct.announce = True\n old_node.send_and_ping(sendcmpct)\n # Header sync\n old_node.request_headers_and_sync(locator=[tip])\n check_announcement_of_new_block(node, old_node, lambda p: \"cmpctblock\" in p.last_message)\n\n # This test actually causes ritod to (reasonably!) disconnect us, so do this last.\n def test_invalid_cmpctblock_message(self):\n self.nodes[0].generate(101)\n block = self.build_block_on_tip(self.nodes[0])\n\n cmpct_block = P2PHeaderAndShortIDs()\n cmpct_block.header = CBlockHeader(block)\n cmpct_block.prefilled_txn_length = 1\n # This index will be too high\n prefilled_txn = PrefilledTransaction(1, block.vtx[0])\n cmpct_block.prefilled_txn = [prefilled_txn]\n self.test_node.send_await_disconnect(msg_cmpctblock(cmpct_block))\n assert_equal(int(self.nodes[0].getbestblockhash(), 16), block.hashPrevBlock)\n\n # Compare the generated shortids to what we expect based on BIP 152, given\n # ritod's choice of nonce.\n def test_compactblock_construction(self, node, test_node, version, use_witness_address):\n # Generate a bunch of transactions.\n node.generate(101)\n num_transactions = 25\n address = node.getnewaddress()\n if use_witness_address:\n # Want at least one segwit spend, so move all funds to\n # a witness address.\n address = node.addwitnessaddress(address)\n value_to_send = node.getbalance()\n node.sendtoaddress(address, satoshi_round(value_to_send-Decimal(0.1)))\n node.generate(1)\n\n segwit_tx_generated = False\n for i in range(num_transactions):\n txid = node.sendtoaddress(address, 0.1)\n hex_tx = node.gettransaction(txid)[\"hex\"]\n tx = FromHex(CTransaction(), hex_tx)\n if not tx.wit.is_null():\n segwit_tx_generated = True\n\n if use_witness_address:\n assert(segwit_tx_generated) # check that our test is not broken\n\n # Wait until we've seen the block announcement for the resulting tip\n tip = int(node.getbestblockhash(), 16)\n test_node.wait_for_block_announcement(tip)\n\n # Make sure we will receive a fast-announce compact block\n self.request_cb_announcements(test_node, node, version)\n\n # Now mine a block, and look at the resulting compact block.\n test_node.clear_block_announcement()\n block_hash = int(node.generate(1)[0], 16)\n\n # Store the raw block in our internal format.\n block = FromHex(CBlock(), node.getblock(\"%02x\" % block_hash, False))\n for tx in block.vtx:\n tx.calc_sha256()\n block.rehash()\n\n # Wait until the block was announced (via compact blocks)\n wait_until(test_node.received_block_announcement, timeout=30, lock=mininode_lock)\n\n # Now fetch and check the compact block\n header_and_shortids = None\n with mininode_lock:\n assert(\"cmpctblock\" in test_node.last_message)\n # Convert the on-the-wire representation to absolute indexes\n header_and_shortids = HeaderAndShortIDs(test_node.last_message[\"cmpctblock\"].header_and_shortids)\n self.check_compactblock_construction_from_block(version, header_and_shortids, block_hash, block)\n\n # Now fetch the compact block using a normal non-announce getdata\n with mininode_lock:\n test_node.clear_block_announcement()\n inv = CInv(4, block_hash) # 4 == \"CompactBlock\"\n test_node.send_message(msg_getdata([inv]))\n\n wait_until(test_node.received_block_announcement, timeout=30, lock=mininode_lock)\n\n # Now fetch and check the compact block\n header_and_shortids = None\n with mininode_lock:\n assert(\"cmpctblock\" in test_node.last_message)\n # Convert the on-the-wire representation to absolute indexes\n header_and_shortids = HeaderAndShortIDs(test_node.last_message[\"cmpctblock\"].header_and_shortids)\n self.check_compactblock_construction_from_block(version, header_and_shortids, block_hash, block)\n\n def check_compactblock_construction_from_block(self, version, header_and_shortids, block_hash, block):\n # Check that we got the right block!\n header_and_shortids.header.calc_sha256()\n assert_equal(header_and_shortids.header.sha256, block_hash)\n\n # Make sure the prefilled_txn appears to have included the coinbase\n assert(len(header_and_shortids.prefilled_txn) >= 1)\n assert_equal(header_and_shortids.prefilled_txn[0].index, 0)\n\n # Check that all prefilled_txn entries match what's in the block.\n for entry in header_and_shortids.prefilled_txn:\n entry.tx.calc_sha256()\n # This checks the non-witness parts of the tx agree\n assert_equal(entry.tx.sha256, block.vtx[entry.index].sha256)\n\n # And this checks the witness\n wtxid = entry.tx.calc_sha256(True)\n if version == 2:\n assert_equal(wtxid, block.vtx[entry.index].calc_sha256(True))\n else:\n # Shouldn't have received a witness\n assert(entry.tx.wit.is_null())\n\n # Check that the cmpctblock message announced all the transactions.\n assert_equal(len(header_and_shortids.prefilled_txn) + len(header_and_shortids.shortids), len(block.vtx))\n\n # And now check that all the shortids are as expected as well.\n # Determine the siphash keys to use.\n [k0, k1] = header_and_shortids.get_siphash_keys()\n\n index = 0\n while index < len(block.vtx):\n if (len(header_and_shortids.prefilled_txn) > 0 and\n header_and_shortids.prefilled_txn[0].index == index):\n # Already checked prefilled transactions above\n header_and_shortids.prefilled_txn.pop(0)\n else:\n tx_hash = block.vtx[index].sha256\n if version == 2:\n tx_hash = block.vtx[index].calc_sha256(True)\n shortid = calculate_shortid(k0, k1, tx_hash)\n assert_equal(shortid, header_and_shortids.shortids[0])\n header_and_shortids.shortids.pop(0)\n index += 1\n\n # Test that ritod requests compact blocks when we announce new blocks\n # via header or inv, and that responding to getblocktxn causes the block\n # to be successfully reconstructed.\n # Post-segwit: upgraded nodes would only make this request of cb-version-2,\n # NODE_WITNESS peers. Unupgraded nodes would still make this request of\n # any cb-version-1-supporting peer.\n def test_compactblock_requests(self, node, test_node, version, segwit):\n # Try announcing a block with an inv or header, expect a compactblock\n # request\n for announce in [\"inv\", \"header\"]:\n block = self.build_block_on_tip(node, segwit=segwit)\n with mininode_lock:\n test_node.last_message.pop(\"getdata\", None)\n\n if announce == \"inv\":\n test_node.send_message(msg_inv([CInv(2, block.sha256)]))\n wait_until(lambda: \"getheaders\" in test_node.last_message, timeout=30, lock=mininode_lock)\n test_node.send_header_for_blocks([block])\n else:\n test_node.send_header_for_blocks([block])\n wait_until(lambda: \"getdata\" in test_node.last_message, timeout=30, lock=mininode_lock)\n assert_equal(len(test_node.last_message[\"getdata\"].inv), 1)\n assert_equal(test_node.last_message[\"getdata\"].inv[0].type, 4)\n assert_equal(test_node.last_message[\"getdata\"].inv[0].hash, block.sha256)\n\n # Send back a compactblock message that omits the coinbase\n comp_block = HeaderAndShortIDs()\n comp_block.header = CBlockHeader(block)\n comp_block.nonce = 0\n [k0, k1] = comp_block.get_siphash_keys()\n coinbase_hash = block.vtx[0].sha256\n if version == 2:\n coinbase_hash = block.vtx[0].calc_sha256(True)\n comp_block.shortids = [\n calculate_shortid(k0, k1, coinbase_hash) ]\n test_node.send_and_ping(msg_cmpctblock(comp_block.to_p2p()))\n assert_equal(int(node.getbestblockhash(), 16), block.hashPrevBlock)\n # Expect a getblocktxn message.\n with mininode_lock:\n assert(\"getblocktxn\" in test_node.last_message)\n absolute_indexes = test_node.last_message[\"getblocktxn\"].block_txn_request.to_absolute()\n assert_equal(absolute_indexes, [0]) # should be a coinbase request\n\n # Send the coinbase, and verify that the tip advances.\n if version == 2:\n msg = msg_witness_blocktxn()\n else:\n msg = msg_blocktxn()\n msg.block_transactions.blockhash = block.sha256\n msg.block_transactions.transactions = [block.vtx[0]]\n test_node.send_and_ping(msg)\n assert_equal(int(node.getbestblockhash(), 16), block.sha256)\n\n # Create a chain of transactions from given utxo, and add to a new block.\n def build_block_with_transactions(self, node, utxo, num_transactions):\n block = self.build_block_on_tip(node)\n\n for i in range(num_transactions):\n tx = CTransaction()\n tx.vin.append(CTxIn(COutPoint(utxo[0], utxo[1]), b''))\n tx.vout.append(CTxOut(utxo[2] - 1000, CScript([OP_TRUE])))\n tx.rehash()\n utxo = [tx.sha256, 0, tx.vout[0].nValue]\n block.vtx.append(tx)\n\n block.hashMerkleRoot = block.calc_merkle_root()\n block.solve()\n return block\n\n # Test that we only receive getblocktxn requests for transactions that the\n # node needs, and that responding to them causes the block to be\n # reconstructed.\n def test_getblocktxn_requests(self, node, test_node, version):\n with_witness = (version==2)\n\n def test_getblocktxn_response(compact_block, peer, expected_result):\n msg = msg_cmpctblock(compact_block.to_p2p())\n peer.send_and_ping(msg)\n with mininode_lock:\n assert(\"getblocktxn\" in peer.last_message)\n absolute_indexes = peer.last_message[\"getblocktxn\"].block_txn_request.to_absolute()\n assert_equal(absolute_indexes, expected_result)\n\n def test_tip_after_message(node, peer, msg, tip):\n peer.send_and_ping(msg)\n assert_equal(int(node.getbestblockhash(), 16), tip)\n\n # First try announcing compactblocks that won't reconstruct, and verify\n # that we receive getblocktxn messages back.\n utxo = self.utxos.pop(0)\n\n block = self.build_block_with_transactions(node, utxo, 5)\n self.utxos.append([block.vtx[-1].sha256, 0, block.vtx[-1].vout[0].nValue])\n comp_block = HeaderAndShortIDs()\n comp_block.initialize_from_block(block, use_witness=with_witness)\n\n test_getblocktxn_response(comp_block, test_node, [1, 2, 3, 4, 5])\n\n msg_bt = msg_blocktxn()\n if with_witness:\n msg_bt = msg_witness_blocktxn() # serialize with witnesses\n msg_bt.block_transactions = BlockTransactions(block.sha256, block.vtx[1:])\n test_tip_after_message(node, test_node, msg_bt, block.sha256)\n\n utxo = self.utxos.pop(0)\n block = self.build_block_with_transactions(node, utxo, 5)\n self.utxos.append([block.vtx[-1].sha256, 0, block.vtx[-1].vout[0].nValue])\n\n # Now try interspersing the prefilled transactions\n comp_block.initialize_from_block(block, prefill_list=[0, 1, 5], use_witness=with_witness)\n test_getblocktxn_response(comp_block, test_node, [2, 3, 4])\n msg_bt.block_transactions = BlockTransactions(block.sha256, block.vtx[2:5])\n test_tip_after_message(node, test_node, msg_bt, block.sha256)\n\n # Now try giving one transaction ahead of time.\n utxo = self.utxos.pop(0)\n block = self.build_block_with_transactions(node, utxo, 5)\n self.utxos.append([block.vtx[-1].sha256, 0, block.vtx[-1].vout[0].nValue])\n test_node.send_and_ping(msg_tx(block.vtx[1]))\n assert(block.vtx[1].hash in node.getrawmempool())\n\n # Prefill 4 out of the 6 transactions, and verify that only the one\n # that was not in the mempool is requested.\n comp_block.initialize_from_block(block, prefill_list=[0, 2, 3, 4], use_witness=with_witness)\n test_getblocktxn_response(comp_block, test_node, [5])\n\n msg_bt.block_transactions = BlockTransactions(block.sha256, [block.vtx[5]])\n test_tip_after_message(node, test_node, msg_bt, block.sha256)\n\n # Now provide all transactions to the node before the block is\n # announced and verify reconstruction happens immediately.\n utxo = self.utxos.pop(0)\n block = self.build_block_with_transactions(node, utxo, 10)\n self.utxos.append([block.vtx[-1].sha256, 0, block.vtx[-1].vout[0].nValue])\n for tx in block.vtx[1:]:\n test_node.send_message(msg_tx(tx))\n test_node.sync_with_ping()\n # Make sure all transactions were accepted.\n mempool = node.getrawmempool()\n for tx in block.vtx[1:]:\n assert(tx.hash in mempool)\n\n # Clear out last request.\n with mininode_lock:\n test_node.last_message.pop(\"getblocktxn\", None)\n\n # Send compact block\n comp_block.initialize_from_block(block, prefill_list=[0], use_witness=with_witness)\n test_tip_after_message(node, test_node, msg_cmpctblock(comp_block.to_p2p()), block.sha256)\n with mininode_lock:\n # Shouldn't have gotten a request for any transaction\n assert(\"getblocktxn\" not in test_node.last_message)\n\n # Incorrectly responding to a getblocktxn shouldn't cause the block to be\n # permanently failed.\n def test_incorrect_blocktxn_response(self, node, test_node, version):\n if (len(self.utxos) == 0):\n self.make_utxos()\n utxo = self.utxos.pop(0)\n\n block = self.build_block_with_transactions(node, utxo, 10)\n self.utxos.append([block.vtx[-1].sha256, 0, block.vtx[-1].vout[0].nValue])\n # Relay the first 5 transactions from the block in advance\n for tx in block.vtx[1:6]:\n test_node.send_message(msg_tx(tx))\n test_node.sync_with_ping()\n # Make sure all transactions were accepted.\n mempool = node.getrawmempool()\n for tx in block.vtx[1:6]:\n assert(tx.hash in mempool)\n\n # Send compact block\n comp_block = HeaderAndShortIDs()\n comp_block.initialize_from_block(block, prefill_list=[0], use_witness=(version == 2))\n test_node.send_and_ping(msg_cmpctblock(comp_block.to_p2p()))\n absolute_indexes = []\n with mininode_lock:\n assert(\"getblocktxn\" in test_node.last_message)\n absolute_indexes = test_node.last_message[\"getblocktxn\"].block_txn_request.to_absolute()\n assert_equal(absolute_indexes, [6, 7, 8, 9, 10])\n\n # Now give an incorrect response.\n # Note that it's possible for ritod to be smart enough to know we're\n # lying, since it could check to see if the shortid matches what we're\n # sending, and eg disconnect us for misbehavior. If that behavior\n # change were made, we could just modify this test by having a\n # different peer provide the block further down, so that we're still\n # verifying that the block isn't marked bad permanently. This is good\n # enough for now.\n msg = msg_blocktxn()\n if version==2:\n msg = msg_witness_blocktxn()\n msg.block_transactions = BlockTransactions(block.sha256, [block.vtx[5]] + block.vtx[7:])\n test_node.send_and_ping(msg)\n\n # Tip should not have updated\n assert_equal(int(node.getbestblockhash(), 16), block.hashPrevBlock)\n\n # We should receive a getdata request\n wait_until(lambda: \"getdata\" in test_node.last_message, timeout=10, lock=mininode_lock)\n assert_equal(len(test_node.last_message[\"getdata\"].inv), 1)\n assert(test_node.last_message[\"getdata\"].inv[0].type == 2 or test_node.last_message[\"getdata\"].inv[0].type == 2|MSG_WITNESS_FLAG)\n assert_equal(test_node.last_message[\"getdata\"].inv[0].hash, block.sha256)\n\n # Deliver the block\n if version==2:\n test_node.send_and_ping(msg_witness_block(block))\n else:\n test_node.send_and_ping(msg_block(block))\n assert_equal(int(node.getbestblockhash(), 16), block.sha256)\n\n def test_getblocktxn_handler(self, node, test_node, version):\n # ritod will not send blocktxn responses for blocks whose height is\n # more than 10 blocks deep.\n MAX_GETBLOCKTXN_DEPTH = 10\n chain_height = node.getblockcount()\n current_height = chain_height\n while (current_height >= chain_height - MAX_GETBLOCKTXN_DEPTH):\n block_hash = node.getblockhash(current_height)\n block = FromHex(CBlock(), node.getblock(block_hash, False))\n\n msg = msg_getblocktxn()\n msg.block_txn_request = BlockTransactionsRequest(int(block_hash, 16), [])\n num_to_request = random.randint(1, len(block.vtx))\n msg.block_txn_request.from_absolute(sorted(random.sample(range(len(block.vtx)), num_to_request)))\n test_node.send_message(msg)\n wait_until(lambda: \"blocktxn\" in test_node.last_message, timeout=10, lock=mininode_lock)\n\n [tx.calc_sha256() for tx in block.vtx]\n with mininode_lock:\n assert_equal(test_node.last_message[\"blocktxn\"].block_transactions.blockhash, int(block_hash, 16))\n all_indices = msg.block_txn_request.to_absolute()\n for index in all_indices:\n tx = test_node.last_message[\"blocktxn\"].block_transactions.transactions.pop(0)\n tx.calc_sha256()\n assert_equal(tx.sha256, block.vtx[index].sha256)\n if version == 1:\n # Witnesses should have been stripped\n assert(tx.wit.is_null())\n else:\n # Check that the witness matches\n assert_equal(tx.calc_sha256(True), block.vtx[index].calc_sha256(True))\n test_node.last_message.pop(\"blocktxn\", None)\n current_height -= 1\n\n # Next request should send a full block response, as we're past the\n # allowed depth for a blocktxn response.\n block_hash = node.getblockhash(current_height)\n msg.block_txn_request = BlockTransactionsRequest(int(block_hash, 16), [0])\n with mininode_lock:\n test_node.last_message.pop(\"block\", None)\n test_node.last_message.pop(\"blocktxn\", None)\n test_node.send_and_ping(msg)\n with mininode_lock:\n test_node.last_message[\"block\"].block.calc_sha256()\n assert_equal(test_node.last_message[\"block\"].block.sha256, int(block_hash, 16))\n assert \"blocktxn\" not in test_node.last_message\n\n def test_compactblocks_not_at_tip(self, node, test_node):\n # Test that requesting old compactblocks doesn't work.\n MAX_CMPCTBLOCK_DEPTH = 5\n new_blocks = []\n for i in range(MAX_CMPCTBLOCK_DEPTH + 1):\n test_node.clear_block_announcement()\n new_blocks.append(node.generate(1)[0])\n wait_until(test_node.received_block_announcement, timeout=30, lock=mininode_lock)\n\n test_node.clear_block_announcement()\n test_node.send_message(msg_getdata([CInv(4, int(new_blocks[0], 16))]))\n wait_until(lambda: \"cmpctblock\" in test_node.last_message, timeout=30, lock=mininode_lock)\n\n test_node.clear_block_announcement()\n node.generate(1)\n wait_until(test_node.received_block_announcement, timeout=30, lock=mininode_lock)\n test_node.clear_block_announcement()\n with mininode_lock:\n test_node.last_message.pop(\"block\", None)\n test_node.send_message(msg_getdata([CInv(4, int(new_blocks[0], 16))]))\n wait_until(lambda: \"block\" in test_node.last_message, timeout=30, lock=mininode_lock)\n with mininode_lock:\n test_node.last_message[\"block\"].block.calc_sha256()\n assert_equal(test_node.last_message[\"block\"].block.sha256, int(new_blocks[0], 16))\n\n # Generate an old compactblock, and verify that it's not accepted.\n cur_height = node.getblockcount()\n hashPrevBlock = int(node.getblockhash(cur_height-5), 16)\n block = self.build_block_on_tip(node)\n block.hashPrevBlock = hashPrevBlock\n block.solve()\n\n comp_block = HeaderAndShortIDs()\n comp_block.initialize_from_block(block)\n test_node.send_and_ping(msg_cmpctblock(comp_block.to_p2p()))\n\n tips = node.getchaintips()\n found = False\n for x in tips:\n if x[\"hash\"] == block.hash:\n assert_equal(x[\"status\"], \"headers-only\")\n found = True\n break\n assert(found)\n\n # Requesting this block via getblocktxn should silently fail\n # (to avoid fingerprinting attacks).\n msg = msg_getblocktxn()\n msg.block_txn_request = BlockTransactionsRequest(block.sha256, [0])\n with mininode_lock:\n test_node.last_message.pop(\"blocktxn\", None)\n test_node.send_and_ping(msg)\n with mininode_lock:\n assert \"blocktxn\" not in test_node.last_message\n\n def activate_segwit(self, node):\n node.generate(144*3)\n assert_equal(get_bip9_status(node, \"segwit\")[\"status\"], 'active')\n\n def test_end_to_end_block_relay(self, node, listeners):\n utxo = self.utxos.pop(0)\n\n block = self.build_block_with_transactions(node, utxo, 10)\n\n [l.clear_block_announcement() for l in listeners]\n\n # ToHex() won't serialize with witness, but this block has no witnesses\n # anyway. TODO: repeat this test with witness tx's to a segwit node.\n node.submitblock(ToHex(block))\n\n for l in listeners:\n wait_until(lambda: l.received_block_announcement(), timeout=30, lock=mininode_lock)\n with mininode_lock:\n for l in listeners:\n assert \"cmpctblock\" in l.last_message\n l.last_message[\"cmpctblock\"].header_and_shortids.header.calc_sha256()\n assert_equal(l.last_message[\"cmpctblock\"].header_and_shortids.header.sha256, block.sha256)\n\n # Test that we don't get disconnected if we relay a compact block with valid header,\n # but invalid transactions.\n def test_invalid_tx_in_compactblock(self, node, test_node, use_segwit):\n assert(len(self.utxos))\n utxo = self.utxos[0]\n\n block = self.build_block_with_transactions(node, utxo, 5)\n del block.vtx[3]\n block.hashMerkleRoot = block.calc_merkle_root()\n if use_segwit:\n # If we're testing with segwit, also drop the coinbase witness,\n # but include the witness commitment.\n add_witness_commitment(block)\n block.vtx[0].wit.vtxinwit = []\n block.solve()\n\n # Now send the compact block with all transactions prefilled, and\n # verify that we don't get disconnected.\n comp_block = HeaderAndShortIDs()\n comp_block.initialize_from_block(block, prefill_list=[0, 1, 2, 3, 4], use_witness=use_segwit)\n msg = msg_cmpctblock(comp_block.to_p2p())\n test_node.send_and_ping(msg)\n\n # Check that the tip didn't advance\n assert(int(node.getbestblockhash(), 16) is not block.sha256)\n test_node.sync_with_ping()\n\n # Helper for enabling cb announcements\n # Send the sendcmpct request and sync headers\n def request_cb_announcements(self, peer, node, version):\n tip = node.getbestblockhash()\n peer.get_headers(locator=[int(tip, 16)], hashstop=0)\n\n msg = msg_sendcmpct()\n msg.version = version\n msg.announce = True\n peer.send_and_ping(msg)\n\n def test_compactblock_reconstruction_multiple_peers(self, node, stalling_peer, delivery_peer):\n assert(len(self.utxos))\n\n def announce_cmpct_block(node, peer):\n utxo = self.utxos.pop(0)\n block = self.build_block_with_transactions(node, utxo, 5)\n\n cmpct_block = HeaderAndShortIDs()\n cmpct_block.initialize_from_block(block)\n msg = msg_cmpctblock(cmpct_block.to_p2p())\n peer.send_and_ping(msg)\n with mininode_lock:\n assert \"getblocktxn\" in peer.last_message\n return block, cmpct_block\n\n block, cmpct_block = announce_cmpct_block(node, stalling_peer)\n\n for tx in block.vtx[1:]:\n delivery_peer.send_message(msg_tx(tx))\n delivery_peer.sync_with_ping()\n mempool = node.getrawmempool()\n for tx in block.vtx[1:]:\n assert(tx.hash in mempool)\n\n delivery_peer.send_and_ping(msg_cmpctblock(cmpct_block.to_p2p()))\n assert_equal(int(node.getbestblockhash(), 16), block.sha256)\n\n self.utxos.append([block.vtx[-1].sha256, 0, block.vtx[-1].vout[0].nValue])\n\n # Now test that delivering an invalid compact block won't break relay\n\n block, cmpct_block = announce_cmpct_block(node, stalling_peer)\n for tx in block.vtx[1:]:\n delivery_peer.send_message(msg_tx(tx))\n delivery_peer.sync_with_ping()\n\n cmpct_block.prefilled_txn[0].tx.wit.vtxinwit = [ CTxInWitness() ]\n cmpct_block.prefilled_txn[0].tx.wit.vtxinwit[0].scriptWitness.stack = [ser_uint256(0)]\n\n cmpct_block.use_witness = True\n delivery_peer.send_and_ping(msg_cmpctblock(cmpct_block.to_p2p()))\n assert(int(node.getbestblockhash(), 16) != block.sha256)\n\n msg = msg_blocktxn()\n msg.block_transactions.blockhash = block.sha256\n msg.block_transactions.transactions = block.vtx[1:]\n stalling_peer.send_and_ping(msg)\n assert_equal(int(node.getbestblockhash(), 16), block.sha256)\n\n def run_test(self):\n # Setup the p2p connections and start up the network thread.\n self.test_node = TestNode()\n self.segwit_node = TestNode()\n self.old_node = TestNode() # version 1 peer <--> segwit node\n\n connections = []\n connections.append(NodeConn('127.0.0.1', p2p_port(0), self.nodes[0], self.test_node))\n connections.append(NodeConn('127.0.0.1', p2p_port(1), self.nodes[1],\n self.segwit_node, services=NODE_NETWORK|NODE_WITNESS))\n connections.append(NodeConn('127.0.0.1', p2p_port(1), self.nodes[1],\n self.old_node, services=NODE_NETWORK))\n self.test_node.add_connection(connections[0])\n self.segwit_node.add_connection(connections[1])\n self.old_node.add_connection(connections[2])\n\n NetworkThread().start() # Start up network handling in another thread\n\n # Test logic begins here\n self.test_node.wait_for_verack()\n\n # We will need UTXOs to construct transactions in later tests.\n self.make_utxos()\n\n self.log.info(\"Running tests, pre-segwit activation:\")\n\n self.log.info(\"Testing SENDCMPCT p2p message... \")\n self.test_sendcmpct(self.nodes[0], self.test_node, 1)\n sync_blocks(self.nodes)\n self.test_sendcmpct(self.nodes[1], self.segwit_node, 2, old_node=self.old_node)\n sync_blocks(self.nodes)\n\n self.log.info(\"Testing compactblock construction...\")\n self.test_compactblock_construction(self.nodes[0], self.test_node, 1, False)\n sync_blocks(self.nodes)\n self.test_compactblock_construction(self.nodes[1], self.segwit_node, 2, False)\n sync_blocks(self.nodes)\n\n self.log.info(\"Testing compactblock requests... \")\n self.test_compactblock_requests(self.nodes[0], self.test_node, 1, False)\n sync_blocks(self.nodes)\n self.test_compactblock_requests(self.nodes[1], self.segwit_node, 2, False)\n sync_blocks(self.nodes)\n\n self.log.info(\"Testing getblocktxn requests...\")\n self.test_getblocktxn_requests(self.nodes[0], self.test_node, 1)\n sync_blocks(self.nodes)\n self.test_getblocktxn_requests(self.nodes[1], self.segwit_node, 2)\n sync_blocks(self.nodes)\n\n self.log.info(\"Testing getblocktxn handler...\")\n self.test_getblocktxn_handler(self.nodes[0], self.test_node, 1)\n sync_blocks(self.nodes)\n self.test_getblocktxn_handler(self.nodes[1], self.segwit_node, 2)\n self.test_getblocktxn_handler(self.nodes[1], self.old_node, 1)\n sync_blocks(self.nodes)\n\n self.log.info(\"Testing compactblock requests/announcements not at chain tip...\")\n self.test_compactblocks_not_at_tip(self.nodes[0], self.test_node)\n sync_blocks(self.nodes)\n self.test_compactblocks_not_at_tip(self.nodes[1], self.segwit_node)\n self.test_compactblocks_not_at_tip(self.nodes[1], self.old_node)\n sync_blocks(self.nodes)\n\n self.log.info(\"Testing handling of incorrect blocktxn responses...\")\n self.test_incorrect_blocktxn_response(self.nodes[0], self.test_node, 1)\n sync_blocks(self.nodes)\n self.test_incorrect_blocktxn_response(self.nodes[1], self.segwit_node, 2)\n sync_blocks(self.nodes)\n\n # End-to-end block relay tests\n self.log.info(\"Testing end-to-end block relay...\")\n self.request_cb_announcements(self.test_node, self.nodes[0], 1)\n self.request_cb_announcements(self.old_node, self.nodes[1], 1)\n self.request_cb_announcements(self.segwit_node, self.nodes[1], 2)\n self.test_end_to_end_block_relay(self.nodes[0], [self.segwit_node, self.test_node, self.old_node])\n self.test_end_to_end_block_relay(self.nodes[1], [self.segwit_node, self.test_node, self.old_node])\n\n self.log.info(\"Testing handling of invalid compact blocks...\")\n self.test_invalid_tx_in_compactblock(self.nodes[0], self.test_node, False)\n self.test_invalid_tx_in_compactblock(self.nodes[1], self.segwit_node, False)\n self.test_invalid_tx_in_compactblock(self.nodes[1], self.old_node, False)\n\n self.log.info(\"Testing reconstructing compact blocks from all peers...\")\n self.test_compactblock_reconstruction_multiple_peers(self.nodes[1], self.segwit_node, self.old_node)\n sync_blocks(self.nodes)\n\n # Advance to segwit activation\n self.log.info(\"Advancing to segwit activation\")\n self.activate_segwit(self.nodes[1])\n self.log.info(\"Running tests, post-segwit activation...\")\n\n self.log.info(\"Testing compactblock construction...\")\n self.test_compactblock_construction(self.nodes[1], self.old_node, 1, True)\n self.test_compactblock_construction(self.nodes[1], self.segwit_node, 2, True)\n sync_blocks(self.nodes)\n\n self.log.info(\"Testing compactblock requests (unupgraded node)... \")\n self.test_compactblock_requests(self.nodes[0], self.test_node, 1, True)\n\n self.log.info(\"Testing getblocktxn requests (unupgraded node)...\")\n self.test_getblocktxn_requests(self.nodes[0], self.test_node, 1)\n\n # Need to manually sync node0 and node1, because post-segwit activation,\n # node1 will not download blocks from node0.\n self.log.info(\"Syncing nodes...\")\n assert(self.nodes[0].getbestblockhash() != self.nodes[1].getbestblockhash())\n while (self.nodes[0].getblockcount() > self.nodes[1].getblockcount()):\n block_hash = self.nodes[0].getblockhash(self.nodes[1].getblockcount()+1)\n self.nodes[1].submitblock(self.nodes[0].getblock(block_hash, False))\n assert_equal(self.nodes[0].getbestblockhash(), self.nodes[1].getbestblockhash())\n\n self.log.info(\"Testing compactblock requests (segwit node)... \")\n self.test_compactblock_requests(self.nodes[1], self.segwit_node, 2, True)\n\n self.log.info(\"Testing getblocktxn requests (segwit node)...\")\n self.test_getblocktxn_requests(self.nodes[1], self.segwit_node, 2)\n sync_blocks(self.nodes)\n\n self.log.info(\"Testing getblocktxn handler (segwit node should return witnesses)...\")\n self.test_getblocktxn_handler(self.nodes[1], self.segwit_node, 2)\n self.test_getblocktxn_handler(self.nodes[1], self.old_node, 1)\n\n # Test that if we submitblock to node1, we'll get a compact block\n # announcement to all peers.\n # (Post-segwit activation, blocks won't propagate from node0 to node1\n # automatically, so don't bother testing a block announced to node0.)\n self.log.info(\"Testing end-to-end block relay...\")\n self.request_cb_announcements(self.test_node, self.nodes[0], 1)\n self.request_cb_announcements(self.old_node, self.nodes[1], 1)\n self.request_cb_announcements(self.segwit_node, self.nodes[1], 2)\n self.test_end_to_end_block_relay(self.nodes[1], [self.segwit_node, self.test_node, self.old_node])\n\n self.log.info(\"Testing handling of invalid compact blocks...\")\n self.test_invalid_tx_in_compactblock(self.nodes[0], self.test_node, False)\n self.test_invalid_tx_in_compactblock(self.nodes[1], self.segwit_node, True)\n self.test_invalid_tx_in_compactblock(self.nodes[1], self.old_node, True)\n\n self.log.info(\"Testing invalid index in cmpctblock message...\")\n self.test_invalid_cmpctblock_message()\n\n\nif __name__ == '__main__':\n CompactBlocksTest().main()\n"},"avg_line_length":{"kind":"number","value":47.1082529475,"string":"47.108253"},"max_line_length":{"kind":"number","value":137,"string":"137"},"alphanum_fraction":{"kind":"number","value":0.6689115399,"string":"0.668912"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"RitoProject/Ravencoin"},"path":{"kind":"string","value":"test/functional/p2p_compactblocks.py"},"size":{"kind":"number","value":43952,"string":"43,952"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8794,"cells":{"content":{"kind":"string","value":"import logging\nimport io\nfrom homeassistant.core import callback\nfrom homeassistant.components.ais_dom import ais_global\nfrom homeassistant.const import EVENT_HOMEASSISTANT_START\nfrom homeassistant.components.camera import Camera\nfrom homeassistant.helpers.event import async_track_state_change\nfrom datetime import timedelta\n\n_LOGGER = logging.getLogger(__name__)\n\nDEFAULT_NAME = \"qr_code\"\n\nSCAN_INTERVAL = timedelta(seconds=2000)\n\n\ndef setup_platform(hass, config, add_entities, discovery_info=None):\n \"\"\"Set up the QRCode image platform.\"\"\"\n\n add_entities([QRCodeCamera(hass, \"remote_access\", \"remote_access\")])\n\n\nclass QRCodeCamera(Camera):\n \"\"\"Representation of an QRCode image.\"\"\"\n\n def __init__(self, hass, name, entity_ids):\n \"\"\"Initialize the QRCode entity.\"\"\"\n super().__init__()\n self._hass = hass\n self._name = name\n self._entities = entity_ids\n self._image = io.BytesIO()\n self._refresh_()\n\n async def async_added_to_hass(self):\n \"\"\"Register callbacks.\"\"\"\n\n @callback\n def qr_state_listener(entity, old_state, new_state):\n \"\"\"Handle device state changes.\"\"\"\n self._refresh_()\n\n @callback\n def qr_sensor_startup(event):\n \"\"\"Update template on startup.\"\"\"\n async_track_state_change(self.hass, self._entities, qr_state_listener)\n\n self.hass.bus.async_listen_once(EVENT_HOMEASSISTANT_START, qr_sensor_startup)\n\n @property\n def name(self):\n \"\"\"Return the name of the image processor.\"\"\"\n return self._name\n\n @property\n def should_poll(self):\n \"\"\"Update the recording state periodically.\"\"\"\n return True\n\n @property\n def state(self):\n gate_id = ais_global.get_sercure_android_id_dom()\n return \"https://\" + gate_id + \".paczka.pro\"\n\n def camera_image(self):\n \"\"\"Process the image.\"\"\"\n return self._image.getvalue()\n\n def turn_on(self):\n \"\"\"Turn on camera.\"\"\"\n self._refresh_()\n\n def turn_off(self):\n pass\n\n def enable_motion_detection(self):\n pass\n\n def disable_motion_detection(self):\n pass\n\n def _refresh_(self):\n import pyqrcode\n import png\n\n gate_id = ais_global.get_sercure_android_id_dom()\n _template = \"https://\" + gate_id + \".paczka.pro\"\n qr_code = pyqrcode.create(_template)\n self._image.truncate(0)\n self._image.seek(0)\n\n qr_code.png(\n self._image, scale=6, module_color=[0, 0, 0], background=[0xFF, 0xFF, 0xFF]\n )\n"},"avg_line_length":{"kind":"number","value":27.1684210526,"string":"27.168421"},"max_line_length":{"kind":"number","value":87,"string":"87"},"alphanum_fraction":{"kind":"number","value":0.6551724138,"string":"0.655172"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"DRubioBizcaino/AIS-home-assistant"},"path":{"kind":"string","value":"homeassistant/components/ais_qrcode/camera.py"},"size":{"kind":"number","value":2581,"string":"2,581"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8795,"cells":{"content":{"kind":"string","value":"from datetime import date, timedelta\n\nfrom app import create_app, new_functions as nf\nfrom app.constants import weekend_answer\nfrom app.models import User\nfrom tg_bot import bot\n\n\ndef schedule_sender():\n send_cnt, err_cnt = 0, 0\n\n for user in User.query.filter_by(is_subscribed=True).all():\n answer = user.create_answer_for_date(\n for_date=date.today() + timedelta(days=1)\n )\n if answer == weekend_answer:\n continue\n\n try:\n answer = \"Расписание на завтра:\\n\\n\" + answer\n nf.tgbot_send_long_message(bot, answer, user.tg_id)\n send_cnt += 1\n except Exception as err:\n print(\"---------------ERROR START---------------\")\n print(err)\n print(\"USER ID:\", user.id)\n print(\"----------------ERROR END----------------\")\n err_cnt += 1\n return send_cnt, err_cnt\n\n\nif __name__ == '__main__':\n with create_app().app_context():\n print(\"OK: {0}; ERRORS: {1}\".format(*schedule_sender()))\n"},"avg_line_length":{"kind":"number","value":29.5142857143,"string":"29.514286"},"max_line_length":{"kind":"number","value":64,"string":"64"},"alphanum_fraction":{"kind":"number","value":0.5730880929,"string":"0.573088"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"EeOneDown/spbu4u"},"path":{"kind":"string","value":"tg_schedule_sender.py"},"size":{"kind":"number","value":1051,"string":"1,051"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8796,"cells":{"content":{"kind":"string","value":"from collections import defaultdict\n\ndd = defaultdict(list)\n\nn, m = map(int, input().split())\n\ngroupA = []\nfor i in range(n):\n a_element = input()\n dd[a_element].append(str(i+1))\n\nfor _ in range(m):\n b_element = input()\n if b_element not in dd:\n print(-1)\n else:\n print(\" \".join(dd[b_element]))\n"},"avg_line_length":{"kind":"number","value":18,"string":"18"},"max_line_length":{"kind":"number","value":38,"string":"38"},"alphanum_fraction":{"kind":"number","value":0.6018518519,"string":"0.601852"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"rawat9/HackerRank"},"path":{"kind":"string","value":"Python/Collections/DefaultDict Tutorial/solution.py"},"size":{"kind":"number","value":324,"string":"324"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8797,"cells":{"content":{"kind":"string","value":"#!/usr/bin/env python\n\nfrom setuptools import setup\n\nwith open('README.md') as f:\n long_description = f.read()\n\nsetup(name=\"pipelinewise-target-s3-csv\",\n version=\"1.4.0\",\n description=\"Singer.io target for writing CSV files and upload to S3 - PipelineWise compatible\",\n long_description=long_description,\n long_description_content_type='text/markdown',\n author=\"TransferWise\",\n url='https://github.com/transferwise/pipelinewise-target-s3-csv',\n classifiers=[\n 'License :: OSI Approved :: Apache Software License',\n 'Programming Language :: Python :: 3 :: Only'\n ],\n py_modules=[\"target_s3_csv\"],\n install_requires=[\n 'pipelinewise-singer-python==1.*',\n 'inflection==0.3.1',\n 'boto3==1.9.57',\n ],\n extras_require={\n \"test\": [\n \"nose==1.3.7\",\n \"pylint==2.4.2\"\n ]\n },\n entry_points=\"\"\"\n [console_scripts]\n target-s3-csv=target_s3_csv:main\n \"\"\",\n packages=[\"target_s3_csv\"],\n package_data = {},\n include_package_data=True,\n)\n"},"avg_line_length":{"kind":"number","value":28.7692307692,"string":"28.769231"},"max_line_length":{"kind":"number","value":102,"string":"102"},"alphanum_fraction":{"kind":"number","value":0.5837789661,"string":"0.583779"},"licenses":{"kind":"list like","value":["Apache-2.0"],"string":"[\n \"Apache-2.0\"\n]"},"repository_name":{"kind":"string","value":"EasyPost/pipelinewise-target-s3-csv"},"path":{"kind":"string","value":"setup.py"},"size":{"kind":"number","value":1122,"string":"1,122"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8798,"cells":{"content":{"kind":"string","value":"from datetime import datetime\nimport logging\nimport os\nimport subprocess\nimport sys\nfrom argparse import Namespace\n\nlogging.getLogger(\"transformers\").setLevel(logging.WARNING)\n\nimport click\nimport torch\n\nfrom luke.utils.model_utils import ModelArchive\n\nfrom zero.utils.experiment_logger import commet_logger_args, CometLogger, NullLogger\n\nLOG_FORMAT = \"[%(asctime)s] [%(levelname)s] %(message)s (%(funcName)s@%(filename)s:%(lineno)s)\"\n\ntry:\n import absl.logging\n\n # https://github.com/tensorflow/tensorflow/issues/27045#issuecomment-519642980\n logging.getLogger().removeHandler(absl.logging._absl_handler)\n absl.logging._warn_preinit_stderr = False\nexcept ImportError:\n pass\n\nlogger = logging.getLogger(__name__)\n\n\n@click.group()\n@click.option(\n \"--output-dir\", default=\"models\", type=click.Path()\n)\n@click.option(\"--num-gpus\", default=1)\n@click.option(\"--experiment-logger\", \"--logger\", type=click.Choice([\"comet\"]))\n@click.option(\"--master-port\", default=29500)\n@click.option(\"--local-rank\", \"--local_rank\", default=-1)\n@click.option(\"--model-file\", type=click.Path(exists=True))\n@click.option(\"--device-id\", type=int)\n@commet_logger_args\n@click.pass_context\ndef cli(ctx, **kwargs):\n args = Namespace(**kwargs)\n\n if args.local_rank == -1 and args.num_gpus > 1:\n current_env = os.environ.copy()\n current_env[\"MASTER_ADDR\"] = \"127.0.0.1\"\n current_env[\"MASTER_PORT\"] = str(args.master_port)\n current_env[\"WORLD_SIZE\"] = str(args.num_gpus)\n\n processes = []\n\n for args.local_rank in range(0, args.num_gpus):\n current_env[\"RANK\"] = str(args.local_rank)\n current_env[\"LOCAL_RANK\"] = str(args.local_rank)\n\n cmd = [sys.executable, \"-u\", \"-m\", \"examples.cli\", \"--local-rank={}\".format(args.local_rank)]\n cmd.extend(sys.argv[1:])\n\n process = subprocess.Popen(cmd, env=current_env)\n processes.append(process)\n\n for process in processes:\n process.wait()\n if process.returncode != 0:\n raise subprocess.CalledProcessError(returncode=process.returncode, cmd=cmd)\n\n sys.exit(0)\n else:\n if args.local_rank not in (-1, 0):\n logging.basicConfig(format=LOG_FORMAT, level=logging.WARNING)\n else:\n logging.basicConfig(format=LOG_FORMAT, level=logging.INFO)\n\n if not os.path.exists(args.output_dir) and args.local_rank in [-1, 0]:\n os.makedirs(args.output_dir)\n logger.info(\"Output dir: %s\", args.output_dir)\n\n # NOTE: ctx.obj is documented here: http://click.palletsprojects.com/en/7.x/api/#click.Context.obj\n ctx.obj = dict(local_rank=args.local_rank, output_dir=args.output_dir)\n\n if args.num_gpus == 0:\n ctx.obj[\"device\"] = torch.device(\"cpu\")\n elif args.local_rank == -1:\n ctx.obj[\"device\"] = torch.device(\"cuda:{}\".format(args.device_id))\n else:\n torch.cuda.set_device(args.local_rank)\n ctx.obj[\"device\"] = torch.device(\"cuda\", args.local_rank)\n torch.distributed.init_process_group(backend=\"nccl\")\n\n experiment_logger = NullLogger()\n\n if args.local_rank in (-1, 0) and args.experiment_logger == \"comet\":\n experiment_logger = CometLogger(args)\n\n experiment_logger.log_parameters({p.name: getattr(args, p.name) for p in cli.params})\n ctx.obj[\"experiment\"] = experiment_logger\n\n if args.model_file:\n model_archive = ModelArchive.load(args.model_file)\n ctx.obj[\"tokenizer\"] = model_archive.tokenizer\n ctx.obj[\"entity_vocab\"] = model_archive.entity_vocab\n ctx.obj[\"bert_model_name\"] = model_archive.bert_model_name\n ctx.obj[\"model_config\"] = model_archive.config\n ctx.obj[\"max_mention_length\"] = model_archive.max_mention_length\n ctx.obj[\"model_weights\"] = model_archive.state_dict\n\n experiment_logger.log_parameter(\"model_file_name\", os.path.basename(args.model_file))\n\n\nfrom zero.ner.main import cli as ner_cli\ncli.add_command(ner_cli)\n\n\nif __name__ == \"__main__\":\n cli()"},"avg_line_length":{"kind":"number","value":35.3076923077,"string":"35.307692"},"max_line_length":{"kind":"number","value":106,"string":"106"},"alphanum_fraction":{"kind":"number","value":0.663761801,"string":"0.663762"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"nguyenvanhoang7398/nndl2-project"},"path":{"kind":"string","value":"zero/cli.py"},"size":{"kind":"number","value":4131,"string":"4,131"},"lang":{"kind":"string","value":"Python"}}},{"rowIdx":8799,"cells":{"content":{"kind":"string","value":"count=0\nn=4\nfor i in range(1,n+1):\n for j in range(1,n+1):\n if i==j:\n continue\n for k in range(1,n+1):\n if i==k or j==k:\n continue\n count += 1\n print(f\"第{count}种方案:甲担任{i}号课代表,乙担任{j}号课代表,丙担任{k}号课代表\")\n\nprint(f\"一共{count}种方案\")"},"avg_line_length":{"kind":"number","value":22.9230769231,"string":"22.923077"},"max_line_length":{"kind":"number","value":66,"string":"66"},"alphanum_fraction":{"kind":"number","value":0.466442953,"string":"0.466443"},"licenses":{"kind":"list like","value":["MIT"],"string":"[\n \"MIT\"\n]"},"repository_name":{"kind":"string","value":"royqh1979/programming_with_python"},"path":{"kind":"string","value":"Chap02Loops/5-4.无重复组合.py"},"size":{"kind":"number","value":364,"string":"364"},"lang":{"kind":"string","value":"Python"}}}],"truncated":false,"partial":false},"paginationData":{"pageIndex":87,"numItemsPerPage":100,"numTotalItems":10000,"offset":8700,"length":100}},"jwt":"eyJhbGciOiJFZERTQSJ9.eyJyZWFkIjp0cnVlLCJwZXJtaXNzaW9ucyI6eyJyZXBvLmNvbnRlbnQucmVhZCI6dHJ1ZX0sImlhdCI6MTc1Njc0MjQ5NCwic3ViIjoiL2RhdGFzZXRzL21sNnRlYW0vdGhlLXN0YWNrLXNtb2wtcHl0aG9uIiwiZXhwIjoxNzU2NzQ2MDk0LCJpc3MiOiJodHRwczovL2h1Z2dpbmdmYWNlLmNvIn0.QDG3Fw2hs30yg-CO83gT09Q4HH3O13LNURQVVVCPoL-7BGp5jnrkGDOmky3s_QgsIFMB6O_eT58u1wxUOg6uCQ","displayUrls":true},"discussionsStats":{"closed":0,"open":0,"total":0},"fullWidth":true,"hasGatedAccess":true,"hasFullAccess":true,"isEmbedded":false,"savedQueries":{"community":[],"user":[]}}"><div><header class="bg-linear-to-t border-b border-gray-100 pt-4 xl:pt-0 from-purple-500/8 dark:from-purple-500/20 to-white to-70% dark:to-gray-950"><div class="mx-4 relative flex flex-col xl:flex-row"><h1 class="flex flex-wrap items-center max-md:leading-tight gap-y-1 text-lg xl:flex-none"><a href="/datasets" class="group flex items-center"><svg class="sm:mr-1 -mr-1 text-gray-400" style="" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 25 25"><ellipse cx="12.5" cy="5" fill="currentColor" fill-opacity="0.25" rx="7.5" ry="2"></ellipse><path d="M12.5 15C16.6421 15 20 14.1046 20 13V20C20 21.1046 16.6421 22 12.5 22C8.35786 22 5 21.1046 5 20V13C5 14.1046 8.35786 15 12.5 15Z" fill="currentColor" opacity="0.5"></path><path d="M12.5 7C16.6421 7 20 6.10457 20 5V11.5C20 12.6046 16.6421 13.5 12.5 13.5C8.35786 13.5 5 12.6046 5 11.5V5C5 6.10457 8.35786 7 12.5 7Z" fill="currentColor" opacity="0.5"></path><path d="M5.23628 12C5.08204 12.1598 5 12.8273 5 13C5 14.1046 8.35786 15 12.5 15C16.6421 15 20 14.1046 20 13C20 12.8273 19.918 12.1598 19.7637 12C18.9311 12.8626 15.9947 13.5 12.5 13.5C9.0053 13.5 6.06886 12.8626 5.23628 12Z" fill="currentColor"></path></svg> <span class="mr-2.5 font-semibold text-gray-400 group-hover:text-gray-500 max-sm:hidden">Datasets:</span></a> <hr class="mx-1.5 h-2 translate-y-px rounded-sm border-r dark:border-gray-600 sm:hidden"> <div class="group flex flex-none items-center"><div class="relative mr-1 flex items-center"> <span class="inline-block "><span class="contents"><a href="/ml6team" class="text-gray-400 hover:text-blue-600"><img alt="" class="size-3.5 rounded-sm flex-none" src="https://aifasthub.com/avatars/v1/production/uploads/1607088946666-5f44b7cb79c1ba4c353d0fbb.png" crossorigin="anonymous"></a></span> </span></div> <span class="inline-block "><span class="contents"><a href="/ml6team" class="text-gray-400 hover:text-blue-600">ml6team</a></span> </span> <div class="mx-0.5 text-gray-300">/</div></div> <div class="max-w-full xl:flex xl:min-w-0 xl:flex-nowrap xl:items-center xl:gap-x-1"><a class="break-words font-mono font-semibold hover:text-blue-600 text-[1.07rem] xl:truncate" href="/datasets/ml6team/the-stack-smol-python">the-stack-smol-python</a> <button class="text-xs mr-3 focus:outline-hidden inline-flex cursor-pointer items-center text-sm mx-0.5 text-gray-600 " title="Copy dataset name to clipboard" type="button"><svg class="" xmlns="http://www.w3.org/2000/svg" aria-hidden="true" fill="currentColor" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 32 32"><path d="M28,10V28H10V10H28m0-2H10a2,2,0,0,0-2,2V28a2,2,0,0,0,2,2H28a2,2,0,0,0,2-2V10a2,2,0,0,0-2-2Z" transform="translate(0)"></path><path d="M4,18H2V4A2,2,0,0,1,4,2H18V4H4Z" transform="translate(0)"></path><rect fill="none" width="32" height="32"></rect></svg> </button></div> <div class="inline-flex items-center overflow-hidden whitespace-nowrap rounded-md border bg-white text-sm leading-none text-gray-500 mr-2"><button class="relative flex items-center overflow-hidden from-red-50 to-transparent dark:from-red-900 px-1.5 py-1 hover:bg-linear-to-t focus:outline-hidden" title="Like"><svg class="left-1.5 absolute" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 32 32" fill="currentColor"><path d="M22.45,6a5.47,5.47,0,0,1,3.91,1.64,5.7,5.7,0,0,1,0,8L16,26.13,5.64,15.64a5.7,5.7,0,0,1,0-8,5.48,5.48,0,0,1,7.82,0L16,10.24l2.53-2.58A5.44,5.44,0,0,1,22.45,6m0-2a7.47,7.47,0,0,0-5.34,2.24L16,7.36,14.89,6.24a7.49,7.49,0,0,0-10.68,0,7.72,7.72,0,0,0,0,10.82L16,29,27.79,17.06a7.72,7.72,0,0,0,0-10.82A7.49,7.49,0,0,0,22.45,4Z"></path></svg> <span class="ml-4 pl-0.5 ">like</span></button> <button class="focus:outline-hidden flex items-center border-l px-1.5 py-1 text-gray-400 hover:bg-gray-50 focus:bg-gray-100 dark:hover:bg-gray-900 dark:focus:bg-gray-800" title="See users who liked this repository">2</button></div> <div class="relative flex items-center gap-1.5 "><div class="mr-2 inline-flex h-6 items-center overflow-hidden whitespace-nowrap rounded-md border text-sm text-gray-500"><button class="focus:outline-hidden relative flex h-full max-w-56 items-center gap-1.5 overflow-hidden px-1.5 hover:bg-gray-50 focus:bg-gray-100 dark:hover:bg-gray-900 dark:focus:bg-gray-800" type="button" ><div class="flex h-full flex-1 items-center justify-center ">Follow</div> <img alt="" class="rounded-xs size-3 flex-none" src="https://aifasthub.com/avatars/v1/production/uploads/1607088946666-5f44b7cb79c1ba4c353d0fbb.png"> <span class="truncate">ML6 Team</span></button> <button class="focus:outline-hidden flex h-full items-center border-l pl-1.5 pr-1.5 text-gray-400 hover:bg-gray-50 focus:bg-gray-100 dark:hover:bg-gray-900 dark:focus:bg-gray-800" title="Show ML6 Team's followers" type="button">117</button></div> </div> </h1> <div class="flex flex-col-reverse gap-x-2 sm:flex-row sm:items-center sm:justify-between xl:ml-auto"><div class="-mb-px flex h-12 items-center overflow-x-auto overflow-y-hidden "> <a class="tab-alternate" href="/datasets/ml6team/the-stack-smol-python"><svg class="mr-1.5 text-gray-400 flex-none" style="" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 24 24"><path class="uim-quaternary" d="M20.23 7.24L12 12L3.77 7.24a1.98 1.98 0 0 1 .7-.71L11 2.76c.62-.35 1.38-.35 2 0l6.53 3.77c.29.173.531.418.7.71z" opacity=".25" fill="currentColor"></path><path class="uim-tertiary" d="M12 12v9.5a2.09 2.09 0 0 1-.91-.21L4.5 17.48a2.003 2.003 0 0 1-1-1.73v-7.5a2.06 2.06 0 0 1 .27-1.01L12 12z" opacity=".5" fill="currentColor"></path><path class="uim-primary" d="M20.5 8.25v7.5a2.003 2.003 0 0 1-1 1.73l-6.62 3.82c-.275.13-.576.198-.88.2V12l8.23-4.76c.175.308.268.656.27 1.01z" fill="currentColor"></path></svg> Dataset card </a><a class="tab-alternate active" href="/datasets/ml6team/the-stack-smol-python/viewer/"><svg class="mr-1.5 text-gray-400 flex-none" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill="currentColor" d="M2.5 2h7a1 1 0 0 1 1 1v6a1 1 0 0 1-1 1h-7a1 1 0 0 1-1-1V3a1 1 0 0 1 1-1Zm0 2v2h3V4h-3Zm4 0v2h3V4h-3Zm-4 3v2h3V7h-3Zm4 0v2h3V7h-3Z"></path></svg> Data Studio </a><a class="tab-alternate" href="/datasets/ml6team/the-stack-smol-python/tree/main"><svg class="mr-1.5 text-gray-400 flex-none" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 24 24"><path class="uim-tertiary" d="M21 19h-8a1 1 0 0 1 0-2h8a1 1 0 0 1 0 2zm0-4h-8a1 1 0 0 1 0-2h8a1 1 0 0 1 0 2zm0-8h-8a1 1 0 0 1 0-2h8a1 1 0 0 1 0 2zm0 4h-8a1 1 0 0 1 0-2h8a1 1 0 0 1 0 2z" opacity=".5" fill="currentColor"></path><path class="uim-primary" d="M9 19a1 1 0 0 1-1-1V6a1 1 0 0 1 2 0v12a1 1 0 0 1-1 1zm-6-4.333a1 1 0 0 1-.64-1.769L3.438 12l-1.078-.898a1 1 0 0 1 1.28-1.538l2 1.667a1 1 0 0 1 0 1.538l-2 1.667a.999.999 0 0 1-.64.231z" fill="currentColor"></path></svg> <span class="xl:hidden">Files</span> <span class="hidden xl:inline">Files and versions</span> <span class="inline-block "><span class="contents"><div slot="anchor" class="shadow-purple-500/10 ml-2 inline-flex -translate-y-px items-center gap-0.5 rounded-md border bg-white px-1 py-0.5 align-middle text-xs font-semibold leading-none text-gray-800 shadow-sm dark:border-gray-700 dark:bg-gradient-to-b dark:from-gray-925 dark:to-gray-925 dark:text-gray-300"><svg class="size-3 " xmlns="http://www.w3.org/2000/svg" aria-hidden="true" fill="currentColor" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M6.14 3.64 5.1 4.92 2.98 2.28h2.06l1.1 1.36Zm0 4.72-1.1 1.36H2.98l2.13-2.64 1.03 1.28Zm4.9 1.36L8.03 6l3-3.72H8.96L5.97 6l3 3.72h2.06Z" fill="#7875FF"></path><path d="M4.24 6 2.6 8.03.97 6 2.6 3.97 4.24 6Z" fill="#FF7F41" opacity="1"></path></svg> <span>xet</span> </div></span> </span> </a><a class="tab-alternate" href="/datasets/ml6team/the-stack-smol-python/discussions"><svg class="mr-1.5 text-gray-400 flex-none" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 32 32"><path d="M20.6081 3C21.7684 3 22.8053 3.49196 23.5284 4.38415C23.9756 4.93678 24.4428 5.82749 24.4808 7.16133C24.9674 7.01707 25.4353 6.93643 25.8725 6.93643C26.9833 6.93643 27.9865 7.37587 28.696 8.17411C29.6075 9.19872 30.0124 10.4579 29.8361 11.7177C29.7523 12.3177 29.5581 12.8555 29.2678 13.3534C29.8798 13.8646 30.3306 14.5763 30.5485 15.4322C30.719 16.1032 30.8939 17.5006 29.9808 18.9403C30.0389 19.0342 30.0934 19.1319 30.1442 19.2318C30.6932 20.3074 30.7283 21.5229 30.2439 22.6548C29.5093 24.3704 27.6841 25.7219 24.1397 27.1727C21.9347 28.0753 19.9174 28.6523 19.8994 28.6575C16.9842 29.4379 14.3477 29.8345 12.0653 29.8345C7.87017 29.8345 4.8668 28.508 3.13831 25.8921C0.356375 21.6797 0.754104 17.8269 4.35369 14.1131C6.34591 12.058 7.67023 9.02782 7.94613 8.36275C8.50224 6.39343 9.97271 4.20438 12.4172 4.20438H12.4179C12.6236 4.20438 12.8314 4.2214 13.0364 4.25468C14.107 4.42854 15.0428 5.06476 15.7115 6.02205C16.4331 5.09583 17.134 4.359 17.7682 3.94323C18.7242 3.31737 19.6794 3 20.6081 3ZM20.6081 5.95917C20.2427 5.95917 19.7963 6.1197 19.3039 6.44225C17.7754 7.44319 14.8258 12.6772 13.7458 14.7131C13.3839 15.3952 12.7655 15.6837 12.2086 15.6837C11.1036 15.6837 10.2408 14.5497 12.1076 13.1085C14.9146 10.9402 13.9299 7.39584 12.5898 7.1776C12.5311 7.16799 12.4731 7.16355 12.4172 7.16355C11.1989 7.16355 10.6615 9.33114 10.6615 9.33114C10.6615 9.33114 9.0863 13.4148 6.38031 16.206C3.67434 18.998 3.5346 21.2388 5.50675 24.2246C6.85185 26.2606 9.42666 26.8753 12.0653 26.8753C14.8021 26.8753 17.6077 26.2139 19.1799 25.793C19.2574 25.7723 28.8193 22.984 27.6081 20.6107C27.4046 20.212 27.0693 20.0522 26.6471 20.0522C24.9416 20.0522 21.8393 22.6726 20.5057 22.6726C20.2076 22.6726 19.9976 22.5416 19.9116 22.222C19.3433 20.1173 28.552 19.2325 27.7758 16.1839C27.639 15.6445 27.2677 15.4256 26.746 15.4263C24.4923 15.4263 19.4358 19.5181 18.3759 19.5181C18.2949 19.5181 18.2368 19.4937 18.2053 19.4419C17.6743 18.557 17.9653 17.9394 21.7082 15.6009C25.4511 13.2617 28.0783 11.8545 26.5841 10.1752C26.4121 9.98141 26.1684 9.8956 25.8725 9.8956C23.6001 9.89634 18.2311 14.9403 18.2311 14.9403C18.2311 14.9403 16.7821 16.496 15.9057 16.496C15.7043 16.496 15.533 16.4139 15.4169 16.2112C14.7956 15.1296 21.1879 10.1286 21.5484 8.06535C21.7928 6.66715 21.3771 5.95917 20.6081 5.95917Z" fill="#FF9D00"></path><path d="M5.50686 24.2246C3.53472 21.2387 3.67446 18.9979 6.38043 16.206C9.08641 13.4147 10.6615 9.33111 10.6615 9.33111C10.6615 9.33111 11.2499 6.95933 12.59 7.17757C13.93 7.39581 14.9139 10.9401 12.1069 13.1084C9.29997 15.276 12.6659 16.7489 13.7459 14.713C14.8258 12.6772 17.7747 7.44316 19.304 6.44221C20.8326 5.44128 21.9089 6.00204 21.5484 8.06532C21.188 10.1286 14.795 15.1295 15.4171 16.2118C16.0391 17.2934 18.2312 14.9402 18.2312 14.9402C18.2312 14.9402 25.0907 8.49588 26.5842 10.1752C28.0776 11.8545 25.4512 13.2616 21.7082 15.6008C17.9646 17.9393 17.6744 18.557 18.2054 19.4418C18.7372 20.3266 26.9998 13.1351 27.7759 16.1838C28.5513 19.2324 19.3434 20.1173 19.9117 22.2219C20.48 24.3274 26.3979 18.2382 27.6082 20.6107C28.8193 22.9839 19.2574 25.7722 19.18 25.7929C16.0914 26.62 8.24723 28.3726 5.50686 24.2246Z" fill="#FFD21E"></path></svg> Community </a></div> </div></div></header> </div> <div class="flex flex-col w-full"> <div class="flex h-full flex-1"> <div class="flex flex-1 flex-col overflow-hidden " style="height: calc(100vh - 48px)"><div class="flex flex-col overflow-hidden h-full "> <div class="flex flex-1 flex-col overflow-hidden "><div class="flex flex-1 flex-col overflow-hidden"><div class="flex min-h-0 flex-1"><div class="flex flex-1 flex-col overflow-hidden"><div class="md:shadow-xs dark:border-gray-800 md:my-4 md:ml-4 md:rounded-lg md:border flex min-w-0 flex-wrap "><div class="flex min-w-0 flex-1 flex-wrap"><div class="grid flex-1 grid-cols-1 overflow-hidden text-sm md:grid-cols-2 md:place-content-center md:rounded-lg"><label class="relative block flex-1 px-3 py-2 hover:bg-gray-50 dark:border-gray-850 dark:hover:bg-gray-950 md:border-r md:border-r-0 hidden" title="default"><span class="text-gray-500">Subset (1)</span> <div class="flex items-center whitespace-nowrap"><span class="truncate">default</span> <span class="mx-2 text-gray-500">·</span> <span class="text-gray-500">10k rows</span> <svg class="ml-auto min-w-6 pl-2" width="1em" height="1em" viewBox="0 0 12 7" fill="none" xmlns="http://www.w3.org/2000/svg"><path d="M1 1L6 6L11 1" stroke="currentColor"></path></svg></div> <select class="absolute inset-0 z-10 w-full cursor-pointer border-0 bg-white text-base opacity-0"><optgroup label="Subset (1)"><option value="default" selected>default (10k rows)</option></optgroup></select></label> <label class="relative block flex-1 px-3 py-2 hover:bg-gray-50 dark:border-gray-850 dark:hover:bg-gray-900 md:border-r md:border-r" title="train"><div class="text-gray-500">Split (1)</div> <div class="flex items-center overflow-hidden whitespace-nowrap"><span class="truncate">train</span> <span class="mx-2 text-gray-500">·</span> <span class="text-gray-500">10k rows</span> <svg class="ml-auto min-w-6 pl-2" width="1em" height="1em" viewBox="0 0 12 7" fill="none" xmlns="http://www.w3.org/2000/svg"><path d="M1 1L6 6L11 1" stroke="currentColor"></path></svg></div> <select class="absolute inset-0 z-10 w-full cursor-pointer border-0 bg-white text-base opacity-0"><optgroup label="Split (1)"><option value="train" selected>train (10k rows)</option></optgroup></select></label></div></div> <div class="hidden flex-none flex-col items-center gap-0.5 border-l px-1 md:flex justify-end"> <span class="inline-block "><span class="contents"><div slot="anchor"><button class="group text-gray-500 hover:text-gray-700" aria-label="Hide sidepanel"><div class="rounded-xs flex size-4 items-center justify-center border border-gray-400 bg-gray-100 hover:border-gray-600 hover:bg-blue-50 dark:border-gray-600 dark:bg-gray-800 dark:hover:bg-gray-700 dark:group-hover:border-gray-400"><div class="float-left h-full w-[65%]"></div> <div class="float-right h-full w-[35%] bg-gray-400 group-hover:bg-gray-600 dark:bg-gray-600 dark:group-hover:bg-gray-400"></div></div></button></div></span> </span> <div class="relative "> <button class="btn px-0.5 py-0.5 " type="button"> <svg xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" role="img" class="p-0.5" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 32 32"><circle cx="16" cy="7" r="3" fill="currentColor"></circle><circle cx="16" cy="16" r="3" fill="currentColor"></circle><circle cx="16" cy="25" r="3" fill="currentColor"></circle></svg> </button> </div></div></div> <div class="flex min-h-0 flex-1 flex-col border dark:border-gray-800 md:mb-4 md:ml-4 md:rounded-lg"> <div class="bg-linear-to-r text-smd relative flex items-center dark:border-gray-900 dark:bg-gray-950 false rounded-t-lg [&:has(:focus)]:from-gray-50 [&:has(:focus)]:to-transparent [&:has(:focus)]:to-20% dark:[&:has(:focus)]:from-gray-900"><form class="flex-1"><svg class="absolute left-3 top-1/2 transform -translate-y-1/2 pointer-events-none text-gray-400" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 32 32"><path d="M30 28.59L22.45 21A11 11 0 1 0 21 22.45L28.59 30zM5 14a9 9 0 1 1 9 9a9 9 0 0 1-9-9z" fill="currentColor"></path></svg> <input disabled class="outline-hidden h-9 w-full border-none bg-transparent px-1 pl-9 pr-3 placeholder:text-gray-400 " placeholder="Search this dataset" dir="auto"></form> <div class="flex items-center gap-2 px-2 py-1"><button type="button" class="hover:bg-yellow-200/70 flex items-center gap-1 rounded-md border border-yellow-200 bg-yellow-100 pl-0.5 pr-1 text-[.8rem] leading-normal text-gray-700 dark:border-orange-500/25 dark:bg-orange-500/20 dark:text-gray-300 dark:hover:brightness-110 md:hidden"><div class="rounded-sm bg-yellow-300 px-1 font-mono text-[.7rem] font-bold text-black dark:bg-yellow-700 dark:text-gray-200">SQL </div> Console </button></div></div> <div class="flex flex-1 flex-col overflow-hidden min-h-64 flex w-full flex-col border-t md:rounded-b-lg md:shadow-lg"> <div class="flex-1 relative overflow-auto"><table class="w-full table-auto rounded-lg font-mono text-xs text-gray-900"><thead class="shadow-xs sticky left-0 right-0 top-0 z-1 bg-white align-top"><tr class="space-y-54 h-full min-w-fit divide-x border-b text-left"><th class="h-full max-w-sm p-2 text-left relative w-auto"><div class="flex h-full flex-col flex-nowrap justify-between"><div><div class="flex items-center justify-between">content <form class="flex flex-col"><button id="asc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="-rotate-180 transform text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button> <button id="desc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button></form></div> <div class="mb-2 whitespace-nowrap text-xs font-normal text-gray-500"><span>string</span><span class="italic text-gray-400 before:mx-1 before:content-['·']">lengths</span></div></div> <div><div class="" style="height: 40px; padding-top: 2px"><svg width="130" height="28"><g><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="0" y="0" width="11.2" height="30" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="13.2" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="26.4" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="39.599999999999994" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="52.8" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="66" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="79.19999999999999" y="26" width="11.2" height="4" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="92.39999999999999" y="26" width="11.2" height="4" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="105.6" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="118.8" y="25" width="11.2" height="5" fill-opacity="1"></rect></g><rect class="fill-white dark:fill-gray-900" x="0" y="26" width="130" height="2" stroke-opacity="1"></rect><line class="stroke-gray-100 dark:stroke-gray-500/20" x1="0" y1="27.5" x2="130" y2="27.5" stroke-opacity="1"></line><g><rect class="fill-indigo-500 cursor-pointer" x="-1" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="12.2" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="25.4" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="38.599999999999994" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="51.8" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="65" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="78.19999999999999" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="91.39999999999999" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="104.6" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="117.8" y="0" width="13.2" height="30" fill-opacity="0"></rect></g></svg> <div class="relative font-light text-gray-400" style="height: 10px; width: 130px;"><div class="absolute left-0 overflow-hidden text-ellipsis whitespace-nowrap" style="max-width: 60px">7</div> <div class="absolute overflow-hidden text-ellipsis whitespace-nowrap" style="right: 0px; max-width: 60px">928k</div> </div></div></div></div> <div class="absolute right-0 top-0 z-10 h-full w-1 cursor-col-resize hover:bg-indigo-100 active:bg-indigo-500 dark:hover:bg-indigo-800 dark:active:bg-indigo-600/80"><div class="absolute right-0 top-0 h-full w-1"></div> </div> </th><th class="h-full max-w-sm p-2 text-left relative w-auto"><div class="flex h-full flex-col flex-nowrap justify-between"><div><div class="flex items-center justify-between">avg_line_length <form class="flex flex-col"><button id="asc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="-rotate-180 transform text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button> <button id="desc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button></form></div> <div class="mb-2 whitespace-nowrap text-xs font-normal text-gray-500"><span>float64</span></div></div> <div><div class="" style="height: 40px; padding-top: 2px"><svg width="130" height="28"><g><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="0" y="0" width="11.2" height="30" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="13.2" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="26.4" y="26" width="11.2" height="4" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="39.599999999999994" y="26" width="11.2" height="4" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="52.8" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="66" y="26" width="11.2" height="4" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="79.19999999999999" y="26" width="11.2" height="4" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="92.39999999999999" y="26" width="11.2" height="4" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="105.6" y="26" width="11.2" height="4" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="118.8" y="25" width="11.2" height="5" fill-opacity="1"></rect></g><rect class="fill-white dark:fill-gray-900" x="0" y="26" width="130" height="2" stroke-opacity="1"></rect><line class="stroke-gray-100 dark:stroke-gray-500/20" x1="0" y1="27.5" x2="130" y2="27.5" stroke-opacity="1"></line><g><rect class="fill-indigo-500 cursor-pointer" x="-1" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="12.2" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="25.4" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="38.599999999999994" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="51.8" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="65" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="78.19999999999999" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="91.39999999999999" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="104.6" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="117.8" y="0" width="13.2" height="30" fill-opacity="0"></rect></g></svg> <div class="relative font-light text-gray-400" style="height: 10px; width: 130px;"><div class="absolute left-0 overflow-hidden text-ellipsis whitespace-nowrap" style="max-width: 60px">3.5</div> <div class="absolute overflow-hidden text-ellipsis whitespace-nowrap" style="right: 0px; max-width: 60px">33.8k</div> </div></div></div></div> <div class="absolute right-0 top-0 z-10 h-full w-1 cursor-col-resize hover:bg-indigo-100 active:bg-indigo-500 dark:hover:bg-indigo-800 dark:active:bg-indigo-600/80"><div class="absolute right-0 top-0 h-full w-1"></div> </div> </th><th class="h-full max-w-sm p-2 text-left relative w-auto"><div class="flex h-full flex-col flex-nowrap justify-between"><div><div class="flex items-center justify-between">max_line_length <form class="flex flex-col"><button id="asc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="-rotate-180 transform text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button> <button id="desc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button></form></div> <div class="mb-2 whitespace-nowrap text-xs font-normal text-gray-500"><span>int64</span></div></div> <div><div class="" style="height: 40px; padding-top: 2px"><svg width="130" height="28"><g><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="0" y="0" width="11.2" height="30" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="13.2" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="26.4" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="39.599999999999994" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="52.8" y="26" width="11.2" height="4" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="66" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="79.19999999999999" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="92.39999999999999" y="26" width="11.2" height="4" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="105.6" y="26" width="11.2" height="4" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="118.8" y="25" width="11.2" height="5" fill-opacity="1"></rect></g><rect class="fill-white dark:fill-gray-900" x="0" y="26" width="130" height="2" stroke-opacity="1"></rect><line class="stroke-gray-100 dark:stroke-gray-500/20" x1="0" y1="27.5" x2="130" y2="27.5" stroke-opacity="1"></line><g><rect class="fill-indigo-500 cursor-pointer" x="-1" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="12.2" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="25.4" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="38.599999999999994" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="51.8" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="65" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="78.19999999999999" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="91.39999999999999" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="104.6" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="117.8" y="0" width="13.2" height="30" fill-opacity="0"></rect></g></svg> <div class="relative font-light text-gray-400" style="height: 10px; width: 130px;"><div class="absolute left-0 overflow-hidden text-ellipsis whitespace-nowrap" style="max-width: 60px">6</div> <div class="absolute overflow-hidden text-ellipsis whitespace-nowrap" style="right: 0px; max-width: 60px">139k</div> </div></div></div></div> <div class="absolute right-0 top-0 z-10 h-full w-1 cursor-col-resize hover:bg-indigo-100 active:bg-indigo-500 dark:hover:bg-indigo-800 dark:active:bg-indigo-600/80"><div class="absolute right-0 top-0 h-full w-1"></div> </div> </th><th class="h-full max-w-sm p-2 text-left relative w-auto"><div class="flex h-full flex-col flex-nowrap justify-between"><div><div class="flex items-center justify-between">alphanum_fraction <form class="flex flex-col"><button id="asc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="-rotate-180 transform text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button> <button id="desc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button></form></div> <div class="mb-2 whitespace-nowrap text-xs font-normal text-gray-500"><span>float64</span></div></div> <div><div class="" style="height: 40px; padding-top: 2px"><svg width="130" height="28"><g><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="0" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="13.2" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="26.4" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="39.599999999999994" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="52.8" y="23.02499426736987" width="11.2" height="6.97500573263013" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="66" y="10.475120385232742" width="11.2" height="19.524879614767258" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="79.19999999999999" y="0" width="11.2" height="30" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="92.39999999999999" y="13.825728044026599" width="11.2" height="16.174271955973403" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="105.6" y="24.020637468470532" width="11.2" height="5.979362531529466" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="118.8" y="25" width="11.2" height="5" fill-opacity="1"></rect></g><rect class="fill-white dark:fill-gray-900" x="0" y="26" width="130" height="2" stroke-opacity="1"></rect><line class="stroke-gray-100 dark:stroke-gray-500/20" x1="0" y1="27.5" x2="130" y2="27.5" stroke-opacity="1"></line><g><rect class="fill-indigo-500 cursor-pointer" x="-1" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="12.2" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="25.4" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="38.599999999999994" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="51.8" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="65" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="78.19999999999999" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="91.39999999999999" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="104.6" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="117.8" y="0" width="13.2" height="30" fill-opacity="0"></rect></g></svg> <div class="relative font-light text-gray-400" style="height: 10px; width: 130px;"><div class="absolute left-0 overflow-hidden text-ellipsis whitespace-nowrap" style="max-width: 60px">0.08</div> <div class="absolute overflow-hidden text-ellipsis whitespace-nowrap" style="right: 0px; max-width: 60px">0.96</div> </div></div></div></div> <div class="absolute right-0 top-0 z-10 h-full w-1 cursor-col-resize hover:bg-indigo-100 active:bg-indigo-500 dark:hover:bg-indigo-800 dark:active:bg-indigo-600/80"><div class="absolute right-0 top-0 h-full w-1"></div> </div> </th><th class="h-full max-w-sm p-2 text-left relative w-auto"><div class="flex h-full flex-col flex-nowrap justify-between"><div><div class="flex items-center justify-between">licenses <form class="flex flex-col"><button id="asc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="-rotate-180 transform text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button> <button id="desc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button></form></div> <div class="mb-2 whitespace-nowrap text-xs font-normal text-gray-500"><span>list</span></div></div> <div></div></div> <div class="absolute right-0 top-0 z-10 h-full w-1 cursor-col-resize hover:bg-indigo-100 active:bg-indigo-500 dark:hover:bg-indigo-800 dark:active:bg-indigo-600/80"><div class="absolute right-0 top-0 h-full w-1"></div> </div> </th><th class="h-full max-w-sm p-2 text-left relative w-auto"><div class="flex h-full flex-col flex-nowrap justify-between"><div><div class="flex items-center justify-between">repository_name <form class="flex flex-col"><button id="asc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="-rotate-180 transform text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button> <button id="desc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button></form></div> <div class="mb-2 whitespace-nowrap text-xs font-normal text-gray-500"><span>string</span><span class="italic text-gray-400 before:mx-1 before:content-['·']">lengths</span></div></div> <div><div class="" style="height: 40px; padding-top: 2px"><svg width="130" height="28"><g><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="0" y="14.3272800645682" width="11.2" height="15.6727199354318" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="13.2" y="0" width="11.2" height="30" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="26.4" y="14.767958030669895" width="11.2" height="15.232041969330105" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="39.599999999999994" y="23.324455205811137" width="11.2" height="6.675544794188863" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="52.8" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="66" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="79.19999999999999" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="92.39999999999999" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="105.6" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="118.8" y="25" width="11.2" height="5" fill-opacity="1"></rect></g><rect class="fill-white dark:fill-gray-900" x="0" y="26" width="130" height="2" stroke-opacity="1"></rect><line class="stroke-gray-100 dark:stroke-gray-500/20" x1="0" y1="27.5" x2="130" y2="27.5" stroke-opacity="1"></line><g><rect class="fill-indigo-500 cursor-pointer" x="-1" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="12.2" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="25.4" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="38.599999999999994" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="51.8" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="65" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="78.19999999999999" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="91.39999999999999" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="104.6" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="117.8" y="0" width="13.2" height="30" fill-opacity="0"></rect></g></svg> <div class="relative font-light text-gray-400" style="height: 10px; width: 130px;"><div class="absolute left-0 overflow-hidden text-ellipsis whitespace-nowrap" style="max-width: 60px">7</div> <div class="absolute overflow-hidden text-ellipsis whitespace-nowrap" style="right: 0px; max-width: 60px">104</div> </div></div></div></div> <div class="absolute right-0 top-0 z-10 h-full w-1 cursor-col-resize hover:bg-indigo-100 active:bg-indigo-500 dark:hover:bg-indigo-800 dark:active:bg-indigo-600/80"><div class="absolute right-0 top-0 h-full w-1"></div> </div> </th><th class="h-full max-w-sm p-2 text-left relative w-auto"><div class="flex h-full flex-col flex-nowrap justify-between"><div><div class="flex items-center justify-between">path <form class="flex flex-col"><button id="asc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="-rotate-180 transform text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button> <button id="desc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button></form></div> <div class="mb-2 whitespace-nowrap text-xs font-normal text-gray-500"><span>string</span><span class="italic text-gray-400 before:mx-1 before:content-['·']">lengths</span></div></div> <div><div class="" style="height: 40px; padding-top: 2px"><svg width="130" height="28"><g><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="0" y="0.5453230472516886" width="11.2" height="29.45467695274831" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="13.2" y="0" width="11.2" height="30" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="26.4" y="17.926711668273867" width="11.2" height="12.073288331726133" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="39.599999999999994" y="23.84378013500482" width="11.2" height="6.156219864995178" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="52.8" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="66" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="79.19999999999999" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="92.39999999999999" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="105.6" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-gray-400 dark:fill-gray-500/80" rx="2" x="118.8" y="25" width="11.2" height="5" fill-opacity="1"></rect></g><rect class="fill-white dark:fill-gray-900" x="0" y="26" width="130" height="2" stroke-opacity="1"></rect><line class="stroke-gray-100 dark:stroke-gray-500/20" x1="0" y1="27.5" x2="130" y2="27.5" stroke-opacity="1"></line><g><rect class="fill-indigo-500 cursor-pointer" x="-1" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="12.2" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="25.4" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="38.599999999999994" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="51.8" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="65" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="78.19999999999999" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="91.39999999999999" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="104.6" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="117.8" y="0" width="13.2" height="30" fill-opacity="0"></rect></g></svg> <div class="relative font-light text-gray-400" style="height: 10px; width: 130px;"><div class="absolute left-0 overflow-hidden text-ellipsis whitespace-nowrap" style="max-width: 60px">4</div> <div class="absolute overflow-hidden text-ellipsis whitespace-nowrap" style="right: 0px; max-width: 60px">230</div> </div></div></div></div> <div class="absolute right-0 top-0 z-10 h-full w-1 cursor-col-resize hover:bg-indigo-100 active:bg-indigo-500 dark:hover:bg-indigo-800 dark:active:bg-indigo-600/80"><div class="absolute right-0 top-0 h-full w-1"></div> </div> </th><th class="h-full max-w-sm p-2 text-left relative w-auto"><div class="flex h-full flex-col flex-nowrap justify-between"><div><div class="flex items-center justify-between">size <form class="flex flex-col"><button id="asc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="-rotate-180 transform text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button> <button id="desc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button></form></div> <div class="mb-2 whitespace-nowrap text-xs font-normal text-gray-500"><span>int64</span></div></div> <div><div class="" style="height: 40px; padding-top: 2px"><svg width="130" height="28"><g><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="0" y="0" width="11.2" height="30" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="13.2" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="26.4" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="39.599999999999994" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="52.8" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="66" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="79.19999999999999" y="26" width="11.2" height="4" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="92.39999999999999" y="26" width="11.2" height="4" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="105.6" y="25" width="11.2" height="5" fill-opacity="1"></rect><rect class="fill-indigo-500 dark:fill-indigo-600/80" rx="2" x="118.8" y="25" width="11.2" height="5" fill-opacity="1"></rect></g><rect class="fill-white dark:fill-gray-900" x="0" y="26" width="130" height="2" stroke-opacity="1"></rect><line class="stroke-gray-100 dark:stroke-gray-500/20" x1="0" y1="27.5" x2="130" y2="27.5" stroke-opacity="1"></line><g><rect class="fill-indigo-500 cursor-pointer" x="-1" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="12.2" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="25.4" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="38.599999999999994" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="51.8" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="65" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="78.19999999999999" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="91.39999999999999" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="104.6" y="0" width="13.2" height="30" fill-opacity="0"></rect><rect class="fill-indigo-500 cursor-pointer" x="117.8" y="0" width="13.2" height="30" fill-opacity="0"></rect></g></svg> <div class="relative font-light text-gray-400" style="height: 10px; width: 130px;"><div class="absolute left-0 overflow-hidden text-ellipsis whitespace-nowrap" style="max-width: 60px">7</div> <div class="absolute overflow-hidden text-ellipsis whitespace-nowrap" style="right: 0px; max-width: 60px">928k</div> </div></div></div></div> <div class="absolute right-0 top-0 z-10 h-full w-1 cursor-col-resize hover:bg-indigo-100 active:bg-indigo-500 dark:hover:bg-indigo-800 dark:active:bg-indigo-600/80"><div class="absolute right-0 top-0 h-full w-1"></div> </div> </th><th class="h-full max-w-sm p-2 text-left relative w-auto"><div class="flex h-full flex-col flex-nowrap justify-between"><div><div class="flex items-center justify-between">lang <form class="flex flex-col"><button id="asc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="-rotate-180 transform text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button> <button id="desc" class="-mr-1 ml-2 h-[0.4rem] w-[0.8rem] transition ease-in-out"><svg class="text-gray-300 hover:text-gray-500" xmlns="http://www.w3.org/2000/svg" viewBox="0 64 256 128" fill="currentColor" aria-hidden="true"><path d="M213.65674,101.657l-80,79.99976a7.99945,7.99945,0,0,1-11.31348,0l-80-79.99976A8,8,0,0,1,48,88H208a8,8,0,0,1,5.65674,13.657Z"></path></svg></button></form></div> <div class="mb-2 whitespace-nowrap text-xs font-normal text-gray-500"><span>string</span><span class="italic text-gray-400 before:mx-1 before:content-['·']">classes</span></div></div> <div><div class="" style="height: 40px; padding-top: 2px"><svg width="130" height="28"><defs><clipPath id="rounded-bar"><rect x="0" y="0" width="130" height="8" rx="4"></rect></clipPath><pattern id="hatching" patternUnits="userSpaceOnUse" patternTransform="rotate(-45)" height="1" width="5"><line y1="0" class="stroke-gray-400 dark:stroke-gray-500/80" stroke-width="3" y2="1" x1="2" x2="2"></line></pattern><pattern id="hatching-faded" patternUnits="userSpaceOnUse" patternTransform="rotate(-45)" height="1" width="5"><line y1="0" class="stroke-gray-100 dark:stroke-gray-500/20" stroke-width="3" y2="1" x1="2" x2="2"></line></pattern></defs><g height="8" style="transform: translateY(20px)" clip-path="url(#rounded-bar)"><g style="transform: scaleX(1.0153846153846153) translateX(-1px)"><g><rect class="fill-indigo-500 dark:fill-indigo-600/80" x="1" y="0" width="128" height="8" fill-opacity="1"></rect></g></g></g><g style="transform: scaleX(1.0153846153846153) translateX(-1px)"><g><rect class="fill-white cursor-pointer" x="0" y="0" width="130" height="28" fill-opacity="0"></rect></g></g></svg> <div class="relative font-light text-gray-400" style="height: 10px; width: 130px;"><div class="absolute left-0 max-w-full overflow-hidden text-ellipsis whitespace-nowrap">1 value</div></div></div></div></div> <div class="absolute right-0 top-0 z-10 h-full w-1 cursor-col-resize hover:bg-indigo-100 active:bg-indigo-500 dark:hover:bg-indigo-800 dark:active:bg-indigo-600/80"><div class="absolute right-0 top-0 h-full w-1"></div> </div> </th></tr></thead> <tbody class="h-16 overflow-scroll"><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8700"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import titration.utils.analysis as analysis import titration.utils.constants as constants import titration.utils.devices.serial_mock as serial_mock import titration.utils.interfaces as interfaces class Syringe_Pump: def __init__(self): self.serial = serial_mock.Serial( port=constants.ARDUINO_PORT, baudrate=constants.ARDUINO_BAUD, timeout=constants.ARDUINO_TIMEOUT, ) self.volume_in_pump = constants.volume_in_pump self.max_pump_capacity = constants.MAX_PUMP_CAPACITY def set_volume_in_pump(self, volume): self.volume_in_pump = volume constants.volume_in_pump = volume def get_volume_in_pump(self): return self.volume_in_pump def pump_volume(self, volume, direction): volume_to_add = volume # pull in solution if direction == 0: # check if volume to add is greater than space left space_in_pump = self.max_pump_capacity - self.volume_in_pump if volume_to_add > space_in_pump: volume_to_add = self.max_pump_capacity - self.volume_in_pump self.drive_pump(volume_to_add, direction) # pump out solution elif direction == 1: # volume greater than max capacity of pump if volume_to_add > self.max_pump_capacity: interfaces.lcd_out( "Volume > pumpable", style=constants.LCD_CENT_JUST, line=4 ) # pump out all current volume next_volume = self.volume_in_pump self.drive_pump(next_volume, 1) # calculate new volume to add volume_to_add = volume_to_add - next_volume # keep pumping until full volume_to_add is met while volume_to_add > 0: next_volume = min(volume_to_add, self.max_pump_capacity) self.drive_pump(next_volume, 0) self.drive_pump(next_volume, 1) volume_to_add -= next_volume # volume greater than volume in pump elif volume_to_add > self.volume_in_pump: next_volume = self.volume_in_pump self.drive_pump(next_volume, 1) # calculate remaining volume to add volume_to_add -= next_volume self.drive_pump(volume_to_add, 0) self.drive_pump(volume_to_add, 1) else: # volume less than volume in pump self.drive_pump(volume_to_add, direction) def drive_pump(self, volume, direction): """Converts volume to cycles and ensures and checks pump level and values""" if direction == 0: space_in_pump = self.max_pump_capacity - self.volume_in_pump if volume > space_in_pump: interfaces.lcd_out("Filling Error", line=4) else: interfaces.lcd_out("Filling {0:1.2f} ml".format(volume), line=4) cycles = analysis.determine_pump_cycles(volume) self.drive_step_stick(cycles, direction) self.volume_in_pump += volume elif direction == 1: if volume > self.volume_in_pump: interfaces.lcd_out("Pumping Error", line=4) else: interfaces.lcd_out("Pumping {0:1.2f} ml".format(volume), line=4) cycles = analysis.determine_pump_cycles(volume) offset = self.drive_step_stick(cycles, direction) # offset is what is returned from drive_step_stick which originally is returned from the arduino if offset != 0: self.drive_step_stick(offset, 0) self.drive_step_stick(offset, 1) self.volume_in_pump -= volume interfaces.lcd_out("Pump Vol: {0:1.2f} ml".format(self.volume_in_pump), line=4) def drive_step_stick(self, cycles, direction): """ cycles and direction are integers Communicates with arduino to add HCl through pump :param cycles: number of rising edges for the pump :param direction: direction of pump """ if cycles == 0: return 0 if self.serial.writable(): self.serial.write(cycles.to_bytes(4, "little")) self.serial.write(direction.to_bytes(1, "little")) self.serial.flush() temp = self.serial.readline() if temp == b"DONE\r\n" or temp == b"": return 0 else: return int(temp) else: interfaces.lcd_out("Arduino Unavailable", 4, constants.LCD_CENT_JUST) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">39.689076</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">112</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.597925</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">KonradMcClure/AlkalinityTitrator</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">titration/utils/devices/syringe_pump_mock.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">4,723</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8701"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from typing import TYPE_CHECKING from loopchain.jsonrpc.exception import GenericJsonRpcServerError from loopchain.blockchain.blocks import BlockBuilder, BlockVerifier as BaseBlockVerifier from loopchain.blockchain.blocks.v0_1a import BlockHeader from loopchain.blockchain.exception import ScoreInvokeError, ScoreInvokeResultError if TYPE_CHECKING: from loopchain.blockchain.types import ExternalAddress from loopchain.blockchain.blocks import Block from loopchain.blockchain.blocks.v0_1a import BlockBody class BlockVerifier(BaseBlockVerifier): version = BlockHeader.version def _verify_common(self, block: 'Block', prev_block: 'Block', **kwargs): generator: 'ExternalAddress' = kwargs.get("generator") header: BlockHeader = block.header body: BlockBody = block.body builder = BlockBuilder.new(self.version, self._tx_versioner) builder.height = header.height builder.prev_hash = header.prev_hash builder.fixed_timestamp = header.timestamp for tx in body.transactions.values(): builder.transactions[tx.hash] = tx invoke_result = None if self.invoke_func: self.verify_invoke(builder, block, prev_block) builder.build_merkle_tree_root_hash() if header.merkle_tree_root_hash != builder.merkle_tree_root_hash: exception = RuntimeError(f"Block({header.height}, {header.hash.hex()}, " f"MerkleTreeRootHash({header.merkle_tree_root_hash.hex()}), " f"Expected({builder.merkle_tree_root_hash.hex()}).") self._handle_exception(exception) builder.build_hash() if header.hash != builder.hash: exception = RuntimeError(f"Block({header.height}, {header.hash.hex()}, " f"Hash({header.hash.hex()}, " f"Expected({builder.hash.hex()}).") self._handle_exception(exception) if generator: self.verify_generator(block, generator) return invoke_result def verify_invoke(self, builder: 'BlockBuilder', block: 'Block', prev_block: 'Block'): header: BlockHeader = block.header try: new_block, invoke_result = self.invoke_func(block, prev_block) except GenericJsonRpcServerError as e: if hasattr(e, 'message') and 'Failed to invoke a block' in e.message: e = ScoreInvokeError(f"{e.message} with block({header.hash.hex()})") self._handle_exception(e) except Exception as e: self._handle_exception(e) else: if not header.commit_state and len(block.body.transactions) == 0: # vote block pass elif header.commit_state != new_block.header.commit_state: exception = ScoreInvokeResultError(f"Block({header.height}, {header.hash.hex()}, " f"CommitState({header.commit_state}), " f"Expected({new_block.header.commit_state}).") self._handle_exception(exception) def verify_prev_block(self, block: 'Block', prev_block: 'Block'): super().verify_prev_block(block, prev_block) prev_block_header: BlockHeader = prev_block.header block_header: BlockHeader = block.header if not block_header.complained and prev_block_header.next_leader and \ prev_block_header.next_leader != block_header.peer_id: exception = RuntimeError(f"Block({block.header.height}, {block.header.hash.hex()}, " f"Leader({block_header.peer_id.hex_xx()}), " f"Expected({prev_block_header.next_leader.hex_xx()}).") self._handle_exception(exception) def verify_generator(self, block: 'Block', generator: 'ExternalAddress'): block_header: BlockHeader = block.header if not block_header.complained and block.header.peer_id != generator: exception = RuntimeError(f"Block({block.header.height}, {block.header.hash.hex()}, " f"Generator({block.header.peer_id.hex_xx()}), " f"Expected({generator.hex_xx()}).") self._handle_exception(exception) def _handle_exception(self, exception: Exception): if self._raise_exceptions: raise exception else: self.exceptions.append(exception) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">46.494949</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">98</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.625244</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">JINWOO-J/loopchain</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">loopchain/blockchain/blocks/v0_1a/block_verifier.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">4,603</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8702"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># Copyright (c) 2019-2020, Manfred Moitzi # License: MIT-License from typing import TYPE_CHECKING, Iterable, cast, Union, List, Set from contextlib import contextmanager import logging from ezdxf.lldxf import validator, const from ezdxf.lldxf.attributes import ( DXFAttr, DXFAttributes, DefSubclass, RETURN_DEFAULT, group_code_mapping, ) from ezdxf.audit import AuditError from .dxfentity import base_class, SubclassProcessor, DXFEntity from .dxfobj import DXFObject from .factory import register_entity from .objectcollection import ObjectCollection logger = logging.getLogger('ezdxf') if TYPE_CHECKING: from ezdxf.eztypes import ( TagWriter, Drawing, DXFNamespace, Auditor, EntityDB, ) __all__ = ['DXFGroup', 'GroupCollection'] acdb_group = DefSubclass('AcDbGroup', { # Group description 'description': DXFAttr(300, default=''), # 1 = Unnamed # 0 = Named 'unnamed': DXFAttr( 70, default=1, validator=validator.is_integer_bool, fixer=RETURN_DEFAULT, ), # 1 = Selectable # 0 = Not selectable 'selectable': DXFAttr( 71, default=1, validator=validator.is_integer_bool, fixer=RETURN_DEFAULT, ), # 340: Hard-pointer handle to entity in group (one entry per object) }) acdb_group_group_codes = group_code_mapping(acdb_group) GROUP_ITEM_CODE = 340 @register_entity class DXFGroup(DXFObject): """ Groups are not allowed in block definitions, and each entity can only reside in one group, so cloning of groups creates also new entities. """ DXFTYPE = 'GROUP' DXFATTRIBS = DXFAttributes(base_class, acdb_group) def __init__(self): super().__init__() self._handles: Set[str] = set() # only needed at the loading stage self._data: List[DXFEntity] = [] def copy(self): raise const.DXFTypeError('Copying of GROUP not supported.') def load_dxf_attribs(self, processor: SubclassProcessor = None) -> 'DXFNamespace': dxf = super().load_dxf_attribs(processor) if processor: tags = processor.fast_load_dxfattribs( dxf, acdb_group_group_codes, 1, log=False) self.load_group(tags) return dxf def load_group(self, tags): for code, value in tags: if code == GROUP_ITEM_CODE: # First store handles, because at this point, objects # are not stored in the EntityDB: self._handles.add(value) def preprocess_export(self, tagwriter: 'TagWriter') -> bool: self.purge(self.doc.entitydb) return True # export even empty groups def export_entity(self, tagwriter: 'TagWriter') -> None: """ Export entity specific data as DXF tags. """ super().export_entity(tagwriter) tagwriter.write_tag2(const.SUBCLASS_MARKER, acdb_group.name) self.dxf.export_dxf_attribs(tagwriter, [ 'description', 'unnamed', 'selectable']) self.export_group(tagwriter) def export_group(self, tagwriter: 'TagWriter'): for entity in self._data: tagwriter.write_tag2(GROUP_ITEM_CODE, entity.dxf.handle) def __iter__(self) -> Iterable[DXFEntity]: """ Iterate over all DXF entities in :class:`DXFGroup` as instances of :class:`DXFGraphic` or inherited (LINE, CIRCLE, ...). """ return (e for e in self._data if e.is_alive) def __len__(self) -> int: """ Returns the count of DXF entities in :class:`DXFGroup`. """ return len(self._data) def __getitem__(self, item): """ Returns entities by standard Python indexing and slicing. """ return self._data[item] def __contains__(self, item: Union[str, DXFEntity]) -> bool: """ Returns ``True`` if item is in :class:`DXFGroup`. `item` has to be a handle string or an object of type :class:`DXFEntity` or inherited. """ handle = item if isinstance(item, str) else item.dxf.handle return handle in set(self.handles()) def handles(self) -> Iterable[str]: """ Iterable of handles of all DXF entities in :class:`DXFGroup`. """ return (entity.dxf.handle for entity in self) def post_load_hook(self, doc: 'Drawing') -> None: super().post_load_hook(doc) db_get = doc.entitydb.get def entities(): for handle in self._handles: entity = db_get(handle) if entity and entity.is_alive: yield entity try: self.set_data(entities()) except const.DXFStructureError as e: logger.error(str(e)) del self._handles # all referenced entities are stored in _data @contextmanager def edit_data(self) -> List[DXFEntity]: """ Context manager which yields all the group entities as standard Python list:: with group.edit_data() as data: # add new entities to a group data.append(modelspace.add_line((0, 0), (3, 0))) # remove last entity from a group data.pop() """ data = list(self) yield data self.set_data(data) def set_data(self, entities: Iterable[DXFEntity]) -> None: """ Set `entities` as new group content, entities should be an iterable :class:`DXFGraphic` or inherited (LINE, CIRCLE, ...). Raises :class:`DXFValueError` if not all entities be on the same layout (modelspace or any paperspace layout but not block) """ entities = list(entities) if not all_entities_on_same_layout(entities): raise const.DXFStructureError( "All entities have to be in the same layout and are not allowed" " to be in a block layout." ) self.clear() self._data = entities def extend(self, entities: Iterable[DXFEntity]) -> None: """ Add `entities` to :class:`DXFGroup`. """ self._data.extend(entities) def clear(self) -> None: """ Remove all entities from :class:`DXFGroup`, does not delete any drawing entities referenced by this group. """ self._data = [] def audit(self, auditor: 'Auditor') -> None: """ Remove invalid handles from :class:`DXFGroup`. Invalid handles are: deleted entities, not all entities in the same layout or entities in a block layout. """ # Remove destroyed or invalid entities: self.purge(auditor.entitydb) if not all_entities_on_same_layout(self._data): auditor.fixed_error( code=AuditError.GROUP_ENTITIES_IN_DIFFERENT_LAYOUTS, message=f'Cleared {str(self)}, not all entities are located in ' f'the same layout.', ) self.clear() def _has_valid_owner(self, entity, db: 'EntityDB') -> bool: # no owner -> no layout association if entity.dxf.owner is None: return False owner = db.get(entity.dxf.owner) # owner does not exist or is destroyed -> no layout association if owner is None or not owner.is_alive: return False # owner block_record.layout is 0 if entity is in a block definition, # which is not allowed: valid = owner.dxf.layout != '0' if not valid: logger.debug( f"{str(entity)} in {str(self)} is located in a block layout, " f"which is not allowed") return valid def _filter_invalid_entities(self, db: 'EntityDB') -> List[DXFEntity]: assert db is not None return [e for e in self._data if e.is_alive and self._has_valid_owner(e, db)] def purge(self, db: 'EntityDB') -> None: """ Remove invalid group entities. """ self._data = self._filter_invalid_entities(db) def all_entities_on_same_layout(entities: Iterable[DXFEntity]): """ Check if all entities are on the same layout (model space or any paper layout but not block). """ owners = set(entity.dxf.owner for entity in entities) # 0 for no entities; 1 for all entities on the same layout return len(owners) < 2 class GroupCollection(ObjectCollection): def __init__(self, doc: 'Drawing'): super().__init__(doc, dict_name='ACAD_GROUP', object_type='GROUP') self._next_unnamed_number = 0 def groups(self) -> Iterable[DXFGroup]: """ Iterable of all existing groups. """ for name, group in self: yield group def next_name(self) -> str: name = self._next_name() while name in self: name = self._next_name() return name def _next_name(self) -> str: self._next_unnamed_number += 1 return f"*A{self._next_unnamed_number}" def new(self, name: str = None, description: str = "", selectable: bool = True) -> DXFGroup: r""" Creates a new group. If `name` is ``None`` an unnamed group is created, which has an automatically generated name like "\*Annnn". Args: name: group name as string description: group description as string selectable: group is selectable if ``True`` """ if name in self: raise const.DXFValueError(f"GROUP '{name}' already exists.") if name is None: name = self.next_name() unnamed = 1 else: unnamed = 0 # The group name isn't stored in the group entity itself. dxfattribs = { 'description': description, 'unnamed': unnamed, 'selectable': int(bool(selectable)), } return cast(DXFGroup, self._new(name, dxfattribs)) def delete(self, group: Union[DXFGroup, str]) -> None: """ Delete `group`, `group` can be an object of type :class:`DXFGroup` or a group name as string. """ # Delete group by name: if isinstance(group, str): name = group elif group.dxftype() == 'GROUP': name = get_group_name(group, self.entitydb) else: raise TypeError(group.dxftype()) if name in self: super().delete(name) else: raise const.DXFValueError("GROUP not in group table registered.") def audit(self, auditor: 'Auditor') -> None: """ Removes empty groups and invalid handles from all groups. """ trash = [] for name, group in self: group.audit(auditor) if not len(group): # remove empty group # do not delete groups while iterating over groups! trash.append(name) # now delete empty groups for name in trash: auditor.fixed_error( code=AuditError.REMOVE_EMPTY_GROUP, message=f'Removed empty group "{name}".', ) self.delete(name) def get_group_name(group: DXFGroup, db: 'EntityDB') -> str: """ Get name of `group`. """ group_table = cast('Dictionary', db[group.dxf.owner]) for name, entity in group_table.items(): if entity is group: return name </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">34.432927</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">80</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.609616</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">dmtvanzanten/ezdxf</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">src/ezdxf/entities/dxfgroups.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">11,294</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8703"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import numpy as np import pandas as pd from pylab import rcParams from sklearn.metrics import mean_absolute_error, mean_squared_error # Additional custom functions from cases.industrial.processing import multi_automl_fit_forecast, plot_results from fedot.core.constants import BEST_QUALITY_PRESET_NAME from fedot.core.data.multi_modal import prepare_multimodal_data rcParams['figure.figsize'] = 15, 7 if __name__ == '__main__': # Below is an example of multivariate time series forecasting. # An example of how forecasts can be made is presented and a simple # validation is given on a single block which length is equal to the # length of the forecast horizon. # Define forecast horizon and read dataframe forecast_length = 20 df = pd.read_csv('pw_dataset.csv', parse_dates=['datetime']) # Wrap time series data into InputData class features_to_use = ['wind_power_kWh', 'diesel_time_h', 'wind_time_h', 'velocity_max_msec', 'velocity_mean_msec', 'tmp_grad', 'diesel_fuel_kWh'] ts = np.array(df['diesel_fuel_kWh']) mm_train, mm_test, = prepare_multimodal_data(dataframe=df, features=features_to_use, forecast_length=forecast_length) # Prepare parameters for algorithm launch # timeout 5 - means that AutoML algorithm will work for 5 minutes timeout = 0.5 composer_params = {'max_depth': 6, 'max_arity': 3, 'pop_size': 20, 'num_of_generations': 20, 'preset': BEST_QUALITY_PRESET_NAME, 'metric': 'rmse', 'cv_folds': None, 'validation_blocks': None} forecast, obtained_pipeline = multi_automl_fit_forecast(mm_train, mm_test, timeout, composer_params, ts, forecast_length, vis=True) mse_metric = mean_squared_error(ts[-forecast_length:], forecast, squared=False) mae_metric = mean_absolute_error(ts[-forecast_length:], forecast) print(f'MAE - {mae_metric:.2f}') print(f'RMSE - {mse_metric:.2f}') # Save obtained pipeline obtained_pipeline.save('best') # Visualise predictions plot_results(actual_time_series=ts, predicted_values=forecast, len_train_data=len(ts) - forecast_length) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">43.333333</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">85</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.608077</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "BSD-3-Clause" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">vishalbelsare/FEDOT</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">cases/industrial/multivariate_forecasting.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">2,600</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8704"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from werkzeug.wrappers import Response from .application import Rocinante from .request import Request from .response import JSONResponse from .router import Router from .handler import RequestHandler from .url import Url from . import status </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">24.4</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">38</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.831967</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">a30285/Rocinante</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">rocinante/__init__.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">244</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8705"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">""" Source code for PyGMT modules. """ # pylint: disable=import-outside-toplevel from pygmt.src.basemap import basemap from pygmt.src.blockm import blockmean, blockmedian from pygmt.src.coast import coast from pygmt.src.colorbar import colorbar from pygmt.src.config import config from pygmt.src.contour import contour from pygmt.src.grd2cpt import grd2cpt from pygmt.src.grdcontour import grdcontour from pygmt.src.grdcut import grdcut from pygmt.src.grdfilter import grdfilter from pygmt.src.grdimage import grdimage from pygmt.src.grdinfo import grdinfo from pygmt.src.grdtrack import grdtrack from pygmt.src.grdview import grdview from pygmt.src.image import image from pygmt.src.info import info from pygmt.src.inset import inset from pygmt.src.legend import legend from pygmt.src.logo import logo from pygmt.src.makecpt import makecpt from pygmt.src.meca import meca from pygmt.src.plot import plot from pygmt.src.plot3d import plot3d from pygmt.src.rose import rose from pygmt.src.solar import solar from pygmt.src.subplot import set_panel, subplot from pygmt.src.surface import surface from pygmt.src.text import text_ as text # "text" is an argument within "text_" from pygmt.src.which import which from pygmt.src.x2sys_cross import x2sys_cross from pygmt.src.x2sys_init import x2sys_init </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">35.135135</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">80</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.824615</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "BSD-3-Clause" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">alperen-kilic/pygmt</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">pygmt/src/__init__.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">1,300</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8706"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># -*- coding: utf-8 -*- from __future__ import print_function, division, absolute_import, unicode_literals from parser_base import RegexParser import model class RegexSemantics(object): def __init__(self): super(RegexSemantics, self).__init__() self._count = 0 def START(self, ast): return model.Regex(ast) def CHOICE(self, ast): return model.Choice(ast.opts) def SEQUENCE(self, ast): if not ast.terms: return model.Empty() elif len(ast.terms) < 2: return ast.terms[0] else: return model.Sequence(ast.terms) def CLOSURE(self, ast): return model.Closure(ast) def SUBEXP(self, ast): return ast def LITERAL(self, ast): return model.Literal(ast) def translate(regex, trace=False): parser = RegexParser(trace=trace, semantics=RegexSemantics()) model = parser.parse(regex, 'START') model.set_rule_numbers() return model.render() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">24.219512</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">82</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.637462</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "BSD-2-Clause" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">alyosha1879/grako</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">examples/regex/regex_parser.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">993</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8707"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># coding: utf-8 """ FlashArray REST API No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) OpenAPI spec version: 2.7 Generated by: https://github.com/swagger-api/swagger-codegen.git """ import pprint import re import six import typing from ....properties import Property if typing.TYPE_CHECKING: from pypureclient.flasharray.FA_2_7 import models class VolumeSnapshotGetResponse(object): """ Attributes: swagger_types (dict): The key is attribute name and the value is attribute type. attribute_map (dict): The key is attribute name and the value is json key in definition. """ swagger_types = { 'more_items_remaining': 'bool', 'total_item_count': 'int', 'continuation_token': 'str', 'items': 'list[VolumeSnapshot]', 'total': 'list[VolumeSnapshot]' } attribute_map = { 'more_items_remaining': 'more_items_remaining', 'total_item_count': 'total_item_count', 'continuation_token': 'continuation_token', 'items': 'items', 'total': 'total' } required_args = { } def __init__( self, more_items_remaining=None, # type: bool total_item_count=None, # type: int continuation_token=None, # type: str items=None, # type: List[models.VolumeSnapshot] total=None, # type: List[models.VolumeSnapshot] ): """ Keyword args: more_items_remaining (bool): Returns a value of `true` if subsequent items can be retrieved. total_item_count (int): The total number of records after applying all filter query parameters. The `total_item_count` will be calculated if and only if the corresponding query parameter `total_item_count` is set to `true`. If this query parameter is not set or set to `false`, a value of `null` will be returned. continuation_token (str): Continuation token that can be provided in the `continuation_token` query param to get the next page of data. If you use the continuation token to page through data you are guaranteed to get all items exactly once regardless of how items are modified. If an item is added or deleted during the pagination then it may or may not be returned. The continuation token is generated if the limit is less than the remaining number of items, and the default sort is used (no sort is specified). items (list[VolumeSnapshot]): Returns a list of all items after filtering. The values are displayed for each name where meaningful. If `total_only=true`, the `items` list will be empty. total (list[VolumeSnapshot]): The aggregate value of all items after filtering. Where it makes more sense, the average value is displayed instead. The values are displayed for each field where meaningful. """ if more_items_remaining is not None: self.more_items_remaining = more_items_remaining if total_item_count is not None: self.total_item_count = total_item_count if continuation_token is not None: self.continuation_token = continuation_token if items is not None: self.items = items if total is not None: self.total = total def __setattr__(self, key, value): if key not in self.attribute_map: raise KeyError("Invalid key `{}` for `VolumeSnapshotGetResponse`".format(key)) self.__dict__[key] = value def __getattribute__(self, item): value = object.__getattribute__(self, item) if isinstance(value, Property): raise AttributeError else: return value def to_dict(self): """Returns the model properties as a dict""" result = {} for attr, _ in six.iteritems(self.swagger_types): if hasattr(self, attr): value = getattr(self, attr) if isinstance(value, list): result[attr] = list(map( lambda x: x.to_dict() if hasattr(x, "to_dict") else x, value )) elif hasattr(value, "to_dict"): result[attr] = value.to_dict() elif isinstance(value, dict): result[attr] = dict(map( lambda item: (item[0], item[1].to_dict()) if hasattr(item[1], "to_dict") else item, value.items() )) else: result[attr] = value if issubclass(VolumeSnapshotGetResponse, dict): for key, value in self.items(): result[key] = value return result def to_str(self): """Returns the string representation of the model""" return pprint.pformat(self.to_dict()) def __repr__(self): """For `print` and `pprint`""" return self.to_str() def __eq__(self, other): """Returns true if both objects are equal""" if not isinstance(other, VolumeSnapshotGetResponse): return False return self.__dict__ == other.__dict__ def __ne__(self, other): """Returns true if both objects are not equal""" return not self == other </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">39.647059</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">524</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.618323</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "BSD-2-Clause" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Flav-STOR-WL/py-pure-client</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">pypureclient/flasharray/FA_2_7/models/volume_snapshot_get_response.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">5,392</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8708"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">"""A fingerprint + random forest model. Try to generate independent and identically distributed figerprint as decoy. """ import os import sys import json import argparse import numpy as np from pathlib import Path from tqdm import tqdm import scipy.sparse as sp from scipy.spatial import distance from multiprocessing import Pool from rdkit import Chem from rdkit.Chem import AllChem from rdkit import DataStructs from rdkit.Chem import Descriptors from sklearn import metrics from sklearn.ensemble import RandomForestClassifier from sklearn.ensemble import RandomForestRegressor import matplotlib matplotlib.use('Agg') import matplotlib.pyplot as plt parser = argparse.ArgumentParser(description=__doc__) parser.add_argument('-i', '--index', required=True) parser.add_argument( '-d', '--datadir', required=True, help="pdbbind datadir, like v2018") parser.add_argument( '-u', '--uclust', help="uclust output, format: https://www.drive5.com/usearch/manual/opt_uc.html") args = parser.parse_args() DATADIR = Path(args.datadir) def read_index(index_file): codes = [] pKs = [] with open(index_file) as f: for i in f: if i[0] == '#': continue code, reso, year, pK, *others = i.split() codes.append(code) pKs.append(float(pK)) return codes, pKs def getProp(mol): mw = Descriptors.ExactMolWt(mol) logp = Descriptors.MolLogP(mol) rotb = Descriptors.NumRotatableBonds(mol) hbd = Descriptors.NumHDonors(mol) hba = Descriptors.NumHAcceptors(mol) q = Chem.GetFormalCharge(mol) return tuple([mw, logp, rotb, hbd, hba, q]) def load_fps(codes): print("Loading ligand fingerprint") fps = [] for i, code in tqdm(enumerate(codes), total=len(codes)): # already converted ligand.mol2 to ligand.pdb by babel path = DATADIR / code / (code + '_ligand.pdb') if not path.exists(): fps.append(None) continue mol = Chem.MolFromPDBFile(str(path)) if mol is None: fps.append(None) continue # fp = AllChem.GetMorganFingerprintAsBitVect(mol, 2, nBits=512) fp = getProp(mol) fps.append(fp) notNone = sum([1 for i in fps if i is not None]) print('succeed loaded {}/{}'.format(notNone, len(codes))) return fps def load_clust(uclust_file, codes): clust_nums = [None for i in codes] all_clust_nums = [] labels = [] with open(uclust_file) as f: for line in f: fields = line.split() all_clust_nums.append( int(fields[1])) labels.append(fields[8]) for i, code in enumerate(codes): try: idx = labels.index(code) clust_nums[i] = all_clust_nums[idx] except ValueError: continue return clust_nums codes, pKs = read_index(args.index) fps = load_fps(codes) Nones = [i for i in range(len(codes)) if fps[i] is None] fps = [j for i,j in enumerate(fps) if i not in Nones] pKs = [j for i,j in enumerate(pKs) if i not in Nones] codes = [j for i,j in enumerate(codes) if i not in Nones] X = np.array(fps) if args.uclust: clust_nums = load_clust(args.uclust, codes) Nones.extend([i for i in range(len(codes)) if clust_nums[i] is None]) Nones = set(Nones) fps = [j for i,j in enumerate(fps) if i not in Nones] pKs = [j for i,j in enumerate(pKs) if i not in Nones] codes = [j for i,j in enumerate(codes) if i not in Nones] clust_nums = [j for i,j in enumerate(clust_nums) if i not in Nones] clust_nums = np.array(clust_nums, dtype=int) join_clust = np.zeros_like(clust_nums) for i, num in enumerate(set(clust_nums)): mask = clust_nums == num # all cluster smaller than 5 will set as cluster 0 if sum(mask) >= 10: join_clust[mask] = i+1 nb_clust = max(join_clust) + 1 print(join_clust) one_hot = np.eye(nb_clust, dtype=int)[join_clust] X = np.hstack((one_hot, fps)) X = one_hot print(X.shape) pKs = np.array(pKs) # filter None for seed in (111, 222, 333): np.random.seed(seed) N = len(codes) perm = np.random.permutation(N) train_idx = perm[:int(N*0.8)] valid_idx = perm[int(N*0.8):int(N*0.9)] test_idx = perm[int(N*0.9):] train_X = X[train_idx] test_X = X[test_idx] train_pKs = pKs[train_idx] test_pKs = pKs[test_idx] clf = RandomForestRegressor( n_estimators=10, max_depth=15, # min_samples_split=10, min_samples_split=5, min_samples_leaf=1, random_state=0, n_jobs=8, ) clf.fit(train_X, train_pKs) pred_pKs = clf.predict(test_X) r2 = np.corrcoef(test_pKs, pred_pKs)[0,1] ** 2 print('seed {} r2: {}'.format(seed, r2)) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">30.754839</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">106</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.646528</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">hnlab/can-ai-do</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">pdbbind/props_random_forest.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">4,767</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8709"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from datanator_query_python.util import mongo_util from pymongo.collation import Collation, CollationStrength class QueryXmdb: def __init__(self, username=None, password=None, server=None, authSource='admin', database='datanator', max_entries=float('inf'), verbose=True, collection_str='ecmdb', readPreference='nearest', replicaSet=None): self.mongo_manager = mongo_util.MongoUtil(MongoDB=server, username=username, password=password, authSource=authSource, db=database, readPreference=readPreference, replicaSet=replicaSet) self.collation = Collation(locale='en', strength=CollationStrength.SECONDARY) self.max_entries = max_entries self.verbose = verbose self.client, self.db, self.collection = self.mongo_manager.con_db(collection_str) self.collection_str = collection_str def get_all_concentrations(self, projection={'_id': 0, 'inchi': 1, 'inchikey': 1, 'smiles': 1, 'name': 1}): """Get all entries that have concentration values Args: projection (dict, optional): mongodb query projection. Defaults to {'_id': 0, 'inchi': 1,'inchikey': 1, 'smiles': 1, 'name': 1}. Returns: (list): all results that meet the constraint. """ result = [] query = {'concentrations': {'$ne': None} } docs = self.collection.find(filter=query, projection=projection) for doc in docs: result.append(doc) return result def get_name_by_inchikey(self, inchikey): """Get metabolite's name by its inchikey Args: inchikey (:obj:`str`): inchi key of metabolite Return: (:obj:`str`): name of metabolite """ query = {'inchikey': inchikey} projection = {'_id': 0, 'name': 1} doc = self.collection.find_one(filter=query, projection=projection, collation=self.collation) if doc is None: return 'No metabolite found.' else: return doc['name'] def get_standard_ids_by_id(self, _id): """Get chebi_id, pubmed_id, and kegg_id from database specific id. Args: _id (:obj:`str`): Database specific ID. Return: (:obj:`dict`): Dictionary containing the information. """ if self.collection_str == 'ecmdb': db_id = 'm2m_id' else: db_id = 'ymdb_id' query = {db_id: _id} # projection = {'hmdb_id': 1, 'chebi_id': 1, 'kegg_id': 1, '_id': 0} doc = self.collection.find_one(filter=query) if doc is None: return {} else: return doc</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">38.780822</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">140</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.579301</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">KarrLab/datanator_query_python</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">datanator_query_python/query/query_xmdb.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">2,831</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8710"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># Copyright (c) Facebook, Inc. and its affiliates. import copy import logging import numpy as np from typing import List, Optional, Union import torch from detectron2.config import configurable from . import detection_utils as utils from . import transforms as T """ This file contains the default mapping that's applied to "dataset dicts". """ __all__ = ["DatasetMapper"] class DatasetMapper: """ A callable which takes a dataset dict in Detectron2 Dataset format, and map it into a format used by the model. This is the default callable to be used to map your dataset dict into training data. You may need to follow it to implement your own one for customized logic, such as a different way to read or transform images. See :doc:`/tutorials/data_loading` for details. The callable currently does the following: 1. Read the image from "file_name" 2. Applies cropping/geometric transforms to the image and annotations 3. Prepare data and annotations to Tensor and :class:`Instances` """ @configurable def __init__( self, is_train: bool, *, augmentations: List[Union[T.Augmentation, T.Transform]], image_format: str, use_instance_mask: bool = False, use_keypoint: bool = False, instance_mask_format: str = "polygon", keypoint_hflip_indices: Optional[np.ndarray] = None, precomputed_proposal_topk: Optional[int] = None, recompute_boxes: bool = False, ): """ NOTE: this interface is experimental. Args: is_train: whether it's used in training or inference augmentations: a list of augmentations or deterministic transforms to apply image_format: an image format supported by :func:`detection_utils.read_image`. use_instance_mask: whether to process instance segmentation annotations, if available use_keypoint: whether to process keypoint annotations if available instance_mask_format: one of "polygon" or "bitmask". Process instance segmentation masks into this format. keypoint_hflip_indices: see :func:`detection_utils.create_keypoint_hflip_indices` precomputed_proposal_topk: if given, will load pre-computed proposals from dataset_dict and keep the top k proposals for each image. recompute_boxes: whether to overwrite bounding box annotations by computing tight bounding boxes from instance mask annotations. """ if recompute_boxes: assert use_instance_mask, "recompute_boxes requires instance masks" # fmt: off self.is_train = is_train self.augmentations = T.AugmentationList(augmentations) self.image_format = image_format self.use_instance_mask = use_instance_mask self.instance_mask_format = instance_mask_format self.use_keypoint = use_keypoint self.keypoint_hflip_indices = keypoint_hflip_indices self.proposal_topk = precomputed_proposal_topk self.recompute_boxes = recompute_boxes # fmt: on logger = logging.getLogger(__name__) mode = "training" if is_train else "inference" logger.info(f"[DatasetMapper] Augmentations used in {mode}: {augmentations}") @classmethod def from_config(cls, cfg, is_train: bool = True): augs = utils.build_augmentation(cfg, is_train) if cfg.INPUT.CROP.ENABLED and is_train: augs.insert(0, T.RandomCrop(cfg.INPUT.CROP.TYPE, cfg.INPUT.CROP.SIZE)) recompute_boxes = cfg.MODEL.MASK_ON else: recompute_boxes = False ret = { "is_train": is_train, "augmentations": augs, "image_format": cfg.INPUT.FORMAT, "use_instance_mask": cfg.MODEL.MASK_ON, "instance_mask_format": cfg.INPUT.MASK_FORMAT, "use_keypoint": cfg.MODEL.KEYPOINT_ON, "recompute_boxes": recompute_boxes, } if cfg.MODEL.KEYPOINT_ON: ret["keypoint_hflip_indices"] = utils.create_keypoint_hflip_indices(cfg.DATASETS.TRAIN) if cfg.MODEL.LOAD_PROPOSALS: ret["precomputed_proposal_topk"] = ( cfg.DATASETS.PRECOMPUTED_PROPOSAL_TOPK_TRAIN if is_train else cfg.DATASETS.PRECOMPUTED_PROPOSAL_TOPK_TEST ) return ret def __call__(self, dataset_dict): """ Args: dataset_dict (dict): Metadata of one image, in Detectron2 Dataset format. Returns: dict: a format that builtin models in detectron2 accept """ dataset_dict = copy.deepcopy(dataset_dict) # it will be modified by code below # USER: Write your own image loading if it's not from a file image = utils.read_image(dataset_dict["file_name"], format=self.image_format) utils.check_image_size(dataset_dict, image) # USER: Remove if you don't do semantic/panoptic segmentation. if "sem_seg_file_name" in dataset_dict: sem_seg_gt = utils.read_image(dataset_dict.pop("sem_seg_file_name"), "L").squeeze(2) else: sem_seg_gt = None aug_input = T.AugInput(image, sem_seg=sem_seg_gt) transforms = self.augmentations(aug_input) image, sem_seg_gt = aug_input.image, aug_input.sem_seg image_shape = image.shape[:2] # h, w # Pytorch's dataloader is efficient on torch.Tensor due to shared-memory, # but not efficient on large generic data structures due to the use of pickle & mp.Queue. # Therefore it's important to use torch.Tensor. dataset_dict["image"] = torch.as_tensor(np.ascontiguousarray(image.transpose(2, 0, 1))) if sem_seg_gt is not None: dataset_dict["sem_seg"] = torch.as_tensor(sem_seg_gt.astype("long")) # USER: Remove if you don't use pre-computed proposals. # Most users would not need this feature. if self.proposal_topk is not None: utils.transform_proposals( dataset_dict, image_shape, transforms, proposal_topk=self.proposal_topk ) if not self.is_train: # USER: Modify this if you want to keep them for some reason. # dataset_dict.pop("annotations", None) dataset_dict.pop("sem_seg_file_name", None) return dataset_dict if "annotations" in dataset_dict: # USER: Modify this if you want to keep them for some reason. for anno in dataset_dict["annotations"]: if not self.use_instance_mask: anno.pop("segmentation", None) if not self.use_keypoint: anno.pop("keypoints", None) # USER: Implement additional transformations if you have other types of data annos = [ utils.transform_instance_annotations( obj, transforms, image_shape, keypoint_hflip_indices=self.keypoint_hflip_indices ) for obj in dataset_dict.pop("annotations") if obj.get("iscrowd", 0) == 0 ] instances = utils.annotations_to_instances( annos, image_shape, mask_format=self.instance_mask_format ) # After transforms such as cropping are applied, the bounding box may no longer # tightly bound the object. As an example, imagine a triangle object # [(0,0), (2,0), (0,2)] cropped by a box [(1,0),(2,2)] (XYXY format). The tight # bounding box of the cropped triangle should be [(1,0),(2,1)], which is not equal to # the intersection of original bounding box and the cropping box. if self.recompute_boxes: instances.gt_boxes = instances.gt_masks.get_bounding_boxes() dataset_dict["instances"] = utils.filter_empty_instances(instances) return dataset_dict </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">43.154255</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">100</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.644768</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Jerrypiglet/detectron2</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">detectron2/data/dataset_mapper.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">8,113</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8711"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from bs4 import BeautifulSoup from urllib.request import urlopen def main(): url = "http://www.networksciencelab.com" with urlopen(url) as doc: soup = BeautifulSoup(doc) links = [(link.string, link['href']) for link in soup.find_all('a') if link.has_attr('href') ] # print(links) broken_links = [] for _, link in links: try: urlopen(link, timeout=3) except Exception as e: print(f'broken link {link}, {e}') broken_links.append(link) print(broken_links) if __name__ == "__main__": main()</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">24.08</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">45</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.58804</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">zzragida/study-datascience</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">data-science-essentials-in-python/broken-link-detector.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">602</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8712"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">#!/usr/bin/env python3.8 # Copyright 2018 The Fuchsia Authors. All rights reserved. # Use of this source code is governed by a BSD-style license that can be # found in the LICENSE file. import argparse import contextlib import errno import json import os import shutil import sys import tarfile import tempfile from functools import total_ordering @total_ordering class Part(object): def __init__(self, json): self.meta = json['meta'] self.type = json['type'] def __lt__(self, other): return self.meta < other.meta and self.type < other.type def __eq__(self, other): return ( isinstance(other, self.__class__) and self.meta == other.meta and self.type == other.type) def __ne__(self, other): return not self.__eq__(other) def __hash__(self): return hash((self.meta, self.type)) @contextlib.contextmanager def _open_archive(archive, directory): '''Manages a directory in which an existing SDK is laid out.''' if directory: yield directory elif archive: temp_dir = tempfile.mkdtemp(prefix='fuchsia-merger') # Extract the tarball into the temporary directory. # This is vastly more efficient than accessing files one by one via # the tarfile API. with tarfile.open(archive) as archive_file: archive_file.extractall(temp_dir) try: yield temp_dir finally: shutil.rmtree(temp_dir, ignore_errors=True) else: raise Exception('Error: archive or directory must be set') @contextlib.contextmanager def _open_output(archive, directory): '''Manages the output of this script.''' if directory: # Remove any existing output. shutil.rmtree(directory, ignore_errors=True) yield directory elif archive: temp_dir = tempfile.mkdtemp(prefix='fuchsia-merger') try: yield temp_dir # Write the archive file. with tarfile.open(archive, "w:gz") as archive_file: archive_file.add(temp_dir, arcname='') finally: shutil.rmtree(temp_dir, ignore_errors=True) else: raise Exception('Error: archive or directory must be set') def _get_manifest(sdk_dir): '''Returns the set of elements in the given SDK.''' with open(os.path.join(sdk_dir, 'meta', 'manifest.json'), 'r') as manifest: return json.load(manifest) def _get_meta(element, sdk_dir): '''Returns the contents of the given element's manifest in a given SDK.''' with open(os.path.join(sdk_dir, element), 'r') as meta: return json.load(meta) def _get_type(element): '''Returns the SDK element type.''' # For versioned SDK elements, the type is inside the data field. if 'schema_id' in element: return element['data']['type'] return element['type'] def _get_files(element_meta): '''Extracts the files associated with the given element. Returns a 2-tuple containing: - the set of arch-independent files; - the sets of arch-dependent files, indexed by architecture. ''' type = _get_type(element_meta) common_files = set() arch_files = {} if type == 'cc_prebuilt_library': common_files.update(element_meta['headers']) for arch, binaries in element_meta['binaries'].items(): contents = set() contents.add(binaries['link']) if 'dist' in binaries: contents.add(binaries['dist']) if 'debug' in binaries: contents.add(binaries['debug']) arch_files[arch] = contents elif type == 'cc_source_library': common_files.update(element_meta['headers']) common_files.update(element_meta['sources']) elif type == 'dart_library': common_files.update(element_meta['sources']) elif type == 'fidl_library': common_files.update(element_meta['sources']) elif type in ['host_tool', 'companion_host_tool']: if 'files' in element_meta: common_files.update(element_meta['files']) if 'target_files' in element_meta: arch_files.update(element_meta['target_files']) elif type == 'loadable_module': common_files.update(element_meta['resources']) arch_files.update(element_meta['binaries']) elif type == 'sysroot': for arch, version in element_meta['versions'].items(): contents = set() contents.update(version['headers']) contents.update(version['link_libs']) contents.update(version['dist_libs']) contents.update(version['debug_libs']) arch_files[arch] = contents elif type == 'documentation': common_files.update(element_meta['docs']) elif type in ('config', 'license', 'component_manifest'): common_files.update(element_meta['data']) elif type in ('version_history'): # These types are pure metadata. pass elif type == 'bind_library': common_files.update(element_meta['sources']) else: raise Exception('Unknown element type: ' + type) return (common_files, arch_files) def _ensure_directory(path): '''Ensures that the directory hierarchy of the given path exists.''' target_dir = os.path.dirname(path) try: os.makedirs(target_dir) except OSError as exception: if exception.errno == errno.EEXIST and os.path.isdir(target_dir): pass else: raise def _copy_file(file, source_dir, dest_dir): '''Copies a file to a given path, taking care of creating directories if needed. ''' source = os.path.join(source_dir, file) destination = os.path.join(dest_dir, file) _ensure_directory(destination) shutil.copy2(source, destination) def _copy_files(files, source_dir, dest_dir): '''Copies a set of files to a given directory.''' for file in files: _copy_file(file, source_dir, dest_dir) def _copy_identical_files( set_one, source_dir_one, set_two, source_dir_two, dest_dir): '''Verifies that two sets of files are absolutely identical and then copies them to the output directory. ''' if set_one != set_two: return False # Not verifying that the contents of the files are the same, as builds are # not exactly stable at the moment. _copy_files(set_one, source_dir_one, dest_dir) return True def _copy_element(element, source_dir, dest_dir): '''Copy an entire SDK element to a given directory.''' meta = _get_meta(element, source_dir) common_files, arch_files = _get_files(meta) files = common_files for more_files in arch_files.values(): files.update(more_files) _copy_files(files, source_dir, dest_dir) # Copy the metadata file as well. _copy_file(element, source_dir, dest_dir) def _write_meta(element, source_dir_one, source_dir_two, dest_dir): '''Writes a meta file for the given element, resulting from the merge of the meta files for that element in the two given SDK directories. ''' meta_one = _get_meta(element, source_dir_one) meta_two = _get_meta(element, source_dir_two) # TODO(fxbug.dev/5362): verify that the common parts of the metadata files are in # fact identical. type = _get_type(meta_one) meta = {} if type in ('cc_prebuilt_library', 'loadable_module'): meta = meta_one meta['binaries'].update(meta_two['binaries']) elif type == 'sysroot': meta = meta_one meta['versions'].update(meta_two['versions']) elif type in ['host_tool', 'companion_host_tool']: meta = meta_one if not 'target_files' in meta: meta['target_files'] = {} if 'target_files' in meta_two: meta['target_files'].update(meta_two['target_files']) elif type in ('cc_source_library', 'dart_library', 'fidl_library', 'documentation', 'device_profile', 'config', 'license', 'component_manifest', 'bind_library', 'version_history'): # These elements are arch-independent, the metadata does not need any # update. meta = meta_one else: raise Exception('Unknown element type: ' + type) meta_path = os.path.join(dest_dir, element) _ensure_directory(meta_path) with open(meta_path, 'w') as meta_file: json.dump( meta, meta_file, indent=2, sort_keys=True, separators=(',', ': ')) return True def _has_host_content(parts): '''Returns true if the given list of SDK parts contains an element with content built for a host. ''' return 'host_tool' in [part.type for part in parts] def _write_manifest(source_dir_one, source_dir_two, dest_dir): '''Writes a manifest file resulting from the merge of the manifest files for the two given SDK directories. ''' manifest_one = _get_manifest(source_dir_one) manifest_two = _get_manifest(source_dir_two) parts_one = set([Part(p) for p in manifest_one['parts']]) parts_two = set([Part(p) for p in manifest_two['parts']]) manifest = {'arch': {}} # Schema version. if manifest_one['schema_version'] != manifest_two['schema_version']: print('Error: mismatching schema version') return False manifest['schema_version'] = manifest_one['schema_version'] # Host architecture. host_archs = set() if _has_host_content(parts_one): host_archs.add(manifest_one['arch']['host']) if _has_host_content(parts_two): host_archs.add(manifest_two['arch']['host']) if not host_archs: # The archives do not have any host content. The architecture is not # meaningful in that case but is still needed: just pick one. host_archs.add(manifest_one['arch']['host']) if len(host_archs) != 1: print( 'Error: mismatching host architecture: %s' % ', '.join(host_archs)) return False manifest['arch']['host'] = list(host_archs)[0] # Id. if manifest_one['id'] != manifest_two['id']: print('Error: mismatching id') return False manifest['id'] = manifest_one['id'] # Root. if manifest_one['root'] != manifest_two['root']: print('Error: mismatching root') return False manifest['root'] = manifest_one['root'] # Target architectures. manifest['arch']['target'] = sorted( set(manifest_one['arch']['target']) | set(manifest_two['arch']['target'])) # Parts. manifest['parts'] = [vars(p) for p in sorted(parts_one | parts_two)] manifest_path = os.path.join(dest_dir, 'meta', 'manifest.json') _ensure_directory(manifest_path) with open(manifest_path, 'w') as manifest_file: json.dump( manifest, manifest_file, indent=2, sort_keys=True, separators=(',', ': ')) return True def main(): parser = argparse.ArgumentParser( description=('Merges the contents of two SDKs')) first_group = parser.add_mutually_exclusive_group(required=True) first_group.add_argument( '--first-archive', help='Path to the first SDK - as an archive', default='') first_group.add_argument( '--first-directory', help='Path to the first SDK - as a directory', default='') second_group = parser.add_mutually_exclusive_group(required=True) second_group.add_argument( '--second-archive', help='Path to the second SDK - as an archive', default='') second_group.add_argument( '--second-directory', help='Path to the second SDK - as a directory', default='') output_group = parser.add_mutually_exclusive_group(required=True) output_group.add_argument( '--output-archive', help='Path to the merged SDK - as an archive', default='') output_group.add_argument( '--output-directory', help='Path to the merged SDK - as a directory', default='') args = parser.parse_args() has_errors = False with _open_archive(args.first_archive, args.first_directory) as first_dir, \ _open_archive(args.second_archive, args.second_directory) as second_dir, \ _open_output(args.output_archive, args.output_directory) as out_dir: first_elements = set( [Part(p) for p in _get_manifest(first_dir)['parts']]) second_elements = set( [Part(p) for p in _get_manifest(second_dir)['parts']]) common_elements = first_elements & second_elements # Copy elements that appear in a single SDK. for element in sorted(first_elements - common_elements): _copy_element(element.meta, first_dir, out_dir) for element in (second_elements - common_elements): _copy_element(element.meta, second_dir, out_dir) # Verify and merge elements which are common to both SDKs. for raw_element in sorted(common_elements): element = raw_element.meta first_meta = _get_meta(element, first_dir) second_meta = _get_meta(element, second_dir) first_common, first_arch = _get_files(first_meta) second_common, second_arch = _get_files(second_meta) # Common files should not vary. if not _copy_identical_files(first_common, first_dir, second_common, second_dir, out_dir): print('Error: different common files for %s' % (element)) has_errors = True continue # Arch-dependent files need to be merged in the metadata. all_arches = set(first_arch.keys()) | set(second_arch.keys()) for arch in all_arches: if arch in first_arch and arch in second_arch: if not _copy_identical_files(first_arch[arch], first_dir, second_arch[arch], second_dir, out_dir): print( 'Error: different %s files for %s' % (arch, element)) has_errors = True continue elif arch in first_arch: _copy_files(first_arch[arch], first_dir, out_dir) elif arch in second_arch: _copy_files(second_arch[arch], second_dir, out_dir) if not _write_meta(element, first_dir, second_dir, out_dir): print('Error: unable to merge meta for %s' % (element)) has_errors = True if not _write_manifest(first_dir, second_dir, out_dir): print('Error: could not write manifest file') has_errors = True # TODO(fxbug.dev/5362): verify that metadata files are valid. return 1 if has_errors else 0 if __name__ == '__main__': sys.exit(main()) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">36.091127</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">85</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.634485</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "BSD-2-Clause" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">allansrc/fuchsia</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">scripts/sdk/merger/merge.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">15,050</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8713"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">def sort(arr): for i in range(1, len(arr)): key = arr[i] j = i-1 while j >=0 and key < arr[j] : arr[j+1] = arr[j] j -= 1 arr[j+1] = key return arr arr = list(map(int,input("Enter Numbers: ").split())) print(sort(arr)) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">24.5</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">53</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.442177</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Aashutosh-922/Data-Structures-And-Algorithms</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">sorting/python/insertion-sort.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">294</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8714"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import boto from boto.dynamodb2.fields import HashKey from boto.dynamodb2.table import Table conn = boto.dynamodb.connect_to_region('us-west-2') connection=boto.dynamodb2.connect_to_region('us-west-2') users = Table.create('users', schema=[ HashKey('username'), # defaults to STRING data_type ], throughput={ 'read': 5, 'write': 15, }, ) consumerTable.put_item({"username":"user"}) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">28.571429</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">56</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.72</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">samvarankashyap/amazondynamodb</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">samplescripts/create_table.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">400</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8715"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">""" Airflow API (Stable) # Overview To facilitate management, Apache Airflow supports a range of REST API endpoints across its objects. This section provides an overview of the API design, methods, and supported use cases. Most of the endpoints accept `JSON` as input and return `JSON` responses. This means that you must usually add the following headers to your request: ``` Content-type: application/json Accept: application/json ``` ## Resources The term `resource` refers to a single type of object in the Airflow metadata. An API is broken up by its endpoint's corresponding resource. The name of a resource is typically plural and expressed in camelCase. Example: `dagRuns`. Resource names are used as part of endpoint URLs, as well as in API parameters and responses. ## CRUD Operations The platform supports **C**reate, **R**ead, **U**pdate, and **D**elete operations on most resources. You can review the standards for these operations and their standard parameters below. Some endpoints have special behavior as exceptions. ### Create To create a resource, you typically submit an HTTP `POST` request with the resource's required metadata in the request body. The response returns a `201 Created` response code upon success with the resource's metadata, including its internal `id`, in the response body. ### Read The HTTP `GET` request can be used to read a resource or to list a number of resources. A resource's `id` can be submitted in the request parameters to read a specific resource. The response usually returns a `200 OK` response code upon success, with the resource's metadata in the response body. If a `GET` request does not include a specific resource `id`, it is treated as a list request. The response usually returns a `200 OK` response code upon success, with an object containing a list of resources' metadata in the response body. When reading resources, some common query parameters are usually available. e.g.: ``` v1/connections?limit=25&offset=25 ``` |Query Parameter|Type|Description| |---------------|----|-----------| |limit|integer|Maximum number of objects to fetch. Usually 25 by default| |offset|integer|Offset after which to start returning objects. For use with limit query parameter.| ### Update Updating a resource requires the resource `id`, and is typically done using an HTTP `PATCH` request, with the fields to modify in the request body. The response usually returns a `200 OK` response code upon success, with information about the modified resource in the response body. ### Delete Deleting a resource requires the resource `id` and is typically executing via an HTTP `DELETE` request. The response usually returns a `204 No Content` response code upon success. ## Conventions - Resource names are plural and expressed in camelCase. - Names are consistent between URL parameter name and field name. - Field names are in snake_case. ```json { \"name\": \"string\", \"slots\": 0, \"occupied_slots\": 0, \"used_slots\": 0, \"queued_slots\": 0, \"open_slots\": 0 } ``` ### Update Mask Update mask is available as a query parameter in patch endpoints. It is used to notify the API which fields you want to update. Using `update_mask` makes it easier to update objects by helping the server know which fields to update in an object instead of updating all fields. The update request ignores any fields that aren't specified in the field mask, leaving them with their current values. Example: ``` resource = request.get('/resource/my-id').json() resource['my_field'] = 'new-value' request.patch('/resource/my-id?update_mask=my_field', data=json.dumps(resource)) ``` ## Versioning and Endpoint Lifecycle - API versioning is not synchronized to specific releases of the Apache Airflow. - APIs are designed to be backward compatible. - Any changes to the API will first go through a deprecation phase. # Summary of Changes | Airflow version | Description | |-|-| | v2.0 | Initial release | | v2.0.2 | Added /plugins endpoint | | v2.1 | New providers endpoint | # Trying the API You can use a third party airflow_client.client, such as [curl](https://curl.haxx.se/), [HTTPie](https://httpie.org/), [Postman](https://www.postman.com/) or [the Insomnia rest airflow_client.client](https://insomnia.rest/) to test the Apache Airflow API. Note that you will need to pass credentials data. For e.g., here is how to pause a DAG with [curl](https://curl.haxx.se/), when basic authorization is used: ```bash curl -X PATCH 'https://example.com/api/v1/dags/{dag_id}?update_mask=is_paused' \\ -H 'Content-Type: application/json' \\ --user \"username:password\" \\ -d '{ \"is_paused\": true }' ``` Using a graphical tool such as [Postman](https://www.postman.com/) or [Insomnia](https://insomnia.rest/), it is possible to import the API specifications directly: 1. Download the API specification by clicking the **Download** button at top of this document 2. Import the JSON specification in the graphical tool of your choice. - In *Postman*, you can click the **import** button at the top - With *Insomnia*, you can just drag-and-drop the file on the UI Note that with *Postman*, you can also generate code snippets by selecting a request and clicking on the **Code** button. ## Enabling CORS [Cross-origin resource sharing (CORS)](https://developer.mozilla.org/en-US/docs/Web/HTTP/CORS) is a browser security feature that restricts HTTP requests that are initiated from scripts running in the browser. For details on enabling/configuring CORS, see [Enabling CORS](https://airflow.apache.org/docs/apache-airflow/stable/security/api.html). # Authentication To be able to meet the requirements of many organizations, Airflow supports many authentication methods, and it is even possible to add your own method. If you want to check which auth backend is currently set, you can use `airflow config get-value api auth_backend` command as in the example below. ```bash $ airflow config get-value api auth_backend airflow.api.auth.backend.basic_auth ``` The default is to deny all requests. For details on configuring the authentication, see [API Authorization](https://airflow.apache.org/docs/apache-airflow/stable/security/api.html). # Errors We follow the error response format proposed in [RFC 7807](https://tools.ietf.org/html/rfc7807) also known as Problem Details for HTTP APIs. As with our normal API responses, your airflow_client.client must be prepared to gracefully handle additional members of the response. ## Unauthenticated This indicates that the request has not been applied because it lacks valid authentication credentials for the target resource. Please check that you have valid credentials. ## PermissionDenied This response means that the server understood the request but refuses to authorize it because it lacks sufficient rights to the resource. It happens when you do not have the necessary permission to execute the action you performed. You need to get the appropriate permissions in other to resolve this error. ## BadRequest This response means that the server cannot or will not process the request due to something that is perceived to be a airflow_client.client error (e.g., malformed request syntax, invalid request message framing, or deceptive request routing). To resolve this, please ensure that your syntax is correct. ## NotFound This airflow_client.client error response indicates that the server cannot find the requested resource. ## MethodNotAllowed Indicates that the request method is known by the server but is not supported by the target resource. ## NotAcceptable The target resource does not have a current representation that would be acceptable to the user agent, according to the proactive negotiation header fields received in the request, and the server is unwilling to supply a default representation. ## AlreadyExists The request could not be completed due to a conflict with the current state of the target resource, e.g. the resource it tries to create already exists. ## Unknown This means that the server encountered an unexpected condition that prevented it from fulfilling the request. # noqa: E501 The version of the OpenAPI document: 1.0.0 Contact: <a href="/cdn-cgi/l/email-protection" class="__cf_email__" data-cfemail="c1a5a4b781a0a8b3a7adaeb6efa0b1a0a2a9a4efaeb3a6">[email protected]</a> Generated by: https://openapi-generator.tech """ import sys import unittest import airflow_client.client from airflow_client.client.model.dag import DAG globals()['DAG'] = DAG from airflow_client.client.model.dag_collection_all_of import DAGCollectionAllOf class TestDAGCollectionAllOf(unittest.TestCase): """DAGCollectionAllOf unit test stubs""" def setUp(self): pass def tearDown(self): pass def testDAGCollectionAllOf(self): """Test DAGCollectionAllOf""" # FIXME: construct object with mandatory attributes with example values # model = DAGCollectionAllOf() # noqa: E501 pass if __name__ == '__main__': unittest.main() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">230.589744</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">8,173</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.759813</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">sptsakcg/airflow-client-python</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">airflow_client/test/test_dag_collection_all_of.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">8,993</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8716"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">print("=="*20) print(f' Banco dev') print("=="*20) sac = float(input('Qual o valor voce quer sacar?R$ ')) total = sac ced = 50 totced = 0 while True: if total >=ced: total -= ced totced += 1 else: print(f'Total de {totced} cedulas de R${ced}') if ced == 50: ced = 20 elif ced == 20: ced = 10 elif ced == 10: ced = 1 totced = 0 if total == 0: break</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">21.304348</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">55</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.436735</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">lucasohara98/Python_CursoemVideo</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">PythonExecicios/ex071.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">490</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8717"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># -*- coding: utf-8 -*- from __future__ import division, unicode_literals from __future__ import absolute_import from uuid import uuid1 from datetime import datetime import pytest import pytz from pycoin.key.BIP32Node import BIP32Node from transactions import Transactions from transactions.services.daemonservice import BitcoinDaemonService def test_blockchainspider_init(rpcuser, rpcpassword, host, port): from spool.spoolex import BlockchainSpider blockchain_spider = BlockchainSpider( testnet=True, service='daemon', username=rpcuser, password=rpcpassword, host=host, port=port, ) assert isinstance(blockchain_spider._t, Transactions) assert blockchain_spider._t.testnet is True assert blockchain_spider._t._service._username == rpcuser assert blockchain_spider._t._service._password == rpcpassword assert blockchain_spider._t._service._host == host assert blockchain_spider._t._service._port == port assert isinstance(blockchain_spider._t._service, BitcoinDaemonService) @pytest.mark.usefixtures('init_blockchain') def test_check_script(rpconn, piece_hashes, spool_regtest, transactions): """ Test :staticmethod:`check_script`. Args; alice (str): bitcoin address of alice, the sender bob (str): bitcoin address of bob, the receiver rpconn (AuthServiceProxy): JSON-RPC connection (:class:`AuthServiceProxy` instance) to bitcoin regtest transactions (Transactions): :class:`Transactions` instance to communicate to the bitcoin regtest node """ from spool import Spool from spool.spoolex import BlockchainSpider sender_password = uuid1().hex.encode('utf-8') sender_wallet = BIP32Node.from_master_secret(sender_password, netcode='XTN') sender_address = sender_wallet.bitcoin_address() rpconn.importaddress(sender_address) rpconn.sendtoaddress(sender_address, Spool.FEE/100000000) rpconn.sendtoaddress(sender_address, Spool.TOKEN/100000000) rpconn.sendtoaddress(sender_address, Spool.TOKEN/100000000) rpconn.sendtoaddress(sender_address, Spool.TOKEN/100000000) rpconn.generate(1) receiver_address = rpconn.getnewaddress() # TODO do not rely on Spool txid = spool_regtest.transfer( ('', sender_address), receiver_address, piece_hashes, sender_password, 5, min_confirmations=1, ) verb = BlockchainSpider.check_script(transactions.get(txid)['vouts']) assert verb == b'ASCRIBESPOOL01TRANSFER5' @pytest.mark.usefixtures('init_blockchain') def test_check_script_with_invalid_tx(eve, wendy, rpconn, transactions): """ An invalid transaction in this context is one that does not contain a ``vout`` for which the ``hex`` is a valid ``Spool`` verb. Args; eve (str): bitcoin address of eve, the sender wendy (str): bitcoin address of wendy, the receiver rpconn (AuthServiceProxy): JSON-RPC connection (:class:`AuthServiceProxy` instance) a local bitcoin regtest transactions (Transactions): :class:`Transactions` instance to communicate to the bitcoin regtest node """ from spool.spoolex import BlockchainSpider rpconn.sendtoaddress(eve, 2) rpconn.generate(1) txid = rpconn.sendfrom('eve', wendy, 1) decoded_raw_transfer_tx = transactions.get(txid) with pytest.raises(Exception) as exc: BlockchainSpider.check_script(decoded_raw_transfer_tx['vouts']) assert exc.value.args[0] == 'Invalid ascribe transaction' @pytest.mark.usefixtures('init_blockchain') def test_get_addresses(rpconn, piece_hashes, spool_regtest, transactions): from spool import Spool from spool.spoolex import BlockchainSpider sender_password = uuid1().hex.encode('utf-8') sender_wallet = BIP32Node.from_master_secret(sender_password, netcode='XTN') sender_address = sender_wallet.bitcoin_address() rpconn.importaddress(sender_address) rpconn.sendtoaddress(sender_address, Spool.FEE/100000000) rpconn.sendtoaddress(sender_address, Spool.TOKEN/100000000) rpconn.sendtoaddress(sender_address, Spool.TOKEN/100000000) rpconn.sendtoaddress(sender_address, Spool.TOKEN/100000000) rpconn.generate(1) receiver_address = rpconn.getnewaddress() # TODO do not rely on Spool txid = spool_regtest.transfer( ('', sender_address), receiver_address, piece_hashes, sender_password, 5, min_confirmations=1, ) decoded_raw_transfer_tx = transactions.get(txid) addresses = BlockchainSpider._get_addresses(decoded_raw_transfer_tx) assert len(addresses) == 3 assert addresses[0] == sender_address assert addresses[1] == receiver_address assert addresses[2] == piece_hashes[0] @pytest.mark.usefixtures('init_blockchain') def test_get_addresses_with_invalid_tx(eve, wendy, rpconn, transactions): """ An invalid transaction in this context is one that has inputs from different addresses. Args; eve (str): bitcoin address of eve, the sender wendy (str): bitcoin address of wendy, the receiver rpconn (AuthServiceProxy): JSON-RPC connection (:class:`AuthServiceProxy` instance) a local bitcoin regtest transactions (Transactions): :class:`Transactions` instance to communicate to the bitcoin regtest node """ from spool.spoolex import BlockchainSpider, InvalidTransactionError rpconn.sendtoaddress(eve, 1) rpconn.sendtoaddress(eve, 1) rpconn.generate(1) txid = rpconn.sendfrom('eve', wendy, 2) decoded_raw_transfer_tx = transactions.get(txid) with pytest.raises(InvalidTransactionError) as exc: BlockchainSpider._get_addresses(decoded_raw_transfer_tx) assert isinstance(exc.value, InvalidTransactionError) def test_decode_op_return(): from spool.spoolex import BlockchainSpider op_return_hex = '6a174153435249424553504f4f4c30315452414e5346455235' op_return = BlockchainSpider.decode_op_return(op_return_hex) assert op_return == b'ASCRIBESPOOL01TRANSFER5' def test_get_time_utc(): from spool.spoolex import BlockchainSpider, TIME_FORMAT time = '2016-06-13T17:28:03 UTC' timestamp = BlockchainSpider._get_time_utc(time) assert timestamp assert datetime.fromtimestamp(timestamp, tz=pytz.UTC).strftime(TIME_FORMAT) == time def test_simplest_history(federation, alice, piece_hashes, spool_regtest, spider, rpconn): txid = spool_regtest.register_piece( ('', federation), alice, piece_hashes, b'federation-secret', min_confirmations=1, ) rpconn.generate(1) history = spider.history(piece_hashes[0]) assert len(history) == 1 assert '' in history assert len(history['']) == 1 piece_registration_data = history[''][0] assert piece_registration_data['action'] == 'PIECE' assert piece_registration_data['edition_number'] == '' assert piece_registration_data['from_address'] == federation assert piece_registration_data['number_editions'] == 0 assert piece_registration_data['piece_address'] == piece_hashes[0] assert piece_registration_data['timestamp_utc'] assert piece_registration_data['to_address'] == alice assert piece_registration_data['txid'] == txid assert piece_registration_data['verb'] == b'ASCRIBESPOOL01PIECE' def test_register_editions_qty_history(federation, alice, registered_piece_hashes, spool_regtest, spider, rpconn): txid = spool_regtest.editions( ('', federation), alice, registered_piece_hashes, b'federation-secret', 3, min_confirmations=1, ) rpconn.generate(1) history = spider.history(registered_piece_hashes[0]) assert len(history) == 2 assert '' in history assert 0 in history assert len(history['']) == 1 assert len(history[0]) == 1 editions_data = history[0][0] assert editions_data['action'] == 'EDITIONS' assert editions_data['edition_number'] == 0 assert editions_data['from_address'] == federation assert editions_data['number_editions'] == 3 assert editions_data['piece_address'] == registered_piece_hashes[0] assert editions_data['timestamp_utc'] assert editions_data['to_address'] == alice assert editions_data['txid'] == txid assert editions_data['verb'] == b'ASCRIBESPOOL01EDITIONS3' def test_register_edition_history(federation, alice, spool_regtest, spider, registered_edition_qty_hashes, rpconn): edition_number = 2 piece_hash = registered_edition_qty_hashes[0] txid = spool_regtest.register( ('', federation), alice, registered_edition_qty_hashes, b'federation-secret', edition_number, min_confirmations=1, ) rpconn.generate(1) history = spider.history(piece_hash) assert len(history) == 3 assert '' in history assert 0 in history assert edition_number in history assert len(history['']) == 1 assert len(history[0]) == 1 assert len(history[edition_number]) == 1 edition_registration_data = history[edition_number][0] assert edition_registration_data['action'] == 'REGISTER' assert edition_registration_data['edition_number'] == edition_number assert edition_registration_data['from_address'] == federation assert edition_registration_data['number_editions'] == 3 assert edition_registration_data['piece_address'] == piece_hash assert edition_registration_data['timestamp_utc'] assert edition_registration_data['to_address'] == alice assert edition_registration_data['txid'] == txid assert edition_registration_data['verb'] == b'ASCRIBESPOOL01REGISTER2' def test_transfer_history(federation, alice, bob, spool_regtest, spider, registered_edition_two_hashes, rpconn): from .conftest import reload_address reload_address(alice, rpconn) edition_number = 2 piece_hash = registered_edition_two_hashes[0] txid = spool_regtest.transfer( ('', alice), bob, registered_edition_two_hashes, b'alice-secret', edition_number, min_confirmations=1, ) rpconn.generate(1) history = spider.history(piece_hash) assert len(history) == 3 assert '' in history assert 0 in history assert edition_number in history assert len(history['']) == 1 assert len(history[0]) == 1 assert len(history[edition_number]) == 2 transfer_data = history[edition_number][1] assert transfer_data['action'] == 'TRANSFER' assert transfer_data['edition_number'] == edition_number assert transfer_data['from_address'] == alice assert transfer_data['number_editions'] == 3 assert transfer_data['piece_address'] == piece_hash assert transfer_data['timestamp_utc'] assert transfer_data['to_address'] == bob assert transfer_data['txid'] == txid assert transfer_data['verb'] == b'ASCRIBESPOOL01TRANSFER2' def test_loan_history(federation, bob, carol, spool_regtest, spider, transferred_edition_two_hashes, rpconn): from .conftest import reload_address edition_number = 2 loan_start, loan_end = '171017', '181018' piece_hash = transferred_edition_two_hashes[0] reload_address(bob, rpconn) txid = spool_regtest.loan( ('', bob), carol, transferred_edition_two_hashes, b'bob-secret', 2, loan_start, loan_end, min_confirmations=1, ) rpconn.generate(1) history = spider.history(piece_hash) assert len(history) == 3 assert '' in history assert 0 in history assert edition_number in history assert len(history['']) == 1 assert len(history[0]) == 1 assert len(history[edition_number]) == 3 loan_data = history[edition_number][2] assert loan_data['action'] == 'LOAN' assert loan_data['edition_number'] == edition_number assert loan_data['from_address'] == bob assert loan_data['number_editions'] == 3 assert loan_data['piece_address'] == piece_hash assert loan_data['timestamp_utc'] assert loan_data['to_address'] == carol assert loan_data['txid'] == txid assert loan_data['verb'] == b'ASCRIBESPOOL01LOAN2/171017181018' def test_chain(loaned_edition_two_hashes, spider): from spool import BlockchainSpider history = spider.history(loaned_edition_two_hashes[0]) chain = BlockchainSpider.chain(history, 2) assert len(chain) == 3 assert chain[0]['action'] == 'REGISTER' assert chain[1]['action'] == 'TRANSFER' assert chain[2]['action'] == 'LOAN' assert chain[0]['edition_number'] == 2 assert chain[1]['edition_number'] == 2 assert chain[2]['edition_number'] == 2 def test_strip_loan(loaned_edition_two_hashes, spider): from spool import BlockchainSpider history = spider.history(loaned_edition_two_hashes[0]) chain = BlockchainSpider.chain(history, 2) assert len(chain) == 3 assert 'LOAN' in (tx['action'] for tx in chain) chain = BlockchainSpider.strip_loan(chain) assert len(chain) == 2 assert 'LOAN' not in (tx['action'] for tx in chain) def test_pprint(transferred_edition_two_hashes, spider): from spool import BlockchainSpider history = spider.history(transferred_edition_two_hashes[0]) BlockchainSpider.pprint(history) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">37.608696</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">76</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.69328</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">ascribe/pyspool</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">tests/test_spoolex.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">13,840</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8718"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">#!/usr/bin/python3 import time from flask import url_for from urllib.request import urlopen from . util import set_original_response, set_modified_response, live_server_setup sleep_time_for_fetch_thread = 3 # Basic test to check inscriptus is not adding return line chars, basically works etc def test_inscriptus(): from inscriptis import get_text html_content="<html><body>test!<br/>ok man</body></html>" stripped_text_from_html = get_text(html_content) assert stripped_text_from_html == 'test!\nok man' def test_check_basic_change_detection_functionality(client, live_server): set_original_response() live_server_setup(live_server) # Add our URL to the import page res = client.post( url_for("import_page"), data={"urls": url_for('test_endpoint', _external=True)}, follow_redirects=True ) assert b"1 Imported" in res.data time.sleep(sleep_time_for_fetch_thread) # Do this a few times.. ensures we dont accidently set the status for n in range(3): client.get(url_for("api_watch_checknow"), follow_redirects=True) # Give the thread time to pick it up time.sleep(sleep_time_for_fetch_thread) # It should report nothing found (no new 'unviewed' class) res = client.get(url_for("index")) assert b'unviewed' not in res.data assert b'test-endpoint' in res.data # Default no password set, this stuff should be always available. assert b"SETTINGS" in res.data assert b"BACKUP" in res.data assert b"IMPORT" in res.data ##################### # Check HTML conversion detected and workd res = client.get( url_for("preview_page", uuid="first"), follow_redirects=True ) # Check this class does not appear (that we didnt see the actual source) assert b'foobar-detection' not in res.data # Make a change set_modified_response() res = urlopen(url_for('test_endpoint', _external=True)) assert b'which has this one new line' in res.read() # Force recheck res = client.get(url_for("api_watch_checknow"), follow_redirects=True) assert b'1 watches are queued for rechecking.' in res.data time.sleep(sleep_time_for_fetch_thread) # Now something should be ready, indicated by having a 'unviewed' class res = client.get(url_for("index")) assert b'unviewed' in res.data # #75, and it should be in the RSS feed res = client.get(url_for("rss")) expected_url = url_for('test_endpoint', _external=True) assert b'<rss' in res.data # re #16 should have the diff in here too assert b'(into ) which has this one new line' in res.data assert b'CDATA' in res.data assert expected_url.encode('utf-8') in res.data # Following the 'diff' link, it should no longer display as 'unviewed' even after we recheck it a few times res = client.get(url_for("diff_history_page", uuid="first")) assert b'Compare newest' in res.data time.sleep(2) # Do this a few times.. ensures we dont accidently set the status for n in range(2): client.get(url_for("api_watch_checknow"), follow_redirects=True) # Give the thread time to pick it up time.sleep(sleep_time_for_fetch_thread) # It should report nothing found (no new 'unviewed' class) res = client.get(url_for("index")) assert b'unviewed' not in res.data assert b'head title' not in res.data # Should not be present because this is off by default assert b'test-endpoint' in res.data set_original_response() # Enable auto pickup of <title> in settings res = client.post( url_for("settings_page"), data={"extract_title_as_title": "1", "minutes_between_check": 180, 'fetch_backend': "html_requests"}, follow_redirects=True ) client.get(url_for("api_watch_checknow"), follow_redirects=True) time.sleep(sleep_time_for_fetch_thread) res = client.get(url_for("index")) assert b'unviewed' in res.data # It should have picked up the <title> assert b'head title' in res.data # # Cleanup everything res = client.get(url_for("api_delete", uuid="all"), follow_redirects=True) assert b'Deleted' in res.data </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">33.170543</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">111</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.685441</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">shaikhspeare/changedetection.io</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">changedetectionio/tests/test_backend.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">4,279</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8719"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># -*- coding: utf-8 -*- """ kay.ext.gaema.urls :Copyright: (c) 2009 Takashi Matsuo <<a href="/cdn-cgi/l/email-protection" class="__cf_email__" data-cfemail="651108041116100a2506040b010c114b0f15">[email protected]</a>> All rights reserved. :license: BSD, see LICENSE for more details. """ from kay.routing import ( ViewGroup, Rule ) view_groups = [ ViewGroup( Rule('/login/<service>', endpoint='login', view='kay.ext.gaema.views.login'), Rule('/logout/<service>', endpoint='logout', view='kay.ext.gaema.views.logout'), Rule('/marketplace_login/a/<domain>', endpoint='marketplace_login', view='kay.ext.gaema.views.marketplace_login'), Rule('/marketplace_logout/<domain>', endpoint='marketplace_logout', view='kay.ext.gaema.views.marketplace_logout'), Rule('/select_service/<targets>', endpoint='select_service', view='kay.ext.gaema.views.select_service'), ) ] </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">28.931034</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">71</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.649583</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0", "BSD-3-Clause" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">IanLewis/kay</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">kay/ext/gaema/urls.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">839</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8720"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from django.db import models class Rice(models.Model): state_name=models.CharField("state_name",max_length=255) distict_name=models.CharField("distict_name",max_length=255) crop_year=models.IntegerField("crop_year") season=models.CharField("season",max_length=255) crop=models.CharField("crop",max_length=255) temperature=models.FloatField("temperature") precipitation=models.FloatField("precipitation") humidity=models.IntegerField("humidity") area=models.IntegerField("area") production=models.FloatField("production")</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">43.153846</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">64</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.770053</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">blitz-cmd/Rice-Crop-Yield-Prediction</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Rice_Crop_Yield_Prediction/models.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">561</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8721"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">""" Asyncio using Asyncio.Task to execute three math function in parallel """ import asyncio @asyncio.coroutine def factorial(number): f = 1 for i in range(2, number+1): print("Asyncio.Task: Compute factorial(%s)" % (i)) yield from asyncio.sleep(1) f *= i print("Asyncio.Task - factorial(%s) = %s" % (number, f)) @asyncio.coroutine def fibonacci(number): a, b = 0, 1 for i in range(number): print("Asyncio.Task: Compute fibonacci (%s)" % (i)) yield from asyncio.sleep(1) a, b = b, a + b print("Asyncio.Task - fibonacci(%s) = %s" % (number, a)) @asyncio.coroutine def binomialCoeff(n, k): result = 1 for i in range(1, k+1): result = result * (n-i+1) / i print("Asyncio.Task: Compute binomialCoeff (%s)" % (i)) yield from asyncio.sleep(1) print("Asyncio.Task - binomialCoeff(%s , %s) = %s" % (n,k,result)) if __name__ == "__main__": tasks = [asyncio.Task(factorial(10)), asyncio.Task(fibonacci(10)), asyncio.Task(binomialCoeff(20,10))] loop = asyncio.get_event_loop() loop.run_until_complete(asyncio.wait(tasks)) loop.close() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">29.45</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">70</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.60017</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">jsdnhk/python-parallel-programming-cookbook-code</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Chapter 4/asyncio_Task.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">1,178</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8722"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># Copyright 2015 Pants project contributors (see CONTRIBUTORS.md). # Licensed under the Apache License, Version 2.0 (see LICENSE). import unittest from dataclasses import dataclass from textwrap import dedent from typing import Dict from pants.engine.fs import FileContent from pants.option.config import Config, TomlSerializer @dataclass(frozen=True) class ConfigFile: content: str default_values: Dict expected_options: Dict FILE_1 = ConfigFile( content=dedent( """ [DEFAULT] name = "%(env.NAME)s" answer = 42 scale = 1.2 path = "/a/b/%(answer)s" embed = "%(path)s::%(name)s" disclaimer = ''' Let it be known that.''' [a] # TODO: once TOML releases its new version with support for heterogenous lists, we should be # able to rewrite this to `[1, 2, 3, "%(answer)s"`. See # https://github.com/toml-lang/toml/issues/665. list = ["1", "2", "3", "%(answer)s"] list2.add = [7, 8, 9] list3.remove = ["x", "y", "z"] [b] preempt = true [c] name = "overridden_from_default" interpolated_from_section = "%(name)s is interpolated" recursively_interpolated_from_section = "%(interpolated_from_section)s (again)" [d.dict_val] # Make sure we don't misinterpret `add` and `remove` as list options. add = 0 remove = 0 nested = { nested_key = 'foo' } [list_merging] list1 = [] list2 = [1, 2] list3.add = [3, 4] list4.remove = [5] list5 = [6, 7] """ ), default_values={ "name": "foo", "answer": 42, "scale": 1.2, "path": "/a/b/42", "embed": "/a/b/42::foo", "disclaimer": "Let it be known\nthat.", }, expected_options={ "a": {"list": '["1", "2", "3", "42"]', "list2": "+[7, 8, 9]", "list3": '-["x", "y", "z"]'}, "b": {"preempt": "True"}, "c": { "name": "overridden_from_default", "interpolated_from_section": "overridden_from_default is interpolated", "recursively_interpolated_from_section": "overridden_from_default is interpolated (again)", }, "d": {"dict_val": "{'add': 0, 'remove': 0, 'nested': {'nested_key': 'foo'}"}, "list_merging": { "list1": "[]", "list2": "[1, 2]", "list3": "+[3, 4]", "list4": "-[5]", "list5": "[6, 7]", }, }, ) FILE_2 = ConfigFile( content=dedent( """ [a] fast = true [b] preempt = false [d] list.add = [0, 1] list.remove = [8, 9] [empty_section] [list_merging] list1 = [11, 22] list2.add = [33] list3.add = [8, 9] list3.remove = [4, 55] list4 = [66] list6.add = [77, 88] """ ), default_values={}, expected_options={ "a": {"fast": "True"}, "b": {"preempt": "False"}, "d": {"list": "+[0, 1],-[8, 9]"}, "empty_section": {}, "list_merging": { "list1": "[11, 22]", "list2": "+[33]", "list3": "+[8, 9],-[4, 55]", "list4": "[66]", "list6": "+[77, 88]", }, }, ) def _setup_config() -> Config: parsed_config = Config.load( file_contents=[ FileContent("file1.toml", FILE_1.content.encode()), FileContent("file2.toml", FILE_2.content.encode()), ], seed_values={"buildroot": "fake_buildroot"}, env={"NAME": "foo"}, ) assert ["file1.toml", "file2.toml"] == parsed_config.sources() return parsed_config class ConfigTest(unittest.TestCase): def setUp(self) -> None: self.config = _setup_config() self.default_seed_values = Config._determine_seed_values( seed_values={"buildroot": "fake_buildroot"}, env={"NAME": "foo"}, ) self.expected_combined_values: dict[str, dict[str, list[str]]] = { "a": { "list": ['["1", "2", "3", "42"]'], "list2": ["+[7, 8, 9]"], "list3": ['-["x", "y", "z"]'], "fast": ["True"], }, "b": {"preempt": ["True", "False"]}, "c": { "name": ["overridden_from_default"], "interpolated_from_section": ["overridden_from_default is interpolated"], "recursively_interpolated_from_section": [ "overridden_from_default is interpolated (again)" ], }, "d": { "dict_val": ["{'add': 0, 'remove': 0, 'nested': {'nested_key': 'foo'}}"], "list": ["+[0, 1],-[8, 9]"], }, "empty_section": {}, "list_merging": { "list1": ["[]", "[11, 22]"], "list2": ["[1, 2]", "+[33]"], "list3": ["+[3, 4]", "+[8, 9],-[4, 55]"], "list4": ["-[5]", "[66]"], "list5": ["[6, 7]"], "list6": ["+[77, 88]"], }, } def test_default_values(self) -> None: # This is used in `options_bootstrapper.py` to ignore default values when validating options. file1_values = self.config.values[0] file2_values = self.config.values[1] # NB: string interpolation should only happen when calling _ConfigValues.get_value(). The # values for _ConfigValues.defaults are not yet interpolated. default_file1_values_unexpanded = { **FILE_1.default_values, "name": "%(env.NAME)s", "path": "/a/b/%(answer)s", "embed": "%(path)s::%(name)s", } assert file1_values.defaults == { **self.default_seed_values, **default_file1_values_unexpanded, } assert file2_values.defaults == self.default_seed_values def test_get(self) -> None: # Check the DEFAULT section # N.B.: All values read from config files are read as str and only later converted by the # options parser to the expected destination type; so we ensure we're comparing strings # here. for option, value in self.default_seed_values.items(): # Both config files have the seed values. assert self.config.get(section="DEFAULT", option=option) == [str(value), str(value)] for option, value in FILE_1.default_values.items(): # Only FILE_1 has explicit DEFAULT values. assert self.config.get(section="DEFAULT", option=option) == [str(value)] # Check the combined values. for section, section_values in self.expected_combined_values.items(): for option, value_list in section_values.items(): assert self.config.get(section=section, option=option) == value_list def test_empty(self) -> None: config = Config.load([]) assert config.sources() == [] def test_toml_serializer() -> None: original_values: Dict = { "GLOBAL": { "truthy": True, "falsy": False, "int": 0, "float": 0.0, "word": "hello there", "listy": ["a", "b", "c"], "map": {"a": 0, "b": 1}, }, "some-subsystem": {"o": ""}, } assert TomlSerializer(original_values).normalize() == { "GLOBAL": {**original_values["GLOBAL"], "map": "{'a': 0, 'b': 1}"}, "some-subsystem": {"o": ""}, } def test_toml_serializer_list_add_remove() -> None: original_values = {"GLOBAL": {"backend_packages.add": ["added"]}} assert TomlSerializer(original_values).normalize() == { # type: ignore[arg-type] "GLOBAL": {"backend_packages": "+['added']"} } </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">32.158537</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">103</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.506763</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">wonlay/pants</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">src/python/pants/option/config_test.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">7,911</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8723"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import contextlib import logging from cStringIO import StringIO from teuthology import misc from teuthology.job_status import set_status from teuthology.orchestra import run log = logging.getLogger(__name__) @contextlib.contextmanager def syslog(ctx, config): """ start syslog / stop syslog on exit. """ if ctx.archive is None: # disable this whole feature if we're not going to archive the data # anyway yield return log.info('Starting syslog monitoring...') archive_dir = misc.get_archive_dir(ctx) log_dir = '{adir}/syslog'.format(adir=archive_dir) run.wait( ctx.cluster.run( args=['mkdir', '-p', '-m0755', '--', log_dir], wait=False, ) ) CONF = '/etc/rsyslog.d/80-cephtest.conf' kern_log = '{log_dir}/kern.log'.format(log_dir=log_dir) misc_log = '{log_dir}/misc.log'.format(log_dir=log_dir) conf_lines = [ 'kern.* -{kern_log};RSYSLOG_FileFormat'.format(kern_log=kern_log), '*.*;kern.none -{misc_log};RSYSLOG_FileFormat'.format( misc_log=misc_log), ] conf_fp = StringIO('\n'.join(conf_lines)) try: for rem in ctx.cluster.remotes.iterkeys(): log_context = 'system_u:object_r:var_log_t:s0' for log_path in (kern_log, misc_log): rem.run(args='touch %s' % log_path) rem.chcon(log_path, log_context) misc.sudo_write_file( remote=rem, path=CONF, data=conf_fp, ) conf_fp.seek(0) run.wait( ctx.cluster.run( args=[ 'sudo', 'service', # a mere reload (SIGHUP) doesn't seem to make # rsyslog open the files 'rsyslog', 'restart', ], wait=False, ), ) yield finally: log.info('Shutting down syslog monitoring...') run.wait( ctx.cluster.run( args=[ 'sudo', 'rm', '-f', '--', CONF, run.Raw('&&'), 'sudo', 'service', 'rsyslog', 'restart', ], wait=False, ), ) # race condition: nothing actually says rsyslog had time to # flush the file fully. oh well. log.info('Checking logs for errors...') for rem in ctx.cluster.remotes.iterkeys(): log.debug('Checking %s', rem.name) r = rem.run( args=[ 'egrep', '--binary-files=text', '\\bBUG\\b|\\bINFO\\b|\\bDEADLOCK\\b', run.Raw('{adir}/syslog/*.log'.format(adir=archive_dir)), run.Raw('|'), 'grep', '-v', 'task .* blocked for more than .* seconds', run.Raw('|'), 'grep', '-v', 'lockdep is turned off', run.Raw('|'), 'grep', '-v', 'trying to register non-static key', run.Raw('|'), 'grep', '-v', 'DEBUG: fsize', # xfs_fsr run.Raw('|'), 'grep', '-v', 'CRON', # ignore cron noise run.Raw('|'), 'grep', '-v', 'BUG: bad unlock balance detected', # #6097 run.Raw('|'), 'grep', '-v', 'inconsistent lock state', # FIXME see #2523 run.Raw('|'), 'grep', '-v', '*** DEADLOCK ***', # part of lockdep output run.Raw('|'), 'grep', '-v', # FIXME see #2590 and #147 'INFO: possible irq lock inversion dependency detected', run.Raw('|'), 'grep', '-v', 'INFO: NMI handler (perf_event_nmi_handler) took too long to run', # noqa run.Raw('|'), 'grep', '-v', 'INFO: recovery required on readonly', run.Raw('|'), 'grep', '-v', 'ceph-create-keys: INFO', run.Raw('|'), 'egrep', '-v', '\\bsalt-master\\b|\\bsalt-minion\\b|\\bsalt-api\\b', run.Raw('|'), 'head', '-n', '1', ], stdout=StringIO(), ) stdout = r.stdout.getvalue() if stdout != '': log.error('Error in syslog on %s: %s', rem.name, stdout) set_status(ctx.summary, 'fail') if 'failure_reason' not in ctx.summary: ctx.summary['failure_reason'] = \ "'{error}' in syslog".format(error=stdout) log.info('Compressing syslogs...') run.wait( ctx.cluster.run( args=[ 'find', '{adir}/syslog'.format(adir=archive_dir), '-name', '*.log', '-print0', run.Raw('|'), 'sudo', 'xargs', '-0', '--no-run-if-empty', '--', 'gzip', '--', ], wait=False, ), ) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">33.789157</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">94</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.415404</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">dzedro/teuthology</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">teuthology/task/internal/syslog.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">5,609</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8724"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">#https://www.codechef.com/problems/DECINC n = int(input()) if(n%4==0): print(n+1) else: print(n-1)</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">17.666667</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">41</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.613208</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Unlicense" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">27Anurag/Competitive-programing-hacktoberfest-2021</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">CodeChef/DECINC_Decrement OR Increment.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">106</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8725"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">r"""Distributed TensorFlow with Monitored Training Session. This implements the 1a image recognition benchmark task, see https://mlbench.readthedocs.io/en/latest/benchmark-tasks.html#a-image-classification-resnet-cifar-10 for more details Adapted from official tutorial:: https://www.tensorflow.org/deploy/distributed Launch:: mpirun -n 3 --allow-run-as-root python .... """ import argparse import logging import os import tensorflow as tf from mlbench_core.controlflow.tensorflow.train_validation import train_round, \ validation_round from mlbench_core.dataset.imagerecognition.tensorflow.cifar10 import \ DatasetCifar from mlbench_core.evaluation.goals import task1_time_to_accuracy_light_goal, \ task1_time_to_accuracy_goal from mlbench_core.evaluation.tensorflow.criterion import \ softmax_cross_entropy_with_logits_v2_l2_regularized from mlbench_core.evaluation.tensorflow.metrics import TopKAccuracy from mlbench_core.lr_scheduler.tensorflow.lr import manual_stepping from mlbench_core.models.tensorflow.resnet_model import Cifar10Model from mlbench_core.utils import Tracker def define_graph(inputs, labels, is_training, batch_size, replicas_to_aggregate): """ Define graph for synchronized training. """ model = Cifar10Model( resnet_size=20, data_format='channels_last', resnet_version=2, dtype=tf.float32) logits = model(inputs, is_training) loss = softmax_cross_entropy_with_logits_v2_l2_regularized( logits=logits, labels=labels, l2=2e-4, # Exclude BN weights from L2 regularizer loss_filter_fn=lambda name: 'batch_normalization' not in name) # Use Top K accuracy as metrics metrics = [ TopKAccuracy(logits, labels, topk=1), TopKAccuracy(logits, labels, topk=5), ] global_step = tf.train.get_or_create_global_step() # scheduling learning steps. lr_scheduler = manual_stepping( global_step=global_step, boundaries=[32000 // replicas_to_aggregate, 48000 // replicas_to_aggregate], rates=[0.1, 0.01, 0.001], warmup=False) # Define the optimizer optimizer_ = tf.train.MomentumOptimizer( learning_rate=lr_scheduler, momentum=0.9, use_nesterov=True) # Wrap optimizer with `SyncReplicasOptimizer` optimizer = tf.train.SyncReplicasOptimizer( optimizer_, replicas_to_aggregate=replicas_to_aggregate, total_num_replicas=replicas_to_aggregate) hooks = [ optimizer.make_session_run_hook((rank == 0), num_tokens=0) ] # The update for batch normalization. update_ops = tf.get_collection(tf.GraphKeys.UPDATE_OPS) with tf.control_dependencies(update_ops): # Not all of the processes contribute one update. Some faster procs can push more updates. grads_and_vars = list(optimizer.compute_gradients( loss, tf.trainable_variables())) train_op = optimizer.apply_gradients( grads_and_vars, global_step=global_step) return train_op, loss, metrics, hooks def main(is_ps, run_id, rank, world_size, cluster_spec, batch_size, replicas_to_aggregate, light_target=False): logging.info("Initial.") job_name = "ps" if is_ps else "worker" cluster = tf.train.ClusterSpec(cluster_spec) gpu_options = tf.GPUOptions(allow_growth=True, per_process_gpu_memory_fraction=0.2) session_conf = tf.ConfigProto( gpu_options=gpu_options, allow_soft_placement=True, log_device_placement=False) server = tf.train.Server( cluster, job_name=job_name, task_index=rank, config=session_conf) if is_ps: server.join() else: # Pin variables to parameter server. device_fn = tf.train.replica_device_setter( ps_tasks=None, ps_device="/job:ps", worker_device="/job:{}/task:{}/device:GPU:{}".format( job_name, rank, rank), merge_devices=True, cluster=cluster, ps_ops=None, ps_strategy=None) with tf.Graph().as_default(): with tf.device(device_fn): data_loader = DatasetCifar( dataset='cifar-10', dataset_root='/datasets', batch_size=batch_size, world_size=world_size, rank=rank, seed=42, tf_dtype=tf.float32) train_op, loss, metrics, hooks = define_graph( data_loader.inputs, data_loader.labels, data_loader.training, batch_size, replicas_to_aggregate) local_init_op = tf.group( tf.local_variables_initializer(), data_loader.train_init_op, data_loader.validation_init_op) scaffold = tf.train.Scaffold( init_op=None, init_feed_dict=None, init_fn=None, ready_op=None, ready_for_local_init_op=None, local_init_op=local_init_op) lr_tensor_name = tf.get_default_graph().get_tensor_by_name("learning_rate:0") with tf.train.MonitoredTrainingSession(config=session_conf, master=server.target, scaffold=scaffold, is_chief=(rank == 0), checkpoint_dir=None, save_checkpoint_secs=None, save_summaries_steps=None, stop_grace_period_secs=5, hooks=hooks) as sess: logging.info("Begin training.") final_epoch = 164 if light_target: goal = task1_time_to_accuracy_light_goal() else: goal = task1_time_to_accuracy_goal() tracker = Tracker(metrics, run_id, rank, goal=goal) tracker.start() for i_epoch in range(final_epoch): logging.debug("=> Epoch {}".format(i_epoch)) train_round(sess, data_loader.train_init_op, train_op, loss, metrics, batch_size, data_loader.num_batches_per_epoch_for_train, tracker, lr_tensor=lr_tensor_name, lr_scheduler_level='epoch') validation_round(sess, data_loader.validation_init_op, loss, metrics, batch_size, data_loader.num_batches_per_epoch_for_eval, tracker) tracker.epoch_end() if tracker.goal_reached: print("Goal Reached!") return logging.info("Finish.") def configure_logger(log_dir, is_ps, rank): logger = logging.getLogger('') logger.setLevel(logging.DEBUG) formatter = logging.Formatter( '{:6} rank={} : %(message)s'.format("ps" if is_ps else "worker", rank), "%Y-%m-%d %H:%M:%S") ch = logging.StreamHandler() ch.setLevel(logging.DEBUG) ch.setFormatter(formatter) logger.addHandler(ch) log_name = '{}-{}.log'.format("ps" if is_ps else "worker", rank) log_name = os.path.join(log_dir, log_name) if os.path.exists(log_name): os.remove(log_name) fh = logging.FileHandler(log_name) fh.setLevel(logging.DEBUG) fh.setFormatter(formatter) logger.addHandler(fh) if __name__ == "__main__": parser = argparse.ArgumentParser(description='Process run parameters') parser.add_argument('--run_id', type=str, help='The id of the run') parser.add_argument('--hosts', type=str, help='The hosts participating in this run') parser.add_argument('--light', action='store_true', default=False, help='Train to light target metric goal') args = parser.parse_args() rank = int(os.environ['OMPI_COMM_WORLD_RANK']) size = int(os.environ['OMPI_COMM_WORLD_SIZE']) hosts = args.hosts.split(",") if len(hosts) < 2: raise ValueError("At least 2 pods are needed for this benchmark (1 parameter server, 1 worker)") workers = [h + ":22222" for h in hosts[1:]] ps = hosts[0] + ":22222" # First worker is the parameter server cluster_spec = {"worker": workers, "ps": [ps]} # Parse role in the cluster by rank. is_ps = rank < len(cluster_spec['ps']) rank = rank if is_ps else rank - len(cluster_spec['ps']) world_size = size - len(cluster_spec['ps']) # Configure Logging if not os.path.exists('/mlbench'): os.makedirs('/mlbench') configure_logger('/mlbench', is_ps, rank) batch_size = 128 replicas_to_aggregate = len(cluster_spec['worker']) main(is_ps, args.run_id, rank, world_size, cluster_spec, batch_size, replicas_to_aggregate, light_target=args.light) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">35.200743</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">161</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.598479</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">mlbench/mlbench-benchmarks</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">tensorflow/imagerecognition/openmpi-cifar10-resnet20-all-reduce/main.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">9,469</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8726"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from pathlib import Path, PurePath class Directory: def __init__(self, path_in_image, path_out_image, path_out_file): self.__path_in_image = path_in_image self.__path_out_image = path_out_image self.__path_out_file = path_out_file self.__allowed_image_extension = ['.jpg', '.jpeg', '.png'] @property def get_path_in_image(self): return self.__path_in_image @property def get_path_out_image(self): return self.__path_out_image @property def get_path_out_file(self): return self.__path_out_file @property def get_allowed_image_extension(self): return self.__allowed_image_extension def get_images(self): file_path_list = [] for file in self.get_path_in_image.iterdir(): if file.is_file(): for image_extension in self.get_allowed_image_extension: if file.suffix == image_extension: file_path_list.append(PurePath.joinpath( self.get_path_in_image, file)) return file_path_list def move_decoded_image(self, path, operation_id): file_extension = path.suffix new_file_name = operation_id + file_extension Path.rename(path, self.get_path_out_image / new_file_name) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">30.767442</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">72</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.663643</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">paaarx/tax_receipt</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">tax_receipt/directory.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">1,323</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8727"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># =============================================================================== # Copyright 2014 Jake Ross # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # =============================================================================== # ============= enthought library imports ======================= from __future__ import absolute_import from traits.api import List # ============= standard library imports ======================== # ============= local library imports ========================== from pychron.loggable import Loggable class BaseTagModel(Loggable): items = List # ============= EOF ============================================= </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">37.322581</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">81</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.543647</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">ASUPychron/pychron</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">pychron/pipeline/tagging/base_tags.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">1,157</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8728"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import time import types import unittest from unittest.mock import ( call, _Call, create_autospec, MagicMock, Mock, ANY, _CallList, patch, PropertyMock ) from datetime import datetime class SomeClass(object): def one(self, a, b): pass def two(self): pass def three(self, a=None): pass class AnyTest(unittest.TestCase): def test_any(self): self.assertEqual(ANY, object()) mock = Mock() mock(ANY) mock.assert_called_with(ANY) mock = Mock() mock(foo=ANY) mock.assert_called_with(foo=ANY) def test_repr(self): self.assertEqual(repr(ANY), '<ANY>') self.assertEqual(str(ANY), '<ANY>') def test_any_and_datetime(self): mock = Mock() mock(datetime.now(), foo=datetime.now()) mock.assert_called_with(ANY, foo=ANY) def test_any_mock_calls_comparison_order(self): mock = Mock() d = datetime.now() class Foo(object): def __eq__(self, other): return False def __ne__(self, other): return True for d in datetime.now(), Foo(): mock.reset_mock() mock(d, foo=d, bar=d) mock.method(d, zinga=d, alpha=d) mock().method(a1=d, z99=d) expected = [ call(ANY, foo=ANY, bar=ANY), call.method(ANY, zinga=ANY, alpha=ANY), call(), call().method(a1=ANY, z99=ANY) ] self.assertEqual(expected, mock.mock_calls) self.assertEqual(mock.mock_calls, expected) class CallTest(unittest.TestCase): def test_call_with_call(self): kall = _Call() self.assertEqual(kall, _Call()) self.assertEqual(kall, _Call(('',))) self.assertEqual(kall, _Call(((),))) self.assertEqual(kall, _Call(({},))) self.assertEqual(kall, _Call(('', ()))) self.assertEqual(kall, _Call(('', {}))) self.assertEqual(kall, _Call(('', (), {}))) self.assertEqual(kall, _Call(('foo',))) self.assertEqual(kall, _Call(('bar', ()))) self.assertEqual(kall, _Call(('baz', {}))) self.assertEqual(kall, _Call(('spam', (), {}))) kall = _Call(((1, 2, 3),)) self.assertEqual(kall, _Call(((1, 2, 3),))) self.assertEqual(kall, _Call(('', (1, 2, 3)))) self.assertEqual(kall, _Call(((1, 2, 3), {}))) self.assertEqual(kall, _Call(('', (1, 2, 3), {}))) kall = _Call(((1, 2, 4),)) self.assertNotEqual(kall, _Call(('', (1, 2, 3)))) self.assertNotEqual(kall, _Call(('', (1, 2, 3), {}))) kall = _Call(('foo', (1, 2, 4),)) self.assertNotEqual(kall, _Call(('', (1, 2, 4)))) self.assertNotEqual(kall, _Call(('', (1, 2, 4), {}))) self.assertNotEqual(kall, _Call(('bar', (1, 2, 4)))) self.assertNotEqual(kall, _Call(('bar', (1, 2, 4), {}))) kall = _Call(({'a': 3},)) self.assertEqual(kall, _Call(('', (), {'a': 3}))) self.assertEqual(kall, _Call(('', {'a': 3}))) self.assertEqual(kall, _Call(((), {'a': 3}))) self.assertEqual(kall, _Call(({'a': 3},))) def test_empty__Call(self): args = _Call() self.assertEqual(args, ()) self.assertEqual(args, ('foo',)) self.assertEqual(args, ((),)) self.assertEqual(args, ('foo', ())) self.assertEqual(args, ('foo',(), {})) self.assertEqual(args, ('foo', {})) self.assertEqual(args, ({},)) def test_named_empty_call(self): args = _Call(('foo', (), {})) self.assertEqual(args, ('foo',)) self.assertEqual(args, ('foo', ())) self.assertEqual(args, ('foo',(), {})) self.assertEqual(args, ('foo', {})) self.assertNotEqual(args, ((),)) self.assertNotEqual(args, ()) self.assertNotEqual(args, ({},)) self.assertNotEqual(args, ('bar',)) self.assertNotEqual(args, ('bar', ())) self.assertNotEqual(args, ('bar', {})) def test_call_with_args(self): args = _Call(((1, 2, 3), {})) self.assertEqual(args, ((1, 2, 3),)) self.assertEqual(args, ('foo', (1, 2, 3))) self.assertEqual(args, ('foo', (1, 2, 3), {})) self.assertEqual(args, ((1, 2, 3), {})) def test_named_call_with_args(self): args = _Call(('foo', (1, 2, 3), {})) self.assertEqual(args, ('foo', (1, 2, 3))) self.assertEqual(args, ('foo', (1, 2, 3), {})) self.assertNotEqual(args, ((1, 2, 3),)) self.assertNotEqual(args, ((1, 2, 3), {})) def test_call_with_kwargs(self): args = _Call(((), dict(a=3, b=4))) self.assertEqual(args, (dict(a=3, b=4),)) self.assertEqual(args, ('foo', dict(a=3, b=4))) self.assertEqual(args, ('foo', (), dict(a=3, b=4))) self.assertEqual(args, ((), dict(a=3, b=4))) def test_named_call_with_kwargs(self): args = _Call(('foo', (), dict(a=3, b=4))) self.assertEqual(args, ('foo', dict(a=3, b=4))) self.assertEqual(args, ('foo', (), dict(a=3, b=4))) self.assertNotEqual(args, (dict(a=3, b=4),)) self.assertNotEqual(args, ((), dict(a=3, b=4))) def test_call_with_args_call_empty_name(self): args = _Call(((1, 2, 3), {})) self.assertEqual(args, call(1, 2, 3)) self.assertEqual(call(1, 2, 3), args) self.assertIn(call(1, 2, 3), [args]) def test_call_ne(self): self.assertNotEqual(_Call(((1, 2, 3),)), call(1, 2)) self.assertFalse(_Call(((1, 2, 3),)) != call(1, 2, 3)) self.assertTrue(_Call(((1, 2), {})) != call(1, 2, 3)) def test_call_non_tuples(self): kall = _Call(((1, 2, 3),)) for value in 1, None, self, int: self.assertNotEqual(kall, value) self.assertFalse(kall == value) def test_repr(self): self.assertEqual(repr(_Call()), 'call()') self.assertEqual(repr(_Call(('foo',))), 'call.foo()') self.assertEqual(repr(_Call(((1, 2, 3), {'a': 'b'}))), "call(1, 2, 3, a='b')") self.assertEqual(repr(_Call(('bar', (1, 2, 3), {'a': 'b'}))), "call.bar(1, 2, 3, a='b')") self.assertEqual(repr(call), 'call') self.assertEqual(str(call), 'call') self.assertEqual(repr(call()), 'call()') self.assertEqual(repr(call(1)), 'call(1)') self.assertEqual(repr(call(zz='thing')), "call(zz='thing')") self.assertEqual(repr(call().foo), 'call().foo') self.assertEqual(repr(call(1).foo.bar(a=3).bing), 'call().foo.bar().bing') self.assertEqual( repr(call().foo(1, 2, a=3)), "call().foo(1, 2, a=3)" ) self.assertEqual(repr(call()()), "call()()") self.assertEqual(repr(call(1)(2)), "call()(2)") self.assertEqual( repr(call()().bar().baz.beep(1)), "call()().bar().baz.beep(1)" ) def test_call(self): self.assertEqual(call(), ('', (), {})) self.assertEqual(call('foo', 'bar', one=3, two=4), ('', ('foo', 'bar'), {'one': 3, 'two': 4})) mock = Mock() mock(1, 2, 3) mock(a=3, b=6) self.assertEqual(mock.call_args_list, [call(1, 2, 3), call(a=3, b=6)]) def test_attribute_call(self): self.assertEqual(call.foo(1), ('foo', (1,), {})) self.assertEqual(call.bar.baz(fish='eggs'), ('bar.baz', (), {'fish': 'eggs'})) mock = Mock() mock.foo(1, 2 ,3) mock.bar.baz(a=3, b=6) self.assertEqual(mock.method_calls, [call.foo(1, 2, 3), call.bar.baz(a=3, b=6)]) def test_extended_call(self): result = call(1).foo(2).bar(3, a=4) self.assertEqual(result, ('().foo().bar', (3,), dict(a=4))) mock = MagicMock() mock(1, 2, a=3, b=4) self.assertEqual(mock.call_args, call(1, 2, a=3, b=4)) self.assertNotEqual(mock.call_args, call(1, 2, 3)) self.assertEqual(mock.call_args_list, [call(1, 2, a=3, b=4)]) self.assertEqual(mock.mock_calls, [call(1, 2, a=3, b=4)]) mock = MagicMock() mock.foo(1).bar()().baz.beep(a=6) last_call = call.foo(1).bar()().baz.beep(a=6) self.assertEqual(mock.mock_calls[-1], last_call) self.assertEqual(mock.mock_calls, last_call.call_list()) def test_call_list(self): mock = MagicMock() mock(1) self.assertEqual(call(1).call_list(), mock.mock_calls) mock = MagicMock() mock(1).method(2) self.assertEqual(call(1).method(2).call_list(), mock.mock_calls) mock = MagicMock() mock(1).method(2)(3) self.assertEqual(call(1).method(2)(3).call_list(), mock.mock_calls) mock = MagicMock() int(mock(1).method(2)(3).foo.bar.baz(4)(5)) kall = call(1).method(2)(3).foo.bar.baz(4)(5).__int__() self.assertEqual(kall.call_list(), mock.mock_calls) def test_call_any(self): self.assertEqual(call, ANY) m = MagicMock() int(m) self.assertEqual(m.mock_calls, [ANY]) self.assertEqual([ANY], m.mock_calls) def test_two_args_call(self): args = _Call(((1, 2), {'a': 3}), two=True) self.assertEqual(len(args), 2) self.assertEqual(args[0], (1, 2)) self.assertEqual(args[1], {'a': 3}) other_args = _Call(((1, 2), {'a': 3})) self.assertEqual(args, other_args) def test_call_with_name(self): self.assertEqual(_Call((), 'foo')[0], 'foo') self.assertEqual(_Call((('bar', 'barz'),),)[0], '') self.assertEqual(_Call((('bar', 'barz'), {'hello': 'world'}),)[0], '') class SpecSignatureTest(unittest.TestCase): def _check_someclass_mock(self, mock): self.assertRaises(AttributeError, getattr, mock, 'foo') mock.one(1, 2) mock.one.assert_called_with(1, 2) self.assertRaises(AssertionError, mock.one.assert_called_with, 3, 4) self.assertRaises(TypeError, mock.one, 1) mock.two() mock.two.assert_called_with() self.assertRaises(AssertionError, mock.two.assert_called_with, 3) self.assertRaises(TypeError, mock.two, 1) mock.three() mock.three.assert_called_with() self.assertRaises(AssertionError, mock.three.assert_called_with, 3) self.assertRaises(TypeError, mock.three, 3, 2) mock.three(1) mock.three.assert_called_with(1) mock.three(a=1) mock.three.assert_called_with(a=1) def test_basic(self): mock = create_autospec(SomeClass) self._check_someclass_mock(mock) mock = create_autospec(SomeClass()) self._check_someclass_mock(mock) def test_create_autospec_return_value(self): def f(): pass mock = create_autospec(f, return_value='foo') self.assertEqual(mock(), 'foo') class Foo(object): pass mock = create_autospec(Foo, return_value='foo') self.assertEqual(mock(), 'foo') def test_autospec_reset_mock(self): m = create_autospec(int) int(m) m.reset_mock() self.assertEqual(m.__int__.call_count, 0) def test_mocking_unbound_methods(self): class Foo(object): def foo(self, foo): pass p = patch.object(Foo, 'foo') mock_foo = p.start() Foo().foo(1) mock_foo.assert_called_with(1) def test_create_autospec_unbound_methods(self): # see mock issue 128 # this is expected to fail until the issue is fixed return class Foo(object): def foo(self): pass klass = create_autospec(Foo) instance = klass() self.assertRaises(TypeError, instance.foo, 1) # Note: no type checking on the "self" parameter klass.foo(1) klass.foo.assert_called_with(1) self.assertRaises(TypeError, klass.foo) def test_create_autospec_keyword_arguments(self): class Foo(object): a = 3 m = create_autospec(Foo, a='3') self.assertEqual(m.a, '3') def test_create_autospec_keyword_only_arguments(self): def foo(a, *, b=None): pass m = create_autospec(foo) m(1) m.assert_called_with(1) self.assertRaises(TypeError, m, 1, 2) m(2, b=3) m.assert_called_with(2, b=3) def test_function_as_instance_attribute(self): obj = SomeClass() def f(a): pass obj.f = f mock = create_autospec(obj) mock.f('bing') mock.f.assert_called_with('bing') def test_spec_as_list(self): # because spec as a list of strings in the mock constructor means # something very different we treat a list instance as the type. mock = create_autospec([]) mock.append('foo') mock.append.assert_called_with('foo') self.assertRaises(AttributeError, getattr, mock, 'foo') class Foo(object): foo = [] mock = create_autospec(Foo) mock.foo.append(3) mock.foo.append.assert_called_with(3) self.assertRaises(AttributeError, getattr, mock.foo, 'foo') def test_attributes(self): class Sub(SomeClass): attr = SomeClass() sub_mock = create_autospec(Sub) for mock in (sub_mock, sub_mock.attr): self._check_someclass_mock(mock) def test_builtin_functions_types(self): # we could replace builtin functions / methods with a function # with *args / **kwargs signature. Using the builtin method type # as a spec seems to work fairly well though. class BuiltinSubclass(list): def bar(self, arg): pass sorted = sorted attr = {} mock = create_autospec(BuiltinSubclass) mock.append(3) mock.append.assert_called_with(3) self.assertRaises(AttributeError, getattr, mock.append, 'foo') mock.bar('foo') mock.bar.assert_called_with('foo') self.assertRaises(TypeError, mock.bar, 'foo', 'bar') self.assertRaises(AttributeError, getattr, mock.bar, 'foo') mock.sorted([1, 2]) mock.sorted.assert_called_with([1, 2]) self.assertRaises(AttributeError, getattr, mock.sorted, 'foo') mock.attr.pop(3) mock.attr.pop.assert_called_with(3) self.assertRaises(AttributeError, getattr, mock.attr, 'foo') def test_method_calls(self): class Sub(SomeClass): attr = SomeClass() mock = create_autospec(Sub) mock.one(1, 2) mock.two() mock.three(3) expected = [call.one(1, 2), call.two(), call.three(3)] self.assertEqual(mock.method_calls, expected) mock.attr.one(1, 2) mock.attr.two() mock.attr.three(3) expected.extend( [call.attr.one(1, 2), call.attr.two(), call.attr.three(3)] ) self.assertEqual(mock.method_calls, expected) def test_magic_methods(self): class BuiltinSubclass(list): attr = {} mock = create_autospec(BuiltinSubclass) self.assertEqual(list(mock), []) self.assertRaises(TypeError, int, mock) self.assertRaises(TypeError, int, mock.attr) self.assertEqual(list(mock), []) self.assertIsInstance(mock['foo'], MagicMock) self.assertIsInstance(mock.attr['foo'], MagicMock) def test_spec_set(self): class Sub(SomeClass): attr = SomeClass() for spec in (Sub, Sub()): mock = create_autospec(spec, spec_set=True) self._check_someclass_mock(mock) self.assertRaises(AttributeError, setattr, mock, 'foo', 'bar') self.assertRaises(AttributeError, setattr, mock.attr, 'foo', 'bar') def test_descriptors(self): class Foo(object): @classmethod def f(cls, a, b): pass @staticmethod def g(a, b): pass class Bar(Foo): pass class Baz(SomeClass, Bar): pass for spec in (Foo, Foo(), Bar, Bar(), Baz, Baz()): mock = create_autospec(spec) mock.f(1, 2) mock.f.assert_called_once_with(1, 2) mock.g(3, 4) mock.g.assert_called_once_with(3, 4) def test_recursive(self): class A(object): def a(self): pass foo = 'foo bar baz' bar = foo A.B = A mock = create_autospec(A) mock() self.assertFalse(mock.B.called) mock.a() mock.B.a() self.assertEqual(mock.method_calls, [call.a(), call.B.a()]) self.assertIs(A.foo, A.bar) self.assertIsNot(mock.foo, mock.bar) mock.foo.lower() self.assertRaises(AssertionError, mock.bar.lower.assert_called_with) def test_spec_inheritance_for_classes(self): class Foo(object): def a(self, x): pass class Bar(object): def f(self, y): pass class_mock = create_autospec(Foo) self.assertIsNot(class_mock, class_mock()) for this_mock in class_mock, class_mock(): this_mock.a(x=5) this_mock.a.assert_called_with(x=5) this_mock.a.assert_called_with(5) self.assertRaises(TypeError, this_mock.a, 'foo', 'bar') self.assertRaises(AttributeError, getattr, this_mock, 'b') instance_mock = create_autospec(Foo()) instance_mock.a(5) instance_mock.a.assert_called_with(5) instance_mock.a.assert_called_with(x=5) self.assertRaises(TypeError, instance_mock.a, 'foo', 'bar') self.assertRaises(AttributeError, getattr, instance_mock, 'b') # The return value isn't isn't callable self.assertRaises(TypeError, instance_mock) instance_mock.Bar.f(6) instance_mock.Bar.f.assert_called_with(6) instance_mock.Bar.f.assert_called_with(y=6) self.assertRaises(AttributeError, getattr, instance_mock.Bar, 'g') instance_mock.Bar().f(6) instance_mock.Bar().f.assert_called_with(6) instance_mock.Bar().f.assert_called_with(y=6) self.assertRaises(AttributeError, getattr, instance_mock.Bar(), 'g') def test_inherit(self): class Foo(object): a = 3 Foo.Foo = Foo # class mock = create_autospec(Foo) instance = mock() self.assertRaises(AttributeError, getattr, instance, 'b') attr_instance = mock.Foo() self.assertRaises(AttributeError, getattr, attr_instance, 'b') # instance mock = create_autospec(Foo()) self.assertRaises(AttributeError, getattr, mock, 'b') self.assertRaises(TypeError, mock) # attribute instance call_result = mock.Foo() self.assertRaises(AttributeError, getattr, call_result, 'b') def test_builtins(self): # used to fail with infinite recursion create_autospec(1) create_autospec(int) create_autospec('foo') create_autospec(str) create_autospec({}) create_autospec(dict) create_autospec([]) create_autospec(list) create_autospec(set()) create_autospec(set) create_autospec(1.0) create_autospec(float) create_autospec(1j) create_autospec(complex) create_autospec(False) create_autospec(True) def test_function(self): def f(a, b): pass mock = create_autospec(f) self.assertRaises(TypeError, mock) mock(1, 2) mock.assert_called_with(1, 2) mock.assert_called_with(1, b=2) mock.assert_called_with(a=1, b=2) f.f = f mock = create_autospec(f) self.assertRaises(TypeError, mock.f) mock.f(3, 4) mock.f.assert_called_with(3, 4) mock.f.assert_called_with(a=3, b=4) def test_skip_attributeerrors(self): class Raiser(object): def __get__(self, obj, type=None): if obj is None: raise AttributeError('Can only be accessed via an instance') class RaiserClass(object): raiser = Raiser() @staticmethod def existing(a, b): return a + b s = create_autospec(RaiserClass) self.assertRaises(TypeError, lambda x: s.existing(1, 2, 3)) s.existing(1, 2) self.assertRaises(AttributeError, lambda: s.nonexisting) # check we can fetch the raiser attribute and it has no spec obj = s.raiser obj.foo, obj.bar def test_signature_class(self): class Foo(object): def __init__(self, a, b=3): pass mock = create_autospec(Foo) self.assertRaises(TypeError, mock) mock(1) mock.assert_called_once_with(1) mock.assert_called_once_with(a=1) self.assertRaises(AssertionError, mock.assert_called_once_with, 2) mock(4, 5) mock.assert_called_with(4, 5) mock.assert_called_with(a=4, b=5) self.assertRaises(AssertionError, mock.assert_called_with, a=5, b=4) def test_class_with_no_init(self): # this used to raise an exception # due to trying to get a signature from object.__init__ class Foo(object): pass create_autospec(Foo) def test_signature_callable(self): class Callable(object): def __init__(self, x, y): pass def __call__(self, a): pass mock = create_autospec(Callable) mock(1, 2) mock.assert_called_once_with(1, 2) mock.assert_called_once_with(x=1, y=2) self.assertRaises(TypeError, mock, 'a') instance = mock(1, 2) self.assertRaises(TypeError, instance) instance(a='a') instance.assert_called_once_with('a') instance.assert_called_once_with(a='a') instance('a') instance.assert_called_with('a') instance.assert_called_with(a='a') mock = create_autospec(Callable(1, 2)) mock(a='a') mock.assert_called_once_with(a='a') self.assertRaises(TypeError, mock) mock('a') mock.assert_called_with('a') def test_signature_noncallable(self): class NonCallable(object): def __init__(self): pass mock = create_autospec(NonCallable) instance = mock() mock.assert_called_once_with() self.assertRaises(TypeError, mock, 'a') self.assertRaises(TypeError, instance) self.assertRaises(TypeError, instance, 'a') mock = create_autospec(NonCallable()) self.assertRaises(TypeError, mock) self.assertRaises(TypeError, mock, 'a') def test_create_autospec_none(self): class Foo(object): bar = None mock = create_autospec(Foo) none = mock.bar self.assertNotIsInstance(none, type(None)) none.foo() none.foo.assert_called_once_with() def test_autospec_functions_with_self_in_odd_place(self): class Foo(object): def f(a, self): pass a = create_autospec(Foo) a.f(10) a.f.assert_called_with(10) a.f.assert_called_with(self=10) a.f(self=10) a.f.assert_called_with(10) a.f.assert_called_with(self=10) def test_autospec_data_descriptor(self): class Descriptor(object): def __init__(self, value): self.value = value def __get__(self, obj, cls=None): if obj is None: return self return self.value def __set__(self, obj, value): pass class MyProperty(property): pass class Foo(object): __slots__ = ['slot'] @property def prop(self): return 3 @MyProperty def subprop(self): return 4 desc = Descriptor(42) foo = create_autospec(Foo) def check_data_descriptor(mock_attr): # Data descriptors don't have a spec. self.assertIsInstance(mock_attr, MagicMock) mock_attr(1, 2, 3) mock_attr.abc(4, 5, 6) mock_attr.assert_called_once_with(1, 2, 3) mock_attr.abc.assert_called_once_with(4, 5, 6) # property check_data_descriptor(foo.prop) # property subclass check_data_descriptor(foo.subprop) # class __slot__ check_data_descriptor(foo.slot) # plain data descriptor check_data_descriptor(foo.desc) def test_autospec_on_bound_builtin_function(self): meth = types.MethodType(time.ctime, time.time()) self.assertIsInstance(meth(), str) mocked = create_autospec(meth) # no signature, so no spec to check against mocked() mocked.assert_called_once_with() mocked.reset_mock() mocked(4, 5, 6) mocked.assert_called_once_with(4, 5, 6) class TestCallList(unittest.TestCase): def test_args_list_contains_call_list(self): mock = Mock() self.assertIsInstance(mock.call_args_list, _CallList) mock(1, 2) mock(a=3) mock(3, 4) mock(b=6) for kall in call(1, 2), call(a=3), call(3, 4), call(b=6): self.assertIn(kall, mock.call_args_list) calls = [call(a=3), call(3, 4)] self.assertIn(calls, mock.call_args_list) calls = [call(1, 2), call(a=3)] self.assertIn(calls, mock.call_args_list) calls = [call(3, 4), call(b=6)] self.assertIn(calls, mock.call_args_list) calls = [call(3, 4)] self.assertIn(calls, mock.call_args_list) self.assertNotIn(call('fish'), mock.call_args_list) self.assertNotIn([call('fish')], mock.call_args_list) def test_call_list_str(self): mock = Mock() mock(1, 2) mock.foo(a=3) mock.foo.bar().baz('fish', cat='dog') expected = ( "[call(1, 2),\n" " call.foo(a=3),\n" " call.foo.bar(),\n" " call.foo.bar().baz('fish', cat='dog')]" ) self.assertEqual(str(mock.mock_calls), expected) def test_propertymock(self): p = patch('%s.SomeClass.one' % __name__, new_callable=PropertyMock) mock = p.start() try: SomeClass.one mock.assert_called_once_with() s = SomeClass() s.one mock.assert_called_with() self.assertEqual(mock.mock_calls, [call(), call()]) s.one = 3 self.assertEqual(mock.mock_calls, [call(), call(), call(3)]) finally: p.stop() def test_propertymock_returnvalue(self): m = MagicMock() p = PropertyMock() type(m).foo = p returned = m.foo p.assert_called_once_with() self.assertIsInstance(returned, MagicMock) self.assertNotIsInstance(returned, PropertyMock) if __name__ == '__main__': unittest.main() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">29.372756</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">80</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.559354</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">4nkitd/pyAutomation</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Mark_attandance_py_selenium/py/App/Python/Lib/unittest/test/testmock/testhelpers.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">27,816</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8729"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># Generated by Django 3.2.4 on 2021-08-06 15:38 from django.db import migrations class Migration(migrations.Migration): dependencies = [ ('blog', '0002_alter_tag_tag_name'), ] operations = [ migrations.RemoveField( model_name='comment', name='subject', ), ] </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">18.166667</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">47</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.590214</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Gandabh/E-commerce-Site</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">blog/migrations/0003_remove_comment_subject.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">327</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8730"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Binary code class for Fermion-qubit mappings (arXiv:1712.07067) """ import copy import numpy import scipy import scipy.sparse from openfermion.ops import BinaryPolynomial def shift_decoder(decoder, shift_constant): """ Shifts the indices of a decoder by a constant. Args: decoder (iterable): list of BinaryPolynomial; the decoder shift_constant (int): the qubit index that corresponds to the offset. Returns (list): list of BinaryPolynomial shifted decoder """ decode_shifted = [] if not isinstance(shift_constant, (numpy.int64, numpy.int32, int)): raise TypeError('the shift to the decoder must be integer. got {}' 'of type {}'.format(shift_constant, type(shift_constant))) for entry in decoder: tmp_entry = copy.deepcopy(entry) tmp_entry.shift(shift_constant) decode_shifted.append(tmp_entry) return decode_shifted def double_decoding(decoder_1, decoder_2): """ Concatenates two decodings Args: decoder_1 (iterable): list of BinaryPolynomial decoding of the outer code layer decoder_2 (iterable): list of BinaryPolynomial decoding of the inner code layer Returns (list): list of BinaryPolynomial the decoding defined by w -> decoder_1( decoder_2(w) ) """ doubled_decoder = [] for entry in decoder_1: tmp_sum = 0 for summand in entry.terms: tmp_term = BinaryPolynomial('1') for factor in summand: if isinstance(factor, (numpy.int32, numpy.int64, int)): tmp_term *= decoder_2[factor] tmp_sum = tmp_term + tmp_sum doubled_decoder += [tmp_sum] return doubled_decoder class BinaryCodeError(Exception): pass class BinaryCode(object): """The BinaryCode class provides a representation of an encoding-decoding pair for binary vectors of different lengths, where the decoding is allowed to be non-linear. As the occupation number of fermionic mode is effectively binary, a length-N vector (v) of binary number can be utilized to describe a configuration of a many-body fermionic state on N modes. An n-qubit product state configuration \|w0> \|w1> \|w2> ... \|wn-1>, on the other hand is described by a length-n binary vector w=(w0, w1, ..., wn-1). To map a subset of N-Orbital Fermion states to n-qubit states we define a binary code, which consists of a (here: linear) encoding (e) and a (non-linear) decoding (d), such that for every v from that subset, w = e(v) is a length-n binary vector with d(w) = v. This can be used to save qubits given a Hamiltonian that dictates such a subset, otherwise n=N. Two binary codes (e,d) and (e',d') can construct a third code (e",d") by two possible operations: Concatenation: (e",d") = (e,d) * (e',d') which means e": v" -> e'( e(v") ) and d": w" -> d( d'(w") ) where n" = n' and N" = N, with n = N' as necessary condition. Appendage: (e",d") = (e,d) + (e',d') which means e": (v + v') -> e(v) + e'(v') and d": (w + w') -> d(w) + d'( w') where the addition is to be understood as appending two vectors together, so N" = N' + N and n" = n + n'. Appending codes is particularly useful when considering segment codes or segmented transforms. A BinaryCode-instance is initialized by BinaryCode(A,d), given the encoding (e) as n x N array or matrix-like nested lists A, such that e(v) = (A v) mod 2. The decoding d is an array or a list input of length N, which has entries either of type BinaryPolynomial, or of valid type for an input of the BinaryPolynomial-constructor. The signs + and \*, += and \*= are overloaded to implement concatenation and appendage on BinaryCode-objects. NOTE: multiplication of a BinaryCode with an integer yields a multiple appending of the same code, the multiplication with another BinaryCode their concatenation. Attributes: decoder (list): list of BinaryPolynomial: Outputs the decoding functions as components. encoder (scipy.sparse.csc_matrix): Outputs A, the linear matrix that implements the encoding function. n_modes (int): Outputs the number of modes. n_qubits (int): Outputs the number of qubits. """ def __init__(self, encoding, decoding): """ Initialization of a binary code. Args: encoding (np.ndarray or list): nested lists or binary 2D-array decoding (array or list): list of BinaryPolynomial (list or str). Raises: TypeError: non-list, array like encoding or decoding, unsuitable BinaryPolynomial generators, BinaryCodeError: in case of decoder/encoder size mismatch or decoder size, qubits indexed mismatch """ if not isinstance(encoding, (numpy.ndarray, list)): raise TypeError('encoding must be a list or array.') if not isinstance(decoding, (numpy.ndarray, list)): raise TypeError('decoding must be a list or array.') self.encoder = scipy.sparse.csc_matrix(encoding) self.n_qubits, self.n_modes = numpy.shape(encoding) if self.n_modes != len(decoding): raise BinaryCodeError( 'size mismatch, decoder and encoder should have the same' ' first dimension') decoder_qubits = set() self.decoder = [] for symbolic_binary in decoding: if isinstance(symbolic_binary, (tuple, list, str, int, numpy.int32, numpy.int64)): symbolic_binary = BinaryPolynomial(symbolic_binary) if isinstance(symbolic_binary, BinaryPolynomial): self.decoder.append(symbolic_binary) decoder_qubits = decoder_qubits | set( symbolic_binary.enumerate_qubits()) else: raise TypeError( 'decoder component provided ' 'is not a suitable for BinaryPolynomial', symbolic_binary) if len(decoder_qubits) != self.n_qubits: raise BinaryCodeError( 'decoder and encoder provided has different number of qubits') if max(decoder_qubits) + 1 > self.n_qubits: raise BinaryCodeError('decoder is not indexing some qubits. Qubits' 'indexed are: {}'.format(decoder_qubits)) def __iadd__(self, appendix): """ In-place appending a binary code with +=. Args: appendix (BinaryCode): The code to append to the present one. Returns (BinaryCode): A global binary code with size (n_modes1 + n_modes2), (n_qubits1,n_qubits2) Raises: TypeError: Appendix must be a BinaryCode. """ if not isinstance(appendix, BinaryCode): raise TypeError('argument must be a BinaryCode.') self.decoder = numpy.append(self.decoder, shift_decoder(appendix.decoder, self.n_qubits)).tolist() self.encoder = scipy.sparse.bmat([[self.encoder, None], [None, appendix.encoder]]) self.n_qubits, self.n_modes = numpy.shape(self.encoder) return self def __add__(self, appendix): """Appends two binary codes via addition +. Args: appendix (BinaryCode): The code to append to the present one. Returns (BinaryCode): global binary code """ twin = copy.deepcopy(self) twin += appendix return twin def __imul__(self, factor): """In-place code concatenation or appendage via *= . Multiplication with integer will yield appendage, otherwise concatenation. Args: factor (int or BinaryCode): the BinaryCode to concatenate. In case of int, it will append the code to itself factor times. Returns (BinaryCode): segmented or concatenated code Raises: TypeError: factor must be an integer or a BinaryCode BinaryCodeError: size mismatch between self and factor ValueError: in case of an integer factor that is < 1 """ if not isinstance(factor, (BinaryCode, numpy.int32, numpy.int64, int)): raise TypeError('argument must be a BinaryCode or integer') if isinstance(factor, BinaryCode): if self.n_qubits != factor.n_modes: raise BinaryCodeError( 'size mismatch between inner and outer code layer') self.decoder = double_decoding(self.decoder, factor.decoder) self.encoder = factor.encoder.dot(self.encoder) self.n_qubits, self.n_modes = numpy.shape(self.encoder) return self elif isinstance(factor, (numpy.int32, numpy.int64, int)): if factor < 1: raise ValueError('integer factor has to be positive, ' 'non-zero ') self.encoder = scipy.sparse.kron( scipy.sparse.identity(factor, format='csc', dtype=int), self.encoder, 'csc') tmp_decoder = self.decoder for index in numpy.arange(1, factor): self.decoder = numpy.append(self.decoder, shift_decoder(tmp_decoder, index * self.n_qubits)) self.n_qubits *= factor self.n_modes *= factor return self def __mul__(self, factor): """ Concatenation of two codes or appendage the same code factor times in case of integer factor. Args: factor (int or BinaryCode): the BinaryCode to concatenate. In case of int, it will append the code to itself factor times. Returns (BinaryCode): segmented or concatenated code """ twin = copy.deepcopy(self) twin *= factor return twin def __rmul__(self, factor): """ Appending the same code factor times. Args: factor (int): integer defining number of appendages. Returns (BinaryCode): Segmented code. Raises: TypeError: factor must be an integer """ if isinstance(factor, (numpy.int32, numpy.int64, int)): return self * factor else: raise TypeError('the left multiplier must be an integer to a' 'BinaryCode. Was given {} of ' 'type {}'.format(factor, type(factor))) def __str__(self): """ Return an easy-to-read string representation.""" string_return = [list(map(list, self.encoder.toarray()))] dec_str = '[' for term in self.decoder: dec_str += term.__str__() + ',' dec_str = dec_str[:-1] string_return.append(dec_str + ']') return str(string_return) def __repr__(self): return str(self) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">38.766234</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">79</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.605109</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">0tt3r/OpenFermion</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">src/openfermion/ops/_binary_code.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">11,940</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8731"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from concurrent.futures import ThreadPoolExecutor, CancelledError from aiomysql import create_pool from asyncio import ensure_future, gather, sleep from pymysql.err import OperationalError from logging import getLogger from sanic import Sanic from sanic.request import Request from sanic.response import json from sanic.exceptions import abort from kiwi.database.DataAccessor import DataAccessor from kiwi.Recommender import Recommender from kiwi.config import read_mysql_config, read_config from kiwi.TransferTypes import create_vote from kiwi.AsyncContentWrapper import AsyncContentWrapper from kiwi.ContentEngine import ContentEngine from kiwi.ActivationCalculator import ActivationCalculator import time app = Sanic(__name__) def create_accessor(context): return DataAccessor(conn=context) async def repeated_pool(loop, sleeper, tries): n = 1 while n <= tries: try: return await create_pool(**read_mysql_config()._asdict(), autocommit=True, loop=loop, pool_recycle=600) except OperationalError as e: getLogger('root').warn(e) getLogger('root').warn("Waiting {}s before retry".format(sleeper)) await sleep(sleeper) n += 1 return await create_pool(**read_mysql_config()._asdict(), autocommit=True, loop=loop, pool_recycle=600) async def retrain(context, loop): print("Start training...") start = time.time() async with context.pool.acquire() as conn: accessor = create_accessor(conn) content_frame = await accessor.get_content_frame() rating_frame = await accessor.get_vote_frame() print("Collected data in {}".format(time.time() - start)) algorithm = ContentEngine( content_frame, rating_frame) predictor = AsyncContentWrapper( loop, context.executor, algorithm) await predictor.fit() print("Completed training in {}s".format(time.time() - start)) context.algorithm = algorithm context.predictor = predictor @app.listener("before_server_start") async def setup(context, loop): context.executor = ThreadPoolExecutor() context.pool = await repeated_pool(loop, 5, 10) await retrain(context, loop) @app.middleware("request") async def generate_accessor(request): request['conn'] = await app.pool.acquire() request['accessor'] = create_accessor(request['conn']) @app.middleware("response") async def teardown_accessor(request, response): await request['conn'].ensure_closed() app.pool.release(request['conn']) @app.listener("before_server_stop") async def teardown(context, loop): context.run_retrain = False context.executor.shutdown() context.pool.close() await context.pool.wait_closed() @app.get('/recommendation') async def recommend(request): ''' Gets recommendations for user Expects args in query string form -> user=x&count=n Returns json object {posts, unvoted, user, meta} ''' args = request.raw_args recommender = Recommender( app.predictor, request['accessor'], read_config()) posts = await recommender.recommend_for(args['user'], int(args.get('count', 10))) return json(posts) @app.post('/feedback') async def feedback(request: Request): '''Stores the feedback for a recommended post. Will return a information object on success and an empty object on failure. Think about returning 409-Conflict on failure instead, because the empty object can cause an issue in engine service.''' vote = request.json['vote'] config = read_config() recommender = Recommender( app.predictor, request['accessor'], config) try: vote_result = await recommender.store_feedback( create_vote(vote, config['positive_cutoff'])) return json(vote_result) except KeyError: abort(400, "Unknown user") @app.post('/content') async def content(request: Request): ''' Inserts posts into the database. The request needs the format { "posts": [{"id": string, "tags": string}]}. Returns the amout of inserted items and 200-OK. ''' filtered_posts = [(post['id'], post['tags']) for post in request.json['posts']] inserted = await request['accessor'].add_content(filtered_posts) if inserted > 0: ensure_future(retrain(app, app.loop)) return json({"inserted_count": inserted}) @app.get('/predict') async def predict(request: Request): recommender = Recommender( app.predictor, request['accessor'], read_config()) user = request.raw_args['user'] item = request.raw_args['item'] result = await recommender.predict(user, item) return json(result) @app.get('/activation') async def activation(request: Request): ''' Returns the activation value for the given set of heuristics ''' heuristics = request.json['heuristics'] try: utv = await app.predictor.get_user_taste_vector(heuristics["user"]) except KeyError: utv = None ac = ActivationCalculator(heuristics, request['accessor']) a = await ac.get_activation(utv) return json({"activation": a, 'received_heuristics': heuristics}) @app.post('/training') async def training(request: Request): votes = request.json['votes'] config = read_config() do_retrain = request.json.get('retrain', False) inserted_user = await request['accessor'].batch_register_users( {str(vote[0]) for vote in votes}) inserted = await request['accessor'].insert_votes( (str(vote[0]), str(vote[1]), 1 if float(vote[2]) > config['positive_cutoff'] else -1) for vote in votes) if do_retrain: ensure_future(retrain(app, app.loop)) return json({ 'inserted_users': inserted_user, 'inserted_votes': inserted}) if __name__ == '__main__': app.run(host='0.0.0.0', port=8000) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">33.461538</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">126</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.669294</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">bubblegumsoldier/kiwi</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">kiwi-content/kiwi/app.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">6,090</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8732"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import click import subprocess import os @click.group() def cli(): ... @cli.command() def deploy(): click.echo("Running chalice deploy") output = subprocess.check_output(f"source {os.environ['VIRTUAL_ENV']}/bin/activate && chalice deploy",shell=True) click.echo(output) click.echo(os.environ["VIRTUAL_ENV"]) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">18.5</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">117</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.693694</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">foretheta/whatsup</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">scripts/whatsup.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">333</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8733"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># tested from boa.builtins import take def Main(amount): str1 = 'helloworld1234567' str2 = take(str1, amount) return str2 </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">10.769231</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">30</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.664286</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">CityOfZion/neo-boa</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">boa_test/example/TakeTest.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">140</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8734"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># Copyright 2020 Huawei Technologies Co., Ltd # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== import sys import pytest import numpy as np import pandas as pd import mindspore.dataset as de from mindspore import log as logger import mindspore.dataset.transforms.vision.c_transforms as vision def test_numpy_slices_list_1(): logger.info("Test Slicing a 1D list.") np_data = [1, 2, 3] ds = de.NumpySlicesDataset(np_data, shuffle=False) for i, data in enumerate(ds): assert data[0] == np_data[i] def test_numpy_slices_list_2(): logger.info("Test Slicing a 2D list into 1D list.") np_data = [[1, 2], [3, 4]] ds = de.NumpySlicesDataset(np_data, column_names=["col1"], shuffle=False) for i, data in enumerate(ds): assert np.equal(data[0], np_data[i]).all() def test_numpy_slices_list_3(): logger.info("Test Slicing list in the first dimension.") np_data = [[[1, 2], [3, 4]], [[5, 6], [7, 8]]] ds = de.NumpySlicesDataset(np_data, column_names=["col1"], shuffle=False) for i, data in enumerate(ds): assert np.equal(data[0], np_data[i]).all() def test_numpy_slices_list_append(): logger.info("Test reading data of image list.") DATA_DIR = ["../data/dataset/test_tf_file_3_images/train-0000-of-0001.data"] resize_height, resize_width = 2, 2 data1 = de.TFRecordDataset(DATA_DIR) resize_op = vision.Resize((resize_height, resize_width)) data1 = data1.map(input_columns=["image"], operations=[vision.Decode(True), resize_op]) res = [] for data in data1.create_dict_iterator(): res.append(data["image"]) ds = de.NumpySlicesDataset(res, column_names=["col1"], shuffle=False) for i, data in enumerate(ds): assert np.equal(data, res[i]).all() def test_numpy_slices_dict_1(): logger.info("Test Dictionary structure data.") np_data = {"a": [1, 2], "b": [3, 4]} ds = de.NumpySlicesDataset(np_data, shuffle=False) res = [[1, 3], [2, 4]] for i, data in enumerate(ds): assert data[0] == res[i][0] assert data[1] == res[i][1] def test_numpy_slices_tuple_1(): logger.info("Test slicing a list of tuple.") np_data = [([1, 2], [3, 4]), ([11, 12], [13, 14]), ([21, 22], [23, 24])] ds = de.NumpySlicesDataset(np_data, shuffle=False) for i, data in enumerate(ds): assert np.equal(data, np_data[i]).all() assert sum([1 for _ in ds]) == 3 def test_numpy_slices_tuple_2(): logger.info("Test slicing a tuple of list.") np_data = ([1, 2], [3, 4], [5, 6]) expected = [[1, 3, 5], [2, 4, 6]] ds = de.NumpySlicesDataset(np_data, shuffle=False) for i, data in enumerate(ds): assert np.equal(data, expected[i]).all() assert sum([1 for _ in ds]) == 2 def test_numpy_slices_tuple_3(): logger.info("Test reading different dimension of tuple data.") features, labels = np.random.sample((5, 2)), np.random.sample((5, 1)) data = (features, labels) ds = de.NumpySlicesDataset(data, column_names=["col1", "col2"], shuffle=False) for i, data in enumerate(ds): assert np.equal(data[0], features[i]).all() assert data[1] == labels[i] def test_numpy_slices_csv_value(): logger.info("Test loading value of csv file.") csv_file = "../data/dataset/testNumpySlicesDataset/heart.csv" df = pd.read_csv(csv_file) target = df.pop("target") df.pop("state") np_data = (df.values, target.values) ds = de.NumpySlicesDataset(np_data, column_names=["col1", "col2"], shuffle=False) for i, data in enumerate(ds): assert np.equal(np_data[0][i], data[0]).all() assert np.equal(np_data[1][i], data[1]).all() def test_numpy_slices_csv_dict(): logger.info("Test loading csv file as dict.") csv_file = "../data/dataset/testNumpySlicesDataset/heart.csv" df = pd.read_csv(csv_file) df.pop("state") res = df.values ds = de.NumpySlicesDataset(dict(df), shuffle=False) for i, data in enumerate(ds): assert np.equal(data, res[i]).all() def test_numpy_slices_num_samplers(): logger.info("Test num_samplers.") np_data = [[1, 2], [3, 4], [5, 6], [7, 8], [9, 10], [11, 12], [13, 14], [15, 16]] ds = de.NumpySlicesDataset(np_data, shuffle=False, num_samples=2) for i, data in enumerate(ds): assert np.equal(data[0], np_data[i]).all() assert sum([1 for _ in ds]) == 2 def test_numpy_slices_distributed_sampler(): logger.info("Test distributed sampler.") np_data = [[1, 2], [3, 4], [5, 6], [7, 8], [9, 10], [11, 12], [13, 14], [15, 16]] ds = de.NumpySlicesDataset(np_data, shuffle=False, shard_id=0, num_shards=4) for i, data in enumerate(ds): assert np.equal(data[0], np_data[i * 4]).all() assert sum([1 for _ in ds]) == 2 def test_numpy_slices_distributed_shard_limit(): logger.info("Test Slicing a 1D list.") np_data = [1, 2, 3] num = sys.maxsize with pytest.raises(ValueError) as err: de.NumpySlicesDataset(np_data, num_shards=num, shard_id=0, shuffle=False) assert "Input num_shards is not within the required interval of (1 to 2147483647)." in str(err.value) def test_numpy_slices_distributed_zero_shard(): logger.info("Test Slicing a 1D list.") np_data = [1, 2, 3] with pytest.raises(ValueError) as err: de.NumpySlicesDataset(np_data, num_shards=0, shard_id=0, shuffle=False) assert "Input num_shards is not within the required interval of (1 to 2147483647)." in str(err.value) def test_numpy_slices_sequential_sampler(): logger.info("Test numpy_slices_dataset with SequentialSampler and repeat.") np_data = [[1, 2], [3, 4], [5, 6], [7, 8], [9, 10], [11, 12], [13, 14], [15, 16]] ds = de.NumpySlicesDataset(np_data, sampler=de.SequentialSampler()).repeat(2) for i, data in enumerate(ds): assert np.equal(data[0], np_data[i % 8]).all() def test_numpy_slices_invalid_column_names_type(): logger.info("Test incorrect column_names input") np_data = [1, 2, 3] with pytest.raises(TypeError) as err: de.NumpySlicesDataset(np_data, column_names=[1], shuffle=False) assert "Argument column_names[0] with value 1 is not of type (<class 'str'>,)." in str(err.value) def test_numpy_slices_invalid_column_names_string(): logger.info("Test incorrect column_names input") np_data = [1, 2, 3] with pytest.raises(ValueError) as err: de.NumpySlicesDataset(np_data, column_names=[""], shuffle=False) assert "column_names[0] should not be empty" in str(err.value) def test_numpy_slices_invalid_empty_column_names(): logger.info("Test incorrect column_names input") np_data = [1, 2, 3] with pytest.raises(ValueError) as err: de.NumpySlicesDataset(np_data, column_names=[], shuffle=False) assert "column_names should not be empty" in str(err.value) def test_numpy_slices_invalid_empty_data_column(): logger.info("Test incorrect column_names input") np_data = [] with pytest.raises(ValueError) as err: de.NumpySlicesDataset(np_data, shuffle=False) assert "Argument data cannot be empty" in str(err.value) if __name__ == "__main__": test_numpy_slices_list_1() test_numpy_slices_list_2() test_numpy_slices_list_3() test_numpy_slices_list_append() test_numpy_slices_dict_1() test_numpy_slices_tuple_1() test_numpy_slices_tuple_2() test_numpy_slices_tuple_3() test_numpy_slices_csv_value() test_numpy_slices_csv_dict() test_numpy_slices_num_samplers() test_numpy_slices_distributed_sampler() test_numpy_slices_distributed_shard_limit() test_numpy_slices_distributed_zero_shard() test_numpy_slices_sequential_sampler() test_numpy_slices_invalid_column_names_type() test_numpy_slices_invalid_column_names_string() test_numpy_slices_invalid_empty_column_names() test_numpy_slices_invalid_empty_data_column() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">32.442748</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">105</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.675647</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Gavin-Hoang/mindspore</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">tests/ut/python/dataset/test_dataset_numpy_slices.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">8,500</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8735"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">""" Bu kod MQTT den alir FireBase e atar """ import firebase_admin from firebase_admin import credentials from firebase_admin import firestore import paho.mqtt.client as mqtt from time import sleep import json import sys Fb_Coll = "color" def main(): x = open("../ip.json") data_ = json.load(x) ip = data_["ip"] x.close() cred = credentials.Certificate("../Login.json") firebase_admin.initialize_app(cred) Server = ip db = firestore.client() def on_connect(client, userdata, flags, rc): print("Connected with result code "+str(rc)) client.subscribe("/blue") print("Topics Subscribed Successfully") def on_message(client, userdata, msg): topic = msg.topic data = msg.payload.decode('UTF-8') print("Mqtt'den: Topic: {}, Message: {}".format(topic,data)) if topic =="/blue": db.collection(Fb_Coll).document("color").update({ topic: data }) print("SEND") sleep(1) client = mqtt.Client() client.connect(Server, 1883, 60) client.on_connect = on_connect client.on_message = on_message client.loop_forever() if __name__ == "__main__": try: main() except KeyboardInterrupt: print("\nPrograms was stopped") sys.exit() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">24.344828</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">77</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.580737</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">KJPOUNDY132/mqtt_to_firebase</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">MyAwsomeMainCode/send_.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">1,412</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8736"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># # SPDX-FileCopyrightText: Copyright (c) 1993-2022 NVIDIA CORPORATION & AFFILIATES. All rights reserved. # SPDX-License-Identifier: Apache-2.0 # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # # Utility functions for building/saving/loading TensorRT Engine import sys import os import tensorrt as trt import pycuda.driver as cuda import numpy as np from utils.modeldata import ModelData # ../../common.py sys.path.insert(1, os.path.join( os.path.dirname(os.path.realpath(__file__)), os.pardir, os.pardir ) ) from common import HostDeviceMem def allocate_buffers(engine): """Allocates host and device buffer for TRT engine inference. This function is similair to the one in ../../common.py, but converts network outputs (which are np.float32) appropriately before writing them to Python buffer. This is needed, since TensorRT plugins doesn't support output type description, and in our particular case, we use NMS plugin as network output. Args: engine (trt.ICudaEngine): TensorRT engine Returns: inputs [HostDeviceMem]: engine input memory outputs [HostDeviceMem]: engine output memory bindings [int]: buffer to device bindings stream (cuda.Stream): cuda stream for engine inference synchronization """ inputs = [] outputs = [] bindings = [] stream = cuda.Stream() # Current NMS implementation in TRT only supports DataType.FLOAT but # it may change in the future, which could brake this sample here # when using lower precision [e.g. NMS output would not be np.float32 # anymore, even though this is assumed in binding_to_type] binding_to_type = {"Input": np.float32, "NMS": np.float32, "NMS_1": np.int32} for binding in engine: size = trt.volume(engine.get_binding_shape(binding)) * engine.max_batch_size dtype = binding_to_type[str(binding)] # Allocate host and device buffers host_mem = cuda.pagelocked_empty(size, dtype) device_mem = cuda.mem_alloc(host_mem.nbytes) # Append the device buffer to device bindings. bindings.append(int(device_mem)) # Append to the appropriate list. if engine.binding_is_input(binding): inputs.append(HostDeviceMem(host_mem, device_mem)) else: outputs.append(HostDeviceMem(host_mem, device_mem)) return inputs, outputs, bindings, stream def build_engine(uff_model_path, trt_logger, trt_engine_datatype=trt.DataType.FLOAT, batch_size=1, silent=False): with trt.Builder(trt_logger) as builder, builder.create_network() as network, builder.create_builder_config() as config, trt.UffParser() as parser, trt.Runtime(trt_logger) as runtime: config.max_workspace_size = 1 << 30 if trt_engine_datatype == trt.DataType.HALF: config.set_flag(trt.BuilderFlag.FP16) builder.max_batch_size = batch_size parser.register_input(ModelData.INPUT_NAME, ModelData.INPUT_SHAPE) parser.register_output("MarkOutput_0") parser.parse(uff_model_path, network) if not silent: print("Building TensorRT engine. This may take few minutes.") plan = builder.build_serialized_network(network, config) return runtime.deserialize_cuda_engine(plan) def save_engine(engine, engine_dest_path): buf = engine.serialize() with open(engine_dest_path, 'wb') as f: f.write(buf) def load_engine(trt_runtime, engine_path): with open(engine_path, 'rb') as f: engine_data = f.read() engine = trt_runtime.deserialize_cuda_engine(engine_data) return engine </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">37.690909</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">187</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.713459</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">GreyZzzzzzXh/TensorRT</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">samples/python/uff_ssd/utils/engine.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">4,146</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8737"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">class CouponNotFoundException(Exception): pass</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">25</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">41</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.82</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">daniellima/desafio-lojaintegrada</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">src/app/coupon/coupon_not_found_exception.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">50</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8738"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from .imports import * def rainbow_to_vector(r, timeformat='h'): """ Convert Rainbow object to np.arrays Parameters ---------- r : Rainbow object chromatic Rainbow object to convert into array format timeformat : str (optional, default='hours') The time format to use (seconds, minutes, hours, days etc.) Returns ---------- rflux : np.array flux (MJy/sr) [n_wavelengths x n_integrations] rfluxe : np.array flux error (MJy/sr) [n_wavelengths x n_integrations] rtime : np.array time (BJD_TDB, houra) [n_integrations] rwavel : np.array wavelength (microns) [n_wavelengths] """ secondformat = ['second', 'seconds', 'sec', 's'] minuteformat = ['minute', 'minutes', 'min', 'm'] hourformat = ['hour', 'hours', 'h'] dayformat = ['day', 'days', 'd'] yearformat = ['year', 'years', 'y'] rflux = r.fluxlike['flux'] # flux (MJy/sr) : [n_wavelengths x n_integrations] rfluxe = r.fluxlike['uncertainty'] # flux error (MJy/sr) : [n_wavelengths x n_integrations] rtime = r.timelike['time'] # time (BJD_TDB, hours) : [n_integrations] rwavel = r.wavelike['wavelength'] # wavelength (microns) : [n_wavelengths] # change the time array into the requested format (e.g. seconds, minutes, days etc.) if timeformat in secondformat: rtime = rtime * 3600 elif timeformat in minuteformat: rtime = rtime * 60 elif timeformat in hourformat: # hours is the default time setting pass elif timeformat in dayformat: rtime = rtime / 24. elif timeformat in yearformat: rtime = rtime / (24 * 365.) else: warnings.warn("Unrecognised Time Format!") return return rflux, rfluxe, rtime, rwavel def rainbow_to_df(r, timeformat='h'): """ Convert Rainbow object to pandas dataframe Parameters ---------- r : Rainbow object chromatic Rainbow object to convert into pandas df format timeformat : str (optional, default='hours') The time format to use (seconds, minutes, hours, days etc.) Returns ---------- pd.DataFrame """ rflux, rfluxe, rtime, rwavel = rainbow_to_vector(r, timeformat) x, y = np.meshgrid(rtime.to_value(), rwavel.to_value()) rainbow_dict = {f"Time ({timeformat})": x.ravel(), "Wavelength (microns)": y.ravel(), "Flux": rflux.ravel(), "Flux Error": rfluxe.ravel()} df = pd.DataFrame(rainbow_dict) return df def bin_data(jd, y, mins_jd): t = np.array(jd) split = [] sorted_t = t sorted_y = y start = sorted_t[0] nextbin = sorted_t[np.absolute(sorted_t - start) > mins_jd] while nextbin != []: start = start + mins_jd ind_st = np.argmax(sorted_t > start) if len(split) > 0: if ind_st != split[-1]: split.append(ind_st) time = sorted_t[ind_st:] # need to add defn for time here? else: split.append(ind_st) time = sorted_t[ind_st:] nextbin = time[np.absolute(time - start) > mins_jd] times = np.split(sorted_t, split) ys = np.split(sorted_y, split) bins = np.zeros(len(times)) binned_y = np.zeros(len(times)) binned_err = np.zeros(len(times)) for i in range(len(times)): if len(ys[i]) > 0: try: bins[i] = np.nanmean(times[i]) binned_y[i] = np.nanmean(ys[i]) n = len(times[i]) # standard error in the median: # binned_err[i] = 1.253 * np.nanstd(ys[i]) / np.sqrt(n) binned_err[i] = np.nanstd(ys[i]) / np.sqrt(n) except Exception as e: print(e) pass bin_t = bins[binned_y != 0] bin_e = binned_err[binned_y != 0] bin_y = binned_y[binned_y != 0] return bin_t, bin_y, bin_e def find_nearest(array, value): # array = np.asarray(array) idx = (np.abs(array - value)).argmin() return idx def remove_nans(arr_with_nans,*otherarrs): nanfree_arrs = [] for arr in otherarrs: nanfree_arrs.append(arr[~np.isnan(arr_with_nans)]) arr_without_nans = arr_with_nans[~np.isnan(arr_with_nans)] return arr_without_nans, nanfree_arrs</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">32.910448</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">112</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.578005</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">catrionamurray/chromatic_fitting</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">src/utils.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">4,410</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8739"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">""" This test will initialize the display using displayio and draw a solid red background """ import board import displayio from adafruit_st7735r import ST7735R spi = board.SPI() tft_cs = board.D5 tft_dc = board.D6 displayio.release_displays() display_bus = displayio.FourWire(spi, command=tft_dc, chip_select=tft_cs, reset=board.D9) display = ST7735R(display_bus, width=128, height=160, bgr=True) # Make the display context splash = displayio.Group(max_size=10) display.show(splash) color_bitmap = displayio.Bitmap(128, 160, 1) color_palette = displayio.Palette(1) color_palette[0] = 0xFF0000 bg_sprite = displayio.TileGrid(color_bitmap, pixel_shader=color_palette, x=0, y=0) splash.append(bg_sprite) while True: pass </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">24.294118</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">90</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.690073</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">jadudm/feather-isa</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">infra/libs-400rc2-20190512/examples/st7735r_128x160_simpletest.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">826</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8740"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">#!/usr/bin/env python3 # Copyright (c) 2014-2016 The Bitcoin Core developers # Distributed under the MIT software license, see the accompanying # file COPYING or http://www.opensource.org/licenses/mit-license.php. """Test wallet import RPCs. Test rescan behavior of importaddress, importpubkey, importprivkey, and importmulti RPCs with different types of keys and rescan options. In the first part of the test, node 0 creates an address for each type of import RPC call and sends BTC to it. Then other nodes import the addresses, and the test makes listtransactions and getbalance calls to confirm that the importing node either did or did not execute rescans picking up the send transactions. In the second part of the test, node 0 sends more BTC to each address, and the test makes more listtransactions and getbalance calls to confirm that the importing nodes pick up the new transactions regardless of whether rescans happened previously. """ from test_framework.test_framework import BitcoinTestFramework from test_framework.util import (assert_raises_rpc_error, connect_nodes, sync_blocks, assert_equal, set_node_times) import collections import enum import itertools import sys Call = enum.Enum("Call", "single multi") Data = enum.Enum("Data", "address pub priv") Rescan = enum.Enum("Rescan", "no yes late_timestamp") class Variant(collections.namedtuple("Variant", "call data rescan prune")): """Helper for importing one key and verifying scanned transactions.""" def try_rpc(self, func, *args, **kwargs): if self.expect_disabled: assert_raises_rpc_error(-4, "Rescan is disabled in pruned mode", func, *args, **kwargs) else: return func(*args, **kwargs) def do_import(self, timestamp): """Call one key import RPC.""" if self.call == Call.single: if self.data == Data.address: response = self.try_rpc(self.node.importaddress, self.address["address"], self.label, self.rescan == Rescan.yes) elif self.data == Data.pub: response = self.try_rpc(self.node.importpubkey, self.address["pubkey"], self.label, self.rescan == Rescan.yes) elif self.data == Data.priv: response = self.try_rpc(self.node.importprivkey, self.key, self.label, self.rescan == Rescan.yes) assert_equal(response, None) elif self.call == Call.multi: response = self.node.importmulti([{ "scriptPubKey": { "address": self.address["address"] }, "timestamp": timestamp + TIMESTAMP_WINDOW + (1 if self.rescan == Rescan.late_timestamp else 0), "pubkeys": [self.address["pubkey"]] if self.data == Data.pub else [], "keys": [self.key] if self.data == Data.priv else [], "label": self.label, "watchonly": self.data != Data.priv }], {"rescan": self.rescan in (Rescan.yes, Rescan.late_timestamp)}) assert_equal(response, [{"success": True}]) def check(self, txid=None, amount=None, confirmations=None): """Verify that getbalance/listtransactions return expected values.""" balance = self.node.getbalance(self.label, 0, False, True) assert_equal(balance, self.expected_balance) txs = self.node.listtransactions(self.label, 10000, 0, True) assert_equal(len(txs), self.expected_txs) if txid is not None: tx, = [tx for tx in txs if tx["txid"] == txid] assert_equal(tx["account"], self.label) assert_equal(tx["address"], self.address["address"]) assert_equal(tx["amount"], amount) assert_equal(tx["category"], "receive") assert_equal(tx["label"], self.label) assert_equal(tx["txid"], txid) assert_equal(tx["confirmations"], confirmations) assert_equal("trusted" not in tx, True) # Verify the transaction is correctly marked watchonly depending on # whether the transaction pays to an imported public key or # imported private key. The test setup ensures that transaction # inputs will not be from watchonly keys (important because # involvesWatchonly will be true if either the transaction output # or inputs are watchonly). if self.data != Data.priv: assert_equal(tx["involvesWatchonly"], True) else: assert_equal("involvesWatchonly" not in tx, True) # List of Variants for each way a key or address could be imported. IMPORT_VARIANTS = [Variant(*variants) for variants in itertools.product(Call, Data, Rescan, (False, True))] # List of nodes to import keys to. Half the nodes will have pruning disabled, # half will have it enabled. Different nodes will be used for imports that are # expected to cause rescans, and imports that are not expected to cause # rescans, in order to prevent rescans during later imports picking up # transactions associated with earlier imports. This makes it easier to keep # track of expected balances and transactions. ImportNode = collections.namedtuple("ImportNode", "prune rescan") IMPORT_NODES = [ImportNode(*fields) for fields in itertools.product((False, True), repeat=2)] # Rescans start at the earliest block up to 2 hours before the key timestamp. TIMESTAMP_WINDOW = 2 * 60 * 60 class ImportRescanTest(BitcoinTestFramework): def set_test_params(self): self.num_nodes = 2 + len(IMPORT_NODES) def setup_network(self): extra_args = [[] for _ in range(self.num_nodes)] for i, import_node in enumerate(IMPORT_NODES, 2): if import_node.prune: # txindex is enabled by default in Dash and needs to be disabled for import-rescan.py extra_args[i] += ["-prune=1", "-txindex=0", "-reindex"] self.add_nodes(self.num_nodes, extra_args, stderr=sys.stdout) self.start_nodes() for i in range(1, self.num_nodes): connect_nodes(self.nodes[i], 0) def run_test(self): # Create one transaction on node 0 with a unique amount and label for # each possible type of wallet import RPC. for i, variant in enumerate(IMPORT_VARIANTS): variant.label = "label {} {}".format(i, variant) variant.address = self.nodes[1].validateaddress(self.nodes[1].getnewaddress(variant.label)) variant.key = self.nodes[1].dumpprivkey(variant.address["address"]) variant.initial_amount = 10 - (i + 1) / 4.0 variant.initial_txid = self.nodes[0].sendtoaddress(variant.address["address"], variant.initial_amount) # Generate a block containing the initial transactions, then another # block further in the future (past the rescan window). self.nodes[0].generate(1) assert_equal(self.nodes[0].getrawmempool(), []) timestamp = self.nodes[0].getblockheader(self.nodes[0].getbestblockhash())["time"] set_node_times(self.nodes, timestamp + TIMESTAMP_WINDOW + 1) self.nodes[0].generate(1) self.sync_blocks() # For each variation of wallet key import, invoke the import RPC and # check the results from getbalance and listtransactions. for variant in IMPORT_VARIANTS: variant.expect_disabled = variant.rescan == Rescan.yes and variant.prune and variant.call == Call.single expect_rescan = variant.rescan == Rescan.yes and not variant.expect_disabled variant.node = self.nodes[2 + IMPORT_NODES.index(ImportNode(variant.prune, expect_rescan))] variant.do_import(timestamp) if expect_rescan: variant.expected_balance = variant.initial_amount variant.expected_txs = 1 variant.check(variant.initial_txid, variant.initial_amount, 2) else: variant.expected_balance = 0 variant.expected_txs = 0 variant.check() # Create new transactions sending to each address. for i, variant in enumerate(IMPORT_VARIANTS): variant.sent_amount = 10 - (2 * i + 1) / 8.0 variant.sent_txid = self.nodes[0].sendtoaddress(variant.address["address"], variant.sent_amount) # Generate a block containing the new transactions. self.nodes[0].generate(1) assert_equal(self.nodes[0].getrawmempool(), []) self.sync_blocks() # Check the latest results from getbalance and listtransactions. for variant in IMPORT_VARIANTS: if not variant.expect_disabled: variant.expected_balance += variant.sent_amount variant.expected_txs += 1 variant.check(variant.sent_txid, variant.sent_amount, 1) else: variant.check() if __name__ == "__main__": ImportRescanTest().main() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">47.631579</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">116</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.654365</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">BlueScionic/vivarium</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">test/functional/import-rescan.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">9,050</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8741"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">shisu_risto = [1, 0, 2] kazu_risto = [1, 4, 6] tou_risto = [] for ai in range(len(shisu_risto)): tou_risto.append(kazu_risto[shisu_risto[ai]]) print(tou_risto) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">16.7</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">49</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.682635</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">ALFA-group/neural-program-comprehension</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">stimuli/Python/one_file_per_item/jap/33_# math_for 15.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">167</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8742"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># # ------------------------------------------------------------------------- # Copyright (c) 2018 Intel Corporation Intellectual Property # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # # ------------------------------------------------------------------------- # """Test case for RootController /""" import json from conductor import version from conductor.tests.unit.api import base_api class TestRoot(base_api.BaseApiTest): def test_get_index(self): actual_response = self.app.get('/') req_json_file = './conductor/tests/unit/api/controller/versions.json' expected_response = json.loads(open(req_json_file).read()) versions = expected_response.get('versions') for version_obj in versions: version_obj['version'] = "of-has:{}".format(version.version_info.version_string()) self.assertEqual(200, actual_response.status_int) self.assertJsonEqual(expected_response, json.loads(actual_response.body.decode())) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">38.4</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">94</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.639323</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">onap/optf-has</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">conductor/conductor/tests/unit/api/controller/test_root.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">1,536</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8743"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from apollo.viewsets import UserViewSet from applications.assets.viewsets import EquipmentViewSet, ServiceViewSet from applications.business.viewsets import BusinessViewSet, BusinessMembershipViewSet from applications.charge_list.viewsets import ChargeListViewSet, ActivityChargeViewSet, \ ActivityChargeActivityCountViewSet, TimeChargeViewSet, UnitChargeViewSet from applications.price_list.viewsets import PriceListViewSet, ActivityPriceListItemViewSet, TimePriceListItemViewSet, \ UnitPriceListItemViewSet, PriceListItemEquipmentViewSet, PriceListItemServiceViewSet from applications.station.viewsets import StationViewSet, StationBusinessViewSet, StationRentalViewSet from applications.terms_of_service.viewsets import TermsOfServiceViewSet from rest_framework.routers import DefaultRouter # Internal API Definition router = DefaultRouter() router.register(r'account/user', UserViewSet, base_name='user') router.register(r'account/terms_of_service', TermsOfServiceViewSet, base_name='terms-of-service') router.register(r'business/business', BusinessViewSet, base_name='business') router.register(r'business/business_membership', BusinessMembershipViewSet, base_name='business-membership') router.register(r'equipment/equipment', EquipmentViewSet, base_name='equipment') router.register(r'equipment/service', ServiceViewSet, base_name='service') router.register(r'station/station', StationViewSet, base_name='station') router.register(r'station/station_business', StationBusinessViewSet, base_name='station-business') router.register(r'station/station_rental', StationRentalViewSet, base_name='station-rental') router.register(r'price_list/price_list', PriceListViewSet, base_name='price-list') router.register(r'price_list/activity_item', ActivityPriceListItemViewSet, base_name='activity-price-list-item') router.register(r'price_list/time_item', TimePriceListItemViewSet, base_name='time-price-list-item') router.register(r'price_list/unit_item', UnitPriceListItemViewSet, base_name='unit-price-list-item') router.register(r'price_list/equipment_relation', PriceListItemEquipmentViewSet, base_name='price-list-item-equipment') router.register(r'price_list/service_relation', PriceListItemServiceViewSet, base_name='price-list-item-service') router.register(r'charge_list/charge_list', ChargeListViewSet, base_name='charge-list') router.register(r'charge_list/activity_charge', ActivityChargeViewSet, base_name='activity-charge') router.register(r'charge_list/activity_charge_activity_count', ActivityChargeActivityCountViewSet, base_name='activity-charge-activity-count') router.register(r'charge_list/time_charge', TimeChargeViewSet, base_name='time-charge') router.register(r'charge_list/unit_charge', UnitChargeViewSet, base_name='unit-charge') </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">75.162162</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">120</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.848256</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">awwong1/apollo</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">apollo/router.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">2,781</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8744"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from whey.mixin import BuilderMixin class GettextMixin: def build_messages(self: BuilderMixin): from babel.messages.mofile import write_mo from babel.messages.pofile import read_po locales = self.pkgdir / "locales" if self.verbose: print(" Building messages") for po in locales.glob("*/LC_MESSAGES/pm2hw.po"): with po.open("rt", encoding="UTF-8") as f: catalog = read_po(f, po.parts[-3], po.stem) mo = self.build_dir / po.relative_to(self.project_dir).with_suffix(".mo") mo.parent.maybe_make(parents=True) with mo.open("wb") as f: write_mo(f, catalog) self.report_written(mo) if self.verbose: print(" Wrote language file:", mo) # class SDistBuilder(GettextMixin, builder.SDistBuilder): # def call_additional_hooks(self): # self.build_messages() # class WheelBuilder(GettextMixin, builder.WheelBuilder): # def call_additional_hooks(self): # self.build_messages() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">27.205882</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">76</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.718919</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MPL-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">bedwardly-down/pm2hw</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">build_hooks.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">925</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8745"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># coding: utf-8 """ """ from copy import deepcopy import datetime import io import json import math import os import zipfile import flask import flask_login import itsdangerous import werkzeug.utils from flask_babel import _ from . import frontend from .. import logic from .. import models from .. import db from ..logic import user_log, object_log, comments, object_sorting from ..logic.actions import get_action, get_actions, get_action_type, get_action_types from ..logic.action_type_translations import get_action_types_with_translations_in_language, \ get_action_type_with_translation_in_language from ..logic.action_translations import get_action_with_translation_in_language from ..logic.action_permissions import get_user_action_permissions, get_sorted_actions_for_user from ..logic.object_permissions import Permissions, get_user_object_permissions, object_is_public, get_object_permissions_for_users, set_object_public, set_user_object_permissions, set_group_object_permissions, set_project_object_permissions, get_objects_with_permissions, get_object_info_with_permissions, get_object_permissions_for_groups, get_object_permissions_for_projects, request_object_permissions from ..logic.datatypes import JSONEncoder from ..logic.instrument_translations import get_instrument_with_translation_in_language from ..logic.users import get_user, get_users, get_users_by_name from ..logic.schemas import validate, generate_placeholder from ..logic.settings import get_user_settings, set_user_settings from ..logic.object_search import generate_filter_func, wrap_filter_func from ..logic.groups import get_group, get_user_groups from ..logic.objects import create_object, create_object_batch, update_object, get_object, get_object_versions from ..logic.object_log import ObjectLogEntryType from ..logic.projects import get_project, get_user_projects, get_user_project_permissions from ..logic.locations import get_location, get_object_ids_at_location, get_object_location_assignment, get_object_location_assignments, get_locations, assign_location_to_object, get_locations_tree from ..logic.languages import get_language_by_lang_code, get_language, get_languages, Language, get_user_language from ..logic.files import FileLogEntryType from ..logic.errors import GroupDoesNotExistError, ObjectDoesNotExistError, UserDoesNotExistError, ActionDoesNotExistError, ValidationError, ProjectDoesNotExistError, LocationDoesNotExistError, ActionTypeDoesNotExistError from ..logic.notebook_templates import get_notebook_templates from .objects_forms import ObjectPermissionsForm, ObjectForm, ObjectVersionRestoreForm, ObjectUserPermissionsForm, CommentForm, ObjectGroupPermissionsForm, ObjectProjectPermissionsForm, FileForm, FileInformationForm, FileHidingForm, ObjectLocationAssignmentForm, ExternalLinkForm, ObjectPublicationForm, CopyPermissionsForm from ..utils import object_permissions_required from .utils import jinja_filter, generate_qrcode from .object_form_parser import parse_form_data from .labels import create_labels, PAGE_SIZES, DEFAULT_PAPER_FORMAT, HORIZONTAL_LABEL_MARGIN, VERTICAL_LABEL_MARGIN, mm from . import pdfexport from .utils import check_current_user_is_not_readonly from ..logic.utils import get_translated_text __author__ = 'Florian Rhiem <<a href="/cdn-cgi/l/email-protection" class="__cf_email__" data-cfemail="ddbbf3afb5b4b8b09dbba7f0b7a8b8b1b4beb5f3b9b8">[email protected]</a>>' def on_unauthorized(object_id): permissions_by_user = get_object_permissions_for_users(object_id) has_grant_user = any( Permissions.GRANT in permissions for permissions in permissions_by_user.values() ) return flask.render_template('objects/unauthorized.html', object_id=object_id, has_grant_user=has_grant_user), 403 @frontend.route('/objects/') @flask_login.login_required def objects(): object_ids = flask.request.args.get('ids', '') objects = [] display_properties = [] display_property_titles = {} user_language_id = logic.languages.get_user_language(flask_login.current_user).id if 'display_properties' in flask.request.args: for property_info in flask.request.args.get('display_properties', '').split(','): if ':' in property_info: property_name, property_title = property_info.split(':', 1) else: property_name, property_title = property_info, property_info if property_name not in display_properties: display_properties.append(property_name) display_property_titles[property_name] = property_title name_only = True if object_ids: object_ids = object_ids.split(',') try: object_ids = [int(object_id) for object_id in object_ids] except ValueError: object_ids = [] readable_object_ids = [] for object_id in object_ids: if Permissions.READ in get_user_object_permissions(object_id, user_id=flask_login.current_user.id): readable_object_ids.append(object_id) object_ids = readable_object_ids for object_id in object_ids: try: objects.append(get_object(object_id)) except logic.errors.ObjectDoesNotExistError: pass action_id = None action = None action_type = None project_id = None location_id = None location = None user = None user_id = None doi = None object_ids_at_location = None project = None group = None group_id = None query_string = '' use_advanced_search = False must_use_advanced_search = False advanced_search_had_error = False search_notes = [] search_tree = None limit = None offset = None pagination_enabled = True num_objects_found = len(objects) sorting_property_name = None sorting_order_name = None else: pagination_enabled = True try: user_id = int(flask.request.args.get('user', '')) user = get_user(user_id) except ValueError: user_id = None user = None except UserDoesNotExistError: user_id = None user = None if user_id is not None: user_permissions = { 'read': Permissions.READ, 'write': Permissions.WRITE, 'grant': Permissions.GRANT }.get(flask.request.args.get('user_permissions', '').lower()) else: user_permissions = None try: doi = logic.publications.simplify_doi(flask.request.args.get('doi', '')) except logic.errors.InvalidDOIError: doi = None try: location_id = int(flask.request.args.get('location', '')) location = get_location(location_id) object_ids_at_location = get_object_ids_at_location(location_id) except ValueError: location_id = None location = None object_ids_at_location = None except LocationDoesNotExistError: location_id = None location = None object_ids_at_location = None try: action_id = int(flask.request.args.get('action', '')) except ValueError: action_id = None if action_id is not None: action = get_action_with_translation_in_language(action_id, user_language_id, use_fallback=True) action_type = get_action_type_with_translation_in_language(action.type_id, user_language_id) action_schema = action.schema if not display_properties: display_properties = action_schema.get('displayProperties', []) for property_name in display_properties: display_property_titles[property_name] = action_schema['properties'][property_name]['title'] else: action = None action_type_id = flask.request.args.get('t', '') if action_type_id is not None: try: action_type_id = int(action_type_id) except ValueError: # ensure old links still function action_type_id = { 'samples': models.ActionType.SAMPLE_CREATION, 'measurements': models.ActionType.MEASUREMENT, 'simulations': models.ActionType.SIMULATION }.get(action_type_id, None) if action_type_id is not None: try: action_type = get_action_type_with_translation_in_language( action_type_id=action_type_id, language_id=user_language_id ) except ActionTypeDoesNotExistError: action_type = None else: action_type = None project_permissions = None if display_properties: name_only = False try: project_id = int(flask.request.args.get('project', '')) except ValueError: project_id = None if project_id is not None: if Permissions.READ not in get_user_project_permissions(project_id=project_id, user_id=flask_login.current_user.id, include_groups=True): return flask.abort(403) project = get_project(project_id) project_permissions = { 'read': Permissions.READ, 'write': Permissions.WRITE, 'grant': Permissions.GRANT }.get(flask.request.args.get('project_permissions', '').lower()) else: project = None group_permissions = None try: group_id = int(flask.request.args.get('group', '')) except ValueError: group_id = None if group_id is not None: try: group = logic.groups.get_group(group_id) group_member_ids = logic.groups.get_group_member_ids(group_id) except logic.errors.GroupDoesNotExistError: group = None else: if flask_login.current_user.id not in group_member_ids: return flask.abort(403) else: group = None if group is not None: group_permissions = { 'read': Permissions.READ, 'write': Permissions.WRITE, 'grant': Permissions.GRANT }.get(flask.request.args.get('group_permissions', '').lower()) else: group_permissions = None if flask.request.args.get('limit', '') == 'all': limit = None else: try: limit = int(flask.request.args.get('limit', '')) except ValueError: limit = None else: if limit <= 0: limit = None elif limit >= 1000: limit = 1000 # default objects per page if limit is None: limit = get_user_settings(flask_login.current_user.id)['OBJECTS_PER_PAGE'] else: set_user_settings(flask_login.current_user.id, {'OBJECTS_PER_PAGE': limit}) try: offset = int(flask.request.args.get('offset', '')) except ValueError: offset = None else: if offset < 0: offset = None elif offset > 100000000: offset = 100000000 if limit is not None and offset is None: offset = 0 sorting_order_name = flask.request.args.get('order', None) if sorting_order_name == 'asc': sorting_order = object_sorting.ascending elif sorting_order_name == 'desc': sorting_order = object_sorting.descending else: sorting_order = None sorting_property_name = flask.request.args.get('sortby', None) if sorting_order is None: if sorting_property_name is None: sorting_order_name = 'desc' sorting_order = object_sorting.descending else: sorting_order_name = 'asc' sorting_order = object_sorting.ascending if sorting_property_name is None: sorting_property_name = '_object_id' else: name_only = False if sorting_property_name == '_object_id': sorting_property = object_sorting.object_id() elif sorting_property_name == '_creation_date': sorting_property = object_sorting.creation_date() elif sorting_property_name == '_last_modification_date': sorting_property = object_sorting.last_modification_date() else: sorting_property = object_sorting.property_value(sorting_property_name) sorting_function = sorting_order(sorting_property) query_string = flask.request.args.get('q', '') if query_string: name_only = False search_tree = None use_advanced_search = flask.request.args.get('advanced', None) is not None must_use_advanced_search = use_advanced_search advanced_search_had_error = False additional_search_notes = [] if not use_advanced_search and query_string: if user_id is None: users = get_users_by_name(query_string) if len(users) == 1: user = users[0] user_id = user.id query_string = '' elif len(users) > 1: additional_search_notes.append(('error', "There are multiple users with this name.", 0, 0)) if doi is None and query_string.startswith('doi:'): try: doi = logic.publications.simplify_doi(query_string) query_string = '' except logic.errors.InvalidDOIError: pass try: filter_func, search_tree, use_advanced_search = generate_filter_func(query_string, use_advanced_search) except Exception: # TODO: ensure that advanced search does not cause exceptions if use_advanced_search: advanced_search_had_error = True def filter_func(data, search_notes): """ Return all objects""" search_notes.append(('error', "Unable to parse search expression", 0, len(query_string))) return False else: raise filter_func, search_notes = wrap_filter_func(filter_func) search_notes.extend(additional_search_notes) if user_id is None or user_permissions is not None: object_ids_for_user = None else: object_ids_for_user = user_log.get_user_related_object_ids(user_id) if doi is None: object_ids_for_doi = None else: object_ids_for_doi = logic.publications.get_object_ids_linked_to_doi(doi) if use_advanced_search and not must_use_advanced_search: search_notes.append(('info', _("The advanced search was used automatically. Search for \"%(query_string)s\" to use the simple search.", query_string=query_string), 0, 0)) try: object_ids = None if object_ids_at_location is not None: if object_ids is None: object_ids = set() object_ids = object_ids.union(object_ids_at_location) if object_ids_for_user is not None: if object_ids is None: object_ids = set() object_ids = object_ids.union(object_ids_for_user) if object_ids_for_doi is not None: if object_ids is None: object_ids = set() object_ids = object_ids.union(object_ids_for_doi) if object_ids is not None: pagination_enabled = False limit = None offset = None if object_ids is not None and not object_ids: objects = [] num_objects_found = 0 else: num_objects_found_list = [] objects = get_objects_with_permissions( user_id=flask_login.current_user.id, permissions=Permissions.READ, filter_func=filter_func, sorting_func=sorting_function, limit=limit, offset=offset, action_id=action_id, action_type_id=action_type.id if action_type is not None else None, other_user_id=user_id, other_user_permissions=user_permissions, project_id=project_id, project_permissions=project_permissions, group_id=group_id, group_permissions=group_permissions, object_ids=object_ids, num_objects_found=num_objects_found_list, name_only=name_only ) num_objects_found = num_objects_found_list[0] except Exception as e: search_notes.append(('error', "Error during search: {}".format(e), 0, 0)) objects = [] num_objects_found = 0 if any(note[0] == 'error' for note in search_notes): objects = [] advanced_search_had_error = True cached_actions = {} cached_users = {} for i, obj in enumerate(objects): if obj.version_id == 0: original_object = obj else: original_object = get_object(object_id=obj.object_id, version_id=0) if obj.action_id not in cached_actions: cached_actions[obj.action_id] = get_action(obj.action_id) if obj.user_id not in cached_users: cached_users[obj.user_id] = get_user(obj.user_id) if original_object.user_id not in cached_users: cached_users[original_object.user_id] = get_user(original_object.user_id) objects[i] = { 'object_id': obj.object_id, 'created_by': cached_users[original_object.user_id], 'created_at': original_object.utc_datetime, 'modified_by': cached_users[obj.user_id], 'last_modified_at': obj.utc_datetime, 'data': obj.data, 'schema': obj.schema, 'action': cached_actions[obj.action_id], 'display_properties': {} } for property_name in display_properties: if property_name not in objects[i]['data'] or '_type' not in objects[i]['data'][property_name] or property_name not in objects[i]['schema']['properties']: objects[i]['display_properties'][property_name] = None continue objects[i]['display_properties'][property_name] = (objects[i]['data'][property_name], objects[i]['schema']['properties'][property_name]) if action_id is None: show_action = True else: show_action = False def build_modified_url(**kwargs): return flask.url_for( '.objects', **{k: v for k, v in flask.request.args.items() if k not in kwargs}, **kwargs ) action_ids = { object['action'].id for object in objects } action_translations = {} for id in action_ids: action_translations[id] = logic.action_translations.get_action_translation_for_action_in_language( action_id=id, language_id=user_language_id, use_fallback=True ) return flask.render_template( 'objects/objects.html', objects=objects, display_properties=display_properties, display_property_titles=display_property_titles, search_query=query_string, action=action, action_translations=action_translations, action_id=action_id, action_type=action_type, project=project, project_id=project_id, group=group, group_id=group_id, location_id=location_id, location=location, user_id=user_id, user=user, doi=doi, get_object_if_current_user_has_read_permissions=get_object_if_current_user_has_read_permissions, get_instrument_translation_for_instrument_in_language=logic.instrument_translations.get_instrument_translation_for_instrument_in_language, build_modified_url=build_modified_url, sorting_property=sorting_property_name, sorting_order=sorting_order_name, limit=limit, offset=offset, pagination_enabled=pagination_enabled, num_objects_found=num_objects_found, show_action=show_action, use_advanced_search=use_advanced_search, must_use_advanced_search=must_use_advanced_search, advanced_search_had_error=advanced_search_had_error, search_notes=search_notes, search_tree=search_tree ) @jinja_filter def to_datatype(obj): return json.loads(json.dumps(obj), object_hook=JSONEncoder.object_hook) def get_sub_data_and_schema(data, schema, id_prefix): sub_data = data sub_schema = schema try: for key in id_prefix.split('__'): if sub_schema['type'] == 'array': key = int(key) sub_schema = sub_schema['items'] elif sub_schema['type'] == 'object': sub_schema = sub_schema['properties'][key] else: raise ValueError('invalid type') if isinstance(key, int): while key >= len(sub_data): sub_data.append(generate_placeholder(sub_schema)) elif key not in sub_data: sub_data[key] = generate_placeholder(sub_schema) sub_data = sub_data[key] if sub_schema['type'] != 'array': raise ValueError('invalid type') except (ValueError, KeyError, IndexError, TypeError): # TODO: error handling/logging? raise ValueError('invalid action') return sub_data, sub_schema def apply_action_to_form_data(action, form_data): new_form_data = form_data action_id_prefix, action_index, action_type = action[len('action_'):].rsplit('__', 2) if action_type == 'delete': deleted_item_index = int(action_index) parent_id_prefix = action_id_prefix new_form_data = {} for name in form_data: if not name.startswith(parent_id_prefix + '__'): new_form_data[name] = form_data[name] else: item_index, id_suffix = name[len(parent_id_prefix) + 2:].split('__', 1) item_index = int(item_index) if item_index < deleted_item_index: new_form_data[name] = form_data[name] if item_index > deleted_item_index: new_name = parent_id_prefix + '__' + str(item_index - 1) + '__' + id_suffix new_form_data[new_name] = form_data[name] return new_form_data def apply_action_to_data(action, data, schema): action_id_prefix, action_index, action_type = action[len('action_'):].rsplit('__', 2) if action_type not in ('add', 'delete', 'addcolumn', 'deletecolumn'): raise ValueError('invalid action') sub_data, sub_schema = get_sub_data_and_schema(data, schema, action_id_prefix.split('__', 1)[1]) if action_type in ('addcolumn', 'deletecolumn') and (sub_schema["style"] != "table" or sub_schema["items"]["type"] != "array"): raise ValueError('invalid action') num_existing_items = len(sub_data) if action_type == 'add': if 'maxItems' not in sub_schema or num_existing_items < sub_schema["maxItems"]: sub_data.append(generate_placeholder(sub_schema["items"])) if isinstance(sub_data[-1], list) and sub_schema.get('style') == 'table': num_existing_columns = sub_schema["items"].get("minItems", 0) for row in sub_data: num_existing_columns = max(num_existing_columns, len(row)) while len(sub_data[-1]) < num_existing_columns: sub_data[-1].append(None) elif action_type == 'delete': action_index = int(action_index) if ('minItems' not in sub_schema or num_existing_items > sub_schema["minItems"]) and action_index < num_existing_items: del sub_data[action_index] else: num_existing_columns = sub_schema["items"].get("minItems", 0) for row in sub_data: num_existing_columns = max(num_existing_columns, len(row)) if action_type == 'addcolumn': if 'maxItems' not in sub_schema["items"] or num_existing_columns < sub_schema["items"]["maxItems"]: num_existing_columns += 1 for row in sub_data: while len(row) < num_existing_columns: row.append(generate_placeholder(sub_schema["items"]["items"])) elif action_type == 'deletecolumn': if num_existing_columns > sub_schema.get("minItems", 0): num_existing_columns -= 1 for row in sub_data: while len(row) > num_existing_columns: del row[-1] def show_object_form(object, action, previous_object=None, should_upgrade_schema=False, placeholder_data=None): if object is None and previous_object is None: data = generate_placeholder(action.schema) if placeholder_data: for path, value in placeholder_data.items(): try: sub_data = data for step in path[:-1]: sub_data = sub_data[step] sub_data[path[-1]] = value except Exception: # Ignore invalid placeholder data pass elif object is None and previous_object is not None: data = logic.schemas.copy_data(previous_object.data, previous_object.schema) else: data = object.data previous_object_schema = None mode = 'edit' if should_upgrade_schema: mode = 'upgrade' assert object is not None schema = action.schema data, upgrade_warnings = logic.schemas.convert_to_schema(object.data, object.schema, action.schema) for upgrade_warning in upgrade_warnings: flask.flash(upgrade_warning, 'warning') elif object is not None: schema = object.schema elif previous_object is not None: schema = previous_object.schema previous_object_schema = schema else: schema = action.schema if action is not None and action.instrument is not None and flask_login.current_user in action.instrument.responsible_users: may_create_log_entry = True create_log_entry_default = action.instrument.create_log_entry_default instrument_log_categories = logic.instrument_log_entries.get_instrument_log_categories(action.instrument.id) if 'create_instrument_log_entry' in flask.request.form: category_ids = [] for category_id in flask.request.form.getlist('instrument_log_categories'): try: if int(category_id) in [category.id for category in instrument_log_categories]: category_ids.append(int(category_id)) except Exception: pass else: category_ids = None else: instrument_log_categories = None category_ids = None create_log_entry_default = None may_create_log_entry = False permissions_for_group_id = None permissions_for_project_id = None copy_permissions_object_id = None if object is None: if flask.request.form.get('permissions_method') == 'copy_permissions' and flask.request.form.get('copy_permissions_object_id'): copy_permissions_object_id = flask.request.form.get('copy_permissions_object_id') try: copy_permissions_object_id = int(copy_permissions_object_id) if Permissions.READ not in get_user_object_permissions(copy_permissions_object_id, flask_login.current_user.id): flask.flash(_("Unable to copy permissions. Default permissions will be applied."), 'error') copy_permissions_object_id = None except Exception: flask.flash(_("Unable to copy permissions. Default permissions will be applied."), 'error') copy_permissions_object_id = None elif flask.request.form.get('permissions_method') == 'permissions_for_group' and flask.request.form.get('permissions_for_group_group_id'): permissions_for_group_id = flask.request.form.get('permissions_for_group_group_id') try: permissions_for_group_id = int(permissions_for_group_id) if flask_login.current_user.id not in logic.groups.get_group_member_ids(permissions_for_group_id): flask.flash(_("Unable to grant permissions to basic group. Default permissions will be applied."), 'error') permissions_for_group_id = None except Exception: flask.flash(_("Unable to grant permissions to basic group. Default permissions will be applied."), 'error') permissions_for_group_id = None elif flask.request.form.get('permissions_method') == 'permissions_for_project' and flask.request.form.get('permissions_for_project_project_id'): permissions_for_project_id = flask.request.form.get('permissions_for_project_project_id') try: permissions_for_project_id = int(permissions_for_project_id) if flask_login.current_user.id not in logic.projects.get_project_member_user_ids_and_permissions(permissions_for_project_id, include_groups=True): flask.flash(_("Unable to grant permissions to project group. Default permissions will be applied."), 'error') permissions_for_project_id = None except Exception: flask.flash(_("Unable to grant permissions to project group. Default permissions will be applied."), 'error') permissions_for_project_id = None if previous_object is not None: action_id = previous_object.action_id previous_object_id = previous_object.id has_grant_for_previous_object = Permissions.GRANT in get_user_object_permissions(user_id=flask_login.current_user.id, object_id=previous_object_id) else: action_id = action.id previous_object_id = None has_grant_for_previous_object = False errors = [] object_errors = {} form_data = {} previous_actions = [] serializer = itsdangerous.URLSafeSerializer(flask.current_app.config['SECRET_KEY']) form = ObjectForm() if flask.request.method != 'GET' and form.validate_on_submit(): raw_form_data = {key: flask.request.form.getlist(key) for key in flask.request.form} form_data = {k: v[0] for k, v in raw_form_data.items()} if 'input_num_batch_objects' in form_data: try: num_objects_in_batch = int(form_data['input_num_batch_objects']) except ValueError: try: # The form allows notations like '1.2e1' for '12', however # Python can only parse these as floats num_objects_in_batch = float(form_data['input_num_batch_objects']) if num_objects_in_batch == int(num_objects_in_batch): num_objects_in_batch = int(num_objects_in_batch) else: raise except ValueError: errors.append('input_num_batch_objects') num_objects_in_batch = None else: form_data['input_num_batch_objects'] = str(num_objects_in_batch) else: form_data['input_num_batch_objects'] = str(num_objects_in_batch) else: num_objects_in_batch = None if 'previous_actions' in flask.request.form: try: previous_actions = serializer.loads(flask.request.form['previous_actions']) except itsdangerous.BadData: flask.abort(400) if "action_submit" in form_data: # The object name might need the batch number to match the pattern if schema.get('batch', False) and num_objects_in_batch is not None: name_suffix_format = schema.get('batch_name_format', '{:d}') try: name_suffix_format.format(1) except (ValueError, KeyError): name_suffix_format = '{:d}' if name_suffix_format: example_name_suffix = name_suffix_format.format(1) else: example_name_suffix = '' if 'object__name__text' in form_data: batch_base_name = form_data['object__name__text'] raw_form_data['object__name__text'] = [batch_base_name + example_name_suffix] else: enabled_languages = form_data.get('object__name__text_languages', []) if 'en' not in enabled_languages: enabled_languages.append('en') for language_code in enabled_languages: batch_base_name = form_data.get('object__name__text_' + language_code, '') raw_form_data['object__name__text_' + language_code] = [batch_base_name + example_name_suffix] else: batch_base_name = None name_suffix_format = None object_data, object_errors = parse_form_data(raw_form_data, schema) errors += object_errors if object_data is not None and not errors: try: validate(object_data, schema) except ValidationError: # TODO: proper logging print('object schema validation failed') # TODO: handle error flask.abort(400) for markdown in logic.markdown_to_html.get_markdown_from_object_data(object_data): markdown_as_html = logic.markdown_to_html.markdown_to_safe_html(markdown) logic.markdown_images.mark_referenced_markdown_images_as_permanent(markdown_as_html) if object is None: if schema.get('batch', False) and num_objects_in_batch is not None: if 'name' in object_data and 'text' in object_data['name'] and name_suffix_format is not None and batch_base_name is not None: data_sequence = [] for i in range(1, num_objects_in_batch + 1): if name_suffix_format: name_suffix = name_suffix_format.format(i) else: name_suffix = '' object_data['name']['text'] = batch_base_name + name_suffix data_sequence.append(deepcopy(object_data)) else: data_sequence = [object_data] * num_objects_in_batch objects = create_object_batch( action_id=action.id, data_sequence=data_sequence, user_id=flask_login.current_user.id, copy_permissions_object_id=copy_permissions_object_id, permissions_for_group_id=permissions_for_group_id, permissions_for_project_id=permissions_for_project_id ) object_ids = [object.id for object in objects] if category_ids is not None: log_entry = logic.instrument_log_entries.create_instrument_log_entry( instrument_id=action.instrument.id, user_id=flask_login.current_user.id, content='', category_ids=category_ids ) for object_id in object_ids: logic.instrument_log_entries.create_instrument_log_object_attachment( instrument_log_entry_id=log_entry.id, object_id=object_id ) flask.flash(_('The objects were created successfully.'), 'success') return flask.redirect(flask.url_for('.objects', ids=','.join([str(object_id) for object_id in object_ids]))) else: object = create_object( action_id=action.id, data=object_data, user_id=flask_login.current_user.id, previous_object_id=previous_object_id, schema=previous_object_schema, copy_permissions_object_id=copy_permissions_object_id, permissions_for_group_id=permissions_for_group_id, permissions_for_project_id=permissions_for_project_id ) if category_ids is not None: log_entry = logic.instrument_log_entries.create_instrument_log_entry( instrument_id=action.instrument.id, user_id=flask_login.current_user.id, content='', category_ids=category_ids ) logic.instrument_log_entries.create_instrument_log_object_attachment( instrument_log_entry_id=log_entry.id, object_id=object.id ) flask.flash(_('The object was created successfully.'), 'success') else: if object_data != object.data or schema != object.schema: update_object(object_id=object.id, user_id=flask_login.current_user.id, data=object_data, schema=schema) flask.flash(_('The object was updated successfully.'), 'success') return flask.redirect(flask.url_for('.object', object_id=object.id)) elif any(name.startswith('action_object__') and (name.endswith('__delete') or name.endswith('__add') or name.endswith('__addcolumn') or name.endswith('__deletecolumn')) for name in form_data): action = [name for name in form_data if name.startswith('action_')][0] previous_actions.append(action) if previous_actions: try: for action in previous_actions: apply_action_to_data(action, data, schema) form_data = apply_action_to_form_data(previous_actions[-1], form_data) except ValueError: flask.abort(400) if not flask.current_app.config["LOAD_OBJECTS_IN_BACKGROUND"]: referencable_objects = get_objects_with_permissions( user_id=flask_login.current_user.id, permissions=Permissions.READ ) if object is not None: referencable_objects = [ referencable_object for referencable_object in referencable_objects if referencable_object.object_id != object.object_id ] else: referencable_objects = [] existing_objects = [] sorted_actions = get_sorted_actions_for_user( user_id=flask_login.current_user.id ) action_type_id_by_action_id = {} for action_type in get_action_types(): for action in get_actions(action_type.id): action_type_id_by_action_id[action.id] = action_type.id tags = [{'name': tag.name, 'uses': tag.uses} for tag in logic.tags.get_tags()] users = get_users(exclude_hidden=True) users.sort(key=lambda user: user.id) english = get_language(Language.ENGLISH) if object is None: if not flask.current_app.config["LOAD_OBJECTS_IN_BACKGROUND"]: existing_objects = get_objects_with_permissions( user_id=flask_login.current_user.id, permissions=Permissions.GRANT ) user_groups = logic.groups.get_user_groups(flask_login.current_user.id) user_projects = logic.projects.get_user_projects(flask_login.current_user.id, include_groups=True) return flask.render_template( 'objects/forms/form_create.html', action_id=action_id, schema=schema, data=data, errors=errors, object_errors=object_errors, form_data=form_data, previous_actions=serializer.dumps(previous_actions), form=form, can_copy_permissions=True, existing_objects=existing_objects, user_groups=user_groups, user_projects=user_projects, referencable_objects=referencable_objects, sorted_actions=sorted_actions, action_type_id_by_action_id=action_type_id_by_action_id, get_object_if_current_user_has_read_permissions=get_object_if_current_user_has_read_permissions, ActionType=models.ActionType, datetime=datetime, tags=tags, users=users, may_create_log_entry=may_create_log_entry, instrument_log_categories=instrument_log_categories, create_log_entry_default=create_log_entry_default, previous_object_id=previous_object_id, has_grant_for_previous_object=has_grant_for_previous_object, languages=get_languages(only_enabled_for_input=True), ENGLISH=english ) else: return flask.render_template( 'objects/forms/form_edit.html', schema=schema, data=data, object_id=object.object_id, errors=errors, object_errors=object_errors, form_data=form_data, previous_actions=serializer.dumps(previous_actions), form=form, referencable_objects=referencable_objects, sorted_actions=sorted_actions, get_object_if_current_user_has_read_permissions=get_object_if_current_user_has_read_permissions, action_type_id_by_action_id=action_type_id_by_action_id, ActionType=models.ActionType, datetime=datetime, tags=tags, users=users, mode=mode, languages=get_languages(), ENGLISH=english ) def build_object_location_assignment_confirmation_url(object_location_assignment_id: int) -> None: confirmation_url = flask.url_for( 'frontend.accept_responsibility_for_object', t=logic.security_tokens.generate_token( object_location_assignment_id, salt='confirm_responsibility', secret_key=flask.current_app.config['SECRET_KEY'] ), _external=True ) return confirmation_url def get_project_if_it_exists(project_id): try: return get_project(project_id) except logic.errors.ProjectDoesNotExistError: return None def show_inline_edit(obj, action): # Set view attributes related_objects_tree = logic.object_relationships.build_related_objects_tree(obj.id, flask_login.current_user.id) user_language_id = get_user_language(flask_login.current_user).id english = get_language(Language.ENGLISH) object_id = obj.id user_permissions = get_user_object_permissions(object_id=object_id, user_id=flask_login.current_user.id) user_may_grant = Permissions.GRANT in user_permissions user_may_use_as_template = Permissions.READ in get_user_action_permissions(obj.action_id, user_id=flask_login.current_user.id) new_schema_available = True if action.schema != obj.schema else False instrument = get_instrument_with_translation_in_language(action.instrument_id, user_language_id) if action.instrument else None object_type = get_action_type_with_translation_in_language( action_type_id=action.type_id, language_id=user_language_id ).translation.object_name object_log_entries = object_log.get_object_log_entries(object_id=obj.id, user_id=flask_login.current_user.id) dataverse_enabled = bool(flask.current_app.config['DATAVERSE_URL']) if dataverse_enabled: dataverse_url = logic.dataverse_export.get_dataverse_url(obj.id) show_dataverse_export = not dataverse_url else: dataverse_url = None show_dataverse_export = False serializer = itsdangerous.URLSafeTimedSerializer(flask.current_app.config['SECRET_KEY'], salt='mobile-upload') token = serializer.dumps([flask_login.current_user.id, object_id]) mobile_upload_url = flask.url_for('.mobile_file_upload', object_id=object_id, token=token, _external=True) mobile_upload_qrcode = generate_qrcode(mobile_upload_url, should_cache=False) object_url = flask.url_for('.object', object_id=object_id, _external=True) object_qrcode = generate_qrcode(object_url, should_cache=True) location_form = ObjectLocationAssignmentForm() locations_map, locations_tree = get_locations_tree() locations = [('-1', '—')] unvisited_location_ids_prefixes_and_subtrees = [(location_id, '', locations_tree[location_id]) for location_id in locations_tree] while unvisited_location_ids_prefixes_and_subtrees: location_id, prefix, subtree = unvisited_location_ids_prefixes_and_subtrees.pop(0) location = locations_map[location_id] locations.append( (str(location_id), '{}{} (#{})'.format(prefix, get_translated_text(location.name), location.id))) for location_id in sorted(subtree, key=lambda location_id: get_translated_text(locations_map[location_id].name), reverse=True): unvisited_location_ids_prefixes_and_subtrees.insert( 0, (location_id, f'{prefix}{get_translated_text(location.name)} / ', subtree[location_id]) ) location_form.location.choices = locations possible_responsible_users = [('-1', '—')] for user in logic.users.get_users(exclude_hidden=True): possible_responsible_users.append((str(user.id), '{} (#{})'.format(user.name, user.id))) location_form.responsible_user.choices = possible_responsible_users measurement_actions = logic.action_translations.get_actions_with_translation_in_language(user_language_id, models.ActionType.MEASUREMENT, use_fallback=True) favorite_action_ids = logic.favorites.get_user_favorite_action_ids(flask_login.current_user.id) favorite_measurement_actions = [ action for action in measurement_actions if action.id in favorite_action_ids and not action.is_hidden ] # Sort by: instrument name (independent actions first), action name favorite_measurement_actions.sort(key=lambda action: ( action.user.name.lower() if action.user else '', get_instrument_with_translation_in_language(action.instrument_id, user_language_id).translation.name.lower() if action.instrument else '', action.translation.name.lower() )) publication_form = ObjectPublicationForm() object_publications = logic.publications.get_publications_for_object(object_id=obj.id) user_may_link_publication = True notebook_templates = get_notebook_templates( object_id=obj.id, data=obj.data, schema=obj.schema, user_id=flask_login.current_user.id ) linked_project = logic.projects.get_project_linked_to_object(object_id) object_languages = logic.languages.get_languages_in_object_data(obj.data) languages = [] for lang_code in object_languages: languages.append(get_language_by_lang_code(lang_code)) all_languages = get_languages() metadata_language = flask.request.args.get('language', None) if not any( language.lang_code == metadata_language for language in languages ): metadata_language = None view_kwargs = { "template_mode": "inline_edit", "show_object_type_and_id_on_object_page_text": get_user_settings(flask_login.current_user.id)["SHOW_OBJECT_TYPE_AND_ID_ON_OBJECT_PAGE"], "show_object_title": get_user_settings(flask_login.current_user.id)["SHOW_OBJECT_TITLE"], "measurement_type_name": logic.action_type_translations.get_action_type_translation_for_action_type_in_language( action_type_id=logic.actions.models.ActionType.MEASUREMENT, language_id=logic.languages.get_user_language(flask_login.current_user).id, use_fallback=True ).name, "metadata_language": metadata_language, "languages": languages, "all_languages": all_languages, "SUPPORTED_LOCALES": logic.locale.SUPPORTED_LOCALES, "ENGLISH": english, "object_type": object_type, "action": action, "action_type": get_action_type_with_translation_in_language(action.type_id, user_language_id), "instrument": instrument, "schema": obj.schema, "data": obj.data, "object_log_entries": object_log_entries, "ObjectLogEntryType": ObjectLogEntryType, "last_edit_datetime": obj.utc_datetime, "last_edit_user": get_user(obj.user_id), "object_id": object_id, "user_may_edit": True, "user_may_comment": True, "comments": comments.get_comments_for_object(object_id), "comment_form": CommentForm(), "files": logic.files.get_files_for_object(object_id), "file_source_instrument_exists": False, "file_source_jupyterhub_exists": False, "file_form": FileForm(), "external_link_form": ExternalLinkForm(), "external_link_invalid": 'invalid_link' in flask.request.args, "mobile_upload_url": mobile_upload_url, "mobile_upload_qrcode": mobile_upload_qrcode, "notebook_templates": notebook_templates, "object_qrcode": object_qrcode, "object_url": object_url, "restore_form": None, "version_id": obj.version_id, "user_may_grant": user_may_grant, "favorite_measurement_actions": favorite_measurement_actions, "FileLogEntryType": FileLogEntryType, "file_information_form": FileInformationForm(), "file_hiding_form": FileHidingForm(), "new_schema_available": new_schema_available, "related_objects_tree": related_objects_tree, "object_publications": object_publications, "user_may_link_publication": user_may_link_publication, "user_may_use_as_template": user_may_use_as_template, "show_dataverse_export": show_dataverse_export, "dataverse_url": dataverse_url, "publication_form": publication_form, "get_object": get_object, "get_object_if_current_user_has_read_permissions": get_object_if_current_user_has_read_permissions, "get_object_location_assignment": get_object_location_assignment, "get_user": get_user, "get_location": get_location, "PAGE_SIZES": PAGE_SIZES, "HORIZONTAL_LABEL_MARGIN": HORIZONTAL_LABEL_MARGIN, "VERTICAL_LABEL_MARGIN": VERTICAL_LABEL_MARGIN, "mm": mm, "object_location_assignments": get_object_location_assignments(object_id), "build_object_location_assignment_confirmation_url": build_object_location_assignment_confirmation_url, "user_may_assign_location": True, "location_form": location_form, "project": linked_project, "get_project": get_project_if_it_exists, "get_action_type": get_action_type, "get_action_type_with_translation_in_language": get_action_type_with_translation_in_language, "get_instrument_with_translation_in_language": get_instrument_with_translation_in_language } # form kwargs if action is not None and action.instrument is not None and flask_login.current_user in action.instrument.responsible_users: instrument_log_categories = logic.instrument_log_entries.get_instrument_log_categories(action.instrument.id) if 'create_instrument_log_entry' in flask.request.form: category_ids = [] for category_id in flask.request.form.getlist('instrument_log_categories'): try: if int(category_id) in [category.id for category in instrument_log_categories]: category_ids.append(int(category_id)) except Exception: pass errors = [] object_errors = {} form_data = {} previous_actions = [] serializer = itsdangerous.URLSafeSerializer(flask.current_app.config['SECRET_KEY']) form = ObjectForm() if flask.request.method != 'GET' and form.validate_on_submit(): raw_form_data = {key: flask.request.form.getlist(key) for key in flask.request.form} form_data = {k: v[0] for k, v in raw_form_data.items()} if 'input_num_batch_objects' in form_data: try: num_objects_in_batch = int(form_data['input_num_batch_objects']) except ValueError: try: # The form allows notations like '1.2e1' for '12', however # Python can only parse these as floats num_objects_in_batch = float(form_data['input_num_batch_objects']) if num_objects_in_batch == int(num_objects_in_batch): num_objects_in_batch = int(num_objects_in_batch) else: raise except ValueError: errors.append('input_num_batch_objects') else: form_data['input_num_batch_objects'] = str(num_objects_in_batch) else: form_data['input_num_batch_objects'] = str(num_objects_in_batch) if 'previous_actions' in flask.request.form: try: previous_actions = serializer.loads(flask.request.form['previous_actions']) except itsdangerous.BadData: flask.abort(400) if not flask.current_app.config["LOAD_OBJECTS_IN_BACKGROUND"]: referencable_objects = get_objects_with_permissions( user_id=flask_login.current_user.id, permissions=Permissions.READ ) if object is not None: referencable_objects = [ referencable_object for referencable_object in referencable_objects if referencable_object.object_id != object_id ] else: referencable_objects = [] sorted_actions = get_sorted_actions_for_user( user_id=flask_login.current_user.id ) for action in sorted_actions: db.session.expunge(action) action_type_id_by_action_id = {} for action_type in get_action_types(): for action in get_actions(action_type.id): action_type_id_by_action_id[action.id] = action_type.id tags = [{'name': tag.name, 'uses': tag.uses} for tag in logic.tags.get_tags()] users = get_users(exclude_hidden=True) users.sort(key=lambda user: user.id) english = get_language(Language.ENGLISH) form_kwargs = { "errors": errors, "object_errors": object_errors, "form_data": form_data, "previous_actions": serializer.dumps(previous_actions), "form": form, "referencable_objects": referencable_objects, "sorted_actions": sorted_actions, "action_type_id_by_action_id": action_type_id_by_action_id, "ActionType": models.ActionType, "datetime": datetime, "tags": tags, "users": users, "mode": 'edit', "languages": get_languages(), "ENGLISH": english } kwargs = {**view_kwargs, **form_kwargs} return flask.render_template('objects/inline_edit/inline_edit_base.html', **kwargs) def get_object_if_current_user_has_read_permissions(object_id): user_id = flask_login.current_user.id try: permissions = get_user_object_permissions(object_id, user_id) except ObjectDoesNotExistError: return None if Permissions.READ not in permissions: return None return get_object(object_id) @frontend.route('/objects/<int:object_id>', methods=['GET', 'POST']) @object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized) def object(object_id): object = get_object(object_id=object_id) related_objects_tree = logic.object_relationships.build_related_objects_tree(object_id, flask_login.current_user.id) user_language_id = get_user_language(flask_login.current_user).id english = get_language(Language.ENGLISH) object_languages = set() user_permissions = get_user_object_permissions(object_id=object_id, user_id=flask_login.current_user.id) user_may_edit = Permissions.WRITE in user_permissions user_may_grant = Permissions.GRANT in user_permissions user_may_use_as_template = Permissions.READ in get_user_action_permissions(object.action_id, user_id=flask_login.current_user.id) action = get_action_with_translation_in_language(object.action_id, user_language_id, use_fallback=True) if action.schema != object.schema: new_schema_available = True else: new_schema_available = False if not user_may_edit and flask.request.args.get('mode', '') == 'edit': return flask.abort(403) if not user_may_edit and flask.request.args.get('mode', '') == 'upgrade': return flask.abort(403) if not flask.current_app.config['DISABLE_INLINE_EDIT']: if not user_may_edit and flask.request.args.get('mode', '') == 'inline_edit': return flask.abort(403) if user_may_edit and flask.request.method == 'GET' and flask.request.args.get('mode', '') in {'', 'inline_edit'}: return show_inline_edit(object, get_action(object.action_id)) if flask.request.method == 'GET' and flask.request.args.get('mode', '') not in ('edit', 'upgrade'): instrument = get_instrument_with_translation_in_language(action.instrument_id, user_language_id) if action.instrument else None object_type = get_action_type_with_translation_in_language( action_type_id=action.type_id, language_id=user_language_id ).translation.object_name object_log_entries = object_log.get_object_log_entries(object_id=object_id, user_id=flask_login.current_user.id) dataverse_enabled = bool(flask.current_app.config['DATAVERSE_URL']) if dataverse_enabled: dataverse_url = logic.dataverse_export.get_dataverse_url(object_id) show_dataverse_export = user_may_grant and not dataverse_url else: dataverse_url = None show_dataverse_export = False if user_may_edit: serializer = itsdangerous.URLSafeTimedSerializer(flask.current_app.config['SECRET_KEY'], salt='mobile-upload') token = serializer.dumps([flask_login.current_user.id, object_id]) mobile_upload_url = flask.url_for('.mobile_file_upload', object_id=object_id, token=token, _external=True) mobile_upload_qrcode = generate_qrcode(mobile_upload_url, should_cache=False) else: mobile_upload_url = None mobile_upload_qrcode = None object_url = flask.url_for('.object', object_id=object_id, _external=True) object_qrcode = generate_qrcode(object_url, should_cache=True) location_form = ObjectLocationAssignmentForm() locations_map, locations_tree = get_locations_tree() locations = [('-1', '—')] unvisited_location_ids_prefixes_and_subtrees = [(location_id, '', locations_tree[location_id]) for location_id in locations_tree] while unvisited_location_ids_prefixes_and_subtrees: location_id, prefix, subtree = unvisited_location_ids_prefixes_and_subtrees.pop(0) location = locations_map[location_id] locations.append((str(location_id), '{}{} (#{})'.format(prefix, get_translated_text(location.name), location.id))) for location_id in sorted(subtree, key=lambda location_id: get_translated_text(locations_map[location_id].name), reverse=True): unvisited_location_ids_prefixes_and_subtrees.insert(0, (location_id, '{}{} / '.format(prefix, get_translated_text(location.name)), subtree[location_id])) location_form.location.choices = locations possible_responsible_users = [('-1', '—')] for user in logic.users.get_users(exclude_hidden=True): possible_responsible_users.append((str(user.id), '{} (#{})'.format(user.name, user.id))) location_form.responsible_user.choices = possible_responsible_users measurement_actions = logic.action_translations.get_actions_with_translation_in_language(user_language_id, models.ActionType.MEASUREMENT, use_fallback=True) favorite_action_ids = logic.favorites.get_user_favorite_action_ids(flask_login.current_user.id) favorite_measurement_actions = [ action for action in measurement_actions if action.id in favorite_action_ids and not action.is_hidden ] # Sort by: instrument name (independent actions first), action name favorite_measurement_actions.sort(key=lambda action: ( action.user.name.lower() if action.user else '', get_instrument_with_translation_in_language(action.instrument_id, user_language_id).translation.name.lower() if action.instrument else '', action.translation.name.lower() )) publication_form = ObjectPublicationForm() object_publications = logic.publications.get_publications_for_object(object_id=object.id) user_may_link_publication = Permissions.WRITE in user_permissions notebook_templates = get_notebook_templates( object_id=object.id, data=object.data, schema=object.schema, user_id=flask_login.current_user.id ) linked_project = logic.projects.get_project_linked_to_object(object_id) object_languages = logic.languages.get_languages_in_object_data(object.data) languages = [] for lang_code in object_languages: languages.append(get_language_by_lang_code(lang_code)) all_languages = get_languages() metadata_language = flask.request.args.get('language', None) if not any( language.lang_code == metadata_language for language in languages ): metadata_language = None return flask.render_template( 'objects/view/base.html', template_mode="view", show_object_type_and_id_on_object_page_text=get_user_settings(flask_login.current_user.id)["SHOW_OBJECT_TYPE_AND_ID_ON_OBJECT_PAGE"], show_object_title=get_user_settings(flask_login.current_user.id)["SHOW_OBJECT_TITLE"], measurement_type_name=logic.action_type_translations.get_action_type_translation_for_action_type_in_language( action_type_id=logic.actions.models.ActionType.MEASUREMENT, language_id=logic.languages.get_user_language(flask_login.current_user).id, use_fallback=True ).name, metadata_language=metadata_language, languages=languages, all_languages=all_languages, SUPPORTED_LOCALES=logic.locale.SUPPORTED_LOCALES, ENGLISH=english, object_type=object_type, action=action, action_type=get_action_type_with_translation_in_language(action.type_id, user_language_id), instrument=instrument, schema=object.schema, data=object.data, object_log_entries=object_log_entries, ObjectLogEntryType=ObjectLogEntryType, last_edit_datetime=object.utc_datetime, last_edit_user=get_user(object.user_id), object_id=object_id, user_may_edit=user_may_edit, user_may_comment=user_may_edit, comments=comments.get_comments_for_object(object_id), comment_form=CommentForm(), files=logic.files.get_files_for_object(object_id), file_source_instrument_exists=False, file_source_jupyterhub_exists=False, file_form=FileForm(), external_link_form=ExternalLinkForm(), external_link_invalid='invalid_link' in flask.request.args, mobile_upload_url=mobile_upload_url, mobile_upload_qrcode=mobile_upload_qrcode, notebook_templates=notebook_templates, object_qrcode=object_qrcode, object_url=object_url, restore_form=None, version_id=object.version_id, user_may_grant=user_may_grant, favorite_measurement_actions=favorite_measurement_actions, FileLogEntryType=FileLogEntryType, file_information_form=FileInformationForm(), file_hiding_form=FileHidingForm(), new_schema_available=new_schema_available, related_objects_tree=related_objects_tree, object_publications=object_publications, user_may_link_publication=user_may_link_publication, user_may_use_as_template=user_may_use_as_template, show_dataverse_export=show_dataverse_export, dataverse_url=dataverse_url, publication_form=publication_form, get_object=get_object, get_object_if_current_user_has_read_permissions=get_object_if_current_user_has_read_permissions, get_object_location_assignment=get_object_location_assignment, get_user=get_user, get_location=get_location, PAGE_SIZES=PAGE_SIZES, HORIZONTAL_LABEL_MARGIN=HORIZONTAL_LABEL_MARGIN, VERTICAL_LABEL_MARGIN=VERTICAL_LABEL_MARGIN, mm=mm, object_location_assignments=get_object_location_assignments(object_id), build_object_location_assignment_confirmation_url=build_object_location_assignment_confirmation_url, user_may_assign_location=user_may_edit, location_form=location_form, project=linked_project, get_project=get_project_if_it_exists, get_action_type=get_action_type, get_action_type_with_translation_in_language=get_action_type_with_translation_in_language, get_instrument_with_translation_in_language=get_instrument_with_translation_in_language ) check_current_user_is_not_readonly() if flask.request.args.get('mode', '') == 'upgrade': should_upgrade_schema = True else: should_upgrade_schema = False return show_object_form(object, action=get_action(object.action_id), should_upgrade_schema=should_upgrade_schema) @frontend.route('/objects/<int:object_id>/dc.rdf') @frontend.route('/objects/<int:object_id>/versions/<int:version_id>/dc.rdf') @object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized) def object_rdf(object_id, version_id=None): rdf_xml = logic.rdf.generate_rdf(flask_login.current_user.id, object_id, version_id) return flask.Response( rdf_xml, mimetype='application/rdf+xml', ) @frontend.route('/objects/<int:object_id>/label') @object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized) def print_object_label(object_id): mode = flask.request.args.get('mode', 'mixed') if mode == 'fixed-width': create_mixed_labels = False create_long_labels = False include_qrcode_in_long_labels = None paper_format = flask.request.args.get('width-paper-format', '') if paper_format not in PAGE_SIZES: paper_format = DEFAULT_PAPER_FORMAT maximum_width = math.floor(PAGE_SIZES[paper_format][0] / mm - 2 * HORIZONTAL_LABEL_MARGIN) maximum_height = math.floor(PAGE_SIZES[paper_format][1] / mm - 2 * VERTICAL_LABEL_MARGIN) ghs_classes_side_by_side = 'side-by-side' in flask.request.args label_minimum_width = 20 if ghs_classes_side_by_side: label_minimum_width = 40 try: label_width = float(flask.request.args.get('label-width', '20')) except ValueError: label_width = 0 if math.isnan(label_width): label_width = 0 if label_width < label_minimum_width: label_width = label_minimum_width if label_width > maximum_width: label_width = maximum_width try: label_minimum_height = float(flask.request.args.get('label-minimum-height', '0')) except ValueError: label_minimum_height = 0 if math.isnan(label_minimum_height): label_minimum_height = 0 if label_minimum_height < 0: label_minimum_height = 0 if label_minimum_height > maximum_height: label_minimum_height = maximum_height qrcode_width = 18 centered = 'centered' in flask.request.args elif mode == 'minimum-height': create_mixed_labels = False create_long_labels = True paper_format = flask.request.args.get('height-paper-format', '') if paper_format not in PAGE_SIZES: paper_format = DEFAULT_PAPER_FORMAT maximum_width = math.floor(PAGE_SIZES[paper_format][0] / mm - 2 * HORIZONTAL_LABEL_MARGIN) include_qrcode_in_long_labels = 'include-qrcode' in flask.request.args label_width = 0 label_minimum_height = 0 try: label_minimum_width = float(flask.request.args.get('label-minimum-width', '0')) except ValueError: label_minimum_width = 0 if math.isnan(label_minimum_width): label_minimum_width = 0 if label_minimum_width < 0: label_minimum_width = 0 if label_minimum_width > maximum_width: label_minimum_width = maximum_width qrcode_width = 0 ghs_classes_side_by_side = None centered = None else: create_mixed_labels = True create_long_labels = None include_qrcode_in_long_labels = None paper_format = flask.request.args.get('mixed-paper-format', '') if paper_format not in PAGE_SIZES: paper_format = DEFAULT_PAPER_FORMAT label_width = 0 label_minimum_height = 0 qrcode_width = 0 label_minimum_width = 0 ghs_classes_side_by_side = None centered = None object = get_object(object_id=object_id) object_log_entries = object_log.get_object_log_entries(object_id=object_id, user_id=flask_login.current_user.id) for object_log_entry in object_log_entries: if object_log_entry.type in (ObjectLogEntryType.CREATE_OBJECT, ObjectLogEntryType.CREATE_BATCH): creation_date = object_log_entry.utc_datetime.strftime('%Y-%m-%d') creation_user = get_user(object_log_entry.user_id).name break else: creation_date = _('Unknown') creation_user = _('Unknown') if 'created' in object.data and '_type' in object.data['created'] and object.data['created']['_type'] == 'datetime': creation_date = object.data['created']['utc_datetime'].split(' ')[0] if 'name' in object.data and '_type' in object.data['name'] and object.data['name']['_type'] == 'text': object_name = get_translated_text(object.data['name']['text']) else: object_name = _('Unknown Object') object_url = flask.url_for('.object', object_id=object_id, _external=True) if 'hazards' in object.data and '_type' in object.data['hazards'] and object.data['hazards']['_type'] == 'hazards': hazards = object.data['hazards']['hazards'] else: hazards = [] pdf_data = create_labels( object_id=object_id, object_name=object_name, object_url=object_url, creation_user=creation_user, creation_date=creation_date, ghs_classes=hazards, paper_format=paper_format, create_mixed_labels=create_mixed_labels, create_long_labels=create_long_labels, include_qrcode_in_long_labels=include_qrcode_in_long_labels, label_width=label_width, label_minimum_height=label_minimum_height, label_minimum_width=label_minimum_width, qrcode_width=qrcode_width, ghs_classes_side_by_side=ghs_classes_side_by_side, centered=centered ) return flask.send_file( io.BytesIO(pdf_data), mimetype='application/pdf', cache_timeout=-1 ) @frontend.route('/objects/<int:object_id>/comments/', methods=['POST']) @object_permissions_required(Permissions.WRITE) def post_object_comments(object_id): check_current_user_is_not_readonly() comment_form = CommentForm() if comment_form.validate_on_submit(): content = comment_form.content.data comments.create_comment(object_id=object_id, user_id=flask_login.current_user.id, content=content) flask.flash(_('Successfully posted a comment.'), 'success') else: flask.flash(_('Please enter a comment text.'), 'error') return flask.redirect(flask.url_for('.object', object_id=object_id)) @frontend.route('/objects/search/') @flask_login.login_required def search(): actions = get_sorted_actions_for_user( user_id=flask_login.current_user.id ) user_language_id = get_user_language(flask_login.current_user).id action_types = get_action_types_with_translations_in_language(user_language_id) search_paths = {} search_paths_by_action = {} search_paths_by_action_type = {} for action_type in action_types: search_paths_by_action_type[action_type.id] = {} for action in actions: search_paths_by_action[action.id] = {} if action.type_id not in search_paths_by_action_type: search_paths_by_action_type[action.type_id] = {} for property_path, property_type in logic.schemas.utils.get_property_paths_for_schema( schema=action.schema, valid_property_types={'text', 'bool', 'quantity', 'datetime'} ).items(): property_path = '.'.join( key if key is not None else '?' for key in property_path ) search_paths_by_action[action.id][property_path] = [property_type] if property_path not in search_paths_by_action_type[action.type_id]: search_paths_by_action_type[action.type_id][property_path] = [property_type] elif property_type not in search_paths_by_action_type[action.type_id][property_path]: search_paths_by_action_type[action.type_id][property_path].append(property_type) if property_path not in search_paths: search_paths[property_path] = [property_type] elif property_type not in search_paths[property_path]: search_paths[property_path].append(property_type) return flask.render_template( 'search.html', search_paths=search_paths, search_paths_by_action=search_paths_by_action, search_paths_by_action_type=search_paths_by_action_type, actions=actions, action_types=action_types, datetime=datetime ), 200, { 'Cache-Control': 'no-cache, no-store, must-revalidate', 'Pragma': 'no-cache', 'Expires': '0' } @frontend.route('/objects/referencable') @flask_login.login_required def referencable_objects(): required_perm = Permissions.READ if 'required_perm' in flask.request.args: try: required_perm = Permissions.from_name(flask.request.args['required_perm']) except ValueError: try: required_perm = Permissions(int(flask.request.args['required_perm'])) except ValueError: return { "message": "argument {} is not a valid permission.".format(flask.request.args['required_perm']) }, 400 referencable_objects = get_object_info_with_permissions( user_id=flask_login.current_user.id, permissions=required_perm, ) def dictify(x): return { 'id': x.object_id, 'text': flask.escape('{} (#{})'.format(get_translated_text(x.name_json), x.object_id)), 'action_id': x.action_id, 'max_permission': x.max_permission, 'tags': [flask.escape(tag) for tag in x.tags['tags']] if x.tags and isinstance(x.tags, dict) and x.tags.get('_type') == 'tags' and x.tags.get('tags') else [] } return {'referencable_objects': [dictify(x) for x in referencable_objects]} @frontend.route('/objects/<int:object_id>/permissions/request', methods=['POST']) @flask_login.login_required def object_permissions_request(object_id): current_permissions = get_user_object_permissions(object_id=object_id, user_id=flask_login.current_user.id) if Permissions.READ in current_permissions: flask.flash(_('You already have permissions to access this object.'), 'error') return flask.redirect(flask.url_for('.object', object_id=object_id)) request_object_permissions(flask_login.current_user.id, object_id) flask.flash(_('Your request for permissions has been sent.'), 'success') return flask.redirect(flask.url_for('.objects')) @frontend.route('/objects/<int:object_id>/locations/', methods=['POST']) @object_permissions_required(Permissions.WRITE) def post_object_location(object_id): check_current_user_is_not_readonly() location_form = ObjectLocationAssignmentForm() location_form.location.choices = [('-1', '—')] + [ (str(location.id), '{} (#{})'.format(location.name, location.id)) for location in get_locations() ] possible_responsible_users = [('-1', '—')] for user in logic.users.get_users(exclude_hidden=True): possible_responsible_users.append((str(user.id), '{} (#{})'.format(user.name, user.id))) location_form.responsible_user.choices = possible_responsible_users if location_form.validate_on_submit(): location_id = int(location_form.location.data) if location_id < 0: location_id = None responsible_user_id = int(location_form.responsible_user.data) if responsible_user_id < 0: responsible_user_id = None description = location_form.description.data try: description = json.loads(description) except Exception: description = {} valid_description = {'en': ''} for language_code, description_text in description.items(): if not isinstance(language_code, str): continue try: language = get_language_by_lang_code(language_code) except logic.errors.LanguageDoesNotExistError: continue if not language.enabled_for_input: continue valid_description[language_code] = description_text description = valid_description if location_id is not None or responsible_user_id is not None: assign_location_to_object(object_id, location_id, responsible_user_id, flask_login.current_user.id, description) flask.flash(_('Successfully assigned a new location to this object.'), 'success') else: flask.flash(_('Please select a location or a responsible user.'), 'error') else: flask.flash(_('Please select a location or a responsible user.'), 'error') return flask.redirect(flask.url_for('.object', object_id=object_id)) @frontend.route('/objects/<int:object_id>/publications/', methods=['POST']) @object_permissions_required(Permissions.WRITE) def post_object_publication(object_id): check_current_user_is_not_readonly() publication_form = ObjectPublicationForm() if publication_form.validate_on_submit(): doi = publication_form.doi.data title = publication_form.title.data object_name = publication_form.object_name.data if title is not None: title = title.strip() if not title: title = None if object_name is not None: object_name = object_name.strip() if not object_name: object_name = None existing_publication = ([ publication for publication in logic.publications.get_publications_for_object(object_id) if publication.doi == doi ] or [None])[0] if existing_publication is not None and existing_publication.title == title and existing_publication.object_name == object_name: flask.flash(_('This object has already been linked to this publication.'), 'info') else: logic.publications.link_publication_to_object(user_id=flask_login.current_user.id, object_id=object_id, doi=doi, title=title, object_name=object_name) if existing_publication is None: flask.flash(_('Successfully linked this object to a publication.'), 'success') else: flask.flash(_('Successfully updated the information for this publication.'), 'success') else: flask.flash(_('Please enter a valid DOI for the publication you want to link this object to.'), 'error') return flask.redirect(flask.url_for('.object', object_id=object_id)) @frontend.route('/objects/<int:object_id>/export') @object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized) def export_data(object_id): object_ids = [object_id] file_extension = flask.request.args.get('format', '.pdf') if file_extension != '.pdf' and file_extension not in logic.export.FILE_FORMATS: return flask.abort(400) if 'object_ids' in flask.request.args: try: object_ids = json.loads(flask.request.args['object_ids']) object_ids = [int(i) for i in object_ids] if any((Permissions.READ not in get_user_object_permissions(i, flask_login.current_user.id)) for i in object_ids): return flask.abort(400) except Exception: return flask.abort(400) if not object_ids: return flask.abort(400) if file_extension == '.pdf': sections = pdfexport.SECTIONS if 'sections' in flask.request.args: try: sections = sections.intersection(json.loads(flask.request.args['sections'])) except Exception: return flask.abort(400) if 'language' in flask.request.args: try: lang_code = flask.request.args['language'] if lang_code not in logic.locale.SUPPORTED_LOCALES: raise ValueError() language = logic.languages.get_language_by_lang_code(lang_code) if not language.enabled_for_user_interface: raise ValueError() except Exception: lang_code = 'en' else: lang_code = 'en' pdf_data = pdfexport.create_pdfexport(object_ids, sections, lang_code) file_bytes = io.BytesIO(pdf_data) elif file_extension in logic.export.FILE_FORMATS: file_bytes = logic.export.FILE_FORMATS[file_extension][1](flask_login.current_user.id, object_ids=object_ids) else: file_bytes = None if file_bytes: return flask.Response( file_bytes, 200, headers={ 'Content-Disposition': f'attachment; filename=sampledb_export{file_extension}', 'Content-Type': 'application/pdf' if file_extension == '.pdf' else logic.export.FILE_FORMATS[file_extension][2] } ) return flask.abort(500) @frontend.route('/objects/<int:object_id>/files/') @object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized) def object_files(object_id): files = logic.files.get_files_for_object(object_id) zip_bytes = io.BytesIO() with zipfile.ZipFile(zip_bytes, 'w') as zip_file: for file in files: if file.is_hidden: continue if file.storage in {'local', 'database'}: try: file_bytes = file.open(read_only=True).read() except Exception: pass else: zip_file.writestr(os.path.basename(file.original_file_name), file_bytes) return flask.Response( zip_bytes.getvalue(), 200, headers={ 'Content-Type': 'application/zip', 'Content-Disposition': f'attachment; filename=object_{object_id}_files.zip' } ) @frontend.route('/objects/<int:object_id>/files/<int:file_id>', methods=['GET']) @object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized) def object_file(object_id, file_id): file = logic.files.get_file_for_object(object_id, file_id) if file is None: return flask.abort(404) if file.is_hidden: return flask.abort(403) if file.storage in ('local', 'database'): if 'preview' in flask.request.args: file_extension = os.path.splitext(file.original_file_name)[1] mime_type = flask.current_app.config.get('MIME_TYPES', {}).get(file_extension, None) if mime_type is not None: return flask.send_file(file.open(), mimetype=mime_type, last_modified=file.utc_datetime) return flask.send_file(file.open(), as_attachment=True, attachment_filename=file.original_file_name, last_modified=file.utc_datetime) # TODO: better error handling return flask.abort(404) @frontend.route('/objects/<int:object_id>/files/<int:file_id>', methods=['POST']) @object_permissions_required(Permissions.WRITE) def update_file_information(object_id, file_id): check_current_user_is_not_readonly() form = FileInformationForm() if not form.validate_on_submit(): return flask.abort(400) title = form.title.data description = form.description.data try: logic.files.update_file_information( object_id=object_id, file_id=file_id, user_id=flask_login.current_user.id, title=title, description=description ) except logic.errors.FileDoesNotExistError: return flask.abort(404) return flask.redirect(flask.url_for('.object', object_id=object_id, _anchor='file-{}'.format(file_id))) @frontend.route('/objects/<int:object_id>/files/<int:file_id>/hide', methods=['POST']) @object_permissions_required(Permissions.WRITE) def hide_file(object_id, file_id): check_current_user_is_not_readonly() form = FileHidingForm() if not form.validate_on_submit(): return flask.abort(400) reason = form.reason.data try: logic.files.hide_file( object_id=object_id, file_id=file_id, user_id=flask_login.current_user.id, reason=reason ) except logic.errors.FileDoesNotExistError: return flask.abort(404) flask.flash(_('The file was hidden successfully.'), 'success') return flask.redirect(flask.url_for('.object', object_id=object_id, _anchor='file-{}'.format(file_id))) @frontend.route('/objects/<int:object_id>/files/mobile_upload/<token>', methods=['GET']) def mobile_file_upload(object_id: int, token: str): serializer = itsdangerous.URLSafeTimedSerializer(flask.current_app.config['SECRET_KEY'], salt='mobile-upload') try: user_id, object_id = serializer.loads(token, max_age=15 * 60) except itsdangerous.BadSignature: return flask.abort(400) try: user = logic.users.get_user(user_id) except UserDoesNotExistError: return flask.abort(403) if user.is_readonly: return flask.abort(403) return flask.render_template('mobile_upload.html') @frontend.route('/objects/<int:object_id>/files/mobile_upload/<token>', methods=['POST']) def post_mobile_file_upload(object_id: int, token: str): serializer = itsdangerous.URLSafeTimedSerializer(flask.current_app.config['SECRET_KEY'], salt='mobile-upload') try: user_id, object_id = serializer.loads(token, max_age=15 * 60) except itsdangerous.BadSignature: return flask.abort(400) try: user = logic.users.get_user(user_id) except UserDoesNotExistError: return flask.abort(403) if user.is_readonly: return flask.abort(403) files = flask.request.files.getlist('file_input') if not files: return flask.redirect( flask.url_for( '.mobile_file_upload', object_id=object_id, token=token ) ) for file_storage in files: file_name = werkzeug.utils.secure_filename(file_storage.filename) logic.files.create_database_file(object_id, user_id, file_name, lambda stream: file_storage.save(dst=stream)) return flask.render_template('mobile_upload_success.html') @frontend.route('/objects/<int:object_id>/files/', methods=['POST']) @object_permissions_required(Permissions.WRITE) def post_object_files(object_id): check_current_user_is_not_readonly() external_link_form = ExternalLinkForm() file_form = FileForm() if file_form.validate_on_submit(): file_source = file_form.file_source.data if file_source == 'local': files = flask.request.files.getlist(file_form.local_files.name) for file_storage in files: file_name = werkzeug.utils.secure_filename(file_storage.filename) logic.files.create_database_file(object_id, flask_login.current_user.id, file_name, lambda stream: file_storage.save(dst=stream)) flask.flash(_('Successfully uploaded files.'), 'success') else: flask.flash(_('Failed to upload files.'), 'error') elif external_link_form.validate_on_submit(): url = external_link_form.url.data logic.files.create_url_file(object_id, flask_login.current_user.id, url) flask.flash(_('Successfully posted link.'), 'success') elif external_link_form.errors: flask.flash(_('Failed to post link.'), 'error') return flask.redirect(flask.url_for('.object', object_id=object_id, invalid_link=True, _anchor='anchor-post-link')) else: flask.flash(_('Failed to upload files.'), 'error') return flask.redirect(flask.url_for('.object', object_id=object_id)) @frontend.route('/objects/new', methods=['GET', 'POST']) @flask_login.login_required def new_object(): check_current_user_is_not_readonly() action_id = flask.request.args.get('action_id', None) previous_object_id = flask.request.args.get('previous_object_id', None) if not action_id and not previous_object_id: # TODO: handle error return flask.abort(404) sample_id = flask.request.args.get('sample_id', None) previous_object = None action = None if previous_object_id: try: previous_object = get_object(previous_object_id) except ObjectDoesNotExistError: flask.flash(_("This object does not exist."), 'error') return flask.abort(404) if Permissions.READ not in get_user_object_permissions(user_id=flask_login.current_user.id, object_id=previous_object_id): flask.flash(_("You do not have the required permissions to use this object as a template."), 'error') return flask.abort(403) if action_id: if action_id != str(previous_object.action_id): flask.flash(_("This object was created with a different action."), 'error') return flask.abort(400) else: action_id = previous_object.action_id if action_id: try: action = get_action(action_id) except ActionDoesNotExistError: flask.flash(_("This action does not exist."), 'error') return flask.abort(404) if Permissions.READ not in get_user_action_permissions(action_id, user_id=flask_login.current_user.id): flask.flash(_("You do not have the required permissions to use this action."), 'error') return flask.abort(403) placeholder_data = {} if sample_id is not None: try: sample_id = int(sample_id) except ValueError: sample_id = None else: if sample_id <= 0: sample_id = None if sample_id is not None: try: logic.objects.get_object(sample_id) except logic.errors.ObjectDoesNotExistError: sample_id = None if sample_id is not None: if action.schema.get('properties', {}).get('sample', {}).get('type', '') == 'sample': placeholder_data = { ('sample', ): {'_type': 'sample', 'object_id': sample_id} } # TODO: check instrument permissions return show_object_form(None, action, previous_object, placeholder_data=placeholder_data) @frontend.route('/objects/<int:object_id>/versions/') @object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized) def object_versions(object_id): object = get_object(object_id=object_id) if object is None: return flask.abort(404) object_versions = get_object_versions(object_id=object_id) object_versions.sort(key=lambda object_version: -object_version.version_id) return flask.render_template('objects/object_versions.html', get_user=get_user, object=object, object_versions=object_versions) @frontend.route('/objects/<int:object_id>/versions/<int:version_id>') @object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized) def object_version(object_id, version_id): user_language_id = logic.languages.get_user_language(flask_login.current_user).id english = get_language(Language.ENGLISH) object = get_object(object_id=object_id, version_id=version_id) form = None user_permissions = get_user_object_permissions(object_id=object_id, user_id=flask_login.current_user.id) if Permissions.WRITE in user_permissions: current_object = get_object(object_id=object_id) if current_object.version_id != version_id: form = ObjectVersionRestoreForm() user_may_grant = Permissions.GRANT in user_permissions action = get_action_with_translation_in_language(object.action_id, user_language_id, use_fallback=True) action_type = get_action_type_with_translation_in_language(action.type_id, user_language_id) instrument = get_instrument_with_translation_in_language(action.instrument_id, user_language_id) if action.instrument_id else None object_languages = logic.languages.get_languages_in_object_data(object.data) languages = [] for lang_code in object_languages: languages.append(get_language_by_lang_code(lang_code)) metadata_language = flask.request.args.get('language', None) if not any( language.lang_code == metadata_language for language in languages ): metadata_language = None return flask.render_template( 'objects/view/base.html', template_mode="view", show_object_type_and_id_on_object_page_text=get_user_settings(flask_login.current_user.id)["SHOW_OBJECT_TYPE_AND_ID_ON_OBJECT_PAGE"], show_object_title=get_user_settings(flask_login.current_user.id)["SHOW_OBJECT_TITLE"], languages=languages, metadata_language=metadata_language, ENGLISH=english, is_archived=True, object_type=action_type.translation.object_name, action=action, action_type=action_type, instrument=instrument, schema=object.schema, data=object.data, last_edit_datetime=object.utc_datetime, last_edit_user=get_user(object.user_id), get_object_if_current_user_has_read_permissions=get_object_if_current_user_has_read_permissions, object_id=object_id, version_id=version_id, link_version_specific_rdf=True, restore_form=form, get_user=get_user, user_may_grant=user_may_grant, get_action_type=get_action_type, get_action_type_with_translation_in_language=get_action_type_with_translation_in_language, ) @frontend.route('/objects/<int:object_id>/versions/<int:version_id>/restore', methods=['GET', 'POST']) @object_permissions_required(Permissions.WRITE) def restore_object_version(object_id, version_id): if version_id < 0 or object_id < 0: return flask.abort(404) try: current_object = get_object(object_id=object_id) except ObjectDoesNotExistError: return flask.abort(404) if current_object.version_id <= version_id: return flask.abort(404) form = ObjectVersionRestoreForm() if form.validate_on_submit(): logic.objects.restore_object_version(object_id=object_id, version_id=version_id, user_id=flask_login.current_user.id) return flask.redirect(flask.url_for('.object', object_id=object_id)) return flask.render_template('objects/restore_object_version.html', object_id=object_id, version_id=version_id, restore_form=form) @frontend.route('/objects/<int:object_id>/permissions') @object_permissions_required(Permissions.READ, on_unauthorized=on_unauthorized) def object_permissions(object_id): check_current_user_is_not_readonly() object = get_object(object_id) action = get_action(object.action_id) instrument = action.instrument user_permissions = get_object_permissions_for_users(object_id=object_id, include_instrument_responsible_users=False, include_groups=False, include_projects=False, include_readonly=False, include_admin_permissions=False) group_permissions = get_object_permissions_for_groups(object_id=object_id, include_projects=False) project_permissions = get_object_permissions_for_projects(object_id=object_id) public_permissions = Permissions.READ if object_is_public(object_id) else Permissions.NONE suggested_user_id = flask.request.args.get('add_user_id', '') try: suggested_user_id = int(suggested_user_id) except ValueError: suggested_user_id = None if Permissions.GRANT in get_user_object_permissions(object_id=object_id, user_id=flask_login.current_user.id): user_permission_form_data = [] for user_id, permissions in user_permissions.items(): if user_id is None: continue user_permission_form_data.append({'user_id': user_id, 'permissions': permissions.name.lower()}) group_permission_form_data = [] for group_id, permissions in group_permissions.items(): if group_id is None: continue group_permission_form_data.append({'group_id': group_id, 'permissions': permissions.name.lower()}) project_permission_form_data = [] for project_id, permissions in project_permissions.items(): if project_id is None: continue project_permission_form_data.append({'project_id': project_id, 'permissions': permissions.name.lower()}) edit_user_permissions_form = ObjectPermissionsForm(public_permissions=public_permissions.name.lower(), user_permissions=user_permission_form_data, group_permissions=group_permission_form_data, project_permissions=project_permission_form_data) users = get_users(exclude_hidden=True) users = [user for user in users if user.id not in user_permissions] add_user_permissions_form = ObjectUserPermissionsForm() groups = get_user_groups(flask_login.current_user.id) groups = [group for group in groups if group.id not in group_permissions] add_group_permissions_form = ObjectGroupPermissionsForm() projects = get_user_projects(flask_login.current_user.id, include_groups=True) projects = [project for project in projects if project.id not in project_permissions] add_project_permissions_form = ObjectProjectPermissionsForm() copy_permissions_form = CopyPermissionsForm() if not flask.current_app.config["LOAD_OBJECTS_IN_BACKGROUND"]: existing_objects = get_objects_with_permissions( user_id=flask_login.current_user.id, permissions=Permissions.GRANT ) copy_permissions_form.object_id.choices = [ (str(existing_object.id), existing_object.data['name']['text']) for existing_object in existing_objects if existing_object.id != object_id ] if len(copy_permissions_form.object_id.choices) == 0: copy_permissions_form = None else: copy_permissions_form.object_id.choices = [] else: edit_user_permissions_form = None add_user_permissions_form = None add_group_permissions_form = None add_project_permissions_form = None copy_permissions_form = None users = [] groups = [] projects = [] acceptable_project_ids = { project.id for project in projects } all_projects = logic.projects.get_projects() all_projects_by_id = { project.id: project for project in all_projects } if not flask.current_app.config['DISABLE_SUBPROJECTS']: project_id_hierarchy_list = logic.projects.get_project_id_hierarchy_list(list(all_projects_by_id)) project_id_hierarchy_list = [ (level, project_id, project_id in acceptable_project_ids) for level, project_id in project_id_hierarchy_list ] else: project_id_hierarchy_list = [ (0, project.id, project.id in acceptable_project_ids) for project in sorted(all_projects, key=lambda project: project.id) ] return flask.render_template( 'objects/object_permissions.html', instrument=instrument, action=action, object=object, user_permissions=user_permissions, group_permissions=group_permissions, project_permissions=project_permissions, public_permissions=public_permissions, get_user=get_user, Permissions=Permissions, form=edit_user_permissions_form, users=users, groups=groups, projects_by_id=all_projects_by_id, project_id_hierarchy_list=project_id_hierarchy_list, show_projects_form=len(acceptable_project_ids) > 0, add_user_permissions_form=add_user_permissions_form, add_group_permissions_form=add_group_permissions_form, get_group=get_group, add_project_permissions_form=add_project_permissions_form, copy_permissions_form=copy_permissions_form, get_project=get_project, suggested_user_id=suggested_user_id ) @frontend.route('/objects/<int:object_id>/permissions', methods=['POST']) @object_permissions_required(Permissions.GRANT) def update_object_permissions(object_id): edit_user_permissions_form = ObjectPermissionsForm() add_user_permissions_form = ObjectUserPermissionsForm() add_group_permissions_form = ObjectGroupPermissionsForm() add_project_permissions_form = ObjectProjectPermissionsForm() copy_permissions_form = CopyPermissionsForm() if 'copy_permissions' in flask.request.form: if not flask.current_app.config["LOAD_OBJECTS_IN_BACKGROUND"]: existing_objects = get_objects_with_permissions( user_id=flask_login.current_user.id, permissions=Permissions.GRANT ) copy_permissions_form.object_id.choices = [ (str(existing_object.id), existing_object.data['name']['text']) for existing_object in existing_objects if existing_object.id != object_id ] else: copy_permissions_form.object_id.choices = [] if copy_permissions_form.validate_on_submit(): logic.object_permissions.copy_permissions(object_id, int(copy_permissions_form.object_id.data)) logic.object_permissions.set_user_object_permissions(object_id, flask_login.current_user.id, Permissions.GRANT) flask.flash(_("Successfully copied object permissions."), 'success') elif 'edit_user_permissions' in flask.request.form and edit_user_permissions_form.validate_on_submit(): set_object_public(object_id, edit_user_permissions_form.public_permissions.data == 'read') for user_permissions_data in edit_user_permissions_form.user_permissions.data: user_id = user_permissions_data['user_id'] try: get_user(user_id) except UserDoesNotExistError: continue permissions = Permissions.from_name(user_permissions_data['permissions']) set_user_object_permissions(object_id=object_id, user_id=user_id, permissions=permissions) for group_permissions_data in edit_user_permissions_form.group_permissions.data: group_id = group_permissions_data['group_id'] try: get_group(group_id) except GroupDoesNotExistError: continue permissions = Permissions.from_name(group_permissions_data['permissions']) set_group_object_permissions(object_id=object_id, group_id=group_id, permissions=permissions) for project_permissions_data in edit_user_permissions_form.project_permissions.data: project_id = project_permissions_data['project_id'] try: get_project(project_id) except ProjectDoesNotExistError: continue permissions = Permissions.from_name(project_permissions_data['permissions']) set_project_object_permissions(object_id=object_id, project_id=project_id, permissions=permissions) user_log.edit_object_permissions(user_id=flask_login.current_user.id, object_id=object_id) flask.flash(_("Successfully updated object permissions."), 'success') elif 'add_user_permissions' in flask.request.form and add_user_permissions_form.validate_on_submit(): user_id = add_user_permissions_form.user_id.data permissions = Permissions.from_name(add_user_permissions_form.permissions.data) object_permissions = get_object_permissions_for_users(object_id=object_id, include_instrument_responsible_users=False, include_groups=False, include_projects=False, include_admin_permissions=False) assert permissions in [Permissions.READ, Permissions.WRITE, Permissions.GRANT] assert user_id not in object_permissions user_log.edit_object_permissions(user_id=flask_login.current_user.id, object_id=object_id) set_user_object_permissions(object_id=object_id, user_id=user_id, permissions=permissions) flask.flash(_("Successfully updated object permissions."), 'success') elif 'add_group_permissions' in flask.request.form and add_group_permissions_form.validate_on_submit(): group_id = add_group_permissions_form.group_id.data permissions = Permissions.from_name(add_group_permissions_form.permissions.data) object_permissions = get_object_permissions_for_groups(object_id=object_id) assert permissions in [Permissions.READ, Permissions.WRITE, Permissions.GRANT] assert group_id not in object_permissions user_log.edit_object_permissions(user_id=flask_login.current_user.id, object_id=object_id) set_group_object_permissions(object_id=object_id, group_id=group_id, permissions=permissions) flask.flash(_("Successfully updated object permissions."), 'success') elif 'add_project_permissions' in flask.request.form and add_project_permissions_form.validate_on_submit(): project_id = add_project_permissions_form.project_id.data permissions = Permissions.from_name(add_project_permissions_form.permissions.data) object_permissions = get_object_permissions_for_projects(object_id=object_id) assert permissions in [Permissions.READ, Permissions.WRITE, Permissions.GRANT] assert project_id not in object_permissions user_log.edit_object_permissions(user_id=flask_login.current_user.id, object_id=object_id) set_project_object_permissions(object_id=object_id, project_id=project_id, permissions=permissions) flask.flash(_("Successfully updated object permissions."), 'success') else: flask.flash(_("A problem occurred while changing the object permissions. Please try again."), 'error') return flask.redirect(flask.url_for('.object_permissions', object_id=object_id)) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">47.410323</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">405</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.664943</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">sciapp/sampledb</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">sampledb/frontend/objects.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">110,241</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8746"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from decimal import Decimal, ROUND_DOWN from time import time def elapsed(t0=0.0): """get elapsed time from the give time Returns: now: the absolute time now dt_str: elapsed time in string """ now = time() dt = now - t0 dt_sec = Decimal(str(dt)).quantize(Decimal('.0001'), rounding=ROUND_DOWN) if dt_sec <= 1: dt_str = str(dt_sec) + ' second' else: dt_str = str(dt_sec) + ' seconds' return now, dt_str </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">23.85</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">77</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.603774</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">mhdella/andes</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">andes/utils/time.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">477</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8747"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">_base_ = './fcn_r50-d8_512x1024_40k_cityscapes.py' model = dict(pretrained='open-mmlab://resnet101_v1c', backbone=dict(depth=101)) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">43.666667</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">79</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.778626</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">1171000410/mmsegmentation</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">configs/fcn/fcn_r101-d8_512x1024_40k_cityscapes.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">131</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8748"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># Copyright 2019 Splunk, Inc. # # Use of this source code is governed by a BSD-2-clause-style # license that can be found in the LICENSE-BSD2 file or at # https://opensource.org/licenses/BSD-2-Clause from jinja2 import Environment from .sendmessage import * from .splunkutils import * from .timeutils import * import pytest env = Environment() # time format for Apr 5 22:51:54 2021 # <187>{{ arubadate }} {{ host }} authmgr[4130]: <124198> <4130> <ERRS> <{{ host }} 10.10.10.10> {00:00:00:00:00:00-??} Missing server in attribute list, auth=VPN, utype=L3. # <187>{{ arubadate }} {{ host }} stm[4133]: <399803> <4133> <ERRS> <{{ host }} 10.10.10.10> An internal system error has occurred at file sapm_ap_mgmt.c function sapm_get_img_build_version_str line 11853 error stat /mswitch/sap/mips64.ari failed: No such file or directory. # <188>{{ arubadate }} {{ host }} wms[4096]: <126005> <4096> <WARN> <{{ host }} 10.10.10.10> |ids| Interfering AP: The system classified an access point (BSSID 00:0e:8e:96:f4:32 and SSID on CHANNEL 36) as interfering. Additional Info: Detector-AP-Name:00:0b:86:9e:6b:5f; Detector-AP-MAC:24:de:c6:70:2c:90; Detector-AP-Radio:1. # <191>{{ arubadate }} 10.10.10.10 dnsmasq: reading /etc/resolv.conf testdata = [ "<187>{{ arubadate }} {{ host }} authmgr[4130]: <124198> <4130> <ERRS> <{{ host }} 10.10.10.10> {00:00:00:00:00:00-??} Missing server in attribute list, auth=VPN, utype=L3.", "<187>{{ arubadate }} {{ host }} stm[4133]: <399803> <4133> <ERRS> <{{ host }} 10.10.10.10> An internal system error has occurred at file sapm_ap_mgmt.c function sapm_get_img_build_version_str line 11853 error stat /mswitch/sap/mips64.ari failed: No such file or directory.", "<188>{{ arubadate }} {{ host }} wms[4096]: <126005> <4096> <WARN> <{{ host }} 10.10.10.10> |ids| Interfering AP: The system classified an access point (BSSID 00:0e:8e:96:f4:32 and SSID on CHANNEL 36) as interfering. Additional Info: Detector-AP-Name:00:0b:86:9e:6b:5f; Detector-AP-MAC:24:de:c6:70:2c:90; Detector-AP-Radio:1.", "<188>{{ arubadate }} {{ host }} sapd[1362]: <127037> <WARN> |AP 00:0b:86:eb:4e:<a href="/cdn-cgi/l/email-protection" class="__cf_email__" data-cfemail="e1d2d3a1d0d1cfd0d1cfd0d1cfd0d1">[email protected]</a> sapd| |ids-ap| AP(04:bd:88:8a:3a:60): Station Associated to Rogue AP: An AP detected a client a4:8d:3b:ae:68:68 associated to a rogue access point (BSSID 98:1e:19:31:63:b6 and SSID MySpectrumWiFib0-2G on CHANNEL 11).", ] @pytest.mark.parametrize("event", testdata) def test_aruba( record_property, setup_wordlist, get_host_key, setup_splunk, setup_sc4s, event ): host = get_host_key dt = datetime.datetime.now() iso, bsd, time, date, tzoffset, tzname, epoch = time_operations(dt) arubadate = dt.strftime("%b %d %H:%M:%S %Y") # Tune time functions epoch = epoch[:-7] mt = env.from_string(event + "\n") message = mt.render(mark="<188>", bsd=bsd, host=host, arubadate=arubadate) sendsingle(message, setup_sc4s[0], setup_sc4s[1][514]) st = env.from_string( 'search index=netops _time={{ epoch }} sourcetype="aruba:syslog" host={{ host }}' ) search = st.render(epoch=epoch, host=host) resultCount, eventCount = splunk_single(setup_splunk, search) record_property("host", host) record_property("resultCount", resultCount) record_property("message", message) assert resultCount == 1 </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">54.245902</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">332</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.686008</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "BSD-2-Clause", "CC0-1.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">iainrose/splunk-connect-for-syslog</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">tests/test_aruba.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">3,309</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8749"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">#!/usr/bin/env python """Django's command-line utility for administrative tasks.""" import os import sys def main(): os.environ.setdefault('DJANGO_SETTINGS_MODULE', 'hackcrisis.settings') try: from django.core.management import execute_from_command_line except ImportError as exc: raise ImportError( "Couldn't import Django. Are you sure it's installed and " "available on your PYTHONPATH environment variable? Did you " "forget to activate a virtual environment?" ) from exc execute_from_command_line(sys.argv) if __name__ == '__main__': main() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">28.636364</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">74</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.684127</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">jakubzadrozny/hackcrisis</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">manage.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">630</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8750"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># This script fetches Atelier 801 translation file and adds the required IDs into our own translation files import sys from urllib.request import urlopen import zlib from string import Template import json if len(sys.argv) < 2: print("Please pass in lang code for first arguement") exit() lang = sys.argv[1] url = 'https://www.transformice.com/langues/tfm-'+lang+'.gz' # Fetch file response = urlopen(url) filedata = response.read() filedata = zlib.decompress(filedata) filedata = bytes.decode(filedata) # Parse file filedata = filedata.split("\n-\n") i18n = {} for data in filedata: if(not data): continue key,val = data.split("=", 1) i18n[key] = val # Use data to do the actual thing this tool is for def desc(key, arg1=None): if(arg1 != None): return i18n[key].replace("%1", arg1) return i18n[key] transKeys = [ "C_GuideSprirituel", "C_MaitresseDuVent", "C_Mecanicienne", "C_Sauvageonne", "C_Physicienne", "C_14", "C_14_T", "C_11", "C_11_T", "C_12", "C_12_T", "C_13", "C_13_T", "C_8", "C_8_T", "C_9", "C_9_T", "C_10", "C_10_T", "C_5", "C_5_T", "C_6", "C_6_T", "C_7", "C_7_T", "C_2", "C_2_T", "C_3", "C_3_T", "C_4", "C_4_T", "C_0", "C_0_T", "C_1", "C_1_T", "C_34", "C_34_T", "C_31", "C_31_T", "C_32", "C_32_T", "C_33", "C_33_T", "C_28", "C_28_T", "C_29", "C_29_T", "C_30", "C_30_T", "C_25", "C_25_T", "C_26", "C_26_T", "C_27", "C_27_T", "C_22", "C_22_T", "C_23", "C_23_T", "C_24", "C_24_T", "C_20", "C_20_T", "C_21", "C_21_T", "C_54", "C_54_T", "C_51", "C_51_T", "C_52", "C_52_T", "C_53", "C_53_T", "C_48", "C_48_T", "C_49", "C_49_T", "C_50", "C_50_T", "C_45", "C_45_T", "C_46", "C_46_T", "C_47", "C_47_T", "C_42", "C_42_T", "C_43", "C_43_T", "C_44", "C_44_T", "C_40", "C_40_T", "C_41", "C_41_T", "C_94", "C_94_T", "C_80", "C_80_T", "C_93", "C_93_T", "C_70", "C_70_T", "C_72", "C_72_T", "C_81", "C_81_T", "C_92", "C_92_T", "C_66", "C_66_T", "C_71", "C_71_T", "C_73", "C_73_T", "C_68", "C_68_T", "C_88", "C_88_T", "C_84", "C_84_T", "C_86", "C_86_T", "C_89", "C_89_T", "C_91", "C_91_T", "C_83", "C_83_T", "C_85", "C_85_T", "C_90", "C_90_T", "C_63", "C_63_T", "C_74", "C_74_T", "C_87", "C_87_T", "C_82", "C_82_T", "C_60", "C_60_T", "C_64", "C_64_T", "C_65", "C_65_T", "C_69", "C_69_T", "C_67", "C_67_T", "C_61", "C_61_T", "C_62", "C_62_T", ] i18nToWrite = {} for key in transKeys: i18nToWrite[key] = i18n[key] with open(lang+'.json', 'w') as outfile: # outfile.write(i18nToWrite) json.dump(i18nToWrite, outfile, indent=4)</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">20.015873</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">107</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.607851</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">fewfre/TransformiceSkillTreeBuilder</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">i18n/_tfm_trans_to_skilldata.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">2,522</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8751"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">#!/usr/bin/env python __author__ = ('Duy Tin Truong (<a href="/cdn-cgi/l/email-protection" class="__cf_email__" data-cfemail="5430212d203d3a7a2026213b3a3314213a3d203a7a3d20">[email protected]</a>), ' 'Aitor Blanco Miguez (<a href="/cdn-cgi/l/email-protection" class="__cf_email__" data-cfemail="6f0e061b001d410d030e010c000206081a0a152f1a01061b0141061b">[email protected]</a>)') __version__ = '3.0' __date__ = '21 Feb 2020' import argparse as ap import dendropy from io import StringIO import re from collections import defaultdict import matplotlib.colors as colors import subprocess def read_params(): p = ap.ArgumentParser() p.add_argument('-t', '--ifn_tree', required=True, default=None, type=str, help='The input tree in newick format.') p.add_argument('-m', '--colorized_metadata', required=False, default='unset', type=str, help='The metadata field to colorize. Default "unset".') p.add_argument('--fig_size', required=False, default=8, type=float, help='The figure size. Default "8".') p.add_argument('--legend_marker_size', required=False, default=20, type=int, help='The legend marker size. Default "20".' ) p.add_argument('--legend_font_size', required=False, default=10, type=int, help='The legend font size. Default "10".' ) p.add_argument('--legend_marker_edge_width', required=False, default=0.2, type=float, help='The legend marker edge width. Default "0.2".' ) p.add_argument('--leaf_marker_size', required=False, default=20, type=int, help='The legend marker size. Default "20".' ) p.add_argument('--leaf_marker_edge_width', required=False, default=0.2, type=float, help='The legend marker edge width. Default "0.2".' ) p.add_argument('--dpi', required=False, default=300, type=int, help='The figure dpi.') p.add_argument('--figure_extension', required=False, default='.png', type=str, help='The figure extension. Default ".png".') p.add_argument('--ofn_prefix', required=False, default=None, type=str, help='The prefix of output files.') return p.parse_args() def run(cmd): print (cmd) subprocess.call(cmd.split()) def main(): args = read_params() tree = dendropy.Tree.get_from_path(args.ifn_tree, schema='newick', preserve_underscores=True) tree.reroot_at_midpoint() count = 0 metadatas = set([]) node2metadata = {} for node in tree.preorder_node_iter(): nodestr = node.__getattribute__("taxon").__str__().strip("'") if node.is_leaf(): if '.' in nodestr: nodestr = nodestr.replace('.',',') node.taxon = dendropy.Taxon(label=nodestr) substrs = re.findall( '%s-[a-zA-Z0-9.]*'%args.colorized_metadata, nodestr) if substrs: md = substrs[0].replace(args.colorized_metadata + '-', '') metadatas.add(md) node2metadata[nodestr] = md else: count += 1 node.taxon = dendropy.Taxon(label='node_%d'%count) metadatas = sorted(list(metadatas)) color_names = list(colors.cnames.keys()) metadata2color = {} for i, md in enumerate(metadatas): metadata2color[md] = color_names[i % len(color_names)] if not args.ofn_prefix: args.ofn_prefix = args.ifn_tree ofn_tree = args.ofn_prefix + '.graphlantree' tree.write_to_path(ofn_tree, 'newick') ofn_annot = args.ofn_prefix + '.annot' with open(ofn_annot, 'w') as ofile: #ofile.write('clade_separation\t0\n') ofile.write('branch_bracket_width\t0\n') #ofile.write('clade_separation\t0.15\n') ofile.write('branch_bracket_depth\t0\n') #ofile.write('branch_thickness\t1.25\n') ofile.write('annotation_background_width\t0\n') # legend ofile.write('#legends\n') ofile.write('class_legend_font_size\t%d\n'%args.legend_font_size) for md in metadata2color: ofile.write('%s\tclade_marker_size\t%d\n'%(md, args.legend_marker_size)) ofile.write('%s\tclade_marker_color\t%s\n'%(md, metadata2color[md])) ofile.write('%s\tclade_marker_edge_width\t%f\n'%(md, args.legend_marker_edge_width)) # remove intermedate nodes for node in tree.preorder_node_iter(): if not node.is_leaf(): nodestr = node.__getattribute__("taxon").__str__().strip("'") ofile.write('%s\tclade_marker_size\t0\n'%(nodestr)) # colorize leaf nodes for node in tree.seed_node.leaf_nodes(): nodestr = node.__getattribute__("taxon").__str__().strip("'") if nodestr in node2metadata: leaf_color = metadata2color[node2metadata[nodestr]] ofile.write('%s\tclade_marker_size\t%d\n'%(nodestr, args.leaf_marker_size)) ofile.write('%s\tclade_marker_color\t%s\n'%(nodestr, leaf_color)) ofile.write('%s\tclade_marker_edge_width\t%f\n'%(nodestr, args.leaf_marker_edge_width)) ofn_xml = args.ofn_prefix + '.xml' cmd = 'graphlan_annotate.py --annot %s %s %s'%(ofn_annot, ofn_tree, ofn_xml) run(cmd) ofn_fig = args.ofn_prefix + args.figure_extension cmd = 'graphlan.py %s %s --dpi %d --size %f'%(ofn_xml, ofn_fig, args.dpi, args.fig_size) run(cmd) print ('Output file: %s'%ofn_fig) if __name__ == '__main__': main() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">37.527607</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">103</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.542586</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Adrian-Howard/MetaPhlAn</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">metaphlan/utils/plot_tree_graphlan.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">6,117</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8752"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from django.db import models from django.urls import reverse import uuid # Required for unique book instances class Genre(models.Model): """ Model representing a book genre (e.g. Science Fiction, Non Fiction). """ name = models.CharField(max_length=200, help_text="Enter a book genre (e.g. Science Fiction, French Poetry etc.)") def __str__(self): """ String for representing the Model object (in Admin site etc.) """ return self.name class Language(models.Model): """ Model representing a Language (e.g. Russian, English etc.) """ name = models.CharField(max_length=200, help_text="Enter a book language (e.g. Russian, English etc.)") def __str__(self): """ String for representing the Model object (in Admin site etc.) """ return self.name class Book(models.Model): """ Model representing a book (but not a specific copy of a book). """ title = models.CharField(max_length=200) author = models.ForeignKey('Author', on_delete=models.SET_NULL, null=True) # Foreign Key used because book can only have one author, but authors can have multiple books # Author as a string rather than object because it hasn't been declared yet in the file. summary = models.TextField(max_length=1000, help_text="Enter a brief description of the book") isbn = models.CharField('ISBN',max_length=13, help_text='13 Character <a href="https://www.isbn-international.org/content/what-isbn">ISBN number</a>') genre = models.ManyToManyField(Genre, help_text="Select a genre for this book") # ManyToManyField used because genre can contain many books. Books can cover many genres. # Genre class has already been defined so we can specify the object above. language = models.ForeignKey('Language', on_delete=models.SET_NULL, null=True) def __str__(self): """ String for representing the Model object. """ return self.title def get_absolute_url(self): """ Returns the url to access a particular book instance. """ return reverse('book-detail', args=[str(self.id)]) class BookInstance(models.Model): """ Model representing a specific copy of a book (i.e. that can be borrowed from the library). """ id = models.UUIDField(primary_key=True, default=uuid.uuid4, help_text="Unique ID for this particular book across whole library") book = models.ForeignKey('Book', on_delete=models.SET_NULL, null=True) imprint = models.CharField(max_length=200) due_back = models.DateField(null=True, blank=True) LOAN_STATUS = ( ('m', 'Maintenance'), ('o', 'On loan'), ('a', 'Available'), ('r', 'Reserved'), ) status = models.CharField(max_length=1, choices=LOAN_STATUS, blank=True, default='m', help_text='Book availability') class Meta: ordering = ["due_back"] def __str__(self): """ String for representing the Model object """ return '{0} ({1})'.format(self.id, self.book.title) class Author(models.Model): """ Model representing an author. """ first_name = models.CharField(max_length=100) last_name = models.CharField(max_length=100) date_of_birth = models.DateField(null=True, blank=True) date_of_death = models.DateField('Died', null=True, blank=True) def get_absolute_url(self): """ Returns the url to access a particular author instance. """ return reverse('author-detail', args=[str(self.id)]) def __str__(self): """ String for representing the Model object. """ return '{0} ({1})'.format(self.last_name, self.first_name) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">32.084746</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">132</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.651083</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">zhekazuev/mozilla-django-learning</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">src/locallibrary/catalog/models.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">3,786</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8753"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># -------------- import pandas as pd import numpy as np from sklearn.cross_validation import train_test_split # code starts here df = pd.read_csv(path) df.head() X = df[['ages','num_reviews','piece_count','play_star_rating','review_difficulty','star_rating','theme_name','val_star_rating','country']] y = df['list_price'] X_train,X_test,y_train,y_test = train_test_split(X,y,random_state = 6, test_size = 0.3) # code ends here # -------------- import matplotlib.pyplot as plt import pandas as pd import numpy as np import matplotlib.pyplot as plt import seaborn as sns import warnings # code starts here cols = X_train.columns #cols= list(X_train.columns.values) sns.pairplot(df) # code ends here # -------------- # Code starts here corr = X_train.corr() print(corr) X_train.drop(['play_star_rating', 'val_star_rating'], axis = 1,inplace = True) X_test.drop(['play_star_rating', 'val_star_rating'], axis = 1,inplace = True) # Code ends here # -------------- from sklearn.linear_model import LinearRegression from sklearn.metrics import mean_squared_error, r2_score import math # Code starts here regressor = LinearRegression() regressor.fit(X_train,y_train) y_pred = regressor.predict(X_test) def metrics(actual,pred): print('Mean Squared Error', mean_squared_error(actual,pred)) print('R-Squared', r2_score(actual,pred)) metrics(y_test,y_pred) mse = 2106.7634311857673 r2 = 0.7747160273433752 # Code ends here # -------------- # Code starts here residual = y_test - y_pred plt.hist(residual) # Code ends here </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">21.704225</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">138</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.720311</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">iamacityzen/ga-learner-dsmp-repo</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Making-first-prediction-using-linear-regression/code.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">1,541</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8754"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from dgl.data import CoraGraphDataset, CiteseerGraphDataset, PubmedGraphDataset def load(name): if name == 'cora': dataset = CoraGraphDataset() elif name == 'citeseer': dataset = CiteseerGraphDataset() elif name == 'pubmed': dataset = PubmedGraphDataset() graph = dataset[0] train_mask = graph.ndata.pop('train_mask') test_mask = graph.ndata.pop('test_mask') feat = graph.ndata.pop('feat') labels = graph.ndata.pop('label') return graph, feat, labels, train_mask, test_mask</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">28.315789</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">79</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.667286</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">905355494/dgl</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">examples/pytorch/grace/dataset.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">538</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8755"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from enum import IntEnum from typing import Dict, Union, Callable, Any from cereal import log, car import cereal.messaging as messaging from common.realtime import DT_CTRL from selfdrive.config import Conversions as CV from selfdrive.locationd.calibrationd import MIN_SPEED_FILTER AlertSize = log.ControlsState.AlertSize AlertStatus = log.ControlsState.AlertStatus VisualAlert = car.CarControl.HUDControl.VisualAlert AudibleAlert = car.CarControl.HUDControl.AudibleAlert EventName = car.CarEvent.EventName # Alert priorities class Priority(IntEnum): LOWEST = 0 LOWER = 1 LOW = 2 MID = 3 HIGH = 4 HIGHEST = 5 # Event types class ET: ENABLE = 'enable' PRE_ENABLE = 'preEnable' NO_ENTRY = 'noEntry' WARNING = 'warning' USER_DISABLE = 'userDisable' SOFT_DISABLE = 'softDisable' IMMEDIATE_DISABLE = 'immediateDisable' PERMANENT = 'permanent' # get event name from enum EVENT_NAME = {v: k for k, v in EventName.schema.enumerants.items()} class Events: def __init__(self): self.events = [] self.static_events = [] self.events_prev = dict.fromkeys(EVENTS.keys(), 0) @property def names(self): return self.events def __len__(self): return len(self.events) def add(self, event_name, static=False): if static: self.static_events.append(event_name) self.events.append(event_name) def clear(self): self.events_prev = {k: (v + 1 if k in self.events else 0) for k, v in self.events_prev.items()} self.events = self.static_events.copy() def any(self, event_type): for e in self.events: if event_type in EVENTS.get(e, {}).keys(): return True return False def create_alerts(self, event_types, callback_args=None): if callback_args is None: callback_args = [] ret = [] for e in self.events: types = EVENTS[e].keys() for et in event_types: if et in types: alert = EVENTS[e][et] if not isinstance(alert, Alert): alert = alert(*callback_args) if DT_CTRL * (self.events_prev[e] + 1) >= alert.creation_delay: alert.alert_type = f"{EVENT_NAME[e]}/{et}" alert.event_type = et ret.append(alert) return ret def add_from_msg(self, events): for e in events: self.events.append(e.name.raw) def to_msg(self): ret = [] for event_name in self.events: event = car.CarEvent.new_message() event.name = event_name for event_type in EVENTS.get(event_name, {}).keys(): setattr(event, event_type, True) ret.append(event) return ret class Alert: def __init__(self, alert_text_1: str, alert_text_2: str, alert_status: log.ControlsState.AlertStatus, alert_size: log.ControlsState.AlertSize, alert_priority: Priority, visual_alert: car.CarControl.HUDControl.VisualAlert, audible_alert: car.CarControl.HUDControl.AudibleAlert, duration_sound: float, duration_hud_alert: float, duration_text: float, alert_rate: float = 0., creation_delay: float = 0.): self.alert_text_1 = alert_text_1 self.alert_text_2 = alert_text_2 self.alert_status = alert_status self.alert_size = alert_size self.alert_priority = alert_priority self.visual_alert = visual_alert self.audible_alert = audible_alert self.duration_sound = duration_sound self.duration_hud_alert = duration_hud_alert self.duration_text = duration_text self.alert_rate = alert_rate self.creation_delay = creation_delay self.start_time = 0. self.alert_type = "" self.event_type = None def __str__(self) -> str: return f"{self.alert_text_1}/{self.alert_text_2} {self.alert_priority} {self.visual_alert} {self.audible_alert}" def __gt__(self, alert2) -> bool: return self.alert_priority > alert2.alert_priority class NoEntryAlert(Alert): def __init__(self, alert_text_2, audible_alert=AudibleAlert.chimeError, visual_alert=VisualAlert.none, duration_hud_alert=2.): super().__init__("오픈파일럿 사용불가", alert_text_2, AlertStatus.normal, AlertSize.mid, Priority.LOW, visual_alert, audible_alert, .4, duration_hud_alert, 3.) class SoftDisableAlert(Alert): def __init__(self, alert_text_2): super().__init__("핸들을 즉시 잡아주세요", alert_text_2, AlertStatus.userPrompt, AlertSize.full, Priority.MID, VisualAlert.steerRequired, AudibleAlert.chimeError, .1, 2., 2.), class ImmediateDisableAlert(Alert): def __init__(self, alert_text_2, alert_text_1="핸들을 즉시 잡아주세요"): super().__init__(alert_text_1, alert_text_2, AlertStatus.critical, AlertSize.full, Priority.HIGHEST, VisualAlert.steerRequired, AudibleAlert.chimeWarningRepeat, 2.2, 3., 4.), class EngagementAlert(Alert): def __init__(self, audible_alert=True): super().__init__("", "", AlertStatus.normal, AlertSize.none, Priority.MID, VisualAlert.none, audible_alert, .2, 0., 0.), class NormalPermanentAlert(Alert): def __init__(self, alert_text_1: str, alert_text_2: str, duration_text: float = 0.2): super().__init__(alert_text_1, alert_text_2, AlertStatus.normal, AlertSize.mid if len(alert_text_2) else AlertSize.small, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., duration_text), # ********** alert callback functions ********** def below_steer_speed_alert(CP: car.CarParams, sm: messaging.SubMaster, metric: bool) -> Alert: speed = int(round(CP.minSteerSpeed * (CV.MS_TO_KPH if metric else CV.MS_TO_MPH))) unit = "km/h" if metric else "mph" return Alert( "핸들을 잡아주세요", "%d %s 이상의 속도에서 자동조향됩니다" % (speed, unit), AlertStatus.userPrompt, AlertSize.mid, Priority.MID, VisualAlert.steerRequired, AudibleAlert.none, 0., 0.4, .3) def calibration_incomplete_alert(CP: car.CarParams, sm: messaging.SubMaster, metric: bool) -> Alert: speed = int(MIN_SPEED_FILTER * (CV.MS_TO_KPH if metric else CV.MS_TO_MPH)) unit = "km/h" if metric else "mph" return Alert( "캘리브레이션 진행중입니다 : %d%%" % sm['liveCalibration'].calPerc, "속도를 %d %s 이상으로 주행해주세요" % (speed, unit), AlertStatus.normal, AlertSize.mid, Priority.LOWEST, VisualAlert.none, AudibleAlert.none, 0., 0., .2) def no_gps_alert(CP: car.CarParams, sm: messaging.SubMaster, metric: bool) -> Alert: gps_integrated = sm['pandaState'].pandaType in [log.PandaState.PandaType.uno, log.PandaState.PandaType.dos] return Alert( "GPS 수신불량", "GPS 연결상태 및 안테나를 점검하세요" if gps_integrated else "GPS 안테나를 점검하세요", AlertStatus.normal, AlertSize.mid, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2, creation_delay=300.) def wrong_car_mode_alert(CP: car.CarParams, sm: messaging.SubMaster, metric: bool) -> Alert: text = "크루즈 비활성상태" if CP.carName == "honda": text = "메인 스위치 OFF" return NoEntryAlert(text, duration_hud_alert=0.) def startup_fuzzy_fingerprint_alert(CP: car.CarParams, sm: messaging.SubMaster, metric: bool) -> Alert: return Alert( "WARNING: No Exact Match on Car Model", f"Closest Match: {CP.carFingerprint.title()[:40]}", AlertStatus.userPrompt, AlertSize.mid, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., 15.) def auto_lane_change_alert(CP: car.CarParams, sm: messaging.SubMaster, metric: bool) -> Alert: alc_timer = sm['lateralPlan'].autoLaneChangeTimer return Alert( "자동차선변경이 %d초 뒤에 시작됩니다" % alc_timer, "차선의 차량을 확인하세요", AlertStatus.normal, AlertSize.mid, Priority.LOWER, VisualAlert.steerRequired, AudibleAlert.none, 0., .1, .1, alert_rate=0.75) def joystick_alert(CP: car.CarParams, sm: messaging.SubMaster, metric: bool) -> Alert: axes = sm['testJoystick'].axes gb, steer = list(axes)[:2] if len(axes) else (0., 0.) return Alert( "Joystick Mode", f"Gas: {round(gb * 100.)}%, Steer: {round(steer * 100.)}%", AlertStatus.normal, AlertSize.mid, Priority.LOW, VisualAlert.none, AudibleAlert.none, 0., 0., .1) EVENTS: Dict[int, Dict[str, Union[Alert, Callable[[Any, messaging.SubMaster, bool], Alert]]]] = { # ********** events with no alerts ********** # ********** events only containing alerts displayed in all states ********** EventName.joystickDebug: { ET.WARNING: joystick_alert, ET.PERMANENT: Alert( "조이스틱 모드", "", AlertStatus.normal, AlertSize.small, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., 0.1), }, EventName.controlsInitializing: { ET.NO_ENTRY: NoEntryAlert("Controls Initializing"), }, EventName.startup: { ET.PERMANENT: Alert( "오픈파일럿 사용준비 완료", "항상 핸들을 잡고 도로를 주시하세요", AlertStatus.normal, AlertSize.mid, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., 3.), }, EventName.startupMaster: { ET.PERMANENT: Alert( "오픈파일럿 사용준비 완료", "항상 핸들을 잡고 도로를 주시하세요", AlertStatus.userPrompt, AlertSize.mid, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., 3.), }, # Car is recognized, but marked as dashcam only EventName.startupNoControl: { ET.PERMANENT: Alert( "대시캠 모드", "항상 핸들을 잡고 도로를 주시하세요", AlertStatus.normal, AlertSize.mid, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., 15.), }, # Car is not recognized EventName.startupNoCar: { ET.PERMANENT: Alert( "대시캠 모드 : 호환되지않는 차량", "항상 핸들을 잡고 도로를 주시하세요", AlertStatus.normal, AlertSize.mid, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., 15.), }, # openpilot uses the version strings from various ECUs to detect the correct car model. # Usually all ECUs are recognized and an exact match to a car model can be made. Sometimes # one or two ECUs have unrecognized versions, but the others are present in the database. # If openpilot is confident about the match to a car model, it fingerprints anyway. # In this case an alert is thrown since there is a small chance the wrong car was detected # and the user should pay extra attention. # This alert can be prevented by adding all ECU firmware version to openpilot: # https://github.com/commaai/openpilot/wiki/Fingerprinting EventName.startupFuzzyFingerprint: { ET.PERMANENT: startup_fuzzy_fingerprint_alert, }, EventName.startupNoFw: { ET.PERMANENT: Alert( "차량 인식 불가", "모든 연결을 확인해 보세요", AlertStatus.userPrompt, AlertSize.mid, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., 15.), }, EventName.dashcamMode: { ET.PERMANENT: Alert( "대시캠 모드", "", AlertStatus.normal, AlertSize.small, Priority.LOWEST, VisualAlert.none, AudibleAlert.none, 0., 0., .2), }, EventName.invalidLkasSetting: { ET.PERMANENT: Alert( "차량 LKAS 버튼 상태확인", "차량 LKAS 버튼 OFF후 활성화됩니다", AlertStatus.normal, AlertSize.mid, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2), }, # Some features or cars are marked as community features. If openpilot # detects the use of a community feature it switches to dashcam mode # until these features are allowed using a toggle in settings. EventName.communityFeatureDisallowed: { # LOW priority to overcome Cruise Error ET.PERMANENT: Alert( "커뮤니티 기능 감지됨", "개발자설정에서 커뮤니티 기능을 활성화해주세요", AlertStatus.normal, AlertSize.mid, Priority.LOW, VisualAlert.none, AudibleAlert.none, 0., 0., .2), }, # openpilot doesn't recognize the car. This switches openpilot into a # read-only mode. This can be solved by adding your fingerprint. # See https://github.com/commaai/openpilot/wiki/Fingerprinting for more information EventName.carUnrecognized: { ET.PERMANENT: Alert( "대시캠 모드", "차량인식 불가 - 핑거프린트를 확인하세요", AlertStatus.normal, AlertSize.mid, Priority.LOWEST, VisualAlert.none, AudibleAlert.none, 0., 0., .2), }, EventName.stockAeb: { ET.PERMANENT: Alert( "브레이크!", "추돌 위험", AlertStatus.critical, AlertSize.full, Priority.HIGHEST, VisualAlert.fcw, AudibleAlert.none, 1., 2., 2.), ET.NO_ENTRY: NoEntryAlert("Stock AEB: Risk of Collision"), }, EventName.stockFcw: { ET.PERMANENT: Alert( "브레이크!", "추돌 위험", AlertStatus.critical, AlertSize.full, Priority.HIGHEST, VisualAlert.fcw, AudibleAlert.none, 1., 2., 2.), ET.NO_ENTRY: NoEntryAlert("Stock FCW: Risk of Collision"), }, EventName.fcw: { ET.PERMANENT: Alert( "브레이크!", "추돌 위험", AlertStatus.critical, AlertSize.full, Priority.HIGHEST, VisualAlert.fcw, AudibleAlert.chimeWarningRepeat, 1., 2., 2.), }, EventName.ldw: { ET.PERMANENT: Alert( "핸들을 잡아주세요", "차선이탈 감지됨", AlertStatus.userPrompt, AlertSize.mid, Priority.LOW, VisualAlert.ldw, AudibleAlert.chimePrompt, 1., 2., 3.), }, # ********** events only containing alerts that display while engaged ********** EventName.gasPressed: { ET.PRE_ENABLE: Alert( "가속패달감지시 오픈파일럿은 브레이크를 사용하지않습니다", "", AlertStatus.normal, AlertSize.small, Priority.LOWEST, VisualAlert.none, AudibleAlert.none, .0, .0, .1, creation_delay=1.), }, # openpilot tries to learn certain parameters about your car by observing # how the car behaves to steering inputs from both human and openpilot driving. # This includes: # - steer ratio: gear ratio of the steering rack. Steering angle divided by tire angle # - tire stiffness: how much grip your tires have # - angle offset: most steering angle sensors are offset and measure a non zero angle when driving straight # This alert is thrown when any of these values exceed a sanity check. This can be caused by # bad alignment or bad sensor data. If this happens consistently consider creating an issue on GitHub EventName.vehicleModelInvalid: { ET.NO_ENTRY: NoEntryAlert("Vehicle Parameter Identification Failed"), ET.SOFT_DISABLE: SoftDisableAlert("Vehicle Parameter Identification Failed"), ET.WARNING: Alert( "차량 매개변수 식별 오류", "", AlertStatus.normal, AlertSize.small, Priority.LOWEST, VisualAlert.steerRequired, AudibleAlert.none, .0, .0, .1), }, EventName.steerTempUnavailableUserOverride: { ET.WARNING: Alert( "핸들을 잡아주세요", "조향제어 일시적으로 사용불가", AlertStatus.userPrompt, AlertSize.small, Priority.LOW, VisualAlert.steerRequired, AudibleAlert.chimePrompt, 1., 1., 1.), }, EventName.preDriverDistracted: { ET.WARNING: Alert( "도로를 주시하세요 : 운전자 도로주시 불안", "", AlertStatus.normal, AlertSize.small, Priority.LOW, VisualAlert.steerRequired, AudibleAlert.none, .0, .1, .1), }, EventName.promptDriverDistracted: { ET.WARNING: Alert( "도로를 주시하세요", "운전자 도로주시 불안", AlertStatus.userPrompt, AlertSize.mid, Priority.MID, VisualAlert.steerRequired, AudibleAlert.chimeWarning2Repeat, .1, .1, .1), }, EventName.driverDistracted: { ET.WARNING: Alert( "조향제어가 강제로 해제됩니다", "운전자 도로주시 불안", AlertStatus.critical, AlertSize.full, Priority.HIGH, VisualAlert.steerRequired, AudibleAlert.chimeWarningRepeat, .1, .1, .1), }, EventName.preDriverUnresponsive: { ET.WARNING: Alert( "핸들을 잡아주세요 : 운전자 인식 불가", "", AlertStatus.normal, AlertSize.small, Priority.LOW, VisualAlert.steerRequired, AudibleAlert.none, .0, .1, .1, alert_rate=0.75), }, EventName.promptDriverUnresponsive: { ET.WARNING: Alert( "핸들을 잡아주세요", "운전자 응답하지않음", AlertStatus.userPrompt, AlertSize.mid, Priority.MID, VisualAlert.steerRequired, AudibleAlert.chimeWarning2Repeat, .1, .1, .1), }, EventName.driverUnresponsive: { ET.WARNING: Alert( "조향제어가 강제로 해제됩니다", "운전자 응답하지않음", AlertStatus.critical, AlertSize.full, Priority.HIGH, VisualAlert.steerRequired, AudibleAlert.chimeWarningRepeat, .1, .1, .1), }, EventName.manualRestart: { ET.WARNING: Alert( "핸들을 잡아주세요", "수동으로 재활성화하세요", AlertStatus.userPrompt, AlertSize.mid, Priority.LOW, VisualAlert.none, AudibleAlert.none, 0., 0., .2), }, EventName.resumeRequired: { ET.WARNING: Alert( "앞차량 멈춤", "앞차가 출발하면 자동 재출발", AlertStatus.userPrompt, AlertSize.mid, Priority.LOW, VisualAlert.none, AudibleAlert.none, 0., 0., .2), }, EventName.belowSteerSpeed: { ET.WARNING: below_steer_speed_alert, }, EventName.preLaneChangeLeft: { ET.WARNING: Alert( "차선을 변경합니다", "좌측차선의 차량을 확인하세요", AlertStatus.normal, AlertSize.mid, Priority.LOW, VisualAlert.steerRequired, AudibleAlert.none, .0, .1, .1, alert_rate=0.75), }, EventName.preLaneChangeRight: { ET.WARNING: Alert( "차선을 변경합니다", "우측차선의 차량을 확인하세요", AlertStatus.normal, AlertSize.mid, Priority.LOW, VisualAlert.steerRequired, AudibleAlert.none, .0, .1, .1, alert_rate=0.75), }, EventName.laneChangeBlocked: { ET.WARNING: Alert( "후측방 차량감지", "차선에 차량이 감지되니 대기하세요", AlertStatus.userPrompt, AlertSize.mid, Priority.LOW, VisualAlert.steerRequired, AudibleAlert.chimePrompt, .1, .1, .1), }, EventName.laneChange: { ET.WARNING: Alert( "차선을 변경합니다", "후측방 차량에 주의하세요", AlertStatus.normal, AlertSize.mid, Priority.LOW, VisualAlert.steerRequired, AudibleAlert.none, .0, .1, .1), }, EventName.steerSaturated: { ET.WARNING: Alert( "핸들을 잡아주세요", "조향제어 제한을 초과함", AlertStatus.userPrompt, AlertSize.mid, Priority.LOW, VisualAlert.steerRequired, AudibleAlert.chimePrompt, 1., 1., 1.), }, # Thrown when the fan is driven at >50% but is not rotating EventName.fanMalfunction: { ET.PERMANENT: NormalPermanentAlert("FAN 오작동", "하드웨어를 점검하세요"), }, # Camera is not outputting frames at a constant framerate EventName.cameraMalfunction: { ET.PERMANENT: NormalPermanentAlert("", ""), }, # Unused EventName.gpsMalfunction: { ET.PERMANENT: NormalPermanentAlert("GPS Malfunction", "Contact Support"), }, # When the GPS position and localizer diverge the localizer is reset to the # current GPS position. This alert is thrown when the localizer is reset # more often than expected. EventName.localizerMalfunction: { ET.PERMANENT: NormalPermanentAlert("Localizer unstable", "Contact Support"), }, # ********** events that affect controls state transitions ********** EventName.pcmEnable: { ET.ENABLE: EngagementAlert(AudibleAlert.chimeEngage), }, EventName.buttonEnable: { ET.ENABLE: EngagementAlert(AudibleAlert.chimeEngage), }, EventName.pcmDisable: { ET.USER_DISABLE: EngagementAlert(AudibleAlert.chimeDisengage), }, EventName.buttonCancel: { ET.USER_DISABLE: EngagementAlert(AudibleAlert.chimeDisengage), }, EventName.brakeHold: { ET.USER_DISABLE: EngagementAlert(AudibleAlert.chimeDisengage), ET.NO_ENTRY: NoEntryAlert("브레이크 감지됨"), }, EventName.parkBrake: { ET.USER_DISABLE: EngagementAlert(AudibleAlert.chimeDisengage), ET.NO_ENTRY: NoEntryAlert("주차 브레이크를 해제하세요"), }, EventName.pedalPressed: { ET.USER_DISABLE: EngagementAlert(AudibleAlert.chimeDisengage), ET.NO_ENTRY: NoEntryAlert("브레이크 감지됨", visual_alert=VisualAlert.brakePressed), }, EventName.wrongCarMode: { ET.USER_DISABLE: EngagementAlert(AudibleAlert.chimeDisengage), ET.NO_ENTRY: wrong_car_mode_alert, }, EventName.wrongCruiseMode: { ET.USER_DISABLE: EngagementAlert(AudibleAlert.chimeDisengage), ET.NO_ENTRY: NoEntryAlert("어뎁티브크루즈를 활성화하세요"), }, EventName.steerTempUnavailable: { ET.SOFT_DISABLE: SoftDisableAlert("조향제어 일시적으로 사용불가"), ET.NO_ENTRY: NoEntryAlert("조향제어 일시적으로 사용불가", duration_hud_alert=0.), }, EventName.outOfSpace: { ET.PERMANENT: Alert( "저장공간 부족", "", AlertStatus.normal, AlertSize.small, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2), ET.NO_ENTRY: NoEntryAlert("저장공간 부족", duration_hud_alert=0.), }, EventName.belowEngageSpeed: { ET.NO_ENTRY: NoEntryAlert("속도를 높여주세요"), }, EventName.sensorDataInvalid: { ET.PERMANENT: Alert( "장치 센서 오류", "장치 점검후 재가동세요", AlertStatus.normal, AlertSize.mid, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2, creation_delay=1.), ET.NO_ENTRY: NoEntryAlert("장치 센서 오류"), }, EventName.noGps: { ET.PERMANENT: no_gps_alert, }, EventName.soundsUnavailable: { ET.PERMANENT: NormalPermanentAlert("스피커가 감지되지않습니다", "이온을 재부팅 해주세요"), ET.NO_ENTRY: NoEntryAlert("스피커가 감지되지않습니다"), }, EventName.tooDistracted: { ET.NO_ENTRY: NoEntryAlert("방해 수준이 너무높음"), }, EventName.overheat: { ET.PERMANENT: Alert( "장치 과열됨", "", AlertStatus.normal, AlertSize.small, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2), ET.SOFT_DISABLE: SoftDisableAlert("장치 과열됨"), ET.NO_ENTRY: NoEntryAlert("장치 과열됨"), }, EventName.wrongGear: { ET.SOFT_DISABLE: SoftDisableAlert("기어를 [D]로 변경하세요"), ET.NO_ENTRY: NoEntryAlert("기어를 [D]로 변경하세요"), }, # This alert is thrown when the calibration angles are outside of the acceptable range. # For example if the device is pointed too much to the left or the right. # Usually this can only be solved by removing the mount from the windshield completely, # and attaching while making sure the device is pointed straight forward and is level. # See https://comma.ai/setup for more information EventName.calibrationInvalid: { ET.PERMANENT: NormalPermanentAlert("캘리브레이션 오류", "장치 위치변경후 캘리브레이션을 다시하세요"), ET.SOFT_DISABLE: SoftDisableAlert("캘리브레이션 오류 : 장치 위치변경후 캘리브레이션을 다시하세요"), ET.NO_ENTRY: NoEntryAlert("캘리브레이션 오류 : 장치 위치변경후 캘리브레이션을 다시하세요"), }, EventName.calibrationIncomplete: { ET.PERMANENT: calibration_incomplete_alert, ET.SOFT_DISABLE: SoftDisableAlert("캘리브레이션 진행중입니다"), ET.NO_ENTRY: NoEntryAlert("캘리브레이션 진행중입니다"), }, EventName.doorOpen: { ET.SOFT_DISABLE: SoftDisableAlert("도어 열림"), ET.NO_ENTRY: NoEntryAlert("도어 열림"), }, EventName.seatbeltNotLatched: { ET.SOFT_DISABLE: SoftDisableAlert("안전벨트를 착용해주세요"), ET.NO_ENTRY: NoEntryAlert("안전벨트를 착용해주세요"), }, EventName.espDisabled: { ET.SOFT_DISABLE: SoftDisableAlert("ESP 꺼짐"), ET.NO_ENTRY: NoEntryAlert("ESP 꺼짐"), }, EventName.lowBattery: { ET.SOFT_DISABLE: SoftDisableAlert("배터리 부족"), ET.NO_ENTRY: NoEntryAlert("배터리 부족"), }, # Different openpilot services communicate between each other at a certain # interval. If communication does not follow the regular schedule this alert # is thrown. This can mean a service crashed, did not broadcast a message for # ten times the regular interval, or the average interval is more than 10% too high. EventName.commIssue: { ET.SOFT_DISABLE: SoftDisableAlert("장치 프로세스 통신오류"), ET.NO_ENTRY: NoEntryAlert("장치 프로세스 통신오류", audible_alert=AudibleAlert.chimeDisengage), }, # Thrown when manager detects a service exited unexpectedly while driving EventName.processNotRunning: { ET.NO_ENTRY: NoEntryAlert("시스템 오작동: 이온을 재부팅 하세요", audible_alert=AudibleAlert.chimeDisengage), }, EventName.radarFault: { ET.SOFT_DISABLE: SoftDisableAlert("레이더 오류 : 차량을 재가동하세요"), ET.NO_ENTRY : NoEntryAlert("레이더 오류 : 차량을 재가동하세요"), }, # Every frame from the camera should be processed by the model. If modeld # is not processing frames fast enough they have to be dropped. This alert is # thrown when over 20% of frames are dropped. EventName.modeldLagging: { ET.SOFT_DISABLE: SoftDisableAlert("주행모델 지연됨"), ET.NO_ENTRY : NoEntryAlert("주행모델 지연됨"), }, # Besides predicting the path, lane lines and lead car data the model also # predicts the current velocity and rotation speed of the car. If the model is # very uncertain about the current velocity while the car is moving, this # usually means the model has trouble understanding the scene. This is used # as a heuristic to warn the driver. EventName.posenetInvalid: { ET.SOFT_DISABLE: SoftDisableAlert("차선인식상태가 좋지않으니 주의운전하세요"), ET.NO_ENTRY: NoEntryAlert("차선인식상태가 좋지않으니 주의운전하세요"), }, # When the localizer detects an acceleration of more than 40 m/s^2 (~4G) we # alert the driver the device might have fallen from the windshield. EventName.deviceFalling: { ET.SOFT_DISABLE: SoftDisableAlert("장치가 마운트에서 떨어짐"), ET.NO_ENTRY: NoEntryAlert("장치가 마운트에서 떨어짐"), }, EventName.lowMemory: { ET.SOFT_DISABLE: SoftDisableAlert("메모리 부족 : 장치를 재가동하세요"), ET.PERMANENT: NormalPermanentAlert("메모리 부족", "장치를 재가동하세요"), ET.NO_ENTRY : NoEntryAlert("메모리 부족 : 장치를 재가동하세요", audible_alert=AudibleAlert.chimeDisengage), }, EventName.accFaulted: { ET.IMMEDIATE_DISABLE: ImmediateDisableAlert("크루즈 오류"), ET.PERMANENT: NormalPermanentAlert("크루즈 오류", ""), ET.NO_ENTRY: NoEntryAlert("크루즈 오류"), }, EventName.controlsMismatch: { ET.IMMEDIATE_DISABLE: ImmediateDisableAlert("컨트롤 불일치"), }, EventName.roadCameraError: { ET.PERMANENT: NormalPermanentAlert("Road Camera Error", "", duration_text=10.), }, EventName.driverCameraError: { ET.PERMANENT: NormalPermanentAlert("Driver Camera Error", "", duration_text=10.), }, EventName.wideRoadCameraError: { ET.PERMANENT: NormalPermanentAlert("Wide Road Camera Error", "", duration_text=10.), }, # Sometimes the USB stack on the device can get into a bad state # causing the connection to the panda to be lost EventName.usbError: { ET.SOFT_DISABLE: SoftDisableAlert("USB 에러: 이온을 재부팅 하세요"), ET.PERMANENT: NormalPermanentAlert("USB 에러: 이온을 재부팅 하세요", ""), ET.NO_ENTRY: NoEntryAlert("USB 에러: 이온을 재부팅 하세요"), }, # This alert can be thrown for the following reasons: # - No CAN data received at all # - CAN data is received, but some message are not received at the right frequency # If you're not writing a new car port, this is usually cause by faulty wiring EventName.canError: { ET.IMMEDIATE_DISABLE: ImmediateDisableAlert("CAN 오류 : 하드웨어를 점검하세요"), ET.PERMANENT: Alert( "CAN 오류 : 하드웨어를 점검하세요", "", AlertStatus.normal, AlertSize.small, Priority.LOW, VisualAlert.none, AudibleAlert.none, 0., 0., .2, creation_delay=1.), ET.NO_ENTRY: NoEntryAlert("CAN 오류 : 하드웨어를 점검하세요"), }, EventName.steerUnavailable: { ET.IMMEDIATE_DISABLE: ImmediateDisableAlert("LKAS 오류 : 차량을 재가동하세요"), ET.PERMANENT: Alert( "LKAS 오류 : 차량을 재가동하세요", "", AlertStatus.normal, AlertSize.small, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2), ET.NO_ENTRY: NoEntryAlert("LKAS 오류 : 차량을 재가동하세요"), }, EventName.brakeUnavailable: { ET.IMMEDIATE_DISABLE: ImmediateDisableAlert("Cruise Fault: Restart the Car"), ET.PERMANENT: Alert( "크루즈 오류 : 차량을 재가동하세요", "", AlertStatus.normal, AlertSize.small, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2), ET.NO_ENTRY: NoEntryAlert("크루즈 오류 : 차량을 재가동하세요"), }, EventName.reverseGear: { ET.PERMANENT: Alert( "기어 [R] 상태", "", AlertStatus.normal, AlertSize.full, Priority.LOWEST, VisualAlert.none, AudibleAlert.none, 0., 0., .2, creation_delay=0.5), ET.SOFT_DISABLE: SoftDisableAlert("기어 [R] 상태"), ET.NO_ENTRY: NoEntryAlert("기어 [R] 상태"), }, # On cars that use stock ACC the car can decide to cancel ACC for various reasons. # When this happens we can no long control the car so the user needs to be warned immediately. EventName.cruiseDisabled: { ET.IMMEDIATE_DISABLE: ImmediateDisableAlert("크루즈 꺼짐"), }, # For planning the trajectory Model Predictive Control (MPC) is used. This is # an optimization algorithm that is not guaranteed to find a feasible solution. # If no solution is found or the solution has a very high cost this alert is thrown. EventName.plannerError: { ET.SOFT_DISABLE: SoftDisableAlert("플래너 솔루션 오류"), ET.NO_ENTRY: NoEntryAlert("플래너 솔루션 오류"), }, # When the relay in the harness box opens the CAN bus between the LKAS camera # and the rest of the car is separated. When messages from the LKAS camera # are received on the car side this usually means the relay hasn't opened correctly # and this alert is thrown. EventName.relayMalfunction: { ET.IMMEDIATE_DISABLE: ImmediateDisableAlert("하네스 오작동"), ET.PERMANENT: NormalPermanentAlert("하네스 오작동", "하드웨어를 점검하세요"), ET.NO_ENTRY: NoEntryAlert("하네스 오작동"), }, EventName.noTarget: { ET.IMMEDIATE_DISABLE: Alert( "오픈파일럿 사용불가", "근접 앞차량이 없습니다", AlertStatus.normal, AlertSize.mid, Priority.HIGH, VisualAlert.none, AudibleAlert.chimeDisengage, .4, 2., 3.), ET.NO_ENTRY: NoEntryAlert("No Close Lead Car"), }, EventName.speedTooLow: { ET.IMMEDIATE_DISABLE: Alert( "오픈파일럿 사용불가", "속도를 높이고 재가동하세요", AlertStatus.normal, AlertSize.mid, Priority.HIGH, VisualAlert.none, AudibleAlert.chimeDisengage, .4, 2., 3.), }, # When the car is driving faster than most cars in the training data the model outputs can be unpredictable EventName.speedTooHigh: { ET.WARNING: Alert( "속도가 너무 높습니다", "속도를 줄여주세요", AlertStatus.userPrompt, AlertSize.mid, Priority.HIGH, VisualAlert.steerRequired, AudibleAlert.chimeWarning2Repeat, 2.2, 3., 4.), ET.NO_ENTRY: Alert( "속도가 너무 높습니다", "속도를 줄이고 재가동하세요", AlertStatus.normal, AlertSize.mid, Priority.LOW, VisualAlert.none, AudibleAlert.chimeError, .4, 2., 3.), }, EventName.lowSpeedLockout: { ET.PERMANENT: Alert( "크루즈 오류 : 차량을 재가동하세요", "", AlertStatus.normal, AlertSize.small, Priority.LOWER, VisualAlert.none, AudibleAlert.none, 0., 0., .2), ET.NO_ENTRY: NoEntryAlert("크루즈 오류 : 차량을 재가동하세요"), }, EventName.turningIndicatorOn: { ET.WARNING: Alert( "방향지시등 동작중에는 핸들을 잡아주세요", "", AlertStatus.userPrompt, AlertSize.small, Priority.LOW, VisualAlert.none, AudibleAlert.none, .0, .0, .2), }, EventName.autoLaneChange: { ET.WARNING: auto_lane_change_alert, }, EventName.slowingDownSpeed: { ET.PERMANENT: Alert("속도를 조절합니다","", AlertStatus.normal, AlertSize.small, Priority.MID, VisualAlert.none, AudibleAlert.none, 0., .1, .1), }, EventName.slowingDownSpeedSound: { ET.PERMANENT: Alert("속도를 조절합니다","", AlertStatus.normal, AlertSize.small, Priority.HIGH, VisualAlert.none, AudibleAlert.chimeSlowingDownSpeed, 2., 2., 2.), }, } </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">33.876368</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">116</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.674547</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">agegold/neokii_KR-1</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">selfdrive/controls/lib/events.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">34,085</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8756"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import numpy as np import h5py import argparse import imageio import tqdm import os from glob import glob def main(args): """Main function to parse in Nuclei Dataset from Kaggle and store as HDF5 Parameters ---------- args: ArgumentParser() input_dir: str directory of the Nuclei data output_dir: str path to the HDF5 output directory """ # create hdf5 hdf5_fn = h5py.File(os.path.join(args.output_dir, "data_360.hdf5"), "a") # get all data directory data_dirs = glob(os.path.join(args.input_dir, "*/")) with tqdm.tqdm(total=len(data_dirs), unit="folder") as progress_bar: for path in data_dirs: data_name = path.split("/")[-2] x, y, masks = parse_data(path) # TODO only use majority size for now if x is None: progress_bar.update(1) continue # stack x and y together y = np.expand_dims(y, axis=0) data = np.vstack((x,y,masks)) hdf5_fn.create_dataset(str(data_name), data=data, dtype=np.float, chunks=True) progress_bar.update(1) hdf5_fn.close() def parse_data(path): # define data folders x_path = os.path.join(path, "images/") y_path = os.path.join(path, "masks/") # get all data paths x_file = glob(os.path.join(x_path, "*.png"))[0] y_files = glob(os.path.join(y_path, "*.png")) # parse in data x = imageio.imread(x_file) # TODO only using majority shape if x.shape != (256, 256, 4): return None, None, None masks = np.array([imageio.imread(y) for y in y_files]) y = np.zeros_like(masks[0]) for y_raw in masks: y = np.maximum(y, y_raw) # normalize x = x / 255.0 y = y / 255.0 masks = masks / 255.0 # fix dimentions x = np.transpose(x, (2,0,1)) # channels first return x, y, masks if __name__ == "__main__": parser = argparse.ArgumentParser() parser.add_argument('--input_dir', type=str) parser.add_argument('--output_dir', type=str) args = parser.parse_args() main(args) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">23.879121</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">90</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.588127</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">marshuang80/CellSegmentation</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">process_data/nuclei_create_hdf5.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">2,173</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8757"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">#11_Duplicate in an array N+1 integer """ Given an array of n elements that contains elements from 0 to n-1, with any of these numbers appearing any number of times. Find these repeating numbers in O(n) and using only constant memory space. Example: Input : n = 7 and array[] = {1, 2, 3, 6, 3, 6, 1} Output: 1, 3, 6 Explanation: The numbers 1 , 3 and 6 appears more than once in the array. Input : n = 5 and array[] = {1, 2, 3, 4 ,3} Output: 3 Explanation: The number 3 appears more than once in the array. """ """ Algorithm: 1. Traverse the array from start to end. 2. For every element, take its absolute value and if the abs(array[i])‘th element is positive, the element has not encountered before, else if negative the element has been encountered before print the absolute value of the current element. Complexity Analysis: Time Complexity: O(n), only one traversal is needed, so time complexity is O(n) Auxiliary Space: O(1), no extra space is required, so space complexity is constant """ def printRepeating(arr, size): print("The repeating elements are :") for i in range(0,size): if arr[abs(arr[i])] > 0: arr[abs(arr[i])] =-arr[abs(arr[i])] else: print(abs(arr[i]), end=" ") arr = [1,2,3,1,3,6,6] arr_size = len(arr) printRepeating(arr, arr_size) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">26.641509</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">199</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.640227</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">iamParvezKhan25/Data-Structure-Algorithm</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">11_Duplicate in an array N+1 integer.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">1,414</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8758"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># Copyright (c) OpenMMLab. All rights reserved. import torch from torch.nn.parallel.distributed import (DistributedDataParallel, _find_tensors) from mmcv import print_log from mmcv.utils import TORCH_VERSION, digit_version from .scatter_gather import scatter_kwargs class MMDistributedDataParallel(DistributedDataParallel): """The DDP module that supports DataContainer. MMDDP has two main differences with PyTorch DDP: - It supports a custom type :class:`DataContainer` which allows more flexible control of input data. - It implement two APIs ``train_step()`` and ``val_step()``. """ def to_kwargs(self, inputs, kwargs, device_id): # Use `self.to_kwargs` instead of `self.scatter` in pytorch1.8 # to move all tensors to device_id return scatter_kwargs(inputs, kwargs, [device_id], dim=self.dim) def scatter(self, inputs, kwargs, device_ids): return scatter_kwargs(inputs, kwargs, device_ids, dim=self.dim) def train_step(self, *inputs, **kwargs): """train_step() API for module wrapped by DistributedDataParallel. This method is basically the same as ``DistributedDataParallel.forward()``, while replacing ``self.module.forward()`` with ``self.module.train_step()``. It is compatible with PyTorch 1.1 - 1.5. """ # In PyTorch >= 1.7, ``reducer._rebuild_buckets()`` is moved from the # end of backward to the beginning of forward. if ('parrots' not in TORCH_VERSION and digit_version(TORCH_VERSION) >= digit_version('1.7') and self.reducer._rebuild_buckets()): print_log( 'Reducer buckets have been rebuilt in this iteration.', logger='mmcv') if ('parrots' not in TORCH_VERSION and digit_version(TORCH_VERSION) >= digit_version('1.11.0')): if self._check_sync_bufs_pre_fwd(): self._sync_buffers() else: if (getattr(self, 'require_forward_param_sync', False) and self.require_forward_param_sync): self._sync_params() if self.device_ids: inputs, kwargs = self.scatter(inputs, kwargs, self.device_ids) if len(self.device_ids) == 1: output = self.module.train_step(*inputs[0], **kwargs[0]) else: outputs = self.parallel_apply( self._module_copies[:len(inputs)], inputs, kwargs) output = self.gather(outputs, self.output_device) else: output = self.module.train_step(*inputs, **kwargs) if ('parrots' not in TORCH_VERSION and digit_version(TORCH_VERSION) >= digit_version('1.11.0')): if self._check_sync_bufs_post_fwd(): self._sync_buffers() if (torch.is_grad_enabled() and getattr(self, 'require_backward_grad_sync', False) and self.require_backward_grad_sync): if self.find_unused_parameters: self.reducer.prepare_for_backward(list(_find_tensors(output))) else: self.reducer.prepare_for_backward([]) else: if ('parrots' not in TORCH_VERSION and digit_version(TORCH_VERSION) > digit_version('1.2')): self.require_forward_param_sync = False return output def val_step(self, *inputs, **kwargs): """val_step() API for module wrapped by DistributedDataParallel. This method is basically the same as ``DistributedDataParallel.forward()``, while replacing ``self.module.forward()`` with ``self.module.val_step()``. It is compatible with PyTorch 1.1 - 1.5. """ # In PyTorch >= 1.7, ``reducer._rebuild_buckets()`` is moved from the # end of backward to the beginning of forward. if ('parrots' not in TORCH_VERSION and digit_version(TORCH_VERSION) >= digit_version('1.7') and self.reducer._rebuild_buckets()): print_log( 'Reducer buckets have been rebuilt in this iteration.', logger='mmcv') if ('parrots' not in TORCH_VERSION and digit_version(TORCH_VERSION) >= digit_version('1.11.0')): if self._check_sync_bufs_pre_fwd(): self._sync_buffers() else: if (getattr(self, 'require_forward_param_sync', False) and self.require_forward_param_sync): self._sync_params() if self.device_ids: inputs, kwargs = self.scatter(inputs, kwargs, self.device_ids) if len(self.device_ids) == 1: output = self.module.val_step(*inputs[0], **kwargs[0]) else: outputs = self.parallel_apply( self._module_copies[:len(inputs)], inputs, kwargs) output = self.gather(outputs, self.output_device) else: output = self.module.val_step(*inputs, **kwargs) if ('parrots' not in TORCH_VERSION and digit_version(TORCH_VERSION) >= digit_version('1.11.0')): if self._check_sync_bufs_post_fwd(): self._sync_buffers() if (torch.is_grad_enabled() and getattr(self, 'require_backward_grad_sync', False) and self.require_backward_grad_sync): if self.find_unused_parameters: self.reducer.prepare_for_backward(list(_find_tensors(output))) else: self.reducer.prepare_for_backward([]) else: if ('parrots' not in TORCH_VERSION and digit_version(TORCH_VERSION) > digit_version('1.2')): self.require_forward_param_sync = False return output </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">42.568345</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">78</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.603008</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">BIGWangYuDong/mmcv</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">mmcv/parallel/distributed.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">5,917</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8759"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import datetime import json import logging import re import time from google.appengine.ext import db # from google.appengine.ext.db import djangoforms from google.appengine.api import mail from google.appengine.api import memcache from google.appengine.api import urlfetch from google.appengine.api import taskqueue from google.appengine.api import users import settings import util #from django.forms import ModelForm from collections import OrderedDict from django import forms # import google.appengine.ext.django as django SIMPLE_TYPES = (int, long, float, bool, dict, basestring, list) WEBCOMPONENTS = 1 MISC = 2 SECURITY = 3 MULTIMEDIA = 4 DOM = 5 FILE = 6 OFFLINE = 7 DEVICE = 8 COMMUNICATION = 9 JAVASCRIPT = 10 NETWORKING = 11 INPUT = 12 PERFORMANCE = 13 GRAPHICS = 14 CSS = 15 HOUDINI = 16 SERVICEWORKER = 17 WEBRTC = 18 LAYERED = 19 FEATURE_CATEGORIES = { CSS: 'CSS', WEBCOMPONENTS: 'Web Components', MISC: 'Misc', SECURITY: 'Security', MULTIMEDIA: 'Multimedia', DOM: 'DOM', FILE: 'File APIs', OFFLINE: 'Offline / Storage', DEVICE: 'Device', COMMUNICATION: 'Realtime / Communication', JAVASCRIPT: 'JavaScript', NETWORKING: 'Network / Connectivity', INPUT: 'User input', PERFORMANCE: 'Performance', GRAPHICS: 'Graphics', HOUDINI: 'Houdini', SERVICEWORKER: 'Service Worker', WEBRTC: 'Web RTC', LAYERED: 'Layered APIs', } # Intent stages and mapping from stage to stage name. INTENT_NONE = 0 INTENT_IMPLEMENT = 1 INTENT_EXPERIMENT = 2 INTENT_EXTEND_TRIAL = 3 INTENT_IMPLEMENT_SHIP = 4 INTENT_SHIP = 5 INTENT_REMOVE = 6 INTENT_STAGES = { INTENT_NONE: 'None', INTENT_IMPLEMENT: 'Prototype', INTENT_EXPERIMENT: 'Experiment', INTENT_EXTEND_TRIAL: 'Extend Origin Trial', INTENT_IMPLEMENT_SHIP: 'Implement and Ship', INTENT_SHIP: 'Ship', INTENT_REMOVE: 'Remove', } NO_ACTIVE_DEV = 1 PROPOSED = 2 IN_DEVELOPMENT = 3 BEHIND_A_FLAG = 4 ENABLED_BY_DEFAULT = 5 DEPRECATED = 6 REMOVED = 7 ORIGIN_TRIAL = 8 INTERVENTION = 9 NO_LONGER_PURSUING = 1000 # insure bottom of list # Ordered dictionary, make sure the order of this dictionary matches that of # the sorted list above! IMPLEMENTATION_STATUS = OrderedDict() IMPLEMENTATION_STATUS[NO_ACTIVE_DEV] = 'No active development' IMPLEMENTATION_STATUS[PROPOSED] = 'Proposed' IMPLEMENTATION_STATUS[IN_DEVELOPMENT] = 'In development' IMPLEMENTATION_STATUS[BEHIND_A_FLAG] = 'Behind a flag' IMPLEMENTATION_STATUS[ENABLED_BY_DEFAULT] = 'Enabled by default' IMPLEMENTATION_STATUS[DEPRECATED] = 'Deprecated' IMPLEMENTATION_STATUS[REMOVED] = 'Removed' IMPLEMENTATION_STATUS[ORIGIN_TRIAL] = 'Origin trial' IMPLEMENTATION_STATUS[INTERVENTION] = 'Browser Intervention' IMPLEMENTATION_STATUS[NO_LONGER_PURSUING] = 'No longer pursuing' MAJOR_NEW_API = 1 MAJOR_MINOR_NEW_API = 2 SUBSTANTIVE_CHANGES = 3 MINOR_EXISTING_CHANGES = 4 EXTREMELY_SMALL_CHANGE = 5 FOOTPRINT_CHOICES = { MAJOR_NEW_API: ('A major new independent API (e.g. adding a large # ' 'independent concepts with many methods/properties/objects)'), MAJOR_MINOR_NEW_API: ('Major changes to an existing API OR a minor new ' 'independent API (e.g. adding a large # of new ' 'methods/properties or introducing new concepts to ' 'augment an existing API)'), SUBSTANTIVE_CHANGES: ('Substantive changes to an existing API (e.g. small ' 'number of new methods/properties)'), MINOR_EXISTING_CHANGES: ( 'Minor changes to an existing API (e.g. adding a new keyword/allowed ' 'argument to a property/method)'), EXTREMELY_SMALL_CHANGE: ('Extremely small tweaks to an existing API (e.g. ' 'how existing keywords/arguments are interpreted)'), } MAINSTREAM_NEWS = 1 WARRANTS_ARTICLE = 2 IN_LARGER_ARTICLE = 3 SMALL_NUM_DEVS = 4 SUPER_SMALL = 5 VISIBILITY_CHOICES = { MAINSTREAM_NEWS: 'Likely in mainstream tech news', WARRANTS_ARTICLE: 'Will this feature generate articles on sites like developers.google.com/web/', IN_LARGER_ARTICLE: 'Covered as part of a larger article but not on its own', SMALL_NUM_DEVS: 'Only a very small number of web developers will care', SUPER_SMALL: "So small it doesn't need to be covered in this dashboard", } SHIPPED = 1 IN_DEV = 2 PUBLIC_SUPPORT = 3 MIXED_SIGNALS = 4 NO_PUBLIC_SIGNALS = 5 PUBLIC_SKEPTICISM = 6 OPPOSED = 7 VENDOR_VIEWS = { SHIPPED: 'Shipped', IN_DEV: 'In development', PUBLIC_SUPPORT: 'Public support', MIXED_SIGNALS: 'Mixed public signals', NO_PUBLIC_SIGNALS: 'No public signals', PUBLIC_SKEPTICISM: 'Public skepticism', OPPOSED: 'Opposed', } DEFACTO_STD = 1 ESTABLISHED_STD = 2 WORKING_DRAFT = 3 EDITORS_DRAFT = 4 PUBLIC_DISCUSSION = 5 NO_STD_OR_DISCUSSION = 6 STANDARDIZATION = { DEFACTO_STD: 'De-facto standard', ESTABLISHED_STD: 'Established standard', WORKING_DRAFT: 'Working draft or equivalent', EDITORS_DRAFT: "Editor's draft", PUBLIC_DISCUSSION: 'Public discussion', NO_STD_OR_DISCUSSION: 'No public standards discussion', } DEV_STRONG_POSITIVE = 1 DEV_POSITIVE = 2 DEV_MIXED_SIGNALS = 3 DEV_NO_SIGNALS = 4 DEV_NEGATIVE = 5 DEV_STRONG_NEGATIVE = 6 WEB_DEV_VIEWS = { DEV_STRONG_POSITIVE: 'Strongly positive', DEV_POSITIVE: 'Positive', DEV_MIXED_SIGNALS: 'Mixed signals', DEV_NO_SIGNALS: 'No signals', DEV_NEGATIVE: 'Negative', DEV_STRONG_NEGATIVE: 'Strongly negative', } def del_none(d): """ Delete dict keys with None values, and empty lists, recursively. """ for key, value in d.items(): if value is None or (isinstance(value, list) and len(value) == 0): del d[key] elif isinstance(value, dict): del_none(value) return d def list_to_chunks(l, n): """Yield successive n-sized chunk lists from l.""" for i in xrange(0, len(l), n): yield l[i:i + n] class DictModel(db.Model): # def to_dict(self): # return dict([(p, unicode(getattr(self, p))) for p in self.properties()]) def format_for_template(self): d = self.to_dict() d['id'] = self.key().id() return d def to_dict(self): output = {} for key, prop in self.properties().iteritems(): value = getattr(self, key) if value is None or isinstance(value, SIMPLE_TYPES): output[key] = value elif isinstance(value, datetime.date): # Convert date/datetime to ms-since-epoch ("new Date()"). #ms = time.mktime(value.utctimetuple()) #ms += getattr(value, 'microseconds', 0) / 1000 #output[key] = int(ms) output[key] = unicode(value) elif isinstance(value, db.GeoPt): output[key] = {'lat': value.lat, 'lon': value.lon} elif isinstance(value, db.Model): output[key] = to_dict(value) elif isinstance(value, users.User): output[key] = value.email() else: raise ValueError('cannot encode ' + repr(prop)) return output class BlinkComponent(DictModel): DEFAULT_COMPONENT = 'Blink' COMPONENTS_URL = 'https://blinkcomponents-b48b5.firebaseapp.com' COMPONENTS_ENDPOINT = '%s/blinkcomponents' % COMPONENTS_URL WF_CONTENT_ENDPOINT = '%s/wfcomponents' % COMPONENTS_URL name = db.StringProperty(required=True, default=DEFAULT_COMPONENT) created = db.DateTimeProperty(auto_now_add=True) updated = db.DateTimeProperty(auto_now=True) @property def subscribers(self): return FeatureOwner.all().filter('blink_components = ', self.key()).order('name').fetch(None) @property def owners(self): return FeatureOwner.all().filter('primary_blink_components = ', self.key()).order('name').fetch(None) @classmethod def fetch_all_components(self, update_cache=False): """Returns the list of blink components from live endpoint if unavailable in the cache.""" key = '%s|blinkcomponents' % (settings.MEMCACHE_KEY_PREFIX) components = memcache.get(key) if components is None or update_cache: components = [] result = urlfetch.fetch(self.COMPONENTS_ENDPOINT, deadline=60) if result.status_code == 200: components = sorted(json.loads(result.content)) memcache.set(key, components) else: logging.error('Fetching blink components returned: %s' % result.status_code) return components @classmethod def fetch_wf_content_for_components(self, update_cache=False): """Returns the /web content that use each blink component.""" key = '%s|wfcomponents' % (settings.MEMCACHE_KEY_PREFIX) components = memcache.get(key) if components is None or update_cache: components = {} result = urlfetch.fetch(self.WF_CONTENT_ENDPOINT, deadline=60) if result.status_code == 200: components = json.loads(result.content) memcache.set(key, components) else: logging.error('Fetching /web blink components content returned: %s' % result.status_code) return components @classmethod def update_db(self): """Updates the db with new Blink components from the json endpoint""" self.fetch_wf_content_for_components(update_cache=True) # store /web content in memcache new_components = self.fetch_all_components(update_cache=True) existing_comps = self.all().fetch(None) for name in new_components: if not len([x.name for x in existing_comps if x.name == name]): logging.info('Adding new BlinkComponent: ' + name) c = BlinkComponent(name=name) c.put() @classmethod def get_by_name(self, component_name): """Fetch blink component with given name.""" q = self.all() q.filter('name =', component_name) component = q.fetch(1) if not component: logging.error('%s is an unknown BlinkComponent.' % (component_name)) return None return component[0] # UMA metrics. class StableInstance(DictModel): created = db.DateTimeProperty(auto_now_add=True) updated = db.DateTimeProperty(auto_now=True) property_name = db.StringProperty(required=True) bucket_id = db.IntegerProperty(required=True) date = db.DateProperty(verbose_name='When the data was fetched', required=True) #hits = db.IntegerProperty(required=True) #total_pages = db.IntegerProperty() day_percentage = db.FloatProperty() rolling_percentage = db.FloatProperty() class AnimatedProperty(StableInstance): pass class FeatureObserver(StableInstance): pass # Feature dashboard. class Feature(DictModel): """Container for a feature.""" DEFAULT_MEMCACHE_KEY = '%s|features' % (settings.MEMCACHE_KEY_PREFIX) MAX_CHUNK_SIZE = 500 # max num features to save for each memcache chunk. @classmethod def get_feature_chunk_memcache_keys(self, key_prefix): num_features = len(Feature.all().fetch(limit=None, keys_only=True)) l = list_to_chunks(range(0, num_features), self.MAX_CHUNK_SIZE) return ['%s|chunk%s' % (key_prefix, i) for i,val in enumerate(l)] @classmethod def set_feature_chunk_memcache_keys(self, key_prefix, feature_list): chunks = list_to_chunks(feature_list, self.MAX_CHUNK_SIZE) vals = [] for i, chunk in enumerate(chunks): vals.append(('%s|chunk%s' % (key_prefix, i), chunk)) # d = OrderedDict(sorted(dict(vals).items(), key=lambda t: t[0])) d = dict(vals) return d @classmethod def _first_of_milestone(self, feature_list, milestone, start=0): for i in xrange(start, len(feature_list)): f = feature_list[i] if (str(f['shipped_milestone']) == str(milestone) or f['impl_status_chrome'] == str(milestone)): return i elif (f['shipped_milestone'] == None and str(f['shipped_android_milestone']) == str(milestone)): return i return -1 @classmethod def _first_of_milestone_v2(self, feature_list, milestone, start=0): for i in xrange(start, len(feature_list)): f = feature_list[i] desktop_milestone = f['browsers']['chrome'].get('desktop', None) android_milestone = f['browsers']['chrome'].get('android', None) status = f['browsers']['chrome']['status'].get('text', None) if (str(desktop_milestone) == str(milestone) or status == str(milestone)): return i elif (desktop_milestone == None and str(android_milestone) == str(milestone)): return i return -1 @classmethod def _annotate_first_of_milestones(self, feature_list, version=None): try: omaha_data = util.get_omaha_data() win_versions = omaha_data[0]['versions'] # Find the latest canary major version from the list of windows versions. canary_versions = [x for x in win_versions if x.get('channel') and x.get('channel').startswith('canary')] LATEST_VERSION = int(canary_versions[0].get('version').split('.')[0]) milestones = range(1, LATEST_VERSION + 1) milestones.reverse() versions = [ IMPLEMENTATION_STATUS[NO_ACTIVE_DEV], IMPLEMENTATION_STATUS[PROPOSED], IMPLEMENTATION_STATUS[IN_DEVELOPMENT], IMPLEMENTATION_STATUS[DEPRECATED], ] versions.extend(milestones) versions.append(IMPLEMENTATION_STATUS[NO_LONGER_PURSUING]) first_of_milestone_func = Feature._first_of_milestone if version == 2: first_of_milestone_func = Feature._first_of_milestone_v2 last_good_idx = 0 for i, ver in enumerate(versions): idx = first_of_milestone_func(feature_list, ver, start=last_good_idx) if idx != -1: feature_list[idx]['first_of_milestone'] = True last_good_idx = idx except Exception as e: logging.error(e) def format_for_template(self, version=None): d = self.to_dict() if version == 2: if self.is_saved(): d['id'] = self.key().id() else: d['id'] = None d['category'] = FEATURE_CATEGORIES[self.category] if self.intent_stage is not None: d['intent_stage'] = INTENT_STAGES[self.intent_stage] d['created'] = { 'by': d.pop('created_by', None), 'when': d.pop('created', None), } d['updated'] = { 'by': d.pop('updated_by', None), 'when': d.pop('updated', None), } d['standards'] = { 'spec': d.pop('spec_link', None), 'status': { 'text': STANDARDIZATION[self.standardization], 'val': d.pop('standardization', None), }, 'visibility': { 'text': VISIBILITY_CHOICES[self.visibility], 'val': d.pop('visibility', None), }, 'footprint': { 'val': d.pop('footprint', None), #'text': FOOTPRINT_CHOICES[self.footprint] } } d['resources'] = { 'samples': d.pop('sample_links', []), 'docs': d.pop('doc_links', []), } d['tags'] = d.pop('search_tags', []) d['browsers'] = { 'chrome': { 'bug': d.pop('bug_url', None), 'blink_components': d.pop('blink_components', []), 'owners': d.pop('owner', []), 'origintrial': self.impl_status_chrome == ORIGIN_TRIAL, 'intervention': self.impl_status_chrome == INTERVENTION, 'prefixed': d.pop('prefixed', False), 'flag': self.impl_status_chrome == BEHIND_A_FLAG, 'status': { 'text': IMPLEMENTATION_STATUS[self.impl_status_chrome], 'val': d.pop('impl_status_chrome', None) }, 'desktop': d.pop('shipped_milestone', None), 'android': d.pop('shipped_android_milestone', None), 'webview': d.pop('shipped_webview_milestone', None), 'ios': d.pop('shipped_ios_milestone', None), }, 'ff': { 'view': { 'text': VENDOR_VIEWS[self.ff_views], 'val': d.pop('ff_views', None), 'url': d.pop('ff_views_link', None), 'notes': d.pop('ff_views_notes', None), } }, 'edge': { 'view': { 'text': VENDOR_VIEWS[self.ie_views], 'val': d.pop('ie_views', None), 'url': d.pop('ie_views_link', None), 'notes': d.pop('ie_views_notes', None), } }, 'safari': { 'view': { 'text': VENDOR_VIEWS[self.safari_views], 'val': d.pop('safari_views', None), 'url': d.pop('safari_views_link', None), 'notes': d.pop('safari_views_notes', None), } }, 'webdev': { 'view': { 'text': WEB_DEV_VIEWS[self.web_dev_views], 'val': d.pop('web_dev_views', None), 'url': d.pop('web_dev_views_link', None), 'notes': d.pop('web_dev_views_notes', None), } } } if self.shipped_milestone: d['browsers']['chrome']['status']['milestone_str'] = self.shipped_milestone elif self.shipped_milestone is None and self.shipped_android_milestone: d['browsers']['chrome']['status']['milestone_str'] = self.shipped_android_milestone else: d['browsers']['chrome']['status']['milestone_str'] = d['browsers']['chrome']['status']['text'] del d['created'] del_none(d) # Further prune response by removing null/[] values. else: if self.is_saved(): d['id'] = self.key().id() else: d['id'] = None d['category'] = FEATURE_CATEGORIES[self.category] if self.intent_stage is not None: d['intent_stage'] = INTENT_STAGES[self.intent_stage] d['visibility'] = VISIBILITY_CHOICES[self.visibility] d['impl_status_chrome'] = IMPLEMENTATION_STATUS[self.impl_status_chrome] d['meta'] = { 'origintrial': self.impl_status_chrome == ORIGIN_TRIAL, 'intervention': self.impl_status_chrome == INTERVENTION, 'needsflag': self.impl_status_chrome == BEHIND_A_FLAG, } if self.shipped_milestone: d['meta']['milestone_str'] = self.shipped_milestone elif self.shipped_milestone is None and self.shipped_android_milestone: d['meta']['milestone_str'] = self.shipped_android_milestone else: d['meta']['milestone_str'] = d['impl_status_chrome'] d['ff_views'] = {'value': self.ff_views, 'text': VENDOR_VIEWS[self.ff_views]} d['ie_views'] = {'value': self.ie_views, 'text': VENDOR_VIEWS[self.ie_views]} d['safari_views'] = {'value': self.safari_views, 'text': VENDOR_VIEWS[self.safari_views]} d['standardization'] = {'value': self.standardization, 'text': STANDARDIZATION[self.standardization]} d['web_dev_views'] = {'value': self.web_dev_views, 'text': WEB_DEV_VIEWS[self.web_dev_views]} return d def format_for_edit(self): d = self.to_dict() #d['id'] = self.key().id d['owner'] = ', '.join(self.owner) d['explainer_links'] = '\r\n'.join(self.explainer_links) d['doc_links'] = '\r\n'.join(self.doc_links) d['sample_links'] = '\r\n'.join(self.sample_links) d['search_tags'] = ', '.join(self.search_tags) d['blink_components'] = self.blink_components[0] #TODO: support more than one component. return d @classmethod def get_all(self, limit=None, order='-updated', filterby=None, update_cache=False): KEY = '%s|%s|%s' % (Feature.DEFAULT_MEMCACHE_KEY, order, limit) # TODO(ericbidelman): Support more than one filter. if filterby is not None: s = ('%s%s' % (filterby[0], filterby[1])).replace(' ', '') KEY += '|%s' % s feature_list = memcache.get(KEY) if feature_list is None or update_cache: query = Feature.all().order(order) #.order('name') # TODO(ericbidelman): Support more than one filter. if filterby: query.filter(filterby[0], filterby[1]) features = query.fetch(limit) feature_list = [f.format_for_template() for f in features] memcache.set(KEY, feature_list) return feature_list @classmethod def get_all_with_statuses(self, statuses, update_cache=False): if not statuses: return [] KEY = '%s|%s' % (Feature.DEFAULT_MEMCACHE_KEY, sorted(statuses)) feature_list = memcache.get(KEY) if feature_list is None or update_cache: # There's no way to do an OR in a single datastore query, and there's a # very good chance that the self.get_all() results will already be in # memcache, so use an array comprehension to grab the features we # want from the array of everything. feature_list = [feature for feature in self.get_all(update_cache=update_cache) if feature['impl_status_chrome'] in statuses] memcache.set(KEY, feature_list) return feature_list @classmethod def get_feature(self, feature_id, update_cache=False): KEY = '%s|%s' % (Feature.DEFAULT_MEMCACHE_KEY, feature_id) feature = memcache.get(KEY) if feature is None or update_cache: unformatted_feature = Feature.get_by_id(feature_id) if unformatted_feature: feature = unformatted_feature.format_for_template() feature['updated_display'] = unformatted_feature.updated.strftime("%Y-%m-%d") feature['new_crbug_url'] = unformatted_feature.new_crbug_url() memcache.set(KEY, feature) return feature @classmethod def get_chronological(self, limit=None, update_cache=False, version=None): KEY = '%s|%s|%s|%s' % (Feature.DEFAULT_MEMCACHE_KEY, 'cronorder', limit, version) keys = Feature.get_feature_chunk_memcache_keys(KEY) feature_list = memcache.get_multi(keys) # If we didn't get the expected number of chunks back (or a cache update # was requested), do a db query. if len(feature_list.keys()) != len(keys) or update_cache: # Features with no active, in dev, proposed features. q = Feature.all() q.order('impl_status_chrome') q.order('name') q.filter('impl_status_chrome <=', IN_DEVELOPMENT) pre_release = q.fetch(None) # Shipping features. Exclude features that do not have a desktop # shipping milestone. q = Feature.all() q.order('-shipped_milestone') q.order('name') q.filter('shipped_milestone !=', None) shipping_features = q.fetch(None) # Features with an android shipping milestone but no desktop milestone. q = Feature.all() q.order('-shipped_android_milestone') q.order('name') q.filter('shipped_milestone =', None) android_only_shipping_features = q.fetch(None) # No longer pursuing features. q = Feature.all() q.order('impl_status_chrome') q.order('name') q.filter('impl_status_chrome =', NO_LONGER_PURSUING) no_longer_pursuing_features = q.fetch(None) shipping_features.extend(android_only_shipping_features) shipping_features = [f for f in shipping_features if (IN_DEVELOPMENT < f.impl_status_chrome < NO_LONGER_PURSUING)] def getSortingMilestone(feature): feature._sort_by_milestone = (feature.shipped_milestone or feature.shipped_android_milestone) return feature # Sort the feature list on either Android shipping milestone or desktop # shipping milestone, depending on which is specified. If a desktop # milestone is defined, that will take default. shipping_features = map(getSortingMilestone, shipping_features) # First sort by name, then sort by feature milestone (latest first). shipping_features.sort(key=lambda f: f.name, reverse=False) shipping_features.sort(key=lambda f: f._sort_by_milestone, reverse=True) # Constructor the proper ordering. pre_release.extend(shipping_features) pre_release.extend(no_longer_pursuing_features) feature_list = [f.format_for_template(version) for f in pre_release] self._annotate_first_of_milestones(feature_list, version=version) # Memcache doesn't support saving values > 1MB. Break up features list into # chunks so we don't hit the limit. memcache.set_multi(Feature.set_feature_chunk_memcache_keys(KEY, feature_list)) else: temp_feature_list = [] # Reconstruct feature list by ordering chunks. for key in sorted(feature_list.keys()): temp_feature_list.extend(feature_list[key]) feature_list = temp_feature_list return feature_list @classmethod def get_shipping_samples(self, limit=None, update_cache=False): KEY = '%s|%s|%s' % (Feature.DEFAULT_MEMCACHE_KEY, 'samples', limit) feature_list = memcache.get(KEY) if feature_list is None or update_cache: # Get all shipping features. Ordered by shipping milestone (latest first). q = Feature.all() q.filter('impl_status_chrome IN', [ENABLED_BY_DEFAULT, ORIGIN_TRIAL, INTERVENTION]) q.order('-impl_status_chrome') q.order('-shipped_milestone') q.order('name') features = q.fetch(None) # Get non-shipping features (sans removed or deprecated ones) and # append to bottom of list. q = Feature.all() q.filter('impl_status_chrome <', ENABLED_BY_DEFAULT) q.order('-impl_status_chrome') q.order('-shipped_milestone') q.order('name') others = q.fetch(None) features.extend(others) # Filter out features without sample links. feature_list = [f.format_for_template() for f in features if len(f.sample_links)] memcache.set(KEY, feature_list) return feature_list def crbug_number(self): if not self.bug_url: return m = re.search(r'[\/|?id=]([0-9]+)$', self.bug_url) if m: return m.group(1) def new_crbug_url(self): url = 'https://bugs.chromium.org/p/chromium/issues/entry' params = ['components=' + self.blink_components[0] or BlinkComponent.DEFAULT_COMPONENT] crbug_number = self.crbug_number() if crbug_number and self.impl_status_chrome in ( NO_ACTIVE_DEV, PROPOSED, IN_DEVELOPMENT, BEHIND_A_FLAG, ORIGIN_TRIAL, INTERVENTION): params.append('blocking=' + crbug_number) if self.owner: params.append('cc=' + ','.join(self.owner)) return url + '?' + '&'.join(params) def __init__(self, *args, **kwargs): super(Feature, self).__init__(*args, **kwargs) # Stash existing values when entity is created so we can diff property # values later in put() to know what's changed. https://stackoverflow.com/a/41344898 for prop_name, prop in self.properties().iteritems(): old_val = getattr(self, prop_name, None) setattr(self, '_old_' + prop_name, old_val) def __notify_feature_subscribers_of_changes(self, is_update): """Async notifies subscribers of new features and property changes to features by posting to a task queue.""" # Diff values to see what properties have changed. changed_props = [] for prop_name, prop in self.properties().iteritems(): new_val = getattr(self, prop_name, None) old_val = getattr(self, '_old_' + prop_name, None) if new_val != old_val: changed_props.append({ 'prop_name': prop_name, 'old_val': old_val, 'new_val': new_val}) payload = json.dumps({ 'changes': changed_props, 'is_update': is_update, 'feature': self.format_for_template(version=2) }) # Create task to email subscribers. queue = taskqueue.Queue()#name='emailer') task = taskqueue.Task(method="POST", url='/tasks/email-subscribers', target='notifier', payload=payload) queue.add(task) # Create task to send push notifications queue = taskqueue.Queue() task = taskqueue.Task(method="POST", url='/tasks/send_notifications', target='notifier', payload=payload) queue.add(task) def put(self, **kwargs): is_update = self.is_saved() key = super(Feature, self).put(**kwargs) self.__notify_feature_subscribers_of_changes(is_update) return key # Metadata. created = db.DateTimeProperty(auto_now_add=True) updated = db.DateTimeProperty(auto_now=True) updated_by = db.UserProperty(auto_current_user=True) created_by = db.UserProperty(auto_current_user_add=True) intent_template_use_count = db.IntegerProperty(default = 0) # General info. category = db.IntegerProperty(required=True) name = db.StringProperty(required=True) intent_stage = db.IntegerProperty(default=0) summary = db.StringProperty(required=True, multiline=True) intent_to_implement_url = db.LinkProperty() origin_trial_feedback_url = db.LinkProperty() # A list of intent threads in the format "date|subject|url" intent_threads = db.StringListProperty() motivation = db.StringProperty(multiline=True) # Chromium details. bug_url = db.LinkProperty() blink_components = db.StringListProperty(required=True, default=[BlinkComponent.DEFAULT_COMPONENT]) impl_status_chrome = db.IntegerProperty(required=True) shipped_milestone = db.IntegerProperty() shipped_android_milestone = db.IntegerProperty() shipped_ios_milestone = db.IntegerProperty() shipped_webview_milestone = db.IntegerProperty() owner = db.ListProperty(db.Email) footprint = db.IntegerProperty() interop_compat_risks = db.StringProperty(multiline=True) ergonomics_risks = db.StringProperty(multiline=True) activation_risks = db.StringProperty(multiline=True) security_risks = db.StringProperty(multiline=True) debuggability = db.StringProperty(multiline=True) all_platforms = db.BooleanProperty() all_platforms_descr = db.StringProperty(multiline=True) wpt = db.BooleanProperty() wpt_descr = db.StringProperty(multiline=True) visibility = db.IntegerProperty(required=True) #webbiness = db.IntegerProperty() # TODO: figure out what this is # Standards details. standardization = db.IntegerProperty(required=True) spec_link = db.LinkProperty() tag_review = db.StringProperty(multiline=True) prefixed = db.BooleanProperty() explainer_links = db.StringListProperty() ff_views = db.IntegerProperty(required=True, default=NO_PUBLIC_SIGNALS) ie_views = db.IntegerProperty(required=True, default=NO_PUBLIC_SIGNALS) safari_views = db.IntegerProperty(required=True, default=NO_PUBLIC_SIGNALS) web_dev_views = db.IntegerProperty(required=True) ff_views_link = db.LinkProperty() ie_views_link = db.LinkProperty() safari_views_link = db.LinkProperty() web_dev_views_link = db.LinkProperty() ff_views_notes = db.StringProperty(multiline=True) ie_views_notes = db.StringProperty(multiline=True) safari_views_notes = db.StringProperty(multiline=True) web_dev_views_notes = db.StringProperty(multiline=True) doc_links = db.StringListProperty() sample_links = db.StringListProperty() #tests = db.StringProperty() search_tags = db.StringListProperty() comments = db.StringProperty(multiline=True) experiment_goals = db.StringProperty(multiline=True) experiment_timeline = db.StringProperty(multiline=True) experiment_risks = db.StringProperty(multiline=True) experiment_extension_reason = db.StringProperty(multiline=True) ongoing_constraints = db.StringProperty(multiline=True) class PlaceholderCharField(forms.CharField): def __init__(self, *args, **kwargs): #super(forms.CharField, self).__init__(*args, **kwargs) attrs = {} if kwargs.get('placeholder'): attrs['placeholder'] = kwargs.get('placeholder') del kwargs['placeholder'] label = kwargs.get('label') or '' if label: del kwargs['label'] self.max_length = kwargs.get('max_length') or None super(forms.CharField, self).__init__(label=label, widget=forms.TextInput(attrs=attrs), *args, **kwargs) # class PlaceholderForm(forms.Form): # def __init__(self, *args, **kwargs): # super(PlaceholderForm, self).__init__(*args, **kwargs) # for field_name in self.fields: # field = self.fields.get(field_name) # if field: # if type(field.widget) in (forms.TextInput, forms.DateInput): # field.widget = forms.TextInput(attrs={'placeholder': field.label}) class FeatureForm(forms.Form): SHIPPED_HELP_TXT = ('First milestone to ship with this ' 'status. Applies to: Enabled by default, Behind a flag, ' 'Origin trial, Browser Intervention, and Deprecated. If ' 'the flag is \'test\' rather than \'experimental\' set ' 'status to In development.') # Note that the "required" argument in the following field definitions only # mean so much in practice. There's various code in js/admin/feature_form.js, # including intentStageChanged(), that adjusts what fields are required (as # well as visible at all). IOW, when making changes to what form fields are or # are not required, look both in the definitions here as well as in # js/admin/feature_form.js and make sure the code works as intended. #name = PlaceholderCharField(required=True, placeholder='Feature name') name = forms.CharField(required=True, label='Feature', help_text='Capitalize only the first letter and the beginnings of proper nouns.') summary = forms.CharField(label='', required=True, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 500}), help_text='Provide a one sentence description followed by one or two lines explaining how this feature helps web developers.') category = forms.ChoiceField(required=True, help_text='Select the most specific category. If unsure, leave as "%s".' % FEATURE_CATEGORIES[MISC], initial=MISC, choices=sorted(FEATURE_CATEGORIES.items(), key=lambda x: x[1])) intent_stage = forms.ChoiceField(required=True, label='Intent stage', help_text='Select the appropriate intent stage.', initial=INTENT_IMPLEMENT, choices=INTENT_STAGES.items()) current_user_email = users.get_current_user().email if users.get_current_user() else None owner = forms.CharField(initial=current_user_email, required=True, label='Contact emails', help_text='Comma separated list of full email addresses. Prefer @chromium.org.') summary = forms.CharField(label='Feature summary', required=True, max_length=500, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 500}), help_text='Summarize the feature using complete sentences as you would to an external developer using the feature.') motivation = forms.CharField(label='Motivation', required=True, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}), help_text='Explain why the web needs this change. It may be useful to describe what web developers are forced to do without it. When possible, include links to back up your claims in the explainer.') explainer_links = forms.CharField(label='Explainer link(s)', required=False, widget=forms.Textarea(attrs={'rows': 4, 'cols': 50, 'maxlength': 500}), help_text='Link to explainer(s) (one URL per line). You should have at least an explainer in hand and have shared it on a public forum before sending an Intent to Prototype in order to enable discussion with other browser vendors, standards bodies, or other interested parties.') intent_to_implement_url = forms.URLField(required=False, label='Intent to Prototype link', help_text='Link to the "Intent to Prototype" discussion thread.') origin_trial_feedback_url = forms.URLField(required=False, label='Origin Trial feedback summary', help_text='If your feature was available as an Origin Trial, link to a summary of usage and developer feedback. If not, leave this empty.') doc_links = forms.CharField(label='Doc link(s)', required=False, widget=forms.Textarea(attrs={'rows': 4, 'cols': 50, 'maxlength': 500}), help_text='Links to design doc(s) (one URL per line), if and when available. [This is not required to send out an Intent to Prototype. Please update the intent thread with the design doc when ready]. An explainer and/or design doc is sufficient to start this process. [Note: Please include links and data, where possible, to support any claims.]') standardization = forms.ChoiceField( label='Standardization', choices=STANDARDIZATION.items(), initial=EDITORS_DRAFT, help_text=("The standardization status of the API. In bodies that don't " "use this nomenclature, use the closest equivalent.")) spec_link = forms.URLField(required=False, label='Spec link', help_text="Link to spec, if and when available. Please update the chromestatus.com entry and the intent thread(s) with the spec link when available.") tag_review = forms.CharField(label='TAG Review', required=True, widget=forms.Textarea(attrs={'rows': 2, 'cols': 50, 'maxlength': 1480}), help_text='Link(s) to TAG review(s), or explanation why this is not needed.') interop_compat_risks = forms.CharField(label='Interoperability and Compatibility Risks', required=True, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}), help_text='Describe the degree of <a target="_blank" href="https://sites.google.com/a/chromium.org/dev/blink?pli=1#TOC-Policy-for-shipping-and-removing-web-platform-API-features">interoperability risk</a>. For a new feature, the main risk is that it fails to become an interoperable part of the web platform if other browsers do not implement it. For a removal, please review our <a target="_blank" href="https://docs.google.com/document/d/1RC-pBBvsazYfCNNUSkPqAVpSpNJ96U8trhNkfV0v9fk/edit">principles of web compatibility</a>.') safari_views = forms.ChoiceField(label='Safari views', choices=VENDOR_VIEWS.items(), initial=NO_PUBLIC_SIGNALS) safari_views_link = forms.URLField(required=False, label='', help_text='Citation link.') safari_views_notes = forms.CharField(required=False, label='', widget=forms.Textarea(attrs={'rows': 2, 'cols': 50, 'placeholder': 'Notes', 'maxlength': 1480})) ff_views = forms.ChoiceField(label='Firefox views', choices=VENDOR_VIEWS.items(), initial=NO_PUBLIC_SIGNALS) ff_views_link = forms.URLField(required=False, label='', help_text='Citation link.') ff_views_notes = forms.CharField(required=False, label='', widget=forms.Textarea(attrs={'rows': 2, 'cols': 50, 'placeholder': 'Notes', 'maxlength': 1480})) ie_views = forms.ChoiceField(label='Edge', choices=VENDOR_VIEWS.items(), initial=NO_PUBLIC_SIGNALS) ie_views_link = forms.URLField(required=False, label='', help_text='Citation link.') ie_views_notes = forms.CharField(required=False, label='', widget=forms.Textarea(attrs={'rows': 2, 'cols': 50, 'placeholder': 'Notes', 'maxlength': 1480})) web_dev_views = forms.ChoiceField( label='Web / Framework developer views', choices=WEB_DEV_VIEWS.items(), initial=DEV_NO_SIGNALS, help_text='If unsure, default to "No signals".') web_dev_views_link = forms.URLField(required=False, label='', help_text='Citation link.') web_dev_views_notes = forms.CharField(required=False, label='', widget=forms.Textarea(attrs={'rows': 2, 'cols': 50, 'placeholder': 'Notes', 'maxlength': 1480}), help_text='Reference known representative examples of opinion, both positive and negative.') ergonomics_risks = forms.CharField(label='Ergonomics Risks', required=False, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}), help_text='Are there any other platform APIs this feature will frequently be used in tandem with? Could the default usage of this API make it hard for Chrome to maintain good performance (i.e. synchronous return, must run on a certain thread, guaranteed return timing)?') activation_risks = forms.CharField(label='Activation Risks', required=False, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}), help_text='Will it be challenging for developers to take advantage of this feature immediately, as-is? Would this feature benefit from having polyfills, significant documentation and outreach, and/or libraries built on top of it to make it easier to use?') security_risks = forms.CharField(label='Security Risks', required=False, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}), help_text='List any security considerations that were taken into account when deigning this feature.') experiment_goals = forms.CharField(label='Experiment Goals', required=False, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}), help_text='Which pieces of the API surface are you looking to gain insight on? What metrics/measurement/feedback will you be using to validate designs? Double check that your experiment makes sense given that a large developer (e.g. a Google product or Facebook) likely can\'t use it in production due to the limits enforced by origin trials.\n\nIf Intent to Extend Origin Trial, highlight new/different areas for experimentation. Should not be an exact copy of goals from the first Intent to Experiment.') experiment_timeline = forms.CharField(label='Experiment Timeline', required=False, widget=forms.Textarea(attrs={'rows': 2, 'cols': 50, 'maxlength': 1480}), help_text='When does the experiment start and expire?') experiment_risks = forms.CharField(label='Experiment Risks', required=False, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}), help_text='When this experiment comes to an end are there any risks to the sites that were using it, for example losing access to important storage due to an experimental storage API?') experiment_extension_reason = forms.CharField(label='Experiment Extension Reason', required=False, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}), help_text='If this is a repeat experiment, link to the previous Intent to Experiment thread and explain why you want to extend this experiment.') ongoing_constraints = forms.CharField(label='Ongoing Constraints', required=False, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}), help_text='Do you anticipate adding any ongoing technical constraints to the codebase while implementing this feature? We prefer to avoid features which require or assume a specific architecture. For most features, the answer here is "None."') debuggability = forms.CharField(label='Debuggability', required=False, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}), help_text='Description of the desired DevTools debugging support for your feature. Consider emailing the <a href="https://groups.google.com/forum/?fromgroups#!forum/google-chrome-developer-tools">google-chrome-developer-tools</a> list for additional help. For new language features in V8 specifically, refer to the debugger support checklist. If your feature doesn\'t require changes to DevTools in order to provide a good debugging experience, feel free to leave this section empty.') all_platforms = forms.BooleanField(required=False, initial=False, label='Supported on all platforms?', help_text='Will this feature be supported on all six Blink platforms (Windows, Mac, Linux, Chrome OS, Android, and Android WebView)?') all_platforms_descr = forms.CharField(label='Platform Support Explanation', required=False, widget=forms.Textarea(attrs={'rows': 2, 'cols': 50, 'maxlength': 2000}), help_text='Explanation for why this feature is, or is not, supported on all platforms.') wpt = forms.BooleanField(required=False, initial=False, label='Web Platform Tests', help_text='Is this feature fully tested in Web Platform Tests?') wpt_descr = forms.CharField(label='Web Platform Tests Description', required=True, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}), help_text='Please link to the <a href="https://wpt.fyi/results">results on wpt.fyi</a>. If any part of the feature is not tested by web-platform-tests, please include links to issues, e.g. a web-platform-tests issue with the "infra" label explaining why a certain thing cannot be tested (<a href="https://github.com/w3c/web-platform-tests/issues/3867">example</a>), a spec issue for some change that would make it possible to test. (<a href="https://github.com/whatwg/fullscreen/issues/70">example</a>), or a Chromium issue to upstream some existing tests (<a href="https://bugs.chromium.org/p/chromium/issues/detail?id=695486">example</a>).') sample_links = forms.CharField(label='Samples links', required=False, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 500}), help_text='Links to samples (one URL per line).') bug_url = forms.URLField(required=False, label='Tracking bug URL', help_text='Tracking bug url (https://bugs.chromium.org/...). This bug should have "Type=Feature" set and be world readable.') blink_components = forms.ChoiceField( required=True, label='Blink component', help_text='Select the most specific component. If unsure, leave as "%s".' % BlinkComponent.DEFAULT_COMPONENT, choices=[(x, x) for x in BlinkComponent.fetch_all_components()], initial=[BlinkComponent.DEFAULT_COMPONENT]) impl_status_chrome = forms.ChoiceField(required=True, label='Status in Chromium', choices=IMPLEMENTATION_STATUS.items()) #shipped_milestone = PlaceholderCharField(required=False, # placeholder='First milestone the feature shipped with this status (either enabled by default or experimental)') shipped_milestone = forms.IntegerField(required=False, label='', help_text='Desktop:<br/>' + SHIPPED_HELP_TXT) shipped_android_milestone = forms.IntegerField(required=False, label='', help_text='Chrome for Android:</br/>' + SHIPPED_HELP_TXT) shipped_ios_milestone = forms.IntegerField(required=False, label='', help_text='Chrome for iOS (RARE):<br/>' + SHIPPED_HELP_TXT) shipped_webview_milestone = forms.IntegerField(required=False, label='', help_text='Android WebView:<br/>' + SHIPPED_HELP_TXT) prefixed = forms.BooleanField(required=False, initial=False, label='Prefixed?') footprint = forms.ChoiceField(label='Technical footprint', choices=FOOTPRINT_CHOICES.items(), initial=MAJOR_MINOR_NEW_API) visibility = forms.ChoiceField( label='Developer visibility', choices=VISIBILITY_CHOICES.items(), initial=WARRANTS_ARTICLE, help_text=('How much press / media / web developer buzz will this ' 'feature generate?')) search_tags = forms.CharField(label='Search tags', required=False, help_text='Comma separated keywords used only in search') comments = forms.CharField(label='Comments', required=False, widget=forms.Textarea(attrs={'cols': 50, 'maxlength': 1480}), help_text='Additional comments, caveats, info...') class Meta: model = Feature #exclude = ('shipped_webview_milestone',) def __init__(self, *args, **keyargs): super(FeatureForm, self).__init__(*args, **keyargs) meta = getattr(self, 'Meta', None) exclude = getattr(meta, 'exclude', []) for field_name in exclude: if field_name in self.fields: del self.fields[field_name] for field, val in self.fields.iteritems(): if val.required: self.fields[field].widget.attrs['required'] = 'required' class AppUser(DictModel): """Describes a user for whitelisting.""" #user = db.UserProperty(required=True, verbose_name='Google Account') email = db.EmailProperty(required=True) #is_admin = db.BooleanProperty(default=False) created = db.DateTimeProperty(auto_now_add=True) updated = db.DateTimeProperty(auto_now=True) def list_with_component(l, component): return [x for x in l if x.id() == component.key().id()] def list_without_component(l, component): return [x for x in l if x.id() != component.key().id()] class FeatureOwner(DictModel): """Describes subscribers of a web platform feature.""" created = db.DateTimeProperty(auto_now_add=True) updated = db.DateTimeProperty(auto_now=True) name = db.StringProperty(required=True) email = db.EmailProperty(required=True) twitter = db.StringProperty() blink_components = db.ListProperty(db.Key) primary_blink_components = db.ListProperty(db.Key) watching_all_features = db.BooleanProperty(default=False) # def __eq__(self, other): # return self.key().id() == other.key().id() def add_to_component_subscribers(self, component_name): """Adds the user to the list of Blink component subscribers.""" c = BlinkComponent.get_by_name(component_name) if c: # Add the user if they're not already in the list. if not len(list_with_component(self.blink_components, c)): self.blink_components.append(c.key()) return self.put() return None def remove_from_component_subscribers(self, component_name, remove_as_owner=False): """Removes the user from the list of Blink component subscribers or as the owner of the component.""" c = BlinkComponent.get_by_name(component_name) if c: if remove_as_owner: self.primary_blink_components = list_without_component(self.primary_blink_components, c) else: self.blink_components = list_without_component(self.blink_components, c) self.primary_blink_components = list_without_component(self.primary_blink_components, c) return self.put() return None def add_as_component_owner(self, component_name): """Adds the user as the Blink component owner.""" c = BlinkComponent.get_by_name(component_name) if c: # Update both the primary list and blink components subscribers if the # user is not already in them. self.add_to_component_subscribers(component_name) if not len(list_with_component(self.primary_blink_components, c)): self.primary_blink_components.append(c.key()) return self.put() return None def remove_as_component_owner(self, component_name): return self.remove_from_component_subscribers(component_name, remove_as_owner=True) class HistogramModel(db.Model): """Container for a histogram.""" bucket_id = db.IntegerProperty(required=True) property_name = db.StringProperty(required=True) MAX_CHUNK_SIZE = 500 # max num features to save for each memcache chunk. @classmethod def get_property_chunk_memcache_keys(self, property_class, key_prefix): num_props = len(property_class.all().fetch(limit=None, keys_only=True)) l = list_to_chunks(range(0, num_props), self.MAX_CHUNK_SIZE) return ['%s|chunk%s' % (key_prefix, i) for i,val in enumerate(l)] @classmethod def set_property_chunk_memcache_keys(self, key_prefix, pop_list): chunks = list_to_chunks(pop_list, self.MAX_CHUNK_SIZE) vals = [] for i, chunk in enumerate(chunks): vals.append(('%s|chunk%s' % (key_prefix, i), chunk)) d = dict(vals) return d @classmethod def get_all(self): output = {} buckets = self.all().fetch(None) for bucket in buckets: output[bucket.bucket_id] = bucket.property_name return output class CssPropertyHistogram(HistogramModel): pass class FeatureObserverHistogram(HistogramModel): pass </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">40.36664</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">649</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.693194</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">cwilso/chromium-dashboard</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">models.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">51,306</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8760"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># -*- coding: utf-8 -*- import time from pymongo import MongoClient from config import MONGO_CONFIG def get_current_time(format_str: str = '%Y-%m-%d %H:%M:%S'): """ 获取当前时间,默认为 2020-01-01 00:00:00 格式 :param format_str: 格式 :return: """ return time.strftime(format_str, time.localtime()) class MongoDb: def __init__(self): """初始化 初始化 mongo db """ mongo_uri = 'mongodb://%s:%s@%s:%s' % ( MONGO_CONFIG['user'], MONGO_CONFIG['pwd'], MONGO_CONFIG['host'], MONGO_CONFIG['port']) self.mongo = MongoClient(mongo_uri) self.sogou_db = self.mongo['sogou_dev'] self.sogou_search_col = self.sogou_db['sogou_search_results'] # self.task_db = self.mongo['sogou_tast'] def update_sogou_login_cookie(self, username, cookie): """ 更新搜狗微信登录 cookie 信息 :param username: :param cookie: :return: """ col = self.sogou_db['sogou_login_cookies'] ctime = get_current_time() find_obj = { 'nickname': username, 'is_valid': 1, } login_item = col.find_one(find_obj) print(login_item) # 插入新数据 if not login_item: cookie = 'DESC=0; %s' % cookie col.insert_one({ 'cookie': cookie, 'nickname': username, 'device': '0', 'state': 'normal', 'c_time': ctime, 'm_time': ctime, 'is_valid': 1, 'failures': 0, }) return # 更新原有数据 cookie = 'DESC=%s; %s' % (login_item['device'], cookie) col.update_one(find_obj, { '$set': { 'state': 'normal', 'cookie': cookie, 'c_time': ctime, 'm_time': ctime, 'failures': 0, } }) def insert_sogou_search_result(self, result): """ 保存搜狗搜索信息 :param results: 结果数组 """ ctime = get_current_time() find_obj = { 'id': result['id'], 'is_valid': 1 } search_item = self.sogou_search_col.find_one(find_obj) print(search_item) new_result = result # 插入新数据 if not search_item: new_result["c_time"] = ctime new_result["m_time"] = ctime new_result["is_valid"] = 1 self.sogou_search_col.insert_one(new_result) return # 更新原有数据 new_result["m_time"] = ctime self.sogou_search_col.update_one(find_obj, { '$set': new_result })</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">25.551402</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">69</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.49305</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">matiastang/selenium-learning</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">src/sogou_wechat/mongoDB.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">2,862</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8761"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># -*- coding: utf-8 -*- # PLEASE DO NOT EDIT THIS FILE, IT IS GENERATED AND WILL BE OVERWRITTEN: # https://github.com/ccxt/ccxt/blob/master/CONTRIBUTING.md#how-to-contribute-code from ccxt.base.exchange import Exchange from ccxt.base.errors import ExchangeError from ccxt.base.errors import AuthenticationError from ccxt.base.errors import BadRequest from ccxt.base.errors import OrderNotFound from ccxt.base.errors import InvalidNonce from ccxt.base.decimal_to_precision import TICK_SIZE from ccxt.base.precise import Precise class bitso(Exchange): def describe(self): return self.deep_extend(super(bitso, self).describe(), { 'id': 'bitso', 'name': 'Bitso', 'countries': ['MX'], # Mexico 'rateLimit': 2000, # 30 requests per minute 'version': 'v3', 'has': { 'CORS': None, 'spot': True, 'margin': False, 'swap': False, 'future': False, 'option': False, 'addMargin': False, 'cancelOrder': True, 'createOrder': True, 'createReduceOnlyOrder': False, 'fetchBalance': True, 'fetchBorrowRate': False, 'fetchBorrowRateHistories': False, 'fetchBorrowRateHistory': False, 'fetchBorrowRates': False, 'fetchBorrowRatesPerSymbol': False, 'fetchDepositAddress': True, 'fetchFundingFee': False, 'fetchFundingFees': True, 'fetchFundingHistory': False, 'fetchFundingRate': False, 'fetchFundingRateHistory': False, 'fetchFundingRates': False, 'fetchIndexOHLCV': False, 'fetchLeverage': False, 'fetchMarkets': True, 'fetchMarkOHLCV': False, 'fetchMyTrades': True, 'fetchOHLCV': True, 'fetchOpenOrders': True, 'fetchOrder': True, 'fetchOrderBook': True, 'fetchOrderTrades': True, 'fetchPosition': False, 'fetchPositions': False, 'fetchPositionsRisk': False, 'fetchPremiumIndexOHLCV': False, 'fetchTicker': True, 'fetchTrades': True, 'fetchTradingFee': False, 'fetchTradingFees': True, 'fetchTransfer': False, 'fetchTransfers': False, 'reduceMargin': False, 'setLeverage': False, 'setMarginMode': False, 'setPositionMode': False, 'transfer': False, 'withdraw': True, }, 'urls': { 'logo': 'https://user-images.githubusercontent.com/51840849/87295554-11f98280-c50e-11ea-80d6-15b3bafa8cbf.jpg', 'api': 'https://api.bitso.com', 'www': 'https://bitso.com', 'doc': 'https://bitso.com/api_info', 'fees': 'https://bitso.com/fees', 'referral': 'https://bitso.com/?ref=itej', }, 'precisionMode': TICK_SIZE, 'options': { 'precision': { 'XRP': 0.000001, 'MXN': 0.01, 'TUSD': 0.01, }, 'defaultPrecision': 0.00000001, }, 'timeframes': { '1m': '60', '5m': '300', '15m': '900', '30m': '1800', '1h': '3600', '4h': '14400', '12h': '43200', '1d': '86400', '1w': '604800', }, 'api': { 'public': { 'get': [ 'available_books', 'ticker', 'order_book', 'trades', 'ohlc', ], }, 'private': { 'get': [ 'account_status', 'balance', 'fees', 'fundings', 'fundings/{fid}', 'funding_destination', 'kyc_documents', 'ledger', 'ledger/trades', 'ledger/fees', 'ledger/fundings', 'ledger/withdrawals', 'mx_bank_codes', 'open_orders', 'order_trades/{oid}', 'orders/{oid}', 'user_trades', 'user_trades/{tid}', 'withdrawals/', 'withdrawals/{wid}', ], 'post': [ 'bitcoin_withdrawal', 'debit_card_withdrawal', 'ether_withdrawal', 'ripple_withdrawal', 'bcash_withdrawal', 'litecoin_withdrawal', 'orders', 'phone_number', 'phone_verification', 'phone_withdrawal', 'spei_withdrawal', 'ripple_withdrawal', 'bcash_withdrawal', 'litecoin_withdrawal', ], 'delete': [ 'orders/{oid}', 'orders/all', ], }, }, 'exceptions': { '0201': AuthenticationError, # Invalid Nonce or Invalid Credentials '104': InvalidNonce, # Cannot perform request - nonce must be higher than 1520307203724237 '0304': BadRequest, # {"success":false,"error":{"code":"0304","message":"The field time_bucket() is either invalid or missing"}} }, }) def fetch_markets(self, params={}): response = self.publicGetAvailableBooks(params) # # { # "success":true, # "payload":[ # { # "book":"btc_mxn", # "minimum_price":"500", # "maximum_price":"10000000", # "minimum_amount":"0.00005", # "maximum_amount":"500", # "minimum_value":"5", # "maximum_value":"10000000", # "tick_size":"0.01", # "fees":{ # "flat_rate":{"maker":"0.500","taker":"0.650"}, # "structure":[ # {"volume":"1500000","maker":"0.00500","taker":"0.00650"}, # {"volume":"2000000","maker":"0.00490","taker":"0.00637"}, # {"volume":"5000000","maker":"0.00480","taker":"0.00624"}, # {"volume":"7000000","maker":"0.00440","taker":"0.00572"}, # {"volume":"10000000","maker":"0.00420","taker":"0.00546"}, # {"volume":"15000000","maker":"0.00400","taker":"0.00520"}, # {"volume":"35000000","maker":"0.00370","taker":"0.00481"}, # {"volume":"50000000","maker":"0.00300","taker":"0.00390"}, # {"volume":"150000000","maker":"0.00200","taker":"0.00260"}, # {"volume":"250000000","maker":"0.00100","taker":"0.00130"}, # {"volume":"9999999999","maker":"0.00000","taker":"0.00130"}, # ] # } # }, # ] # } markets = self.safe_value(response, 'payload') result = [] for i in range(0, len(markets)): market = markets[i] id = self.safe_string(market, 'book') baseId, quoteId = id.split('_') base = baseId.upper() quote = quoteId.upper() base = self.safe_currency_code(base) quote = self.safe_currency_code(quote) fees = self.safe_value(market, 'fees', {}) flatRate = self.safe_value(fees, 'flat_rate', {}) takerString = self.safe_string(flatRate, 'taker') makerString = self.safe_string(flatRate, 'maker') taker = self.parse_number(Precise.string_div(takerString, '100')) maker = self.parse_number(Precise.string_div(makerString, '100')) feeTiers = self.safe_value(fees, 'structure', []) fee = { 'taker': taker, 'maker': maker, 'percentage': True, 'tierBased': True, } takerFees = [] makerFees = [] for j in range(0, len(feeTiers)): tier = feeTiers[j] volume = self.safe_number(tier, 'volume') takerFee = self.safe_number(tier, 'taker') makerFee = self.safe_number(tier, 'maker') takerFees.append([volume, takerFee]) makerFees.append([volume, makerFee]) if j == 0: fee['taker'] = takerFee fee['maker'] = makerFee tiers = { 'taker': takerFees, 'maker': makerFees, } fee['tiers'] = tiers defaultPricePrecision = self.safe_number(self.options['precision'], quote, self.options['defaultPrecision']) result.append(self.extend({ 'id': id, 'symbol': base + '/' + quote, 'base': base, 'quote': quote, 'settle': None, 'baseId': baseId, 'quoteId': quoteId, 'settleId': None, 'type': 'spot', 'spot': True, 'margin': False, 'swap': False, 'future': False, 'option': False, 'active': None, 'contract': False, 'linear': None, 'inverse': None, 'taker': taker, 'maker': maker, 'contractSize': None, 'expiry': None, 'expiryDatetime': None, 'strike': None, 'optionType': None, 'precision': { 'amount': self.safe_number(self.options['precision'], base, self.options['defaultPrecision']), 'price': self.safe_number(market, 'tick_size', defaultPricePrecision), }, 'limits': { 'leverage': { 'min': None, 'max': None, }, 'amount': { 'min': self.safe_number(market, 'minimum_amount'), 'max': self.safe_number(market, 'maximum_amount'), }, 'price': { 'min': self.safe_number(market, 'minimum_price'), 'max': self.safe_number(market, 'maximum_price'), }, 'cost': { 'min': self.safe_number(market, 'minimum_value'), 'max': self.safe_number(market, 'maximum_value'), }, }, 'info': market, }, fee)) return result def parse_balance(self, response): payload = self.safe_value(response, 'payload', {}) balances = self.safe_value(payload, 'balances') result = { 'info': response, 'timestamp': None, 'datetime': None, } for i in range(0, len(balances)): balance = balances[i] currencyId = self.safe_string(balance, 'currency') code = self.safe_currency_code(currencyId) account = self.account() account['free'] = self.safe_string(balance, 'available') account['used'] = self.safe_string(balance, 'locked') account['total'] = self.safe_string(balance, 'total') result[code] = account return self.safe_balance(result) def fetch_balance(self, params={}): self.load_markets() response = self.privateGetBalance(params) # # { # "success": True, # "payload": { # "balances": [ # { # "currency": "bat", # "available": "0.00000000", # "locked": "0.00000000", # "total": "0.00000000", # "pending_deposit": "0.00000000", # "pending_withdrawal": "0.00000000" # }, # { # "currency": "bch", # "available": "0.00000000", # "locked": "0.00000000", # "total": "0.00000000", # "pending_deposit": "0.00000000", # "pending_withdrawal": "0.00000000" # }, # ], # }, # } # return self.parse_balance(response) def fetch_order_book(self, symbol, limit=None, params={}): self.load_markets() request = { 'book': self.market_id(symbol), } response = self.publicGetOrderBook(self.extend(request, params)) orderbook = self.safe_value(response, 'payload') timestamp = self.parse8601(self.safe_string(orderbook, 'updated_at')) return self.parse_order_book(orderbook, symbol, timestamp, 'bids', 'asks', 'price', 'amount') def parse_ticker(self, ticker, market=None): # # { # "high":"37446.85", # "last":"36599.54", # "created_at":"2022-01-28T12:06:11+00:00", # "book":"btc_usdt", # "volume":"7.29075419", # "vwap":"36579.1564400307", # "low":"35578.52", # "ask":"36574.76", # "bid":"36538.22", # "change_24":"-105.64" # } # symbol = self.safe_symbol(None, market) timestamp = self.parse8601(self.safe_string(ticker, 'created_at')) vwap = self.safe_string(ticker, 'vwap') baseVolume = self.safe_string(ticker, 'volume') quoteVolume = Precise.string_mul(baseVolume, vwap) last = self.safe_string(ticker, 'last') return self.safe_ticker({ 'symbol': symbol, 'timestamp': timestamp, 'datetime': self.iso8601(timestamp), 'high': self.safe_string(ticker, 'high'), 'low': self.safe_string(ticker, 'low'), 'bid': self.safe_string(ticker, 'bid'), 'bidVolume': None, 'ask': self.safe_string(ticker, 'ask'), 'askVolume': None, 'vwap': vwap, 'open': None, 'close': last, 'last': last, 'previousClose': None, 'change': None, 'percentage': None, 'average': None, 'baseVolume': baseVolume, 'quoteVolume': quoteVolume, 'info': ticker, }, market, False) def fetch_ticker(self, symbol, params={}): self.load_markets() market = self.market(symbol) request = { 'book': market['id'], } response = self.publicGetTicker(self.extend(request, params)) ticker = self.safe_value(response, 'payload') # # { # "success":true, # "payload":{ # "high":"37446.85", # "last":"37051.96", # "created_at":"2022-01-28T17:03:29+00:00", # "book":"btc_usdt", # "volume":"6.16176186", # "vwap":"36582.6293169472", # "low":"35578.52", # "ask":"37083.62", # "bid":"37039.66", # "change_24":"478.45" # } # } # return self.parse_ticker(ticker, market) def fetch_ohlcv(self, symbol, timeframe='1m', since=None, limit=None, params={}): self.load_markets() market = self.market(symbol) request = { 'book': market['id'], 'time_bucket': self.timeframes[timeframe], } if since is not None: request['start'] = since if limit is not None: duration = self.parse_timeframe(timeframe) request['end'] = self.sum(since, duration * limit * 1000) elif limit is not None: now = self.milliseconds() request['end'] = now request['start'] = now - self.parse_timeframe(timeframe) * 1000 * limit response = self.publicGetOhlc(self.extend(request, params)) # # { # "success":true, # "payload": [ # { # "bucket_start_time":1648219140000, # "first_trade_time":1648219154990, # "last_trade_time":1648219189441, # "first_rate":"44958.60", # "last_rate":"44979.88", # "min_rate":"44957.33", # "max_rate":"44979.88", # "trade_count":8, # "volume":"0.00082814", # "vwap":"44965.02" # }, # ] # } # payload = self.safe_value(response, 'payload', []) return self.parse_ohlcvs(payload, market, timeframe, since, limit) def parse_ohlcv(self, ohlcv, market=None, timeframe='1m'): # # { # "bucket_start_time":1648219140000, # "first_trade_time":1648219154990, # "last_trade_time":1648219189441, # "first_rate":"44958.60", # "last_rate":"44979.88", # "min_rate":"44957.33", # "max_rate":"44979.88", # "trade_count":8, # "volume":"0.00082814", # "vwap":"44965.02" # }, # return [ self.safe_integer(ohlcv, 'bucket_start_time'), self.safe_number(ohlcv, 'first_rate'), self.safe_number(ohlcv, 'max_rate'), self.safe_number(ohlcv, 'min_rate'), self.safe_number(ohlcv, 'last_rate'), self.safe_number(ohlcv, 'volume'), ] def parse_trade(self, trade, market=None): # # fetchTrades(public) # # { # "book": "btc_usdt", # "created_at": "2021-11-24T12:14:53+0000", # "amount": "0.00026562", # "maker_side": "sell", # "price": "56471.55", # "tid": "52557338" # } # # fetchMyTrades(private) # # { # "book": "btc_usdt", # "created_at": "2021-11-24T12:31:03+0000", # "minor": "11.30356000", # "major": "-0.00020000", # "fees_amount": "0.01119052", # "fees_currency": "usdt", # "minor_currency": "usdt", # "major_currency": "btc", # "oid": "djTzMIWx2Vi3iMjl", # "tid": "52559051", # "price": "56517.80", # "side": "sell", # "maker_side": "buy" # } # # fetchOrderTrades(private) # # { # "book": "btc_usdt", # "created_at": "2021-11-24T12:30:52+0000", # "minor": "-11.33047916", # "major": "0.00020020", # "fees_amount": "0.00000020", # "fees_currency": "btc", # "minor_currency": "usdt", # "major_currency": "btc", # "oid": "O0D2zcljjjQF5xlG", # "tid": "52559030", # "price": "56595.80", # "side": "buy", # "maker_side": "sell" # } # timestamp = self.parse8601(self.safe_string(trade, 'created_at')) marketId = self.safe_string(trade, 'book') symbol = self.safe_symbol(marketId, market, '_') side = self.safe_string_2(trade, 'side', 'maker_side') makerSide = self.safe_string(trade, 'maker_side') takerOrMaker = None if side == makerSide: takerOrMaker = 'maker' else: takerOrMaker = 'taker' amount = self.safe_string_2(trade, 'amount', 'major') if amount is not None: amount = Precise.string_abs(amount) fee = None feeCost = self.safe_string(trade, 'fees_amount') if feeCost is not None: feeCurrencyId = self.safe_string(trade, 'fees_currency') feeCurrency = self.safe_currency_code(feeCurrencyId) fee = { 'cost': feeCost, 'currency': feeCurrency, } cost = self.safe_string(trade, 'minor') if cost is not None: cost = Precise.string_abs(cost) price = self.safe_string(trade, 'price') orderId = self.safe_string(trade, 'oid') id = self.safe_string(trade, 'tid') return self.safe_trade({ 'id': id, 'info': trade, 'timestamp': timestamp, 'datetime': self.iso8601(timestamp), 'symbol': symbol, 'order': orderId, 'type': None, 'side': side, 'takerOrMaker': takerOrMaker, 'price': price, 'amount': amount, 'cost': cost, 'fee': fee, }, market) def fetch_trades(self, symbol, since=None, limit=None, params={}): self.load_markets() market = self.market(symbol) request = { 'book': market['id'], } response = self.publicGetTrades(self.extend(request, params)) return self.parse_trades(response['payload'], market, since, limit) def fetch_trading_fees(self, params={}): self.load_markets() response = self.privateGetFees(params) # # { # success: True, # payload: { # fees: [ # { # book: 'btc_mxn', # fee_percent: '0.6500', # fee_decimal: '0.00650000', # taker_fee_percent: '0.6500', # taker_fee_decimal: '0.00650000', # maker_fee_percent: '0.5000', # maker_fee_decimal: '0.00500000', # volume_currency: 'mxn', # current_volume: '0.00', # next_volume: '1500000.00', # next_maker_fee_percent: '0.490', # next_taker_fee_percent: '0.637', # nextVolume: '1500000.00', # nextFee: '0.490', # nextTakerFee: '0.637' # }, # ... # ], # deposit_fees: [ # { # currency: 'btc', # method: 'rewards', # fee: '0.00', # is_fixed: False # }, # ... # ], # withdrawal_fees: { # ada: '0.20958100', # bch: '0.00009437', # ars: '0', # btc: '0.00001209', # ... # } # } # } # payload = self.safe_value(response, 'payload', {}) fees = self.safe_value(payload, 'fees', []) result = {} for i in range(0, len(fees)): fee = fees[i] marketId = self.safe_string(fee, 'book') symbol = self.safe_symbol(marketId, None, '_') result[symbol] = { 'info': fee, 'symbol': symbol, 'maker': self.safe_number(fee, 'maker_fee_decimal'), 'taker': self.safe_number(fee, 'taker_fee_decimal'), 'percentage': True, 'tierBased': True, } return result def fetch_my_trades(self, symbol=None, since=None, limit=25, params={}): self.load_markets() market = self.market(symbol) # the don't support fetching trades starting from a date yet # use the `marker` extra param for that # self is not a typo, the variable name is 'marker'(don't confuse with 'market') markerInParams = ('marker' in params) # warn the user with an exception if the user wants to filter # starting from since timestamp, but does not set the trade id with an extra 'marker' param if (since is not None) and not markerInParams: raise ExchangeError(self.id + ' fetchMyTrades does not support fetching trades starting from a timestamp with the `since` argument, use the `marker` extra param to filter starting from an integer trade id') # convert it to an integer unconditionally if markerInParams: params = self.extend(params, { 'marker': int(params['marker']), }) request = { 'book': market['id'], 'limit': limit, # default = 25, max = 100 # 'sort': 'desc', # default = desc # 'marker': id, # integer id to start from } response = self.privateGetUserTrades(self.extend(request, params)) return self.parse_trades(response['payload'], market, since, limit) def create_order(self, symbol, type, side, amount, price=None, params={}): self.load_markets() request = { 'book': self.market_id(symbol), 'side': side, 'type': type, 'major': self.amount_to_precision(symbol, amount), } if type == 'limit': request['price'] = self.price_to_precision(symbol, price) response = self.privatePostOrders(self.extend(request, params)) id = self.safe_string(response['payload'], 'oid') return { 'info': response, 'id': id, } def cancel_order(self, id, symbol=None, params={}): self.load_markets() request = { 'oid': id, } return self.privateDeleteOrdersOid(self.extend(request, params)) def parse_order_status(self, status): statuses = { 'partial-fill': 'open', # self is a common substitution in ccxt 'completed': 'closed', } return self.safe_string(statuses, status, status) def parse_order(self, order, market=None): id = self.safe_string(order, 'oid') side = self.safe_string(order, 'side') status = self.parse_order_status(self.safe_string(order, 'status')) marketId = self.safe_string(order, 'book') symbol = self.safe_symbol(marketId, market, '_') orderType = self.safe_string(order, 'type') timestamp = self.parse8601(self.safe_string(order, 'created_at')) price = self.safe_string(order, 'price') amount = self.safe_string(order, 'original_amount') remaining = self.safe_string(order, 'unfilled_amount') clientOrderId = self.safe_string(order, 'client_id') return self.safe_order({ 'info': order, 'id': id, 'clientOrderId': clientOrderId, 'timestamp': timestamp, 'datetime': self.iso8601(timestamp), 'lastTradeTimestamp': None, 'symbol': symbol, 'type': orderType, 'timeInForce': None, 'postOnly': None, 'side': side, 'price': price, 'stopPrice': None, 'amount': amount, 'cost': None, 'remaining': remaining, 'filled': None, 'status': status, 'fee': None, 'average': None, 'trades': None, }, market) def fetch_open_orders(self, symbol=None, since=None, limit=25, params={}): self.load_markets() market = self.market(symbol) # the don't support fetching trades starting from a date yet # use the `marker` extra param for that # self is not a typo, the variable name is 'marker'(don't confuse with 'market') markerInParams = ('marker' in params) # warn the user with an exception if the user wants to filter # starting from since timestamp, but does not set the trade id with an extra 'marker' param if (since is not None) and not markerInParams: raise ExchangeError(self.id + ' fetchOpenOrders does not support fetching orders starting from a timestamp with the `since` argument, use the `marker` extra param to filter starting from an integer trade id') # convert it to an integer unconditionally if markerInParams: params = self.extend(params, { 'marker': int(params['marker']), }) request = { 'book': market['id'], 'limit': limit, # default = 25, max = 100 # 'sort': 'desc', # default = desc # 'marker': id, # integer id to start from } response = self.privateGetOpenOrders(self.extend(request, params)) orders = self.parse_orders(response['payload'], market, since, limit) return orders def fetch_order(self, id, symbol=None, params={}): self.load_markets() response = self.privateGetOrdersOid({ 'oid': id, }) payload = self.safe_value(response, 'payload') if isinstance(payload, list): numOrders = len(response['payload']) if numOrders == 1: return self.parse_order(payload[0]) raise OrderNotFound(self.id + ': The order ' + id + ' not found.') def fetch_order_trades(self, id, symbol=None, since=None, limit=None, params={}): self.load_markets() market = self.market(symbol) request = { 'oid': id, } response = self.privateGetOrderTradesOid(self.extend(request, params)) return self.parse_trades(response['payload'], market) def fetch_deposit_address(self, code, params={}): self.load_markets() currency = self.currency(code) request = { 'fund_currency': currency['id'], } response = self.privateGetFundingDestination(self.extend(request, params)) address = self.safe_string(response['payload'], 'account_identifier') tag = None if address.find('?dt=') >= 0: parts = address.split('?dt=') address = self.safe_string(parts, 0) tag = self.safe_string(parts, 1) self.check_address(address) return { 'currency': code, 'address': address, 'tag': tag, 'network': None, 'info': response, } def fetch_funding_fees(self, params={}): self.load_markets() response = self.privateGetFees(params) # # { # success: True, # payload: { # fees: [ # { # book: 'btc_mxn', # fee_percent: '0.6500', # fee_decimal: '0.00650000', # taker_fee_percent: '0.6500', # taker_fee_decimal: '0.00650000', # maker_fee_percent: '0.5000', # maker_fee_decimal: '0.00500000', # volume_currency: 'mxn', # current_volume: '0.00', # next_volume: '1500000.00', # next_maker_fee_percent: '0.490', # next_taker_fee_percent: '0.637', # nextVolume: '1500000.00', # nextFee: '0.490', # nextTakerFee: '0.637' # }, # ... # ], # deposit_fees: [ # { # currency: 'btc', # method: 'rewards', # fee: '0.00', # is_fixed: False # }, # ... # ], # withdrawal_fees: { # ada: '0.20958100', # bch: '0.00009437', # ars: '0', # btc: '0.00001209', # ... # } # } # } # payload = self.safe_value(response, 'payload', {}) depositFees = self.safe_value(payload, 'deposit_fees', []) deposit = {} for i in range(0, len(depositFees)): depositFee = depositFees[i] currencyId = self.safe_string(depositFee, 'currency') code = self.safe_currency_code(currencyId) deposit[code] = self.safe_number(depositFee, 'fee') withdraw = {} withdrawalFees = self.safe_value(payload, 'withdrawal_fees', []) currencyIds = list(withdrawalFees.keys()) for i in range(0, len(currencyIds)): currencyId = currencyIds[i] code = self.safe_currency_code(currencyId) withdraw[code] = self.safe_number(withdrawalFees, currencyId) return { 'info': response, 'deposit': deposit, 'withdraw': withdraw, } def withdraw(self, code, amount, address, tag=None, params={}): tag, params = self.handle_withdraw_tag_and_params(tag, params) self.check_address(address) self.load_markets() methods = { 'BTC': 'Bitcoin', 'ETH': 'Ether', 'XRP': 'Ripple', 'BCH': 'Bcash', 'LTC': 'Litecoin', } currency = self.currency(code) method = methods[code] if (code in methods) else None if method is None: raise ExchangeError(self.id + ' not valid withdraw coin: ' + code) request = { 'amount': amount, 'address': address, 'destination_tag': tag, } classMethod = 'privatePost' + method + 'Withdrawal' response = getattr(self, classMethod)(self.extend(request, params)) # # { # "success": True, # "payload": [ # { # "wid": "c5b8d7f0768ee91d3b33bee648318688", # "status": "pending", # "created_at": "2016-04-08T17:52:31.000+00:00", # "currency": "btc", # "method": "Bitcoin", # "amount": "0.48650929", # "details": { # "withdrawal_address": "18MsnATiNiKLqUHDTRKjurwMg7inCrdNEp", # "tx_hash": "d4f28394693e9fb5fffcaf730c11f32d1922e5837f76ca82189d3bfe30ded433" # } # }, # ] # } # payload = self.safe_value(response, 'payload', []) first = self.safe_value(payload, 0) return self.parse_transaction(first, currency) def parse_transaction(self, transaction, currency=None): # # withdraw # # { # "wid": "c5b8d7f0768ee91d3b33bee648318688", # "status": "pending", # "created_at": "2016-04-08T17:52:31.000+00:00", # "currency": "btc", # "method": "Bitcoin", # "amount": "0.48650929", # "details": { # "withdrawal_address": "18MsnATiNiKLqUHDTRKjurwMg7inCrdNEp", # "tx_hash": "d4f28394693e9fb5fffcaf730c11f32d1922e5837f76ca82189d3bfe30ded433" # } # } # currency = self.safe_currency(None, currency) return { 'id': self.safe_string(transaction, 'wid'), 'txid': None, 'timestamp': None, 'datetime': None, 'network': None, 'addressFrom': None, 'address': None, 'addressTo': None, 'amount': None, 'type': None, 'currency': currency['code'], 'status': None, 'updated': None, 'tagFrom': None, 'tag': None, 'tagTo': None, 'comment': None, 'fee': None, 'info': transaction, } def sign(self, path, api='public', method='GET', params={}, headers=None, body=None): endpoint = '/' + self.version + '/' + self.implode_params(path, params) query = self.omit(params, self.extract_params(path)) if method == 'GET': if query: endpoint += '?' + self.urlencode(query) url = self.urls['api'] + endpoint if api == 'private': self.check_required_credentials() nonce = str(self.nonce()) request = ''.join([nonce, method, endpoint]) if method != 'GET': if query: body = self.json(query) request += body signature = self.hmac(self.encode(request), self.encode(self.secret)) auth = self.apiKey + ':' + nonce + ':' + signature headers = { 'Authorization': 'Bitso ' + auth, 'Content-Type': 'application/json', } return {'url': url, 'method': method, 'body': body, 'headers': headers} def handle_errors(self, httpCode, reason, url, method, headers, body, response, requestHeaders, requestBody): if response is None: return # fallback to default error handler if 'success' in response: # # {"success":false,"error":{"code":104,"message":"Cannot perform request - nonce must be higher than 1520307203724237"}} # success = self.safe_value(response, 'success', False) if isinstance(success, str): if (success == 'true') or (success == '1'): success = True else: success = False if not success: feedback = self.id + ' ' + self.json(response) error = self.safe_value(response, 'error') if error is None: raise ExchangeError(feedback) code = self.safe_string(error, 'code') self.throw_exactly_matched_exception(self.exceptions, code, feedback) raise ExchangeError(feedback) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">39.967262</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">220</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.454315</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">AsquaredXIV/ccxt</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">python/ccxt/bitso.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">40,287</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8762"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># list all object store access policies res = client.get_object_store_access_policies() print(res) if type(res) == pypureclient.responses.ValidResponse: print(list(res.items)) # Valid fields: continuation_token, filter, ids, limit, names, offset, sort # See section "Common Fields" for examples </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">37.375</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">75</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.77592</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "BSD-2-Clause" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Flav-STOR-WL/py-pure-client</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">docs/source/examples/FB2.0/get_object_store_access_policies.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">299</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8763"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import logging import urllib.parse from typing import Any, Dict, Optional, Type, Union from globus_sdk import config, exc, utils from globus_sdk.authorizers import GlobusAuthorizer from globus_sdk.paging import PaginatorTable from globus_sdk.response import GlobusHTTPResponse from globus_sdk.scopes import ScopeBuilder from globus_sdk.transport import RequestsTransport log = logging.getLogger(__name__) class BaseClient: r""" Abstract base class for clients with error handling for Globus APIs. :param authorizer: A ``GlobusAuthorizer`` which will generate Authorization headers :type authorizer: :class:`GlobusAuthorizer\ <globus_sdk.authorizers.base.GlobusAuthorizer>` :param app_name: Optional "nice name" for the application. Has no bearing on the semantics of client actions. It is just passed as part of the User-Agent string, and may be useful when debugging issues with the Globus Team :type app_name: str :param transport_params: Options to pass to the transport for this client :type transport_params: dict All other parameters are for internal use and should be ignored. """ # service name is used to lookup a service URL from config service_name: str = "_base" # path under the client base URL base_path: str = "/" #: the class for errors raised by this client on HTTP 4xx and 5xx errors #: this can be set in subclasses, but must always be a subclass of GlobusError error_class: Type[exc.GlobusAPIError] = exc.GlobusAPIError #: the type of Transport which will be used, defaults to ``RequestsTransport`` transport_class: Type[RequestsTransport] = RequestsTransport #: the scopes for this client may be present as a ``ScopeBuilder`` scopes: Optional[ScopeBuilder] = None def __init__( self, *, environment: Optional[str] = None, base_url: Optional[str] = None, authorizer: Optional[GlobusAuthorizer] = None, app_name: Optional[str] = None, transport_params: Optional[Dict[str, Any]] = None, ): # explicitly check the `service_name` to ensure that it was set # # unfortunately, we can't rely on declaring BaseClient as an ABC because it # doesn't have any abstract methods # # if we declare `service_name` without a value, we get AttributeError on access # instead of the (desired) TypeError when instantiating a BaseClient because # it's abstract if self.service_name == "_base": raise NotImplementedError( "Cannot instantiate clients which do not set a 'service_name'" ) log.info( f'Creating client of type {type(self)} for service "{self.service_name}"' ) # if an environment was passed, it will be used, but otherwise lookup # the env var -- and in the special case of `production` translate to # `default`, regardless of the source of that value # logs the environment when it isn't `default` self.environment = config.get_environment_name(environment) self.transport = self.transport_class(**(transport_params or {})) log.debug(f"initialized transport of type {type(self.transport)}") if not self.service_name and not base_url: raise ValueError("Either service_name or base_url must be set") self.base_url = utils.slash_join( config.get_service_url(self.service_name, environment=self.environment) if base_url is None else base_url, self.base_path, ) self.authorizer = authorizer # set application name if given self._app_name = None if app_name is not None: self.app_name = app_name # setup paginated methods self.paginated = PaginatorTable(self) @property def app_name(self) -> Optional[str]: return self._app_name @app_name.setter def app_name(self, value: str) -> None: self._app_name = self.transport.user_agent = value @utils.classproperty def resource_server(cls) -> Optional[str]: """ The resource_server name for the API and scopes associated with this client. This information is pulled from the ``scopes`` attribute of the client class. If the client does not have associated scopes, this value will be ``None``. """ if cls.scopes is None: return None return cls.scopes.resource_server def get( self, path: str, *, query_params: Optional[Dict[str, Any]] = None, headers: Optional[Dict[str, str]] = None, ) -> GlobusHTTPResponse: """ Make a GET request to the specified path. See :py:meth:`~.BaseClient.request` for details on the various parameters. :return: :class:`GlobusHTTPResponse \ <globus_sdk.response.GlobusHTTPResponse>` object """ log.debug(f"GET to {path} with query_params {query_params}") return self.request("GET", path, query_params=query_params, headers=headers) def post( self, path: str, *, query_params: Optional[Dict[str, Any]] = None, data: Union[None, Dict[str, Any], utils.PayloadWrapper] = None, headers: Optional[Dict[str, str]] = None, encoding: Optional[str] = None, ) -> GlobusHTTPResponse: """ Make a POST request to the specified path. See :py:meth:`~.BaseClient.request` for details on the various parameters. :return: :class:`GlobusHTTPResponse \ <globus_sdk.response.GlobusHTTPResponse>` object """ log.debug(f"POST to {path} with query_params {query_params}") return self.request( "POST", path, query_params=query_params, data=data, headers=headers, encoding=encoding, ) def delete( self, path: str, *, query_params: Optional[Dict[str, Any]] = None, headers: Optional[Dict[str, str]] = None, ) -> GlobusHTTPResponse: """ Make a DELETE request to the specified path. See :py:meth:`~.BaseClient.request` for details on the various parameters. :return: :class:`GlobusHTTPResponse \ <globus_sdk.response.GlobusHTTPResponse>` object """ log.debug(f"DELETE to {path} with query_params {query_params}") return self.request("DELETE", path, query_params=query_params, headers=headers) def put( self, path: str, *, query_params: Optional[Dict[str, Any]] = None, data: Union[None, Dict[str, Any], utils.PayloadWrapper] = None, headers: Optional[Dict[str, str]] = None, encoding: Optional[str] = None, ) -> GlobusHTTPResponse: """ Make a PUT request to the specified path. See :py:meth:`~.BaseClient.request` for details on the various parameters. :return: :class:`GlobusHTTPResponse \ <globus_sdk.response.GlobusHTTPResponse>` object """ log.debug(f"PUT to {path} with query_params {query_params}") return self.request( "PUT", path, query_params=query_params, data=data, headers=headers, encoding=encoding, ) def patch( self, path: str, *, query_params: Optional[Dict[str, Any]] = None, data: Union[None, Dict[str, Any], utils.PayloadWrapper] = None, headers: Optional[Dict[str, str]] = None, encoding: Optional[str] = None, ) -> GlobusHTTPResponse: """ Make a PATCH request to the specified path. See :py:meth:`~.BaseClient.request` for details on the various parameters. :return: :class:`GlobusHTTPResponse \ <globus_sdk.response.GlobusHTTPResponse>` object """ log.debug(f"PATCH to {path} with query_params {query_params}") return self.request( "PATCH", path, query_params=query_params, data=data, headers=headers, encoding=encoding, ) def request( self, method: str, path: str, *, query_params: Optional[Dict[str, Any]] = None, data: Union[None, Dict[str, Any], utils.PayloadWrapper] = None, headers: Optional[Dict[str, str]] = None, encoding: Optional[str] = None, ) -> GlobusHTTPResponse: """ Send an HTTP request :param method: HTTP request method, as an all caps string :type method: str :param path: Path for the request, with or without leading slash :type path: str :param query_params: Parameters to be encoded as a query string :type query_params: dict, optional :param headers: HTTP headers to add to the request :type headers: dict :param data: Data to send as the request body. May pass through encoding. :type data: dict or str :param encoding: A way to encode request data. "json", "form", and "text" are all valid values. Custom encodings can be used only if they are registered with the transport. By default, strings get "text" behavior and all other objects get "json". :type encoding: str :return: :class:`GlobusHTTPResponse \ <globus_sdk.response.GlobusHTTPResponse>` object """ # prepare data... # copy headers if present rheaders = {**headers} if headers else {} # if a client is asked to make a request against a full URL, not just the path # component, then do not resolve the path, simply pass it through as the URL if path.startswith("https://") or path.startswith("http://"): url = path else: url = utils.slash_join(self.base_url, urllib.parse.quote(path)) # make the request log.debug("request will hit URL: %s", url) r = self.transport.request( method=method, url=url, data=data.data if isinstance(data, utils.PayloadWrapper) else data, query_params=query_params, headers=rheaders, encoding=encoding, authorizer=self.authorizer, ) log.debug("request made to URL: %s", r.url) if 200 <= r.status_code < 400: log.debug(f"request completed with response code: {r.status_code}") return GlobusHTTPResponse(r, self) log.debug(f"request completed with (error) response code: {r.status_code}") raise self.error_class(r) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">36.133779</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">87</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.623195</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "ECL-2.0", "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">rudyardrichter/globus-sdk-python</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">src/globus_sdk/client.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">10,804</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8764"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">#!/Users/drpaneas/Virtualenvs/linuxed/bin/python2.7 # $Id: rst2pseudoxml.py 4564 2006-05-21 20:44:42Z wiemann $ # Author: David Goodger <<a href="/cdn-cgi/l/email-protection" class="__cf_email__" data-cfemail="2a4d45454e4d4f586a5a535e4245440445584d">[email protected]</a>> # Copyright: This module has been placed in the public domain. """ A minimal front end to the Docutils Publisher, producing pseudo-XML. """ try: import locale locale.setlocale(locale.LC_ALL, '') except: pass from docutils.core import publish_cmdline, default_description description = ('Generates pseudo-XML from standalone reStructuredText ' 'sources (for testing purposes). ' + default_description) publish_cmdline(description=description) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">26.416667</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">73</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.744479</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">drpaneas/linuxed.gr</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">bin/rst2pseudoxml.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">634</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8765"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from django.urls import re_path from ..views import OptionsExportView, OptionsView urlpatterns = [ re_path(r'^$', OptionsView.as_view(), name='options'), re_path(r'^export/(?P<format>[a-z]+)/$', OptionsExportView.as_view(), name='options_export'), ] </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">28.888889</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">97</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.703846</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">GeoinformationSystems/rdmo</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">rdmo/options/urls/__init__.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">260</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8766"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">"""Identifiers for objects in Robustness Gym.""" from __future__ import annotations import ast import json from typing import Any, Callable, List, Union # from robustnessgym.core.tools import persistent_hash class Identifier: """Class for creating identifiers for objects in Robustness Gym.""" def __init__( self, _name: str, _index: Union[str, int] = None, **kwargs, ): self._name = _name self._index = str(_index) if _index is not None else None self._parameters = kwargs # Add the parameter for param, value in self.parameters.items(): self.add_parameter(param, value) @property def name(self): """Base name.""" return self._name @property def index(self): """Index associated with the identifier.""" return self._index @property def parameters(self): """Additional parameters contained in the identifier.""" return self._parameters @classmethod def range(cls, n: int, _name: str, **kwargs) -> List[Identifier]: """Create a list of identifiers, with index varying from 1 to `n`.""" if n > 1: return [cls(_name=_name, _index=i, **kwargs) for i in range(1, n + 1)] return [cls(_name=_name, **kwargs)] def __call__(self, **kwargs): """Call the identifier with additional parameters to return a new identifier.""" ident = Identifier.loads(self.dumps()) for parameter, value in kwargs.items(): ident.add_parameter(parameter, value) return ident def __repr__(self): params = ", ".join([f"{k}={v}" for k, v in self.parameters.items()]) if self.index is not None: return ( f"{self.name}-{self.index}({params})" if len(params) > 0 else f"{self.name}-{self.index}" ) return f"{self.name}({params})" if len(params) > 0 else f"{self.name}" def __hash__(self): # return persistent_hash(str(self)) return hash(str(self)) def __eq__(self, other: Union[Identifier, str]): return str(self) == str(other) def dumps(self): """Dump the identifier to JSON.""" return json.dumps(self.__dict__) @staticmethod def _parse_args(s: str): """https://stackoverflow.com/questions/49723047/parsing-a-string-as-a- python-argument-list.""" args = "f({})".format(s) tree = ast.parse(args) funccall = tree.body[0].value # return {arg.arg: ast.literal_eval(arg.value) for arg in funccall.keywords} params = {} for arg in funccall.keywords: try: params[arg.arg] = ast.literal_eval(arg.value) except ValueError: params[arg.arg] = arg.value.id return params @classmethod def parse(cls, s: str) -> Identifier: """Parse in an identifier from string.""" # Parse out the various components if "(" in s: name_index, params = s.split("(") params = params.split(")")[0] else: name_index = s params = None # Create the name and index if "-" in name_index: name, index = name_index.split("-")[:-1], name_index.split("-")[-1] name = "-".join(name) if index.isnumeric(): index = int(index) else: name = "-".join([name, index]) index = None else: name = name_index index = None # Parse out the params if params is not None: params = cls._parse_args(params) else: params = {} return cls(_name=name, _index=index, **params) def without(self, *params) -> Identifier: """Returns an identifier without `params`.""" return Identifier( self.name, self.index, **{k: v for k, v in self.parameters.items() if k not in set(params)}, ) @classmethod def loads(cls, s: str): """Load the identifier from JSON.""" identifier = Identifier(_name="") identifier.__dict__ = json.loads(s) return identifier def add_parameter(self, parameter: str, value: Any) -> None: """Add a parameter to the identifier.""" if isinstance(value, Callable): self.parameters[parameter] = ".".join( [str(value.__module__), str(value.__name__)] ) else: self.parameters[parameter] = value # Assign Id as an alias for the Identifier class Id = Identifier </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">30.25</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">84</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.559229</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">ANarayan/robustness-gym</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">robustnessgym/core/identifier.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">4,719</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8767"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># Copyright 2013-2022 Lawrence Livermore National Security, LLC and other # Spack Project Developers. See the top-level COPYRIGHT file for details. # # SPDX-License-Identifier: (Apache-2.0 OR MIT) from spack import * class RAbind(RPackage): """ Combine Multidimensional Arrays. Combine multidimensional arrays into a single array. This is a generalization of 'cbind' and 'rbind'. Works with vectors, matrices, and higher-dimensional arrays. Also provides functions 'adrop', 'asub', and 'afill' for manipulating, extracting and replacing data in arrays.""" cran = "abind" version('1.4-5', sha256='3a3ace5afbcb86e56889efcebf3bf5c3bb042a282ba7cc4412d450bb246a3f2c') version('1.4-3', sha256='b6c255878c1ab81701ae701f34546e88be115629b984ac4272e311fa3c0ea6ce') depends_on('<a href="/cdn-cgi/l/email-protection" class="__cf_email__" data-cfemail="e290a2d3ccd7ccd2">[email protected]</a>:', type=('build', 'run')) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">35.333333</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">95</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.742925</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "ECL-2.0", "Apache-2.0", "MIT-0", "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">FJ-NaokiMatsumura/spack</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">var/spack/repos/builtin/packages/r-abind/package.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">848</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8768"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import numpy as np import torch def get_sinusoid_encoding_table(n_position, d_hid, padding_idx=None): ''' Sinusoid position encoding table ''' def cal_angle(position, hid_idx): return position / np.power(10000, 2 * (hid_idx // 2) / d_hid) def get_posi_angle_vec(position): return [cal_angle(position, hid_j) for hid_j in range(d_hid)] sinusoid_table = np.array([get_posi_angle_vec(pos_i) for pos_i in range(n_position)]) sinusoid_table[:, 0::2] = np.sin(sinusoid_table[:, 0::2]) # dim 2i sinusoid_table[:, 1::2] = np.cos(sinusoid_table[:, 1::2]) # dim 2i+1 if padding_idx is not None: # zero vector for padding dimension sinusoid_table[padding_idx] = 0. return torch.FloatTensor(sinusoid_table)</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">33.391304</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">89</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.684896</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">MrSchnappi/RL-for-Question-Generation</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">src/onqg/utils/sinusoid.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">768</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8769"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from unittest import TestCase class TestNumbers2Words(TestCase): from numbers2words import numbers2words # 1-10 def test_one(self): self.assertEqual(numbers2words(1), "one") def test_two(self): self.assertEqual(numbers2words(2), "two") def test_three(self): self.assertEqual(numbers2words(3), "three") def test_four(self): self.assertEqual(numbers2words(4), "four") def test_five(self): self.assertEqual(numbers2words(5), "five") def test_six(self): self.assertEqual(numbers2words(6), "six") def test_seven(self): self.assertEqual(numbers2words(7), "seven") def test_eight(self): self.assertEqual(numbers2words(8), "eight") def test_nine(self): self.assertEqual(numbers2words(9), "nine") def test_ten(self): self.assertEqual(numbers2words(10), "ten") # 11-20 def test_eleven(self): self.assertEqual(numbers2words(11), "eleven") def test_twelve(self): self.assertEqual(numbers2words(12), "twelve") def test_thirteen(self): self.assertEqual(numbers2words(13), "thirteen") def test_fourteen(self): self.assertEqual(numbers2words(14), "fourteen") def test_fifteen(self): self.assertEqual(numbers2words(15), "fifteen") def test_sixteen(self): self.assertEqual(numbers2words(16), "sixteen") def test_seventeen(self): self.assertEqual(numbers2words(17), "seventeen") def test_eighteen(self): self.assertEqual(numbers2words(18), "eighteen") def test_nineteen(self): self.assertEqual(numbers2words(19), "nineteen") def test_twenty(self): self.assertEqual(numbers2words(20), "twenty") </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">23.214286</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">52</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.710154</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">gnuchu/n2w</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">tests/test_n2w.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">1,625</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8770"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># Copyright 2018 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Common util functions and classes used by both keras cifar and imagenet.""" from __future__ import absolute_import from __future__ import division from __future__ import print_function import os from absl import flags import numpy as np import tensorflow as tf from tensorflow.python.keras.optimizer_v2 import gradient_descent as gradient_descent_v2 import tensorflow_model_optimization as tfmot from official.utils.flags import core as flags_core from official.utils.misc import keras_utils FLAGS = flags.FLAGS BASE_LEARNING_RATE = 0.1 # This matches Jing's version. TRAIN_TOP_1 = 'training_accuracy_top_1' LR_SCHEDULE = [ # (multiplier, epoch to start) tuples (1.0, 5), (0.1, 30), (0.01, 60), (0.001, 80) ] def learning_rate_schedule(current_epoch, current_batch, steps_per_epoch, batch_size): """Handles linear scaling rule, gradual warmup, and LR decay. Scale learning rate at epoch boundaries provided in LR_SCHEDULE by the provided scaling factor. Args: current_epoch: integer, current epoch indexed from 0. current_batch: integer, current batch in the current epoch, indexed from 0. steps_per_epoch: integer, number of steps in an epoch. batch_size: integer, total batch sized. Returns: Adjusted learning rate. """ initial_lr = BASE_LEARNING_RATE * batch_size / 256 epoch = current_epoch + float(current_batch) / steps_per_epoch warmup_lr_multiplier, warmup_end_epoch = LR_SCHEDULE[0] if epoch < warmup_end_epoch: # Learning rate increases linearly per step. return initial_lr * warmup_lr_multiplier * epoch / warmup_end_epoch for mult, start_epoch in LR_SCHEDULE: if epoch >= start_epoch: learning_rate = initial_lr * mult else: break return learning_rate class LearningRateBatchScheduler(tf.keras.callbacks.Callback): """Callback to update learning rate on every batch (not epoch boundaries). N.B. Only support Keras optimizers, not TF optimizers. Attributes: schedule: a function that takes an epoch index and a batch index as input (both integer, indexed from 0) and returns a new learning rate as output (float). """ def __init__(self, schedule, batch_size, steps_per_epoch): super(LearningRateBatchScheduler, self).__init__() self.schedule = schedule self.steps_per_epoch = steps_per_epoch self.batch_size = batch_size self.epochs = -1 self.prev_lr = -1 def on_epoch_begin(self, epoch, logs=None): if not hasattr(self.model.optimizer, 'learning_rate'): raise ValueError('Optimizer must have a "learning_rate" attribute.') self.epochs += 1 def on_batch_begin(self, batch, logs=None): """Executes before step begins.""" lr = self.schedule(self.epochs, batch, self.steps_per_epoch, self.batch_size) if not isinstance(lr, (float, np.float32, np.float64)): raise ValueError('The output of the "schedule" function should be float.') if lr != self.prev_lr: self.model.optimizer.learning_rate = lr # lr should be a float here self.prev_lr = lr tf.compat.v1.logging.debug( 'Epoch %05d Batch %05d: LearningRateBatchScheduler ' 'change learning rate to %s.', self.epochs, batch, lr) class PiecewiseConstantDecayWithWarmup( tf.keras.optimizers.schedules.LearningRateSchedule): """Piecewise constant decay with warmup schedule.""" def __init__(self, batch_size, epoch_size, warmup_epochs, boundaries, multipliers, compute_lr_on_cpu=True, name=None): super(PiecewiseConstantDecayWithWarmup, self).__init__() if len(boundaries) != len(multipliers) - 1: raise ValueError('The length of boundaries must be 1 less than the ' 'length of multipliers') base_lr_batch_size = 256 steps_per_epoch = epoch_size // batch_size self.rescaled_lr = BASE_LEARNING_RATE * batch_size / base_lr_batch_size self.step_boundaries = [float(steps_per_epoch) * x for x in boundaries] self.lr_values = [self.rescaled_lr * m for m in multipliers] self.warmup_steps = warmup_epochs * steps_per_epoch self.compute_lr_on_cpu = compute_lr_on_cpu self.name = name self.learning_rate_ops_cache = {} def __call__(self, step): if tf.executing_eagerly(): return self._get_learning_rate(step) # In an eager function or graph, the current implementation of optimizer # repeatedly call and thus create ops for the learning rate schedule. To # avoid this, we cache the ops if not executing eagerly. graph = tf.compat.v1.get_default_graph() if graph not in self.learning_rate_ops_cache: if self.compute_lr_on_cpu: with tf.device('/device:CPU:0'): self.learning_rate_ops_cache[graph] = self._get_learning_rate(step) else: self.learning_rate_ops_cache[graph] = self._get_learning_rate(step) return self.learning_rate_ops_cache[graph] def _get_learning_rate(self, step): """Compute learning rate at given step.""" with tf.compat.v1.name_scope(self.name, 'PiecewiseConstantDecayWithWarmup', [self.rescaled_lr, self.step_boundaries, self.lr_values, self.warmup_steps, self.compute_lr_on_cpu]): def warmup_lr(step): return self.rescaled_lr * ( tf.cast(step, tf.float32) / tf.cast(self.warmup_steps, tf.float32)) def piecewise_lr(step): return tf.compat.v1.train.piecewise_constant( step, self.step_boundaries, self.lr_values) return tf.cond(step < self.warmup_steps, lambda: warmup_lr(step), lambda: piecewise_lr(step)) def get_config(self): return { 'rescaled_lr': self.rescaled_lr, 'step_boundaries': self.step_boundaries, 'lr_values': self.lr_values, 'warmup_steps': self.warmup_steps, 'compute_lr_on_cpu': self.compute_lr_on_cpu, 'name': self.name } def get_optimizer(learning_rate=0.1): """Returns optimizer to use.""" # The learning_rate is overwritten at the beginning of each step by callback. return gradient_descent_v2.SGD(learning_rate=learning_rate, momentum=0.9) # TODO(hongkuny,haoyuzhang): make cifar model use_tensor_lr to clean up code. def get_callbacks( steps_per_epoch, learning_rate_schedule_fn=None, pruning_method=None, enable_checkpoint_and_export=False, model_dir=None): """Returns common callbacks.""" time_callback = keras_utils.TimeHistory(FLAGS.batch_size, FLAGS.log_steps) callbacks = [time_callback] if not FLAGS.use_tensor_lr and learning_rate_schedule_fn: lr_callback = LearningRateBatchScheduler( learning_rate_schedule_fn, batch_size=FLAGS.batch_size, steps_per_epoch=steps_per_epoch) callbacks.append(lr_callback) if FLAGS.enable_tensorboard: tensorboard_callback = tf.keras.callbacks.TensorBoard( log_dir=FLAGS.model_dir) callbacks.append(tensorboard_callback) if FLAGS.profile_steps: profiler_callback = keras_utils.get_profiler_callback( FLAGS.model_dir, FLAGS.profile_steps, FLAGS.enable_tensorboard, steps_per_epoch) callbacks.append(profiler_callback) is_pruning_enabled = pruning_method is not None if is_pruning_enabled: callbacks.append(tfmot.sparsity.keras.UpdatePruningStep()) if model_dir is not None: callbacks.append(tfmot.sparsity.keras.PruningSummaries( log_dir=model_dir, profile_batch=0)) if enable_checkpoint_and_export: if model_dir is not None: ckpt_full_path = os.path.join(model_dir, 'model.ckpt-{epoch:04d}') callbacks.append( tf.keras.callbacks.ModelCheckpoint(ckpt_full_path, save_weights_only=True)) return callbacks def build_stats(history, eval_output, callbacks): """Normalizes and returns dictionary of stats. Args: history: Results of the training step. Supports both categorical_accuracy and sparse_categorical_accuracy. eval_output: Output of the eval step. Assumes first value is eval_loss and second value is accuracy_top_1. callbacks: a list of callbacks which might include a time history callback used during keras.fit. Returns: Dictionary of normalized results. """ stats = {} if eval_output: stats['accuracy_top_1'] = eval_output[1].item() stats['eval_loss'] = eval_output[0].item() if history and history.history: train_hist = history.history # Gets final loss from training. stats['loss'] = train_hist['loss'][-1].item() # Gets top_1 training accuracy. if 'categorical_accuracy' in train_hist: stats[TRAIN_TOP_1] = train_hist['categorical_accuracy'][-1].item() elif 'sparse_categorical_accuracy' in train_hist: stats[TRAIN_TOP_1] = train_hist['sparse_categorical_accuracy'][-1].item() if not callbacks: return stats # Look for the time history callback which was used during keras.fit for callback in callbacks: if isinstance(callback, keras_utils.TimeHistory): timestamp_log = callback.timestamp_log stats['step_timestamp_log'] = timestamp_log stats['train_finish_time'] = callback.train_finish_time if len(timestamp_log) > 1: stats['avg_exp_per_second'] = ( callback.batch_size * callback.log_steps * (len(callback.timestamp_log)-1) / (timestamp_log[-1].timestamp - timestamp_log[0].timestamp)) return stats def define_keras_flags( dynamic_loss_scale=True, model=False, optimizer=False, pretrained_filepath=False): """Define flags for Keras models.""" flags_core.define_base(clean=True, num_gpu=True, run_eagerly=True, train_epochs=True, epochs_between_evals=True, distribution_strategy=True) flags_core.define_performance(num_parallel_calls=False, synthetic_data=True, dtype=True, all_reduce_alg=True, num_packs=True, tf_gpu_thread_mode=True, datasets_num_private_threads=True, dynamic_loss_scale=dynamic_loss_scale, loss_scale=True, fp16_implementation=True, tf_data_experimental_slack=True, enable_xla=True, force_v2_in_keras_compile=True, training_dataset_cache=True) flags_core.define_image() flags_core.define_benchmark() flags_core.define_distribution() flags.adopt_module_key_flags(flags_core) flags.DEFINE_boolean(name='enable_eager', default=False, help='Enable eager?') flags.DEFINE_boolean(name='skip_eval', default=False, help='Skip evaluation?') # TODO(b/135607288): Remove this flag once we understand the root cause of # slowdown when setting the learning phase in Keras backend. flags.DEFINE_boolean( name='set_learning_phase_to_train', default=True, help='If skip eval, also set Keras learning phase to 1 (training).') flags.DEFINE_boolean( name='explicit_gpu_placement', default=False, help='If not using distribution strategy, explicitly set device scope ' 'for the Keras training loop.') flags.DEFINE_boolean(name='use_trivial_model', default=False, help='Whether to use a trivial Keras model.') flags.DEFINE_boolean(name='report_accuracy_metrics', default=True, help='Report metrics during training and evaluation.') flags.DEFINE_boolean(name='use_tensor_lr', default=False, help='Use learning rate tensor instead of a callback.') flags.DEFINE_boolean( name='enable_tensorboard', default=False, help='Whether to enable Tensorboard callback.') flags.DEFINE_integer( name='train_steps', default=None, help='The number of steps to run for training. If it is larger than ' '# batches per epoch, then use # batches per epoch. This flag will be ' 'ignored if train_epochs is set to be larger than 1. ') flags.DEFINE_string( name='profile_steps', default=None, help='Save profiling data to model dir at given range of global steps. The ' 'value must be a comma separated pair of positive integers, specifying ' 'the first and last step to profile. For example, "--profile_steps=2,4" ' 'triggers the profiler to process 3 steps, starting from the 2nd step. ' 'Note that profiler has a non-trivial performance overhead, and the ' 'output file can be gigantic if profiling many steps.') flags.DEFINE_boolean( name='batchnorm_spatial_persistent', default=True, help='Enable the spacial persistent mode for CuDNN batch norm kernel.') flags.DEFINE_boolean( name='enable_get_next_as_optional', default=False, help='Enable get_next_as_optional behavior in DistributedIterator.') flags.DEFINE_boolean( name='enable_checkpoint_and_export', default=False, help='Whether to enable a checkpoint callback and export the savedmodel.') flags.DEFINE_string( name='tpu', default='', help='TPU address to connect to.') flags.DEFINE_integer( name='steps_per_loop', default=500, help='Number of steps per training loop. Only training step happens ' 'inside the loop. Callbacks will not be called inside. Will be capped at ' 'steps per epoch.') flags.DEFINE_boolean( name='use_tf_while_loop', default=True, help='Whether to build a tf.while_loop inside the training loop on the ' 'host. Setting it to True is critical to have peak performance on ' 'TPU.') flags.DEFINE_boolean( name='use_tf_keras_layers', default=False, help='Whether to use tf.keras.layers instead of tf.python.keras.layers.' 'It only changes imagenet resnet model layers for now. This flag is ' 'a temporal flag during transition to tf.keras.layers. Do not use this ' 'flag for external usage. this will be removed shortly.') if model: flags.DEFINE_string('model', 'resnet50_v1.5', 'Name of model preset. (mobilenet, resnet50_v1.5)') if optimizer: flags.DEFINE_string('optimizer', 'resnet50_default', 'Name of optimizer preset. ' '(mobilenet_default, resnet50_default)') # TODO(kimjaehong): Replace as general hyper-params not only for mobilenet. flags.DEFINE_float('initial_learning_rate_per_sample', 0.00007, 'Initial value of learning rate per sample for ' 'mobilenet_default.') flags.DEFINE_float('lr_decay_factor', 0.94, 'Learning rate decay factor for mobilenet_default.') flags.DEFINE_float('num_epochs_per_decay', 2.5, 'Number of epochs per decay for mobilenet_default.') if pretrained_filepath: flags.DEFINE_string('pretrained_filepath', '', 'Pretrained file path.') def get_synth_data(height, width, num_channels, num_classes, dtype): """Creates a set of synthetic random data. Args: height: Integer height that will be used to create a fake image tensor. width: Integer width that will be used to create a fake image tensor. num_channels: Integer depth that will be used to create a fake image tensor. num_classes: Number of classes that should be represented in the fake labels tensor dtype: Data type for features/images. Returns: A tuple of tensors representing the inputs and labels. """ # Synthetic input should be within [0, 255]. inputs = tf.random.truncated_normal([height, width, num_channels], dtype=dtype, mean=127, stddev=60, name='synthetic_inputs') labels = tf.random.uniform([1], minval=0, maxval=num_classes - 1, dtype=tf.int32, name='synthetic_labels') return inputs, labels def define_pruning_flags(): """Define flags for pruning methods.""" flags.DEFINE_string('pruning_method', None, 'Pruning method.' 'None (no pruning) or polynomial_decay.') flags.DEFINE_float('pruning_initial_sparsity', 0.0, 'Initial sparsity for pruning.') flags.DEFINE_float('pruning_final_sparsity', 0.5, 'Final sparsity for pruning.') flags.DEFINE_integer('pruning_begin_step', 0, 'Begin step for pruning.') flags.DEFINE_integer('pruning_end_step', 100000, 'End step for pruning.') flags.DEFINE_integer('pruning_frequency', 100, 'Frequency for pruning.') def get_synth_input_fn(height, width, num_channels, num_classes, dtype=tf.float32, drop_remainder=True): """Returns an input function that returns a dataset with random data. This input_fn returns a data set that iterates over a set of random data and bypasses all preprocessing, e.g. jpeg decode and copy. The host to device copy is still included. This used to find the upper throughput bound when tuning the full input pipeline. Args: height: Integer height that will be used to create a fake image tensor. width: Integer width that will be used to create a fake image tensor. num_channels: Integer depth that will be used to create a fake image tensor. num_classes: Number of classes that should be represented in the fake labels tensor dtype: Data type for features/images. drop_remainder: A boolean indicates whether to drop the remainder of the batches. If True, the batch dimension will be static. Returns: An input_fn that can be used in place of a real one to return a dataset that can be used for iteration. """ # pylint: disable=unused-argument def input_fn(is_training, data_dir, batch_size, *args, **kwargs): """Returns dataset filled with random data.""" inputs, labels = get_synth_data(height=height, width=width, num_channels=num_channels, num_classes=num_classes, dtype=dtype) # Cast to float32 for Keras model. labels = tf.cast(labels, dtype=tf.float32) data = tf.data.Dataset.from_tensors((inputs, labels)).repeat() # `drop_remainder` will make dataset produce outputs with known shapes. data = data.batch(batch_size, drop_remainder=drop_remainder) data = data.prefetch(buffer_size=tf.data.experimental.AUTOTUNE) return data return input_fn def set_cudnn_batchnorm_mode(): """Set CuDNN batchnorm mode for better performance. Note: Spatial Persistent mode may lead to accuracy losses for certain models. """ if FLAGS.batchnorm_spatial_persistent: os.environ['TF_USE_CUDNN_BATCHNORM_SPATIAL_PERSISTENT'] = '1' else: os.environ.pop('TF_USE_CUDNN_BATCHNORM_SPATIAL_PERSISTENT', None) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">41.699588</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">88</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.673937</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Anku5hk/models</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">official/vision/image_classification/common.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">20,266</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8771"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import collections import itertools from trie_class import Trie import sys import timeit def load_dataset(filename): dataset = [sorted(int(n) for n in i.strip().split()) for i in open(filename).readlines()] size = len(dataset) print('Size of the Dataset : ', size) total_len = 0 for i in range(len(dataset)): total_len = total_len + len(dataset[i]) avg_len = total_len / size print('Average Transaction Length : ', avg_len) # print(dataset) return dataset def find_frequent_1_itemsets(dataset, min_sup): # print('1 - item func : min sup :', min_sup) frequency = dict(collections.Counter( itertools.chain.from_iterable(dataset))) L1 = dict() for item, freq in frequency.items(): if freq >= min_sup: L1[item] = freq # print(L1) return L1 # Input : L_k (k : itemset size) def apriori_gen(L: list, k): # Self Join Step L_next = list() for l1 in L: for l2 in L: if len(set(l1) & set(l2)) == (k - 1): L_next.append(sorted(list(set(l1) | set(l2)))) # Removing Duplicates L_set = set(tuple(x) for x in L_next) L_k1 = [list(x) for x in L_set] L_k1.sort(key=lambda x: L_next.index(x)) L_k1_tuple = [tuple(i) for i in L_k1] info={'join':len(L_k1)} # Prune Step for c in L_k1_tuple: if has_infrequent_subset(c, L): L_k1.remove(list(c)) info['prune'] = len(L_k1) # Returns list of lists [L_k + 1] return info,L_k1 def has_infrequent_subset(candidate: tuple, L: list): for subset in list(itertools.combinations(candidate, len(candidate) - 1)): if list(subset) not in L: return True return False def apriori(db: list, min_sup): min_sup = (len(db) * min_sup) // 100 # print('Apriori - min sup :', min_sup) levels = list() Levels_info = list() L1 = find_frequent_1_itemsets(db, min_sup) # print('L-1 :', L1) if bool(L1) == False: print('No 1-Itemset Satisfies Given Minimum Support Threshold') return None # Creating list of 1-itemset(list itself) _L1 = [[k] for k in L1.keys()] _L1 = sorted(_L1) # print('L1 :', L1) levels.append(_L1) Levels_info.append({'join': len(_L1), 'prune': len(_L1)}) # print('Levels :', levels) while True: info,candidates = apriori_gen(levels[-1], len(levels[-1][0])) trie = Trie(db) trie.build_trie(candidates) trie.assign_frequency() L = list() # print('Func : Min Sup -', min_sup) for itemset in candidates: # print(itemset, trie.get_candidate_freq(itemset), trie.get_candidate_freq(itemset) >= min_sup) if trie.get_candidate_freq(itemset) >= min_sup: # print(itemset, trie.get_candidate_freq(itemset), trie.get_candidate_freq(itemset) >= min_sup) L.append(sorted(itemset)) if not L: break levels.append(L) Levels_info.append(info) return Levels_info,levels if __name__ == "__main__": db = load_dataset(str(sys.argv[1])) min_sup = float(sys.argv[2]) print('Dataset :', str(sys.argv[1])) print('Min Support :', min_sup, '%') print('Min Support Count :', (len(db) * min_sup) // 100) start = timeit.default_timer() info, L = apriori(db, min_sup) stop = timeit.default_timer() pattern_total,join_total,prune_total = 0,0,0 print('Level', ' After Join', ' After Pruning', ' Frequent Itemsets') if L is not None: for i in range(len(L)): print() print((i + 1), info[i]['join'], info[i]['prune'], len(L[i]), sep='\t\t') pattern_total+=len(L[i]) join_total+=info[i]['join'] prune_total+= info[i]['prune'] # print((i + 1), '- Frequent Itemsets :', L[i]) print('\nTotal', join_total, prune_total, pattern_total, sep='\t\t') print('\nTime: ', stop - start, " seconds") </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">25.871795</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">111</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.588206</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">saif-mahmud/Data-Mining-Lab</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Frequent Pattern Mining/apriori.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">4,036</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8772"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">"""Spamming Module {i}spam <no of msgs> <msg> Note:- Don't use to much""" # Copyright (C) 2019 The Raphielscape Company LLC. # # Licensed under the Raphielscape Public License, Version 1.b (the "License"); # you may not use this file except in compliance with the License. # from asyncio import wait from telethon import events @ItzSjDude(outgoing=True, pattern=r"spam") async def spammer(e): if not e.text[0].isalpha() and e.text[0] not in ("/", "#", "@", "!"): message = e.text counter = int(message[6:8]) spam_message = str(e.text[8:]) await wait( [e.respond(spam_message) for i in range(counter)] ) await e.delete() if LOGGER: await e.client.send_message( LOGGER_GROUP, "#SPAM \n\n" "Spam was executed successfully" ) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">25.527778</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">79</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.557127</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">xditya/PikaBotPlugins</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">plugins/spam.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">919</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8773"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># stdlib import json from typing import List from typing import NoReturn from typing import Optional # third party from fastapi import APIRouter from fastapi import Depends from fastapi import File from fastapi import Form from fastapi import UploadFile from loguru import logger from starlette import status from starlette.exceptions import HTTPException # grid absolute from grid.api.dependencies.current_user import get_current_user from grid.api.users.models import ApplicantStatus from grid.api.users.models import User from grid.api.users.models import UserCandidate from grid.api.users.models import UserCreate from grid.api.users.models import UserPrivate from grid.api.users.models import UserUpdate # relative from . import syft as syft_user_messages def raise_generic_private_error() -> NoReturn: raise HTTPException( status_code=status.HTTP_500_INTERNAL_SERVER_ERROR, detail="There was an error processing your request.", ) router = APIRouter() @router.get("/me", response_model=User, name="users:me", status_code=status.HTTP_200_OK) def get_self(current_user: UserPrivate = Depends(get_current_user)) -> User: return current_user # TODO: Syft should return the newly created user and the response model should be User. @router.post("", name="users:create", status_code=status.HTTP_201_CREATED) async def create_user_grid( current_user: UserPrivate = Depends(get_current_user), new_user: str = Form(...), file: Optional[UploadFile] = File(None), ) -> str: if file: pdf_file = file.file.read() # type: ignore else: pdf_file = b"" dict_user = json.loads(new_user) dict_user["daa_pdf"] = pdf_file user_schema = UserCreate(**dict_user) try: return syft_user_messages.create_user(user_schema, current_user) except Exception as err: logger.error(err) raise_generic_private_error() @router.get("/applicants", name="users:applicants", status_code=status.HTTP_201_CREATED) async def get_all_candidates( current_user: UserPrivate = Depends(get_current_user), ) -> List[UserCandidate]: try: return syft_user_messages.get_user_requests(current_user) except Exception as err: logger.error(err) raise_generic_private_error() @router.patch( "/applicants/{candidate_id}", name="users:applicants:process", status_code=status.HTTP_201_CREATED, ) async def process_applicant_request( candidate_id: int, request_status: ApplicantStatus, current_user: UserPrivate = Depends(get_current_user), ) -> str: try: return syft_user_messages.process_applicant_request( current_user=current_user, candidate_id=candidate_id, status=request_status.status, ) except Exception as err: logger.error(err) raise_generic_private_error() @router.get( "", response_model=List[User], name="users:read_all", status_code=status.HTTP_200_OK, ) async def get_all_users_grid( current_user: UserPrivate = Depends(get_current_user), ) -> List[User]: try: return syft_user_messages.get_all_users(current_user) except Exception as err: logger.error(err) raise_generic_private_error() @router.get( "/{user_id}", response_model=User, name="users:read_one", status_code=status.HTTP_200_OK, ) async def get_user_grid( user_id: int, current_user: UserPrivate = Depends(get_current_user) ) -> User: try: return syft_user_messages.get_user(user_id, current_user) except Exception as err: logger.error(err) raise_generic_private_error() @router.patch( "/{user_id}", name="users:update", status_code=status.HTTP_204_NO_CONTENT, ) async def update_user_grid( user_id: int, updated_user: UserUpdate, current_user: UserPrivate = Depends(get_current_user), ) -> None: try: syft_user_messages.update_user(user_id, current_user, updated_user) except Exception as err: logger.error(err) raise_generic_private_error() @router.delete( "/{user_id}", name="users:delete", status_code=status.HTTP_204_NO_CONTENT ) async def delete_user_grid( user_id: int, current_user: UserPrivate = Depends(get_current_user) ) -> None: try: syft_user_messages.delete_user(user_id, current_user) except Exception as err: logger.error(err) raise_generic_private_error() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">28.069182</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">88</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.725745</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">BearerPipelineTest/PySyft</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">packages/grid/backend/grid/api/users/routes.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">4,463</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8774"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># Configuration file for the Sphinx documentation builder. # # This file only contains a selection of the most common options. For a full # list see the documentation: # https://www.sphinx-doc.org/en/master/usage/configuration.html # -- Path setup -------------------------------------------------------------- # If extensions (or modules to document with autodoc) are in another directory, # add these directories to sys.path here. If the directory is relative to the # documentation root, use os.path.abspath to make it absolute, like shown here. # import os import sys sys.path.insert(0, os.path.abspath('../../../yara_scanner')) # -- Project information ----------------------------------------------------- project = 'yara-scanner' copyright = '2020, John Davison' author = 'John Davison' # The full version, including alpha/beta/rc tags release = '1.0.14' # -- General configuration --------------------------------------------------- # Add any Sphinx extension module names here, as strings. They can be # extensions coming with Sphinx (named 'sphinx.ext.*') or your custom # ones. extensions = [ 'sphinx.ext.autodoc', 'sphinx.ext.intersphinx' ] # Add any paths that contain templates here, relative to this directory. templates_path = ['_templates'] # List of patterns, relative to source directory, that match files and # directories to ignore when looking for source files. # This pattern also affects html_static_path and html_extra_path. exclude_patterns = [] # -- Options for HTML output ------------------------------------------------- # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. # html_theme = 'alabaster' # Add any paths that contain custom static files (such as style sheets) here, # relative to this directory. They are copied after the builtin static files, # so a file named "default.css" will overwrite the builtin "default.css". html_static_path = ['_static'] intersphinx_mapping = {'python': ('https://docs.python.org/3', None)} # Both the class’ and the __init__ method’s docstring are concatenated and inserted. autoclass_content = 'both' autodoc_inherit_docstrings = False </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">33.630769</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">84</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.674291</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">2d4d/yara_scanner</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">docs/source/conf.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">2,190</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8775"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import json import os import numpy as np import tensorflow.compat.v1 as tf import argparse from tqdm import tqdm import model from encode_bpe import BPEEncoder_ja if int(tf.__version__[0]) > 1: from model import HParams as HParams else: from tensorflow.contrib.training import HParams parser = argparse.ArgumentParser() parser.add_argument('--model', type=str, default='gpt2ja-medium') parser.add_argument('--context', type=str, required=True) parser.add_argument('--gpu', type=str, default='0') args = parser.parse_args() with open('ja-bpe.txt', encoding='utf-8') as f: bpe = f.read().split('\n') with open('emoji.json', encoding='utf-8') as f: emoji = json.loads(f.read()) enc = BPEEncoder_ja(bpe, emoji) n_vocab = len(enc) if os.path.isfile(args.model+'/hparams.json'): with open(args.model+'/hparams.json', encoding='utf-8') as f: params = json.loads(f.read()) hparams = HParams(**params) elif 'small' in args.model: hparams = HParams(**{ "n_vocab": n_vocab, "n_ctx": 1024, "n_embd": 768, "n_head": 12, "n_layer": 12 }) elif 'medium' in args.model: hparams = HParams(**{ "n_vocab": n_vocab, "n_ctx": 1024, "n_embd": 1024, "n_head": 16, "n_layer": 24 }) elif 'large' in args.model: hparams = HParams(**{ "n_vocab": n_vocab, "n_ctx": 1024, "n_embd": 1280, "n_head": 20, "n_layer": 36 }) else: raise ValueError('invalid model name.') config = tf.ConfigProto() if int(args.gpu) >= 0: config.gpu_options.allow_growth = True config.gpu_options.visible_device_list = args.gpu with tf.Session(config=config,graph=tf.Graph()) as sess: context = tf.placeholder(tf.int32, [1, None]) output = model.model(hparams=hparams, X=context, past=None, reuse=tf.AUTO_REUSE) saver = tf.train.Saver() ckpt = tf.train.latest_checkpoint(args.model) saver.restore(sess, ckpt) context_tokens = enc.encode(args.context) out = sess.run(output, feed_dict={ context: [context_tokens] }) output = out['h_flat'][-1] print(output.tolist()) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">26.949367</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">84</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.648661</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">july-language/gpt2-japanese</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">gpt2-transform.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">2,129</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8776"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from pathlib import Path from datetime import datetime, timedelta from src.settings import envs from airflow import DAG from airflow.models import Variable from airflow.operators.python_operator import PythonOperator from airflow.utils.dates import days_ago from airflow.hooks.postgres_hook import PostgresHook import logging from src.settings import log_config import shutil # Setting up module from __file__ as the interpreter sets __name__ as __main__ when the source file is executed as # main program logger = logging.getLogger(name=__file__.replace(envs.PROJECT_ROOT, '').replace('/', '.')[1:-3]) # these args will get passed on to each operator # you can override them on a per-task basis during operator initialization default_args = { 'owner': 'airflow', 'depends_on_past': False, 'start_date': days_ago(7), 'email': ['<a href="/cdn-cgi/l/email-protection" class="__cf_email__" data-cfemail="dcbdb5aebab0b3ab9cbdb5aebab0b3abf2bfb3b1">[email protected]</a>'], 'email_on_failure': False, 'email_on_retry': False, 'retries': 0, 'retry_delay': timedelta(minutes=5), 'catchup': False } DAG_ID = '{p.parent.name}_{p.stem}'.format(p=Path(__file__)) PARAMS = Variable.get(DAG_ID, deserialize_json=True) SCHEDULE_INTERVAL = PARAMS.get('schedule_interval') or None DAYS_TO_RETAIN = PARAMS.get('days_to_retain', 60) TABLES = ("xcom", "task_instance", "sla_miss", "log", "dag_run", "task_fail", "task_reschedule") LOG_DIR = '/usr/local/airflow/logs' dag = DAG( DAG_ID, default_args=default_args, description='BT Bill Clean Up DAGs Metadata and Logs', schedule_interval=SCHEDULE_INTERVAL, max_active_runs=1 ) def clean_dags_logs(): hook = PostgresHook(postgres_conn_id="airflow_postgres") dag_files = Path(Path(__file__).parent).glob('*.py') dags = ['{p.parent.name}_{p.stem}'.format(p=p) for p in dag_files] dags = [d for d in dags if d != DAG_ID] execution_date = datetime.date(datetime.now()) - timedelta(days=DAYS_TO_RETAIN) p = Path(LOG_DIR) for d in dags: logger.info("Cleaning up meta tables for {}".format(d)) for t in TABLES: sql = "delete from {} where dag_id='{}' and execution_date < '{}'".format(t, d, execution_date) hook.run(sql, True) logger.info('Cleaning up log folder for {}'.format(d)) for path in list(p.glob('{}/*/*'.format(d))): log_date = str(path).split('/')[-1] log_date = log_date.split('T')[0] log_date = datetime.date(datetime.strptime(log_date, '%Y-%m-%d')) if log_date < execution_date: logger.info('Deleting dir {}'.format(str(path.absolute()))) shutil.rmtree(str(path.absolute())) clean_up = PythonOperator( task_id='clean_up', python_callable=clean_dags_logs, dag=dag) dag >> clean_up </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">36.052632</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">114</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.685766</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Mahe1980/btb</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">src/airflow_dags/dags/btb/house_keeping.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">2,740</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8777"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from abc import ABC from asyncio import Lock as AsyncLock from collections import ChainMap, OrderedDict from dataclasses import dataclass, field from datetime import timedelta from functools import partial, wraps from hashlib import sha256 import inspect from pathlib import Path import pickle from sqlite3 import connect, Connection from textwrap import dedent from time import time from threading import Lock as SyncLock from typing import Any, Callable, Hashable, Mapping, Optional, Tuple, Type, Union from weakref import finalize, WeakSet Decoratee = Union[Callable, Type] Keygen = Callable[..., Any] class Pickler(ABC): @staticmethod def dumps(_str: str) -> str: ... # pragma: no cover @staticmethod def loads(_bytes: bytes) -> Any: ... # pragma: no cover class _MemoZeroValue: pass @dataclass class _MemoReturnState: called: bool = False raised: bool = False value: Any = _MemoZeroValue @dataclass(frozen=True) class _MemoBase: t0: Optional[float] memo_return_state: _MemoReturnState = field(init=False, default_factory=_MemoReturnState) @dataclass(frozen=True) class _AsyncMemo(_MemoBase): async_lock: AsyncLock = field(init=False, default_factory=lambda: AsyncLock()) @dataclass(frozen=True) class _SyncMemo(_MemoBase): sync_lock: SyncLock = field(init=False, default_factory=lambda: SyncLock()) _Memo = Union[_AsyncMemo, _SyncMemo] @dataclass(frozen=True) class _MemoizeBase: db: Optional[Connection] default_kwargs: Mapping[str, Any] duration: Optional[timedelta] fn: Callable keygen: Optional[Keygen] pickler: Pickler = field(hash=False) size: Optional[int] expire_order: OrderedDict = field(init=False, default_factory=OrderedDict, hash=False) memos: OrderedDict = field(init=False, default_factory=OrderedDict, hash=False) def __post_init__(self) -> None: if self.db is not None: self.db.isolation_level = None self.db.execute(dedent(f''' CREATE TABLE IF NOT EXISTS `{self.table_name}` ( k TEXT PRIMARY KEY, t0 FLOAT, t FLOAT, v TEXT NOT NULL ) ''')) if self.duration: self.db.execute(dedent(f''' DELETE FROM `{self.table_name}` WHERE t0 < {time() - self.duration.total_seconds()} ''')) if self.size: res = self.db.execute( f"SELECT t FROM `{self.table_name}` ORDER BY t DESC LIMIT {self.size}" ).fetchall() if res: (min_t,) = res[-1] self.db.execute(f"DELETE FROM `{self.table_name}` WHERE t < {min_t}") for k, t0, t, v in self.db.execute( f"SELECT k, t0, t, v FROM `{self.table_name}` ORDER BY t" ).fetchall(): memo = self.make_memo(t0=t0) memo.memo_return_state.called = True memo.memo_return_state.value = self.pickler.loads(v) self.memos[k] = memo if self.duration: for k, t0 in self.db.execute( f"SELECT k, t0 FROM `{self.table_name}` ORDER BY t0" ).fetchall(): self.expire_order[k] = ... def __len__(self) -> int: return len(self.memos) @property def table_name(self) -> str: # noinspection PyUnresolvedReferences return ( f'{self.fn.__code__.co_filename}' f':{self.fn.__code__.co_name}' f':{self.fn.__code__.co_firstlineno}' ) def bind_key_lifetime(self, raw_key: Tuple[Any, ...], key: Union[int, str]) -> None: for raw_key_part in raw_key: if (raw_key_part is not None) and (type(raw_key_part).__hash__ is object.__hash__): finalize(raw_key_part, self.reset_key, key) def default_keygen(self, *args, **kwargs) -> Tuple[Hashable, ...]: """Returns all params (args, kwargs, and missing default kwargs) for function as kwargs.""" return tuple(self.get_args_as_kwargs(*args, **kwargs).values()) def get_args_as_kwargs(self, *args, **kwargs) -> Mapping[str, Any]: args_as_kwargs = {} for k, v in zip(self.default_kwargs, args): args_as_kwargs[k] = v return ChainMap(args_as_kwargs, kwargs, self.default_kwargs) def get_memo(self, key: Union[int, str], insert: bool) -> Optional[_Memo]: try: memo = self.memos[key] = self.memos.pop(key) if self.duration is not None and memo.t0 < time() - self.duration.total_seconds(): self.expire_order.pop(key) raise ValueError('value expired') except (KeyError, ValueError): if not insert: return None elif self.duration is None: t0 = None else: t0 = time() # The value has no significance. We're using the dict entirely for ordering keys. self.expire_order[key] = ... memo = self.memos[key] = self.make_memo(t0=t0) return memo def expire_one_memo(self) -> None: k = None if ( (self.expire_order is not None) and (len(self.expire_order) > 0) and ( self.memos[next(iter(self.expire_order))].t0 < time() - self.duration.total_seconds() ) ): (k, _) = self.expire_order.popitem(last=False) self.memos.pop(k) elif self.size is not None and self.size < len(self.memos): (k, _) = self.memos.popitem(last=False) if (self.db is not None) and (k is not None): self.db.execute(f"DELETE FROM `{self.table_name}` WHERE k = '{k}'") def finalize_memo(self, memo: _Memo, key: Union[int, str]) -> Any: if memo.memo_return_state.raised: raise memo.memo_return_state.value elif (self.db is not None) and (self.memos[key] is memo): value = self.pickler.dumps(memo.memo_return_state.value) self.db.execute( dedent(f''' INSERT OR REPLACE INTO `{self.table_name}` (k, t0, t, v) VALUES (?, ?, ?, ?) '''), ( key, memo.t0, time(), value ) ) return memo.memo_return_state.value def get_key(self, raw_key: Tuple[Hashable, ...]) -> Union[int, str]: if self.db is None: key = hash(raw_key) else: key = sha256(str(raw_key).encode()).hexdigest() return key @staticmethod def make_memo(t0: Optional[float]) -> _Memo: # pragma: no cover raise NotImplemented def reset(self) -> None: object.__setattr__(self, 'expire_order', OrderedDict()) object.__setattr__(self, 'memos', OrderedDict()) if self.db is not None: self.db.execute(f"DELETE FROM `{self.table_name}`") def reset_key(self, key: Union[int, str]) -> None: if key in self.memos: self.memos.pop(key) if self.duration is not None: self.expire_order.pop(key) if self.db is not None: self.db.execute(f"DELETE FROM `{self.table_name}` WHERE k == '{key}'") @dataclass(frozen=True) class _AsyncMemoize(_MemoizeBase): async def get_raw_key(self, *args, **kwargs) -> Tuple[Hashable, ...]: if self.keygen is None: raw_key = self.default_keygen(*args, **kwargs) else: raw_key = self.keygen(**self.get_args_as_kwargs(*args, **kwargs)) if isinstance(raw_key, tuple): raw_key = list(raw_key) else: raw_key = [raw_key] for i, v in enumerate(raw_key): if inspect.isawaitable(v): raw_key[i] = await v raw_key = tuple(raw_key) return raw_key def get_behavior(self, *, insert: bool, update: bool) -> Callable: def get_call(*, fn: Callable) -> Callable: @wraps(self.fn) async def call(*args, **kwargs) -> Any: raw_key = await self.get_raw_key(*args, **kwargs) key = self.get_key(raw_key) memo: _AsyncMemo = self.get_memo(key, insert=insert) if memo is None: return await fn(*args, **kwargs) self.expire_one_memo() async with memo.async_lock: if ( (insert and not memo.memo_return_state.called) or (update and memo.memo_return_state.value is not _MemoZeroValue) ): memo.memo_return_state.called = True try: memo.memo_return_state.value = await fn(*args, **kwargs) except Exception as e: memo.memo_return_state.raised = True memo.memo_return_state.value = e self.bind_key_lifetime(raw_key, key) return self.finalize_memo(memo=memo, key=key) return call return get_call async def insert(self, *args, **kwargs) -> Any: return await self.get_behavior(insert=True, update=False)(fn=self.fn)(*args, **kwargs) def update(self, *args, **kwargs) -> Callable: async def to(value: Any) -> Any: async def fn(*_args, **_kwargs) -> Any: return value return await self.get_behavior(insert=False, update=True)(fn=fn)(*args, **kwargs) return to def upsert(self, *args, **kwargs) -> Callable: async def to(value: Any) -> Any: async def fn(*_args, **_kwargs) -> Any: return value return await self.get_behavior(insert=True, update=True)(fn=fn)(*args, **kwargs) return to async def remove(self, *args, **kwargs) -> None: raw_key = await self.get_raw_key(*args, **kwargs) key = self.get_key(raw_key) self.reset_key(key) def get_decorator(self) -> Callable: async def decorator(*args, **kwargs) -> Any: return await self.insert(*args, **kwargs) decorator.memoize = self return decorator @staticmethod def make_memo(t0: Optional[float]) -> _AsyncMemo: return _AsyncMemo(t0=t0) @dataclass(frozen=True) class _SyncMemoize(_MemoizeBase): _sync_lock: SyncLock = field(init=False, default_factory=lambda: SyncLock()) def get_raw_key(self, *args, **kwargs) -> Tuple[Hashable, ...]: if self.keygen is None: raw_key = self.default_keygen(*args, **kwargs) else: raw_key = self.keygen(**self.get_args_as_kwargs(*args, **kwargs)) if not isinstance(raw_key, tuple): raw_key = [raw_key] raw_key = tuple(raw_key) return raw_key def get_behavior(self, *, insert: bool, update: bool) -> Callable: def get_call(*, fn: Callable) -> Callable: @wraps(self.fn) def call(*args, **kwargs) -> Any: raw_key = self.get_raw_key(*args, **kwargs) key = self.get_key(raw_key) with self._sync_lock: memo: _SyncMemo = self.get_memo(key, insert=insert) if memo is None: return fn(*args, **kwargs) self.expire_one_memo() with memo.sync_lock: if ( (insert and not memo.memo_return_state.called) or (update and memo.memo_return_state.value is not _MemoZeroValue) ): memo.memo_return_state.called = True try: memo.memo_return_state.value = fn(*args, **kwargs) except Exception as e: memo.memo_return_state.raised = True memo.memo_return_state.value = e self.bind_key_lifetime(raw_key, key) return self.finalize_memo(memo=memo, key=key) return call return get_call def insert(self, *args, **kwargs) -> Any: return self.get_behavior(insert=True, update=False)(fn=self.fn)(*args, **kwargs) def update(self, *args, **kwargs) -> Callable: def to(value: Any) -> Any: def fn(*_args, **_kwargs) -> Any: return value return self.get_behavior(insert=False, update=True)(fn=fn)(*args, **kwargs) return to def upsert(self, *args, **kwargs) -> Callable: def to(value: Any) -> Any: def fn(*_args, **_kwargs) -> Any: return value return self.get_behavior(insert=True, update=True)(fn=fn)(*args, **kwargs) return to def remove(self, *args, **kwargs) -> None: raw_key = self.get_raw_key(*args, **kwargs) key = self.get_key(raw_key) self.reset_key(key) def get_decorator(self) -> Callable: def decorator(*args, **kwargs) -> Any: return self.insert(*args, **kwargs) decorator.memoize = self return decorator @staticmethod def make_memo(t0: Optional[float]) -> _SyncMemo: return _SyncMemo(t0=t0) def reset(self) -> None: with self._sync_lock: super().reset() def reset_key(self, key: Union[int, str]) -> None: with self._sync_lock: super().reset_key(key) class _Memoize: """Decorates a function call and caches return value for given inputs. - If `db_path` is provided, memos will persist on disk and reloaded during initialization. - If `duration` is provided, memos will only be valid for given `duration`. - If `keygen` is provided, memo hash keys will be created with given `keygen`. - If `pickler` is provided, persistent memos will (de)serialize using given `pickler`. - If `size` is provided, LRU memo will be evicted if current count exceeds given `size`. ### Examples - Body will run once for unique input `bar` and result is cached. ```python3 @memoize def foo(bar) -> Any: ... foo(1) # Function actually called. Result cached. foo(1) # Function not called. Cached result returned. foo(2) # Function actually called. Result cached. ``` - Same as above, but async. ```python3 @memoize async def foo(bar) -> Any: ... # Concurrent calls from the same event loop are safe. Only one call is generated. The # other nine calls in this example wait for the result. await asyncio.gather(*[foo(1) for _ in range(10)]) ``` - Classes may be memoized. ```python3 @memoize Class Foo: def init(self, _): ... Foo(1) # Instance is actually created. Foo(1) # Instance not created. Cached instance returned. Foo(2) # Instance is actually created. ``` - Calls `foo(1)`, `foo(bar=1)`, and `foo(1, baz='baz')` are equivalent and only cached once. ```python3 @memoize def foo(bar, baz='baz'): ... ``` - Only 2 items are cached. Acts as an LRU. ```python3 @memoize(size=2) def foo(bar) -> Any: ... foo(1) # LRU cache order [foo(1)] foo(2) # LRU cache order [foo(1), foo(2)] foo(1) # LRU cache order [foo(2), foo(1)] foo(3) # LRU cache order [foo(1), foo(3)], foo(2) is evicted to keep cache size at 2 ``` - Items are evicted after 1 minute. ```python3 @memoize(duration=datetime.timedelta(minutes=1)) def foo(bar) -> Any: ... foo(1) # Function actually called. Result cached. foo(1) # Function not called. Cached result returned. sleep(61) foo(1) # Function actually called. Cached result was too old. ``` - Memoize can be explicitly reset through the function's `.memoize` attribute ```python3 @memoize def foo(bar) -> Any: ... foo(1) # Function actually called. Result cached. foo(1) # Function not called. Cached result returned. foo.memoize.reset() foo(1) # Function actually called. Cache was emptied. ``` - Current cache length can be accessed through the function's `.memoize` attribute ```python3 @memoize def foo(bar) -> Any: ... foo(1) foo(2) len(foo.memoize) # returns 2 ``` - Alternate memo hash function can be specified. The inputs must match the function's. ```python3 Class Foo: @memoize(keygen=lambda self, a, b, c: (a, b, c)) # Omit 'self' from hash key. def bar(self, a, b, c) -> Any: ... a, b = Foo(), Foo() # Hash key will be (a, b, c) a.bar(1, 2, 3) # LRU cache order [Foo.bar(a, 1, 2, 3)] # Hash key will again be (a, b, c) # Be aware, in this example the returned result comes from a.bar(...), not b.bar(...). b.bar(1, 2, 3) # Function not called. Cached result returned. ``` - If part of the returned key from keygen is awaitable, it will be awaited. ```python3 async def awaitable_key_part() -> Hashable: ... @memoize(keygen=lambda bar: (bar, awaitable_key_part())) async def foo(bar) -> Any: ... ``` - If the memoized function is async and any part of the key is awaitable, it is awaited. ```python3 async def morph_a(a: int) -> int: ... @memoize(keygen=lambda a, b, c: (morph_a(a), b, c)) def foo(a, b, c) -> Any: ... ``` - Properties can be memoized. ```python3 Class Foo: @property @memoize def bar(self) -> Any: ... a = Foo() a.bar # Function actually called. Result cached. a.bar # Function not called. Cached result returned. b = Foo() # Memoize uses 'self' parameter in hash. 'b' does not share returns with 'a' b.bar # Function actually called. Result cached. b.bar # Function not called. Cached result returned. ``` - Be careful with eviction on instance methods. Memoize is not instance-specific. ```python3 Class Foo: @memoize(size=1) def bar(self, baz) -> Any: ... a, b = Foo(), Foo() a.bar(1) # LRU cache order [Foo.bar(a, 1)] b.bar(1) # LRU cache order [Foo.bar(b, 1)], Foo.bar(a, 1) is evicted a.bar(1) # Foo.bar(a, 1) is actually called and cached again. ``` - Values can persist to disk and be reloaded when memoize is initialized again. ```python3 @memoize(db_path=Path.home() / '.memoize') def foo(a) -> Any: ... foo(1) # Function actually called. Result cached. # Process is restarted. Upon restart, the state of the memoize decorator is reloaded. foo(1) # Function not called. Cached result returned. ``` - If not applied to a function, calling the decorator returns a partial application. ```python3 memoize_db = memoize(db_path=Path.home() / '.memoize') @memoize_db(size=1) def foo(a) -> Any: ... @memoize_db(duration=datetime.timedelta(hours=1)) def bar(b) -> Any: ... ``` - Comparison equality does not affect memoize. Only hash equality matters. ```python3 # Inherits object.__hash__ class Foo: # Don't be fooled. memoize only cares about the hash. def __eq__(self, other: Foo) -> bool: return True @memoize def bar(foo: Foo) -> Any: ... foo0, foo1 = Foo(), Foo() assert foo0 == foo1 bar(foo0) # Function called. Result cached. bar(foo1) # Function called again, despite equality, due to different hash. ``` ### A warning about arguments that inherit `object.__hash__`: It doesn't make sense to keep a memo if it's impossible to generate the same input again. Inputs that inherit the default `object.__hash__` are unique based on their id, and thus, their location in memory. If such inputs are garbage-collected, they are gone forever. For that reason, when those inputs are garbage collected, `memoize` will drop memos created using those inputs. - Memo lifetime is bound to the lifetime of any arguments that inherit `object.__hash__`. ```python3 # Inherits object.__hash__ class Foo: ... @memoize def bar(foo: Foo) -> Any: ... bar(Foo()) # Memo is immediately deleted since Foo() is garbage collected. foo = Foo() bar(foo) # Memo isn't deleted until foo is deleted. del foo # Memo is deleted at the same time as foo. ``` - Types that have specific, consistent hash functions (int, str, etc.) won't cause problems. ```python3 @memoize def foo(a: int, b: str, c: Tuple[int, ...], d: range) -> Any: ... foo(1, 'bar', (1, 2, 3), range(42)) # Function called. Result cached. foo(1, 'bar', (1, 2, 3), range(42)) # Function not called. Cached result returned. ``` - Classmethods rely on classes, which inherit from `object.__hash__`. However, classes are almost never garbage collected until a process exits so memoize will work as expected. ```python3 class Foo: @classmethod @memoize def bar(cls) -> Any: ... foo = Foo() foo.bar() # Function called. Result cached. foo.bar() # Function not called. Cached result returned. del foo # Memo not cleared since lifetime is bound to class Foo. foo = Foo() foo.bar() # Function not called. Cached result returned. foo.bar() # Function not called. Cached result returned. ``` - Long-lasting object instances that inherit from `object.__hash__`. ```python3 class Foo: @memoize def bar(self) -> Any: ... foo = Foo() foo.bar() # Function called. Result cached. # foo instance is kept around somewhere and used later. foo.bar() # Function not called. Cached result returned. ``` - Custom pickler may be specified for unpickleable return types. ```python3 import dill @memoize(db_path='~/.memoize`, pickler=dill) def foo() -> Callable[[], None]: return lambda: None ``` """ _all_decorators = WeakSet() @staticmethod def __call__( _decoratee: Optional[Decoratee] = None, *, db_path: Optional[Path] = None, duration: Optional[Union[int, float, timedelta]] = None, keygen: Optional[Keygen] = None, pickler: Optional[Pickler] = None, size: Optional[int] = None, ) -> Union[Decoratee]: if _decoratee is None: return partial(memoize, db_path=db_path, duration=duration, keygen=keygen, pickler=pickler, size=size) if inspect.isclass(_decoratee): assert db_path is None, 'Class memoization not allowed with db.' class WrappedMeta(type(_decoratee)): # noinspection PyMethodParameters @memoize(duration=duration, size=size) def __call__(cls, *args, **kwargs): return super().__call__(*args, **kwargs) class Wrapped(_decoratee, metaclass=WrappedMeta): pass return type(_decoratee.__name__, (Wrapped,), {'__doc__': _decoratee.__doc__}) db = connect(f'{db_path}') if db_path is not None else None duration = timedelta(seconds=duration) if isinstance(duration, (int, float)) else duration assert (duration is None) or (duration.total_seconds() > 0) pickler = pickle if pickler is None else pickler assert (size is None) or (size > 0) fn = _decoratee default_kwargs: Mapping[str, Any] = { k: v.default for k, v in inspect.signature(fn).parameters.items() } if inspect.iscoroutinefunction(_decoratee): decorator_cls = _AsyncMemoize else: decorator_cls = _SyncMemoize # noinspection PyArgumentList decorator = decorator_cls( db=db, default_kwargs=default_kwargs, duration=duration, fn=fn, keygen=keygen, pickler=pickler, size=size, ).get_decorator() _Memoize._all_decorators.add(decorator) return wraps(_decoratee)(decorator) @staticmethod def reset_all() -> None: for decorator in _Memoize._all_decorators: decorator.memoize.reset() memoize = _Memoize() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">33.545455</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">114</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.564393</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">cevans87/atools</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">atools/_memoize_decorator.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">25,461</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8778"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import os import math import logging from pyaxe import config as config_util from pyaxe.axeerror import aXeError # make sure there is a logger _log = logging.getLogger(__name__) class ConfigList: """Configuration File Object""" def __init__(self, keylist, header=None): """ Initializes the ConfigList object by tranfsforming a list of keywords into a structured list including beams descriptions keylist: list List of configuration keys header: str the header string """ # beam indices which might be found the file idents = ['A', 'B', 'C', 'D', 'E', 'F', 'G', 'H', 'I', 'J', 'K', 'L', 'M', 'N', 'O', 'P', 'Q'] # create the (visible) dictionary self.beams = {} # create the hidden beam list self._beams = [] # store the header self.header = header # load the general required keywords self.gkeys = self._find_gkeys(keylist) # try to load beams as long as there # are keywords and as long as there # are candidate beam numbers iindex = 0 while (len(keylist) > 0 and iindex < len(idents)): try: # try to load a beam self._beams.append(ConfigBeam(idents[iindex], keylist)) self.beams[idents[iindex]] = self._beams[iindex] except BeamNotFound: # no information on this beam is in the file pass # enhance the counter iindex += 1 # inform about the useless keywords if len(keylist) > 0: _log.info('\nDispensable Keywords: ') for key in keylist: _log.info(key) def __str__(self): """String method for the class The method transforms the configuration file object into its string representation. Returns ------- a string representation of the object """ # take the string of the header rstring = str(self.header) + '\n' # add the strings for the global keys for key in self.gkeys: rstring += str(key) for beam in self._beams: rstring += str(beam) # return the total string return rstring def __delitem__(self, item): # find the index of the requested item index = self._find_gkey(item) # check whether the item was found if index > -1: del self.gkeys[index] def __getitem__(self, item): # find the index of the requested item index = self._find_gkey(item) # check whether the item was found if index > -1: # return the identified item return self.gkeys[index].keyvalue else: if item in self.beams.keys(): return self.beams[item] else: # return NULL return None def _find_gkey(self, item): # set the default return value found = -1 # go over all items for index in range(len(self.gkeys)): # check whether it is the right item if self.gkeys[index].keyword == item: # set the return value to the index found = index # return the result return found def _load_file(self, filename): """Configuration file --> keyword list The method load a configuration file and extract all valid keyword-keyvalue-comment information from it. The keyword-keyvalue pairs are organized and returned as a list of configuration key objects. @param filename: name of the configuration file @type filename: String @return: list of ConfKey's @rtype: [ConfKey] """ # initialize the liust keylist = [] # open the file and parse through it fopen = open(filename, 'r') for line in fopen: # strip the line str_line = line.strip() # check whether the line contains a keyword if len(str_line) and str_line[0] != '#': # create and append the keyword keylist.append(self._key_from_line(str_line)) # close the file fopen.close() # return the list return keylist def _get_gkey_index(self, keyword): """Retrieve the index of a global keyword The method searches for the index of a requested keyword in the list of global keywords. If the keyword does not exists, the index -1 is returned Parameters ---------- keyword: str name of the requested keyword Returns ------- index: int the index of the keyword """ # initialize the return value kindex = -1 # go over all keys for index in range(len(self.gkeys)): # check whether the current key matches if self.gkeys[index].keyword == keyword: # return it if it matches return index # return the default return kindex def _key_from_line(self, line): """Creates a keyword from a line The method extracts the konfiguration keyword, the associated value and, if present, a comment from a line in the configuration file. A configuration key object representing the extracted keyword is created and returned. Parameters ---------- line: list line to analyze Returns ------- configuration key object """ # split the line into items items = line.split() # for more than one item the # first item is the keyword if len(items) > 1: keyword = items[0].strip() # check for a comment cpos = line.rfind(';') if cpos < 0: # evaluate the keyvalue keyvalue = line[line.find(keyword)+len(keyword):].strip() comment = None else: # evalute keyvalue and comment tmp_val = line[line.find(keyword)+len(keyword):].strip() keyvalue = tmp_val.split(';')[0].strip() comment = tmp_val.split(';')[1].strip() else: # something's wrong here err_msg = 'Only one item in: ' + line + ' !' raise aXeError(err_msg) # create and return the keyword return ConfKey(keyword, keyvalue, comment) def _find_gkeys(self, keylist): """Finds and extracts the global keywords The method finds the all predefined global keywords in a keyword list. The list of global keywords is returned. Their counterparts in the input keyword list are deleted. Parameters ---------- keylist: list list of keywords Returns ------- keys: list global keywords """ gkeywords = ['INSTRUMENT', 'CAMERA', 'TELAREA', 'SCIENCE_EXT', 'ERRORS_EXT', 'DQ_EXT', 'OPTKEY1', 'OPTVAL1', 'FFNAME', 'DQMASK', 'DRZRESOLA', 'DRZSCALE', 'DRZLAMB0', 'DRZXINI', 'DRZROOT', 'EXPTIME', 'WEIGHT_EXT', 'DRZPFRAC', 'DRZPSCALE', 'DRZKERNEL', 'MODEL_EXT', 'VARIANCE_EXT', 'RDNOISE', 'PSFCOEFFS', 'PSFRANGE', 'IPIXFUNCTION', 'POBJSIZE', 'SMFACTOR'] # initialize the global keylist # and the list with indices to be deleted gkeys = [] dindex = [] # go over the keylist read in, # keeping and index variable iindex = 0 for key in keylist: # identify the current keyword in the # list of possible ones if key.keyword in gkeywords: # store the index dindex.append(iindex) # create and append the new keyword gkeys.append(ConfKey(key.keyword, key.keyvalue, key.comment)) iindex += 1 # delete the input keywords which # have been 'used' dindex.sort() dindex.reverse() for index in dindex: del keylist[index] # return the list of global keys return gkeys def _check_gfiles(self): """Checks whether all files exist The method checks whether the files whose names are within the class data do exist or not. An error is reported in case that the files do not exist. """ # list of the root of all # global keys indicating a file fkeys = ['FFNAME'] # go over all file keywords for key in fkeys: # identify the keyword in the list index = self._get_gkey_index(key) # check for existence if index > -1: # extract the keyvalue kvalue = self.gkeys[index].keyvalue # if the keyvalue is NOT None but the file does not exist if ((kvalue.upper() is not 'NONE') and (not os.path.isfile(config_util.getCONF(kvalue)))): # report an error err_msg = ("The file: {0:s} does not exist!" .format(config_util.getCONF(kvalue))) raise aXeError(err_msg) def get_gkey(self, keyword): """Retrieve a requested global keyword The method searches the list of global keywords for a fitting keyword. In case that the requested keyword exists, it is returned. If not 'None' is returned Parameters ---------- keyword: str name of the requested keyword Returns ------- key: str or None the requested keyword or 'None' """ # initialize the return value rkey = None # search for the index in the keyword list index = self._get_gkey_index(keyword) # check whether the keyword exists if index > -1: # return the keyword return self.gkeys[index] else: # return the default return rkey def add_gkey(self, keyword, keyvalue, comment=None): """Add global keyword The method adds a keyword to the list of global keywords. In case that the keyword just exists, it is overwritten, otherwise it is appended to the global keyword list. Parameters ---------- keyword: str name of the requested keyword keyvalue: any value of the requested keyword comment: str comment for the keyword """ # search for the index in the keyword list index = self._get_gkey_index(keyword) if index > -1: # if it matches, copy the data self.gkeys[index].keyvalue = keyvalue self.gkeys[index].comment = comment else: # the keyword does not yet exist, just create and add it self.gkeys.append(ConfKey(keyword, keyvalue, comment)) # def drizzle_check(self): # """Check for drizzle keywords # The method assures that all necessary drizzle keywords # are present. Nonexisting keywords are added with default # values. Finally the value for the drizzle kernel is checked # against all valid values. # Returns # ------- # bool: True if the drizzle kernel is valid # """ # # list with all valid kernels # kernels = ['square', 'point', 'turbo', 'gaussian', 'tophat', # 'lanczos2', 'lanczos3'] # # make sure that some important drizzle keywords are there # pself = self.setdefault('DRZPSCALE', 1.0) # pfrac = self.setdefault('DRZPFRAC', 1.0) # dkernel = self.setdefault('DRZKERNEL', 'square') # droot = self.setdefault('DRZROOT', 'aXedrizzle') # # check for valid drizzle kernel # if dkernel not in kernels: # return False # return True # def setdefault(self, keyword, keyvalue, comment=None): # """Add global keyword # The method mimics the setdefault method for dictionary # objects. A keyword is added with the given value and # comment, but only in case that it does not yet exist. # If it exists, nothing is done # Parameters # ---------- # keyword: str # name of the requested keyword # keyvalue: any # value of the requested keyword # comment: str # comment for the keyword # Returns # ------- # The keyword value # """ # # search for the index in the keyword list # index = self._get_gkey_index(keyword) # if index < 0: # # the keyword does not yet exist, just create and add it # self.gkeys.append(ConfKey(keyword, keyvalue, comment)) # # extract the keyvalue # value = self.gkeys[-1].keyvalue # else: # # extract the keyvalue # value = self.gkeys[index].keyvalue # # return the keyvalue # return value def get_gvalue(self, keyword): """Retrieve a requested global keyword value The method returns the value of the keyword which matches the requested value. If there is no matching keyword, 'None' is returned. Parameters ---------- keyword: str name of the requested keyword Returns ------- The keyword value """ # set the default return value rvalue = None # search for the keyword key = self.get_gkey(keyword) # check whether it is non-NULL if key: # extract the value rvalue = key.keyvalue # return the value return rvalue def writeto(self, filename): """Save the object to a file The method saves the object to a file with name specified in the input. Parameters ---------- filename: str name of the file """ # destroy the old file if os.path.isfile(filename): os.unlink(filename) # open the new file ofile = open(filename, 'w') # write the string to the file ofile.write(str(self)) # close the file ofile.close() def flush(self): """Save the object back to file The method saves the object back to a file with the identical filename it was read from. """ # just use the more general method self.writeto(self.filename) def check_files(self, check_glob=True): """Checks whether all files exist The method checks whether the files whose names are within the class data do exist or not. An error is reported in case that the files do not exist. """ n_sens = 0 # check global files if desired if check_glob: self._check_gfiles() # create the (visible) dictionary for bkey in self.beams.keys(): n_sens += self.beams[bkey].check_files() # return the number # of existing sensitivity files return n_sens class ConfigFile(ConfigList): """Configuration File Object""" def __init__(self, filename=None): """ Initializes the ConfigFile object either by reading in a configuration file or by creating a default configuration file Parameters ---------- filename: str name of the configuration file """ _log.info(f"Initializing configfile with {filename}") # check if a filename is given if filename is None: # load the default _log.info('No file given, can do nothing!!') else: # safe the file name self.filename = filename # create a keyword list keylist = self._load_file(filename) # load the header header = ConfHeader(filename) super(ConfigFile, self).__init__(keylist, header) def _get_simul_name(self): """Get the filename used in aXeSIM""" # just add '.simul' and return the result return self.filename + '.simul' def confirm_extrkeys(self): """Confirm that all keywords for the extraction exist""" # default is true! extr_ready = 1 # check existence of 'POBJSIZE' if self['POBJSIZE'] is None: extr_ready = 0 # check for reasonable value elif float(self['POBJSIZE']) < 0.0: extr_ready = 0 # check existence of 'SMFACTOR' if self['SMFACTOR'] is None: extr_ready = 0 # check for reasonable value elif float(self['SMFACTOR']) < 0.0: extr_ready = 0 # return the value return extr_ready def confirm_lambda_psf(self): """Check whether a 'lambda_psf' value is needed, provide one""" # check whether 'lambda_psf' is needed if ((self['PSFCOEFFS'] is not None) and (self['PSFRANGE'] is not None)): # split the term psf_range = self['PSFRANGE'].split() # extract the defined range as float lambda_min = float(psf_range[0]) lambda_max = float(psf_range[1]) # make 'lambda_psf' to the mean value lambda_psf = 0.5 * (lambda_max + lambda_min) else: # leave it at None lambda_psf = None # return the value return lambda_psf def axesim_prep(self): """Removes modifies some keywords""" # derive the new configuration file name new_name = self._get_simul_name() # check whether the science extension has other # than the allowed values if self['SCIENCE_EXT'] != 'SCI' and self['SCIENCE_EXT'] != '2': # find the index of the sceicne extension index = self._find_gkey('SCIENCE_EXT') # check whether the item was found if index > -1: # set it to the allowed value self.gkeys[index].keyvalue = 'SCI' # check whether the telesocpe are is known if self['TELAREA'] is None: # set the telescope are to the # Hubble default self.add_gkey('TELAREA', 45238.93) index = 1 while self['OPTKEY'+str(index)] is not None: del self['OPTKEY'+str(index)] del self['OPTVAL'+str(index)] index += 1 # just make sure that # the error=- and dq- # extensions are set self.add_gkey('ERRORS_EXT', 'ERR') self.add_gkey('DQ_EXT', 'DQ') # write the file back self.writeto(new_name) # return the baseic filename of the # simulation configuration file return os.path.basename(new_name) class ConfigBeam: """Configuration Beam object""" def __init__(self, ident=None, keylist=None): """ A configuration beam object is intialized. This is done by either extracting the relevant keywords for a certain beam from a keyword list or creating a default beam. Parameters ---------- ident: char beam identification keylist: list list of keywords """ # check if a filename is given if ident is None or keylist is None: # load the default _log.info('No ID or no keywords given, can do nothing!!') else: # try to load the beam keywords try: # store the ident self.ident = ident # load the general beam keywords self.beamkeys = self._find_beamkeys(ident, keylist) # load the trace keywords self.trace = ConfigTrace(ident, keylist) # load the dispersion keywords self.disp = ConfigDisp(ident, keylist) # catch a pure CKeyNotFound exception # which is raised if a beam is competely # absent in the keyword list except CKeyNotFound: raise BeamNotFound(ident) def __str__(self): """String method for the class The method transforms theconfiguration beam object into its string representation. """ # initialize the return string rstring = ("\n#-----------\n#\n# Beam {0:s}:\n#\n#-----------\n" .format(str(self.ident))) # add the strings for the global keys for key in self.beamkeys: rstring += str(key) # add the string for the trace rstring += str(self.trace) # add the string for the dispersion # solution rstring += str(self.disp) # return the total string return rstring def __getitem__(self, item): full_item = item + self.ident rvalue = self.get_bvalue(full_item) return rvalue def __setitem__(self, item, value): full_item = item + self.ident index = self._get_bkey_index(full_item) if index > -1: self.beamkeys[index].keyvalue = value def _find_beamkeys(self, ident, keylist): """Load the global beam keywords The method extracts all global beam keywords from a keyword list. The extracted keywords are returned as a list. They are removed from the input list. Parameters ---------- ident: char beam identification keylist: list list of keywords """ # list of the root of all globale # beamword keys bkeys = ['BEAM', 'MMAG_EXTRACT_', 'MMAG_MARK_', 'XOFF_', 'YOFF_', 'SENSITIVITY_'] # list of optional keywords okeys = ['PSF_OFFSET_'] # appen the beam identifier to the # keyword roots to get a list of keywords # to search for id_keys = [] for key in bkeys: id_keys.append(key + ident) # initiate and fill # collect a list of optional keywords opt_keys = [] for key in okeys: opt_keys.append(key + ident) # here is some kind of extra # keyword # ekey = 'DLD1P_' + ident + '_PRANGE' opt_keys.append('DLD1P_' + ident + '_PRANGE') # initialize the global keylist # and the list with indices to be deleted bkeys = [] dindex = [] # go over the keylist read in, # keeping and index variable iindex = 0 nfound = 0 for key in keylist: # identify the current keyword in the # list of possible ones if key.keyword in id_keys: # store the index dindex.append(iindex) # create and append the new keyword bkeys.append(ConfKey(key.keyword, key.keyvalue, key.comment)) # enhance the nuber of keywords found nfound += 1 elif key.keyword in opt_keys: # store the index dindex.append(iindex) # create and append the new keyword bkeys.append(ConfKey(key.keyword, key.keyvalue, key.comment)) # enhance the index iindex += 1 # check whether all keywords were found if nfound < len(id_keys): # raise an exeption if not raise CKeyNotFound('general') # delete the input keywords which # have been 'used' dindex.sort() dindex.reverse() for iindex in dindex: del keylist[iindex] # return the list of global keys return bkeys def _get_bkey_index(self, keyword): """Retrieve the index of a beam keyword The method searches for the index of a requested keyword in the list of beam keywords. If the keyword does not exists, the index -1 is returned Parameters ---------- keyword: str name of the requested keyword Returns ------- index: int the index of the keyword """ # initialize the return value bindex = -1 # go over all keys for index in range(len(self.beamkeys)): # check whether the current key matches if self.beamkeys[index].keyword == keyword: # return it if it matches return index # return the default return bindex def get_bkey(self, keyword): """Retrieve a requested beam keyword The method searches the list of beam keywords for a fitting keyword. In case that the requested keyword exists, it is returned. If not 'None' is returned Parameters ---------- keyword: str name of the requested keyword Returns ------- key: str or None the requested keyword or 'None' """ # initialize the return value rkey = None # search for the index in the keyword list index = self._get_bkey_index(keyword) # ckeck whehter the keyword exists if index > -1: # return the keyword return self.beamkeys[index] else: # return the default return rkey def get_bvalue(self, keyword): """Retrieve a requested beam-keyword value The method returns the value of the keyword which matches the requested value. If there is no matching keyword, 'None' is returned. Parameters ---------- keyword: str name of the requested keyword Returns ------- key: str or None the requested keyword or 'None' """ # set the default return value rvalue = None # search for the keyword key = self.get_bkey(keyword) # check whether it is non-NULL if key: # extract the value rvalue = key.keyvalue # return the value return rvalue def check_files(self): """Checks whether all files exist The method checks whether the files whose names are within the class data do exist or not. An error is reported in case that the files do not exist. """ n_sens = 0 # list of the root of all # beamword keys indicating a file fkeys = ['SENSITIVITY_'] # append the beam identifier to the # keyword roots to get the full keyname for key in fkeys: full_keyword = key + self.ident # go over all beam keys for bkey in self.beamkeys: # check whether the current keyword is right # and whether the keyvalue is not 'None' if ((bkey.keyword is full_keyword) and (bkey.keyvalue.upper() is not 'NONE')): # check for the file if not os.path.isfile(config_util.getCONF(bkey.keyvalue)): # report an error err_msg = ("The file: {0:s} does not exist!" .format(config_util.getCONF(bkey.keyvalue))) raise aXeError(err_msg) else: n_sens += 1 return n_sens class TwoDimPolyN: """Object for a polynomial with 2D variance""" def __str__(self): """The method transforms the 2D polynomial object into its str representation. Returns ------- object: str string representation of the object """ # initialize the return string rstring = str(self.norder) for key in self.twodkeys: rstring += str(key) # return the total string return rstring def __getitem__(self, index): """Getindex method for the class The operator method which is called when an index is requested on a class instace test = kkk[0] Parameters ---------- index: int the index to address Returns ------- key : ConfListKey the indexed object """ # check whether the index exists if index > len(self.twodkeys)-1: # raise an exception err_msg = "Index: {0:s} does not exist!".format(str(index)) raise aXeError(err_msg) # return the indexed object return self.twodkeys[index] def __setitem__(self, index, obj): """Setindex method for the class The operator method which is called when the index of a class instance is set to a value. kkk[0] = test Parameters ---------- index: int the index to address obj: ConfListKey description of the object content """ # check whether the index exists if (index > (len(self.twodkeys))-1): # raise an exception err_msg = 'Index ' + str(index) + ' does not exist!' raise aXeError(err_msg) # check whether the input type is correct elif (not isinstance(type(self[0]), obj)): # raise an exception err_msg = ("Object: {0:s} has wrong type: {1:s}!" .format(str(obj), str(type(obj)))) raise aXeError(err_msg) # set the index to the input object self.twodkeys[index] = obj def _find_order(self, prefix, ident, keylist): """Find the keyword with the polynomial order The method finds and extracts the keyword indicating the polynomial degree from a keyword list. The keyword is returned. Parameters ---------- prefix: str keyword prefix ident: char beam identification keylist: list list of keywords Returns ------- keyword: str keyword with number of orders """ # create the name of the keyword with the # polynomial order order_key = prefix + 'ORDER_' + ident # extract and return the keyword from the # keyword list return self._find_key(order_key, keylist) def _find_twodkeys(self, prefix, ident, keylist): """Find the all 2D polynomial keywords Given a prefix and a beam identifier the method extracts all orders of the 2D polynomial which describes the trace or dispersion. The number of orders expected is taken from the object data. Parameters ---------- prefix: str keyword prefix ident: char beam identification keylist: list list of keywords Returns ------- keys: list list of keywords """ # initialize an empty list twodkeys = [] # for each expected keyword for ii in range(int(self.norder.keyvalue)+1): # form the keyword name twodkey = prefix + ident + '_' + str(ii) # extract the new keyword newkey = self._find_key(twodkey, keylist, 1) if self._check_twodkey(newkey): # extract the keyword and append it to the list twodkeys.append(newkey) else: raise CKeyLengthWrong(ident, twodkey) # return the list return twodkeys def _find_key(self, keyword, keylist, lkey=0): """Extract a certain keyword from the list The methods searches for a particular keyword in a keyword list. If found, the keyword is copied and destroied in the input list. If not found, an exception is fired. Parameters ---------- keyword: str the keyword name keylist: list list of keywords Returns ------- keyword: str the extracted keyword """ # initialize the index iindex = 0 # set indicator to "not found" found = -1 # go over all keys in the list for key in keylist: # checke whether the keyword is the desired one if key.keyword == keyword: # create a list keyword if desired if lkey: nkey = ConfListKey(key.keyword, key.keyvalue, key.comment) else: nkey = ConfKey(key.keyword, key.keyvalue, key.comment) # store the index found = iindex # enhance the index iindex += 1 # fire an exception if nothing was found if found < 0: raise CKeyNotFound(keyword) # delete the keyword from the inlist else: del keylist[found] # return the keyword return nkey def _check_twodkey(self, inkey): """Check the length of the a field dependent keyword Field dependent keywords such as the polynimial coefficients in the trace description and dispersion solution must have a certain number of values, which is: n = m^2/2 + m/2 The method checks whether the number of values is in agreement with this. @param inkey: the keyword name @type inkey: ConfListKey @return: 1/0 @rtype: int """ # determine the length of the list n = float(len(inkey.kvallist)) # compute the 'order' of the xy-dependence m = (-1.0 + math.sqrt(1.0+8.0*n))/2.0 # chech whether the 'order' is integer if math.fabs(m-int(m)) > 1.0e-16: # no integer -> key length wrong return 0 # integer -> key length correct return 1 def str_header(self, description): """Create a header string The method offers to the subclasses the possibility to have a meaningful string header before the actual data string. Parameters ---------- @param description: description of the object content @type description: string @return: the header string @rtype: string """ # pre-decoration rstring = '\n#\n# ' # add description rstring += description # add post-decoration rstring += ':\n#\n' # return the result return rstring class ConfigTrace(TwoDimPolyN): """Configuration Beam object""" def __init__(self, ident=None, keylist=None): """The method initializes a configuration beam object for a given beam identifier. All necessary keywords are extracted from an input keyword list. In case of missing keywords an exception is fired. Parameters ---------- ident: char beam identification keylist: list list of keywords """ # try to read in the keywords try: self.ident = ident self.norder = self._find_order('DYDX_', ident, keylist) self.twodkeys = self._find_twodkeys('DYDX_', ident, keylist) # raise an exception if keywords are missing except CKeyNotFound as e: raise TraceNotFound(ident, e.keyword) except CKeyLengthWrong as e: _log.info('Field dependent keyword: ' + e.keyword) def __str__(self): """Returns string representation of the object""" # create the label or description description = 'Trace description for Beam ' + str(self.ident) # get the string header rstring = super(ConfigTrace, self).str_header(description) # get the data string rstring += super(ConfigTrace, self).__str__() # return the result return rstring class ConfigDisp(TwoDimPolyN): """Configuration Beam object""" def __init__(self, ident=None, keylist=None): """The method initializes a configuration dispersion object for a given beam identifier. All necessary keywords are extracted from an input keyword list. In case of missing keywords an exception is fired. Parameters ---------- ident: char beam identification keylist: list list of keywords """ # try to read in the keywords try: self.ident = ident self.norder = self._find_order('DISP_', ident, keylist) self.twodkeys = self._find_twodkeys('DLDP_', ident, keylist) # raise an exception if keywords are missing except CKeyNotFound as e: try: self.twodkeys = self._find_twodkeys('DLD1P_', ident, keylist) # raise an exception if keywords are missing except CKeyNotFound as e: raise DispNotFound(ident, e.keyword) except CKeyLengthWrong as e: _log.info('\nField dependent keyword: {0:s} has wrong length!' .format(e.keyword)) raise DispNotFound(ident, e.keyword) except CKeyLengthWrong as e: _log.info('\nField dependent keyword: {0:s} has wrong length!' .format(e.keyword)) raise DispNotFound(ident, e.keyword) def __str__(self): """return string representation of the object""" # create the label or description description = 'Dispersion solution for Beam ' + str(self.ident) # get the string header rstring = super(ConfigDisp, self).str_header(description) # get the data string rstring += super(ConfigDisp, self).__str__() # return the result return rstring class DefConfHeader: """Default header for a configuration file""" def __init__(self): self.header = [] self.header.append("#-----------------------------------------------" "------------\n# Default configuration file for aXe" "\n#\n#-------------------------------------------" "---------------") def __str__(self): """returns string representation of the object""" rstring = '' for line in self.header: rstring += line return rstring class ConfHeader(DefConfHeader): """Header class for the configuration file""" def __init__(self, filename=None): """Initializes the configuration header class The method extracts the header from a configuration file. If no filename is provided, a default header is created. Parameters ---------- filename: str name of the configuration file """ # no filename -> default header if filename is None: super(ConfHeader, self).__init__() else: # initialize the data list self.header = [] # intialize the start pointer start = 1 # open and parse through the file fopen = open(filename, 'r') for line in fopen: # check whether the start pointer is still set if start: # strip the line str_line = line.strip() # check whether the first character # is a comment, which qualifies # the line as part of the header if ((len(str_line) > 0) and (str_line[0] is '#')): # append the line to the header data self.header.append(line.strip()+'\n') else: # set the starter pointer to 0, # thus indicating the end of the header start = 0 # close the file fopen.close class ConfKey: """Class for a keyword in a configuration file This keyword class is a light, but yet versatile and important class to strore a keyword entry in a configuration file. All important values are directly read from the object attributes. """ def __init__(self, keyword, keyvalue, comment=None): """Constructor for the keyword class The keyword instance is created using all input values. Parameter --------- keyword: str the keword name keyvalue: str the keyword value comment: str the keyword comment """ self.keyword = keyword self.keyvalue = keyvalue self.comment = comment def __str__(self): """String method for the class The method creats and returns the string representation of the keyword. Returns ------- obj: str string representation of the object """ rstring = self.keyword + ' ' + str(self.keyvalue) if self.comment is not None: rstring = rstring + ' ; ' + self.comment rstring += '\n' return rstring class ConfListKey(ConfKey): """Class for a keyword list The keyword list class is a subclass derived from the keyword class. In the keyword list class has as an additional attribute the keyvalues transformed to a list of floats. """ def __init__(self, keyword, keyvalue, comment=None): """Constructor for the keyword list class Initializer for the keyword list class. The keyword instance is created using all input values. Parameters ---------- keyword: str the keword name keyvalue: str the keyword values comment: str the keyword comment """ # initialize the keyvalue list self.kvallist = [] # create a traditional keyword instance super(ConfListKey, self).__init__(keyword, keyvalue, comment) # split the string keyvalue vlist = self.keyvalue.split() for value in vlist: # append the floats to the list self.kvallist.append(float(value)) def __getitem__(self, index): """Getindex method for the class The operator method which is called when an index is requested on a class instace test = kkk[0] Parameters ---------- index: int the index to address Returns ------- obj: float the indexed object """ # check whether the index exists if index > len(self.kvallist)-1: # raise an exception err_msg = 'Index: ' + str(index) + ' does not exist!' raise aXeError(err_msg) # return the indexed object return self.kvallist[index] def __setitem__(self, index, obj): """Setindex method for the class The operator method which is called when the index of a class instance is set to a value. kkk[0] = test Parameters ---------- index: int the index to address obj: list description of the object content """ # check whether the index exists if index > len(self.kvallist)-1: # raise an exception err_msg = 'Index ' + str(index) + ' does not exist!' raise aXeError(err_msg) # check whether the input type is correct elif not (isinstance(type(self[0]), obj)): # raise an exception err_msg = ("Object: {0:s} has wrong type: {1:s}!" .format(str(obj), str(type(obj)))) raise aXeError(err_msg) # set the index to the input object self.kvallist[index] = obj def __str__(self): """returns the string representation of the keyword.""" # first comes the keyword rstring = self.keyword # append the keyvalues using a default format for value in self.kvallist: rstring = rstring + ' %12.6g' % value # append the comment if self.comment is not None: rstring = rstring + ' ; ' + self.comment # append a linefeed rstring += '\n' # return the complete string return rstring class ConfError(Exception): """Base class for exceptions in this module""" pass class CKeyNotFound(ConfError): """Error for missing keyword""" def __init__(self, keyword): self.keyword = keyword class BeamNotFound(ConfError): """Error for unknown beam """ def __init__(self, ident): self.ident = ident class TraceNotFound(ConfError): """Error for unknown trace""" def __init__(self, ident, keyword=None): self.ident = ident self.keyword = keyword class DispNotFound(ConfError): """Error for unknown dispersion""" def __init__(self, ident, keyword=None): self.ident = ident self.keyword = keyword class CKeyLengthWrong(ConfError): """Error for wrong lengt in KeywordList""" def __init__(self, ident, keyword=None): self.ident = ident self.keyword = keyword </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">29.098618</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">79</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.548343</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "BSD-3-Clause" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">sosey/pyaxe</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">pyaxe/axesrc/configfile.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">46,325</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8779"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># from imports import * # import random # class Docs(commands.Cog): # def __init__(self, bot): # self.bot = bot # self.bot.loop.create_task(self.__ainit__()) # async def __ainit__(self): # await self.bot.wait_until_ready() # self.scraper = AsyncScraper(session = self.bot.session) # async def rtfm_lookup(self, program = None, *, args = None): # rtfm_dictionary = { # "fusion.py": "https://fusion.senarc.org/en/master/", # "development" : "https://fusion.senarc.org/en/development/" # } # if not args: # return rtfm_dictionary.get(program) # else: # url = rtfm_dictionary.get(program) # results = await self.scraper.search(args, page=url) # if not results: # return f"Could not find anything with {args}." # else: # return results # def reference(self, message): # reference = message.reference # if reference and isinstance(reference.resolved, discord.Message): # return reference.resolved.to_reference() # return None # async def rtfm_send(self, ctx, results): # if isinstance(results, str): # await ctx.send(results, allowed_mentions = discord.AllowedMentions.none()) # else: # embed = discord.Embed(color = random.randint(0, 16777215)) # results = results[:10] # embed.description = "\n".join(f"[`{result}`]({value})" for result, value in results) # reference = self.reference(ctx.message) # await ctx.send(embed=embed, reference = reference) # @commands.group(slash_interaction=True, aliases=["rtd", "rtfs"], brief="Search for attributes from docs.") # async def rtfm(self, ctx, *, args = None): # await ctx.trigger_typing() # results = await self.rtfm_lookup(program = "fusion.py", args = args) # await self.rtfm_send(ctx, results) # @rtfm.command(slash_interaction=True, brief = "a command using doc_search to look up at development's docs") # async def development(self, ctx, *, args = None): # await ctx.trigger_typing() # results = await self.rtfm_lookup(program="development", args = args) # await self.rtfm_send(ctx, results) # def setup(bot): # bot.add_cog(Docs(bot)) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">30.082192</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">112</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.651184</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">BenitzCoding/Utility-Bot</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">cogs/docs.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">2,196</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8780"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import typer from typing import Optional from article_ripper import get_document, html_to_md app = typer.Typer() @app.command() def fun(url: str, out: Optional[str] = None) -> None: doc = get_document(url) doc_summary = doc.summary() if out is None: print(doc_summary) else: with open(out, "w") as f: f.write(doc_summary) def run() -> None: app() if __name__ == "__main__": run() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">17.56</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">53</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.624146</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">nozwock/article-ripper</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">src/article_ripper/cli.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">439</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8781"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from django.conf.urls import url, include import binder.router # noqa import binder.websocket # noqa import binder.views # noqa import binder.history # noqa import binder.models # noqa import binder.plugins.token_auth.views # noqa from binder.plugins.views.multi_request import multi_request_view from .views import animal, caretaker, costume, custom, zoo, contact_person, gate # noqa router = binder.router.Router().register(binder.views.ModelView) room_controller = binder.websocket.RoomController().register(binder.views.ModelView) urlpatterns = [ url(r'^custom/route', custom.custom, name='custom'), # url(r'^user/$', custom.user, name='user'), url(r'^multi/$', multi_request_view, name='multi_request'), url(r'^', include(router.urls)), url(r'^', binder.views.api_catchall, name='catchall'), ] # FIXME: Hmm, this is a bit hackish. Especially here. But where else? binder.models.install_history_signal_handlers(binder.models.BinderModel) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">38.04</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">87</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.768665</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">BBooijLiewes/django-binder</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">tests/testapp/urls.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">951</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8782"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from .brand import BrandDataset, Brand from .vehicle_id import VehicleIDDataset from .comp_cars import CompCarsDataset # from .veri import VeriDataset from .box_cars import BoxCars116kDataset # from .vric import VRICDataset from .cars196 import Cars196Dataset</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">37</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">40</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.84556</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">piyengar/vehicle-predictor</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">experiments/brand/dataset/__init__.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">259</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8783"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">"""Certbot constants.""" import os import logging from acme import challenges SETUPTOOLS_PLUGINS_ENTRY_POINT = "certbot.plugins" """Setuptools entry point group name for plugins.""" OLD_SETUPTOOLS_PLUGINS_ENTRY_POINT = "letsencrypt.plugins" """Plugins Setuptools entry point before rename.""" CLI_DEFAULTS = dict( config_files=[ "/etc/letsencrypt/cli.ini", # http://freedesktop.org/wiki/Software/xdg-user-dirs/ os.path.join(os.environ.get("XDG_CONFIG_HOME", "~/.config"), "letsencrypt", "cli.ini"), ], dry_run=False, verbose_count=-int(logging.INFO / 10), server="https://acme-v01.api.letsencrypt.org/directory", rsa_key_size=2048, rollback_checkpoints=1, config_dir="/etc/letsencrypt", work_dir="/var/lib/letsencrypt", logs_dir="/var/log/letsencrypt", no_verify_ssl=False, http01_port=challenges.HTTP01Response.PORT, http01_address="", tls_sni_01_port=challenges.TLSSNI01Response.PORT, tls_sni_01_address="", auth_cert_path="./cert.pem", auth_chain_path="./chain.pem", strict_permissions=False, debug_challenges=False, ) STAGING_URI = "https://acme-staging.api.letsencrypt.org/directory" # The set of reasons for revoking a certificate is defined in RFC 5280 in # section 5.3.1. The reasons that users are allowed to submit are restricted to # those accepted by the ACME server implementation. They are listed in # `letsencrypt.boulder.revocation.reasons.go`. REVOCATION_REASONS = { "unspecified": 0, "keycompromise": 1, "affiliationchanged": 3, "superseded": 4, "cessationofoperation": 5} """Defaults for CLI flags and `.IConfig` attributes.""" QUIET_LOGGING_LEVEL = logging.WARNING """Logging level to use in quiet mode.""" RENEWER_DEFAULTS = dict( renewer_enabled="yes", renew_before_expiry="30 days", # This value should ensure that there is never a deployment delay by # default. deploy_before_expiry="99 years", ) """Defaults for renewer script.""" ENHANCEMENTS = ["redirect", "http-header", "ocsp-stapling", "spdy"] """List of possible :class:`certbot.interfaces.IInstaller` enhancements. List of expected options parameters: - redirect: None - http-header: TODO - ocsp-stapling: certificate chain file path - spdy: TODO """ ARCHIVE_DIR = "archive" """Archive directory, relative to `IConfig.config_dir`.""" CONFIG_DIRS_MODE = 0o755 """Directory mode for ``.IConfig.config_dir`` et al.""" ACCOUNTS_DIR = "accounts" """Directory where all accounts are saved.""" BACKUP_DIR = "backups" """Directory (relative to `IConfig.work_dir`) where backups are kept.""" CSR_DIR = "csr" """See `.IConfig.csr_dir`.""" IN_PROGRESS_DIR = "IN_PROGRESS" """Directory used before a permanent checkpoint is finalized (relative to `IConfig.work_dir`).""" KEY_DIR = "keys" """Directory (relative to `IConfig.config_dir`) where keys are saved.""" LIVE_DIR = "live" """Live directory, relative to `IConfig.config_dir`.""" TEMP_CHECKPOINT_DIR = "temp_checkpoint" """Temporary checkpoint directory (relative to `IConfig.work_dir`).""" RENEWAL_CONFIGS_DIR = "renewal" """Renewal configs directory, relative to `IConfig.config_dir`.""" FORCE_INTERACTIVE_FLAG = "--force-interactive" """Flag to disable TTY checking in IDisplay.""" EFF_SUBSCRIBE_URI = "https://supporters.eff.org/subscribe/certbot" """EFF URI used to submit the e-mail address of users who opt-in.""" </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">29.594828</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">79</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.718905</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Randagio13/certbot</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">certbot/constants.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">3,433</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8784"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># Copyright 2021 Canonical Ltd. # See LICENSE file for licensing details. from pathlib import Path from subprocess import check_output from time import sleep import pytest import yaml from selenium import webdriver from selenium.common.exceptions import JavascriptException, WebDriverException from selenium.webdriver.firefox.options import Options from selenium.webdriver.support.ui import WebDriverWait METADATA = yaml.safe_load(Path("./metadata.yaml").read_text()) @pytest.mark.abort_on_fail async def test_build_and_deploy(ops_test): my_charm = await ops_test.build_charm(".") image_path = METADATA["resources"]["oci-image"]["upstream-source"] await ops_test.model.deploy(my_charm, resources={"oci-image": image_path}) charm_name = METADATA["name"] await ops_test.model.wait_for_idle( [charm_name], raise_on_blocked=True, raise_on_error=True, timeout=300, ) assert ops_test.model.applications[charm_name].units[0].workload_status == "waiting" assert ( ops_test.model.applications[charm_name].units[0].workload_status_message == "Waiting for kubeflow-profiles relation data" ) @pytest.mark.abort_on_fail async def test_add_profile_relation(ops_test): charm_name = METADATA["name"] # TODO: Point kubeflow-profiles to latest/stable when Rev 54 or higher are promoted await ops_test.model.deploy("kubeflow-profiles", channel="latest/edge") await ops_test.model.add_relation("kubeflow-profiles", charm_name) await ops_test.model.wait_for_idle( ["kubeflow-profiles", charm_name], status="active", raise_on_blocked=True, raise_on_error=True, timeout=300, ) async def test_status(ops_test): charm_name = METADATA["name"] assert ops_test.model.applications[charm_name].units[0].workload_status == "active" def fix_queryselector(elems): """Workaround for web components breaking querySelector. Because someone thought it was a good idea to just yeet the moral equivalent of iframes everywhere over a single page 🤦 Shadow DOM was a terrible idea and everyone involved should feel professionally ashamed of themselves. Every problem it tried to solved could and should have been solved in better ways that don't break the DOM. """ selectors = '").shadowRoot.querySelector("'.join(elems) return 'return document.querySelector("' + selectors + '")' @pytest.fixture() async def driver(request, ops_test): status = yaml.safe_load( check_output( ["juju", "status", "-m", ops_test.model_full_name, "--format=yaml"] ) ) endpoint = status["applications"]["kubeflow-dashboard"]["address"] application = ops_test.model.applications["kubeflow-dashboard"] config = await application.get_config() port = config["port"]["value"] url = f"http://{endpoint}.nip.io:{port}/" options = Options() options.headless = True with webdriver.Firefox(options=options) as driver: wait = WebDriverWait(driver, 180, 1, (JavascriptException, StopIteration)) for _ in range(60): try: driver.get(url) break except WebDriverException: sleep(5) else: driver.get(url) yield driver, wait, url driver.get_screenshot_as_file(f"/tmp/selenium-{request.node.name}.png") def test_links(driver): driver, wait, url = driver # Ensure that sidebar links are set up properly links = [ "/jupyter/", "/katib/", "/pipeline/#/experiments", "/pipeline/#/pipelines", "/pipeline/#/runs", "/pipeline/#/recurringruns", # Removed temporarily until https://warthogs.atlassian.net/browse/KF-175 is fixed # "/pipeline/#/artifacts", # "/pipeline/#/executions", "/volumes/", "/tensorboards/", ] for link in links: print("Looking for link: %s" % link) script = fix_queryselector(["main-page", f"iframe-link[href='{link}']"]) wait.until(lambda x: x.execute_script(script)) # Ensure that quick links are set up properly links = [ "/pipeline/", "/pipeline/#/runs", "/jupyter/new?namespace=kubeflow", "/katib/", ] for link in links: print("Looking for link: %s" % link) script = fix_queryselector( [ "main-page", "dashboard-view", f"iframe-link[href='{link}']", ] ) wait.until(lambda x: x.execute_script(script)) # Ensure that doc links are set up properly links = [ "https://charmed-kubeflow.io/docs/kubeflow-basics", "https://microk8s.io/docs/addon-kubeflow", "https://www.kubeflow.org/docs/started/requirements/", ] for link in links: print("Looking for link: %s" % link) script = fix_queryselector( [ "main-page", "dashboard-view", f"a[href='{link}']", ] ) wait.until(lambda x: x.execute_script(script)) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">31.357576</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">89</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.63993</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">VariableDeclared/kubeflow-dashboard-operator</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">tests/integration/test_charm.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">5,177</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8785"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># Copyright (c) 2017 Sofia Ira Ktena <<a href="/cdn-cgi/l/email-protection" class="__cf_email__" data-cfemail="78110a1956130c1d1619381115081d0a11191456191b560d13">[email protected]</a>> # # Permission is hereby granted, free of charge, to any person obtaining a copy # of this software and associated documentation files (the "Software"), to deal # in the Software without restriction, including without limitation the rights # to use, copy, modify, merge, publish, distribute, sublicense, and/or sell # copies of the Software, and to permit persons to whom the Software is # furnished to do so, subject to the following conditions: # # The above copyright notice and this permission notice shall be included in all # copies or substantial portions of the Software. import os import csv import numpy as np import scipy.io as sio from sklearn.covariance import GraphLassoCV import nilearn from nilearn import connectome # Output path save_path = '/vol/dhcp-hcp-data/ABIDE' # Number of subjects num_subjects = 1000 # Selected pipeline pipeline = 'cpac' # Files to fetch derivatives = ['rois_ho'] # Get the root folder root_folder = os.path.join(save_path, 'ABIDE_pcp/cpac/filt_noglobal') def get_ids(num_subjects=None, short=True): """ num_subjects : number of subject IDs to get short : True of False, specifies whether to get short or long subject IDs return: subject_IDs : list of subject IDs (length num_subjects) """ if short: subject_IDs = np.loadtxt(os.path.join(root_folder, 'subject_IDs.txt'), dtype=int) subject_IDs = subject_IDs.astype(str) else: subject_IDs = np.loadtxt(os.path.join(root_folder, 'full_IDs.txt'), dtype=str) if num_subjects is not None: subject_IDs = subject_IDs[:num_subjects] return subject_IDs def fetch_filenames(subject_list, file_type): """ subject_list : list of short subject IDs in string format file_type : must be one of the available file types returns: filenames : list of filetypes (same length as subject_list) """ # Specify file mappings for the possible file types filemapping = {'func_preproc': '_func_preproc.nii.gz', 'rois_aal': '_rois_aal.1D', 'rois_cc200': '_rois_cc200.1D', 'rois_ho': '_rois_ho.1D'} # The list to be filled filenames = [] # Load subject ID lists subject_IDs = get_ids(short=True) subject_IDs = subject_IDs.tolist() full_IDs = get_ids(short=False) # Fill list with requested file paths for s in subject_list: try: if file_type in filemapping: idx = subject_IDs.index(s) pattern = full_IDs[idx] + filemapping[file_type] else: pattern = s + file_type filenames.append(os.path.join(root_folder, s, pattern)) except ValueError: # Return N/A if subject ID is not found filenames.append('N/A') return filenames def fetch_subject_files(subjectID): """ subjectID : short subject ID for which list of available files are fetched returns: onlyfiles : list of absolute paths for available subject files """ # Load subject ID lists subject_IDs = get_ids(short=True) subject_IDs = subject_IDs.tolist() full_IDs = get_ids(short=False) try: idx = subject_IDs.index(subjectID) subject_folder = os.path.join(root_folder, subjectID) onlyfiles = [os.path.join(subject_folder, f) for f in os.listdir(subject_folder) if os.path.isfile(os.path.join(subject_folder, f))] except ValueError: onlyfiles = [] return onlyfiles def fetch_conn_matrices(subject_list, atlas_name, kind): """ subject_list : list of short subject IDs in string format atlas_name : the atlas based on which the timeseries are generated e.g. aal, cc200 kind : the kind of correlation used to estimate the matrices, i.e. returns: connectivity : list of square connectivity matrices, one for each subject in subject_list """ conn_files = fetch_filenames(subject_list, '_' + atlas_name + '_' + kind.replace(' ', '_') + '.mat') conn_matrices = [] for fl in conn_files: print("Reading connectivity file %s" % fl) try: mat = sio.loadmat(fl)['connectivity'] conn_matrices.append(mat) except IOError: print("File %s does not exist" % fl) return conn_matrices def get_timeseries(subject_list, atlas_name): """ subject_list : list of short subject IDs in string format atlas_name : the atlas based on which the timeseries are generated e.g. aal, cc200 returns: ts : list of timeseries arrays, each of shape (timepoints x regions) """ ts_files = fetch_filenames(subject_list, 'rois_' + atlas_name) ts = [] for fl in ts_files: print("Reading timeseries file %s" % fl) ts.append(np.loadtxt(fl, skiprows=0)) return ts def norm_timeseries(ts_list): """ ts_list : list of timeseries arrays, each of shape (timepoints x regions) returns: norm_ts : list of normalised timeseries arrays, same shape as ts_list """ norm_ts = [] for ts in ts_list: norm_ts.append(nilearn.signal.clean(ts, detrend=False)) return norm_ts def subject_connectivity(timeseries, subject, atlas_name, kind, save=True, save_path=root_folder): """ timeseries : timeseries table for subject (timepoints x regions) subject : the subject short ID atlas_name : name of the atlas used kind : the kind of connectivity to be used, e.g. lasso, partial correlation, correlation save : save the connectivity matrix to a file save_path : specify path to save the matrix if different from subject folder returns: connectivity : connectivity matrix (regions x regions) """ print("Estimating %s matrix for subject %s" % (kind, subject)) if kind == 'lasso': # Graph Lasso estimator covariance_estimator = GraphLassoCV(verbose=1) covariance_estimator.fit(timeseries) connectivity = covariance_estimator.covariance_ print('Covariance matrix has shape {0}.'.format(connectivity.shape)) elif kind in ['tangent', 'partial correlation', 'correlation']: conn_measure = connectome.ConnectivityMeasure(kind=kind) connectivity = conn_measure.fit_transform([timeseries])[0] if save: subject_file = os.path.join(save_path, subject, subject + '_' + atlas_name + '_' + kind.replace(' ', '_') + '.mat') sio.savemat(subject_file, {'connectivity': connectivity}) return connectivity def group_connectivity(timeseries, subject_list, atlas_name, kind, save=True, save_path=root_folder): """ timeseries : list of timeseries tables for subjects (timepoints x regions) subject_list : the subject short IDs list atlas_name : name of the atlas used kind : the kind of connectivity to be used, e.g. lasso, partial correlation, correlation save : save the connectivity matrix to a file save_path : specify path to save the matrix if different from subject folder returns: connectivity : connectivity matrix (regions x regions) """ if kind == 'lasso': # Graph Lasso estimator covariance_estimator = GraphLassoCV(verbose=1) connectivity_matrices = [] for i, ts in enumerate(timeseries): covariance_estimator.fit(ts) connectivity = covariance_estimator.covariance_ connectivity_matrices.append(connectivity) print('Covariance matrix has shape {0}.'.format(connectivity.shape)) elif kind in ['tangent', 'partial correlation', 'correlation']: conn_measure = connectome.ConnectivityMeasure(kind=kind) connectivity_matrices = conn_measure.fit_transform(timeseries) if save: for i, subject in enumerate(subject_list): subject_file = os.path.join(save_path, subject_list[i], subject_list[i] + '_' + atlas_name + '_' + kind.replace(' ', '_') + '.mat') sio.savemat(subject_file, {'connectivity': connectivity_matrices[i]}) print("Saving connectivity matrix to %s" % subject_file) return connectivity_matrices def get_subject_label(subject_list, label_name): """ subject_list : the subject short IDs list label_name : name of the label to be retrieved returns: label : dictionary of subject labels """ label = {} with open(os.path.join(save_path, 'ABIDE_pcp/Phenotypic_V1_0b_preprocessed1.csv')) as csvfile: reader = csv.DictReader(csvfile) for row in reader: if row['subject'] in subject_list: label[row['subject']] = row[label_name] return label def load_all_networks(subject_list, kind, atlas_name="aal"): """ subject_list : the subject short IDs list kind : the kind of connectivity to be used, e.g. lasso, partial correlation, correlation atlas_name : name of the atlas used returns: all_networks : list of connectivity matrices (regions x regions) """ all_networks = [] for subject in subject_list: fl = os.path.join(root_folder, subject, subject + "_" + atlas_name + "_" + kind + ".mat") matrix = sio.loadmat(fl)['connectivity'] if atlas_name == 'ho': matrix = np.delete(matrix, 82, axis=0) matrix = np.delete(matrix, 82, axis=1) all_networks.append(matrix) # all_networks=np.array(all_networks) return all_networks def get_net_vectors(subject_list, kind, atlas_name="aal"): """ subject_list : the subject short IDs list kind : the kind of connectivity to be used, e.g. lasso, partial correlation, correlation atlas_name : name of the atlas used returns: matrix : matrix of connectivity vectors (num_subjects x num_connections) """ # This is an alternative implementation networks = load_all_networks(subject_list, kind, atlas_name=atlas_name) # Get Fisher transformed matrices norm_networks = [np.arctanh(mat) for mat in networks] # Get upper diagonal indices idx = np.triu_indices_from(norm_networks[0], 1) # Get vectorised matrices vec_networks = [mat[idx] for mat in norm_networks] # Each subject should be a row of the matrix matrix = np.vstack(vec_networks) return matrix def get_atlas_coords(atlas_name='ho'): """ atlas_name : name of the atlas used returns: matrix : matrix of roi 3D coordinates in MNI space (num_rois x 3) """ coords_file = os.path.join(root_folder, atlas_name + '_coords.csv') coords = np.loadtxt(coords_file, delimiter=',') if atlas_name == 'ho': coords = np.delete(coords, 82, axis=0) return coords</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">32.241379</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">115</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.648217</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">HoganZhang/gcn_metric_learning</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">lib/abide_utils.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">11,220</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8786"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from typing import List import numpy as np def mask_nan(arrays: List[np.ndarray]) -> List[np.ndarray]: """ Drop indices from equal-sized arrays if the element at that index is NaN in any of the input arrays. Parameters ---------- arrays : List[np.ndarray] list of ndarrays containing NaNs, to be masked Returns ------- List[np.ndarray] masked arrays (free of NaNs) Notes ----- This function find the indices where one or more elements is NaN in one or more of the input arrays, then drops those indices from all arrays. For example: >> a = np.array([0, 1, np.nan, 3]) >> b = np.array([np.nan, 5, np.nan, 7]) >> c = np.array([8, 9, 10, 11]) >> mask_nan([a, b, c]) [array([ 1., 3.]), array([ 5., 7.]), array([ 9, 11])] """ n = arrays[0].size assert all(a.size == n for a in arrays[1:]) mask = np.array([False] * n) for arr in arrays: mask = np.logical_or(mask, np.isnan(arr)) return [arr[np.where(~mask)[0]] for arr in arrays] </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">27.128205</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">79</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.581285</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">jbburt/jburt</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">jburt/mask.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">1,058</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8787"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block "># Copyright 2016 Google Inc. All rights reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """Pure Python crypto-related routines for oauth2client. Uses the ``rsa``, ``pyasn1`` and ``pyasn1_modules`` packages to parse PEM files storing PKCS#1 or PKCS#8 keys as well as certificates. """ from pyasn1.codec.der import decoder from pyasn1_modules import pem from pyasn1_modules.rfc2459 import Certificate from pyasn1_modules.rfc5208 import PrivateKeyInfo import rsa import sixm from oauth2client import _helpers _PKCS12_ERROR = r"""\ PKCS12 format is not supported by the RSA library. Either install PyOpenSSL, or please convert .p12 format to .pem format: $ cat key.p12 | \ > openssl pkcs12 -nodes -nocerts -passin pass:notasecret | \ > openssl rsa > key.pem """ _POW2 = (128, 64, 32, 16, 8, 4, 2, 1) _PKCS1_MARKER = ('-----BEGIN RSA PRIVATE KEY-----', '-----END RSA PRIVATE KEY-----') _PKCS8_MARKER = ('-----BEGIN PRIVATE KEY-----', '-----END PRIVATE KEY-----') _PKCS8_SPEC = PrivateKeyInfo() def _bit_list_to_bytes(bit_list): """Converts an iterable of 1's and 0's to bytes. Combines the list 8 at a time, treating each group of 8 bits as a single byte. """ num_bits = len(bit_list) byte_vals = bytearray() for start in sixm.moves.xrange(0, num_bits, 8): curr_bits = bit_list[start:start + 8] char_val = sum(val * digit for val, digit in zip(_POW2, curr_bits)) byte_vals.append(char_val) return bytes(byte_vals) class RsaVerifier(object): """Verifies the signature on a message. Args: pubkey: rsa.key.PublicKey (or equiv), The public key to verify with. """ def __init__(self, pubkey): self._pubkey = pubkey def verify(self, message, signature): """Verifies a message against a signature. Args: message: string or bytes, The message to verify. If string, will be encoded to bytes as utf-8. signature: string or bytes, The signature on the message. If string, will be encoded to bytes as utf-8. Returns: True if message was signed by the private key associated with the public key that this object was constructed with. """ message = _helpers._to_bytes(message, encoding='utf-8') try: return rsa.pkcs1.verify(message, signature, self._pubkey) except (ValueError, rsa.pkcs1.VerificationError): return False @classmethod def from_string(cls, key_pem, is_x509_cert): """Construct an RsaVerifier instance from a string. Args: key_pem: string, public key in PEM format. is_x509_cert: bool, True if key_pem is an X509 cert, otherwise it is expected to be an RSA key in PEM format. Returns: RsaVerifier instance. Raises: ValueError: if the key_pem can't be parsed. In either case, error will begin with 'No PEM start marker'. If ``is_x509_cert`` is True, will fail to find the "-----BEGIN CERTIFICATE-----" error, otherwise fails to find "-----BEGIN RSA PUBLIC KEY-----". """ key_pem = _helpers._to_bytes(key_pem) if is_x509_cert: der = rsa.pem.load_pem(key_pem, 'CERTIFICATE') asn1_cert, remaining = decoder.decode(der, asn1Spec=Certificate()) if remaining != b'': raise ValueError('Unused bytes', remaining) cert_info = asn1_cert['tbsCertificate']['subjectPublicKeyInfo'] key_bytes = _bit_list_to_bytes(cert_info['subjectPublicKey']) pubkey = rsa.PublicKey.load_pkcs1(key_bytes, 'DER') else: pubkey = rsa.PublicKey.load_pkcs1(key_pem, 'PEM') return cls(pubkey) class RsaSigner(object): """Signs messages with a private key. Args: pkey: rsa.key.PrivateKey (or equiv), The private key to sign with. """ def __init__(self, pkey): self._key = pkey def sign(self, message): """Signs a message. Args: message: bytes, Message to be signed. Returns: string, The signature of the message for the given key. """ message = _helpers._to_bytes(message, encoding='utf-8') return rsa.pkcs1.sign(message, self._key, 'SHA-256') @classmethod def from_string(cls, key, password='notasecret'): """Construct an RsaSigner instance from a string. Args: key: string, private key in PEM format. password: string, password for private key file. Unused for PEM files. Returns: RsaSigner instance. Raises: ValueError if the key cannot be parsed as PKCS#1 or PKCS#8 in PEM format. """ key = _helpers._from_bytes(key) # pem expects str in Py3 marker_id, key_bytes = pem.readPemBlocksFromFile( sixm.StringIO(key), _PKCS1_MARKER, _PKCS8_MARKER) if marker_id == 0: pkey = rsa.key.PrivateKey.load_pkcs1(key_bytes, format='DER') elif marker_id == 1: key_info, remaining = decoder.decode( key_bytes, asn1Spec=_PKCS8_SPEC) if remaining != b'': raise ValueError('Unused bytes', remaining) pkey_info = key_info.getComponentByName('privateKey') pkey = rsa.key.PrivateKey.load_pkcs1(pkey_info.asOctets(), format='DER') else: raise ValueError('No key could be detected.') return cls(pkey) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">34.432432</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">79</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.609733</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">giangpvit/googledrivepythonsample</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">test/lib/oauth2client/_pure_python_crypt.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">6,370</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8788"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">def findDecision(obj): #obj[0]: Passanger, obj[1]: Coupon, obj[2]: Education, obj[3]: Occupation, obj[4]: Restaurant20to50, obj[5]: Distance # {"feature": "Passanger", "instances": 34, "metric_value": 0.9774, "depth": 1} if obj[0]<=1: # {"feature": "Restaurant20to50", "instances": 22, "metric_value": 0.7732, "depth": 2} if obj[4]<=3.0: # {"feature": "Education", "instances": 21, "metric_value": 0.7025, "depth": 3} if obj[2]<=2: # {"feature": "Occupation", "instances": 16, "metric_value": 0.8113, "depth": 4} if obj[3]<=10: # {"feature": "Coupon", "instances": 13, "metric_value": 0.6194, "depth": 5} if obj[1]>2: # {"feature": "Distance", "instances": 7, "metric_value": 0.8631, "depth": 6} if obj[5]<=2: return 'False' elif obj[5]>2: return 'False' else: return 'False' elif obj[1]<=2: return 'False' else: return 'False' elif obj[3]>10: # {"feature": "Coupon", "instances": 3, "metric_value": 0.9183, "depth": 5} if obj[1]<=2: return 'True' elif obj[1]>2: return 'False' else: return 'False' else: return 'True' elif obj[2]>2: return 'False' else: return 'False' elif obj[4]>3.0: return 'True' else: return 'True' elif obj[0]>1: # {"feature": "Coupon", "instances": 12, "metric_value": 0.8113, "depth": 2} if obj[1]>0: # {"feature": "Occupation", "instances": 11, "metric_value": 0.684, "depth": 3} if obj[3]<=20: # {"feature": "Restaurant20to50", "instances": 10, "metric_value": 0.469, "depth": 4} if obj[4]>1.0: return 'True' elif obj[4]<=1.0: # {"feature": "Education", "instances": 4, "metric_value": 0.8113, "depth": 5} if obj[2]<=1: return 'True' elif obj[2]>1: # {"feature": "Distance", "instances": 2, "metric_value": 1.0, "depth": 6} if obj[5]<=2: return 'True' else: return 'True' else: return 'True' else: return 'True' elif obj[3]>20: return 'False' else: return 'False' elif obj[1]<=0: return 'False' else: return 'False' else: return 'True' </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">34.508197</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">140</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.564371</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">apcarrik/kaggle</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">duke-cs671-fall21-coupon-recommendation/outputs/rules/RF/6_features/numtrees_30/rule_0.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">2,105</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8789"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import AnalysisModule as Ass import GraphFunctions as Gfs import yfinance as yf import DatabaseStocks as Ds listOfStocksToAnalyze = Ds.get_lists() macdproposedbuylist = [] macdproposedselllist = [] proposedbuylist = [] proposedselllist = [] for stock in listOfStocksToAnalyze: # print(stock) StockData = yf.Ticker(stock).history(period="1y") if Ass.macd_potential_buy(StockData) and Ass.is_stock_rising(StockData): macdproposedbuylist.append(stock) print("MACD Something you might wanna buy is " + stock) continue if Ass.macd_potential_sell(StockData) and Ass.is_stock_falling(StockData): macdproposedselllist.append(stock) print("MACD Something you might wanna sell is " + stock) if Ass.sma_potential_buy(StockData): proposedbuylist.append(stock) print("Something you might wanna buy is " + stock) continue if Ass.sma_potential_sell(StockData): proposedselllist.append(stock) print("Something you might wanna sell is " + stock) print(macdproposedselllist) print(macdproposedbuylist) for stock in macdproposedbuylist: StockData = yf.Ticker(stock).history(period="1y") Gfs.draw_macd_buy(StockData, "BUY " + stock) for stock in macdproposedselllist: StockData = yf.Ticker(stock).history(period="1y") Gfs.draw_macd_sell(StockData, "SELL " + stock) for stock in proposedbuylist: StockData = yf.Ticker(stock).history(period="1y") Gfs.draw_macd_buy(StockData, "BUY MA " + stock) for stock in proposedselllist: StockData = yf.Ticker(stock).history(period="1y") Gfs.draw_macd_sell(StockData, "SELL MA " + stock) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">31.75</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">78</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.724409</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">VaseSimion/Finance</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">workfile.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">1,651</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8790"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">#!/usr/bin/env python from __future__ import absolute_import from __future__ import division from __future__ import print_function import os from yolov2_ros.srv import * import rospy from copy import deepcopy from core import YOLO from vision_msgs.msg import Detection2DArray, Detection2D, BoundingBox2D, ObjectHypothesisWithPose from geometry_msgs.msg import PoseWithCovariance, Pose2D from std_msgs.msg import Header from sensor_msgs.msg import Image from cv_bridge import CvBridge, CvBridgeError os.environ["CUDA_DEVICE_ORDER"]="PCI_BUS_ID" os.environ["CUDA_VISIBLE_DEVICES"]="0" os.environ['TF_CPP_MIN_LOG_LEVEL'] = '3' class YoloServer(object): def __init__(self): self.bridge = CvBridge() self.n_gpu = rospy.get_param('~n_gpu', default=1) self.backend = rospy.get_param('~backend', default='full_yolo') # Either 'tiny_yolo', full_yolo, 'mobile_net, 'squeeze_net', or 'inception3' self.backend_path = rospy.get_param('~weights_path') # Weights directory self.input_size = rospy.get_param('~input_size', default=416) # DO NOT change this. 416 is default for YOLO. self.labels = rospy.get_param('~labels') # Eg: ['trafficcone', 'person', 'dog'] self.max_number_detections = rospy.get_param('~max_number_detections', default=5) # Max number of detections self.anchors = rospy.get_param('~anchors', default=[0.57273, 0.677385, 1.87446, # The anchors to use. Use the anchor generator and copy these into the config. 2.06253, 3.33843, 5.47434, 7.88282, 3.52778, 9.77052, 9.16828]) self.weights_path = rospy.get_param('~weights_path', default='../weights/full_yolo.h5') # Path to the weights.h5 file self.weight_file = rospy.get_param('~weight_file') self.yolo = YOLO( n_gpu=self.n_gpu, backend = self.backend, backend_path=self.backend_path, input_size = self.input_size, labels = self.labels, max_box_per_image = self.max_number_detections, anchors = self.anchors ) self.yolo.load_weights(self.weights_path + '/' + self.weight_file) rospy.loginfo('YOLO detector ready...') s = rospy.Service('yolo_detect', YoloDetect, self._handle_yolo_detect, buff_size=10000000) s.spin() def _handle_yolo_detect(self, req): cv_image = None detection_array = Detection2DArray() detections = [] boxes = None try: cv_image = self.bridge.imgmsg_to_cv2(req.image, "bgr8") except CvBridgeError as e: rospy.logerr(e) try: boxes = self.yolo.predict(cv_image) except SystemError: pass # rospy.loginfo('Found {} boxes'.format(len(boxes))) for box in boxes: detection = Detection2D() results = [] bbox = BoundingBox2D() center = Pose2D() detection.header = Header() detection.header.stamp = rospy.get_rostime() # detection.source_img = deepcopy(req.image) labels = box.get_all_labels() for i in range(0,len(labels)): object_hypothesis = ObjectHypothesisWithPose() object_hypothesis.id = i object_hypothesis.score = labels[i] results.append(object_hypothesis) detection.results = results x, y = box.get_xy_center() center.x = x center.y = y center.theta = 0.0 bbox.center = center size_x, size_y = box.get_xy_extents() bbox.size_x = size_x bbox.size_y = size_y detection.bbox = bbox detections.append(detection) detection_array.header = Header() detection_array.header.stamp = rospy.get_rostime() detection_array.detections = detections return YoloDetectResponse(detection_array) if __name__ == '__main__': rospy.init_node('yolo_server') try: ys = YoloServer() except rospy.ROSInterruptException: pass</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">37.853448</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">175</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.59918</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "BSD-3-Clause" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">diggerdata/yolov2_ros</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">scripts/yolo_server.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">4,391</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8791"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from . import IGGrid def get(): return IGGrid.IGGrid() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">10.166667</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">26</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.655738</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">bertrandboudaud/imagegraph</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">nodes/IGGrid/__init__.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">61</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8792"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from django.urls import path, include from . import views app_name = 'test_app' urlpatterns = [ path('', views.index, name='index'), ]</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">17.5</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">40</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.685714</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">nosu23/docker-gunicorn-django-example</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">gunicorn/src/test_app/urls.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">140</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8793"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">#!/usr/bin/env python3 # Copyright (c) 2018 The Bitcoin Core developers # Copyright (c) 2017 The Raven Core developers # Copyright (c) 2018 The Rito Core developers # Distributed under the MIT software license, see the accompanying # file COPYING or http://www.opensource.org/licenses/mit-license.php. """Test compact blocks (BIP 152). Version 1 compact blocks are pre-segwit (txids) Version 2 compact blocks are post-segwit (wtxids) """ from test_framework.mininode import * from test_framework.test_framework import RitoTestFramework from test_framework.util import * from test_framework.blocktools import create_block, create_coinbase, add_witness_commitment from test_framework.script import CScript, OP_TRUE # TestNode: A peer we use to send messages to ritod, and store responses. class TestNode(NodeConnCB): def __init__(self): super().__init__() self.last_sendcmpct = [] self.block_announced = False # Store the hashes of blocks we've seen announced. # This is for synchronizing the p2p message traffic, # so we can eg wait until a particular block is announced. self.announced_blockhashes = set() def on_sendcmpct(self, conn, message): self.last_sendcmpct.append(message) def on_cmpctblock(self, conn, message): self.block_announced = True self.last_message["cmpctblock"].header_and_shortids.header.calc_sha256() self.announced_blockhashes.add(self.last_message["cmpctblock"].header_and_shortids.header.sha256) def on_headers(self, conn, message): self.block_announced = True for x in self.last_message["headers"].headers: x.calc_sha256() self.announced_blockhashes.add(x.sha256) def on_inv(self, conn, message): for x in self.last_message["inv"].inv: if x.type == 2: self.block_announced = True self.announced_blockhashes.add(x.hash) # Requires caller to hold mininode_lock def received_block_announcement(self): return self.block_announced def clear_block_announcement(self): with mininode_lock: self.block_announced = False self.last_message.pop("inv", None) self.last_message.pop("headers", None) self.last_message.pop("cmpctblock", None) def get_headers(self, locator, hashstop): msg = msg_getheaders() msg.locator.vHave = locator msg.hashstop = hashstop self.connection.send_message(msg) def send_header_for_blocks(self, new_blocks): headers_message = msg_headers() headers_message.headers = [CBlockHeader(b) for b in new_blocks] self.send_message(headers_message) def request_headers_and_sync(self, locator, hashstop=0): self.clear_block_announcement() self.get_headers(locator, hashstop) wait_until(self.received_block_announcement, timeout=30, lock=mininode_lock) self.clear_block_announcement() # Block until a block announcement for a particular block hash is # received. def wait_for_block_announcement(self, block_hash, timeout=30): def received_hash(): return (block_hash in self.announced_blockhashes) wait_until(received_hash, timeout=timeout, lock=mininode_lock) def send_await_disconnect(self, message, timeout=30): """Sends a message to the node and wait for disconnect. This is used when we want to send a message into the node that we expect will get us disconnected, eg an invalid block.""" self.send_message(message) wait_until(lambda: not self.connected, timeout=timeout, lock=mininode_lock) class CompactBlocksTest(RitoTestFramework): def set_test_params(self): self.setup_clean_chain = True # Node0 = pre-segwit, node1 = segwit-aware self.num_nodes = 2 self.extra_args = [["-vbparams=segwit:0:0"], ["-txindex"]] self.utxos = [] def build_block_on_tip(self, node, segwit=False): height = node.getblockcount() tip = node.getbestblockhash() mtp = node.getblockheader(tip)['mediantime'] block = create_block(int(tip, 16), create_coinbase(height + 1), mtp + 1) block.nVersion = 4 if segwit: add_witness_commitment(block) block.solve() return block # Create 10 more anyone-can-spend utxo's for testing. def make_utxos(self): # Doesn't matter which node we use, just use node0. block = self.build_block_on_tip(self.nodes[0]) self.test_node.send_and_ping(msg_block(block)) assert(int(self.nodes[0].getbestblockhash(), 16) == block.sha256) self.nodes[0].generate(100) total_value = block.vtx[0].vout[0].nValue out_value = total_value // 10 tx = CTransaction() tx.vin.append(CTxIn(COutPoint(block.vtx[0].sha256, 0), b'')) for i in range(10): tx.vout.append(CTxOut(out_value, CScript([OP_TRUE]))) tx.rehash() block2 = self.build_block_on_tip(self.nodes[0]) block2.vtx.append(tx) block2.hashMerkleRoot = block2.calc_merkle_root() block2.solve() self.test_node.send_and_ping(msg_block(block2)) assert_equal(int(self.nodes[0].getbestblockhash(), 16), block2.sha256) self.utxos.extend([[tx.sha256, i, out_value] for i in range(10)]) return # Test "sendcmpct" (between peers preferring the same version): # - No compact block announcements unless sendcmpct is sent. # - If sendcmpct is sent with version > preferred_version, the message is ignored. # - If sendcmpct is sent with boolean 0, then block announcements are not # made with compact blocks. # - If sendcmpct is then sent with boolean 1, then new block announcements # are made with compact blocks. # If old_node is passed in, request compact blocks with version=preferred-1 # and verify that it receives block announcements via compact block. def test_sendcmpct(self, node, test_node, preferred_version, old_node=None): # Make sure we get a SENDCMPCT message from our peer def received_sendcmpct(): return (len(test_node.last_sendcmpct) > 0) wait_until(received_sendcmpct, timeout=30, lock=mininode_lock) with mininode_lock: # Check that the first version received is the preferred one assert_equal(test_node.last_sendcmpct[0].version, preferred_version) # And that we receive versions down to 1. assert_equal(test_node.last_sendcmpct[-1].version, 1) test_node.last_sendcmpct = [] tip = int(node.getbestblockhash(), 16) def check_announcement_of_new_block(node, peer, predicate): peer.clear_block_announcement() block_hash = int(node.generate(1)[0], 16) peer.wait_for_block_announcement(block_hash, timeout=30) assert(peer.block_announced) with mininode_lock: assert predicate(peer), ( "block_hash={!r}, cmpctblock={!r}, inv={!r}".format( block_hash, peer.last_message.get("cmpctblock", None), peer.last_message.get("inv", None))) # We shouldn't get any block announcements via cmpctblock yet. check_announcement_of_new_block(node, test_node, lambda p: "cmpctblock" not in p.last_message) # Try one more time, this time after requesting headers. test_node.request_headers_and_sync(locator=[tip]) check_announcement_of_new_block(node, test_node, lambda p: "cmpctblock" not in p.last_message and "inv" in p.last_message) # Test a few ways of using sendcmpct that should NOT # result in compact block announcements. # Before each test, sync the headers chain. test_node.request_headers_and_sync(locator=[tip]) # Now try a SENDCMPCT message with too-high version sendcmpct = msg_sendcmpct() sendcmpct.version = preferred_version+1 sendcmpct.announce = True test_node.send_and_ping(sendcmpct) check_announcement_of_new_block(node, test_node, lambda p: "cmpctblock" not in p.last_message) # Headers sync before next test. test_node.request_headers_and_sync(locator=[tip]) # Now try a SENDCMPCT message with valid version, but announce=False sendcmpct.version = preferred_version sendcmpct.announce = False test_node.send_and_ping(sendcmpct) check_announcement_of_new_block(node, test_node, lambda p: "cmpctblock" not in p.last_message) # Headers sync before next test. test_node.request_headers_and_sync(locator=[tip]) # Finally, try a SENDCMPCT message with announce=True sendcmpct.version = preferred_version sendcmpct.announce = True test_node.send_and_ping(sendcmpct) check_announcement_of_new_block(node, test_node, lambda p: "cmpctblock" in p.last_message) # Try one more time (no headers sync should be needed!) check_announcement_of_new_block(node, test_node, lambda p: "cmpctblock" in p.last_message) # Try one more time, after turning on sendheaders test_node.send_and_ping(msg_sendheaders()) check_announcement_of_new_block(node, test_node, lambda p: "cmpctblock" in p.last_message) # Try one more time, after sending a version-1, announce=false message. sendcmpct.version = preferred_version-1 sendcmpct.announce = False test_node.send_and_ping(sendcmpct) check_announcement_of_new_block(node, test_node, lambda p: "cmpctblock" in p.last_message) # Now turn off announcements sendcmpct.version = preferred_version sendcmpct.announce = False test_node.send_and_ping(sendcmpct) check_announcement_of_new_block(node, test_node, lambda p: "cmpctblock" not in p.last_message and "headers" in p.last_message) if old_node is not None: # Verify that a peer using an older protocol version can receive # announcements from this node. sendcmpct.version = preferred_version-1 sendcmpct.announce = True old_node.send_and_ping(sendcmpct) # Header sync old_node.request_headers_and_sync(locator=[tip]) check_announcement_of_new_block(node, old_node, lambda p: "cmpctblock" in p.last_message) # This test actually causes ritod to (reasonably!) disconnect us, so do this last. def test_invalid_cmpctblock_message(self): self.nodes[0].generate(101) block = self.build_block_on_tip(self.nodes[0]) cmpct_block = P2PHeaderAndShortIDs() cmpct_block.header = CBlockHeader(block) cmpct_block.prefilled_txn_length = 1 # This index will be too high prefilled_txn = PrefilledTransaction(1, block.vtx[0]) cmpct_block.prefilled_txn = [prefilled_txn] self.test_node.send_await_disconnect(msg_cmpctblock(cmpct_block)) assert_equal(int(self.nodes[0].getbestblockhash(), 16), block.hashPrevBlock) # Compare the generated shortids to what we expect based on BIP 152, given # ritod's choice of nonce. def test_compactblock_construction(self, node, test_node, version, use_witness_address): # Generate a bunch of transactions. node.generate(101) num_transactions = 25 address = node.getnewaddress() if use_witness_address: # Want at least one segwit spend, so move all funds to # a witness address. address = node.addwitnessaddress(address) value_to_send = node.getbalance() node.sendtoaddress(address, satoshi_round(value_to_send-Decimal(0.1))) node.generate(1) segwit_tx_generated = False for i in range(num_transactions): txid = node.sendtoaddress(address, 0.1) hex_tx = node.gettransaction(txid)["hex"] tx = FromHex(CTransaction(), hex_tx) if not tx.wit.is_null(): segwit_tx_generated = True if use_witness_address: assert(segwit_tx_generated) # check that our test is not broken # Wait until we've seen the block announcement for the resulting tip tip = int(node.getbestblockhash(), 16) test_node.wait_for_block_announcement(tip) # Make sure we will receive a fast-announce compact block self.request_cb_announcements(test_node, node, version) # Now mine a block, and look at the resulting compact block. test_node.clear_block_announcement() block_hash = int(node.generate(1)[0], 16) # Store the raw block in our internal format. block = FromHex(CBlock(), node.getblock("%02x" % block_hash, False)) for tx in block.vtx: tx.calc_sha256() block.rehash() # Wait until the block was announced (via compact blocks) wait_until(test_node.received_block_announcement, timeout=30, lock=mininode_lock) # Now fetch and check the compact block header_and_shortids = None with mininode_lock: assert("cmpctblock" in test_node.last_message) # Convert the on-the-wire representation to absolute indexes header_and_shortids = HeaderAndShortIDs(test_node.last_message["cmpctblock"].header_and_shortids) self.check_compactblock_construction_from_block(version, header_and_shortids, block_hash, block) # Now fetch the compact block using a normal non-announce getdata with mininode_lock: test_node.clear_block_announcement() inv = CInv(4, block_hash) # 4 == "CompactBlock" test_node.send_message(msg_getdata([inv])) wait_until(test_node.received_block_announcement, timeout=30, lock=mininode_lock) # Now fetch and check the compact block header_and_shortids = None with mininode_lock: assert("cmpctblock" in test_node.last_message) # Convert the on-the-wire representation to absolute indexes header_and_shortids = HeaderAndShortIDs(test_node.last_message["cmpctblock"].header_and_shortids) self.check_compactblock_construction_from_block(version, header_and_shortids, block_hash, block) def check_compactblock_construction_from_block(self, version, header_and_shortids, block_hash, block): # Check that we got the right block! header_and_shortids.header.calc_sha256() assert_equal(header_and_shortids.header.sha256, block_hash) # Make sure the prefilled_txn appears to have included the coinbase assert(len(header_and_shortids.prefilled_txn) >= 1) assert_equal(header_and_shortids.prefilled_txn[0].index, 0) # Check that all prefilled_txn entries match what's in the block. for entry in header_and_shortids.prefilled_txn: entry.tx.calc_sha256() # This checks the non-witness parts of the tx agree assert_equal(entry.tx.sha256, block.vtx[entry.index].sha256) # And this checks the witness wtxid = entry.tx.calc_sha256(True) if version == 2: assert_equal(wtxid, block.vtx[entry.index].calc_sha256(True)) else: # Shouldn't have received a witness assert(entry.tx.wit.is_null()) # Check that the cmpctblock message announced all the transactions. assert_equal(len(header_and_shortids.prefilled_txn) + len(header_and_shortids.shortids), len(block.vtx)) # And now check that all the shortids are as expected as well. # Determine the siphash keys to use. [k0, k1] = header_and_shortids.get_siphash_keys() index = 0 while index < len(block.vtx): if (len(header_and_shortids.prefilled_txn) > 0 and header_and_shortids.prefilled_txn[0].index == index): # Already checked prefilled transactions above header_and_shortids.prefilled_txn.pop(0) else: tx_hash = block.vtx[index].sha256 if version == 2: tx_hash = block.vtx[index].calc_sha256(True) shortid = calculate_shortid(k0, k1, tx_hash) assert_equal(shortid, header_and_shortids.shortids[0]) header_and_shortids.shortids.pop(0) index += 1 # Test that ritod requests compact blocks when we announce new blocks # via header or inv, and that responding to getblocktxn causes the block # to be successfully reconstructed. # Post-segwit: upgraded nodes would only make this request of cb-version-2, # NODE_WITNESS peers. Unupgraded nodes would still make this request of # any cb-version-1-supporting peer. def test_compactblock_requests(self, node, test_node, version, segwit): # Try announcing a block with an inv or header, expect a compactblock # request for announce in ["inv", "header"]: block = self.build_block_on_tip(node, segwit=segwit) with mininode_lock: test_node.last_message.pop("getdata", None) if announce == "inv": test_node.send_message(msg_inv([CInv(2, block.sha256)])) wait_until(lambda: "getheaders" in test_node.last_message, timeout=30, lock=mininode_lock) test_node.send_header_for_blocks([block]) else: test_node.send_header_for_blocks([block]) wait_until(lambda: "getdata" in test_node.last_message, timeout=30, lock=mininode_lock) assert_equal(len(test_node.last_message["getdata"].inv), 1) assert_equal(test_node.last_message["getdata"].inv[0].type, 4) assert_equal(test_node.last_message["getdata"].inv[0].hash, block.sha256) # Send back a compactblock message that omits the coinbase comp_block = HeaderAndShortIDs() comp_block.header = CBlockHeader(block) comp_block.nonce = 0 [k0, k1] = comp_block.get_siphash_keys() coinbase_hash = block.vtx[0].sha256 if version == 2: coinbase_hash = block.vtx[0].calc_sha256(True) comp_block.shortids = [ calculate_shortid(k0, k1, coinbase_hash) ] test_node.send_and_ping(msg_cmpctblock(comp_block.to_p2p())) assert_equal(int(node.getbestblockhash(), 16), block.hashPrevBlock) # Expect a getblocktxn message. with mininode_lock: assert("getblocktxn" in test_node.last_message) absolute_indexes = test_node.last_message["getblocktxn"].block_txn_request.to_absolute() assert_equal(absolute_indexes, [0]) # should be a coinbase request # Send the coinbase, and verify that the tip advances. if version == 2: msg = msg_witness_blocktxn() else: msg = msg_blocktxn() msg.block_transactions.blockhash = block.sha256 msg.block_transactions.transactions = [block.vtx[0]] test_node.send_and_ping(msg) assert_equal(int(node.getbestblockhash(), 16), block.sha256) # Create a chain of transactions from given utxo, and add to a new block. def build_block_with_transactions(self, node, utxo, num_transactions): block = self.build_block_on_tip(node) for i in range(num_transactions): tx = CTransaction() tx.vin.append(CTxIn(COutPoint(utxo[0], utxo[1]), b'')) tx.vout.append(CTxOut(utxo[2] - 1000, CScript([OP_TRUE]))) tx.rehash() utxo = [tx.sha256, 0, tx.vout[0].nValue] block.vtx.append(tx) block.hashMerkleRoot = block.calc_merkle_root() block.solve() return block # Test that we only receive getblocktxn requests for transactions that the # node needs, and that responding to them causes the block to be # reconstructed. def test_getblocktxn_requests(self, node, test_node, version): with_witness = (version==2) def test_getblocktxn_response(compact_block, peer, expected_result): msg = msg_cmpctblock(compact_block.to_p2p()) peer.send_and_ping(msg) with mininode_lock: assert("getblocktxn" in peer.last_message) absolute_indexes = peer.last_message["getblocktxn"].block_txn_request.to_absolute() assert_equal(absolute_indexes, expected_result) def test_tip_after_message(node, peer, msg, tip): peer.send_and_ping(msg) assert_equal(int(node.getbestblockhash(), 16), tip) # First try announcing compactblocks that won't reconstruct, and verify # that we receive getblocktxn messages back. utxo = self.utxos.pop(0) block = self.build_block_with_transactions(node, utxo, 5) self.utxos.append([block.vtx[-1].sha256, 0, block.vtx[-1].vout[0].nValue]) comp_block = HeaderAndShortIDs() comp_block.initialize_from_block(block, use_witness=with_witness) test_getblocktxn_response(comp_block, test_node, [1, 2, 3, 4, 5]) msg_bt = msg_blocktxn() if with_witness: msg_bt = msg_witness_blocktxn() # serialize with witnesses msg_bt.block_transactions = BlockTransactions(block.sha256, block.vtx[1:]) test_tip_after_message(node, test_node, msg_bt, block.sha256) utxo = self.utxos.pop(0) block = self.build_block_with_transactions(node, utxo, 5) self.utxos.append([block.vtx[-1].sha256, 0, block.vtx[-1].vout[0].nValue]) # Now try interspersing the prefilled transactions comp_block.initialize_from_block(block, prefill_list=[0, 1, 5], use_witness=with_witness) test_getblocktxn_response(comp_block, test_node, [2, 3, 4]) msg_bt.block_transactions = BlockTransactions(block.sha256, block.vtx[2:5]) test_tip_after_message(node, test_node, msg_bt, block.sha256) # Now try giving one transaction ahead of time. utxo = self.utxos.pop(0) block = self.build_block_with_transactions(node, utxo, 5) self.utxos.append([block.vtx[-1].sha256, 0, block.vtx[-1].vout[0].nValue]) test_node.send_and_ping(msg_tx(block.vtx[1])) assert(block.vtx[1].hash in node.getrawmempool()) # Prefill 4 out of the 6 transactions, and verify that only the one # that was not in the mempool is requested. comp_block.initialize_from_block(block, prefill_list=[0, 2, 3, 4], use_witness=with_witness) test_getblocktxn_response(comp_block, test_node, [5]) msg_bt.block_transactions = BlockTransactions(block.sha256, [block.vtx[5]]) test_tip_after_message(node, test_node, msg_bt, block.sha256) # Now provide all transactions to the node before the block is # announced and verify reconstruction happens immediately. utxo = self.utxos.pop(0) block = self.build_block_with_transactions(node, utxo, 10) self.utxos.append([block.vtx[-1].sha256, 0, block.vtx[-1].vout[0].nValue]) for tx in block.vtx[1:]: test_node.send_message(msg_tx(tx)) test_node.sync_with_ping() # Make sure all transactions were accepted. mempool = node.getrawmempool() for tx in block.vtx[1:]: assert(tx.hash in mempool) # Clear out last request. with mininode_lock: test_node.last_message.pop("getblocktxn", None) # Send compact block comp_block.initialize_from_block(block, prefill_list=[0], use_witness=with_witness) test_tip_after_message(node, test_node, msg_cmpctblock(comp_block.to_p2p()), block.sha256) with mininode_lock: # Shouldn't have gotten a request for any transaction assert("getblocktxn" not in test_node.last_message) # Incorrectly responding to a getblocktxn shouldn't cause the block to be # permanently failed. def test_incorrect_blocktxn_response(self, node, test_node, version): if (len(self.utxos) == 0): self.make_utxos() utxo = self.utxos.pop(0) block = self.build_block_with_transactions(node, utxo, 10) self.utxos.append([block.vtx[-1].sha256, 0, block.vtx[-1].vout[0].nValue]) # Relay the first 5 transactions from the block in advance for tx in block.vtx[1:6]: test_node.send_message(msg_tx(tx)) test_node.sync_with_ping() # Make sure all transactions were accepted. mempool = node.getrawmempool() for tx in block.vtx[1:6]: assert(tx.hash in mempool) # Send compact block comp_block = HeaderAndShortIDs() comp_block.initialize_from_block(block, prefill_list=[0], use_witness=(version == 2)) test_node.send_and_ping(msg_cmpctblock(comp_block.to_p2p())) absolute_indexes = [] with mininode_lock: assert("getblocktxn" in test_node.last_message) absolute_indexes = test_node.last_message["getblocktxn"].block_txn_request.to_absolute() assert_equal(absolute_indexes, [6, 7, 8, 9, 10]) # Now give an incorrect response. # Note that it's possible for ritod to be smart enough to know we're # lying, since it could check to see if the shortid matches what we're # sending, and eg disconnect us for misbehavior. If that behavior # change were made, we could just modify this test by having a # different peer provide the block further down, so that we're still # verifying that the block isn't marked bad permanently. This is good # enough for now. msg = msg_blocktxn() if version==2: msg = msg_witness_blocktxn() msg.block_transactions = BlockTransactions(block.sha256, [block.vtx[5]] + block.vtx[7:]) test_node.send_and_ping(msg) # Tip should not have updated assert_equal(int(node.getbestblockhash(), 16), block.hashPrevBlock) # We should receive a getdata request wait_until(lambda: "getdata" in test_node.last_message, timeout=10, lock=mininode_lock) assert_equal(len(test_node.last_message["getdata"].inv), 1) assert(test_node.last_message["getdata"].inv[0].type == 2 or test_node.last_message["getdata"].inv[0].type == 2|MSG_WITNESS_FLAG) assert_equal(test_node.last_message["getdata"].inv[0].hash, block.sha256) # Deliver the block if version==2: test_node.send_and_ping(msg_witness_block(block)) else: test_node.send_and_ping(msg_block(block)) assert_equal(int(node.getbestblockhash(), 16), block.sha256) def test_getblocktxn_handler(self, node, test_node, version): # ritod will not send blocktxn responses for blocks whose height is # more than 10 blocks deep. MAX_GETBLOCKTXN_DEPTH = 10 chain_height = node.getblockcount() current_height = chain_height while (current_height >= chain_height - MAX_GETBLOCKTXN_DEPTH): block_hash = node.getblockhash(current_height) block = FromHex(CBlock(), node.getblock(block_hash, False)) msg = msg_getblocktxn() msg.block_txn_request = BlockTransactionsRequest(int(block_hash, 16), []) num_to_request = random.randint(1, len(block.vtx)) msg.block_txn_request.from_absolute(sorted(random.sample(range(len(block.vtx)), num_to_request))) test_node.send_message(msg) wait_until(lambda: "blocktxn" in test_node.last_message, timeout=10, lock=mininode_lock) [tx.calc_sha256() for tx in block.vtx] with mininode_lock: assert_equal(test_node.last_message["blocktxn"].block_transactions.blockhash, int(block_hash, 16)) all_indices = msg.block_txn_request.to_absolute() for index in all_indices: tx = test_node.last_message["blocktxn"].block_transactions.transactions.pop(0) tx.calc_sha256() assert_equal(tx.sha256, block.vtx[index].sha256) if version == 1: # Witnesses should have been stripped assert(tx.wit.is_null()) else: # Check that the witness matches assert_equal(tx.calc_sha256(True), block.vtx[index].calc_sha256(True)) test_node.last_message.pop("blocktxn", None) current_height -= 1 # Next request should send a full block response, as we're past the # allowed depth for a blocktxn response. block_hash = node.getblockhash(current_height) msg.block_txn_request = BlockTransactionsRequest(int(block_hash, 16), [0]) with mininode_lock: test_node.last_message.pop("block", None) test_node.last_message.pop("blocktxn", None) test_node.send_and_ping(msg) with mininode_lock: test_node.last_message["block"].block.calc_sha256() assert_equal(test_node.last_message["block"].block.sha256, int(block_hash, 16)) assert "blocktxn" not in test_node.last_message def test_compactblocks_not_at_tip(self, node, test_node): # Test that requesting old compactblocks doesn't work. MAX_CMPCTBLOCK_DEPTH = 5 new_blocks = [] for i in range(MAX_CMPCTBLOCK_DEPTH + 1): test_node.clear_block_announcement() new_blocks.append(node.generate(1)[0]) wait_until(test_node.received_block_announcement, timeout=30, lock=mininode_lock) test_node.clear_block_announcement() test_node.send_message(msg_getdata([CInv(4, int(new_blocks[0], 16))])) wait_until(lambda: "cmpctblock" in test_node.last_message, timeout=30, lock=mininode_lock) test_node.clear_block_announcement() node.generate(1) wait_until(test_node.received_block_announcement, timeout=30, lock=mininode_lock) test_node.clear_block_announcement() with mininode_lock: test_node.last_message.pop("block", None) test_node.send_message(msg_getdata([CInv(4, int(new_blocks[0], 16))])) wait_until(lambda: "block" in test_node.last_message, timeout=30, lock=mininode_lock) with mininode_lock: test_node.last_message["block"].block.calc_sha256() assert_equal(test_node.last_message["block"].block.sha256, int(new_blocks[0], 16)) # Generate an old compactblock, and verify that it's not accepted. cur_height = node.getblockcount() hashPrevBlock = int(node.getblockhash(cur_height-5), 16) block = self.build_block_on_tip(node) block.hashPrevBlock = hashPrevBlock block.solve() comp_block = HeaderAndShortIDs() comp_block.initialize_from_block(block) test_node.send_and_ping(msg_cmpctblock(comp_block.to_p2p())) tips = node.getchaintips() found = False for x in tips: if x["hash"] == block.hash: assert_equal(x["status"], "headers-only") found = True break assert(found) # Requesting this block via getblocktxn should silently fail # (to avoid fingerprinting attacks). msg = msg_getblocktxn() msg.block_txn_request = BlockTransactionsRequest(block.sha256, [0]) with mininode_lock: test_node.last_message.pop("blocktxn", None) test_node.send_and_ping(msg) with mininode_lock: assert "blocktxn" not in test_node.last_message def activate_segwit(self, node): node.generate(144*3) assert_equal(get_bip9_status(node, "segwit")["status"], 'active') def test_end_to_end_block_relay(self, node, listeners): utxo = self.utxos.pop(0) block = self.build_block_with_transactions(node, utxo, 10) [l.clear_block_announcement() for l in listeners] # ToHex() won't serialize with witness, but this block has no witnesses # anyway. TODO: repeat this test with witness tx's to a segwit node. node.submitblock(ToHex(block)) for l in listeners: wait_until(lambda: l.received_block_announcement(), timeout=30, lock=mininode_lock) with mininode_lock: for l in listeners: assert "cmpctblock" in l.last_message l.last_message["cmpctblock"].header_and_shortids.header.calc_sha256() assert_equal(l.last_message["cmpctblock"].header_and_shortids.header.sha256, block.sha256) # Test that we don't get disconnected if we relay a compact block with valid header, # but invalid transactions. def test_invalid_tx_in_compactblock(self, node, test_node, use_segwit): assert(len(self.utxos)) utxo = self.utxos[0] block = self.build_block_with_transactions(node, utxo, 5) del block.vtx[3] block.hashMerkleRoot = block.calc_merkle_root() if use_segwit: # If we're testing with segwit, also drop the coinbase witness, # but include the witness commitment. add_witness_commitment(block) block.vtx[0].wit.vtxinwit = [] block.solve() # Now send the compact block with all transactions prefilled, and # verify that we don't get disconnected. comp_block = HeaderAndShortIDs() comp_block.initialize_from_block(block, prefill_list=[0, 1, 2, 3, 4], use_witness=use_segwit) msg = msg_cmpctblock(comp_block.to_p2p()) test_node.send_and_ping(msg) # Check that the tip didn't advance assert(int(node.getbestblockhash(), 16) is not block.sha256) test_node.sync_with_ping() # Helper for enabling cb announcements # Send the sendcmpct request and sync headers def request_cb_announcements(self, peer, node, version): tip = node.getbestblockhash() peer.get_headers(locator=[int(tip, 16)], hashstop=0) msg = msg_sendcmpct() msg.version = version msg.announce = True peer.send_and_ping(msg) def test_compactblock_reconstruction_multiple_peers(self, node, stalling_peer, delivery_peer): assert(len(self.utxos)) def announce_cmpct_block(node, peer): utxo = self.utxos.pop(0) block = self.build_block_with_transactions(node, utxo, 5) cmpct_block = HeaderAndShortIDs() cmpct_block.initialize_from_block(block) msg = msg_cmpctblock(cmpct_block.to_p2p()) peer.send_and_ping(msg) with mininode_lock: assert "getblocktxn" in peer.last_message return block, cmpct_block block, cmpct_block = announce_cmpct_block(node, stalling_peer) for tx in block.vtx[1:]: delivery_peer.send_message(msg_tx(tx)) delivery_peer.sync_with_ping() mempool = node.getrawmempool() for tx in block.vtx[1:]: assert(tx.hash in mempool) delivery_peer.send_and_ping(msg_cmpctblock(cmpct_block.to_p2p())) assert_equal(int(node.getbestblockhash(), 16), block.sha256) self.utxos.append([block.vtx[-1].sha256, 0, block.vtx[-1].vout[0].nValue]) # Now test that delivering an invalid compact block won't break relay block, cmpct_block = announce_cmpct_block(node, stalling_peer) for tx in block.vtx[1:]: delivery_peer.send_message(msg_tx(tx)) delivery_peer.sync_with_ping() cmpct_block.prefilled_txn[0].tx.wit.vtxinwit = [ CTxInWitness() ] cmpct_block.prefilled_txn[0].tx.wit.vtxinwit[0].scriptWitness.stack = [ser_uint256(0)] cmpct_block.use_witness = True delivery_peer.send_and_ping(msg_cmpctblock(cmpct_block.to_p2p())) assert(int(node.getbestblockhash(), 16) != block.sha256) msg = msg_blocktxn() msg.block_transactions.blockhash = block.sha256 msg.block_transactions.transactions = block.vtx[1:] stalling_peer.send_and_ping(msg) assert_equal(int(node.getbestblockhash(), 16), block.sha256) def run_test(self): # Setup the p2p connections and start up the network thread. self.test_node = TestNode() self.segwit_node = TestNode() self.old_node = TestNode() # version 1 peer <--> segwit node connections = [] connections.append(NodeConn('127.0.0.1', p2p_port(0), self.nodes[0], self.test_node)) connections.append(NodeConn('127.0.0.1', p2p_port(1), self.nodes[1], self.segwit_node, services=NODE_NETWORK|NODE_WITNESS)) connections.append(NodeConn('127.0.0.1', p2p_port(1), self.nodes[1], self.old_node, services=NODE_NETWORK)) self.test_node.add_connection(connections[0]) self.segwit_node.add_connection(connections[1]) self.old_node.add_connection(connections[2]) NetworkThread().start() # Start up network handling in another thread # Test logic begins here self.test_node.wait_for_verack() # We will need UTXOs to construct transactions in later tests. self.make_utxos() self.log.info("Running tests, pre-segwit activation:") self.log.info("Testing SENDCMPCT p2p message... ") self.test_sendcmpct(self.nodes[0], self.test_node, 1) sync_blocks(self.nodes) self.test_sendcmpct(self.nodes[1], self.segwit_node, 2, old_node=self.old_node) sync_blocks(self.nodes) self.log.info("Testing compactblock construction...") self.test_compactblock_construction(self.nodes[0], self.test_node, 1, False) sync_blocks(self.nodes) self.test_compactblock_construction(self.nodes[1], self.segwit_node, 2, False) sync_blocks(self.nodes) self.log.info("Testing compactblock requests... ") self.test_compactblock_requests(self.nodes[0], self.test_node, 1, False) sync_blocks(self.nodes) self.test_compactblock_requests(self.nodes[1], self.segwit_node, 2, False) sync_blocks(self.nodes) self.log.info("Testing getblocktxn requests...") self.test_getblocktxn_requests(self.nodes[0], self.test_node, 1) sync_blocks(self.nodes) self.test_getblocktxn_requests(self.nodes[1], self.segwit_node, 2) sync_blocks(self.nodes) self.log.info("Testing getblocktxn handler...") self.test_getblocktxn_handler(self.nodes[0], self.test_node, 1) sync_blocks(self.nodes) self.test_getblocktxn_handler(self.nodes[1], self.segwit_node, 2) self.test_getblocktxn_handler(self.nodes[1], self.old_node, 1) sync_blocks(self.nodes) self.log.info("Testing compactblock requests/announcements not at chain tip...") self.test_compactblocks_not_at_tip(self.nodes[0], self.test_node) sync_blocks(self.nodes) self.test_compactblocks_not_at_tip(self.nodes[1], self.segwit_node) self.test_compactblocks_not_at_tip(self.nodes[1], self.old_node) sync_blocks(self.nodes) self.log.info("Testing handling of incorrect blocktxn responses...") self.test_incorrect_blocktxn_response(self.nodes[0], self.test_node, 1) sync_blocks(self.nodes) self.test_incorrect_blocktxn_response(self.nodes[1], self.segwit_node, 2) sync_blocks(self.nodes) # End-to-end block relay tests self.log.info("Testing end-to-end block relay...") self.request_cb_announcements(self.test_node, self.nodes[0], 1) self.request_cb_announcements(self.old_node, self.nodes[1], 1) self.request_cb_announcements(self.segwit_node, self.nodes[1], 2) self.test_end_to_end_block_relay(self.nodes[0], [self.segwit_node, self.test_node, self.old_node]) self.test_end_to_end_block_relay(self.nodes[1], [self.segwit_node, self.test_node, self.old_node]) self.log.info("Testing handling of invalid compact blocks...") self.test_invalid_tx_in_compactblock(self.nodes[0], self.test_node, False) self.test_invalid_tx_in_compactblock(self.nodes[1], self.segwit_node, False) self.test_invalid_tx_in_compactblock(self.nodes[1], self.old_node, False) self.log.info("Testing reconstructing compact blocks from all peers...") self.test_compactblock_reconstruction_multiple_peers(self.nodes[1], self.segwit_node, self.old_node) sync_blocks(self.nodes) # Advance to segwit activation self.log.info("Advancing to segwit activation") self.activate_segwit(self.nodes[1]) self.log.info("Running tests, post-segwit activation...") self.log.info("Testing compactblock construction...") self.test_compactblock_construction(self.nodes[1], self.old_node, 1, True) self.test_compactblock_construction(self.nodes[1], self.segwit_node, 2, True) sync_blocks(self.nodes) self.log.info("Testing compactblock requests (unupgraded node)... ") self.test_compactblock_requests(self.nodes[0], self.test_node, 1, True) self.log.info("Testing getblocktxn requests (unupgraded node)...") self.test_getblocktxn_requests(self.nodes[0], self.test_node, 1) # Need to manually sync node0 and node1, because post-segwit activation, # node1 will not download blocks from node0. self.log.info("Syncing nodes...") assert(self.nodes[0].getbestblockhash() != self.nodes[1].getbestblockhash()) while (self.nodes[0].getblockcount() > self.nodes[1].getblockcount()): block_hash = self.nodes[0].getblockhash(self.nodes[1].getblockcount()+1) self.nodes[1].submitblock(self.nodes[0].getblock(block_hash, False)) assert_equal(self.nodes[0].getbestblockhash(), self.nodes[1].getbestblockhash()) self.log.info("Testing compactblock requests (segwit node)... ") self.test_compactblock_requests(self.nodes[1], self.segwit_node, 2, True) self.log.info("Testing getblocktxn requests (segwit node)...") self.test_getblocktxn_requests(self.nodes[1], self.segwit_node, 2) sync_blocks(self.nodes) self.log.info("Testing getblocktxn handler (segwit node should return witnesses)...") self.test_getblocktxn_handler(self.nodes[1], self.segwit_node, 2) self.test_getblocktxn_handler(self.nodes[1], self.old_node, 1) # Test that if we submitblock to node1, we'll get a compact block # announcement to all peers. # (Post-segwit activation, blocks won't propagate from node0 to node1 # automatically, so don't bother testing a block announced to node0.) self.log.info("Testing end-to-end block relay...") self.request_cb_announcements(self.test_node, self.nodes[0], 1) self.request_cb_announcements(self.old_node, self.nodes[1], 1) self.request_cb_announcements(self.segwit_node, self.nodes[1], 2) self.test_end_to_end_block_relay(self.nodes[1], [self.segwit_node, self.test_node, self.old_node]) self.log.info("Testing handling of invalid compact blocks...") self.test_invalid_tx_in_compactblock(self.nodes[0], self.test_node, False) self.test_invalid_tx_in_compactblock(self.nodes[1], self.segwit_node, True) self.test_invalid_tx_in_compactblock(self.nodes[1], self.old_node, True) self.log.info("Testing invalid index in cmpctblock message...") self.test_invalid_cmpctblock_message() if __name__ == '__main__': CompactBlocksTest().main() </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">47.108253</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">137</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.668912</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">RitoProject/Ravencoin</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">test/functional/p2p_compactblocks.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">43,952</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8794"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">import logging import io from homeassistant.core import callback from homeassistant.components.ais_dom import ais_global from homeassistant.const import EVENT_HOMEASSISTANT_START from homeassistant.components.camera import Camera from homeassistant.helpers.event import async_track_state_change from datetime import timedelta _LOGGER = logging.getLogger(__name__) DEFAULT_NAME = "qr_code" SCAN_INTERVAL = timedelta(seconds=2000) def setup_platform(hass, config, add_entities, discovery_info=None): """Set up the QRCode image platform.""" add_entities([QRCodeCamera(hass, "remote_access", "remote_access")]) class QRCodeCamera(Camera): """Representation of an QRCode image.""" def __init__(self, hass, name, entity_ids): """Initialize the QRCode entity.""" super().__init__() self._hass = hass self._name = name self._entities = entity_ids self._image = io.BytesIO() self._refresh_() async def async_added_to_hass(self): """Register callbacks.""" @callback def qr_state_listener(entity, old_state, new_state): """Handle device state changes.""" self._refresh_() @callback def qr_sensor_startup(event): """Update template on startup.""" async_track_state_change(self.hass, self._entities, qr_state_listener) self.hass.bus.async_listen_once(EVENT_HOMEASSISTANT_START, qr_sensor_startup) @property def name(self): """Return the name of the image processor.""" return self._name @property def should_poll(self): """Update the recording state periodically.""" return True @property def state(self): gate_id = ais_global.get_sercure_android_id_dom() return "https://" + gate_id + ".paczka.pro" def camera_image(self): """Process the image.""" return self._image.getvalue() def turn_on(self): """Turn on camera.""" self._refresh_() def turn_off(self): pass def enable_motion_detection(self): pass def disable_motion_detection(self): pass def _refresh_(self): import pyqrcode import png gate_id = ais_global.get_sercure_android_id_dom() _template = "https://" + gate_id + ".paczka.pro" qr_code = pyqrcode.create(_template) self._image.truncate(0) self._image.seek(0) qr_code.png( self._image, scale=6, module_color=[0, 0, 0], background=[0xFF, 0xFF, 0xFF] ) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">27.168421</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">87</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.655172</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">DRubioBizcaino/AIS-home-assistant</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">homeassistant/components/ais_qrcode/camera.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">2,581</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8795"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from datetime import date, timedelta from app import create_app, new_functions as nf from app.constants import weekend_answer from app.models import User from tg_bot import bot def schedule_sender(): send_cnt, err_cnt = 0, 0 for user in User.query.filter_by(is_subscribed=True).all(): answer = user.create_answer_for_date( for_date=date.today() + timedelta(days=1) ) if answer == weekend_answer: continue try: answer = "Расписание на завтра:\n\n" + answer nf.tgbot_send_long_message(bot, answer, user.tg_id) send_cnt += 1 except Exception as err: print("---------------ERROR START---------------") print(err) print("USER ID:", user.id) print("----------------ERROR END----------------") err_cnt += 1 return send_cnt, err_cnt if __name__ == '__main__': with create_app().app_context(): print("OK: {0}; ERRORS: {1}".format(*schedule_sender())) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">29.514286</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">64</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.573088</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">EeOneDown/spbu4u</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">tg_schedule_sender.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">1,051</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8796"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from collections import defaultdict dd = defaultdict(list) n, m = map(int, input().split()) groupA = [] for i in range(n): a_element = input() dd[a_element].append(str(i+1)) for _ in range(m): b_element = input() if b_element not in dd: print(-1) else: print(" ".join(dd[b_element])) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">18</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">38</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.601852</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">rawat9/HackerRank</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python/Collections/DefaultDict Tutorial/solution.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">324</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8797"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">#!/usr/bin/env python from setuptools import setup with open('README.md') as f: long_description = f.read() setup(name="pipelinewise-target-s3-csv", version="1.4.0", description="Singer.io target for writing CSV files and upload to S3 - PipelineWise compatible", long_description=long_description, long_description_content_type='text/markdown', author="TransferWise", url='https://github.com/transferwise/pipelinewise-target-s3-csv', classifiers=[ 'License :: OSI Approved :: Apache Software License', 'Programming Language :: Python :: 3 :: Only' ], py_modules=["target_s3_csv"], install_requires=[ 'pipelinewise-singer-python==1.*', 'inflection==0.3.1', 'boto3==1.9.57', ], extras_require={ "test": [ "nose==1.3.7", "pylint==2.4.2" ] }, entry_points=""" [console_scripts] target-s3-csv=target_s3_csv:main """, packages=["target_s3_csv"], package_data = {}, include_package_data=True, ) </span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">28.769231</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">102</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.583779</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "Apache-2.0" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">EasyPost/pipelinewise-target-s3-csv</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">setup.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">1,122</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8798"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">from datetime import datetime import logging import os import subprocess import sys from argparse import Namespace logging.getLogger("transformers").setLevel(logging.WARNING) import click import torch from luke.utils.model_utils import ModelArchive from zero.utils.experiment_logger import commet_logger_args, CometLogger, NullLogger LOG_FORMAT = "[%(asctime)s] [%(levelname)s] %(message)s (%(funcName)s@%(filename)s:%(lineno)s)" try: import absl.logging # https://github.com/tensorflow/tensorflow/issues/27045#issuecomment-519642980 logging.getLogger().removeHandler(absl.logging._absl_handler) absl.logging._warn_preinit_stderr = False except ImportError: pass logger = logging.getLogger(__name__) @click.group() @click.option( "--output-dir", default="models", type=click.Path() ) @click.option("--num-gpus", default=1) @click.option("--experiment-logger", "--logger", type=click.Choice(["comet"])) @click.option("--master-port", default=29500) @click.option("--local-rank", "--local_rank", default=-1) @click.option("--model-file", type=click.Path(exists=True)) @click.option("--device-id", type=int) @commet_logger_args @click.pass_context def cli(ctx, **kwargs): args = Namespace(**kwargs) if args.local_rank == -1 and args.num_gpus > 1: current_env = os.environ.copy() current_env["MASTER_ADDR"] = "127.0.0.1" current_env["MASTER_PORT"] = str(args.master_port) current_env["WORLD_SIZE"] = str(args.num_gpus) processes = [] for args.local_rank in range(0, args.num_gpus): current_env["RANK"] = str(args.local_rank) current_env["LOCAL_RANK"] = str(args.local_rank) cmd = [sys.executable, "-u", "-m", "examples.cli", "--local-rank={}".format(args.local_rank)] cmd.extend(sys.argv[1:]) process = subprocess.Popen(cmd, env=current_env) processes.append(process) for process in processes: process.wait() if process.returncode != 0: raise subprocess.CalledProcessError(returncode=process.returncode, cmd=cmd) sys.exit(0) else: if args.local_rank not in (-1, 0): logging.basicConfig(format=LOG_FORMAT, level=logging.WARNING) else: logging.basicConfig(format=LOG_FORMAT, level=logging.INFO) if not os.path.exists(args.output_dir) and args.local_rank in [-1, 0]: os.makedirs(args.output_dir) logger.info("Output dir: %s", args.output_dir) # NOTE: ctx.obj is documented here: http://click.palletsprojects.com/en/7.x/api/#click.Context.obj ctx.obj = dict(local_rank=args.local_rank, output_dir=args.output_dir) if args.num_gpus == 0: ctx.obj["device"] = torch.device("cpu") elif args.local_rank == -1: ctx.obj["device"] = torch.device("cuda:{}".format(args.device_id)) else: torch.cuda.set_device(args.local_rank) ctx.obj["device"] = torch.device("cuda", args.local_rank) torch.distributed.init_process_group(backend="nccl") experiment_logger = NullLogger() if args.local_rank in (-1, 0) and args.experiment_logger == "comet": experiment_logger = CometLogger(args) experiment_logger.log_parameters({p.name: getattr(args, p.name) for p in cli.params}) ctx.obj["experiment"] = experiment_logger if args.model_file: model_archive = ModelArchive.load(args.model_file) ctx.obj["tokenizer"] = model_archive.tokenizer ctx.obj["entity_vocab"] = model_archive.entity_vocab ctx.obj["bert_model_name"] = model_archive.bert_model_name ctx.obj["model_config"] = model_archive.config ctx.obj["max_mention_length"] = model_archive.max_mention_length ctx.obj["model_weights"] = model_archive.state_dict experiment_logger.log_parameter("model_file_name", os.path.basename(args.model_file)) from zero.ner.main import cli as ner_cli cli.add_command(ner_cli) if __name__ == "__main__": cli()</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">35.307692</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">106</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.663762</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">nguyenvanhoang7398/nndl2-project</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">zero/cli.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">4,131</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr><tr class="group cursor-pointer space-x-4 divide-x border-b outline-offset-[-2px] odd:bg-gray-50 hover:bg-gray-100 dark:odd:bg-gray-925 dark:hover:bg-gray-850 " tabindex="0" data-row-idx="8799"><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">count=0 n=4 for i in range(1,n+1): for j in range(1,n+1): if i==j: continue for k in range(1,n+1): if i==k or j==k: continue count += 1 print(f"第{count}种方案:甲担任{i}号课代表,乙担任{j}号课代表,丙担任{k}号课代表") print(f"一共{count}种方案")</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">22.923077</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">66</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">0.466443</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-left" dir="auto"><div><button class="float-right ml-2 mr-0.5 mt-1 flex items-center justify-center rounded-full bg-white p-1.5 text-gray-700 ring-1 ring-gray-300 transition hover:bg-gray-50 hover:text-gray-900 hover:shadow-sm dark:bg-gray-800 dark:text-gray-100 dark:ring-gray-600 dark:hover:bg-gray-700 dark:hover:text-white"><svg class="text-sm" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path fill-rule="evenodd" clip-rule="evenodd" d="M8.917 2.25h-.834v.833h.834v2.084A.833.833 0 0 0 9.75 6a.833.833 0 0 0-.833.833v2.084h-.834v.833h.834c.446-.113.833-.375.833-.833V7.25a.833.833 0 0 1 .833-.833H11v-.834h-.417a.833.833 0 0 1-.833-.833V3.083a.833.833 0 0 0-.833-.833Zm-5.834 0a.833.833 0 0 0-.833.833V4.75a.833.833 0 0 1-.833.833H1v.834h.417a.833.833 0 0 1 .833.833v1.667a.833.833 0 0 0 .833.833h.834v-.833h-.834V6.833A.833.833 0 0 0 2.25 6a.833.833 0 0 0 .833-.833V3.083h.834V2.25h-.834ZM6 7.25a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm1.667 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Zm-3.334 0a.417.417 0 1 0 0 .833.417.417 0 0 0 0-.833Z" fill="currentColor"></path></svg></button> <span class="block min-h-[2rem]">[ "MIT" ]</span></div></div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">royqh1979/programming_with_python</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Chap02Loops/5-4.无重复组合.py</span></div> </div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="text-right" dir="auto">364</div></div> </td><td class="min-w-fit max-w-sm break-words p-2 "><div class="line-clamp-2 "><div class="" dir="auto"> <div> <span class="block ">Python</span></div> </div></div> </td> </tr></tbody></table> </div> <div class="bg-linear-to-b from-gray-100 to-white dark:from-gray-950 dark:to-gray-900 rounded-b-lg"><hr class="flex-none -translate-y-px border-t border-dashed border-gray-300 bg-white dark:border-gray-700 dark:bg-gray-950"> <nav><ul class="flex select-none items-center justify-between space-x-2 text-gray-700 sm:justify-center py-1 text-center font-mono text-xs "><li><a class="flex items-center rounded-lg px-2.5 py-1 hover:bg-gray-50 dark:hover:bg-gray-800 " href="/datasets/ml6team/the-stack-smol-python/viewer/default/train?p=86"><svg class="mr-1.5" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 32 32"><path d="M10 16L20 6l1.4 1.4l-8.6 8.6l8.6 8.6L20 26z" fill="currentColor"></path></svg> Previous</a></li> <li class="hidden sm:block"><a class="rounded-lg px-2.5 py-1 hover:bg-gray-50 dark:hover:bg-gray-800" href="/datasets/ml6team/the-stack-smol-python/viewer/default/train?p=0">1</a> </li><li class="hidden sm:block"><a class="rounded-lg px-2.5 py-1 pointer-events-none cursor-default" href="#">...</a> </li><li class="hidden sm:block"><a class="rounded-lg px-2.5 py-1 hover:bg-gray-50 dark:hover:bg-gray-800" href="/datasets/ml6team/the-stack-smol-python/viewer/default/train?p=85">86</a> </li><li class="hidden sm:block"><a class="rounded-lg px-2.5 py-1 hover:bg-gray-50 dark:hover:bg-gray-800" href="/datasets/ml6team/the-stack-smol-python/viewer/default/train?p=86">87</a> </li><li class="hidden sm:block"><a class="rounded-lg px-2.5 py-1 bg-gray-50 font-semibold ring-1 ring-inset ring-gray-200 dark:bg-gray-900 dark:text-yellow-500 dark:ring-gray-900 hover:bg-gray-50 dark:hover:bg-gray-800" href="/datasets/ml6team/the-stack-smol-python/viewer/default/train?p=87">88</a> </li><li class="hidden sm:block"><a class="rounded-lg px-2.5 py-1 hover:bg-gray-50 dark:hover:bg-gray-800" href="/datasets/ml6team/the-stack-smol-python/viewer/default/train?p=88">89</a> </li><li class="hidden sm:block"><a class="rounded-lg px-2.5 py-1 hover:bg-gray-50 dark:hover:bg-gray-800" href="/datasets/ml6team/the-stack-smol-python/viewer/default/train?p=89">90</a> </li><li class="hidden sm:block"><a class="rounded-lg px-2.5 py-1 pointer-events-none cursor-default" href="#">...</a> </li><li class="hidden sm:block"><a class="rounded-lg px-2.5 py-1 hover:bg-gray-50 dark:hover:bg-gray-800" href="/datasets/ml6team/the-stack-smol-python/viewer/default/train?p=99">100</a> </li> <li><a class="flex items-center rounded-lg px-2.5 py-1 hover:bg-gray-50 dark:hover:bg-gray-800 " href="/datasets/ml6team/the-stack-smol-python/viewer/default/train?p=88">Next <svg class="ml-1.5 transform rotate-180" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 32 32"><path d="M10 16L20 6l1.4 1.4l-8.6 8.6l8.6 8.6L20 26z" fill="currentColor"></path></svg></a></li></ul></nav></div></div> </div></div></div></div></div></div></div> <div class="hidden items-center md:flex"> <div class="mx-1 flex items-center justify-center"><div class="h-8 w-1 cursor-ew-resize rounded-full bg-gray-200 hover:bg-gray-400 dark:bg-gray-700 dark:hover:bg-gray-600 max-sm:hidden" role="separator"></div></div> <div class="flex h-full flex-col" style="height: calc(100vh - 48px)"><div class="my-4 mr-4 h-full overflow-auto rounded-lg border shadow-lg dark:border-gray-800" style="width: 480px"><div class="flex h-full flex-col"><div class="flex flex-col "> <div class="px-4 md:mt-4"><div class="mb-4 flex justify-end"> <span class="inline-block w-full flex justify-center"><span class="contents"><div class="flex w-full flex-col rounded-lg border-slate-200 bg-white p-2 shadow-md ring-1 ring-slate-200 dark:border-slate-700 dark:bg-slate-800 dark:ring-slate-700"> <div class="mt-0 flex items-start gap-1"><div class="flex items-center rounded-md bg-slate-100 p-2 dark:bg-slate-700"><svg class="size-4 text-gray-700 dark:text-gray-300" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 11 11"><path fill="currentColor" d="M4.881 4.182c0 .101-.031.2-.087.283a.5.5 0 0 1-.242.18l-.65.217a1.3 1.3 0 0 0-.484.299 1.3 1.3 0 0 0-.298.484l-.222.639a.46.46 0 0 1-.18.242.5.5 0 0 1-.288.092.5.5 0 0 1-.294-.097.5.5 0 0 1-.175-.242l-.211-.644a1.26 1.26 0 0 0-.299-.48 1.14 1.14 0 0 0-.479-.298L.328 4.64a.48.48 0 0 1-.247-.18.515.515 0 0 1 .247-.758l.644-.21a1.28 1.28 0 0 0 .788-.789l.211-.634a.5.5 0 0 1 .165-.242.5.5 0 0 1 .283-.103.5.5 0 0 1 .294.083c.086.058.152.14.19.237l.217.659a1.28 1.28 0 0 0 .788.788l.644.222a.476.476 0 0 1 .237.18.5.5 0 0 1 .092.288"></path><path fill="currentColor" d="M10.031 7.458a.5.5 0 0 1-.098.314.5.5 0 0 1-.267.196l-.881.293c-.272.09-.519.242-.721.443a1.8 1.8 0 0 0-.443.721l-.31.876a.5.5 0 0 1-.185.263.56.56 0 0 1-.319.098.515.515 0 0 1-.515-.366l-.294-.88a1.8 1.8 0 0 0-.443-.722c-.204-.2-.45-.353-.72-.448l-.881-.288a.57.57 0 0 1-.263-.191.56.56 0 0 1-.014-.64.5.5 0 0 1 .271-.194l.886-.294A1.82 1.82 0 0 0 6.01 5.465l.293-.87a.515.515 0 0 1 .49-.377c.11 0 .219.03.314.088a.56.56 0 0 1 .206.263l.298.896a1.82 1.82 0 0 0 1.175 1.174l.875.31a.5.5 0 0 1 .263.195c.07.09.108.2.108.314"></path><path fill="currentColor" d="M7.775 1.684a.5.5 0 0 0 .088-.262.45.45 0 0 0-.088-.263.5.5 0 0 0-.21-.155L7.24.896a.5.5 0 0 1-.165-.103.5.5 0 0 1-.103-.17l-.108-.33a.5.5 0 0 0-.165-.21A.5.5 0 0 0 6.426 0a.5.5 0 0 0-.252.098.5.5 0 0 0-.145.206l-.108.32a.5.5 0 0 1-.103.17.5.5 0 0 1-.17.102L5.334 1a.45.45 0 0 0-.216.155.5.5 0 0 0-.088.262c0 .094.029.186.083.263a.5.5 0 0 0 .216.16l.32.103q.095.03.164.103a.37.37 0 0 1 .103.165l.108.319c.031.09.088.17.165.227a.56.56 0 0 0 .252.077.42.42 0 0 0 .268-.093.5.5 0 0 0 .15-.2l.113-.325a.43.43 0 0 1 .268-.268l.32-.108a.42.42 0 0 0 .215-.155"></path></svg></div> <div class="flex min-w-0 flex-1"><textarea placeholder="Ask AI to help write your query..." class="max-h-64 min-h-8 w-full resize-none overflow-y-auto border-none bg-transparent py-1 text-sm leading-6 text-slate-700 placeholder-slate-400 [scrollbar-width:thin] focus:ring-0 dark:text-slate-200 dark:placeholder-slate-400" rows="1"></textarea> </div> </div> </div></span> </span></div> <div class="relative flex flex-col rounded-md bg-gray-100 pt-2 dark:bg-gray-800/50"> <div class="flex h-64 items-center justify-center "><svg class="animate-spin text-xs" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" fill="none" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 12 12"><path class="opacity-75" fill-rule="evenodd" clip-rule="evenodd" d="M6 0C2.6862 0 0 2.6862 0 6H1.8C1.8 4.88609 2.2425 3.8178 3.03015 3.03015C3.8178 2.2425 4.88609 1.8 6 1.8V0ZM12 6C12 9.3138 9.3138 12 6 12V10.2C7.11391 10.2 8.1822 9.7575 8.96985 8.96985C9.7575 8.1822 10.2 7.11391 10.2 6H12Z" fill="currentColor"></path><path class="opacity-25" fill-rule="evenodd" clip-rule="evenodd" d="M3.03015 8.96985C3.8178 9.7575 4.88609 10.2 6 10.2V12C2.6862 12 0 9.3138 0 6H1.8C1.8 7.11391 2.2425 8.1822 3.03015 8.96985ZM7.60727 2.11971C7.0977 1.90864 6.55155 1.8 6 1.8V0C9.3138 0 12 2.6862 12 6H10.2C10.2 5.44845 10.0914 4.9023 9.88029 4.39273C9.66922 3.88316 9.35985 3.42016 8.96985 3.03015C8.57984 2.64015 8.11684 2.33078 7.60727 2.11971Z" fill="currentColor"></path></svg></div></div> <div class="mt-2 flex flex-col gap-2"><div class="flex items-center justify-between max-sm:text-sm"><div class="flex w-full items-center justify-between gap-4"> <span class="flex flex-shrink-0 items-center gap-1"><span class="font-semibold">Subsets and Splits</span> <span class="inline-block "><span class="contents"><svg class="text-xs text-gray-500 dark:text-gray-400" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" aria-hidden="true" focusable="false" role="img" width="1em" height="1em" preserveAspectRatio="xMidYMid meet" viewBox="0 0 32 32"><path d="M17 22v-8h-4v2h2v6h-3v2h8v-2h-3z" fill="currentColor"></path><path d="M16 8a1.5 1.5 0 1 0 1.5 1.5A1.5 1.5 0 0 0 16 8z" fill="currentColor"></path><path d="M16 30a14 14 0 1 1 14-14a14 14 0 0 1-14 14zm0-26a12 12 0 1 0 12 12A12 12 0 0 0 16 4z" fill="currentColor"></path></svg></span> </span> </span> <div class="ml-4 flex flex-1 items-center justify-end gap-1"> </div></div></div> <div class="flex flex-nowrap gap-1 overflow-x-auto"></div></div> <button type="button" class="btn mt-2 h-10 w-full text-sm font-semibold md:text-base" ><span class="flex items-center gap-1.5"> <span>Run Query</span> <span class="shadow-xs ml-2 hidden items-center rounded-sm border bg-white px-0.5 text-xs font-medium text-gray-700 sm:inline-flex">Ctrl+↵</span></span></button></div> <div class="flex flex-col px-2 pb-4"></div></div> <div class="mt-auto pb-4"><div class="flex justify-center"><div class="w-full sm:px-4"><div class="mb-3"><ul class="flex gap-1 text-sm "><li><button class="flex items-center whitespace-nowrap rounded-lg px-2 text-gray-500 hover:bg-gray-100 hover:text-gray-700 dark:hover:bg-gray-900 dark:hover:text-gray-300">Saved Queries </button> </li><li><button class="flex items-center whitespace-nowrap rounded-lg px-2 bg-black text-white dark:bg-gray-800">Top Community Queries </button> </li></ul></div> <div class="h-48 overflow-y-auto"><div class="flex flex-col gap-2"><div class="flex h-48 flex-col items-center justify-center rounded border border-gray-200 bg-gray-50 p-4 text-center dark:border-gray-700/60 dark:bg-gray-900"><p class="mb-1 font-semibold text-gray-600 dark:text-gray-400">No community queries yet</p> <p class="max-w-xs text-xs text-gray-500 dark:text-gray-400">The top public SQL queries from the community will appear here once available.</p></div></div></div></div></div></div></div></div></div></div> </div></div></div></main> </div> <script data-cfasync="false" src="/cdn-cgi/scripts/5c5dd728/cloudflare-static/email-decode.min.js"></script><script> import("\/front\/build\/kube-16c1f71\/index.js"); window.moonSha = "kube-16c1f71\/"; window.__hf_deferred = {}; </script> <!-- Stripe --> <script> if (["hf.co", "huggingface.co"].includes(window.location.hostname)) { const script = document.createElement("script"); script.src = "https://js.stripe.com/v3/"; script.async = true; document.head.appendChild(script); } </script> </body> </html>