{ // 获取包含Hugging Face文本的span元素 const spans = link.querySelectorAll('span.whitespace-nowrap, span.hidden.whitespace-nowrap'); spans.forEach(span => { if (span.textContent && span.textContent.trim().match(/Hugging\s*Face/i)) { span.textContent = 'AI快站'; } }); }); // 替换logo图片的alt属性 document.querySelectorAll('img[alt*="Hugging"], img[alt*="Face"]').forEach(img => { if (img.alt.match(/Hugging\s*Face/i)) { img.alt = 'AI快站 logo'; } }); } // 替换导航栏中的链接 function replaceNavigationLinks() { // 已替换标记,防止重复运行 if (window._navLinksReplaced) { return; } // 已经替换过的链接集合,防止重复替换 const replacedLinks = new Set(); // 只在导航栏区域查找和替换链接 const headerArea = document.querySelector('header') || document.querySelector('nav'); if (!headerArea) { return; } // 在导航区域内查找链接 const navLinks = headerArea.querySelectorAll('a'); navLinks.forEach(link => { // 如果已经替换过,跳过 if (replacedLinks.has(link)) return; const linkText = link.textContent.trim(); const linkHref = link.getAttribute('href') || ''; // 替换Spaces链接 - 仅替换一次 if ( (linkHref.includes('/spaces') || linkHref === '/spaces' || linkText === 'Spaces' || linkText.match(/^s*Spacess*$/i)) && linkText !== 'OCR模型免费转Markdown' && linkText !== 'OCR模型免费转Markdown' ) { link.textContent = 'OCR模型免费转Markdown'; link.href = 'https://fast360.xyz'; link.setAttribute('target', '_blank'); link.setAttribute('rel', 'noopener noreferrer'); replacedLinks.add(link); } // 删除Posts链接 else if ( (linkHref.includes('/posts') || linkHref === '/posts' || linkText === 'Posts' || linkText.match(/^s*Postss*$/i)) ) { if (link.parentNode) { link.parentNode.removeChild(link); } replacedLinks.add(link); } // 替换Docs链接 - 仅替换一次 else if ( (linkHref.includes('/docs') || linkHref === '/docs' || linkText === 'Docs' || linkText.match(/^s*Docss*$/i)) && linkText !== '模型下载攻略' ) { link.textContent = '模型下载攻略'; link.href = '/'; replacedLinks.add(link); } // 删除Enterprise链接 else if ( (linkHref.includes('/enterprise') || linkHref === '/enterprise' || linkText === 'Enterprise' || linkText.match(/^s*Enterprises*$/i)) ) { if (link.parentNode) { link.parentNode.removeChild(link); } replacedLinks.add(link); } }); // 查找可能嵌套的Spaces和Posts文本 const textNodes = []; function findTextNodes(element) { if (element.nodeType === Node.TEXT_NODE) { const text = element.textContent.trim(); if (text === 'Spaces' || text === 'Posts' || text === 'Enterprise') { textNodes.push(element); } } else { for (const child of element.childNodes) { findTextNodes(child); } } } // 只在导航区域内查找文本节点 findTextNodes(headerArea); // 替换找到的文本节点 textNodes.forEach(node => { const text = node.textContent.trim(); if (text === 'Spaces') { node.textContent = node.textContent.replace(/Spaces/g, 'OCR模型免费转Markdown'); } else if (text === 'Posts') { // 删除Posts文本节点 if (node.parentNode) { node.parentNode.removeChild(node); } } else if (text === 'Enterprise') { // 删除Enterprise文本节点 if (node.parentNode) { node.parentNode.removeChild(node); } } }); // 标记已替换完成 window._navLinksReplaced = true; } // 替换代码区域中的域名 function replaceCodeDomains() { // 特别处理span.hljs-string和span.njs-string元素 document.querySelectorAll('span.hljs-string, span.njs-string, span[class*="hljs-string"], span[class*="njs-string"]').forEach(span => { if (span.textContent && span.textContent.includes('huggingface.co')) { span.textContent = span.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 替换hljs-string类的span中的域名(移除多余的转义符号) document.querySelectorAll('span.hljs-string, span[class*="hljs-string"]').forEach(span => { if (span.textContent && span.textContent.includes('huggingface.co')) { span.textContent = span.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 替换pre和code标签中包含git clone命令的域名 document.querySelectorAll('pre, code').forEach(element => { if (element.textContent && element.textContent.includes('git clone')) { const text = element.innerHTML; if (text.includes('huggingface.co')) { element.innerHTML = text.replace(/huggingface.co/g, 'aifasthub.com'); } } }); // 处理特定的命令行示例 document.querySelectorAll('pre, code').forEach(element => { const text = element.innerHTML; if (text.includes('huggingface.co')) { // 针对git clone命令的专门处理 if (text.includes('git clone') || text.includes('GIT_LFS_SKIP_SMUDGE=1')) { element.innerHTML = text.replace(/huggingface.co/g, 'aifasthub.com'); } } }); // 特别处理模型下载页面上的代码片段 document.querySelectorAll('.flex.border-t, .svelte_hydrator, .inline-block').forEach(container => { const content = container.innerHTML; if (content && content.includes('huggingface.co')) { container.innerHTML = content.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 特别处理模型仓库克隆对话框中的代码片段 try { // 查找包含"Clone this model repository"标题的对话框 const cloneDialog = document.querySelector('.svelte_hydration_boundary, [data-target="MainHeader"]'); if (cloneDialog) { // 查找对话框中所有的代码片段和命令示例 const codeElements = cloneDialog.querySelectorAll('pre, code, span'); codeElements.forEach(element => { if (element.textContent && element.textContent.includes('huggingface.co')) { if (element.innerHTML.includes('huggingface.co')) { element.innerHTML = element.innerHTML.replace(/huggingface.co/g, 'aifasthub.com'); } else { element.textContent = element.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } } }); } // 更精确地定位克隆命令中的域名 document.querySelectorAll('[data-target]').forEach(container => { const codeBlocks = container.querySelectorAll('pre, code, span.hljs-string'); codeBlocks.forEach(block => { if (block.textContent && block.textContent.includes('huggingface.co')) { if (block.innerHTML.includes('huggingface.co')) { block.innerHTML = block.innerHTML.replace(/huggingface.co/g, 'aifasthub.com'); } else { block.textContent = block.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } } }); }); } catch (e) { // 错误处理但不打印日志 } } // 当DOM加载完成后执行替换 if (document.readyState === 'loading') { document.addEventListener('DOMContentLoaded', () => { replaceHeaderBranding(); replaceNavigationLinks(); replaceCodeDomains(); // 只在必要时执行替换 - 3秒后再次检查 setTimeout(() => { if (!window._navLinksReplaced) { console.log('[Client] 3秒后重新检查导航链接'); replaceNavigationLinks(); } }, 3000); }); } else { replaceHeaderBranding(); replaceNavigationLinks(); replaceCodeDomains(); // 只在必要时执行替换 - 3秒后再次检查 setTimeout(() => { if (!window._navLinksReplaced) { console.log('[Client] 3秒后重新检查导航链接'); replaceNavigationLinks(); } }, 3000); } // 增加一个MutationObserver来处理可能的动态元素加载 const observer = new MutationObserver(mutations => { // 检查是否导航区域有变化 const hasNavChanges = mutations.some(mutation => { // 检查是否存在header或nav元素变化 return Array.from(mutation.addedNodes).some(node => { if (node.nodeType === Node.ELEMENT_NODE) { // 检查是否是导航元素或其子元素 if (node.tagName === 'HEADER' || node.tagName === 'NAV' || node.querySelector('header, nav')) { return true; } // 检查是否在导航元素内部 let parent = node.parentElement; while (parent) { if (parent.tagName === 'HEADER' || parent.tagName === 'NAV') { return true; } parent = parent.parentElement; } } return false; }); }); // 只在导航区域有变化时执行替换 if (hasNavChanges) { // 重置替换状态,允许再次替换 window._navLinksReplaced = false; replaceHeaderBranding(); replaceNavigationLinks(); } }); // 开始观察document.body的变化,包括子节点 if (document.body) { observer.observe(document.body, { childList: true, subtree: true }); } else { document.addEventListener('DOMContentLoaded', () => { observer.observe(document.body, { childList: true, subtree: true }); }); } })(); ')\nhtml_file.close()\nwebbrowser.open('out.html')\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-9088434750835889000,"string":"-9,088,434,750,835,889,000"},"line_mean":{"kind":"number","value":45.1413043478,"string":"45.141304"},"line_max":{"kind":"number","value":122,"string":"122"},"alpha_frac":{"kind":"number","value":0.6237926973,"string":"0.623793"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":2.983134223471539,"string":"2.983134"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44962,"cells":{"repo_name":{"kind":"string","value":"patriciohc/carga-de-xls-a-MySQL"},"path":{"kind":"string","value":"Choose_file.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"3639"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\n# Form implementation generated from reading ui file 'Choose_file.ui'\n#\n# Created: Sat Oct 17 15:55:19 2015\n# by: PyQt4 UI code generator 4.10.4\n#\n# WARNING! All changes made in this file will be lost!\n\nfrom PyQt4 import QtCore, QtGui\n\ntry:\n _fromUtf8 = QtCore.QString.fromUtf8\nexcept AttributeError:\n def _fromUtf8(s):\n return s\n\ntry:\n _encoding = QtGui.QApplication.UnicodeUTF8\n def _translate(context, text, disambig):\n return QtGui.QApplication.translate(context, text, disambig, _encoding)\nexcept AttributeError:\n def _translate(context, text, disambig):\n return QtGui.QApplication.translate(context, text, disambig)\n\nclass Ui_MainWindow(object):\n def setupUi(self, MainWindow):\n MainWindow.setObjectName(_fromUtf8(\"MainWindow\"))\n MainWindow.resize(524, 146)\n self.centralwidget = QtGui.QWidget(MainWindow)\n self.centralwidget.setObjectName(_fromUtf8(\"centralwidget\"))\n self.verticalLayoutWidget = QtGui.QWidget(self.centralwidget)\n self.verticalLayoutWidget.setGeometry(QtCore.QRect(10, 10, 501, 81))\n self.verticalLayoutWidget.setObjectName(_fromUtf8(\"verticalLayoutWidget\"))\n self.verticalLayout = QtGui.QVBoxLayout(self.verticalLayoutWidget)\n self.verticalLayout.setMargin(0)\n self.verticalLayout.setObjectName(_fromUtf8(\"verticalLayout\"))\n self.horizontalLayout_2 = QtGui.QHBoxLayout()\n self.horizontalLayout_2.setObjectName(_fromUtf8(\"horizontalLayout_2\"))\n self.label = QtGui.QLabel(self.verticalLayoutWidget)\n self.label.setObjectName(_fromUtf8(\"label\"))\n self.horizontalLayout_2.addWidget(self.label)\n self.txtFile = QtGui.QLineEdit(self.verticalLayoutWidget)\n self.txtFile.setObjectName(_fromUtf8(\"txtFile\"))\n self.horizontalLayout_2.addWidget(self.txtFile)\n self.btChooseFile = QtGui.QPushButton(self.verticalLayoutWidget)\n self.btChooseFile.setObjectName(_fromUtf8(\"btChooseFile\"))\n self.horizontalLayout_2.addWidget(self.btChooseFile)\n self.verticalLayout.addLayout(self.horizontalLayout_2)\n self.horizontalLayout = QtGui.QHBoxLayout()\n self.horizontalLayout.setObjectName(_fromUtf8(\"horizontalLayout\"))\n self.btClose = QtGui.QPushButton(self.verticalLayoutWidget)\n self.btClose.setObjectName(_fromUtf8(\"btClose\"))\n self.horizontalLayout.addWidget(self.btClose)\n self.btLoadFile = QtGui.QPushButton(self.verticalLayoutWidget)\n self.btLoadFile.setObjectName(_fromUtf8(\"btLoadFile\"))\n self.horizontalLayout.addWidget(self.btLoadFile)\n self.verticalLayout.addLayout(self.horizontalLayout)\n MainWindow.setCentralWidget(self.centralwidget)\n self.menubar = QtGui.QMenuBar(MainWindow)\n self.menubar.setGeometry(QtCore.QRect(0, 0, 524, 25))\n self.menubar.setObjectName(_fromUtf8(\"menubar\"))\n MainWindow.setMenuBar(self.menubar)\n self.statusbar = QtGui.QStatusBar(MainWindow)\n self.statusbar.setObjectName(_fromUtf8(\"statusbar\"))\n MainWindow.setStatusBar(self.statusbar)\n\n self.retranslateUi(MainWindow)\n QtCore.QMetaObject.connectSlotsByName(MainWindow)\n\n def retranslateUi(self, MainWindow):\n MainWindow.setWindowTitle(_translate(\"MainWindow\", \"MainWindow\", None))\n self.label.setText(_translate(\"MainWindow\", \"File\", None))\n self.btChooseFile.setText(_translate(\"MainWindow\", \"Choose\", None))\n self.btClose.setText(_translate(\"MainWindow\", \"Cerrar\", None))\n self.btLoadFile.setText(_translate(\"MainWindow\", \"Cargar Archivo\", None))\n\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":-8237645389629048000,"string":"-8,237,645,389,629,048,000"},"line_mean":{"kind":"number","value":46.2597402597,"string":"46.25974"},"line_max":{"kind":"number","value":82,"string":"82"},"alpha_frac":{"kind":"number","value":0.7180544106,"string":"0.718054"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.206936416184971,"string":"4.206936"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44963,"cells":{"repo_name":{"kind":"string","value":"c0cky/mediathread"},"path":{"kind":"string","value":"mediathread/djangosherd/api.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"4549"},"content":{"kind":"string","value":"# pylint: disable-msg=R0904\nfrom tastypie import fields\nfrom tastypie.resources import ModelResource\n\nfrom mediathread.api import UserResource, TagResource\nfrom mediathread.assetmgr.models import Asset\nfrom mediathread.djangosherd.models import SherdNote, DiscussionIndex\nfrom mediathread.projects.models import ProjectNote\nfrom mediathread.taxonomy.api import TermResource\nfrom mediathread.taxonomy.models import TermRelationship\n\n\nclass SherdNoteResource(ModelResource):\n author = fields.ForeignKey(UserResource, 'author',\n full=True, null=True, blank=True)\n\n class Meta:\n queryset = SherdNote.objects.select_related('asset').order_by(\"id\")\n excludes = ['tags', 'body', 'added', 'modified']\n list_allowed_methods = []\n detail_allowed_methods = []\n\n def dehydrate(self, bundle):\n try:\n bundle.data['is_global_annotation'] = \\\n bundle.obj.is_global_annotation()\n bundle.data['asset_id'] = str(bundle.obj.asset.id)\n bundle.data['is_null'] = bundle.obj.is_null()\n bundle.data['annotation'] = bundle.obj.annotation()\n bundle.data['url'] = bundle.obj.get_absolute_url()\n\n modified = bundle.obj.modified.strftime(\"%m/%d/%y %I:%M %p\") \\\n if bundle.obj.modified else ''\n\n bundle.data['metadata'] = {\n 'tags': TagResource().render_list(bundle.request,\n bundle.obj.tags_split()),\n 'body': bundle.obj.body.strip() if bundle.obj.body else '',\n 'primary_type': bundle.obj.asset.primary.label,\n 'modified': modified,\n 'timecode': bundle.obj.range_as_timecode(),\n 'title': bundle.obj.title\n }\n\n editable = (bundle.request.user.id ==\n getattr(bundle.obj, 'author_id', -1))\n citable = bundle.request.GET.get('citable', '') == 'true'\n\n # assumed: there is only one ProjectNote per annotation\n reference = ProjectNote.objects.filter(\n annotation__id=bundle.obj.id).first()\n if reference:\n # notes in a submitted response are not editable\n editable = editable and not reference.project.is_submitted()\n\n if citable:\n # this is a heavy operation. don't call it unless needed\n citable = reference.project.can_cite(bundle.request.course,\n bundle.request.user)\n\n bundle.data['editable'] = editable\n bundle.data['citable'] = citable\n\n termResource = TermResource()\n vocabulary = {}\n related = TermRelationship.objects.get_for_object(\n bundle.obj).prefetch_related('term__vocabulary')\n for rel in related:\n if rel.term.vocabulary.id not in vocabulary:\n vocabulary[rel.term.vocabulary.id] = {\n 'id': rel.term.vocabulary.id,\n 'display_name': rel.term.vocabulary.display_name,\n 'terms': []\n }\n vocabulary[rel.term.vocabulary.id]['terms'].append(\n termResource.render_one(bundle.request, rel.term))\n bundle.data['vocabulary'] = vocabulary.values()\n except Asset.DoesNotExist:\n bundle.data['asset_id'] = ''\n bundle.data['metadata'] = {'title': 'Item Deleted'}\n return bundle\n\n def render_one(self, request, selection, asset_key):\n # assumes user is allowed to see this note\n bundle = self.build_bundle(obj=selection, request=request)\n dehydrated = self.full_dehydrate(bundle)\n bundle.data['asset_key'] = '%s_%s' % (asset_key,\n bundle.data['asset_id'])\n return self._meta.serializer.to_simple(dehydrated, None)\n\n\nclass DiscussionIndexResource(object):\n\n def render_list(self, request, indicies):\n collaborations = DiscussionIndex.with_permission(request, indicies)\n\n ctx = {\n 'references': [{\n 'id': obj.collaboration.object_pk,\n 'title': obj.collaboration.title,\n 'type': obj.get_type_label(),\n 'url': obj.get_absolute_url(),\n 'modified': obj.modified.strftime(\"%m/%d/%y %I:%M %p\")}\n for obj in collaborations]}\n\n return ctx\n"},"license":{"kind":"string","value":"gpl-2.0"},"hash":{"kind":"number","value":-7704276080529471000,"string":"-7,704,276,080,529,471,000"},"line_mean":{"kind":"number","value":41.9150943396,"string":"41.915094"},"line_max":{"kind":"number","value":79,"string":"79"},"alpha_frac":{"kind":"number","value":0.5638601891,"string":"0.56386"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.275375939849624,"string":"4.275376"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44964,"cells":{"repo_name":{"kind":"string","value":"fdslight/fdslight"},"path":{"kind":"string","value":"freenet/handlers/tundev.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"5566"},"content":{"kind":"string","value":"#!/usr/bin/env python3\n\nimport os, sys\nimport pywind.evtframework.handlers.handler as handler\nimport freenet.lib.fn_utils as fn_utils\nimport freenet.lib.simple_qos as simple_qos\n\ntry:\n import fcntl\nexcept ImportError:\n pass\n\n\nclass tun_base(handler.handler):\n __creator_fd = None\n # 要写入到tun的IP包\n ___ip_packets_for_write = []\n # 写入tun设备的最大IP数据包的个数\n __MAX_WRITE_QUEUE_SIZE = 1024\n # 当前需要写入tun设备的IP数据包的个数\n __current_write_queue_n = 0\n\n __BLOCK_SIZE = 16 * 1024\n\n __qos = None\n\n def __create_tun_dev(self, name):\n \"\"\"创建tun 设备\n :param name:\n :return fd:\n \"\"\"\n tun_fd = fn_utils.tuntap_create(name, fn_utils.IFF_TUN | fn_utils.IFF_NO_PI)\n fn_utils.interface_up(name)\n\n if tun_fd < 0:\n raise SystemError(\"can not create tun device,please check your root\")\n\n return tun_fd\n\n @property\n def creator(self):\n return self.__creator_fd\n\n def init_func(self, creator_fd, tun_dev_name, *args, **kwargs):\n \"\"\"\n :param creator_fd:\n :param tun_dev_name:tun 设备名称\n :param subnet:如果是服务端则需要则个参数\n \"\"\"\n tun_fd = self.__create_tun_dev(tun_dev_name)\n\n if tun_fd < 3:\n print(\"error:create tun device failed:%s\" % tun_dev_name)\n sys.exit(-1)\n\n self.__creator_fd = creator_fd\n self.__qos = simple_qos.qos(simple_qos.QTYPE_DST)\n\n self.set_fileno(tun_fd)\n fcntl.fcntl(tun_fd, fcntl.F_SETFL, os.O_NONBLOCK)\n self.dev_init(tun_dev_name, *args, **kwargs)\n\n return tun_fd\n\n def dev_init(self, dev_name, *args, **kwargs):\n pass\n\n def evt_read(self):\n for i in range(32):\n try:\n ip_packet = os.read(self.fileno, self.__BLOCK_SIZE)\n except BlockingIOError:\n break\n self.__qos.add_to_queue(ip_packet)\n\n self.__qos_from_tundev()\n\n def task_loop(self):\n self.__qos_from_tundev()\n\n def __qos_from_tundev(self):\n results = self.__qos.get_queue()\n\n for ip_packet in results:\n self.handle_ip_packet_from_read(ip_packet)\n\n if not results:\n self.del_loop_task(self.fileno)\n else:\n self.add_to_loop_task(self.fileno)\n\n def evt_write(self):\n try:\n ip_packet = self.___ip_packets_for_write.pop(0)\n except IndexError:\n self.remove_evt_write(self.fileno)\n return\n\n self.__current_write_queue_n -= 1\n try:\n os.write(self.fileno, ip_packet)\n except BlockingIOError:\n self.__current_write_queue_n += 1\n self.___ip_packets_for_write.insert(0, ip_packet)\n return\n ''''''\n\n def handle_ip_packet_from_read(self, ip_packet):\n \"\"\"处理读取过来的IP包,重写这个方法\n :param ip_packet:\n :return None:\n \"\"\"\n pass\n\n def handle_ip_packet_for_write(self, ip_packet):\n \"\"\"处理要写入的IP包,重写这个方法\n :param ip_packet:\n :return new_ip_packet:\n \"\"\"\n pass\n\n def error(self):\n self.dev_error()\n\n def dev_error(self):\n \"\"\"重写这个方法\n :return:\n \"\"\"\n pass\n\n def timeout(self):\n self.dev_timeout()\n\n def dev_timeout(self):\n \"\"\"重写这个方法\n :return:\n \"\"\"\n pass\n\n def delete(self):\n self.dev_delete()\n\n def dev_delete(self):\n \"\"\"重写这个方法\n :return:\n \"\"\"\n pass\n\n def add_to_sent_queue(self, ip_packet):\n # 丢到超出规定的数据包,防止内存过度消耗\n n_ip_message = self.handle_ip_packet_for_write(ip_packet)\n if not n_ip_message: return\n\n if self.__current_write_queue_n == self.__MAX_WRITE_QUEUE_SIZE:\n # 删除第一个包,防止队列过多\n self.__current_write_queue_n -= 1\n self.___ip_packets_for_write.pop(0)\n return\n\n self.__current_write_queue_n += 1\n self.___ip_packets_for_write.append(n_ip_message)\n\n\nclass tundevs(tun_base):\n \"\"\"服务端的tun数据处理\n \"\"\"\n\n def dev_init(self, dev_name):\n self.register(self.fileno)\n self.add_evt_read(self.fileno)\n\n def handle_ip_packet_from_read(self, ip_packet):\n self.dispatcher.send_msg_to_tunnel_from_tun(ip_packet)\n\n def handle_ip_packet_for_write(self, ip_packet):\n return ip_packet\n\n def dev_delete(self):\n self.unregister(self.fileno)\n os.close(self.fileno)\n\n def dev_error(self):\n self.delete_handler(self.fileno)\n\n def dev_timeout(self):\n pass\n\n def handle_msg_from_tunnel(self, message):\n self.add_to_sent_queue(message)\n self.add_evt_write(self.fileno)\n\n\nclass tundevc(tun_base):\n def dev_init(self, dev_name):\n self.register(self.fileno)\n self.add_evt_read(self.fileno)\n\n def handle_ip_packet_from_read(self, ip_packet):\n self.dispatcher.handle_msg_from_tundev(ip_packet)\n\n def handle_ip_packet_for_write(self, ip_packet):\n return ip_packet\n\n def dev_delete(self):\n self.unregister(self.fileno)\n os.close(self.fileno)\n\n def dev_error(self):\n self.delete_handler(self.fileno)\n\n def dev_timeout(self):\n pass\n\n def msg_from_tunnel(self, message):\n self.add_to_sent_queue(message)\n self.add_evt_write(self.fileno)\n"},"license":{"kind":"string","value":"bsd-2-clause"},"hash":{"kind":"number","value":794198108318362000,"string":"794,198,108,318,362,000"},"line_mean":{"kind":"number","value":23.4907407407,"string":"23.490741"},"line_max":{"kind":"number","value":84,"string":"84"},"alpha_frac":{"kind":"number","value":0.5678638941,"string":"0.567864"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.09900410076157,"string":"3.099004"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44965,"cells":{"repo_name":{"kind":"string","value":"vesellov/bitdust.devel"},"path":{"kind":"string","value":"customer/data_sender.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"14665"},"content":{"kind":"string","value":"#!/usr/bin/python\n# data_sender.py\n#\n# Copyright (C) 2008-2018 Veselin Penev, https://bitdust.io\n#\n# This file (data_sender.py) is part of BitDust Software.\n#\n# BitDust is free software: you can redistribute it and/or modify\n# it under the terms of the GNU Affero General Public License as published by\n# the Free Software Foundation, either version 3 of the License, or\n# (at your option) any later version.\n#\n# BitDust Software is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU Affero General Public License for more details.\n#\n# You should have received a copy of the GNU Affero General Public License\n# along with BitDust Software. If not, see .\n#\n# Please contact us if you have any questions at bitdust.io@gmail.com\n#\n#\n#\n#\n\n\"\"\"\n.. module:: data_sender.\n\n.. raw:: html\n\n \n \n \n\nA state machine to manage data sending process, acts very simple:\n 1) when new local data is created it tries to send it to the correct supplier\n 2) wait while ``p2p.io_throttle`` is doing some data transmission to remote suppliers\n 3) calls ``p2p.backup_matrix.ScanBlocksToSend()`` to get a list of pieces needs to be send\n 4) this machine is restarted every minute to check if some more data needs to be send\n 5) also can be restarted at any time when it is needed\n\nEVENTS:\n * :red:`block-acked`\n * :red:`block-failed`\n * :red:`init`\n * :red:`new-data`\n * :red:`restart`\n * :red:`scan-done`\n * :red:`timer-1min`\n * :red:`timer-1sec`\n\"\"\"\n\n#------------------------------------------------------------------------------\n\nfrom __future__ import absolute_import\nfrom io import open\n\n#------------------------------------------------------------------------------\n\n_Debug = True\n_DebugLevel = 12\n\n#------------------------------------------------------------------------------\n\nimport os\nimport time\n\n#------------------------------------------------------------------------------\n\nfrom logs import lg\n\nfrom automats import automat\nfrom automats import global_state\n\nfrom lib import misc\n\nfrom lib import packetid\n\nfrom contacts import contactsdb\n\nfrom userid import my_id\n\nfrom main import settings\n\nfrom p2p import contact_status\n\nfrom . import io_throttle\n\n#------------------------------------------------------------------------------\n\n_DataSender = None\n_ShutdownFlag = False\n\n#------------------------------------------------------------------------------\n\n\ndef A(event=None, arg=None):\n \"\"\"\n Access method to interact with the state machine.\n \"\"\"\n global _DataSender\n if _DataSender is None:\n _DataSender = DataSender(\n name='data_sender',\n state='READY',\n debug_level=_DebugLevel,\n log_events=_Debug,\n log_transitions=_Debug,\n )\n if event is not None:\n _DataSender.automat(event, arg)\n return _DataSender\n\n\ndef Destroy():\n \"\"\"\n Destroy the state machine and remove the instance from memory.\n \"\"\"\n global _DataSender\n if _DataSender is None:\n return\n _DataSender.destroy()\n del _DataSender\n _DataSender = None\n\n\nclass DataSender(automat.Automat):\n \"\"\"\n A class to manage process of sending data packets to remote suppliers.\n \"\"\"\n timers = {\n 'timer-1min': (60, ['READY']),\n 'timer-1min': (60, ['READY']),\n 'timer-1sec': (1.0, ['SENDING']),\n }\n statistic = {}\n\n def state_changed(self, oldstate, newstate, event, arg):\n global_state.set_global_state('DATASEND ' + newstate)\n\n def A(self, event, arg):\n #---READY---\n if self.state == 'READY':\n if event == 'new-data' or event == 'timer-1min' or event == 'restart':\n self.state = 'SCAN_BLOCKS'\n self.doScanAndQueue(arg)\n elif event == 'init':\n pass\n #---SCAN_BLOCKS---\n elif self.state == 'SCAN_BLOCKS':\n if event == 'scan-done' and self.isQueueEmpty(arg):\n self.state = 'READY'\n self.doRemoveUnusedFiles(arg)\n elif event == 'scan-done' and not self.isQueueEmpty(arg):\n self.state = 'SENDING'\n #---SENDING---\n elif self.state == 'SENDING':\n if event == 'restart' or ( ( event == 'timer-1sec' or event == 'block-acked' or event == 'block-failed' or event == 'new-data' ) and self.isQueueEmpty(arg) ):\n self.state = 'SCAN_BLOCKS'\n self.doScanAndQueue(arg)\n return None\n\n def isQueueEmpty(self, arg):\n if not arg:\n return io_throttle.IsSendingQueueEmpty()\n remoteID, _ = arg\n return io_throttle.OkToSend(remoteID)\n\n def doScanAndQueue(self, arg):\n global _ShutdownFlag\n if _Debug:\n lg.out(_DebugLevel, 'data_sender.doScanAndQueue _ShutdownFlag=%r' % _ShutdownFlag)\n if _Debug:\n log = open(os.path.join(settings.LogsDir(), 'data_sender.log'), 'w')\n log.write(u'doScanAndQueue %s\\n' % time.asctime()) # .decode('utf-8')\n if _ShutdownFlag:\n if _Debug:\n log.write(u'doScanAndQueue _ShutdownFlag is True\\n')\n self.automat('scan-done')\n if _Debug:\n log.flush()\n log.close()\n return\n for customer_idurl in contactsdb.known_customers():\n if '' not in contactsdb.suppliers(customer_idurl):\n from storage import backup_matrix\n for backupID in misc.sorted_backup_ids(\n list(backup_matrix.local_files().keys()), True):\n this_customer_idurl = packetid.CustomerIDURL(backupID)\n if this_customer_idurl != customer_idurl:\n continue\n packetsBySupplier = backup_matrix.ScanBlocksToSend(backupID)\n if _Debug:\n log.write(u'%s\\n' % packetsBySupplier)\n for supplierNum in packetsBySupplier.keys():\n supplier_idurl = contactsdb.supplier(supplierNum, customer_idurl=customer_idurl)\n if not supplier_idurl:\n lg.warn('unknown supplier_idurl supplierNum=%s for %s, customer_idurl=%s' % (\n supplierNum, backupID, customer_idurl))\n continue\n for packetID in packetsBySupplier[supplierNum]:\n backupID_, _, supplierNum_, _ = packetid.BidBnSnDp(packetID)\n if backupID_ != backupID:\n lg.warn('unexpected backupID supplierNum=%s for %s, customer_idurl=%s' % (\n packetID, backupID, customer_idurl))\n continue\n if supplierNum_ != supplierNum:\n lg.warn('unexpected supplierNum %s for %s, customer_idurl=%s' % (\n packetID, backupID, customer_idurl))\n continue\n if io_throttle.HasPacketInSendQueue(\n supplier_idurl, packetID):\n if _Debug:\n log.write(u'%s already in sending queue for %s\\n' % (packetID, supplier_idurl))\n continue\n if not io_throttle.OkToSend(supplier_idurl):\n if _Debug:\n log.write(u'skip, not ok to send %s\\n' % supplier_idurl)\n continue\n customerGlobalID, pathID = packetid.SplitPacketID(packetID)\n # tranByID = gate.transfers_out_by_idurl().get(supplier_idurl, [])\n # if len(tranByID) > 3:\n # log.write(u'transfers by %s: %d\\n' % (supplier_idurl, len(tranByID)))\n # continue\n customerGlobalID, pathID = packetid.SplitPacketID(packetID)\n filename = os.path.join(\n settings.getLocalBackupsDir(),\n customerGlobalID,\n pathID,\n )\n if not os.path.isfile(filename):\n if _Debug:\n log.write(u'%s is not a file\\n' % filename)\n continue\n if io_throttle.QueueSendFile(\n filename,\n packetID,\n supplier_idurl,\n my_id.getLocalID(),\n self._packetAcked,\n self._packetFailed,\n ):\n if _Debug:\n log.write(u'io_throttle.QueueSendFile %s\\n' % packetID)\n else:\n if _Debug:\n log.write(u'io_throttle.QueueSendFile FAILED %s\\n' % packetID)\n # lg.out(6, ' %s for %s' % (packetID, backupID))\n # DEBUG\n # break\n\n self.automat('scan-done')\n if _Debug:\n log.flush()\n log.close()\n\n# def doPrintStats(self, arg):\n# \"\"\"\n# \"\"\"\n# if lg.is_debug(18):\n# transfers = transport_control.current_transfers()\n# bytes_stats = transport_control.current_bytes_transferred()\n# s = ''\n# for info in transfers:\n# s += '%s ' % (diskspace.MakeStringFromBytes(bytes_stats[info.transfer_id]).replace(' ', '').replace('bytes', 'b'))\n# lg.out(0, 'transfers: ' + s[:120])\n\n def doRemoveUnusedFiles(self, arg):\n # we want to remove files for this block\n # because we only need them during rebuilding\n if settings.getBackupsKeepLocalCopies() is True:\n # if user set this in settings - he want to keep the local files\n return\n # ... user do not want to keep local backups\n if settings.getGeneralWaitSuppliers() is True:\n from customer import fire_hire\n # but he want to be sure - all suppliers are green for a long time\n if len(contact_status.listOfflineSuppliers()) > 0 or time.time(\n ) - fire_hire.GetLastFireTime() < 24 * 60 * 60:\n # some people are not there or we do not have stable team yet\n # do not remove the files because we need it to rebuild\n return\n count = 0\n from storage import backup_matrix\n from storage import restore_monitor\n from storage import backup_rebuilder\n if _Debug:\n lg.out(_DebugLevel, 'data_sender.doRemoveUnusedFiles')\n for backupID in misc.sorted_backup_ids(\n list(backup_matrix.local_files().keys())):\n if restore_monitor.IsWorking(backupID):\n if _Debug:\n lg.out(\n _DebugLevel,\n ' %s : SKIP, because restoring' %\n backupID)\n continue\n if backup_rebuilder.IsBackupNeedsWork(backupID):\n if _Debug:\n lg.out(\n _DebugLevel,\n ' %s : SKIP, because needs rebuilding' %\n backupID)\n continue\n if not backup_rebuilder.ReadStoppedFlag():\n if backup_rebuilder.A().currentBackupID is not None:\n if backup_rebuilder.A().currentBackupID == backupID:\n if _Debug:\n lg.out(\n _DebugLevel,\n ' %s : SKIP, because rebuilding is in process' %\n backupID)\n continue\n packets = backup_matrix.ScanBlocksToRemove(\n backupID, settings.getGeneralWaitSuppliers())\n for packetID in packets:\n customer, pathID = packetid.SplitPacketID(packetID)\n filename = os.path.join(settings.getLocalBackupsDir(), customer, pathID)\n if os.path.isfile(filename):\n try:\n os.remove(filename)\n # lg.out(6, ' ' + os.path.basename(filename))\n except:\n lg.exc()\n continue\n count += 1\n if _Debug:\n lg.out(_DebugLevel, ' %d files were removed' % count)\n backup_matrix.ReadLocalFiles()\n\n def _packetAcked(self, packet, ownerID, packetID):\n from storage import backup_matrix\n backupID, blockNum, supplierNum, dataORparity = packetid.BidBnSnDp(packetID)\n backup_matrix.RemoteFileReport(\n backupID, blockNum, supplierNum, dataORparity, True)\n if ownerID not in self.statistic:\n self.statistic[ownerID] = [0, 0]\n self.statistic[ownerID][0] += 1\n self.automat('block-acked', (ownerID, packetID))\n\n def _packetFailed(self, remoteID, packetID, why):\n from storage import backup_matrix\n backupID, blockNum, supplierNum, dataORparity = packetid.BidBnSnDp(\n packetID)\n backup_matrix.RemoteFileReport(\n backupID, blockNum, supplierNum, dataORparity, False)\n if remoteID not in self.statistic:\n self.statistic[remoteID] = [0, 0]\n self.statistic[remoteID][1] += 1\n self.automat('block-failed', (remoteID, packetID))\n\n\ndef statistic():\n \"\"\"\n The ``data_sender()`` keeps track of sending results with every supplier.\n\n This is used by ``fire_hire()`` to decide how reliable is given\n supplier.\n \"\"\"\n global _DataSender\n if _DataSender is None:\n return {}\n return _DataSender.statistic\n\n\ndef SetShutdownFlag():\n \"\"\"\n Set flag to indicate that no need to send anything anymore.\n \"\"\"\n global _ShutdownFlag\n _ShutdownFlag = True\n"},"license":{"kind":"string","value":"agpl-3.0"},"hash":{"kind":"number","value":4224043803797804000,"string":"4,224,043,803,797,804,000"},"line_mean":{"kind":"number","value":38.4220430108,"string":"38.422043"},"line_max":{"kind":"number","value":170,"string":"170"},"alpha_frac":{"kind":"number","value":0.5121036481,"string":"0.512104"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.385466507177034,"string":"4.385467"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44966,"cells":{"repo_name":{"kind":"string","value":"agacek/camkes-tool"},"path":{"kind":"string","value":"camkes/internal/version.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1813"},"content":{"kind":"string","value":"#\n# Copyright 2014, NICTA\n#\n# This software may be distributed and modified according to the terms of\n# the BSD 2-Clause license. Note that NO WARRANTY is provided.\n# See \"LICENSE_BSD2.txt\" for details.\n#\n# @TAG(NICTA_BSD)\n#\n\n'''Versioning functionality. This computes a version identifier based on the\ncurrent source code state. It was decided this was more reliable while the tool\nis under active development. Note that any extraneous files in your source\ndirectory that match the version filters will be accumulated in the version\ncomputation.'''\n\nfrom memoization import memoized\nimport hashlib, os, re\n\n@memoized\ndef version():\n # Files to consider relevant. Each entry should be a pair of (path, filter)\n # where 'path' is relative to the directory of this file and 'filter' is a\n # regex describing which filenames to match under the given path.\n SOURCES = [\n ('../', r'^.*\\.py$'), # Python sources\n ('../templates', r'.*'), # Templates\n ]\n\n my_path = os.path.dirname(os.path.abspath(__file__))\n sources = set()\n\n # Accumulate all relevant source files.\n for s in SOURCES:\n path = os.path.join(my_path, s[0])\n regex = re.compile(s[1])\n for root, _, files in os.walk(path):\n for f in files:\n if regex.match(f):\n sources.add(os.path.abspath(os.path.join(root, f)))\n\n # Hash each file and hash a concatenation of these hashes. Note, hashing a\n # hash is not good practice for cryptography, but it's fine for this\n # purpose.\n hfinal = hashlib.sha1() #pylint: disable=E1101\n for s in sources:\n with open(s, 'r') as f:\n h = hashlib.sha1(f.read()).hexdigest() #pylint: disable=E1101\n hfinal.update('%s|' % h) #pylint: disable=E1101\n return hfinal.hexdigest()\n"},"license":{"kind":"string","value":"bsd-2-clause"},"hash":{"kind":"number","value":-41992440657990110,"string":"-41,992,440,657,990,110"},"line_mean":{"kind":"number","value":35.26,"string":"35.26"},"line_max":{"kind":"number","value":79,"string":"79"},"alpha_frac":{"kind":"number","value":0.6569222284,"string":"0.656922"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.8329809725158563,"string":"3.832981"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44967,"cells":{"repo_name":{"kind":"string","value":"ibrica/universe-server"},"path":{"kind":"string","value":"play.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1073"},"content":{"kind":"string","value":"from multiprocessing import Process\nimport time\nimport gym\nimport universe\nfrom universe.spaces.vnc_event import keycode\nfrom envs import create_env\n\n\n\ndef start_game(model, env_name):\n \"\"\"regular Python process, not using torch\"\"\"\n p = Process(target=play_game, args=(model,env_name))\n p.start()\n # Don't wait with join, respond to user request\n\ndef play_game(model, env_name):\n \"\"\"Play game with saved model if ther's no model play random\"\"\"\n env = create_env(env_name, client_id=\"play1\",remotes=1) # Local docker container\n max_game_length = 10000\n state = env.reset()\n reward_sum = 0\n start_time = time.time()\n for step in range(max_game_length ):\n state, reward, done, _ = env.step( ['up' for i in range(60)]) #no saved model for now keep pressing up, 60 times in minute\n reward_sum += reward\n print(\"Time {}, game reward {}, game length {}\".format(\n time.strftime(\"%Hh %Mm %Ss\"),\n reward_sum,\n time.gmtime(time.time() - start_time)))\n if done:\n break"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-6093060618181687000,"string":"-6,093,060,618,181,687,000"},"line_mean":{"kind":"number","value":33.6451612903,"string":"33.645161"},"line_max":{"kind":"number","value":130,"string":"130"},"alpha_frac":{"kind":"number","value":0.6309412861,"string":"0.630941"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.7649122807017545,"string":"3.764912"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44968,"cells":{"repo_name":{"kind":"string","value":"droundy/deft"},"path":{"kind":"string","value":"talks/colloquium/figs/plot-walls.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"3242"},"content":{"kind":"string","value":"#!/usr/bin/python\n\n# We need the following two lines in order for matplotlib to work\n# without access to an X server.\nfrom __future__ import division\nimport matplotlib\nmatplotlib.use('Agg')\n\nimport pylab, numpy, sys\n\nxmax = 2.5\nxmin = -0.4\n\ndef plotit(dftdata, mcdata):\n dft_len = len(dftdata[:,0])\n dft_dr = dftdata[2,0] - dftdata[1,0]\n\n mcdata = numpy.insert(mcdata,0,0,0)\n mcdata[0,0]=-10\n\n mcoffset = 10/2\n offset = -3/2\n n0 = dftdata[:,6]\n nA = dftdata[:,8]\n nAmc = mcdata[:,11]\n n0mc = mcdata[:,10]\n\n pylab.figure(figsize=(6, 6))\n pylab.subplots_adjust(hspace=0.001)\n\n n_plt = pylab.subplot(3,1,3)\n n_plt.plot(mcdata[:,0]/2+mcoffset,mcdata[:,1]*4*numpy.pi/3,\"b-\",label='$n$ Monte Carlo')\n n_plt.plot(dftdata[:,0]/2+offset,dftdata[:,1]*4*numpy.pi/3,\"b--\",label='$n$ DFT')\n n_plt.legend(loc='best', ncol=1).draw_frame(False) #.get_frame().set_alpha(0.5)\n n_plt.yaxis.set_major_locator(pylab.MaxNLocator(6,steps=[1,5,10],prune='upper'))\n pylab.ylim(ymin=0)\n pylab.xlim(xmin, xmax)\n pylab.xlabel(\"$z/\\sigma$\")\n pylab.ylabel(\"$n(\\mathbf{r})$\")\n n_plt.axvline(x=0, color='k', linestyle=':')\n\n\n n = len(mcdata[:,0])\n\n#pylab.twinx()\n\n dftr = dftdata[:,0]/2+offset\n thiswork = dftdata[:,5]\n gross = dftdata[:,7]\n stop_here = int(dft_len - 1/dft_dr)\n print stop_here\n start_here = int(2.5/dft_dr)\n off = 1\n me = 40\n\n A_plt = pylab.subplot(3,1,1)\n A_plt.axvline(x=0, color='k', linestyle=':')\n A_plt.plot(mcdata[:,0]/2+mcoffset,mcdata[:,2+2*off]/nAmc,\"r-\",label=\"$g_\\sigma^A$ Monte Carlo\")\n A_plt.plot(dftr[dftr>=0],thiswork[dftr>=0],\"ro\",markevery=me*.8,label=\"$g_\\sigma^A$ this work\")\n A_plt.plot(dftr[dftr>=0],gross[dftr>=0],\"rx\",markevery=me,label=\"Gross\",\n markerfacecolor='none',markeredgecolor='red', markeredgewidth=1)\n A_plt.legend(loc='best', ncol=1).draw_frame(False) #.get_frame().set_alpha(0.5)\n A_plt.yaxis.set_major_locator(pylab.MaxNLocator(integer=True,prune='upper'))\n pylab.ylim(ymin=0)\n pylab.ylabel(\"$g_\\sigma^A$\")\n pylab.xlim(xmin, xmax)\n\n n0mc[0]=1\n mcdata[0,10]=1\n S_plt = pylab.subplot(3,1,2)\n S_plt.axvline(x=0, color='k', linestyle=':')\n S_plt.plot(mcdata[:,0]/2+mcoffset,mcdata[:,3+2*off]/n0mc,\"g-\",label=\"$g_\\sigma^S$ Monte Carlo\")\n S_plt.plot(dftdata[:,0]/2+offset,dftdata[:,4],\"gx\",markevery=me/2,label=\"Yu and Wu\")\n S_plt.legend(loc='best', ncol=1).draw_frame(False) #.get_frame().set_alpha(0.5)\n #pylab.ylim(ymax=12)\n S_plt.yaxis.set_major_locator(pylab.MaxNLocator(5,integer=True,prune='upper'))\n pylab.xlim(xmin, xmax)\n pylab.ylim(ymin=0)\n pylab.ylabel(\"$g_\\sigma^S$\")\n\n xticklabels = A_plt.get_xticklabels() + S_plt.get_xticklabels()\n pylab.setp(xticklabels, visible=False)\n\nmcdata10 = numpy.loadtxt('../../papers/contact/figs/mc-walls-20-196.dat')\ndftdata10 = numpy.loadtxt('../../papers/contact/figs/wallsWB-0.10.dat')\n\nmcdata40 = numpy.loadtxt('../../papers/contact/figs/mc-walls-20-817.dat')\ndftdata40 = numpy.loadtxt('../../papers/contact/figs/wallsWB-0.40.dat')\n\nplotit(dftdata10, mcdata10)\npylab.savefig('figs/walls-10.pdf', transparent=True)\n\nplotit(dftdata40, mcdata40)\npylab.savefig('figs/walls-40.pdf', transparent=True)\n"},"license":{"kind":"string","value":"gpl-2.0"},"hash":{"kind":"number","value":-4687526299663627000,"string":"-4,687,526,299,663,627,000"},"line_mean":{"kind":"number","value":33.4893617021,"string":"33.489362"},"line_max":{"kind":"number","value":99,"string":"99"},"alpha_frac":{"kind":"number","value":0.6375694016,"string":"0.637569"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":2.5151280062063615,"string":"2.515128"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44969,"cells":{"repo_name":{"kind":"string","value":"AprilBrother/esptool"},"path":{"kind":"string","value":"esptool.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"28432"},"content":{"kind":"string","value":"#!/usr/bin/env python\n#\n# ESP8266 ROM Bootloader Utility\n# https://github.com/themadinventor/esptool\n#\n# Copyright (C) 2014 Fredrik Ahlberg\n#\n# This program is free software; you can redistribute it and/or modify it under\n# the terms of the GNU General Public License as published by the Free Software\n# Foundation; either version 2 of the License, or (at your option) any later version.\n#\n# This program is distributed in the hope that it will be useful, but WITHOUT\n# ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS\n# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details.\n#\n# You should have received a copy of the GNU General Public License along with\n# this program; if not, write to the Free Software Foundation, Inc., 51 Franklin\n# Street, Fifth Floor, Boston, MA 02110-1301 USA.\n\nimport sys\nimport struct\nimport serial\nimport time\nimport argparse\nimport os\nimport subprocess\nimport tempfile\n\n\nclass ESPROM:\n # These are the currently known commands supported by the ROM\n ESP_FLASH_BEGIN = 0x02\n ESP_FLASH_DATA = 0x03\n ESP_FLASH_END = 0x04\n ESP_MEM_BEGIN = 0x05\n ESP_MEM_END = 0x06\n ESP_MEM_DATA = 0x07\n ESP_SYNC = 0x08\n ESP_WRITE_REG = 0x09\n ESP_READ_REG = 0x0a\n\n # Maximum block sized for RAM and Flash writes, respectively.\n ESP_RAM_BLOCK = 0x1800\n ESP_FLASH_BLOCK = 0x100\n\n # Default baudrate. The ROM auto-bauds, so we can use more or less whatever we want.\n ESP_ROM_BAUD = 115200\n\n # First byte of the application image\n ESP_IMAGE_MAGIC = 0xe9\n\n # Initial state for the checksum routine\n ESP_CHECKSUM_MAGIC = 0xef\n\n # OTP ROM addresses\n ESP_OTP_MAC0 = 0x3ff00050\n ESP_OTP_MAC1 = 0x3ff00054\n\n # Sflash stub: an assembly routine to read from spi flash and send to host\n SFLASH_STUB = \"\\x80\\x3c\\x00\\x40\\x1c\\x4b\\x00\\x40\\x21\\x11\\x00\\x40\\x00\\x80\" \\\n \"\\xfe\\x3f\\xc1\\xfb\\xff\\xd1\\xf8\\xff\\x2d\\x0d\\x31\\xfd\\xff\\x41\\xf7\\xff\\x4a\" \\\n \"\\xdd\\x51\\xf9\\xff\\xc0\\x05\\x00\\x21\\xf9\\xff\\x31\\xf3\\xff\\x41\\xf5\\xff\\xc0\" \\\n \"\\x04\\x00\\x0b\\xcc\\x56\\xec\\xfd\\x06\\xff\\xff\\x00\\x00\"\n\n def __init__(self, port=0, baud=ESP_ROM_BAUD):\n self._port = serial.Serial(port)\n # setting baud rate in a separate step is a workaround for\n # CH341 driver on some Linux versions (this opens at 9600 then\n # sets), shouldn't matter for other platforms/drivers. See\n # https://github.com/themadinventor/esptool/issues/44#issuecomment-107094446\n self._port.baudrate = baud\n\n \"\"\" Read bytes from the serial port while performing SLIP unescaping \"\"\"\n def read(self, length=1):\n b = ''\n while len(b) < length:\n c = self._port.read(1)\n if c == '\\xdb':\n c = self._port.read(1)\n if c == '\\xdc':\n b = b + '\\xc0'\n elif c == '\\xdd':\n b = b + '\\xdb'\n else:\n raise FatalError('Invalid SLIP escape')\n else:\n b = b + c\n return b\n\n \"\"\" Write bytes to the serial port while performing SLIP escaping \"\"\"\n def write(self, packet):\n buf = '\\xc0' \\\n + (packet.replace('\\xdb','\\xdb\\xdd').replace('\\xc0','\\xdb\\xdc')) \\\n + '\\xc0'\n self._port.write(buf)\n\n \"\"\" Calculate checksum of a blob, as it is defined by the ROM \"\"\"\n @staticmethod\n def checksum(data, state=ESP_CHECKSUM_MAGIC):\n for b in data:\n state ^= ord(b)\n return state\n\n \"\"\" Send a request and read the response \"\"\"\n def command(self, op=None, data=None, chk=0):\n if op:\n pkt = struct.pack(' 0:\n (op_ret, val, body) = self.receive_response()\n if op is None or op_ret == op:\n return val, body # valid response received\n retries = retries - 1\n\n raise FatalError(\"Response doesn't match request\")\n\n \"\"\" Receive a response to a command \"\"\"\n def receive_response(self):\n # Read header of response and parse\n if self._port.read(1) != '\\xc0':\n raise FatalError('Invalid head of packet')\n hdr = self.read(8)\n (resp, op_ret, len_ret, val) = struct.unpack('> 16) & 0xff) == 0:\n oui = (0x18, 0xfe, 0x34)\n elif ((mac1 >> 16) & 0xff) == 1:\n oui = (0xac, 0xd0, 0x74)\n else:\n raise FatalError(\"Unknown OUI\")\n return oui + ((mac1 >> 8) & 0xff, mac1 & 0xff, (mac0 >> 24) & 0xff)\n\n \"\"\" Read SPI flash manufacturer and device id \"\"\"\n def flash_id(self):\n self.flash_begin(0, 0)\n self.write_reg(0x60000240, 0x0, 0xffffffff)\n self.write_reg(0x60000200, 0x10000000, 0xffffffff)\n flash_id = self.read_reg(0x60000240)\n self.flash_finish(False)\n return flash_id\n\n \"\"\" Read SPI flash \"\"\"\n def flash_read(self, offset, size, count=1):\n # Create a custom stub\n stub = struct.pack(' 16:\n raise FatalError('Invalid firmware image')\n\n for i in xrange(segments):\n (offset, size) = struct.unpack(' 0x40200000 or offset < 0x3ffe0000 or size > 65536:\n raise FatalError('Suspicious segment 0x%x, length %d' % (offset, size))\n segment_data = f.read(size)\n if len(segment_data) < size:\n raise FatalError('End of file reading segment 0x%x, length %d (actual length %d)' % (offset, size, len(segment_data)))\n self.segments.append((offset, size, segment_data))\n\n # Skip the padding. The checksum is stored in the last byte so that the\n # file is a multiple of 16 bytes.\n align = 15 - (f.tell() % 16)\n f.seek(align, 1)\n\n self.checksum = ord(f.read(1))\n\n def add_segment(self, addr, data):\n # Data should be aligned on word boundary\n l = len(data)\n if l % 4:\n data += b\"\\x00\" * (4 - l % 4)\n if l > 0:\n self.segments.append((addr, len(data), data))\n\n def save(self, filename):\n f = file(filename, 'wb')\n f.write(struct.pack(' 0:\n esp.mem_block(data[0:esp.ESP_RAM_BLOCK], seq)\n data = data[esp.ESP_RAM_BLOCK:]\n seq += 1\n print 'done!'\n\n print 'All segments done, executing at %08x' % image.entrypoint\n esp.mem_finish(image.entrypoint)\n\n elif args.operation == 'read_mem':\n print '0x%08x = 0x%08x' % (args.address, esp.read_reg(args.address))\n\n elif args.operation == 'write_mem':\n esp.write_reg(args.address, args.value, args.mask, 0)\n print 'Wrote %08x, mask %08x to %08x' % (args.value, args.mask, args.address)\n\n elif args.operation == 'dump_mem':\n f = file(args.filename, 'wb')\n for i in xrange(args.size / 4):\n d = esp.read_reg(args.address + (i * 4))\n f.write(struct.pack(' 0:\n print '\\rWriting at 0x%08x... (%d %%)' % (address + seq * esp.ESP_FLASH_BLOCK, 100 * (seq + 1) / blocks),\n sys.stdout.flush()\n block = image[0:esp.ESP_FLASH_BLOCK]\n # Fix sflash config data\n if address == 0 and seq == 0 and block[0] == '\\xe9':\n block = block[0:2] + flash_info + block[4:]\n # Pad the last block\n block = block + '\\xff' * (esp.ESP_FLASH_BLOCK - len(block))\n esp.flash_block(block, seq)\n image = image[esp.ESP_FLASH_BLOCK:]\n seq += 1\n written += len(block)\n t = time.time() - t\n print '\\rWrote %d bytes at 0x%08x in %.1f seconds (%.1f kbit/s)...' % (written, address, t, written / t * 8 / 1000)\n print '\\nLeaving...'\n if args.flash_mode == 'dio':\n esp.flash_unlock_dio()\n else:\n esp.flash_begin(0, 0)\n esp.flash_finish(False)\n\n elif args.operation == 'run':\n esp.run()\n\n elif args.operation == 'image_info':\n image = ESPFirmwareImage(args.filename)\n print ('Entry point: %08x' % image.entrypoint) if image.entrypoint != 0 else 'Entry point not set'\n print '%d segments' % len(image.segments)\n print\n checksum = ESPROM.ESP_CHECKSUM_MAGIC\n for (idx, (offset, size, data)) in enumerate(image.segments):\n print 'Segment %d: %5d bytes at %08x' % (idx + 1, size, offset)\n checksum = ESPROM.checksum(data, checksum)\n print\n print 'Checksum: %02x (%s)' % (image.checksum, 'valid' if image.checksum == checksum else 'invalid!')\n\n elif args.operation == 'make_image':\n image = ESPFirmwareImage()\n if len(args.segfile) == 0:\n raise FatalError('No segments specified')\n if len(args.segfile) != len(args.segaddr):\n raise FatalError('Number of specified files does not match number of specified addresses')\n for (seg, addr) in zip(args.segfile, args.segaddr):\n data = file(seg, 'rb').read()\n image.add_segment(addr, data)\n image.entrypoint = args.entrypoint\n image.save(args.output)\n\n elif args.operation == 'elf2image':\n if args.output is None:\n args.output = args.input + '-'\n e = ELFFile(args.input)\n image = ESPFirmwareImage()\n image.entrypoint = e.get_entry_point()\n for section, start in ((\".text\", \"_text_start\"), (\".data\", \"_data_start\"), (\".rodata\", \"_rodata_start\")):\n data = e.load_section(section)\n image.add_segment(e.get_symbol_addr(start), data)\n\n image.flash_mode = {'qio':0, 'qout':1, 'dio':2, 'dout': 3}[args.flash_mode]\n image.flash_size_freq = {'4m':0x00, '2m':0x10, '8m':0x20, '16m':0x30, '32m':0x40, '16m-c1': 0x50, '32m-c1':0x60, '32m-c2':0x70}[args.flash_size]\n image.flash_size_freq += {'40m':0, '26m':1, '20m':2, '80m': 0xf}[args.flash_freq]\n\n image.save(args.output + \"0x00000.bin\")\n data = e.load_section(\".irom0.text\")\n off = e.get_symbol_addr(\"_irom0_text_start\") - 0x40200000\n assert off >= 0\n f = open(args.output + \"0x%05x.bin\" % off, \"wb\")\n f.write(data)\n f.close()\n\n elif args.operation == 'read_mac':\n mac = esp.read_mac()\n print 'MAC: %s' % ':'.join(map(lambda x: '%02x' % x, mac))\n\n elif args.operation == 'flash_id':\n flash_id = esp.flash_id()\n print 'Manufacturer: %02x' % (flash_id & 0xff)\n print 'Device: %02x%02x' % ((flash_id >> 8) & 0xff, (flash_id >> 16) & 0xff)\n\n elif args.operation == 'read_flash':\n print 'Please wait...'\n file(args.filename, 'wb').write(esp.flash_read(args.address, 1024, div_roundup(args.size, 1024))[:args.size])\n\n elif args.operation == 'erase_flash':\n esp.flash_erase()\n\nif __name__ == '__main__':\n try:\n main()\n except FatalError as e:\n print '\\nA fatal error occurred: %s' % e\n sys.exit(2)\n"},"license":{"kind":"string","value":"gpl-2.0"},"hash":{"kind":"number","value":1992661783218690600,"string":"1,992,661,783,218,690,600"},"line_mean":{"kind":"number","value":38.7094972067,"string":"38.709497"},"line_max":{"kind":"number","value":152,"string":"152"},"alpha_frac":{"kind":"number","value":0.5735790658,"string":"0.573579"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.507958050586058,"string":"3.507958"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44970,"cells":{"repo_name":{"kind":"string","value":"eharney/cinder"},"path":{"kind":"string","value":"cinder/api/v3/attachments.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"11362"},"content":{"kind":"string","value":"# Licensed under the Apache License, Version 2.0 (the \"License\"); you may\n# not use this file except in compliance with the License. You may obtain\n# a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS, WITHOUT\n# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the\n# License for the specific language governing permissions and limitations\n# under the License.\n\n\"\"\"The volumes attachments API.\"\"\"\n\nfrom oslo_log import log as logging\nimport webob\n\nfrom cinder.api import common\nfrom cinder.api import microversions as mv\nfrom cinder.api.openstack import wsgi\nfrom cinder.api.v3.views import attachments as attachment_views\nfrom cinder import exception\nfrom cinder.i18n import _\nfrom cinder import objects\nfrom cinder import utils\nfrom cinder.volume import api as volume_api\n\n\nLOG = logging.getLogger(__name__)\n\n\nclass AttachmentsController(wsgi.Controller):\n \"\"\"The Attachments API controller for the OpenStack API.\"\"\"\n\n _view_builder_class = attachment_views.ViewBuilder\n\n allowed_filters = {'volume_id', 'status', 'instance_id', 'attach_status'}\n\n def __init__(self, ext_mgr=None):\n \"\"\"Initialize controller class.\"\"\"\n self.volume_api = volume_api.API()\n self.ext_mgr = ext_mgr\n super(AttachmentsController, self).__init__()\n\n @wsgi.Controller.api_version(mv.NEW_ATTACH)\n def show(self, req, id):\n \"\"\"Return data about the given attachment.\"\"\"\n context = req.environ['cinder.context']\n attachment = objects.VolumeAttachment.get_by_id(context, id)\n return attachment_views.ViewBuilder.detail(attachment)\n\n @wsgi.Controller.api_version(mv.NEW_ATTACH)\n def index(self, req):\n \"\"\"Return a summary list of attachments.\"\"\"\n attachments = self._items(req)\n return attachment_views.ViewBuilder.list(attachments)\n\n @wsgi.Controller.api_version(mv.NEW_ATTACH)\n def detail(self, req):\n \"\"\"Return a detailed list of attachments.\"\"\"\n attachments = self._items(req)\n return attachment_views.ViewBuilder.list(attachments, detail=True)\n\n @common.process_general_filtering('attachment')\n def _process_attachment_filtering(self, context=None, filters=None,\n req_version=None):\n utils.remove_invalid_filter_options(context, filters,\n self.allowed_filters)\n\n def _items(self, req):\n \"\"\"Return a list of attachments, transformed through view builder.\"\"\"\n context = req.environ['cinder.context']\n req_version = req.api_version_request\n\n # Pop out non search_opts and create local variables\n search_opts = req.GET.copy()\n sort_keys, sort_dirs = common.get_sort_params(search_opts)\n marker, limit, offset = common.get_pagination_params(search_opts)\n\n self._process_attachment_filtering(context=context,\n filters=search_opts,\n req_version=req_version)\n if search_opts.get('instance_id', None):\n search_opts['instance_uuid'] = search_opts.pop('instance_id', None)\n if context.is_admin and 'all_tenants' in search_opts:\n del search_opts['all_tenants']\n return objects.VolumeAttachmentList.get_all(\n context, search_opts=search_opts, marker=marker, limit=limit,\n offset=offset, sort_keys=sort_keys, sort_direction=sort_dirs)\n else:\n return objects.VolumeAttachmentList.get_all_by_project(\n context, context.project_id, search_opts=search_opts,\n marker=marker, limit=limit, offset=offset, sort_keys=sort_keys,\n sort_direction=sort_dirs)\n\n @wsgi.Controller.api_version(mv.NEW_ATTACH)\n @wsgi.response(202)\n def create(self, req, body):\n \"\"\"Create an attachment.\n\n This method can be used to create an empty attachment (reserve) or to\n create and initialize a volume attachment based on the provided input\n parameters.\n\n If the caller does not yet have the connector information but needs to\n reserve an attachment for the volume (ie Nova BootFromVolume) the\n create can be called with just the volume-uuid and the server\n identifier. This will reserve an attachment, mark the volume as\n reserved and prevent any new attachment_create calls from being made\n until the attachment is updated (completed).\n\n The alternative is that the connection can be reserved and initialized\n all at once with a single call if the caller has all of the required\n information (connector data) at the time of the call.\n\n NOTE: In Nova terms server == instance, the server_id parameter\n referenced below is the UUID of the Instance, for non-nova consumers\n this can be a server UUID or some other arbitrary unique identifier.\n\n Expected format of the input parameter 'body':\n\n .. code-block:: json\n\n {\n \"attachment\":\n {\n \"volume_uuid\": \"volume-uuid\",\n \"instance_uuid\": \"nova-server-uuid\",\n \"connector\": \"null|\"\n }\n }\n\n Example connector:\n\n .. code-block:: json\n\n {\n \"connector\":\n {\n \"initiator\": \"iqn.1993-08.org.debian:01:cad181614cec\",\n \"ip\":\"192.168.1.20\",\n \"platform\": \"x86_64\",\n \"host\": \"tempest-1\",\n \"os_type\": \"linux2\",\n \"multipath\": false,\n \"mountpoint\": \"/dev/vdb\",\n \"mode\": \"null|rw|ro\"\n }\n }\n\n NOTE all that's required for a reserve is volume_uuid\n and an instance_uuid.\n\n returns: A summary view of the attachment object\n \"\"\"\n context = req.environ['cinder.context']\n instance_uuid = body['attachment'].get('instance_uuid', None)\n if not instance_uuid:\n raise webob.exc.HTTPBadRequest(\n explanation=_(\"Must specify 'instance_uuid' \"\n \"to create attachment.\"))\n\n volume_uuid = body['attachment'].get('volume_uuid', None)\n if not volume_uuid:\n raise webob.exc.HTTPBadRequest(\n explanation=_(\"Must specify 'volume_uuid' \"\n \"to create attachment.\"))\n\n volume_ref = objects.Volume.get_by_id(\n context,\n volume_uuid)\n connector = body['attachment'].get('connector', None)\n err_msg = None\n try:\n attachment_ref = (\n self.volume_api.attachment_create(context,\n volume_ref,\n instance_uuid,\n connector=connector))\n except exception.NotAuthorized:\n raise\n except exception.CinderException as ex:\n err_msg = _(\n \"Unable to create attachment for volume (%s).\") % ex.msg\n LOG.exception(err_msg)\n except Exception as ex:\n err_msg = _(\"Unable to create attachment for volume.\")\n LOG.exception(err_msg)\n finally:\n if err_msg:\n raise webob.exc.HTTPInternalServerError(explanation=err_msg)\n return attachment_views.ViewBuilder.detail(attachment_ref)\n\n @wsgi.Controller.api_version(mv.NEW_ATTACH)\n def update(self, req, id, body):\n \"\"\"Update an attachment record.\n\n Update a reserved attachment record with connector information and set\n up the appropriate connection_info from the driver.\n\n Expected format of the input parameter 'body':\n\n .. code:: json\n\n {\n \"attachment\":\n {\n \"connector\":\n {\n \"initiator\": \"iqn.1993-08.org.debian:01:cad181614cec\",\n \"ip\":\"192.168.1.20\",\n \"platform\": \"x86_64\",\n \"host\": \"tempest-1\",\n \"os_type\": \"linux2\",\n \"multipath\": False,\n \"mountpoint\": \"/dev/vdb\",\n \"mode\": None|\"rw\"|\"ro\",\n }\n }\n }\n\n \"\"\"\n context = req.environ['cinder.context']\n attachment_ref = (\n objects.VolumeAttachment.get_by_id(context, id))\n connector = body['attachment'].get('connector', None)\n if not connector:\n raise webob.exc.HTTPBadRequest(\n explanation=_(\"Must specify 'connector' \"\n \"to update attachment.\"))\n err_msg = None\n try:\n attachment_ref = (\n self.volume_api.attachment_update(context,\n attachment_ref,\n connector))\n except exception.NotAuthorized:\n raise\n except exception.CinderException as ex:\n err_msg = (\n _(\"Unable to update attachment.(%s).\") % ex.msg)\n LOG.exception(err_msg)\n except Exception:\n err_msg = _(\"Unable to update the attachment.\")\n LOG.exception(err_msg)\n finally:\n if err_msg:\n raise webob.exc.HTTPInternalServerError(explanation=err_msg)\n\n # TODO(jdg): Test this out some more, do we want to return and object\n # or a dict?\n return attachment_views.ViewBuilder.detail(attachment_ref)\n\n @wsgi.Controller.api_version(mv.NEW_ATTACH)\n def delete(self, req, id):\n \"\"\"Delete an attachment.\n\n Disconnects/Deletes the specified attachment, returns a list of any\n known shared attachment-id's for the effected backend device.\n\n returns: A summary list of any attachments sharing this connection\n\n \"\"\"\n context = req.environ['cinder.context']\n attachment = objects.VolumeAttachment.get_by_id(context, id)\n attachments = self.volume_api.attachment_delete(context, attachment)\n return attachment_views.ViewBuilder.list(attachments)\n\n @wsgi.response(202)\n @wsgi.Controller.api_version(mv.NEW_ATTACH_COMPLETION)\n @wsgi.action('os-complete')\n def complete(self, req, id, body):\n \"\"\"Mark a volume attachment process as completed (in-use).\"\"\"\n context = req.environ['cinder.context']\n attachment_ref = (\n objects.VolumeAttachment.get_by_id(context, id))\n volume_ref = objects.Volume.get_by_id(\n context,\n attachment_ref.volume_id)\n attachment_ref.update({'attach_status': 'attached'})\n attachment_ref.save()\n volume_ref.update({'status': 'in-use', 'attach_status': 'attached'})\n volume_ref.save()\n\n\ndef create_resource(ext_mgr):\n \"\"\"Create the wsgi resource for this controller.\"\"\"\n return wsgi.Resource(AttachmentsController(ext_mgr))\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":-5867306877933996000,"string":"-5,867,306,877,933,996,000"},"line_mean":{"kind":"number","value":38.4513888889,"string":"38.451389"},"line_max":{"kind":"number","value":79,"string":"79"},"alpha_frac":{"kind":"number","value":0.5810596726,"string":"0.58106"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.6,"string":"4.6"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44971,"cells":{"repo_name":{"kind":"string","value":"turbokongen/home-assistant"},"path":{"kind":"string","value":"homeassistant/components/plex/config_flow.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"15991"},"content":{"kind":"string","value":"\"\"\"Config flow for Plex.\"\"\"\nimport copy\nimport logging\n\nfrom aiohttp import web_response\nimport plexapi.exceptions\nfrom plexapi.gdm import GDM\nfrom plexauth import PlexAuth\nimport requests.exceptions\nimport voluptuous as vol\n\nfrom homeassistant import config_entries\nfrom homeassistant.components.http.view import HomeAssistantView\nfrom homeassistant.components.media_player import DOMAIN as MP_DOMAIN\nfrom homeassistant.const import (\n CONF_CLIENT_ID,\n CONF_HOST,\n CONF_PORT,\n CONF_SOURCE,\n CONF_SSL,\n CONF_TOKEN,\n CONF_URL,\n CONF_VERIFY_SSL,\n)\nfrom homeassistant.core import callback\nfrom homeassistant.helpers.aiohttp_client import async_get_clientsession\nimport homeassistant.helpers.config_validation as cv\nfrom homeassistant.helpers.network import get_url\n\nfrom .const import ( # pylint: disable=unused-import\n AUTH_CALLBACK_NAME,\n AUTH_CALLBACK_PATH,\n AUTOMATIC_SETUP_STRING,\n CONF_IGNORE_NEW_SHARED_USERS,\n CONF_IGNORE_PLEX_WEB_CLIENTS,\n CONF_MONITORED_USERS,\n CONF_SERVER,\n CONF_SERVER_IDENTIFIER,\n CONF_USE_EPISODE_ART,\n DEFAULT_PORT,\n DEFAULT_SSL,\n DEFAULT_VERIFY_SSL,\n DOMAIN,\n MANUAL_SETUP_STRING,\n PLEX_SERVER_CONFIG,\n SERVERS,\n X_PLEX_DEVICE_NAME,\n X_PLEX_PLATFORM,\n X_PLEX_PRODUCT,\n X_PLEX_VERSION,\n)\nfrom .errors import NoServersFound, ServerNotSpecified\nfrom .server import PlexServer\n\n_LOGGER = logging.getLogger(__package__)\n\n\n@callback\ndef configured_servers(hass):\n \"\"\"Return a set of the configured Plex servers.\"\"\"\n return {\n entry.data[CONF_SERVER_IDENTIFIER]\n for entry in hass.config_entries.async_entries(DOMAIN)\n }\n\n\nasync def async_discover(hass):\n \"\"\"Scan for available Plex servers.\"\"\"\n gdm = GDM()\n await hass.async_add_executor_job(gdm.scan)\n for server_data in gdm.entries:\n await hass.config_entries.flow.async_init(\n DOMAIN,\n context={CONF_SOURCE: config_entries.SOURCE_INTEGRATION_DISCOVERY},\n data=server_data,\n )\n\n\nclass PlexFlowHandler(config_entries.ConfigFlow, domain=DOMAIN):\n \"\"\"Handle a Plex config flow.\"\"\"\n\n VERSION = 1\n CONNECTION_CLASS = config_entries.CONN_CLASS_LOCAL_PUSH\n\n @staticmethod\n @callback\n def async_get_options_flow(config_entry):\n \"\"\"Get the options flow for this handler.\"\"\"\n return PlexOptionsFlowHandler(config_entry)\n\n def __init__(self):\n \"\"\"Initialize the Plex flow.\"\"\"\n self.current_login = {}\n self.available_servers = None\n self.plexauth = None\n self.token = None\n self.client_id = None\n self._manual = False\n\n async def async_step_user(\n self, user_input=None, errors=None\n ): # pylint: disable=arguments-differ\n \"\"\"Handle a flow initialized by the user.\"\"\"\n if user_input is not None:\n return await self.async_step_plex_website_auth()\n if self.show_advanced_options:\n return await self.async_step_user_advanced(errors=errors)\n return self.async_show_form(step_id=\"user\", errors=errors)\n\n async def async_step_user_advanced(self, user_input=None, errors=None):\n \"\"\"Handle an advanced mode flow initialized by the user.\"\"\"\n if user_input is not None:\n if user_input.get(\"setup_method\") == MANUAL_SETUP_STRING:\n self._manual = True\n return await self.async_step_manual_setup()\n return await self.async_step_plex_website_auth()\n\n data_schema = vol.Schema(\n {\n vol.Required(\"setup_method\", default=AUTOMATIC_SETUP_STRING): vol.In(\n [AUTOMATIC_SETUP_STRING, MANUAL_SETUP_STRING]\n )\n }\n )\n return self.async_show_form(\n step_id=\"user_advanced\", data_schema=data_schema, errors=errors\n )\n\n async def async_step_manual_setup(self, user_input=None, errors=None):\n \"\"\"Begin manual configuration.\"\"\"\n if user_input is not None and errors is None:\n user_input.pop(CONF_URL, None)\n host = user_input.get(CONF_HOST)\n if host:\n port = user_input[CONF_PORT]\n prefix = \"https\" if user_input.get(CONF_SSL) else \"http\"\n user_input[CONF_URL] = f\"{prefix}://{host}:{port}\"\n elif CONF_TOKEN not in user_input:\n return await self.async_step_manual_setup(\n user_input=user_input, errors={\"base\": \"host_or_token\"}\n )\n return await self.async_step_server_validate(user_input)\n\n previous_input = user_input or {}\n\n data_schema = vol.Schema(\n {\n vol.Optional(\n CONF_HOST,\n description={\"suggested_value\": previous_input.get(CONF_HOST)},\n ): str,\n vol.Required(\n CONF_PORT, default=previous_input.get(CONF_PORT, DEFAULT_PORT)\n ): int,\n vol.Required(\n CONF_SSL, default=previous_input.get(CONF_SSL, DEFAULT_SSL)\n ): bool,\n vol.Required(\n CONF_VERIFY_SSL,\n default=previous_input.get(CONF_VERIFY_SSL, DEFAULT_VERIFY_SSL),\n ): bool,\n vol.Optional(\n CONF_TOKEN,\n description={\"suggested_value\": previous_input.get(CONF_TOKEN)},\n ): str,\n }\n )\n return self.async_show_form(\n step_id=\"manual_setup\", data_schema=data_schema, errors=errors\n )\n\n async def async_step_server_validate(self, server_config):\n \"\"\"Validate a provided configuration.\"\"\"\n errors = {}\n self.current_login = server_config\n\n plex_server = PlexServer(self.hass, server_config)\n try:\n await self.hass.async_add_executor_job(plex_server.connect)\n\n except NoServersFound:\n _LOGGER.error(\"No servers linked to Plex account\")\n errors[\"base\"] = \"no_servers\"\n except (plexapi.exceptions.BadRequest, plexapi.exceptions.Unauthorized):\n _LOGGER.error(\"Invalid credentials provided, config not created\")\n errors[CONF_TOKEN] = \"faulty_credentials\"\n except requests.exceptions.SSLError as error:\n _LOGGER.error(\"SSL certificate error: [%s]\", error)\n errors[\"base\"] = \"ssl_error\"\n except (plexapi.exceptions.NotFound, requests.exceptions.ConnectionError):\n server_identifier = (\n server_config.get(CONF_URL) or plex_server.server_choice or \"Unknown\"\n )\n _LOGGER.error(\"Plex server could not be reached: %s\", server_identifier)\n errors[CONF_HOST] = \"not_found\"\n\n except ServerNotSpecified as available_servers:\n self.available_servers = available_servers.args[0]\n return await self.async_step_select_server()\n\n except Exception as error: # pylint: disable=broad-except\n _LOGGER.exception(\"Unknown error connecting to Plex server: %s\", error)\n return self.async_abort(reason=\"unknown\")\n\n if errors:\n if self._manual:\n return await self.async_step_manual_setup(\n user_input=server_config, errors=errors\n )\n return await self.async_step_user(errors=errors)\n\n server_id = plex_server.machine_identifier\n url = plex_server.url_in_use\n token = server_config.get(CONF_TOKEN)\n\n entry_config = {CONF_URL: url}\n if self.client_id:\n entry_config[CONF_CLIENT_ID] = self.client_id\n if token:\n entry_config[CONF_TOKEN] = token\n if url.startswith(\"https\"):\n entry_config[CONF_VERIFY_SSL] = server_config.get(\n CONF_VERIFY_SSL, DEFAULT_VERIFY_SSL\n )\n\n data = {\n CONF_SERVER: plex_server.friendly_name,\n CONF_SERVER_IDENTIFIER: server_id,\n PLEX_SERVER_CONFIG: entry_config,\n }\n\n entry = await self.async_set_unique_id(server_id)\n if self.context[CONF_SOURCE] == config_entries.SOURCE_REAUTH:\n self.hass.config_entries.async_update_entry(entry, data=data)\n _LOGGER.debug(\"Updated config entry for %s\", plex_server.friendly_name)\n await self.hass.config_entries.async_reload(entry.entry_id)\n return self.async_abort(reason=\"reauth_successful\")\n\n self._abort_if_unique_id_configured()\n\n _LOGGER.debug(\"Valid config created for %s\", plex_server.friendly_name)\n\n return self.async_create_entry(title=plex_server.friendly_name, data=data)\n\n async def async_step_select_server(self, user_input=None):\n \"\"\"Use selected Plex server.\"\"\"\n config = dict(self.current_login)\n if user_input is not None:\n config[CONF_SERVER] = user_input[CONF_SERVER]\n return await self.async_step_server_validate(config)\n\n configured = configured_servers(self.hass)\n available_servers = [\n name\n for (name, server_id) in self.available_servers\n if server_id not in configured\n ]\n\n if not available_servers:\n return self.async_abort(reason=\"all_configured\")\n if len(available_servers) == 1:\n config[CONF_SERVER] = available_servers[0]\n return await self.async_step_server_validate(config)\n\n return self.async_show_form(\n step_id=\"select_server\",\n data_schema=vol.Schema(\n {vol.Required(CONF_SERVER): vol.In(available_servers)}\n ),\n errors={},\n )\n\n async def async_step_integration_discovery(self, discovery_info):\n \"\"\"Handle GDM discovery.\"\"\"\n machine_identifier = discovery_info[\"data\"][\"Resource-Identifier\"]\n await self.async_set_unique_id(machine_identifier)\n self._abort_if_unique_id_configured()\n host = f\"{discovery_info['from'][0]}:{discovery_info['data']['Port']}\"\n name = discovery_info[\"data\"][\"Name\"]\n self.context[\"title_placeholders\"] = {\n \"host\": host,\n \"name\": name,\n }\n return await self.async_step_user()\n\n async def async_step_plex_website_auth(self):\n \"\"\"Begin external auth flow on Plex website.\"\"\"\n self.hass.http.register_view(PlexAuthorizationCallbackView)\n hass_url = get_url(self.hass)\n headers = {\"Origin\": hass_url}\n payload = {\n \"X-Plex-Device-Name\": X_PLEX_DEVICE_NAME,\n \"X-Plex-Version\": X_PLEX_VERSION,\n \"X-Plex-Product\": X_PLEX_PRODUCT,\n \"X-Plex-Device\": self.hass.config.location_name,\n \"X-Plex-Platform\": X_PLEX_PLATFORM,\n \"X-Plex-Model\": \"Plex OAuth\",\n }\n session = async_get_clientsession(self.hass)\n self.plexauth = PlexAuth(payload, session, headers)\n await self.plexauth.initiate_auth()\n forward_url = f\"{hass_url}{AUTH_CALLBACK_PATH}?flow_id={self.flow_id}\"\n auth_url = self.plexauth.auth_url(forward_url)\n return self.async_external_step(step_id=\"obtain_token\", url=auth_url)\n\n async def async_step_obtain_token(self, user_input=None):\n \"\"\"Obtain token after external auth completed.\"\"\"\n token = await self.plexauth.token(10)\n\n if not token:\n return self.async_external_step_done(next_step_id=\"timed_out\")\n\n self.token = token\n self.client_id = self.plexauth.client_identifier\n return self.async_external_step_done(next_step_id=\"use_external_token\")\n\n async def async_step_timed_out(self, user_input=None):\n \"\"\"Abort flow when time expires.\"\"\"\n return self.async_abort(reason=\"token_request_timeout\")\n\n async def async_step_use_external_token(self, user_input=None):\n \"\"\"Continue server validation with external token.\"\"\"\n server_config = {CONF_TOKEN: self.token}\n return await self.async_step_server_validate(server_config)\n\n async def async_step_reauth(self, data):\n \"\"\"Handle a reauthorization flow request.\"\"\"\n self.current_login = dict(data)\n return await self.async_step_user()\n\n\nclass PlexOptionsFlowHandler(config_entries.OptionsFlow):\n \"\"\"Handle Plex options.\"\"\"\n\n def __init__(self, config_entry):\n \"\"\"Initialize Plex options flow.\"\"\"\n self.options = copy.deepcopy(dict(config_entry.options))\n self.server_id = config_entry.data[CONF_SERVER_IDENTIFIER]\n\n async def async_step_init(self, user_input=None):\n \"\"\"Manage the Plex options.\"\"\"\n return await self.async_step_plex_mp_settings()\n\n async def async_step_plex_mp_settings(self, user_input=None):\n \"\"\"Manage the Plex media_player options.\"\"\"\n plex_server = self.hass.data[DOMAIN][SERVERS][self.server_id]\n\n if user_input is not None:\n self.options[MP_DOMAIN][CONF_USE_EPISODE_ART] = user_input[\n CONF_USE_EPISODE_ART\n ]\n self.options[MP_DOMAIN][CONF_IGNORE_NEW_SHARED_USERS] = user_input[\n CONF_IGNORE_NEW_SHARED_USERS\n ]\n self.options[MP_DOMAIN][CONF_IGNORE_PLEX_WEB_CLIENTS] = user_input[\n CONF_IGNORE_PLEX_WEB_CLIENTS\n ]\n\n account_data = {\n user: {\"enabled\": bool(user in user_input[CONF_MONITORED_USERS])}\n for user in plex_server.accounts\n }\n\n self.options[MP_DOMAIN][CONF_MONITORED_USERS] = account_data\n\n return self.async_create_entry(title=\"\", data=self.options)\n\n available_accounts = {name: name for name in plex_server.accounts}\n available_accounts[plex_server.owner] += \" [Owner]\"\n\n default_accounts = plex_server.accounts\n known_accounts = set(plex_server.option_monitored_users)\n if known_accounts:\n default_accounts = {\n user\n for user in plex_server.option_monitored_users\n if plex_server.option_monitored_users[user][\"enabled\"]\n }\n for user in plex_server.accounts:\n if user not in known_accounts:\n available_accounts[user] += \" [New]\"\n\n if not plex_server.option_ignore_new_shared_users:\n for new_user in plex_server.accounts - known_accounts:\n default_accounts.add(new_user)\n\n return self.async_show_form(\n step_id=\"plex_mp_settings\",\n data_schema=vol.Schema(\n {\n vol.Required(\n CONF_USE_EPISODE_ART,\n default=plex_server.option_use_episode_art,\n ): bool,\n vol.Optional(\n CONF_MONITORED_USERS, default=default_accounts\n ): cv.multi_select(available_accounts),\n vol.Required(\n CONF_IGNORE_NEW_SHARED_USERS,\n default=plex_server.option_ignore_new_shared_users,\n ): bool,\n vol.Required(\n CONF_IGNORE_PLEX_WEB_CLIENTS,\n default=plex_server.option_ignore_plexweb_clients,\n ): bool,\n }\n ),\n )\n\n\nclass PlexAuthorizationCallbackView(HomeAssistantView):\n \"\"\"Handle callback from external auth.\"\"\"\n\n url = AUTH_CALLBACK_PATH\n name = AUTH_CALLBACK_NAME\n requires_auth = False\n\n async def get(self, request):\n \"\"\"Receive authorization confirmation.\"\"\"\n hass = request.app[\"hass\"]\n await hass.config_entries.flow.async_configure(\n flow_id=request.query[\"flow_id\"], user_input=None\n )\n\n return web_response.Response(\n headers={\"content-type\": \"text/html\"},\n text=\"Success! This window can be closed\",\n )\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":1489924755053045500,"string":"1,489,924,755,053,045,500"},"line_mean":{"kind":"number","value":36.3621495327,"string":"36.36215"},"line_max":{"kind":"number","value":85,"string":"85"},"alpha_frac":{"kind":"number","value":0.5988368457,"string":"0.598837"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.022893081761007,"string":"4.022893"},"config_test":{"kind":"bool","value":true,"string":"true"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44972,"cells":{"repo_name":{"kind":"string","value":"italomaia/turtle-linux"},"path":{"kind":"string","value":"games/Dynamite/pgu/test.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1624"},"content":{"kind":"string","value":"import pygame\nfrom pygame.locals import *\nimport gui\n\n\nscreen = pygame.display.set_mode(\n (640, 480), FULLSCREEN ) # try adding DOUBLEBUF | HWSURFACE \n# pygame.mouse.set_visible(0)\n\n\napp = gui.App()\nc = gui.Container(width=640,height=480)\n\n\n##\n## dialog 1\n##\n\nt1 = gui.Table()\nt1.tr()\nt1.add(gui.Label(\"Gal Test\"))\n\nt2 = gui.Table()\n\nt2.tr()\nt2.add(gui.Label(\"Gui Widgets\"))\nt2.add(gui.Input())\n\nt2.tr()\nt2.add(gui.Label(\"Button\"))\nt2.add(gui.Button(\"Click Me!\"))\n\nd1 = gui.Dialog(t1, t2)\nc.add(d1, 50, 150)\n\n\n##\n## dialog 2\n##\n\nt3 = gui.Table()\nt3.tr()\nt3.add(gui.Label(\"Another one\"))\n\nt4 = gui.Table()\n\nt4.tr()\nt4.add(gui.Label(\"Name\"))\nt4.add(gui.Input())\n\nt4.tr()\nt4.add(gui.Label(\"Ohh\"))\nb1 = gui.Button(\"OK\")\nt4.add(b1)\n\nd2 = gui.Dialog(t3, t4)\nc.add(d2, 50, 300)\n\n\n##\n## some labels\n##\n\nl1 = gui.Label(\"Suppose this is a menu\", color=(255, 255, 255) )\nc.add(l1, 50, 50)\n\nl2 = gui.Label(\"Click to hide top dialog\", color=(255, 255, \n255) )\nc.add(l2, 50, 75)\n\nl3 = gui.Label(\"Opps... Did it happen?\", color=(255, 255, 255) )\n\n##\n## app begins\n##\n\n\napp.init(widget=c,screen=screen)\n\n\nFRAME_EVT = USEREVENT + 1\n\npygame.event.Event(FRAME_EVT)\n\npygame.time.set_timer(FRAME_EVT, 30)\n\n\n_quit = 0\n\nwhile _quit == 0:\n event = pygame.event.wait()\n\n if event.type == FRAME_EVT:\n pygame.display.flip()\n continue\n \n if event.type == KEYDOWN:\n if event.key == K_ESCAPE:\n _quit = 1\n continue\n elif event.key == K_SPACE:\n d1.close()\n c.add(l3, 100, 100)\n \n app._event(event)\n screen.fill((0,0,0))\n app.paint(screen)\n\n"},"license":{"kind":"string","value":"gpl-3.0"},"hash":{"kind":"number","value":4685452212621695000,"string":"4,685,452,212,621,695,000"},"line_mean":{"kind":"number","value":14.037037037,"string":"14.037037"},"line_max":{"kind":"number","value":68,"string":"68"},"alpha_frac":{"kind":"number","value":0.5892857143,"string":"0.589286"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":2.475609756097561,"string":"2.47561"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44973,"cells":{"repo_name":{"kind":"string","value":"wfx/epack"},"path":{"kind":"string","value":"epack/libarchive/ffi.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"7623"},"content":{"kind":"string","value":"# This file is part of a program licensed under the terms of the GNU Lesser\n# General Public License version 2 (or at your option any later version)\n# as published by the Free Software Foundation: http://www.gnu.org/licenses/\n\n\nfrom __future__ import division, print_function, unicode_literals\n\nfrom ctypes import (\n c_char_p, c_int, c_uint, c_longlong, c_size_t, c_void_p,\n c_wchar_p, CFUNCTYPE, POINTER,\n)\n\ntry:\n from ctypes import c_ssize_t\nexcept ImportError:\n from ctypes import c_longlong as c_ssize_t\n\nimport ctypes\nfrom ctypes.util import find_library\nimport logging\nimport mmap\nimport os\n\nfrom .exception import ArchiveError\n\n\nlogger = logging.getLogger('libarchive')\n\npage_size = mmap.PAGESIZE\n\nlibarchive_path = os.environ.get('LIBARCHIVE') or \\\n find_library('archive') or \\\n find_library('libarchive') or \\\n 'libarchive.so'\nlibarchive = ctypes.cdll.LoadLibrary(libarchive_path)\n\n\n# Constants\n\nARCHIVE_EOF = 1 # Found end of archive.\nARCHIVE_OK = 0 # Operation was successful.\nARCHIVE_RETRY = -10 # Retry might succeed.\nARCHIVE_WARN = -20 # Partial success.\nARCHIVE_FAILED = -25 # Current operation cannot complete.\nARCHIVE_FATAL = -30 # No more operations are possible.\n\nAE_IFMT = 0o170000\nAE_IFREG = 0o100000\nAE_IFLNK = 0o120000\nAE_IFSOCK = 0o140000\nAE_IFCHR = 0o020000\nAE_IFBLK = 0o060000\nAE_IFDIR = 0o040000\nAE_IFIFO = 0o010000\n\n\n# Callback types\n\nWRITE_CALLBACK = CFUNCTYPE(\n c_ssize_t, c_void_p, c_void_p, POINTER(c_void_p), c_size_t\n)\nOPEN_CALLBACK = CFUNCTYPE(c_int, c_void_p, c_void_p)\nCLOSE_CALLBACK = CFUNCTYPE(c_int, c_void_p, c_void_p)\nVOID_CB = lambda *_: ARCHIVE_OK\n\n\n# Type aliases, for readability\n\nc_archive_p = c_void_p\nc_archive_entry_p = c_void_p\n\n\n# Helper functions\n\ndef _error_string(archive_p):\n msg = error_string(archive_p)\n if msg is None:\n return\n try:\n return msg.decode('ascii')\n except UnicodeDecodeError:\n return msg\n\n\ndef archive_error(archive_p, retcode):\n msg = _error_string(archive_p)\n raise ArchiveError(msg, errno(archive_p), retcode, archive_p)\n\n\ndef check_null(ret, func, args):\n if ret is None:\n raise ArchiveError(func.__name__+' returned NULL')\n return ret\n\n\ndef check_int(retcode, func, args):\n if retcode >= 0:\n return retcode\n elif retcode == ARCHIVE_WARN:\n logger.warning(_error_string(args[0]))\n return retcode\n else:\n raise archive_error(args[0], retcode)\n\n\ndef ffi(name, argtypes, restype, errcheck=None):\n f = getattr(libarchive, 'archive_'+name)\n f.argtypes = argtypes\n f.restype = restype\n if errcheck:\n f.errcheck = errcheck\n globals()[name] = f\n return f\n\n\n# FFI declarations\n\n# archive_util\n\nerrno = ffi('errno', [c_archive_p], c_int)\nerror_string = ffi('error_string', [c_archive_p], c_char_p)\n\n# archive_entry\n\nffi('entry_new', [], c_archive_entry_p, check_null)\n\nffi('entry_filetype', [c_archive_entry_p], c_int)\nffi('entry_mtime', [c_archive_entry_p], c_int)\nffi('entry_perm', [c_archive_entry_p], c_int)\nffi('entry_pathname_w', [c_archive_entry_p], c_wchar_p)\nffi('entry_sourcepath', [c_archive_entry_p], c_char_p)\nffi('entry_size', [c_archive_entry_p], c_longlong)\nffi('entry_size_is_set', [c_archive_entry_p], c_int)\n\nffi('entry_update_pathname_utf8', [c_archive_entry_p, c_char_p], None)\n\nffi('entry_clear', [c_archive_entry_p], c_archive_entry_p)\nffi('entry_free', [c_archive_entry_p], None)\n\n# archive_read\n\nffi('read_new', [], c_archive_p, check_null)\n\nREAD_FORMATS = set((\n '7zip', 'all', 'ar', 'cab', 'cpio', 'empty', 'iso9660', 'lha', 'mtree',\n 'rar', 'raw', 'tar', 'xar', 'zip'\n))\nfor f_name in list(READ_FORMATS):\n try:\n ffi('read_support_format_'+f_name, [c_archive_p], c_int, check_int)\n except AttributeError: # pragma: no cover\n logger.warning('read format \"%s\" is not supported' % f_name)\n READ_FORMATS.remove(f_name)\n\nREAD_FILTERS = set((\n 'all', 'bzip2', 'compress', 'grzip', 'gzip', 'lrzip', 'lzip', 'lzma',\n 'lzop', 'none', 'rpm', 'uu', 'xz'\n))\nfor f_name in list(READ_FILTERS):\n try:\n ffi('read_support_filter_'+f_name, [c_archive_p], c_int, check_int)\n except AttributeError: # pragma: no cover\n logger.warning('read filter \"%s\" is not supported' % f_name)\n READ_FILTERS.remove(f_name)\n\nffi('read_open_fd', [c_archive_p, c_int, c_size_t], c_int, check_int)\nffi('read_open_filename_w', [c_archive_p, c_wchar_p, c_size_t],\n c_int, check_int)\nffi('read_open_memory', [c_archive_p, c_void_p, c_size_t], c_int, check_int)\n\nffi('read_next_header', [c_archive_p, POINTER(c_void_p)], c_int, check_int)\nffi('read_next_header2', [c_archive_p, c_void_p], c_int, check_int)\n\nffi('read_close', [c_archive_p], c_int, check_int)\nffi('read_free', [c_archive_p], c_int, check_int)\n\n# archive_read_disk\n\nffi('read_disk_new', [], c_archive_p, check_null)\nffi('read_disk_set_standard_lookup', [c_archive_p], c_int, check_int)\nffi('read_disk_open', [c_archive_p, c_char_p], c_int, check_int)\nffi('read_disk_open_w', [c_archive_p, c_wchar_p], c_int, check_int)\nffi('read_disk_descend', [c_archive_p], c_int, check_int)\n\n# archive_read_data\n\nffi('read_data_block',\n [c_archive_p, POINTER(c_void_p), POINTER(c_size_t), POINTER(c_longlong)],\n c_int, check_int)\nffi('read_data', [c_archive_p, c_void_p, c_size_t], c_ssize_t, check_int)\nffi('read_data_skip', [c_archive_p], c_int, check_int)\n\n# archive_write\n\nffi('write_new', [], c_archive_p, check_null)\n\nffi('write_disk_new', [], c_archive_p, check_null)\nffi('write_disk_set_options', [c_archive_p, c_int], c_int, check_int)\n\nWRITE_FORMATS = set((\n '7zip', 'ar_bsd', 'ar_svr4', 'cpio', 'cpio_newc', 'gnutar', 'iso9660',\n 'mtree', 'mtree_classic', 'pax', 'pax_restricted', 'shar', 'shar_dump',\n 'ustar', 'v7tar', 'xar', 'zip'\n))\nfor f_name in list(WRITE_FORMATS):\n try:\n ffi('write_set_format_'+f_name, [c_archive_p], c_int, check_int)\n except AttributeError: # pragma: no cover\n logger.warning('write format \"%s\" is not supported' % f_name)\n WRITE_FORMATS.remove(f_name)\n\nWRITE_FILTERS = set((\n 'b64encode', 'bzip2', 'compress', 'grzip', 'gzip', 'lrzip', 'lzip', 'lzma',\n 'lzop', 'uuencode', 'xz'\n))\nfor f_name in list(WRITE_FILTERS):\n try:\n ffi('write_add_filter_'+f_name, [c_archive_p], c_int, check_int)\n except AttributeError: # pragma: no cover\n logger.warning('write filter \"%s\" is not supported' % f_name)\n WRITE_FILTERS.remove(f_name)\n\nffi('write_open',\n [c_archive_p, c_void_p, OPEN_CALLBACK, WRITE_CALLBACK, CLOSE_CALLBACK],\n c_int, check_int)\nffi('write_open_fd', [c_archive_p, c_int], c_int, check_int)\nffi('write_open_filename', [c_archive_p, c_char_p], c_int, check_int)\nffi('write_open_filename_w', [c_archive_p, c_wchar_p], c_int, check_int)\nffi('write_open_memory',\n [c_archive_p, c_void_p, c_size_t, POINTER(c_size_t)],\n c_int, check_int)\n\nffi('write_get_bytes_in_last_block', [c_archive_p], c_int, check_int)\nffi('write_get_bytes_per_block', [c_archive_p], c_int, check_int)\nffi('write_set_bytes_in_last_block', [c_archive_p, c_int], c_int, check_int)\nffi('write_set_bytes_per_block', [c_archive_p, c_int], c_int, check_int)\n\nffi('write_header', [c_archive_p, c_void_p], c_int, check_int)\nffi('write_data', [c_archive_p, c_void_p, c_size_t], c_ssize_t, check_int)\nffi('write_data_block', [c_archive_p, c_void_p, c_size_t, c_longlong],\n c_int, check_int)\nffi('write_finish_entry', [c_archive_p], c_int, check_int)\n\nffi('write_close', [c_archive_p], c_int, check_int)\nffi('write_free', [c_archive_p], c_int, check_int)\n"},"license":{"kind":"string","value":"gpl-3.0"},"hash":{"kind":"number","value":-946142099526545800,"string":"-946,142,099,526,545,800"},"line_mean":{"kind":"number","value":30.1142857143,"string":"30.114286"},"line_max":{"kind":"number","value":79,"string":"79"},"alpha_frac":{"kind":"number","value":0.6479076479,"string":"0.647908"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":2.710881934566145,"string":"2.710882"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44974,"cells":{"repo_name":{"kind":"string","value":"chintak/scikit-image"},"path":{"kind":"string","value":"skimage/feature/util.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"4726"},"content":{"kind":"string","value":"import numpy as np\n\nfrom skimage.util import img_as_float\n\n\nclass FeatureDetector(object):\n\n def __init__(self):\n self.keypoints_ = np.array([])\n\n def detect(self, image):\n \"\"\"Detect keypoints in image.\n\n Parameters\n ----------\n image : 2D array\n Input image.\n\n \"\"\"\n raise NotImplementedError()\n\n\nclass DescriptorExtractor(object):\n\n def __init__(self):\n self.descriptors_ = np.array([])\n\n def extract(self, image, keypoints):\n \"\"\"Extract feature descriptors in image for given keypoints.\n\n Parameters\n ----------\n image : 2D array\n Input image.\n keypoints : (N, 2) array\n Keypoint locations as ``(row, col)``.\n\n \"\"\"\n raise NotImplementedError()\n\n\ndef plot_matches(ax, image1, image2, keypoints1, keypoints2, matches,\n keypoints_color='k', matches_color=None, only_matches=False):\n \"\"\"Plot matched features.\n\n Parameters\n ----------\n ax : matplotlib.axes.Axes\n Matches and image are drawn in this ax.\n image1 : (N, M [, 3]) array\n First grayscale or color image.\n image2 : (N, M [, 3]) array\n Second grayscale or color image.\n keypoints1 : (K1, 2) array\n First keypoint coordinates as ``(row, col)``.\n keypoints2 : (K2, 2) array\n Second keypoint coordinates as ``(row, col)``.\n matches : (Q, 2) array\n Indices of corresponding matches in first and second set of\n descriptors, where ``matches[:, 0]`` denote the indices in the first\n and ``matches[:, 1]`` the indices in the second set of descriptors.\n keypoints_color : matplotlib color, optional\n Color for keypoint locations.\n matches_color : matplotlib color, optional\n Color for lines which connect keypoint matches. By default the\n color is chosen randomly.\n only_matches : bool, optional\n Whether to only plot matches and not plot the keypoint locations.\n\n \"\"\"\n\n image1 = img_as_float(image1)\n image2 = img_as_float(image2)\n\n new_shape1 = list(image1.shape)\n new_shape2 = list(image2.shape)\n\n if image1.shape[0] < image2.shape[0]:\n new_shape1[0] = image2.shape[0]\n elif image1.shape[0] > image2.shape[0]:\n new_shape2[0] = image1.shape[0]\n\n if image1.shape[1] < image2.shape[1]:\n new_shape1[1] = image2.shape[1]\n elif image1.shape[1] > image2.shape[1]:\n new_shape2[1] = image1.shape[1]\n\n if new_shape1 != image1.shape:\n new_image1 = np.zeros(new_shape1, dtype=image1.dtype)\n new_image1[:image1.shape[0], :image1.shape[1]] = image1\n image1 = new_image1\n\n if new_shape2 != image2.shape:\n new_image2 = np.zeros(new_shape2, dtype=image2.dtype)\n new_image2[:image2.shape[0], :image2.shape[1]] = image2\n image2 = new_image2\n\n image = np.concatenate([image1, image2], axis=1)\n\n offset = image1.shape\n\n if not only_matches:\n ax.scatter(keypoints1[:, 1], keypoints1[:, 0],\n facecolors='none', edgecolors=keypoints_color)\n ax.scatter(keypoints2[:, 1] + offset[1], keypoints2[:, 0],\n facecolors='none', edgecolors=keypoints_color)\n\n ax.imshow(image)\n ax.axis((0, 2 * offset[1], offset[0], 0))\n\n for i in range(matches.shape[0]):\n idx1 = matches[i, 0]\n idx2 = matches[i, 1]\n\n if matches_color is None:\n color = np.random.rand(3, 1)\n else:\n color = matches_color\n\n ax.plot((keypoints1[idx1, 1], keypoints2[idx2, 1] + offset[1]),\n (keypoints1[idx1, 0], keypoints2[idx2, 0]),\n '-', color=color)\n\n\ndef _prepare_grayscale_input_2D(image):\n image = np.squeeze(image)\n if image.ndim != 2:\n raise ValueError(\"Only 2-D gray-scale images supported.\")\n\n return img_as_float(image)\n\n\ndef _mask_border_keypoints(image_shape, keypoints, distance):\n \"\"\"Mask coordinates that are within certain distance from the image border.\n\n Parameters\n ----------\n image_shape : (2, ) array_like\n Shape of the image as ``(rows, cols)``.\n keypoints : (N, 2) array\n Keypoint coordinates as ``(rows, cols)``.\n distance : int\n Image border distance.\n\n Returns\n -------\n mask : (N, ) bool array\n Mask indicating if pixels are within the image (``True``) or in the\n border region of the image (``False``).\n\n \"\"\"\n\n rows = image_shape[0]\n cols = image_shape[1]\n\n mask = (((distance - 1) < keypoints[:, 0])\n & (keypoints[:, 0] < (rows - distance + 1))\n & ((distance - 1) < keypoints[:, 1])\n & (keypoints[:, 1] < (cols - distance + 1)))\n\n return mask\n"},"license":{"kind":"string","value":"bsd-3-clause"},"hash":{"kind":"number","value":973310001294730000,"string":"973,310,001,294,730,000"},"line_mean":{"kind":"number","value":28.3540372671,"string":"28.354037"},"line_max":{"kind":"number","value":79,"string":"79"},"alpha_frac":{"kind":"number","value":0.5854845535,"string":"0.585485"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.7124901806755695,"string":"3.71249"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44975,"cells":{"repo_name":{"kind":"string","value":"pavlov99/jsonapi"},"path":{"kind":"string","value":"jsonapi/utils.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"2220"},"content":{"kind":"string","value":"\"\"\" JSON:API utils.\"\"\"\n\n\nclass _classproperty(property):\n\n \"\"\" Implement property behaviour for classes.\n\n class A():\n\n @_classproperty\n @classmethod\n def name(cls):\n return cls.__name__\n\n \"\"\"\n\n def __get__(self, obj, type_):\n return self.fget.__get__(None, type_)()\n\n\ndef _cached(f):\n \"\"\" Decorator that makes a method cached.\"\"\"\n\n attr_name = '_cached_' + f.__name__\n\n def wrapper(obj, *args, **kwargs):\n if not hasattr(obj, attr_name):\n setattr(obj, attr_name, f(obj, *args, **kwargs))\n return getattr(obj, attr_name)\n return wrapper\n\n\nclassproperty = lambda f: _classproperty(classmethod(f))\ncached_property = lambda f: property(_cached(f))\ncached_classproperty = lambda f: classproperty(_cached(f))\n\n\nclass Choices(object):\n\n \"\"\" Choices.\"\"\"\n\n def __init__(self, *choices):\n self._choices = []\n self._choice_dict = {}\n\n for choice in choices:\n if isinstance(choice, (list, tuple)):\n if len(choice) == 2:\n choice = (choice[0], choice[1], choice[1])\n\n elif len(choice) != 3:\n raise ValueError(\n \"Choices can't handle a list/tuple of length {0}, only\\\n 2 or 3\".format(choice))\n else:\n choice = (choice, choice, choice)\n\n self._choices.append((choice[0], choice[2]))\n self._choice_dict[choice[1]] = choice[0]\n\n def __getattr__(self, attname):\n try:\n return self._choice_dict[attname]\n except KeyError:\n raise AttributeError(attname)\n\n def __iter__(self):\n return iter(self._choices)\n\n def __getitem__(self, index):\n return self._choices[index]\n\n def __delitem__(self, index):\n del self._choices[index]\n\n def __setitem__(self, index, value):\n self._choices[index] = value\n\n def __repr__(self):\n return \"{0}({1})\".format(\n self.__class__.__name__,\n self._choices\n )\n\n def __len__(self):\n return len(self._choices)\n\n def __contains__(self, element):\n return element in self._choice_dict.values()\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-3830283769636155400,"string":"-3,830,283,769,636,155,400"},"line_mean":{"kind":"number","value":23.9438202247,"string":"23.94382"},"line_max":{"kind":"number","value":79,"string":"79"},"alpha_frac":{"kind":"number","value":0.5306306306,"string":"0.530631"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.157303370786517,"string":"4.157303"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44976,"cells":{"repo_name":{"kind":"string","value":"NicWayand/xray"},"path":{"kind":"string","value":"xarray/plot/utils.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"6442"},"content":{"kind":"string","value":"import pkg_resources\n\nimport numpy as np\nimport pandas as pd\n\nfrom ..core.pycompat import basestring\n\n\ndef _load_default_cmap(fname='default_colormap.csv'):\n \"\"\"\n Returns viridis color map\n \"\"\"\n from matplotlib.colors import LinearSegmentedColormap\n\n # Not sure what the first arg here should be\n f = pkg_resources.resource_stream(__name__, fname)\n cm_data = pd.read_csv(f, header=None).values\n\n return LinearSegmentedColormap.from_list('viridis', cm_data)\n\n\ndef _determine_extend(calc_data, vmin, vmax):\n extend_min = calc_data.min() < vmin\n extend_max = calc_data.max() > vmax\n if extend_min and extend_max:\n extend = 'both'\n elif extend_min:\n extend = 'min'\n elif extend_max:\n extend = 'max'\n else:\n extend = 'neither'\n return extend\n\n\ndef _build_discrete_cmap(cmap, levels, extend, filled):\n \"\"\"\n Build a discrete colormap and normalization of the data.\n \"\"\"\n import matplotlib as mpl\n\n if not filled:\n # non-filled contour plots\n extend = 'max'\n\n if extend == 'both':\n ext_n = 2\n elif extend in ['min', 'max']:\n ext_n = 1\n else:\n ext_n = 0\n\n n_colors = len(levels) + ext_n - 1\n pal = _color_palette(cmap, n_colors)\n\n new_cmap, cnorm = mpl.colors.from_levels_and_colors(\n levels, pal, extend=extend)\n # copy the old cmap name, for easier testing\n new_cmap.name = getattr(cmap, 'name', cmap)\n\n return new_cmap, cnorm\n\n\ndef _color_palette(cmap, n_colors):\n import matplotlib.pyplot as plt\n from matplotlib.colors import ListedColormap\n colors_i = np.linspace(0, 1., n_colors)\n if isinstance(cmap, (list, tuple)):\n # we have a list of colors\n try:\n # first try to turn it into a palette with seaborn\n from seaborn.apionly import color_palette\n pal = color_palette(cmap, n_colors=n_colors)\n except ImportError:\n # if that fails, use matplotlib\n # in this case, is there any difference between mpl and seaborn?\n cmap = ListedColormap(cmap, N=n_colors)\n pal = cmap(colors_i)\n elif isinstance(cmap, basestring):\n # we have some sort of named palette\n try:\n # first try to turn it into a palette with seaborn\n from seaborn.apionly import color_palette\n pal = color_palette(cmap, n_colors=n_colors)\n except (ImportError, ValueError):\n # ValueError is raised when seaborn doesn't like a colormap\n # (e.g. jet). If that fails, use matplotlib\n try:\n # is this a matplotlib cmap?\n cmap = plt.get_cmap(cmap)\n except ValueError:\n # or maybe we just got a single color as a string\n cmap = ListedColormap([cmap], N=n_colors)\n pal = cmap(colors_i)\n else:\n # cmap better be a LinearSegmentedColormap (e.g. viridis)\n pal = cmap(colors_i)\n\n return pal\n\n\ndef _determine_cmap_params(plot_data, vmin=None, vmax=None, cmap=None,\n center=None, robust=False, extend=None,\n levels=None, filled=True, cnorm=None):\n \"\"\"\n Use some heuristics to set good defaults for colorbar and range.\n\n Adapted from Seaborn:\n https://github.com/mwaskom/seaborn/blob/v0.6/seaborn/matrix.py#L158\n\n Parameters\n ==========\n plot_data: Numpy array\n Doesn't handle xarray objects\n\n Returns\n =======\n cmap_params : dict\n Use depends on the type of the plotting function\n \"\"\"\n ROBUST_PERCENTILE = 2.0\n import matplotlib as mpl\n\n calc_data = np.ravel(plot_data[~pd.isnull(plot_data)])\n\n # Setting center=False prevents a divergent cmap\n possibly_divergent = center is not False\n\n # Set center to 0 so math below makes sense but remember its state\n center_is_none = False\n if center is None:\n center = 0\n center_is_none = True\n\n # Setting both vmin and vmax prevents a divergent cmap\n if (vmin is not None) and (vmax is not None):\n possibly_divergent = False\n\n # vlim might be computed below\n vlim = None\n\n if vmin is None:\n if robust:\n vmin = np.percentile(calc_data, ROBUST_PERCENTILE)\n else:\n vmin = calc_data.min()\n elif possibly_divergent:\n vlim = abs(vmin - center)\n\n if vmax is None:\n if robust:\n vmax = np.percentile(calc_data, 100 - ROBUST_PERCENTILE)\n else:\n vmax = calc_data.max()\n elif possibly_divergent:\n vlim = abs(vmax - center)\n\n if possibly_divergent:\n # kwargs not specific about divergent or not: infer defaults from data\n divergent = ((vmin < 0) and (vmax > 0)) or not center_is_none\n else:\n divergent = False\n\n # A divergent map should be symmetric around the center value\n if divergent:\n if vlim is None:\n vlim = max(abs(vmin - center), abs(vmax - center))\n vmin, vmax = -vlim, vlim\n\n # Now add in the centering value and set the limits\n vmin += center\n vmax += center\n\n # Choose default colormaps if not provided\n if cmap is None:\n if divergent:\n cmap = \"RdBu_r\"\n else:\n cmap = \"viridis\"\n\n # Allow viridis before matplotlib 1.5\n if cmap == \"viridis\":\n cmap = _load_default_cmap()\n\n # Handle discrete levels\n if levels is not None:\n if isinstance(levels, int):\n ticker = mpl.ticker.MaxNLocator(levels)\n levels = ticker.tick_values(vmin, vmax)\n vmin, vmax = levels[0], levels[-1]\n\n if extend is None:\n extend = _determine_extend(calc_data, vmin, vmax)\n\n if levels is not None:\n cmap, cnorm = _build_discrete_cmap(cmap, levels, extend, filled)\n\n return dict(vmin=vmin, vmax=vmax, cmap=cmap, extend=extend,\n levels=levels, norm=cnorm)\n\n\ndef _infer_xy_labels(darray, x, y):\n \"\"\"\n Determine x and y labels. For use in _plot2d\n\n darray must be a 2 dimensional data array.\n \"\"\"\n\n if x is None and y is None:\n if darray.ndim != 2:\n raise ValueError('DataArray must be 2d')\n y, x = darray.dims\n elif x is None or y is None:\n raise ValueError('cannot supply only one of x and y')\n elif any(k not in darray.coords for k in (x, y)):\n raise ValueError('x and y must be coordinate variables')\n return x, y\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":5193884461763979000,"string":"5,193,884,461,763,979,000"},"line_mean":{"kind":"number","value":28.6866359447,"string":"28.686636"},"line_max":{"kind":"number","value":78,"string":"78"},"alpha_frac":{"kind":"number","value":0.6036945048,"string":"0.603695"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.7894117647058825,"string":"3.789412"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44977,"cells":{"repo_name":{"kind":"string","value":"xozzo/pyfootball"},"path":{"kind":"string","value":"setup.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1257"},"content":{"kind":"string","value":"from setuptools import setup, find_packages\nimport os\n\n\nif os.path.exists('README.rst'):\n readme_path = 'README.rst'\nelse:\n readme_path = 'README.md'\n\nsetup(\n name='pyfootball',\n version='1.0.1',\n description='A client library for the football-data.org REST API',\n long_description=open(readme_path).read(),\n url='https://github.com/xozzo/pyfootball',\n author='Timothy Ng',\n author_email='hello@timothyng.xyz',\n license='MIT',\n\n # See https://pypi.python.org/pypi?%3Aaction=list_classifiers\n classifiers=[\n 'Development Status :: 5 - Production/Stable',\n 'Intended Audience :: Developers',\n 'Topic :: Software Development :: Libraries',\n 'License :: OSI Approved :: MIT License',\n 'Programming Language :: Python :: 3.5'\n ],\n\n keywords='api wrapper client library football data',\n\n packages=find_packages(exclude=['contrib', 'docs', 'tests', 'venv']),\n\n install_requires=['requests'],\n\n test_suite='tests',\n\n # List additional groups of dependencies here (e.g. development\n # dependencies). You can install these using the following syntax,\n # for example:\n # $ pip install -e .[dev]\n extras_require={\n 'dev': ['sphinx', 'sphinx-autobuild']\n }\n)\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-1856567441525745200,"string":"-1,856,567,441,525,745,200"},"line_mean":{"kind":"number","value":27.5681818182,"string":"27.568182"},"line_max":{"kind":"number","value":73,"string":"73"},"alpha_frac":{"kind":"number","value":0.6428003182,"string":"0.6428"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.797583081570997,"string":"3.797583"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44978,"cells":{"repo_name":{"kind":"string","value":"foursquare/pants"},"path":{"kind":"string","value":"contrib/go/src/python/pants/contrib/go/tasks/go_test.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"2117"},"content":{"kind":"string","value":"# coding=utf-8\n# Copyright 2015 Pants project contributors (see CONTRIBUTORS.md).\n# Licensed under the Apache License, Version 2.0 (see LICENSE).\n\nfrom __future__ import absolute_import, division, print_function, unicode_literals\n\nfrom builtins import filter\n\nfrom pants.base.exceptions import TaskError\nfrom pants.base.workunit import WorkUnitLabel\n\nfrom pants.contrib.go.tasks.go_workspace_task import GoWorkspaceTask\n\n\nclass GoTest(GoWorkspaceTask):\n \"\"\"Runs `go test` on Go packages.\n\n To run a library's tests, GoTest only requires a Go workspace to be initialized\n (see GoWorkspaceTask) with links to necessary source files. It does not require\n GoCompile to first compile the library to be tested -- in fact, GoTest will ignore\n any binaries in \"$GOPATH/pkg/\", because Go test files (which live in the package\n they are testing) are ignored in normal compilation, so Go test must compile everything\n from scratch.\n \"\"\"\n\n @classmethod\n def register_options(cls, register):\n super(GoTest, cls).register_options(register)\n register('--build-and-test-flags', default='',\n fingerprint=True,\n help='Flags to pass in to `go test` tool.')\n\n @classmethod\n def supports_passthru_args(cls):\n return True\n\n def execute(self):\n # Only executes the tests from the package specified by the target roots, so\n # we don't run the tests for _all_ dependencies of said package.\n targets = filter(self.is_local_src, self.context.target_roots)\n for target in targets:\n self.ensure_workspace(target)\n self._go_test(target)\n\n def _go_test(self, target):\n args = (self.get_options().build_and_test_flags.split()\n + [target.import_path]\n + self.get_passthru_args())\n result, go_cmd = self.go_dist.execute_go_cmd('test', gopath=self.get_gopath(target), args=args,\n workunit_factory=self.context.new_workunit,\n workunit_labels=[WorkUnitLabel.TEST])\n if result != 0:\n raise TaskError('{} failed with exit code {}'.format(go_cmd, result))\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":-9153807366505908000,"string":"-9,153,807,366,505,908,000"},"line_mean":{"kind":"number","value":38.9433962264,"string":"38.943396"},"line_max":{"kind":"number","value":99,"string":"99"},"alpha_frac":{"kind":"number","value":0.6830420406,"string":"0.683042"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.001890359168242,"string":"4.00189"},"config_test":{"kind":"bool","value":true,"string":"true"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44979,"cells":{"repo_name":{"kind":"string","value":"bodylabs/blmath"},"path":{"kind":"string","value":"blmath/geometry/transform/correspondence.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"2095"},"content":{"kind":"string","value":"# FIXME -- move back to core\n\ndef apply_correspondence(correspondence_src, correspondence_dst, vertices):\n \"\"\"\n Apply a correspondence defined between two vertex sets to a new set.\n\n Identifies a correspondence between `correspondence_src` and\n `correspondence_dst` then applies that correspondence to `vertices`.\n That is, `correspondence_src` is to `correspondence_dst` as `vertices` is\n to [ return value ].\n\n `correspondence_src` and `vertices` must have the same topology. The return\n value will have the same topology as `correspondence_dst`. Arguments can\n be passed as `chumpy` or `numpy` arrays.\n\n The most common usecase here is establishing a relationship between an\n alignment and a pointcloud or set of landmarks. The pointcloud or landmarks\n can then be moved automatically as the alignment is adjusted (e.g. fit to a\n different mesh, reposed, etc).\n\n Args:\n correspondence_src: The source vertices for the correspondence\n correspondence_dst: The destination vertices for the correspondence\n vertices: The vertices to map using the defined correspondence\n\n Returns:\n the mapped version of `vertices`\n\n Example usage\n -------------\n\n >>> transformed_scan_vertices = apply_correspondence(\n ... correspondence_src=alignment.v,\n ... correspondence_dst=scan.v,\n ... vertices=reposed_alignment.v\n ... )\n >>> transformed_scan = Mesh(v=transformed_scan_vertices, vc=scan.vc)\n\n \"\"\"\n import chumpy as ch\n from bodylabs.mesh.landmarking.transformed_lm import TransformedCoeffs\n from bodylabs.mesh.landmarking.transformed_lm import TransformedLms\n\n ch_desired = any([\n isinstance(correspondence_src, ch.Ch),\n isinstance(correspondence_dst, ch.Ch),\n isinstance(vertices, ch.Ch),\n ])\n\n coeffs = TransformedCoeffs(\n src_v=correspondence_src, dst_v=correspondence_dst)\n\n transformed_vertices = TransformedLms(\n transformed_coeffs=coeffs, src_v=vertices)\n\n return transformed_vertices if ch_desired else transformed_vertices.r\n"},"license":{"kind":"string","value":"bsd-2-clause"},"hash":{"kind":"number","value":-4415321806514047000,"string":"-4,415,321,806,514,047,000"},"line_mean":{"kind":"number","value":36.4107142857,"string":"36.410714"},"line_max":{"kind":"number","value":79,"string":"79"},"alpha_frac":{"kind":"number","value":0.7059665871,"string":"0.705967"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.052224371373308,"string":"4.052224"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44980,"cells":{"repo_name":{"kind":"string","value":"lepinkainen/pyfibot"},"path":{"kind":"string","value":"pyfibot/modules/module_geoip.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1389"},"content":{"kind":"string","value":"from __future__ import unicode_literals, print_function, division\nimport pygeoip\nimport os.path\nimport sys\nimport socket\n\ntry:\n from modules.module_usertrack import get_table\n\n user_track_available = True\nexcept ImportError:\n user_track_available = False\n\n\n# http://dev.maxmind.com/geoip/legacy/geolite/\nDATAFILE = os.path.join(sys.path[0], \"GeoIP.dat\")\n\n# STANDARD = reload from disk\n# MEMORY_CACHE = load to memory\n# MMAP_CACHE = memory using mmap\ngi4 = pygeoip.GeoIP(DATAFILE, pygeoip.MEMORY_CACHE)\n\n\ndef command_geoip(bot, user, channel, args):\n \"\"\"Determine the user's country based on host or nick, if module_usertrack is used.\"\"\"\n if not args:\n return bot.say(channel, \"usage: .geoip HOST/NICK\")\n\n host = args\n nick = None\n\n if user_track_available:\n table = get_table(bot, channel)\n user = table.find_one(nick=args)\n if user:\n nick = user[\"nick\"]\n host = user[\"host\"]\n\n try:\n country = gi4.country_name_by_name(host)\n except socket.gaierror:\n country = None\n\n if country:\n if nick:\n return bot.say(channel, \"%s (%s) is in %s\" % (nick, host, country))\n return bot.say(channel, \"%s is in %s\" % (host, country))\n if nick:\n return bot.say(channel, \"Host not found for %s (%s)\" % (nick, host))\n return bot.say(channel, \"Host not found for %s\" % host)\n"},"license":{"kind":"string","value":"bsd-3-clause"},"hash":{"kind":"number","value":-4394593471870656500,"string":"-4,394,593,471,870,656,500"},"line_mean":{"kind":"number","value":26.78,"string":"26.78"},"line_max":{"kind":"number","value":90,"string":"90"},"alpha_frac":{"kind":"number","value":0.6364290857,"string":"0.636429"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.4127764127764126,"string":"3.412776"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44981,"cells":{"repo_name":{"kind":"string","value":"llou/panopticon"},"path":{"kind":"string","value":"panopticon/core/database.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"7145"},"content":{"kind":"string","value":"# database.py is part of Panopticon.\n\n# Panopticon is free software: you can redistribute it and/or modify\n# it under the terms of the GNU General Public License as published by\n# the Free Software Foundation, either version 3 of the License, or\n# (at your option) any later version.\n\n# Panopticon is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU General Public License for more details.\n\n# You should have received a copy of the GNU General Public License\n# along with Panopticon. If not, see .\n\nfrom contextlib import contextmanager\nfrom paramiko import RSAKey as pRSAKey, DSSKey\nfrom sqlalchemy import create_engine, Column, DateTime, String, Integer, Text, Boolean\nfrom sqlalchemy.orm import sessionmaker, relationship, backref\nfrom sqlalchemy.sql import not_ \nfrom sqlalchemy.schema import ForeignKey\nfrom sqlalchemy.pool import NullPool\nfrom sqlalchemy.ext.declarative import declarative_base\nfrom panopticon.core.util.database import key_value_property\n\nBase = declarative_base()\n\nclass Value(Base):\n __tablename__ = \"values\"\n id = Column(Integer(), primary_key=True)\n name = Column(String(1000))\n value = Column(String(1000), nullable=True)\n parent_id = Column(Integer, ForeignKey(\"values.id\"), nullable=True)\n values = relationship(\"Value\", backref=backref('parent', remote_side=[id], \n cascade=\"all\"))\n type = Column(String(20))\n\n def __init__(self, name, _type, value=\"\", parent_id=None):\n self.name = name\n self.type = _type\n self.value = value\n self.parent_id = parent_id\n\n @property\n def root(self):\n return self.id == self.parent\n\nclass Service(Base):\n __tablename__ = \"services\"\n name = Column(String(50), primary_key=True)\n\nclass Computer(Base):\n __tablename__ = \"computers\"\n __table_args__ = {'sqlite_autoincrement':True}\n\n name = Column(String(255), primary_key=True)\n key_name = Column(String(100), ForeignKey('keys.name', onupdate=\"CASCADE\"))\n active = Column(Boolean(), default=True)\n key = relationship(\"Key\", backref=backref('computers'))\n logs = relationship(\"Log\", backref=\"computer\", order_by=\"Log.time\")\n\n def __init__(self, name, key_name=\"\", active=True):\n self.name = name\n self.active = active\n self.key_name = key_name\n\nclass Log(Base):\n __tablename__ = \"logs\"\n id = Column('id', Integer, primary_key=True)\n time = Column(DateTime())\n level = Column(String(10))\n message = Column(Text())\n computer_name = Column(String(255), ForeignKey('computers.name',\n ondelete=\"CASCADE\", onupdate=\"CASCADE\"), index=True)\n service_name = Column(String(255), ForeignKey('services.name',\n ondelete=\"CASCADE\", onupdate=\"CASCADE\"), index=True)\n role_name = Column(String(255), index=True)\n action_name = Column(String(255), index=True)\n\n def __init__(self, time, level, message, computer_name=\"\", \n service_name=\"\", role_name=\"\", action_name=\"\"):\n self.time = time\n self.level = level\n self.message = message\n self.computer_name = computer_name\n\nclass FileTrack(Base):\n __tablename__ = \"filetracks\"\n uid = Column(\"uid\", String(32), primary_key=True)\n _computer_name = Column(\"computer_name\", String(255),ForeignKey('computers.name'))\n _path = Column(\"path\", Text())\n modification_time = Column(\"modification_time\", DateTime())\n md5 = Column(\"md5\", String(32))\n\n def __init__(self, computer_name, path, modification_time, md5=\"\"):\n self.computer_name = computer_name\n self.path = path\n self.modification_time = modification_time\n self.md5 = md5\n self.update_uid()\n\n @property\n def computer_name(self):\n return self._computer_name\n\n @computer_name.setter\n def computer_name(self, value):\n self._computer_name = value\n self.update_uid()\n\n @property\n def path(self):\n return self._path\n\n @path.setter\n def path(self, value):\n self._path = value\n self.update_uid()\n\n def update_uid(self):\n if self.computer_name and self.path:\n self.uid = \"%s:%s\" % (self.computer_name, self.path)\n else:\n self.uid = \"\"\n\nclass Key(Base):\n __tablename__ = \"keys\"\n name = Column(String(100), primary_key=True)\n algorithm = Column(String(20))\n v1 = Column(String(2048))\n v2 = Column(String(2048))\n v3 = Column(String(2048))\n v4 = Column(String(2048))\n key_class = None\n key_vals = []\n __mapper_args__ = {'polymorphic_on' : algorithm}\n\n @classmethod\n def build_from_paramiko_key(cls, name, p_key):\n if isinstance(p_key, pRSAKey):\n return RSAKey(name, p_key.e, p_key.n)\n elif isinstance(p_key, DSSKey):\n return DSAKey(name, p_key.p, p_key.q, p_key.g, p_key.y)\n else:\n raise Exception(\"Not valid key\")\n\n def __init__(self, name, algorithm, v1, v2, v3, v4):\n self.name = name\n self.algorithm = algorithm\n self.v1 = v1\n self.v2 = v2\n self.v3 = v3\n self.v4 = v4\n\n def get_paramiko_key(self):\n vals = [ getattr(self, x) for x in self.key_vals ]\n return self.key_class(vals=vals)\n\nclass RSAKey(Key):\n __mapper_args__ = {'polymorphic_identity':'rsa'}\n key_class = pRSAKey\n key_vals = [ 'e', 'n' ]\n\n def __init__(self, name, e, n):\n self.name = name\n self.algorithm = \"rsa\"\n self.e = e\n self.n = n\n\n e = key_value_property(\"v1\")\n n = key_value_property(\"v2\")\n\n\nclass DSAKey(Key):\n __mapper_args__ = {'polymorphic_identity':'dsa'}\n key_class = DSSKey\n key_vals = [ 'p', 'q', 'g', 'y' ]\n\n def __init__(self, name, p, q, g, y):\n self.name = name\n self.algorithm = \"dsa\"\n self.p = p\n self.q = q\n self.g = g\n self.y = y\n\n p = key_value_property(\"v1\")\n q = key_value_property(\"v2\")\n g = key_value_property(\"v3\")\n y = key_value_property(\"v4\")\n\n\nclass PanopticonDB(object):\n def __init__(self, panopticon, engine=None):\n self.panopticon = panopticon\n self.engine = engine if engine is not None else create_engine(panopticon.db_url, poolclass=NullPool)\n Base.metadata.create_all(self.engine)\n self.Session = sessionmaker(bind=self.engine)\n self.sync()\n\n @contextmanager\n def get_session(self):\n session = self.Session()\n yield session\n session.commit()\n session.close()\n\n def purge(self,sure=False):\n if sure:\n Base.metadata.drop_all(self.engine)\n Base.metadata.create_all(self.engine)\n\n def sync(self):\n computer_names = [ x[0] for x in self.panopticon.computers ]\n with self.get_session() as session:\n session.execute(Computer.__table__.update().where(Computer.name.in_(computer_names)).values(active=True))\n session.execute(Computer.__table__.update().where(not_(Computer.name.in_(computer_names))).values(active=True))\n \n"},"license":{"kind":"string","value":"gpl-3.0"},"hash":{"kind":"number","value":3336946915647172000,"string":"3,336,946,915,647,172,000"},"line_mean":{"kind":"number","value":31.7752293578,"string":"31.775229"},"line_max":{"kind":"number","value":123,"string":"123"},"alpha_frac":{"kind":"number","value":0.6263121064,"string":"0.626312"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.581453634085213,"string":"3.581454"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44982,"cells":{"repo_name":{"kind":"string","value":"i-namekawa/TopSideMonitor"},"path":{"kind":"string","value":"plotting.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"37323"},"content":{"kind":"string","value":"import os, sys, time\nfrom glob import glob\n\nimport cv2\n\nfrom pylab import *\nfrom mpl_toolkits.mplot3d import Axes3D\nfrom matplotlib.backends.backend_pdf import PdfPages\nmatplotlib.rcParams['figure.facecolor'] = 'w'\n\nfrom scipy.signal import argrelextrema\nimport scipy.stats as stats\nimport scipy.io as sio\nfrom scipy import signal\n\nfrom xlwt import Workbook\n\n# specify these in mm to match your behavior chamber.\nCHMAMBER_LENGTH=235\nWATER_HIGHT=40\n\n\n# quick plot should also show xy_within and location_one_third etc\n# summary PDF: handle exception when a pickle file missing some fish in other pickle file\n\n\n## these three taken from http://stackoverflow.com/a/18420730/566035\ndef strided_sliding_std_dev(data, radius=5):\n windowed = rolling_window(data, (2*radius, 2*radius))\n shape = windowed.shape\n windowed = windowed.reshape(shape[0], shape[1], -1)\n return windowed.std(axis=-1)\n\ndef rolling_window(a, window):\n \"\"\"Takes a numpy array *a* and a sequence of (or single) *window* lengths\n and returns a view of *a* that represents a moving window.\"\"\"\n if not hasattr(window, '__iter__'):\n return rolling_window_lastaxis(a, window)\n for i, win in enumerate(window):\n if win > 1:\n a = a.swapaxes(i, -1)\n a = rolling_window_lastaxis(a, win)\n a = a.swapaxes(-2, i)\n return a\n\ndef rolling_window_lastaxis(a, window):\n \"\"\"Directly taken from Erik Rigtorp's post to numpy-discussion.\n \"\"\"\n if window < 1:\n raise ValueError, \"`window` must be at least 1.\"\n if window > a.shape[-1]:\n raise ValueError, \"`window` is too long.\"\n shape = a.shape[:-1] + (a.shape[-1] - window + 1, window)\n strides = a.strides + (a.strides[-1],)\n return np.lib.stride_tricks.as_strided(a, shape=shape, strides=strides)\n## stealing ends here... //\n\n\n\n\ndef filterheadxy(headx,heady,thrs_denom=10):\n \n b, a = signal.butter(8, 0.125)\n dhy = np.abs(np.hstack((0, np.diff(heady,1))))\n thrs = np.nanstd(dhy)/thrs_denom\n ind2remove = dhy>thrs\n headx[ind2remove] = np.nan\n heady[ind2remove] = np.nan\n\n headx = interp_nan(headx)\n heady = interp_nan(heady)\n headx = signal.filtfilt(b, a, headx, padlen=150)\n heady = signal.filtfilt(b, a, heady, padlen=150)\n\n return headx,heady\n\ndef smoothRad(theta, thrs=np.pi/4*3):\n jumps = (np.diff(theta) > thrs).nonzero()[0]\n print 'jumps.size', jumps.size\n while jumps.size:\n # print '%d/%d' % (jumps[0], theta.size)\n theta[jumps+1] -= np.pi\n jumps = (np.diff(theta) > thrs).nonzero()[0]\n\n return theta\n\ndef datadct2array(data, key1, key2):\n\n # put these in a MATLAB CELL\n trialN = len(data[key1][key2])\n matchedUSnameP = np.zeros((trialN,), dtype=np.object)\n fnameP = np.zeros((trialN,), dtype=np.object)\n # others to append to a list\n eventsP = []\n speed3DP = []\n movingSTDP = []\n d2inflowP = []\n xP, yP, zP = [], [], []\n XP, YP, ZP = [], [], []\n ringpixelsP = []\n peaks_withinP = []\n swimdir_withinP = []\n xy_withinP = []\n location_one_thirdP = []\n dtheta_shapeP = []\n dtheta_velP = []\n turns_shapeP = []\n turns_velP = []\n\n for n, dct in enumerate(data[key1][key2]):\n # MATLAB CELL\n matchedUSnameP[n] = dct['matchedUSname']\n fnameP[n] = dct['fname']\n\n # 2D array\n eventsP.append([ele if type(ele) is not list else ele[0] for ele in dct['events']])\n speed3DP.append(dct['speed3D'])\n movingSTDP.append(dct['movingSTD'])\n d2inflowP.append(dct['d2inflow'])\n xP.append(dct['x'])\n yP.append(dct['y'])\n zP.append(dct['z'])\n XP.append(dct['X'])\n YP.append(dct['Y'])\n ZP.append(dct['Z'])\n ringpixelsP.append(dct['ringpixels'])\n peaks_withinP.append(dct['peaks_within'])\n swimdir_withinP.append(dct['swimdir_within'])\n xy_withinP.append(dct['xy_within'])\n location_one_thirdP.append(dct['location_one_third'])\n dtheta_shapeP.append(dct['dtheta_shape'])\n dtheta_velP.append(dct['dtheta_vel'])\n turns_shapeP.append(dct['turns_shape'])\n turns_velP.append(dct['turns_vel'])\n\n TVroi = np.array(dct['TVroi'])\n SVroi = np.array(dct['SVroi'])\n\n return matchedUSnameP, fnameP, np.array(eventsP), np.array(speed3DP), np.array(d2inflowP), \\\n np.array(xP), np.array(yP), np.array(zP), np.array(XP), np.array(YP), np.array(ZP), \\\n np.array(ringpixelsP), np.array(peaks_withinP), np.array(swimdir_withinP), \\\n np.array(xy_withinP), np.array(dtheta_shapeP), np.array(dtheta_velP), \\\n np.array(turns_shapeP), np.array(turns_velP), TVroi, SVroi\n\ndef pickle2mat(fp, data=None):\n # fp : full path to pickle file\n # data : option to provide data to skip np.load(fp) \n if not data:\n data = np.load(fp)\n\n for key1 in data.keys():\n for key2 in data[key1].keys():\n\n matchedUSname, fname, events, speed3D, d2inflow, x, y, z, X, Y, Z, \\\n ringpixels, peaks_within, swimdir_within, xy_within, dtheta_shape, dtheta_vel, \\\n turns_shape, turns_vel, TVroi, SVroi = datadct2array(data, key1, key2)\n\n datadict = {\n 'matchedUSname' : matchedUSname,\n 'fname' : fname,\n 'events' : events,\n 'speed3D' : speed3D,\n 'd2inflow' : d2inflow,\n 'x' : x,\n 'y' : y,\n 'z' : z,\n 'X' : X,\n 'Y' : Y,\n 'Z' : Z,\n 'ringpixels' : ringpixels,\n 'peaks_within' : peaks_within,\n 'swimdir_within' : swimdir_within,\n 'xy_within' : xy_within,\n\n 'dtheta_shape' : dtheta_shape,\n 'dtheta_vel' : dtheta_vel,\n 'turns_shape' : turns_shape,\n 'turns_vel' : turns_vel,\n\n 'TVroi' : TVroi,\n 'SVroi' : SVroi,\n }\n outfp = '%s_%s_%s.mat' % (fp[:-7],key1,key2)\n sio.savemat(outfp, datadict, oned_as='row', do_compression=True)\n\ndef interp_nan(x):\n '''\n Replace nan by interporation\n http://stackoverflow.com/questions/6518811/interpolate-nan-values-in-a-numpy-array\n '''\n ok = -np.isnan(x)\n if (ok == False).all():\n return x\n else:\n xp = ok.ravel().nonzero()[0]\n fp = x[ok]\n _x = np.isnan(x).ravel().nonzero()[0]\n x[-ok] = np.interp(_x, xp, fp)\n return x\n\ndef polytest(x,y,rx,ry,rw,rh,rang):\n points=cv2.ellipse2Poly(\n (rx,ry),\n axes=(rw/2,rh/2),\n angle=rang,\n arcStart=0,\n arcEnd=360,\n delta=3\n )\n return cv2.pointPolygonTest(np.array(points), (x,y), measureDist=1)\n\ndef depthCorrection(z,x,TVx1,TVx2,SVy1,SVy2,SVy3):\n z0 = z - SVy1\n x0 = x - TVx1\n mid = (SVy2-SVy1)/2\n adj = (z0 - mid) / (SVy2-SVy1) * (SVy2-SVy3) * (1-(x0)/float(TVx2-TVx1))\n return z0 + adj + SVy1 # back to abs coord\n\ndef putNp2xls(array, ws):\n for r, row in enumerate(array):\n for c, val in enumerate(row):\n ws.write(r, c, val)\n\ndef drawLines(mi, ma, events, fps=30.0):\n\n CS, USs, preRange = events\n\n plot([CS-preRange, CS-preRange], [mi,ma], '--c') # 2 min prior odor\n plot([CS , CS ], [mi,ma], '--g', linewidth=2) # CS onset\n if USs:\n if len(USs) > 3:\n colors = 'r' * len(USs)\n else:\n colors = [_ for _ in ['r','b','c'][:len(USs)]]\n for c,us in zip(colors, USs):\n plot([us, us],[mi,ma], linestyle='--', color=c, linewidth=2) # US onset\n plot([USs[0]+preRange/2,USs[0]+preRange/2], [mi,ma], linestyle='--', color=c, linewidth=2) # end of US window\n xtck = np.arange(0, max(CS+preRange, max(USs)), 0.5*60*fps) # every 0.5 min tick\n else:\n xtck = np.arange(0, CS+preRange, 0.5*60*fps) # every 0.5 min tick\n \n xticks(xtck, xtck/fps/60)\n gca().xaxis.set_minor_locator(MultipleLocator(5*fps)) # 5 s minor ticks\n\n\ndef approachevents(x,y,z, ringpolyTVArray, ringpolySVArray, fishlength=134, thrs=None):\n '''\n fishlength: some old scrits may call this with fishlength\n thrs: multitrack GUI provides this by ringAppearochLevel spin control. \n can be an numpy array (to track water level change etc)\n '''\n\n smoothedz = np.convolve(np.hanning(10)/np.hanning(10).sum(), z, 'same')\n peaks = argrelextrema(smoothedz, np.less)[0] # less because 0 is top in image.\n\n # now filter peaks by height.\n ringLevel = ringpolySVArray[:,1]\n if thrs is None:\n thrs = ringLevel+fishlength/2\n\n if type(thrs) == int: # can be numpy array or int\n thrs = ringLevel.mean() + thrs\n peaks = peaks[ z[peaks] < thrs ]\n else: # numpy array should be ready to use\n peaks = peaks[ z[peaks] < thrs[peaks] ]\n\n # now filter out by TVringCenter\n peaks_within = get_withinring(ringpolyTVArray, peaks, x, y)\n\n return smoothedz, peaks_within\n\n\ndef get_withinring(ringpolyTVArray, timepoints, x, y):\n \n rx = ringpolyTVArray[:,0].astype(np.int)\n ry = ringpolyTVArray[:,1].astype(np.int)\n rw = ringpolyTVArray[:,2].astype(np.int)\n rh = ringpolyTVArray[:,3].astype(np.int)\n rang = ringpolyTVArray[:,4].astype(np.int)\n # poly test\n peaks_within = []\n for p in timepoints:\n points=cv2.ellipse2Poly(\n (rx[p],ry[p]),\n axes=(rw[p]/2,rh[p]/2),\n angle=rang[p],\n arcStart=0,\n arcEnd=360,\n delta=3\n )\n inout = cv2.pointPolygonTest(np.array(points), (x[p],y[p]), measureDist=1)\n if inout > 0:\n peaks_within.append(p)\n\n return peaks_within\n\n\ndef location_ring(x,y,ringpolyTVArray):\n\n rx = ringpolyTVArray[:,0].astype(np.int)\n ry = ringpolyTVArray[:,1].astype(np.int)\n rw = ringpolyTVArray[:,2].astype(np.int)\n rh = ringpolyTVArray[:,3].astype(np.int)\n d2ringcenter = np.sqrt((x-rx)**2 + (y-ry)**2)\n\n # filter by radius 20% buffer in case the ring moves around\n indices = (d2ringcenter < 1.2*max(rw.max(), rh.max())).nonzero()[0] \n xy_within = get_withinring(ringpolyTVArray, indices, x, y)\n \n return xy_within\n\n\ndef swimdir_analysis(x,y,z,ringpolyTVArray,ringpolySVArray,TVx1,TVy1,TVx2,TVy2,fps=30.0):\n # smoothing\n # z = np.convolve(np.hanning(16)/np.hanning(16).sum(), z, 'same')\n\n # two cameras have different zoom settings. So, distance per pixel is different. But, for\n # swim direction, it does not matter how much x,y are compressed relative to z.\n\n # ring z level from SV\n rz = ringpolySVArray[:,1].astype(np.int)\n # ring all other params from TV\n rx = ringpolyTVArray[:,0].astype(np.int)\n ry = ringpolyTVArray[:,1].astype(np.int)\n rw = ringpolyTVArray[:,2].astype(np.int)\n rh = ringpolyTVArray[:,3].astype(np.int)\n rang = ringpolyTVArray[:,4].astype(np.int)\n\n speed3D = np.sqrt( np.diff(x)**2 + np.diff(y)**2 + np.diff(z)**2 )\n speed3D = np.hstack(([0], speed3D))\n\n # line in 3D http://tutorial.math.lamar.edu/Classes/CalcIII/EqnsOfLines.aspx\n # x-x0 y-y0 z-z0\n # ---- = ---- = ----\n # a b c\n # solve them for z = rz. x0,y0,z0 are tvx, tvy, svy\n # x = (a * (rz-z)) / c + x0\n\n dt = 3 # define slope as diff between current and dt frame before\n a = np.hstack( (np.ones(dt), x[dt:]-x[:-dt]) )\n b = np.hstack( (np.ones(dt), y[dt:]-y[:-dt]) )\n c = np.hstack( (np.ones(dt), z[dt:]-z[:-dt]) )\n c[c==0] = np.nan # avoid zero division\n\n water_x = (a * (rz-z) / c) + x\n water_y = (b * (rz-z) / c) + y\n\n upwards = c<-2/30.0*fps # not accurate when c is small or negative\n xok = (TVx1 < water_x) & (water_x < TVx2)\n yok = (TVy1 < water_y) & (water_y < TVy2)\n\n filtered = upwards & xok & yok# & -np.isinf(water_x) & -np.isinf(water_y)\n\n water_x[-filtered] = np.nan\n water_y[-filtered] = np.nan\n \n # figure()\n # ax = subplot(111)\n # ax.imshow(npData['TVbg'], cmap=cm.gray) # clip out from TVx1,TVy1\n # ax.plot(x-TVx1, y-TVy1, 'c')\n # ax.plot(water_x-TVx1, water_y-TVy1, 'r.')\n # xlim([0, TVx2-TVx1]); ylim([TVy2-TVy1, 0])\n # draw(); show()\n\n SwimDir = []\n for n in filtered.nonzero()[0]:\n inout = polytest(water_x[n],water_y[n],rx[n],ry[n],rw[n],rh[n],rang[n])\n SwimDir.append((n, inout, speed3D[n])) # inout>0 are inside\n\n return SwimDir, water_x, water_y\n\ndef plot_eachTr(events, x, y, z, inflowpos, ringpixels, peaks_within, swimdir_within=None, \n pp=None, _title=None, fps=30.0, inmm=False):\n\n CS, USs, preRange = events\n # preRange = 3600 2 min prior and 1 min after CS. +900 for 0.5 min\n if USs:\n xmin, xmax = CS-preRange-10*fps, USs[0]+preRange/2+10*fps\n else:\n xmin, xmax = CS-preRange-10*fps, CS+preRange/2+(23+10)*fps\n\n fig = figure(figsize=(12,8), facecolor='w')\n \n subplot(511) # Swimming speed\n speed3D = np.sqrt( np.diff(x)**2 + np.diff(y)**2 + np.diff(z)**2 )\n drawLines(np.nanmin(speed3D), np.nanmax(speed3D), events, fps) # go behind\n plot(speed3D)\n\n movingSTD = np.append( np.zeros(fps*10), strided_sliding_std_dev(speed3D, fps*10) )\n plot(movingSTD, linewidth=2)\n\n plot(np.ones_like(speed3D) * speed3D.std()*6, '-.', color='gray')\n ylim([-5, speed3D[xmin:xmax].max()])\n xlim([xmin,xmax]); title(_title)\n if inmm:\n ylabel('Speed 3D (mm),\\n6SD thr'); \n else:\n ylabel('Speed 3D, 6SD thr'); \n \n ax = subplot(512) # z level\n drawLines(z.min(), z.max(), events)\n plot(z, 'b')\n \n pkx = peaks_within.nonzero()[0]\n if inmm:\n plot(pkx, peaks_within[pkx]*z[xmin:xmax].max()*0.97, 'mo')\n if swimdir_within is not None:\n ___x = swimdir_within.nonzero()[0]\n plot(___x, swimdir_within[___x]*z[xmin:xmax].max()*0.96, 'g+')\n ylim([z[xmin:xmax].min()*0.95, z[xmin:xmax].max()])\n xlim([xmin,xmax]); ylabel('Z (mm)')\n else:\n plot(pkx, peaks_within[pkx]*z[xmin:xmax].min()*0.97, 'mo')\n if swimdir_within is not None:\n ___x = swimdir_within.nonzero()[0]\n plot(___x, swimdir_within[___x]*z[xmin:xmax].min()*0.96, 'g+')\n ylim([z[xmin:xmax].min()*0.95, z[xmin:xmax].max()])\n ax.invert_yaxis(); xlim([xmin,xmax]); ylabel('z')\n \n subplot(513) # x\n drawLines(x.min(), x.max(), events)\n plot(x, 'b')\n plot(y, 'g')\n xlim([xmin,xmax]); ylabel('x,y')\n \n subplot(514) # Distance to the inflow tube\n xin, yin, zin = inflowpos\n d2inflow = np.sqrt((x-xin) ** 2 + (y-yin) ** 2 + (z-zin) ** 2 )\n drawLines(d2inflow.min(), d2inflow.max(), events)\n plot(d2inflow)\n ylim([d2inflow[xmin:xmax].min(), d2inflow[xmin:xmax].max()])\n xlim([xmin,xmax]); ylabel('distance to\\ninflow tube')\n \n subplot(515) # ringpixels: it seems i never considered TV x,y for this\n rpmax, rpmin = np.nanmax(ringpixels[xmin:xmax]), np.nanmin(ringpixels[xmin:xmax])\n drawLines(rpmin, rpmax, events)\n plot(ringpixels)\n plot(pkx, peaks_within[pkx]*rpmax*1.06, 'mo')\n if swimdir_within is not None:\n plot(___x, swimdir_within[___x]*rpmax*1.15, 'g+')\n ylim([-100, rpmax*1.2])\n xlim([xmin,xmax]); ylabel('ringpixels')\n\n tight_layout()\n\n if pp:\n fig.savefig(pp, format='pdf')\n\n rng = np.arange(CS-preRange, CS+preRange, dtype=np.int)\n\n return speed3D[rng], movingSTD[rng], d2inflow[rng], ringpixels[rng]\n\ndef plot_turnrates(events, dthetasum_shape,dthetasum_vel,turns_shape,turns_vel, \n pp=None, _title=None, thrs=np.pi/4*(133.33333333333334/120), fps=30.0):\n\n CS, USs, preRange = events\n # preRange = 3600 2 min prior and 1 min after CS. +900 for 0.5 min\n if USs:\n xmin, xmax = CS-preRange-10*fps, USs[0]+preRange/2+10*fps\n else:\n xmin, xmax = CS-preRange-10*fps, CS+preRange/2+(23+10)*fps\n\n fig = figure(figsize=(12,8), facecolor='w')\n\n subplot(211)\n drawLines(dthetasum_shape.min(), dthetasum_shape.max(), events)\n plot(np.ones_like(dthetasum_shape)*thrs,'gray',linestyle='--')\n plot(-np.ones_like(dthetasum_shape)*thrs,'gray',linestyle='--')\n plot(dthetasum_shape)\n dmax = dthetasum_shape[xmin:xmax].max()\n plot(turns_shape, (0.5+dmax)*np.ones_like(turns_shape), 'o')\n temp = np.zeros_like(dthetasum_shape)\n temp[turns_shape] = 1\n shape_cumsum = np.cumsum(temp)\n shape_cumsum -= shape_cumsum[xmin]\n plot( shape_cumsum / shape_cumsum[xmax] * (dmax-dthetasum_shape.min()) + dthetasum_shape.min())\n xlim([xmin,xmax]); ylabel('Shape based'); title('Orientation change per 4 frames: ' + _title)\n ylim([dthetasum_shape[xmin:xmax].min()-1, dmax+1])\n\n subplot(212)\n drawLines(dthetasum_vel.min(), dthetasum_vel.max(), events)\n plot(np.ones_like(dthetasum_vel)*thrs,'gray',linestyle='--')\n plot(-np.ones_like(dthetasum_vel)*thrs,'gray',linestyle='--')\n plot(dthetasum_vel)\n dmax = dthetasum_vel[xmin:xmax].max()\n plot(turns_vel, (0.5+dmax)*np.ones_like(turns_vel), 'o')\n temp = np.zeros_like(dthetasum_vel)\n temp[turns_vel] = 1\n vel_cumsum = np.cumsum(temp)\n vel_cumsum -= vel_cumsum[xmin]\n plot( vel_cumsum / vel_cumsum[xmax] * (dmax-dthetasum_shape.min()) + dthetasum_shape.min())\n\n ylim([dthetasum_vel[xmin:xmax].min()-1, dmax+1])\n xlim([xmin,xmax]); ylabel('Velocity based')\n\n tight_layout()\n\n if pp:\n fig.savefig(pp, format='pdf')\n\ndef trajectory(x, y, z, rng, ax, _xlim=[0,640], _ylim=[480,480+300], _zlim=[150,340], \n color='b', fps=30.0, ringpolygon=None):\n ax.plot(x[rng],y[rng],z[rng], color=color)\n ax.view_init(azim=-75, elev=-180+15)\n if ringpolygon:\n rx, ry, rz = ringpolygon\n ax.plot(rx, ry, rz, color='gray')\n ax.set_xlim(_xlim[0],_xlim[1])\n ax.set_ylim(_ylim[0],_ylim[1])\n ax.set_zlim(_zlim[0],_zlim[1])\n title((\"(%2.1f min to %2.1f min)\" % (rng[0]/fps/60.0,(rng[-1]+1)/60.0/fps)))\n draw()\n\ndef plotTrajectory(x, y, z, events, _xlim=None, _ylim=None, _zlim=None, fps=30.0, pp=None, ringpolygon=None):\n CS, USs, preRange = events\n rng1 = np.arange(CS-preRange, CS-preRange/2, dtype=int)\n rng2 = np.arange(CS-preRange/2, CS, dtype=int)\n if USs:\n rng3 = np.arange(CS, min(USs), dtype=int)\n rng4 = np.arange(min(USs), min(USs)+preRange/2, dtype=int)\n combined = np.hstack((rng1,rng2,rng3,rng4))\n else:\n combined = np.hstack((rng1,rng2))\n\n if _xlim is None:\n _xlim = map( int, ( x[combined].min(), x[combined].max() ) )\n if _ylim is None:\n _ylim = map( int, ( y[combined].min(), y[combined].max() ) )\n if _zlim is None:\n _zlim = map( int, ( z[combined].min(), z[combined].max() ) )\n if ringpolygon:\n _zlim[0] = min( _zlim[0], int(ringpolygon[2][0]) )\n \n fig3D = plt.figure(figsize=(12,8), facecolor='w')\n ax = fig3D.add_subplot(221, projection='3d'); trajectory(x,y,z,rng1,ax,_xlim,_ylim,_zlim,'c',fps,ringpolygon)\n ax = fig3D.add_subplot(222, projection='3d'); trajectory(x,y,z,rng2,ax,_xlim,_ylim,_zlim,'c',fps,ringpolygon)\n if USs:\n ax = fig3D.add_subplot(223, projection='3d'); trajectory(x,y,z,rng3,ax,_xlim,_ylim,_zlim,'g',fps,ringpolygon)\n ax = fig3D.add_subplot(224, projection='3d'); trajectory(x,y,z,rng4,ax,_xlim,_ylim,_zlim,'r',fps,ringpolygon)\n tight_layout()\n\n if pp:\n fig3D.savefig(pp, format='pdf')\n\ndef add2DataAndPlot(fp, fish, data, createPDF):\n\n if createPDF:\n pp = PdfPages(fp[:-7]+'_'+fish+'.pdf')\n else:\n pp = None\n \n params = np.load(fp)\n fname = os.path.basename(fp).split('.')[0] + '.avi'\n dirname = os.path.dirname(fp)\n preRange = params[(fname, 'mog')]['preRange']\n fps = params[(fname, 'mog')]['fps']\n TVx1 = params[(fname, fish)]['TVx1']\n TVy1 = params[(fname, fish)]['TVy1']\n TVx2 = params[(fname, fish)]['TVx2']\n TVy2 = params[(fname, fish)]['TVy2']\n\n SVx1 = params[(fname, fish)]['SVx1']\n SVx2 = params[(fname, fish)]['SVx2']\n SVx3 = params[(fname, fish)]['SVx3']\n SVy1 = params[(fname, fish)]['SVy1']\n SVy2 = params[(fname, fish)]['SVy2']\n SVy3 = params[(fname, fish)]['SVy3']\n ringAppearochLevel = params[(fname, fish)]['ringAppearochLevel']\n\n _npz = os.path.join(dirname, os.path.join('%s_%s.npz' % (fname[:-4], fish)))\n # if os.path.exists(_npz):\n npData = np.load(_npz)\n tvx = npData['TVtracking'][:,0] # x with nan\n tvy = npData['TVtracking'][:,1] # y \n headx = npData['TVtracking'][:,3] # headx \n heady = npData['TVtracking'][:,4] # heady \n svy = npData['SVtracking'][:,1] # z \n InflowTubeTVArray = npData['InflowTubeTVArray']\n InflowTubeSVArray = npData['InflowTubeSVArray']\n inflowpos = InflowTubeTVArray[:,0], InflowTubeTVArray[:,1], InflowTubeSVArray[:,1]\n ringpixels = npData['ringpixel']\n ringpolyTVArray = npData['ringpolyTVArray']\n ringpolySVArray = npData['ringpolySVArray']\n TVbg = npData['TVbg']\n print os.path.basename(_npz), 'loaded.'\n\n x,y,z = map(interp_nan, [tvx,tvy,svy])\n\n # z level correction by depth (x)\n z = depthCorrection(z,x,TVx1,TVx2,SVy1,SVy2,SVy3)\n\n smoothedz, peaks_within = approachevents(x, y, z, \n ringpolyTVArray, ringpolySVArray, thrs=ringAppearochLevel)\n # convert to numpy array from list \n temp = np.zeros_like(x)\n temp[peaks_within] = 1\n peaks_within = temp\n\n # normalize to mm\n longaxis = float(max((TVx2-TVx1), (TVy2-TVy1))) # before rotation H is applied they are orthogonal\n waterlevel = float(SVy2-SVy1)\n X = (x-TVx1) / longaxis * CHMAMBER_LENGTH\n Y = (TVy2-y) / longaxis * CHMAMBER_LENGTH\n Z = (SVy2-z) / waterlevel * WATER_HIGHT # bottom of chamber = 0, higher more positive \n inflowpos_mm = ((inflowpos[0]-TVx1) / longaxis * CHMAMBER_LENGTH,\n (TVy2-inflowpos[1]) / longaxis * CHMAMBER_LENGTH,\n (SVy2-inflowpos[2]) / waterlevel * WATER_HIGHT )\n\n # do the swim direction analysis here\n swimdir, water_x, water_y = swimdir_analysis(x,y,z,\n ringpolyTVArray,ringpolySVArray,TVx1,TVy1,TVx2,TVy2,fps)\n # all of swimdir are within ROI (frame#, inout, speed) but not necessary within ring\n sdir = np.array(swimdir)\n withinRing = sdir[:,1]>0 # inout>0 are inside ring\n temp = np.zeros_like(x)\n temp[ sdir[withinRing,0].astype(int) ] = 1\n swimdir_within = temp\n\n # location_ring\n xy_within = location_ring(x,y, ringpolyTVArray)\n temp = np.zeros_like(x)\n temp[xy_within] = 1\n xy_within = temp\n\n # location_one_third\n if (TVx2-TVx1) > (TVy2-TVy1):\n if np.abs(np.arange(TVx1, longaxis+TVx1, longaxis/3) + longaxis/6 - inflowpos[0].mean()).argmin() == 2:\n location_one_third = x-TVx1 > longaxis/3*2\n else:\n location_one_third = x < longaxis/3\n else:\n if np.abs(np.arange(TVy1, longaxis+TVy1, longaxis/3) + longaxis/6 - inflowpos[1].mean()).argmin() == 2:\n location_one_third = y-TVy1 > longaxis/3*2\n else:\n location_one_third = y < longaxis/3\n\n # turn rate analysis (shape based)\n heady, headx = map(interp_nan, [heady, headx])\n headx, heady = filterheadxy(headx, heady)\n dy = heady - y\n dx = headx - x\n theta_shape = np.arctan2(dy, dx)\n\n # velocity based\n cx, cy = filterheadxy(x.copy(), y.copy()) # centroid x,y\n\n vx = np.append(0, np.diff(cx))\n vy = np.append(0, np.diff(cy))\n theta_vel = np.arctan2(vy, vx)\n\n # prepare ringpolygon for trajectory plot\n rx, ry, rw, rh, rang = ringpolyTVArray.mean(axis=0).astype(int) # use mm ver above\n rz = ringpolySVArray.mean(axis=0)[1].astype(int)\n \n RX = (rx-TVx1) / longaxis * CHMAMBER_LENGTH\n RY = (TVy2-ry) / longaxis * CHMAMBER_LENGTH\n RW = rw / longaxis * CHMAMBER_LENGTH / 2\n RH = rh / longaxis * CHMAMBER_LENGTH / 2\n RZ = (SVy2-rz) / waterlevel * WATER_HIGHT\n points = cv2.ellipse2Poly(\n (RX.astype(int),RY.astype(int)),\n axes=(RW.astype(int),RH.astype(int)),\n angle=rang,\n arcStart=0,\n arcEnd=360,\n delta=3\n )\n ringpolygon = [points[:,0], points[:,1], np.ones(points.shape[0]) * RZ]\n\n eventTypeKeys = params[(fname, fish)]['EventData'].keys()\n CSs = [_ for _ in eventTypeKeys if _.startswith('CS')]\n USs = [_ for _ in eventTypeKeys if _.startswith('US')]\n # print CSs, USs\n\n # events\n for CS in CSs:\n CS_Timings = params[(fname, fish)]['EventData'][CS]\n CS_Timings.sort()\n # initialize when needed\n if CS not in data[fish].keys():\n data[fish][CS] = []\n\n # now look around for US after it within preRange\n for t in CS_Timings:\n tr = len(data[fish][CS])+1\n rng = np.arange(t-preRange, t+preRange, dtype=np.int)\n\n matchedUSname = None\n for us in USs:\n us_Timings = params[(fname, fish)]['EventData'][us]\n matched = [_ for _ in us_Timings if t-preRange < _ < t+preRange]\n if matched:\n events = [t, matched, preRange] # ex. CS+\n matchedUSname = us\n break\n else:\n continue\n\n _title = '(%s, %s) trial#%02d %s (%s)' % (CS, matchedUSname[0], tr, fname, fish)\n print _title, events\n\n _speed3D, _movingSTD, _d2inflow, _ringpixels = plot_eachTr(events, X, Y, Z, inflowpos_mm, \n ringpixels, peaks_within, swimdir_within, pp, _title, fps, inmm=True)\n \n # 3d trajectory\n _xlim = (0, CHMAMBER_LENGTH)\n _zlim = (RZ.max(),0)\n plotTrajectory(X, Y, Z, events, _xlim=_xlim, _zlim=_zlim, fps=fps, pp=pp, ringpolygon=ringpolygon)\n \n\n # turn rate analysis\n # shape based\n theta_shape[rng] = smoothRad(theta_shape[rng].copy(), thrs=np.pi/2)\n dtheta_shape = np.append(0, np.diff(theta_shape)) # full length\n\n kernel = np.ones(4)\n dthetasum_shape = np.convolve(dtheta_shape, kernel, 'same')\n \n # 4 frames = 1000/30.0*4 = 133.3 ms \n thrs = (np.pi / 2) * (133.33333333333334/120) # Braubach et al 2009 90 degree in 120 ms \n peaks_shape = argrelextrema(abs(dthetasum_shape), np.greater)[0]\n turns_shape = peaks_shape[ (abs(dthetasum_shape[peaks_shape]) > thrs).nonzero()[0] ]\n \n # velocity based\n theta_vel[rng] = smoothRad(theta_vel[rng].copy(), thrs=np.pi/2)\n dtheta_vel = np.append(0, np.diff(theta_vel))\n\n dthetasum_vel = np.convolve(dtheta_vel, kernel, 'same')\n\n peaks_vel = argrelextrema(abs(dthetasum_vel), np.greater)[0]\n turns_vel = peaks_vel[ (abs(dthetasum_vel[peaks_vel]) > thrs).nonzero()[0] ]\n\n plot_turnrates(events, dthetasum_shape, dthetasum_vel, turns_shape, turns_vel, pp, _title, fps=fps)\n\n _temp = np.zeros_like(dtheta_shape)\n _temp[turns_shape] = 1\n turns_shape_array = _temp\n\n _temp = np.zeros_like(dtheta_vel)\n _temp[turns_vel] = 1\n turns_vel_array = _temp\n \n # plot swim direction analysis\n fig = figure(figsize=(12,8), facecolor='w')\n ax1 = subplot(211)\n ax1.imshow(TVbg, cmap=cm.gray) # TVbg is clip out of ROI\n ax1.plot(x[rng]-TVx1, y[rng]-TVy1, 'gray')\n ax1.plot(water_x[t-preRange:t]-TVx1, water_y[t-preRange:t]-TVy1, 'c.')\n if matched:\n ax1.plot( water_x[t:matched[0]]-TVx1, \n water_y[t:matched[0]]-TVy1, 'g.')\n ax1.plot( water_x[matched[0]:matched[0]+preRange/4]-TVx1, \n water_y[matched[0]:matched[0]+preRange/4]-TVy1, 'r.')\n xlim([0, TVx2-TVx1]); ylim([TVy2-TVy1, 0])\n title(_title)\n \n ax2 = subplot(212)\n ax2.plot( swimdir_within )\n ax2.plot( peaks_within*1.15-0.1, 'mo' )\n if matched:\n xmin, xmax = t-preRange-10*fps, matched[0]+preRange/4\n else:\n xmin, xmax = t-preRange-10*fps, t+preRange/2+10*fps\n gzcs = np.cumsum(swimdir_within)\n gzcs -= gzcs[xmin]\n ax2.plot( gzcs/gzcs[xmax] )\n drawLines(0,1.2, events)\n ylim([0,1.2])\n xlim([xmin, xmax])\n ylabel('|: SwimDirection\\no: approach events')\n\n data[fish][CS].append( {\n 'fname' : fname,\n 'x': x[rng], 'y': y[rng], 'z': z[rng], \n 'X': X[rng], 'Y': Y[rng], 'Z': Z[rng], # calibrate space (mm)\n 'speed3D': _speed3D, # calibrate space (mm)\n 'movingSTD' : _movingSTD, # calibrate space (mm)\n 'd2inflow': _d2inflow, # calibrate space (mm)\n 'ringpixels': _ringpixels,\n \n 'peaks_within': peaks_within[rng],\n 'xy_within': xy_within[rng],\n 'location_one_third' : location_one_third[rng],\n 'swimdir_within' : swimdir_within[rng],\n \n 'dtheta_shape': dtheta_shape[rng],\n 'dtheta_vel': dtheta_vel[rng],\n 'turns_shape': turns_shape_array[rng], # already +/- preRange\n 'turns_vel': turns_vel_array[rng],\n \n 'events' : events,\n 'matchedUSname' : matchedUSname,\n 'TVroi' : (TVx1,TVy1,TVx2,TVy2),\n 'SVroi' : (SVx1,SVy1,SVx2,SVy2),\n } )\n if pp:\n fig.savefig(pp, format='pdf')\n close('all') # release memory ASAP!\n \n if pp:\n pp.close()\n\ndef getPDFs(pickle_files, fishnames=None, createPDF=True):\n\n # type checking args\n if type(pickle_files) is str:\n pickle_files = [pickle_files]\n \n # convert to a list or set of fish names\n if type(fishnames) is str:\n fishnames = [fishnames]\n elif not fishnames:\n fishnames = set()\n\n # re-organize trials into a dict \"data\"\n data = {}\n # figure out trial number (sometime many trials in one files) for each fish\n # go through all pickle_files and use timestamps of file to sort events.\n timestamps = []\n \n for fp in pickle_files:\n # collect ctime of pickled files\n fname = os.path.basename(fp).split('.')[0] + '.avi'\n timestamps.append( time.strptime(fname, \"%b-%d-%Y_%H_%M_%S.avi\") )\n # look into the pickle and collect fish analyzed\n params = np.load(fp) # loading pickled file!\n if type(fishnames) is set:\n for fish in [fs for fl,fs in params.keys() if fl == fname and fs != 'mog']:\n fishnames.add(fish)\n timestamps = sorted(range(len(timestamps)), key=timestamps.__getitem__)\n\n # For each fish, go thru all pickled files\n for fish in fishnames:\n data[fish] = {}\n\n # now go thru the sorted\n for ind in timestamps:\n \n fp = pickle_files[ind]\n print 'processing #%d\\n%s' % (ind, fp)\n add2DataAndPlot(fp, fish, data, createPDF)\n\n return data\n\ndef plotTrials(data, fish, CSname, key, step, offset=0, pp=None):\n fig = figure(figsize=(12,8), facecolor='w')\n \n ax1 = fig.add_subplot(121) # raw trace\n ax2 = fig.add_subplot(222) # learning curve\n ax3 = fig.add_subplot(224) # bar plot\n preP, postP, postP2 = [], [], []\n longestUS = 0\n for n, measurement in enumerate(data[fish][CSname]):\n tr = n+1\n CS, USs, preRange = measurement['events']\n subplot(ax1)\n mi = -step*(tr-1)\n ma = mi + step\n drawLines(mi, ma, (preRange, [preRange+(USs[0]-CS)], preRange))\n longestUS = max([us-CS+preRange*3/2 for us in USs]+[longestUS])\n \n # 'measurement[key]': vector around the CS timing (+/-) preRange. i.e., preRange is the center\n ax1.plot(measurement[key]-step*(tr-1)+offset)\n title(CSname+': '+key) # cf. preRange = 3600 frames\n pre = measurement[key][:preRange].mean()+offset # 2 min window\n post = measurement[key][preRange:preRange+(USs[0]-CS)].mean()+offset # 23 s window\n post2 = measurement[key][preRange+(USs[0]-CS):preRange*3/2+(USs[0]-CS)].mean()+offset # 1 min window after US\n preP.append(pre)\n postP.append(post)\n postP2.append(post2)\n\n ax3.plot([1, 2, 3], [pre, post, post2],'o-')\n\n ax1.set_xlim([0,longestUS])\n ax1.axis('off')\n\n subplot(ax2)\n x = range(1, tr+1)\n y = np.diff((preP,postP), axis=0).ravel()\n ax2.plot( x, y, 'ko-', linewidth=2 )\n ax2.plot( x, np.zeros_like(x), '-.', linewidth=1, color='gray' )\n # grid()\n slope, intercept, rvalue, pval, stderr = stats.stats.linregress(x,y) \n title('slope = zero? p-value = %f' % pval)\n ax2.set_xlabel(\"Trial#\")\n ax2.set_xlim([0.5,tr+0.5])\n ax2.set_ylabel('CS - pre')\n \n subplot(ax3)\n ax3.bar([0.6, 1.6, 2.6], [np.nanmean(preP), np.nanmean(postP), np.nanmean(postP2)], facecolor='none')\n t, pval = stats.ttest_rel(postP, preP)\n title('paired t p-value = %f' % pval)\n ax3.set_xticks([1,2,3])\n ax3.set_xticklabels(['pre', CSname, measurement['matchedUSname']])\n ax3.set_xlim([0.5,3.5])\n ax3.set_ylabel('Raw mean values')\n\n tight_layout(2, h_pad=1, w_pad=1)\n \n if pp:\n fig.savefig(pp, format='pdf')\n close('all')\n\n return np.vstack((preP, postP, postP2))\n\ndef getSummary(data, dirname=None):\n\n for fish in data.keys():\n for CSname in data[fish].keys():\n\n if dirname:\n pp = PdfPages(os.path.join(dirname, '%s_for_%s.pdf' % (CSname,fish)))\n print 'generating %s_for_%s.pdf' % (CSname,fish)\n\n book = Workbook()\n sheet1 = book.add_sheet('speed3D')\n avgs = plotTrials(data, fish, CSname, 'speed3D', 30, pp=pp)\n putNp2xls(avgs, sheet1)\n\n sheet2 = book.add_sheet('d2inflow')\n avgs = plotTrials(data, fish, CSname, 'd2inflow', 200, pp=pp)\n putNp2xls(avgs, sheet2)\n\n # sheet3 = book.add_sheet('smoothedz')\n sheet3 = book.add_sheet('Z')\n # avgs = plotTrials(data, fish, CSname, 'smoothedz', 100, pp=pp)\n avgs = plotTrials(data, fish, CSname, 'Z', 30, pp=pp)\n putNp2xls(avgs, sheet3)\n\n sheet4 = book.add_sheet('ringpixels')\n avgs = plotTrials(data, fish, CSname, 'ringpixels', 1200, pp=pp)\n putNp2xls(avgs, sheet4)\n \n sheet5 = book.add_sheet('peaks_within')\n avgs = plotTrials(data, fish, CSname, 'peaks_within', 1.5, pp=pp)\n putNp2xls(avgs, sheet5)\n \n sheet6 = book.add_sheet('swimdir_within')\n avgs = plotTrials(data, fish, CSname, 'swimdir_within', 1.5, pp=pp)\n putNp2xls(avgs, sheet6)\n \n sheet7 = book.add_sheet('xy_within')\n avgs = plotTrials(data, fish, CSname, 'xy_within', 1.5, pp=pp)\n putNp2xls(avgs, sheet7)\n \n sheet8 = book.add_sheet('turns_shape')\n avgs = plotTrials(data, fish, CSname, 'turns_shape', 1.5, pp=pp)\n putNp2xls(avgs, sheet8)\n \n sheet9 = book.add_sheet('turns_vel')\n avgs = plotTrials(data, fish, CSname, 'turns_vel', 1.5, pp=pp)\n putNp2xls(avgs, sheet9)\n \n if dirname:\n pp.close()\n book.save(os.path.join(dirname, '%s_for_%s.xls' % (CSname,fish)))\n close('all')\n else:\n show()\n\n\n\n\ndef add2Pickles(dirname, pickle_files):\n # dirname : folder to look for pickle files\n # pickle_files : output, a list to be concatenated.\n pattern = os.path.join(dirname, '*.pickle')\n temp = [_ for _ in glob(pattern) if not _.endswith('- Copy.pickle') and \n not os.path.basename(_).startswith('Summary')]\n pickle_files += temp\n \n\nif __name__ == '__main__':\n \n pickle_files = []\n \n # small test data\n # add2Pickles('R:/Data/itoiori/behav/adult whitlock/conditioning/NeuroD/Aug4/test', pickle_files)\n # outputdir = 'R:/Data/itoiori/behav/adult whitlock/conditioning/NeuroD/Aug4/test'\n\n # show me what you got\n for pf in pickle_files:\n print pf\n \n fp = os.path.join(outputdir, 'Summary.pickle')\n createPDF = True # useful when plotting etc code updated\n if 1: # refresh analysis\n data = getPDFs(pickle_files, createPDF=createPDF)\n import cPickle as pickle\n with open(os.path.join(outputdir, 'Summary.pickle'), 'wb') as f:\n pickle.dump(data, f)\n else: # or reuse previous\n data = np.load(fp)\n \n getSummary(data, outputdir)\n pickle2mat(fp, data)\n\n"},"license":{"kind":"string","value":"bsd-3-clause"},"hash":{"kind":"number","value":4991329245887673000,"string":"4,991,329,245,887,673,000"},"line_mean":{"kind":"number","value":36.4353059178,"string":"36.435306"},"line_max":{"kind":"number","value":124,"string":"124"},"alpha_frac":{"kind":"number","value":0.5672909466,"string":"0.567291"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":2.972286374133949,"string":"2.972286"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44983,"cells":{"repo_name":{"kind":"string","value":"jkunimune15/Map-Projections"},"path":{"kind":"string","value":"src/zupplemental/compose_maps.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"5115"},"content":{"kind":"string","value":"#compose_maps.py\n#make ALL the maps\n\nimport math\n\nfrom generate_borders import generate_borders\nfrom generate_graticule import generate_graticule, generate_backdrop\nfrom generate_indicatrices import generate_indicatrices\nfrom generate_orthodromes import generate_orthodromes\nfrom generate_shape import plot_shapes\nfrom generate_labels import generate_topographical_labels, label_shapes, label_points\n\n\ndef compose_landmasses():\n\tprint('\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_50m_land', trim_antarctica=True)\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_50m_lakes', max_rank=4)\n\tprint('\\t\\t')\n\tprint('\\t')\n\ndef compose_graticule():\n\tprint('\\t')\n\tprint('\\t\\t')\n\tgenerate_graticule(5, 1, include_tropics=True, adjust_poles=True)\n\tprint('\\t\\t')\n\tprint('\\t')\n\ndef compose_graticule2():\n\tprint('\\t')\n\tprint('\\t\\t')\n\tgenerate_graticule(15, .25, include_tropics=True, adjust_poles=True, double_dateline=True)\n\tprint('\\t\\t')\n\tprint('\\t')\n\ndef compose_compound():\n\tprint('\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_50m_land', trim_antarctica=True)\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_50m_rivers_lake_centerlines', max_rank=4)\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_50m_lakes', max_rank=4)\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tgenerate_graticule(15, 1, include_tropics=True, adjust_poles=True)\n\tprint('\\t\\t')\n\tprint('\\t')\n\ndef compose_indicatrices():\n\tprint('\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_50m_land', trim_antarctica=True)\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_50m_lakes', max_rank=4)\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tgenerate_indicatrices(15, math.radians(3.75), resolution=180, adjust_poles=True)\n\tprint('\\t\\t')\n\tprint('\\t')\n\ndef compose_indicatrices2(ctr_meridian):\n\tprint('\\t')\n\tprint('\\t\\t')\n\tgenerate_backdrop(.5, ctr_meridian=ctr_meridian)\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_110m_land', flesh_out_antarctica=True)\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_110m_lakes')\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tgenerate_graticule(10, .5, double_dateline=(ctr_meridian==0))\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tgenerate_indicatrices(30, 500/6371, ctr_meridian=ctr_meridian, adjust_poles=True, resolution=120, side_res=5, pole_res=120)\n\tprint('\\t\\t')\n\tprint('\\t')\n\ndef compose_political():\n\tprint('\\t')\n\tprint('\\t\\t')\n\tgenerate_borders('ne_50m', trim_antarctica=True)\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_50m_lakes', max_rank=4)\n\tprint('\\t\\t')\n\tprint('\\t')\n\tlabel_shapes('ne_50m_admin_0_countries', \"pol\")\n\ndef compose_orthodromes():\n\tprint('\\t')\n\tprint('\\t\\t')\n\tgenerate_orthodromes()\n\tprint('\\t\\t')\n\tprint('\\t')\n\ndef compose_everything():\n\tprint('\\t')\n\tprint('\\t\\t')\n\tgenerate_borders('ne_10m', trim_antarctica=True, borders_only=False)\n\tprint('\\t\\t')\n\tgenerate_borders('ne_10m', trim_antarctica=True, borders_only=True)\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_10m_admin_0_map_units')\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_10m_admin_1_states_provinces_lines', filter_field='adm0_a3',\n\t\tfilter_vals=['RUS','CAN','CHN','USA','BRA','AUS','IND','ARG','KAZ'])\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_10m_admin_0_boundary_lines_disputed_areas')\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_10m_coastline', trim_antarctica=True)\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_10m_rivers_lake_centerlines', max_rank=5)\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tplot_shapes('ne_10m_lakes', max_rank=4)\n\tprint('\\t\\t')\n\tprint('\\t\\t')\n\tgenerate_graticule(5, 1, include_tropics=True, adjust_poles=True)\n\tplot_shapes('ne_10m_geographic_lines', clazz=\"dateline\", filter_field='name', filter_vals=[\"International Date Line\"])\n\tprint('\\t\\t')\n\tprint('\\t')\n\tgenerate_topographical_labels('ne_50m', max_rank=2, text_size=4)\n\tlabel_shapes('ne_10m_lakes', \"sea\", max_rank=1, text_size=1)\n\tlabel_shapes('ne_10m_admin_0_countries', \"pol\", text_size=4)\n\tlabel_points('cities_capital', \"cap\", text_size=1)\n\tlabel_points('cities_other', \"cit\", text_size=0)\n\n\nif __name__ == '__main__':\n\t# compose_landmasses()\n\t# compose_graticule()\n\t# compose_compound()\n\t# compose_indicatrices()\n\t# compose_indicatrices2(-0)\n\t# compose_political()\n\t# compose_orthodromes()\n\tcompose_everything()\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-1186010880348605000,"string":"-1,186,010,880,348,605,000"},"line_mean":{"kind":"number","value":32.8741721854,"string":"32.874172"},"line_max":{"kind":"number","value":124,"string":"124"},"alpha_frac":{"kind":"number","value":0.6578690127,"string":"0.657869"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":2.3735498839907194,"string":"2.37355"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44984,"cells":{"repo_name":{"kind":"string","value":"francisco-dlp/hyperspy"},"path":{"kind":"string","value":"hyperspy/drawing/utils.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"57321"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n# Copyright 2007-2016 The HyperSpy developers\n#\n# This file is part of HyperSpy.\n#\n# HyperSpy is free software: you can redistribute it and/or modify\n# it under the terms of the GNU General Public License as published by\n# the Free Software Foundation, either version 3 of the License, or\n# (at your option) any later version.\n#\n# HyperSpy is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU General Public License for more details.\n#\n# You should have received a copy of the GNU General Public License\n# along with HyperSpy. If not, see .\n\nimport copy\nimport itertools\nimport textwrap\nfrom traits import trait_base\nimport matplotlib.pyplot as plt\nimport matplotlib as mpl\nfrom mpl_toolkits.axes_grid1 import make_axes_locatable\nfrom matplotlib.backend_bases import key_press_handler\nimport warnings\nimport numpy as np\nfrom distutils.version import LooseVersion\nimport logging\n\nimport hyperspy as hs\n\n\n_logger = logging.getLogger(__name__)\n\n\ndef contrast_stretching(data, saturated_pixels):\n \"\"\"Calculate bounds that leaves out a given percentage of the data.\n\n Parameters\n ----------\n data: numpy array\n saturated_pixels: scalar, None\n The percentage of pixels that are left out of the bounds. For example,\n the low and high bounds of a value of 1 are the 0.5% and 99.5%\n percentiles. It must be in the [0, 100] range. If None, set the value\n to 0.\n\n Returns\n -------\n vmin, vmax: scalar\n The low and high bounds\n\n Raises\n ------\n ValueError if the value of `saturated_pixels` is out of the valid range.\n\n \"\"\"\n # Sanity check\n if saturated_pixels is None:\n saturated_pixels = 0\n if not 0 <= saturated_pixels <= 100:\n raise ValueError(\n \"saturated_pixels must be a scalar in the range[0, 100]\")\n vmin = np.nanpercentile(data, saturated_pixels / 2.)\n vmax = np.nanpercentile(data, 100 - saturated_pixels / 2.)\n return vmin, vmax\n\n\nMPL_DIVERGING_COLORMAPS = [\n \"BrBG\",\n \"bwr\",\n \"coolwarm\",\n \"PiYG\",\n \"PRGn\",\n \"PuOr\",\n \"RdBu\",\n \"RdGy\",\n \"RdYIBu\",\n \"RdYIGn\",\n \"seismic\",\n \"Spectral\", ]\n# Add reversed colormaps\nMPL_DIVERGING_COLORMAPS += [cmap + \"_r\" for cmap in MPL_DIVERGING_COLORMAPS]\n\n\ndef centre_colormap_values(vmin, vmax):\n \"\"\"Calculate vmin and vmax to set the colormap midpoint to zero.\n\n Parameters\n ----------\n vmin, vmax : scalar\n The range of data to display.\n\n Returns\n -------\n cvmin, cvmax : scalar\n The values to obtain a centre colormap.\n\n \"\"\"\n\n absmax = max(abs(vmin), abs(vmax))\n return -absmax, absmax\n\n\ndef create_figure(window_title=None,\n _on_figure_window_close=None,\n disable_xyscale_keys=False,\n **kwargs):\n \"\"\"Create a matplotlib figure.\n\n This function adds the possibility to execute another function\n when the figure is closed and to easily set the window title. Any\n keyword argument is passed to the plt.figure function\n\n Parameters\n ----------\n window_title : string\n _on_figure_window_close : function\n disable_xyscale_keys : bool, disable the `k`, `l` and `L` shortcuts which\n toggle the x or y axis between linear and log scale.\n\n Returns\n -------\n\n fig : plt.figure\n\n \"\"\"\n fig = plt.figure(**kwargs)\n if window_title is not None:\n # remove non-alphanumeric characters to prevent file saving problems\n # This is a workaround for:\n # https://github.com/matplotlib/matplotlib/issues/9056\n reserved_characters = r'<>\"/\\|?*'\n for c in reserved_characters:\n window_title = window_title.replace(c, '')\n window_title = window_title.replace('\\n', ' ')\n window_title = window_title.replace(':', ' -')\n fig.canvas.set_window_title(window_title)\n if disable_xyscale_keys and hasattr(fig.canvas, 'toolbar'):\n # hack the `key_press_handler` to disable the `k`, `l`, `L` shortcuts\n manager = fig.canvas.manager\n fig.canvas.mpl_disconnect(manager.key_press_handler_id)\n manager.key_press_handler_id = manager.canvas.mpl_connect(\n 'key_press_event',\n lambda event: key_press_handler_custom(event, manager.canvas))\n if _on_figure_window_close is not None:\n on_figure_window_close(fig, _on_figure_window_close)\n return fig\n\n\ndef key_press_handler_custom(event, canvas):\n if event.key not in ['k', 'l', 'L']:\n key_press_handler(event, canvas, canvas.manager.toolbar)\n\n\ndef on_figure_window_close(figure, function):\n \"\"\"Connects a close figure signal to a given function.\n\n Parameters\n ----------\n\n figure : mpl figure instance\n function : function\n\n \"\"\"\n def function_wrapper(evt):\n function()\n\n figure.canvas.mpl_connect('close_event', function_wrapper)\n\n\ndef plot_RGB_map(im_list, normalization='single', dont_plot=False):\n \"\"\"Plot 2 or 3 maps in RGB.\n\n Parameters\n ----------\n im_list : list of Signal2D instances\n normalization : {'single', 'global'}\n dont_plot : bool\n\n Returns\n -------\n array: RGB matrix\n\n \"\"\"\n# from widgets import cursors\n height, width = im_list[0].data.shape[:2]\n rgb = np.zeros((height, width, 3))\n rgb[:, :, 0] = im_list[0].data.squeeze()\n rgb[:, :, 1] = im_list[1].data.squeeze()\n if len(im_list) == 3:\n rgb[:, :, 2] = im_list[2].data.squeeze()\n if normalization == 'single':\n for i in range(len(im_list)):\n rgb[:, :, i] /= rgb[:, :, i].max()\n elif normalization == 'global':\n rgb /= rgb.max()\n rgb = rgb.clip(0, rgb.max())\n if not dont_plot:\n figure = plt.figure()\n ax = figure.add_subplot(111)\n ax.frameon = False\n ax.set_axis_off()\n ax.imshow(rgb, interpolation='nearest')\n# cursors.set_mpl_ax(ax)\n figure.canvas.draw_idle()\n else:\n return rgb\n\n\ndef subplot_parameters(fig):\n \"\"\"Returns a list of the subplot parameters of a mpl figure.\n\n Parameters\n ----------\n fig : mpl figure\n\n Returns\n -------\n tuple : (left, bottom, right, top, wspace, hspace)\n\n \"\"\"\n wspace = fig.subplotpars.wspace\n hspace = fig.subplotpars.hspace\n left = fig.subplotpars.left\n right = fig.subplotpars.right\n top = fig.subplotpars.top\n bottom = fig.subplotpars.bottom\n return left, bottom, right, top, wspace, hspace\n\n\nclass ColorCycle:\n _color_cycle = [mpl.colors.colorConverter.to_rgba(color) for color\n in ('b', 'g', 'r', 'c', 'm', 'y', 'k')]\n\n def __init__(self):\n self.color_cycle = copy.copy(self._color_cycle)\n\n def __call__(self):\n if not self.color_cycle:\n self.color_cycle = copy.copy(self._color_cycle)\n return self.color_cycle.pop(0)\n\n\ndef plot_signals(signal_list, sync=True, navigator=\"auto\",\n navigator_list=None, **kwargs):\n \"\"\"Plot several signals at the same time.\n\n Parameters\n ----------\n signal_list : list of BaseSignal instances\n If sync is set to True, the signals must have the\n same navigation shape, but not necessarily the same signal shape.\n sync : True or False, default \"True\"\n If True: the signals will share navigation, all the signals\n must have the same navigation shape for this to work, but not\n necessarily the same signal shape.\n navigator : {\"auto\", None, \"spectrum\", \"slider\", BaseSignal}, default \"auto\"\n See signal.plot docstring for full description\n navigator_list : {List of navigator arguments, None}, default None\n Set different navigator options for the signals. Must use valid\n navigator arguments: \"auto\", None, \"spectrum\", \"slider\", or a\n hyperspy Signal. The list must have the same size as signal_list.\n If None, the argument specified in navigator will be used.\n **kwargs\n Any extra keyword arguments are passed to each signal `plot` method.\n\n Example\n -------\n\n >>> s_cl = hs.load(\"coreloss.dm3\")\n >>> s_ll = hs.load(\"lowloss.dm3\")\n >>> hs.plot.plot_signals([s_cl, s_ll])\n\n Specifying the navigator:\n\n >>> s_cl = hs.load(\"coreloss.dm3\")\n >>> s_ll = hs.load(\"lowloss.dm3\")\n >>> hs.plot.plot_signals([s_cl, s_ll], navigator=\"slider\")\n\n Specifying the navigator for each signal:\n\n >>> s_cl = hs.load(\"coreloss.dm3\")\n >>> s_ll = hs.load(\"lowloss.dm3\")\n >>> s_edx = hs.load(\"edx.dm3\")\n >>> s_adf = hs.load(\"adf.dm3\")\n >>> hs.plot.plot_signals(\n [s_cl, s_ll, s_edx], navigator_list=[\"slider\",None,s_adf])\n\n \"\"\"\n\n import hyperspy.signal\n\n if navigator_list:\n if not (len(signal_list) == len(navigator_list)):\n raise ValueError(\n \"signal_list and navigator_list must\"\n \" have the same size\")\n\n if sync:\n axes_manager_list = []\n for signal in signal_list:\n axes_manager_list.append(signal.axes_manager)\n\n if not navigator_list:\n navigator_list = []\n if navigator is None:\n navigator_list.extend([None] * len(signal_list))\n elif isinstance(navigator, hyperspy.signal.BaseSignal):\n navigator_list.append(navigator)\n navigator_list.extend([None] * (len(signal_list) - 1))\n elif navigator == \"slider\":\n navigator_list.append(\"slider\")\n navigator_list.extend([None] * (len(signal_list) - 1))\n elif navigator == \"spectrum\":\n navigator_list.extend([\"spectrum\"] * len(signal_list))\n elif navigator == \"auto\":\n navigator_list.extend([\"auto\"] * len(signal_list))\n else:\n raise ValueError(\n \"navigator must be one of \\\"spectrum\\\",\\\"auto\\\",\"\n \" \\\"slider\\\", None, a Signal instance\")\n\n # Check to see if the spectra have the same navigational shapes\n temp_shape_first = axes_manager_list[0].navigation_shape\n for i, axes_manager in enumerate(axes_manager_list):\n temp_shape = axes_manager.navigation_shape\n if not (temp_shape_first == temp_shape):\n raise ValueError(\n \"The spectra does not have the same navigation shape\")\n axes_manager_list[i] = axes_manager.deepcopy()\n if i > 0:\n for axis0, axisn in zip(axes_manager_list[0].navigation_axes,\n axes_manager_list[i].navigation_axes):\n axes_manager_list[i]._axes[axisn.index_in_array] = axis0\n del axes_manager\n\n for signal, navigator, axes_manager in zip(signal_list,\n navigator_list,\n axes_manager_list):\n signal.plot(axes_manager=axes_manager,\n navigator=navigator,\n **kwargs)\n\n # If sync is False\n else:\n if not navigator_list:\n navigator_list = []\n navigator_list.extend([navigator] * len(signal_list))\n for signal, navigator in zip(signal_list, navigator_list):\n signal.plot(navigator=navigator,\n **kwargs)\n\n\ndef _make_heatmap_subplot(spectra):\n from hyperspy._signals.signal2d import Signal2D\n im = Signal2D(spectra.data, axes=spectra.axes_manager._get_axes_dicts())\n im.metadata.General.title = spectra.metadata.General.title\n im.plot()\n return im._plot.signal_plot.ax\n\n\ndef set_xaxis_lims(mpl_ax, hs_axis):\n \"\"\"\n Set the matplotlib axis limits to match that of a HyperSpy axis\n\n Parameters\n ----------\n mpl_ax : :class:`matplotlib.axis.Axis`\n The ``matplotlib`` axis to change\n hs_axis : :class:`~hyperspy.axes.DataAxis`\n The data axis that contains the values that control the scaling\n \"\"\"\n x_axis_lower_lim = hs_axis.axis[0]\n x_axis_upper_lim = hs_axis.axis[-1]\n mpl_ax.set_xlim(x_axis_lower_lim, x_axis_upper_lim)\n\n\ndef _make_overlap_plot(spectra, ax, color=\"blue\", line_style='-'):\n if isinstance(color, str):\n color = [color] * len(spectra)\n if isinstance(line_style, str):\n line_style = [line_style] * len(spectra)\n for spectrum_index, (spectrum, color, line_style) in enumerate(\n zip(spectra, color, line_style)):\n x_axis = spectrum.axes_manager.signal_axes[0]\n spectrum = _transpose_if_required(spectrum, 1)\n ax.plot(x_axis.axis, spectrum.data, color=color, ls=line_style)\n set_xaxis_lims(ax, x_axis)\n _set_spectrum_xlabel(spectra if isinstance(spectra, hs.signals.BaseSignal)\n else spectra[-1], ax)\n ax.set_ylabel('Intensity')\n ax.autoscale(tight=True)\n\n\ndef _make_cascade_subplot(\n spectra, ax, color=\"blue\", line_style='-', padding=1):\n max_value = 0\n for spectrum in spectra:\n spectrum_yrange = (np.nanmax(spectrum.data) -\n np.nanmin(spectrum.data))\n if spectrum_yrange > max_value:\n max_value = spectrum_yrange\n if isinstance(color, str):\n color = [color] * len(spectra)\n if isinstance(line_style, str):\n line_style = [line_style] * len(spectra)\n for spectrum_index, (spectrum, color, line_style) in enumerate(\n zip(spectra, color, line_style)):\n x_axis = spectrum.axes_manager.signal_axes[0]\n spectrum = _transpose_if_required(spectrum, 1)\n data_to_plot = ((spectrum.data - spectrum.data.min()) /\n float(max_value) + spectrum_index * padding)\n ax.plot(x_axis.axis, data_to_plot, color=color, ls=line_style)\n set_xaxis_lims(ax, x_axis)\n _set_spectrum_xlabel(spectra if isinstance(spectra, hs.signals.BaseSignal)\n else spectra[-1], ax)\n ax.set_yticks([])\n ax.autoscale(tight=True)\n\n\ndef _plot_spectrum(spectrum, ax, color=\"blue\", line_style='-'):\n x_axis = spectrum.axes_manager.signal_axes[0]\n ax.plot(x_axis.axis, spectrum.data, color=color, ls=line_style)\n set_xaxis_lims(ax, x_axis)\n\n\ndef _set_spectrum_xlabel(spectrum, ax):\n x_axis = spectrum.axes_manager.signal_axes[0]\n ax.set_xlabel(\"%s (%s)\" % (x_axis.name, x_axis.units))\n\n\ndef _transpose_if_required(signal, expected_dimension):\n # EDS profiles or maps have signal dimension = 0 and navigation dimension\n # 1 or 2. For convenience transpose the signal if possible\n if (signal.axes_manager.signal_dimension == 0 and \n signal.axes_manager.navigation_dimension == expected_dimension):\n return signal.T\n else:\n return signal\n\n\ndef plot_images(images,\n cmap=None,\n no_nans=False,\n per_row=3,\n label='auto',\n labelwrap=30,\n suptitle=None,\n suptitle_fontsize=18,\n colorbar='multi',\n centre_colormap=\"auto\",\n saturated_pixels=0,\n scalebar=None,\n scalebar_color='white',\n axes_decor='all',\n padding=None,\n tight_layout=False,\n aspect='auto',\n min_asp=0.1,\n namefrac_thresh=0.4,\n fig=None,\n vmin=None,\n vmax=None,\n *args,\n **kwargs):\n \"\"\"Plot multiple images as sub-images in one figure.\n\n Extra keyword arguments are passed to `matplotlib.figure`.\n\n Parameters\n ----------\n images : list of Signal2D or BaseSignal\n `images` should be a list of Signals to plot. For `BaseSignal` with\n navigation dimensions 2 and signal dimension 0, the signal will be \n tranposed to form a `Signal2D`.\n Multi-dimensional images will have each plane plotted as a separate\n image.\n If any signal shape is not suitable, a ValueError will be raised.\n cmap : matplotlib colormap, list, or ``'mpl_colors'``, *optional*\n The colormap used for the images, by default read from ``pyplot``.\n A list of colormaps can also be provided, and the images will\n cycle through them. Optionally, the value ``'mpl_colors'`` will\n cause the cmap to loop through the default ``matplotlib``\n colors (to match with the default output of the\n :py:func:`~.drawing.utils.plot_spectra` method.\n Note: if using more than one colormap, using the ``'single'``\n option for ``colorbar`` is disallowed.\n no_nans : bool, optional\n If True, set nans to zero for plotting.\n per_row : int, optional\n The number of plots in each row\n label : None, str, or list of str, optional\n Control the title labeling of the plotted images.\n If None, no titles will be shown.\n If 'auto' (default), function will try to determine suitable titles\n using Signal2D titles, falling back to the 'titles' option if no good\n short titles are detected.\n Works best if all images to be plotted have the same beginning\n to their titles.\n If 'titles', the title from each image's metadata.General.title\n will be used.\n If any other single str, images will be labeled in sequence using\n that str as a prefix.\n If a list of str, the list elements will be used to determine the\n labels (repeated, if necessary).\n labelwrap : int, optional\n integer specifying the number of characters that will be used on\n one line\n If the function returns an unexpected blank figure, lower this\n value to reduce overlap of the labels between each figure\n suptitle : str, optional\n Title to use at the top of the figure. If called with label='auto',\n this parameter will override the automatically determined title.\n suptitle_fontsize : int, optional\n Font size to use for super title at top of figure\n colorbar : {'multi', None, 'single'}\n Controls the type of colorbars that are plotted.\n If None, no colorbar is plotted.\n If 'multi' (default), individual colorbars are plotted for each\n (non-RGB) image\n If 'single', all (non-RGB) images are plotted on the same scale,\n and one colorbar is shown for all\n centre_colormap : {\"auto\", True, False}\n If True the centre of the color scheme is set to zero. This is\n specially useful when using diverging color schemes. If \"auto\"\n (default), diverging color schemes are automatically centred.\n saturated_pixels: None, scalar or list of scalar, optional, default: 0\n If list of scalar, the length should match the number of images to\n show. If provide in the list, set the value to 0.\n The percentage of pixels that are left out of the bounds. For\n example, the low and high bounds of a value of 1 are the 0.5% and\n 99.5% percentiles. It must be in the [0, 100] range.\n scalebar : {None, 'all', list of ints}, optional\n If None (or False), no scalebars will be added to the images.\n If 'all', scalebars will be added to all images.\n If list of ints, scalebars will be added to each image specified.\n scalebar_color : str, optional\n A valid MPL color string; will be used as the scalebar color\n axes_decor : {'all', 'ticks', 'off', None}, optional\n Controls how the axes are displayed on each image; default is 'all'\n If 'all', both ticks and axis labels will be shown\n If 'ticks', no axis labels will be shown, but ticks/labels will\n If 'off', all decorations and frame will be disabled\n If None, no axis decorations will be shown, but ticks/frame will\n padding : None or dict, optional\n This parameter controls the spacing between images.\n If None, default options will be used\n Otherwise, supply a dictionary with the spacing options as\n keywords and desired values as values\n Values should be supplied as used in pyplot.subplots_adjust(),\n and can be:\n 'left', 'bottom', 'right', 'top', 'wspace' (width),\n and 'hspace' (height)\n tight_layout : bool, optional\n If true, hyperspy will attempt to improve image placement in\n figure using matplotlib's tight_layout\n If false, repositioning images inside the figure will be left as\n an exercise for the user.\n aspect : str or numeric, optional\n If 'auto', aspect ratio is auto determined, subject to min_asp.\n If 'square', image will be forced onto square display.\n If 'equal', aspect ratio of 1 will be enforced.\n If float (or int/long), given value will be used.\n min_asp : float, optional\n Minimum aspect ratio to be used when plotting images\n namefrac_thresh : float, optional\n Threshold to use for auto-labeling. This parameter controls how\n much of the titles must be the same for the auto-shortening of\n labels to activate. Can vary from 0 to 1. Smaller values\n encourage shortening of titles by auto-labeling, while larger\n values will require more overlap in titles before activing the\n auto-label code.\n fig : mpl figure, optional\n If set, the images will be plotted to an existing MPL figure\n vmin, vmax : scalar or list of scalar, optional, default: None\n If list of scalar, the length should match the number of images to\n show.\n A list of scalar is not compatible with a single colorbar.\n See vmin, vmax of matplotlib.imshow() for more details.\n *args, **kwargs, optional\n Additional arguments passed to matplotlib.imshow()\n\n Returns\n -------\n axes_list : list\n a list of subplot axes that hold the images\n\n See Also\n --------\n plot_spectra : Plotting of multiple spectra\n plot_signals : Plotting of multiple signals\n plot_histograms : Compare signal histograms\n\n Notes\n -----\n `interpolation` is a useful parameter to provide as a keyword\n argument to control how the space between pixels is interpolated. A\n value of ``'nearest'`` will cause no interpolation between pixels.\n\n `tight_layout` is known to be quite brittle, so an option is provided\n to disable it. Turn this option off if output is not as expected,\n or try adjusting `label`, `labelwrap`, or `per_row`\n\n \"\"\"\n def __check_single_colorbar(cbar):\n if cbar == 'single':\n raise ValueError('Cannot use a single colorbar with multiple '\n 'colormaps. Please check for compatible '\n 'arguments.')\n\n from hyperspy.drawing.widgets import ScaleBar\n from hyperspy.misc import rgb_tools\n from hyperspy.signal import BaseSignal\n\n # Check that we have a hyperspy signal\n im = [images] if not isinstance(images, (list, tuple)) else images\n for image in im:\n if not isinstance(image, BaseSignal):\n raise ValueError(\"`images` must be a list of image signals or a \"\n \"multi-dimensional signal.\"\n \" \" + repr(type(images)) + \" was given.\")\n\n # For list of EDS maps, transpose the BaseSignal\n if isinstance(images, (list, tuple)):\n images = [_transpose_if_required(image, 2) for image in images]\n\n # If input is >= 1D signal (e.g. for multi-dimensional plotting),\n # copy it and put it in a list so labeling works out as (x,y) when plotting\n if isinstance(images,\n BaseSignal) and images.axes_manager.navigation_dimension > 0:\n images = [images._deepcopy_with_new_data(images.data)]\n\n n = 0\n for i, sig in enumerate(images):\n if sig.axes_manager.signal_dimension != 2:\n raise ValueError(\"This method only plots signals that are images. \"\n \"The signal dimension must be equal to 2. \"\n \"The signal at position \" + repr(i) +\n \" was \" + repr(sig) + \".\")\n # increment n by the navigation size, or by 1 if the navigation size is\n # <= 0\n n += (sig.axes_manager.navigation_size\n if sig.axes_manager.navigation_size > 0\n else 1)\n\n # If no cmap given, get default colormap from pyplot:\n if cmap is None:\n cmap = [plt.get_cmap().name]\n elif cmap == 'mpl_colors':\n for n_color, c in enumerate(mpl.rcParams['axes.prop_cycle']):\n make_cmap(colors=['#000000', c['color']],\n name='mpl{}'.format(n_color))\n cmap = ['mpl{}'.format(i) for i in\n range(len(mpl.rcParams['axes.prop_cycle']))]\n __check_single_colorbar(colorbar)\n # cmap is list, tuple, or something else iterable (but not string):\n elif hasattr(cmap, '__iter__') and not isinstance(cmap, str):\n try:\n cmap = [c.name for c in cmap] # convert colormap to string\n except AttributeError:\n cmap = [c for c in cmap] # c should be string if not colormap\n __check_single_colorbar(colorbar)\n elif isinstance(cmap, mpl.colors.Colormap):\n cmap = [cmap.name] # convert single colormap to list with string\n elif isinstance(cmap, str):\n cmap = [cmap] # cmap is single string, so make it a list\n else:\n # Didn't understand cmap input, so raise error\n raise ValueError('The provided cmap value was not understood. Please '\n 'check input values.')\n\n # If any of the cmaps given are diverging, and auto-centering, set the\n # appropriate flag:\n if centre_colormap == \"auto\":\n centre_colormaps = []\n for c in cmap:\n if c in MPL_DIVERGING_COLORMAPS:\n centre_colormaps.append(True)\n else:\n centre_colormaps.append(False)\n # if it was True, just convert to list\n elif centre_colormap:\n centre_colormaps = [True]\n # likewise for false\n elif not centre_colormap:\n centre_colormaps = [False]\n\n # finally, convert lists to cycle generators for adaptive length:\n centre_colormaps = itertools.cycle(centre_colormaps)\n cmap = itertools.cycle(cmap)\n\n def _check_arg(arg, default_value, arg_name):\n if isinstance(arg, list):\n if len(arg) != n:\n _logger.warning('The provided {} values are ignored because the '\n 'length of the list does not match the number of '\n 'images'.format(arg_name))\n arg = [default_value] * n\n else:\n arg = [arg] * n\n return arg\n vmin = _check_arg(vmin, None, 'vmin')\n vmax = _check_arg(vmax, None, 'vmax')\n saturated_pixels = _check_arg(saturated_pixels, 0, 'saturated_pixels')\n\n # Sort out the labeling:\n div_num = 0\n all_match = False\n shared_titles = False\n user_labels = False\n\n if label is None:\n pass\n elif label == 'auto':\n # Use some heuristics to try to get base string of similar titles\n\n label_list = [x.metadata.General.title for x in images]\n\n # Find the shortest common string between the image titles\n # and pull that out as the base title for the sequence of images\n # array in which to store arrays\n res = np.zeros((len(label_list), len(label_list[0]) + 1))\n res[:, 0] = 1\n\n # j iterates the strings\n for j in range(len(label_list)):\n # i iterates length of substring test\n for i in range(1, len(label_list[0]) + 1):\n # stores whether or not characters in title match\n res[j, i] = label_list[0][:i] in label_list[j]\n\n # sum up the results (1 is True, 0 is False) and create\n # a substring based on the minimum value (this will be\n # the \"smallest common string\" between all the titles\n if res.all():\n basename = label_list[0]\n div_num = len(label_list[0])\n all_match = True\n else:\n div_num = int(min(np.sum(res, 1)))\n basename = label_list[0][:div_num - 1]\n all_match = False\n\n # trim off any '(' or ' ' characters at end of basename\n if div_num > 1:\n while True:\n if basename[len(basename) - 1] == '(':\n basename = basename[:-1]\n elif basename[len(basename) - 1] == ' ':\n basename = basename[:-1]\n else:\n break\n\n # namefrac is ratio of length of basename to the image name\n # if it is high (e.g. over 0.5), we can assume that all images\n # share the same base\n if len(label_list[0]) > 0:\n namefrac = float(len(basename)) / len(label_list[0])\n else:\n # If label_list[0] is empty, it means there was probably no\n # title set originally, so nothing to share\n namefrac = 0\n\n if namefrac > namefrac_thresh:\n # there was a significant overlap of label beginnings\n shared_titles = True\n # only use new suptitle if one isn't specified already\n if suptitle is None:\n suptitle = basename\n\n else:\n # there was not much overlap, so default back to 'titles' mode\n shared_titles = False\n label = 'titles'\n div_num = 0\n\n elif label == 'titles':\n # Set label_list to each image's pre-defined title\n label_list = [x.metadata.General.title for x in images]\n\n elif isinstance(label, str):\n # Set label_list to an indexed list, based off of label\n label_list = [label + \" \" + repr(num) for num in range(n)]\n\n elif isinstance(label, list) and all(\n isinstance(x, str) for x in label):\n label_list = label\n user_labels = True\n # If list of labels is longer than the number of images, just use the\n # first n elements\n if len(label_list) > n:\n del label_list[n:]\n if len(label_list) < n:\n label_list *= (n // len(label_list)) + 1\n del label_list[n:]\n\n else:\n raise ValueError(\"Did not understand input of labels.\")\n\n # Determine appropriate number of images per row\n rows = int(np.ceil(n / float(per_row)))\n if n < per_row:\n per_row = n\n\n # Set overall figure size and define figure (if not pre-existing)\n if fig is None:\n k = max(plt.rcParams['figure.figsize']) / max(per_row, rows)\n f = plt.figure(figsize=(tuple(k * i for i in (per_row, rows))))\n else:\n f = fig\n\n # Initialize list to hold subplot axes\n axes_list = []\n\n # Initialize list of rgb tags\n isrgb = [False] * len(images)\n\n # Check to see if there are any rgb images in list\n # and tag them using the isrgb list\n for i, img in enumerate(images):\n if rgb_tools.is_rgbx(img.data):\n isrgb[i] = True\n\n # Determine how many non-rgb Images there are\n non_rgb = list(itertools.compress(images, [not j for j in isrgb]))\n if len(non_rgb) == 0 and colorbar is not None:\n colorbar = None\n warnings.warn(\"Sorry, colorbar is not implemented for RGB images.\")\n\n # Find global min and max values of all the non-rgb images for use with\n # 'single' scalebar\n if colorbar == 'single':\n # get a g_saturated_pixels from saturated_pixels\n if isinstance(saturated_pixels, list):\n g_saturated_pixels = min(np.array([v for v in saturated_pixels]))\n else:\n g_saturated_pixels = saturated_pixels\n\n # estimate a g_vmin and g_max from saturated_pixels\n g_vmin, g_vmax = contrast_stretching(np.concatenate(\n [i.data.flatten() for i in non_rgb]), g_saturated_pixels)\n\n # if vmin and vmax are provided, override g_min and g_max\n if isinstance(vmin, list):\n _logger.warning('vmin have to be a scalar to be compatible with a '\n 'single colorbar')\n else:\n g_vmin = vmin if vmin is not None else g_vmin\n if isinstance(vmax, list):\n _logger.warning('vmax have to be a scalar to be compatible with a '\n 'single colorbar')\n else:\n g_vmax = vmax if vmax is not None else g_vmax\n if next(centre_colormaps):\n g_vmin, g_vmax = centre_colormap_values(g_vmin, g_vmax)\n\n # Check if we need to add a scalebar for some of the images\n if isinstance(scalebar, list) and all(isinstance(x, int)\n for x in scalebar):\n scalelist = True\n else:\n scalelist = False\n\n idx = 0\n ax_im_list = [0] * len(isrgb)\n\n # Replot: create a list to store references to the images\n replot_ims = []\n\n # Loop through each image, adding subplot for each one\n for i, ims in enumerate(images):\n # Get handles for the signal axes and axes_manager\n axes_manager = ims.axes_manager\n if axes_manager.navigation_dimension > 0:\n ims = ims._deepcopy_with_new_data(ims.data)\n for j, im in enumerate(ims):\n ax = f.add_subplot(rows, per_row, idx + 1)\n axes_list.append(ax)\n data = im.data\n centre = next(centre_colormaps) # get next value for centreing\n\n # Enable RGB plotting\n if rgb_tools.is_rgbx(data):\n data = rgb_tools.rgbx2regular_array(data, plot_friendly=True)\n l_vmin, l_vmax = None, None\n else:\n data = im.data\n # Find min and max for contrast\n l_vmin, l_vmax = contrast_stretching(\n data, saturated_pixels[idx])\n l_vmin = vmin[idx] if vmin[idx] is not None else l_vmin\n l_vmax = vmax[idx] if vmax[idx] is not None else l_vmax\n if centre:\n l_vmin, l_vmax = centre_colormap_values(l_vmin, l_vmax)\n\n # Remove NaNs (if requested)\n if no_nans:\n data = np.nan_to_num(data)\n\n # Get handles for the signal axes and axes_manager\n axes_manager = im.axes_manager\n axes = axes_manager.signal_axes\n\n # Set dimensions of images\n xaxis = axes[0]\n yaxis = axes[1]\n\n extent = (\n xaxis.low_value,\n xaxis.high_value,\n yaxis.high_value,\n yaxis.low_value,\n )\n\n if not isinstance(aspect, (int, float)) and aspect not in [\n 'auto', 'square', 'equal']:\n _logger.warning(\"Did not understand aspect ratio input. \"\n \"Using 'auto' as default.\")\n aspect = 'auto'\n\n if aspect == 'auto':\n if float(yaxis.size) / xaxis.size < min_asp:\n factor = min_asp * float(xaxis.size) / yaxis.size\n elif float(yaxis.size) / xaxis.size > min_asp ** -1:\n factor = min_asp ** -1 * float(xaxis.size) / yaxis.size\n else:\n factor = 1\n asp = np.abs(factor * float(xaxis.scale) / yaxis.scale)\n elif aspect == 'square':\n asp = abs(extent[1] - extent[0]) / abs(extent[3] - extent[2])\n elif aspect == 'equal':\n asp = 1\n elif isinstance(aspect, (int, float)):\n asp = aspect\n if 'interpolation' not in kwargs.keys():\n kwargs['interpolation'] = 'nearest'\n\n # Get colormap for this image:\n cm = next(cmap)\n\n # Plot image data, using vmin and vmax to set bounds,\n # or allowing them to be set automatically if using individual\n # colorbars\n if colorbar == 'single' and not isrgb[i]:\n axes_im = ax.imshow(data,\n cmap=cm,\n extent=extent,\n vmin=g_vmin, vmax=g_vmax,\n aspect=asp,\n *args, **kwargs)\n ax_im_list[i] = axes_im\n else:\n axes_im = ax.imshow(data,\n cmap=cm,\n extent=extent,\n vmin=l_vmin,\n vmax=l_vmax,\n aspect=asp,\n *args, **kwargs)\n ax_im_list[i] = axes_im\n\n # If an axis trait is undefined, shut off :\n if isinstance(xaxis.units, trait_base._Undefined) or \\\n isinstance(yaxis.units, trait_base._Undefined) or \\\n isinstance(xaxis.name, trait_base._Undefined) or \\\n isinstance(yaxis.name, trait_base._Undefined):\n if axes_decor == 'all':\n _logger.warning(\n 'Axes labels were requested, but one '\n 'or both of the '\n 'axes units and/or name are undefined. '\n 'Axes decorations have been set to '\n '\\'ticks\\' instead.')\n axes_decor = 'ticks'\n # If all traits are defined, set labels as appropriate:\n else:\n ax.set_xlabel(axes[0].name + \" axis (\" + axes[0].units + \")\")\n ax.set_ylabel(axes[1].name + \" axis (\" + axes[1].units + \")\")\n\n if label:\n if all_match:\n title = ''\n elif shared_titles:\n title = label_list[i][div_num - 1:]\n else:\n if len(ims) == n:\n # This is true if we are plotting just 1\n # multi-dimensional Signal2D\n title = label_list[idx]\n elif user_labels:\n title = label_list[idx]\n else:\n title = label_list[i]\n\n if ims.axes_manager.navigation_size > 1 and not user_labels:\n title += \" %s\" % str(ims.axes_manager.indices)\n\n ax.set_title(textwrap.fill(title, labelwrap))\n\n # Set axes decorations based on user input\n set_axes_decor(ax, axes_decor)\n\n # If using independent colorbars, add them\n if colorbar == 'multi' and not isrgb[i]:\n div = make_axes_locatable(ax)\n cax = div.append_axes(\"right\", size=\"5%\", pad=0.05)\n plt.colorbar(axes_im, cax=cax)\n\n # Add scalebars as necessary\n if (scalelist and idx in scalebar) or scalebar == 'all':\n ax.scalebar = ScaleBar(\n ax=ax,\n units=axes[0].units,\n color=scalebar_color,\n )\n # Replot: store references to the images\n replot_ims.append(im)\n\n idx += 1\n\n # If using a single colorbar, add it, and do tight_layout, ensuring that\n # a colorbar is only added based off of non-rgb Images:\n if colorbar == 'single':\n foundim = None\n for i in range(len(isrgb)):\n if (not isrgb[i]) and foundim is None:\n foundim = i\n\n if foundim is not None:\n f.subplots_adjust(right=0.8)\n cbar_ax = f.add_axes([0.9, 0.1, 0.03, 0.8])\n f.colorbar(ax_im_list[foundim], cax=cbar_ax)\n if tight_layout:\n # tight_layout, leaving room for the colorbar\n plt.tight_layout(rect=[0, 0, 0.9, 1])\n elif tight_layout:\n plt.tight_layout()\n\n elif tight_layout:\n plt.tight_layout()\n\n # Set top bounds for shared titles and add suptitle\n if suptitle:\n f.subplots_adjust(top=0.85)\n f.suptitle(suptitle, fontsize=suptitle_fontsize)\n\n # If we want to plot scalebars, loop through the list of axes and add them\n if scalebar is None or scalebar is False:\n # Do nothing if no scalebars are called for\n pass\n elif scalebar == 'all':\n # scalebars were taken care of in the plotting loop\n pass\n elif scalelist:\n # scalebars were taken care of in the plotting loop\n pass\n else:\n raise ValueError(\"Did not understand scalebar input. Must be None, \"\n \"\\'all\\', or list of ints.\")\n\n # Adjust subplot spacing according to user's specification\n if padding is not None:\n plt.subplots_adjust(**padding)\n\n # Replot: connect function\n def on_dblclick(event):\n # On the event of a double click, replot the selected subplot\n if not event.inaxes:\n return\n if not event.dblclick:\n return\n subplots = [axi for axi in f.axes if isinstance(axi, mpl.axes.Subplot)]\n inx = list(subplots).index(event.inaxes)\n im = replot_ims[inx]\n\n # Use some of the info in the subplot\n cm = subplots[inx].images[0].get_cmap()\n clim = subplots[inx].images[0].get_clim()\n\n sbar = False\n if (scalelist and inx in scalebar) or scalebar == 'all':\n sbar = True\n\n im.plot(colorbar=bool(colorbar),\n vmin=clim[0],\n vmax=clim[1],\n no_nans=no_nans,\n aspect=asp,\n scalebar=sbar,\n scalebar_color=scalebar_color,\n cmap=cm)\n\n f.canvas.mpl_connect('button_press_event', on_dblclick)\n\n return axes_list\n\n\ndef set_axes_decor(ax, axes_decor):\n if axes_decor == 'off':\n ax.axis('off')\n elif axes_decor == 'ticks':\n ax.set_xlabel('')\n ax.set_ylabel('')\n elif axes_decor == 'all':\n pass\n elif axes_decor is None:\n ax.set_xlabel('')\n ax.set_ylabel('')\n ax.set_xticklabels([])\n ax.set_yticklabels([])\n\n\ndef make_cmap(colors, name='my_colormap', position=None,\n bit=False, register=True):\n \"\"\"\n Create a matplotlib colormap with customized colors, optionally registering\n it with matplotlib for simplified use.\n\n Adapted from Chris Slocum's code at:\n https://github.com/CSlocumWX/custom_colormap/blob/master/custom_colormaps.py\n and used under the terms of that code's BSD-3 license\n\n Parameters\n ----------\n colors : iterable\n list of either tuples containing rgb values, or html strings\n Colors should be arranged so that the first color is the lowest\n value for the colorbar and the last is the highest.\n name : str\n name of colormap to use when registering with matplotlib\n position : None or iterable\n list containing the values (from [0,1]) that dictate the position\n of each color within the colormap. If None (default), the colors\n will be equally-spaced within the colorbar.\n bit : boolean\n True if RGB colors are given in 8-bit [0 to 255] or False if given\n in arithmetic basis [0 to 1] (default)\n register : boolean\n switch to control whether or not to register the custom colormap\n with matplotlib in order to enable use by just the name string\n \"\"\"\n def _html_color_to_rgb(color_string):\n \"\"\" convert #RRGGBB to an (R, G, B) tuple \"\"\"\n color_string = color_string.strip()\n if color_string[0] == '#':\n color_string = color_string[1:]\n if len(color_string) != 6:\n raise ValueError(\n \"input #{} is not in #RRGGBB format\".format(color_string))\n r, g, b = color_string[:2], color_string[2:4], color_string[4:]\n r, g, b = [int(n, 16) / 255 for n in (r, g, b)]\n return r, g, b\n\n bit_rgb = np.linspace(0, 1, 256)\n\n if position is None:\n position = np.linspace(0, 1, len(colors))\n else:\n if len(position) != len(colors):\n raise ValueError(\"position length must be the same as colors\")\n elif position[0] != 0 or position[-1] != 1:\n raise ValueError(\"position must start with 0 and end with 1\")\n\n cdict = {'red': [], 'green': [], 'blue': []}\n\n for pos, color in zip(position, colors):\n if isinstance(color, str):\n color = _html_color_to_rgb(color)\n\n elif bit:\n color = (bit_rgb[color[0]],\n bit_rgb[color[1]],\n bit_rgb[color[2]])\n\n cdict['red'].append((pos, color[0], color[0]))\n cdict['green'].append((pos, color[1], color[1]))\n cdict['blue'].append((pos, color[2], color[2]))\n\n cmap = mpl.colors.LinearSegmentedColormap(name, cdict, 256)\n\n if register:\n mpl.cm.register_cmap(name, cmap)\n return cmap\n\n\ndef plot_spectra(\n spectra,\n style='overlap',\n color=None,\n line_style=None,\n padding=1.,\n legend=None,\n legend_picking=True,\n legend_loc='upper right',\n fig=None,\n ax=None,\n **kwargs):\n \"\"\"Plot several spectra in the same figure.\n\n Extra keyword arguments are passed to `matplotlib.figure`.\n\n Parameters\n ----------\n spectra : list of Signal1D or BaseSignal\n Ordered spectra list of signal to plot. If `style` is \"cascade\" or \n \"mosaic\" the spectra can have different size and axes. For `BaseSignal`\n with navigation dimensions 1 and signal dimension 0, the signal will be\n tranposed to form a `Signal1D`.\n style : {'overlap', 'cascade', 'mosaic', 'heatmap'}\n The style of the plot.\n color : matplotlib color or a list of them or `None`\n Sets the color of the lines of the plots (no action on 'heatmap').\n If a list, if its length is less than the number of spectra to plot,\n the colors will be cycled. If `None`, use default matplotlib color\n cycle.\n line_style: matplotlib line style or a list of them or `None`\n Sets the line style of the plots (no action on 'heatmap').\n The main line style are '-','--','steps','-.',':'.\n If a list, if its length is less than the number of\n spectra to plot, line_style will be cycled. If\n If `None`, use continuous lines, eg: ('-','--','steps','-.',':')\n padding : float, optional, default 0.1\n Option for \"cascade\". 1 guarantees that there is not overlapping.\n However, in many cases a value between 0 and 1 can produce a tighter\n plot without overlapping. Negative values have the same effect but\n reverse the order of the spectra without reversing the order of the\n colors.\n legend: None or list of str or 'auto'\n If list of string, legend for \"cascade\" or title for \"mosaic\" is\n displayed. If 'auto', the title of each spectra (metadata.General.title)\n is used.\n legend_picking: bool\n If true, a spectrum can be toggle on and off by clicking on\n the legended line.\n legend_loc : str or int\n This parameter controls where the legend is placed on the figure;\n see the pyplot.legend docstring for valid values\n fig : matplotlib figure or None\n If None, a default figure will be created. Specifying fig will\n not work for the 'heatmap' style.\n ax : matplotlib ax (subplot) or None\n If None, a default ax will be created. Will not work for 'mosaic'\n or 'heatmap' style.\n **kwargs\n remaining keyword arguments are passed to matplotlib.figure() or\n matplotlib.subplots(). Has no effect on 'heatmap' style.\n\n Example\n -------\n >>> s = hs.load(\"some_spectra\")\n >>> hs.plot.plot_spectra(s, style='cascade', color='red', padding=0.5)\n\n To save the plot as a png-file\n\n >>> hs.plot.plot_spectra(s).figure.savefig(\"test.png\")\n\n Returns\n -------\n ax: matplotlib axes or list of matplotlib axes\n An array is returned when `style` is \"mosaic\".\n\n \"\"\"\n import hyperspy.signal\n\n def _reverse_legend(ax_, legend_loc_):\n \"\"\"\n Reverse the ordering of a matplotlib legend (to be more consistent\n with the default ordering of plots in the 'cascade' and 'overlap'\n styles\n\n Parameters\n ----------\n ax_: matplotlib axes\n\n legend_loc_: str or int\n This parameter controls where the legend is placed on the\n figure; see the pyplot.legend docstring for valid values\n \"\"\"\n l = ax_.get_legend()\n labels = [lb.get_text() for lb in list(l.get_texts())]\n handles = l.legendHandles\n ax_.legend(handles[::-1], labels[::-1], loc=legend_loc_)\n\n # Before v1.3 default would read the value from prefereces.\n if style == \"default\":\n style = \"overlap\"\n\n if color is not None:\n if isinstance(color, str):\n color = itertools.cycle([color])\n elif hasattr(color, \"__iter__\"):\n color = itertools.cycle(color)\n else:\n raise ValueError(\"Color must be None, a valid matplotlib color \"\n \"string or a list of valid matplotlib colors.\")\n else:\n if LooseVersion(mpl.__version__) >= \"1.5.3\":\n color = itertools.cycle(\n plt.rcParams['axes.prop_cycle'].by_key()[\"color\"])\n else:\n color = itertools.cycle(plt.rcParams['axes.color_cycle'])\n\n if line_style is not None:\n if isinstance(line_style, str):\n line_style = itertools.cycle([line_style])\n elif hasattr(line_style, \"__iter__\"):\n line_style = itertools.cycle(line_style)\n else:\n raise ValueError(\"line_style must be None, a valid matplotlib\"\n \" line_style string or a list of valid matplotlib\"\n \" line_style.\")\n else:\n line_style = ['-'] * len(spectra)\n\n if legend is not None:\n if isinstance(legend, str):\n if legend == 'auto':\n legend = [spec.metadata.General.title for spec in spectra]\n else:\n raise ValueError(\"legend must be None, 'auto' or a list of\"\n \" string\")\n\n elif hasattr(legend, \"__iter__\"):\n legend = itertools.cycle(legend)\n\n if style == 'overlap':\n if fig is None:\n fig = plt.figure(**kwargs)\n if ax is None:\n ax = fig.add_subplot(111)\n _make_overlap_plot(spectra,\n ax,\n color=color,\n line_style=line_style,)\n if legend is not None:\n ax.legend(legend, loc=legend_loc)\n _reverse_legend(ax, legend_loc)\n if legend_picking is True:\n animate_legend(fig=fig, ax=ax)\n elif style == 'cascade':\n if fig is None:\n fig = plt.figure(**kwargs)\n if ax is None:\n ax = fig.add_subplot(111)\n _make_cascade_subplot(spectra,\n ax,\n color=color,\n line_style=line_style,\n padding=padding)\n if legend is not None:\n plt.legend(legend, loc=legend_loc)\n _reverse_legend(ax, legend_loc)\n elif style == 'mosaic':\n default_fsize = plt.rcParams[\"figure.figsize\"]\n figsize = (default_fsize[0], default_fsize[1] * len(spectra))\n fig, subplots = plt.subplots(\n len(spectra), 1, figsize=figsize, **kwargs)\n if legend is None:\n legend = [legend] * len(spectra)\n for spectrum, ax, color, line_style, legend in zip(\n spectra, subplots, color, line_style, legend):\n spectrum = _transpose_if_required(spectrum, 1)\n _plot_spectrum(spectrum, ax, color=color, line_style=line_style)\n ax.set_ylabel('Intensity')\n if legend is not None:\n ax.set_title(legend)\n if not isinstance(spectra, hyperspy.signal.BaseSignal):\n _set_spectrum_xlabel(spectrum, ax)\n if isinstance(spectra, hyperspy.signal.BaseSignal):\n _set_spectrum_xlabel(spectrum, ax)\n fig.tight_layout()\n\n elif style == 'heatmap':\n if not isinstance(spectra, hyperspy.signal.BaseSignal):\n import hyperspy.utils\n spectra = [_transpose_if_required(spectrum, 1) for spectrum in \n spectra]\n spectra = hyperspy.utils.stack(spectra)\n with spectra.unfolded():\n ax = _make_heatmap_subplot(spectra)\n ax.set_ylabel('Spectra')\n ax = ax if style != \"mosaic\" else subplots\n\n return ax\n\n\ndef animate_legend(fig=None, ax=None):\n \"\"\"Animate the legend of a figure.\n\n A spectrum can be toggle on and off by clicking on the legended line.\n\n Parameters\n ----------\n\n fig: None | matplotlib.figure\n If None pick the current figure using \"plt.gcf\"\n ax: None | matplotlib.axes\n If None pick the current axes using \"plt.gca\".\n\n Note\n ----\n\n Code inspired from legend_picking.py in the matplotlib gallery\n\n \"\"\"\n if fig is None:\n fig = plt.gcf()\n if ax is None:\n ax = plt.gca()\n lines = ax.lines[::-1]\n lined = dict()\n leg = ax.get_legend()\n for legline, origline in zip(leg.get_lines(), lines):\n legline.set_picker(5) # 5 pts tolerance\n lined[legline] = origline\n\n def onpick(event):\n # on the pick event, find the orig line corresponding to the\n # legend proxy line, and toggle the visibility\n legline = event.artist\n if legline.axes == ax:\n origline = lined[legline]\n vis = not origline.get_visible()\n origline.set_visible(vis)\n # Change the alpha on the line in the legend so we can see what lines\n # have been toggled\n if vis:\n legline.set_alpha(1.0)\n else:\n legline.set_alpha(0.2)\n fig.canvas.draw_idle()\n\n fig.canvas.mpl_connect('pick_event', onpick)\n\n\ndef plot_histograms(signal_list,\n bins='freedman',\n range_bins=None,\n color=None,\n line_style=None,\n legend='auto',\n fig=None,\n **kwargs):\n \"\"\"Plot the histogram of every signal in the list in the same figure.\n\n This function creates a histogram for each signal and plot the list with\n the `utils.plot.plot_spectra` function.\n\n Parameters\n ----------\n signal_list : iterable\n Ordered spectra list to plot. If `style` is \"cascade\" or \"mosaic\"\n the spectra can have different size and axes.\n bins : int or list or str, optional\n If bins is a string, then it must be one of:\n 'knuth' : use Knuth's rule to determine bins\n 'scotts' : use Scott's rule to determine bins\n 'freedman' : use the Freedman-diaconis rule to determine bins\n 'blocks' : use bayesian blocks for dynamic bin widths\n range_bins : tuple or None, optional.\n the minimum and maximum range for the histogram. If not specified,\n it will be (x.min(), x.max())\n color : valid matplotlib color or a list of them or `None`, optional.\n Sets the color of the lines of the plots. If a list, if its length is\n less than the number of spectra to plot, the colors will be cycled. If\n If `None`, use default matplotlib color cycle.\n line_style: valid matplotlib line style or a list of them or `None`,\n optional.\n The main line style are '-','--','steps','-.',':'.\n If a list, if its length is less than the number of\n spectra to plot, line_style will be cycled. If\n If `None`, use continuous lines, eg: ('-','--','steps','-.',':')\n legend: None or list of str or 'auto', optional.\n Display a legend. If 'auto', the title of each spectra\n (metadata.General.title) is used.\n legend_picking: bool, optional.\n If true, a spectrum can be toggle on and off by clicking on\n the legended line.\n fig : matplotlib figure or None, optional.\n If None, a default figure will be created.\n **kwargs\n other keyword arguments (weight and density) are described in\n np.histogram().\n\n Example\n -------\n Histograms of two random chi-square distributions\n\n >>> img = hs.signals.Signal2D(np.random.chisquare(1,[10,10,100]))\n >>> img2 = hs.signals.Signal2D(np.random.chisquare(2,[10,10,100]))\n >>> hs.plot.plot_histograms([img,img2],legend=['hist1','hist2'])\n\n Returns\n -------\n ax: matplotlib axes or list of matplotlib axes\n An array is returned when `style` is \"mosaic\".\n\n \"\"\"\n hists = []\n for obj in signal_list:\n hists.append(obj.get_histogram(bins=bins,\n range_bins=range_bins, **kwargs))\n if line_style is None:\n line_style = 'steps'\n return plot_spectra(hists, style='overlap', color=color,\n line_style=line_style, legend=legend, fig=fig)\n"},"license":{"kind":"string","value":"gpl-3.0"},"hash":{"kind":"number","value":685807880072156300,"string":"685,807,880,072,156,300"},"line_mean":{"kind":"number","value":36.986083499,"string":"36.986083"},"line_max":{"kind":"number","value":82,"string":"82"},"alpha_frac":{"kind":"number","value":0.5811308247,"string":"0.581131"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.057262174405436,"string":"4.057262"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44985,"cells":{"repo_name":{"kind":"string","value":"rg3915/django-experience"},"path":{"kind":"string","value":"djexperience/settings.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"3763"},"content":{"kind":"string","value":"import os\nfrom decouple import config, Csv\nfrom dj_database_url import parse as dburl\n\n# Build paths inside the project like this: os.path.join(BASE_DIR, ...)\nBASE_DIR = os.path.dirname(os.path.dirname(os.path.abspath(__file__)))\n\n\n# Quick-start development settings - unsuitable for production\n# See https://docs.djangoproject.com/en/1.9/howto/deployment/checklist/\n\n# SECURITY WARNING: keep the secret key used in production secret!\nSECRET_KEY = config('SECRET_KEY')\n\nDEBUG = config('DEBUG', default=False, cast=bool)\n\nALLOWED_HOSTS = config('ALLOWED_HOSTS', default=[], cast=Csv())\n\n\n# Application definition\n\nINSTALLED_APPS = [\n # my apps\n 'djexperience.core',\n # default django apps\n 'django.contrib.admin',\n 'django.contrib.auth',\n 'django.contrib.contenttypes',\n 'django.contrib.sessions',\n 'django.contrib.messages',\n 'django.contrib.staticfiles',\n # thirty apps\n 'django_extensions',\n 'bootstrapform',\n 'widget_tweaks',\n 'daterange_filter',\n 'django_activeurl',\n 'import_export',\n 'django_tables2',\n # my apps\n 'djexperience.bookstore',\n 'djexperience.company',\n 'djexperience.crm',\n 'djexperience.myemail',\n 'djexperience.product',\n 'djexperience.selling',\n 'djexperience.service',\n]\n\n\nMIDDLEWARE_CLASSES = [\n 'django.middleware.security.SecurityMiddleware',\n 'django.contrib.sessions.middleware.SessionMiddleware',\n 'django.middleware.common.CommonMiddleware',\n 'django.middleware.csrf.CsrfViewMiddleware',\n 'django.contrib.auth.middleware.AuthenticationMiddleware',\n 'django.contrib.auth.middleware.SessionAuthenticationMiddleware',\n 'django.contrib.messages.middleware.MessageMiddleware',\n 'django.middleware.clickjacking.XFrameOptionsMiddleware',\n]\n\nROOT_URLCONF = 'djexperience.urls'\n\nTEMPLATES = [\n {\n 'BACKEND': 'django.template.backends.django.DjangoTemplates',\n 'DIRS': [],\n 'APP_DIRS': True,\n 'OPTIONS': {\n 'context_processors': [\n 'django.template.context_processors.debug',\n 'django.template.context_processors.request',\n 'django.contrib.auth.context_processors.auth',\n 'django.contrib.messages.context_processors.messages',\n ],\n },\n },\n]\n\nWSGI_APPLICATION = 'djexperience.wsgi.application'\n\n\n# Database\n# https://docs.djangoproject.com/en/1.9/ref/settings/#databases\n\ndefault_dburl = 'sqlite:///' + os.path.join(BASE_DIR, 'db.sqlite3')\nDATABASES = {\n 'default': config('DATABASE_URL', default=default_dburl, cast=dburl),\n}\n\n# Password validation\n# https://docs.djangoproject.com/en/1.9/ref/settings/#auth-password-validators\n\nAUTH_PASSWORD_VALIDATORS = [\n {\n 'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator',\n },\n {\n 'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator',\n },\n {\n 'NAME': 'django.contrib.auth.password_validation.CommonPasswordValidator',\n },\n {\n 'NAME': 'django.contrib.auth.password_validation.NumericPasswordValidator',\n },\n]\n\nEMAIL_HOST = 'smtp.gmail.com'\nEMAIL_PORT = 587\nEMAIL_HOST_USER = config('EMAIL_HOST_USER')\nEMAIL_HOST_PASSWORD = config('EMAIL_HOST_PASSWORD')\nEMAIL_USE_TLS = True\nDEFAULT_FROM_EMAIL = config('DEFAULT_FROM_EMAIL')\n\n\n# Internationalization\n# https://docs.djangoproject.com/en/1.9/topics/i18n/\n\nLANGUAGE_CODE = 'pt-br'\n\nTIME_ZONE = 'America/Sao_Paulo'\n\nUSE_I18N = True\n\nUSE_L10N = True\n\nUSE_TZ = True\n\nUSE_THOUSAND_SEPARATOR = True\n\nDECIMAL_SEPARATOR = ','\n\n\n# Static files (CSS, JavaScript, Images)\n# https://docs.djangoproject.com/en/1.9/howto/static-files/\n\nSTATIC_URL = '/static/'\nSTATIC_ROOT = os.path.join(BASE_DIR, 'staticfiles')\n\nLOGIN_URL = '/admin/login/'\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-8715243961084812000,"string":"-8,715,243,961,084,812,000"},"line_mean":{"kind":"number","value":25.6879432624,"string":"25.687943"},"line_max":{"kind":"number","value":91,"string":"91"},"alpha_frac":{"kind":"number","value":0.6877491363,"string":"0.687749"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.520112254443405,"string":"3.520112"},"config_test":{"kind":"bool","value":true,"string":"true"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44986,"cells":{"repo_name":{"kind":"string","value":"shoyer/xray"},"path":{"kind":"string","value":"xarray/backends/locks.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"5397"},"content":{"kind":"string","value":"import multiprocessing\nimport threading\nimport weakref\nfrom typing import Any, MutableMapping\n\ntry:\n from dask.utils import SerializableLock\nexcept ImportError:\n # no need to worry about serializing the lock\n SerializableLock = threading.Lock\n\ntry:\n from dask.distributed import Lock as DistributedLock\nexcept ImportError:\n DistributedLock = None\n\n\n# Locks used by multiple backends.\n# Neither HDF5 nor the netCDF-C library are thread-safe.\nHDF5_LOCK = SerializableLock()\nNETCDFC_LOCK = SerializableLock()\n\n\n_FILE_LOCKS = weakref.WeakValueDictionary() # type: MutableMapping[Any, threading.Lock] # noqa\n\n\ndef _get_threaded_lock(key):\n try:\n lock = _FILE_LOCKS[key]\n except KeyError:\n lock = _FILE_LOCKS[key] = threading.Lock()\n return lock\n\n\ndef _get_multiprocessing_lock(key):\n # TODO: make use of the key -- maybe use locket.py?\n # https://github.com/mwilliamson/locket.py\n del key # unused\n return multiprocessing.Lock()\n\n\n_LOCK_MAKERS = {\n None: _get_threaded_lock,\n 'threaded': _get_threaded_lock,\n 'multiprocessing': _get_multiprocessing_lock,\n 'distributed': DistributedLock,\n}\n\n\ndef _get_lock_maker(scheduler=None):\n \"\"\"Returns an appropriate function for creating resource locks.\n\n Parameters\n ----------\n scheduler : str or None\n Dask scheduler being used.\n\n See Also\n --------\n dask.utils.get_scheduler_lock\n \"\"\"\n return _LOCK_MAKERS[scheduler]\n\n\ndef _get_scheduler(get=None, collection=None):\n \"\"\"Determine the dask scheduler that is being used.\n\n None is returned if no dask scheduler is active.\n\n See also\n --------\n dask.base.get_scheduler\n \"\"\"\n try:\n # dask 0.18.1 and later\n from dask.base import get_scheduler\n actual_get = get_scheduler(get, collection)\n except ImportError:\n try:\n from dask.utils import effective_get\n actual_get = effective_get(get, collection)\n except ImportError:\n return None\n\n try:\n from dask.distributed import Client\n if isinstance(actual_get.__self__, Client):\n return 'distributed'\n except (ImportError, AttributeError):\n try:\n import dask.multiprocessing\n if actual_get == dask.multiprocessing.get:\n return 'multiprocessing'\n else:\n return 'threaded'\n except ImportError:\n return 'threaded'\n\n\ndef get_write_lock(key):\n \"\"\"Get a scheduler appropriate lock for writing to the given resource.\n\n Parameters\n ----------\n key : str\n Name of the resource for which to acquire a lock. Typically a filename.\n\n Returns\n -------\n Lock object that can be used like a threading.Lock object.\n \"\"\"\n scheduler = _get_scheduler()\n lock_maker = _get_lock_maker(scheduler)\n return lock_maker(key)\n\n\ndef acquire(lock, blocking=True):\n \"\"\"Acquire a lock, possibly in a non-blocking fashion.\n\n Includes backwards compatibility hacks for old versions of Python, dask\n and dask-distributed.\n \"\"\"\n if blocking:\n # no arguments needed\n return lock.acquire()\n elif DistributedLock is not None and isinstance(lock, DistributedLock):\n # distributed.Lock doesn't support the blocking argument yet:\n # https://github.com/dask/distributed/pull/2412\n return lock.acquire(timeout=0)\n else:\n # \"blocking\" keyword argument not supported for:\n # - threading.Lock on Python 2.\n # - dask.SerializableLock with dask v1.0.0 or earlier.\n # - multiprocessing.Lock calls the argument \"block\" instead.\n return lock.acquire(blocking)\n\n\nclass CombinedLock:\n \"\"\"A combination of multiple locks.\n\n Like a locked door, a CombinedLock is locked if any of its constituent\n locks are locked.\n \"\"\"\n\n def __init__(self, locks):\n self.locks = tuple(set(locks)) # remove duplicates\n\n def acquire(self, blocking=True):\n return all(acquire(lock, blocking=blocking) for lock in self.locks)\n\n def release(self):\n for lock in self.locks:\n lock.release()\n\n def __enter__(self):\n for lock in self.locks:\n lock.__enter__()\n\n def __exit__(self, *args):\n for lock in self.locks:\n lock.__exit__(*args)\n\n def locked(self):\n return any(lock.locked for lock in self.locks)\n\n def __repr__(self):\n return \"CombinedLock(%r)\" % list(self.locks)\n\n\nclass DummyLock:\n \"\"\"DummyLock provides the lock API without any actual locking.\"\"\"\n\n def acquire(self, blocking=True):\n pass\n\n def release(self):\n pass\n\n def __enter__(self):\n pass\n\n def __exit__(self, *args):\n pass\n\n def locked(self):\n return False\n\n\ndef combine_locks(locks):\n \"\"\"Combine a sequence of locks into a single lock.\"\"\"\n all_locks = []\n for lock in locks:\n if isinstance(lock, CombinedLock):\n all_locks.extend(lock.locks)\n elif lock is not None:\n all_locks.append(lock)\n\n num_locks = len(all_locks)\n if num_locks > 1:\n return CombinedLock(all_locks)\n elif num_locks == 1:\n return all_locks[0]\n else:\n return DummyLock()\n\n\ndef ensure_lock(lock):\n \"\"\"Ensure that the given object is a lock.\"\"\"\n if lock is None or lock is False:\n return DummyLock()\n return lock\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":-7480206169277232000,"string":"-7,480,206,169,277,232,000"},"line_mean":{"kind":"number","value":24.5781990521,"string":"24.578199"},"line_max":{"kind":"number","value":96,"string":"96"},"alpha_frac":{"kind":"number","value":0.6312766352,"string":"0.631277"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.1198473282442745,"string":"4.119847"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44987,"cells":{"repo_name":{"kind":"string","value":"brahle/eval2"},"path":{"kind":"string","value":"scripts/haski/actions/reviewaction.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1578"},"content":{"kind":"string","value":"#!/usr/bin/env python3.2\n# Copyright 2011 Bruno Rahle\n#\n# This file is part of Evaluator.\n#\n# Evaluator is free software: you can redistribute it and/or modify\n# it under the terms of the GNU Affero General Public License as\n# published by the Free Software Foundation, either version 3 of the\n# License, or (at your option) any later version.\n#\n# Evaluator is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU Affero General Public License for more details.\n#\n# You should have received a copy of the GNU Affero General Public\n# License along with Evaluator. If not, see\n# .\n\nfrom actions.baseaction import BaseHaskiAction\n\nimport argparse\n\nclass ReviewAction(BaseHaskiAction):\n \"\"\"This class is the class that does linting work.\n \"\"\"\n RB_ID_STR = 'reviewboard id'\n\n def __call__(self, params):\n \"\"\"Fetches the desired revision and then sends it to reviewboard.\n \"\"\"\n commit = self.get_commit(params)\n if not params.skip_lint:\n commit.lint(params)\n rb_id = commit.review()\n if params.revision != 'HEAD':\n if self.RB_ID_STR not in commit.message.fields:\n print('[WARNING] Please edit the message to incorporate',\n '`ReviewBoardID` field.')\n else:\n commit.message.set_field(self.RB_ID_STR, rb_id)\n commit.amend()\n\ndef main():\n pass\n\nif __name__ == '__main__':\n main()\n\n"},"license":{"kind":"string","value":"agpl-3.0"},"hash":{"kind":"number","value":-8740087895962332000,"string":"-8,740,087,895,962,332,000"},"line_mean":{"kind":"number","value":31.2040816327,"string":"31.204082"},"line_max":{"kind":"number","value":73,"string":"73"},"alpha_frac":{"kind":"number","value":0.6653992395,"string":"0.665399"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.905940594059406,"string":"3.905941"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44988,"cells":{"repo_name":{"kind":"string","value":"pelodelfuego/word2vec-toolbox"},"path":{"kind":"string","value":"toolbox/mlLib/conceptPairFeature.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"4358"},"content":{"kind":"string","value":"#!/usr/bin/env python\n# -*- coding: utf-8 -*-\n\nimport __init__\n\nimport numpy as np\nfrom scipy.weave import inline\n\nfrom sklearn.ensemble import RandomForestClassifier\n\nimport cpLib.concept as cp\nimport utils.skUtils as sku\n\n\n# PROJECTION\ndef projCosSim(c1, c2):\n v1 = c1.vect\n v2 = c2.vect\n dimCount = len(v1)\n\n arr = np.zeros(dimCount, 'f')\n\n code = \"\"\"\n for(int i = 0; i < dimCount; i++) {\n float norm_v1 = 0.0;\n float norm_v2 = 0.0;\n float dot_pdt = 0.0;\n\n for(int j = 0; j < dimCount; j++) {\n if(i != j) {\n dot_pdt += v1[j] * v2[j];\n norm_v1 += v1[j] * v1[j];\n norm_v2 += v2[j] * v2[j];\n }\n }\n\n norm_v1 = sqrtf(norm_v1);\n norm_v2 = sqrtf(norm_v2);\n\n arr[i] = dot_pdt / norm_v1 / norm_v2;\n }\n\n return_val = 1;\n \"\"\"\n inline(code, ['v1', 'v2', 'dimCount', 'arr'], headers = [''], compiler = 'gcc')\n return arr\n\ndef projEuclDist(c1, c2):\n v1 = c1.vect\n v2 = c2.vect\n dimCount = len(v1)\n\n arr = np.zeros(dimCount, 'f')\n\n code = \"\"\"\n for(int i = 0; i < dimCount; i++) {\n float dist = 0.0;\n\n for(int j = 0; j < dimCount; j++) {\n if(i != j) {\n dist += pow(v1[j] - v2[j], 2);\n }\n }\n\n arr[i] = sqrt(dist);\n }\n\n return_val = 1;\n \"\"\"\n inline(code, ['v1', 'v2', 'dimCount', 'arr'], headers = [''], compiler = 'gcc')\n return arr\n\ndef projManaDist(c1, c2):\n v1 = c1.vect\n v2 = c2.vect\n dimCount = len(v1)\n\n arr = np.zeros(dimCount, 'f')\n\n code = \"\"\"\n for(int i = 0; i < dimCount; i++) {\n float dist = 0.0;\n\n for(int j = 0; j < dimCount; j++) {\n if(i != j) {\n dist += fabs(v1[i] - v2[i]);\n }\n }\n\n arr[i] = dist;\n }\n\n return_val = 1;\n \"\"\"\n inline(code, ['v1', 'v2', 'dimCount', 'arr'], headers = [''], compiler = 'gcc')\n return arr\n\n\n# COMMUTATIVE FEATURE\ndef subCarth(conceptPair):\n return conceptPair[2].vect - conceptPair[0].vect\n\ndef subPolar(conceptPair):\n return conceptPair[2].polarVect() - conceptPair[0].polarVect()\n\ndef subAngular(conceptPair):\n return conceptPair[2].angularVect() - conceptPair[0].angularVect()\n\ndef concatCarth(conceptPair):\n return np.concatenate((conceptPair[0].vect, conceptPair[2].vect))\n\ndef concatPolar(conceptPair):\n return np.concatenate((conceptPair[0].polarVect(), conceptPair[2].polarVect()))\n\ndef concatAngular(conceptPair):\n return np.concatenate((conceptPair[0].angularVect(), conceptPair[2].angularVect()))\n\n\n# NON COMMUATIVE FEATURE\n# PROJECTION SIMILARITY\ndef pCosSim(conceptPair):\n return projCosSim(conceptPair[0], conceptPair[2])\n\ndef pEuclDist(conceptPair):\n return projEuclDist(conceptPair[0], conceptPair[2])\n\ndef pManaDist(conceptPair):\n return projManaDist(conceptPair[0], conceptPair[2])\n\n# PROJECTION DISSIMILARITY\ndef _projectionDissimarilty(projectionMetric, globalMetric, conceptPair):\n projectedFeature = projectionMetric(conceptPair[0], conceptPair[2])\n globalFeature = globalMetric(conceptPair[0], conceptPair[2])\n return np.array([(globalFeature - v) for v in projectedFeature])\n\ndef pdCosSim(conceptPair):\n return _projectionDissimarilty(projCosSim, cp.cosSim, conceptPair)\n\ndef pdEuclDist(conceptPair):\n return _projectionDissimarilty(projEuclDist, cp.euclDist, conceptPair)\n\ndef pdManaDist(conceptPair):\n return _projectionDissimarilty(projManaDist, cp.manaDist, conceptPair)\n\n\n# CLF\nclass ConceptPairClf(object):\n def __init__(self, clf, featureExtractionFct):\n self.clf = clf\n self.featureExtractionFct = featureExtractionFct\n\n def fit(self, X, y):\n self.clf.fit([self.featureExtractionFct(x) for x in X], y)\n self.classes_ = self.clf.classes_\n\n def predict(self, X):\n return self.clf.predict([self.featureExtractionFct(x) for x in X])\n\n def predict_proba(self, X):\n return self.clf.predict_proba([self.featureExtractionFct(x) for x in X])\n"},"license":{"kind":"string","value":"gpl-3.0"},"hash":{"kind":"number","value":-1004693826859406600,"string":"-1,004,693,826,859,406,600"},"line_mean":{"kind":"number","value":26.2375,"string":"26.2375"},"line_max":{"kind":"number","value":91,"string":"91"},"alpha_frac":{"kind":"number","value":0.5621844883,"string":"0.562184"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.228148148148148,"string":"3.228148"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44989,"cells":{"repo_name":{"kind":"string","value":"skodapetr/lbvs-environment"},"path":{"kind":"string","value":"scripts/libs/core.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1664"},"content":{"kind":"string","value":"#!/usr/bin/env python\n# -*- coding: utf-8 -*-\n\n\nimport json\nimport csv\nimport os\nimport logging\nimport gzip\n\n__license__ = \"X11\"\n\n\ndef init_logging():\n logging.basicConfig(\n level=logging.DEBUG,\n format='%(asctime)s [%(levelname)s] - %(message)s',\n datefmt='%H:%M:%S')\n\n\ndef create_directory(path):\n if not os.path.exists(path) and not path == \"\":\n os.makedirs(path)\n\n\ndef create_parent_directory(path):\n parent_directory = os.path.dirname(path)\n if not os.path.exists(parent_directory) and not parent_directory == \"\":\n os.makedirs(parent_directory)\n\n\ndef read_json(path):\n if path.endswith(\".gz\"):\n with gzip.open(path, \"rt\") as stream:\n return json.load(stream)\n else:\n with open(path, \"r\") as stream:\n return json.load(stream)\n\n\ndef write_json(path, object_to_write):\n create_parent_directory(path)\n if path.endswith(\".gz\"):\n with gzip.open(path, \"wt\") as stream:\n json.dump(object_to_write, stream, indent=2)\n else:\n with open(path, \"w\") as stream:\n json.dump(object_to_write, stream, indent=2)\n\n\ndef read_csv_as_object(path):\n \"\"\"\n Read CSV lines as objects.\n \"\"\"\n results = []\n with open(path) as stream:\n reader = csv.reader(stream, delimiter=\",\", quotechar='\"')\n header = next(reader)\n for row in reader:\n new_object = {}\n for index in range(0, len(row)):\n new_object[header[index]] = row[index]\n results.append(new_object)\n return results\n\n\nif __name__ == \"__main__\":\n raise Exception(\"This module can be used only as a library!\")\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":453216932470209800,"string":"453,216,932,470,209,800"},"line_mean":{"kind":"number","value":23.4705882353,"string":"23.470588"},"line_max":{"kind":"number","value":75,"string":"75"},"alpha_frac":{"kind":"number","value":0.5901442308,"string":"0.590144"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.570815450643777,"string":"3.570815"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44990,"cells":{"repo_name":{"kind":"string","value":"kaniblu/hangul-utils"},"path":{"kind":"string","value":"hangul_utils/unicode.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"8775"},"content":{"kind":"string","value":"__all__ = [\"split_syllable_char\", \"split_syllables\",\n \"join_jamos\", \"join_jamos_char\",\n \"CHAR_INITIALS\", \"CHAR_MEDIALS\", \"CHAR_FINALS\"]\n\nimport itertools\n\nINITIAL = 0x001\nMEDIAL = 0x010\nFINAL = 0x100\nCHAR_LISTS = {\n INITIAL: list(map(chr, [\n 0x3131, 0x3132, 0x3134, 0x3137, 0x3138, 0x3139,\n 0x3141, 0x3142, 0x3143, 0x3145, 0x3146, 0x3147,\n 0x3148, 0x3149, 0x314a, 0x314b, 0x314c, 0x314d,\n 0x314e\n ])),\n MEDIAL: list(map(chr, [\n 0x314f, 0x3150, 0x3151, 0x3152, 0x3153, 0x3154,\n 0x3155, 0x3156, 0x3157, 0x3158, 0x3159, 0x315a,\n 0x315b, 0x315c, 0x315d, 0x315e, 0x315f, 0x3160,\n 0x3161, 0x3162, 0x3163\n ])),\n FINAL: list(map(chr, [\n 0x3131, 0x3132, 0x3133, 0x3134, 0x3135, 0x3136,\n 0x3137, 0x3139, 0x313a, 0x313b, 0x313c, 0x313d,\n 0x313e, 0x313f, 0x3140, 0x3141, 0x3142, 0x3144,\n 0x3145, 0x3146, 0x3147, 0x3148, 0x314a, 0x314b,\n 0x314c, 0x314d, 0x314e\n ]))\n}\nCHAR_INITIALS = CHAR_LISTS[INITIAL]\nCHAR_MEDIALS = CHAR_LISTS[MEDIAL]\nCHAR_FINALS = CHAR_LISTS[FINAL]\nCHAR_SETS = {k: set(v) for k, v in CHAR_LISTS.items()}\nCHARSET = set(itertools.chain(*CHAR_SETS.values()))\nCHAR_INDICES = {k: {c: i for i, c in enumerate(v)}\n for k, v in CHAR_LISTS.items()}\n\n\ndef is_hangul_syllable(c):\n return 0xac00 <= ord(c) <= 0xd7a3 # Hangul Syllables\n\n\ndef is_hangul_jamo(c):\n return 0x1100 <= ord(c) <= 0x11ff # Hangul Jamo\n\n\ndef is_hangul_compat_jamo(c):\n return 0x3130 <= ord(c) <= 0x318f # Hangul Compatibility Jamo\n\n\ndef is_hangul_jamo_exta(c):\n return 0xa960 <= ord(c) <= 0xa97f # Hangul Jamo Extended-A\n\n\ndef is_hangul_jamo_extb(c):\n return 0xd7b0 <= ord(c) <= 0xd7ff # Hangul Jamo Extended-B\n\n\ndef is_hangul(c):\n return (is_hangul_syllable(c) or\n is_hangul_jamo(c) or\n is_hangul_compat_jamo(c) or\n is_hangul_jamo_exta(c) or\n is_hangul_jamo_extb(c))\n\n\ndef is_supported_hangul(c):\n return is_hangul_syllable(c) or is_hangul_compat_jamo(c)\n\n\ndef check_hangul(c, jamo_only=False):\n if not ((jamo_only or is_hangul_compat_jamo(c)) or is_supported_hangul(c)):\n raise ValueError(f\"'{c}' is not a supported hangul character. \"\n f\"'Hangul Syllables' (0xac00 ~ 0xd7a3) and \"\n f\"'Hangul Compatibility Jamos' (0x3130 ~ 0x318f) are \"\n f\"supported at the moment.\")\n\n\ndef get_jamo_type(c):\n check_hangul(c)\n assert is_hangul_compat_jamo(c), f\"not a jamo: {ord(c):x}\"\n return sum(t for t, s in CHAR_SETS.items() if c in s)\n\n\ndef split_syllable_char(c):\n \"\"\"\n Splits a given korean syllable into its components. Each component is\n represented by Unicode in 'Hangul Compatibility Jamo' range.\n\n Arguments:\n c: A Korean character.\n\n Returns:\n A triple (initial, medial, final) of Hangul Compatibility Jamos.\n If no jamo corresponds to a position, `None` is returned there.\n\n Example:\n >>> split_syllable_char(\"안\")\n (\"ㅇ\", \"ㅏ\", \"ㄴ\")\n >>> split_syllable_char(\"고\")\n (\"ㄱ\", \"ㅗ\", None)\n >>> split_syllable_char(\"ㅗ\")\n (None, \"ㅗ\", None)\n >>> split_syllable_char(\"ㅇ\")\n (\"ㅇ\", None, None)\n \"\"\"\n check_hangul(c)\n if len(c) != 1:\n raise ValueError(\"Input string must have exactly one character.\")\n\n init, med, final = None, None, None\n if is_hangul_syllable(c):\n offset = ord(c) - 0xac00\n x = (offset - offset % 28) // 28\n init, med, final = x // 21, x % 21, offset % 28\n if not final:\n final = None\n else:\n final -= 1\n else:\n pos = get_jamo_type(c)\n if pos & INITIAL == INITIAL:\n pos = INITIAL\n elif pos & MEDIAL == MEDIAL:\n pos = MEDIAL\n elif pos & FINAL == FINAL:\n pos = FINAL\n idx = CHAR_INDICES[pos][c]\n if pos == INITIAL:\n init = idx\n elif pos == MEDIAL:\n med = idx\n else:\n final = idx\n return tuple(CHAR_LISTS[pos][idx] if idx is not None else None\n for pos, idx in\n zip([INITIAL, MEDIAL, FINAL], [init, med, final]))\n\n\ndef split_syllables(s, ignore_err=True, pad=None):\n \"\"\"\n Performs syllable-split on a string.\n\n Arguments:\n s (str): A string (possibly mixed with non-Hangul characters).\n ignore_err (bool): If set False, it ensures that all characters in\n the string are Hangul-splittable and throws a ValueError otherwise.\n (default: True)\n pad (str): Pad empty jamo positions (initial, medial, or final) with\n `pad` character. This is useful for cases where fixed-length\n strings are needed. (default: None)\n\n Returns:\n Hangul-split string\n\n Example:\n >>> split_syllables(\"안녕하세요\")\n \"ㅇㅏㄴㄴㅕㅇㅎㅏㅅㅔㅇㅛ\"\n >>> split_syllables(\"안녕하세요~~\", ignore_err=False)\n ValueError: encountered an unsupported character: ~ (0x7e)\n >>> split_syllables(\"안녕하세요ㅛ\", pad=\"x\")\n 'ㅇㅏㄴㄴㅕㅇㅎㅏxㅅㅔxㅇㅛxxㅛx'\n \"\"\"\n\n def try_split(c):\n try:\n return split_syllable_char(c)\n except ValueError:\n if ignore_err:\n return (c,)\n raise ValueError(f\"encountered an unsupported character: \"\n f\"{c} (0x{ord(c):x})\")\n\n s = map(try_split, s)\n if pad is not None:\n tuples = map(lambda x: tuple(pad if y is None else y for y in x), s)\n else:\n tuples = map(lambda x: filter(None, x), s)\n return \"\".join(itertools.chain(*tuples))\n\n\ndef join_jamos_char(init, med, final=None):\n \"\"\"\n Combines jamos into a single syllable.\n\n Arguments:\n init (str): Initial jao.\n med (str): Medial jamo.\n final (str): Final jamo. If not supplied, the final syllable is made\n without the final. (default: None)\n\n Returns:\n A Korean syllable.\n \"\"\"\n chars = (init, med, final)\n for c in filter(None, chars):\n check_hangul(c, jamo_only=True)\n\n idx = tuple(CHAR_INDICES[pos][c] if c is not None else c\n for pos, c in zip((INITIAL, MEDIAL, FINAL), chars))\n init_idx, med_idx, final_idx = idx\n # final index must be shifted once as\n # final index with 0 points to syllables without final\n final_idx = 0 if final_idx is None else final_idx + 1\n return chr(0xac00 + 28 * 21 * init_idx + 28 * med_idx + final_idx)\n\n\ndef join_jamos(s, ignore_err=True):\n \"\"\"\n Combines a sequence of jamos to produce a sequence of syllables.\n\n Arguments:\n s (str): A string (possible mixed with non-jamo characters).\n ignore_err (bool): If set False, it will ensure that all characters\n will be consumed for the making of syllables. It will throw a\n ValueError when it fails to do so. (default: True)\n\n Returns:\n A string\n\n Example:\n >>> join_jamos(\"ㅇㅏㄴㄴㅕㅇㅎㅏㅅㅔㅇㅛ\")\n \"안녕하세요\"\n >>> join_jamos(\"ㅇㅏㄴㄴㄴㅕㅇㅎㅏㅅㅔㅇㅛ\")\n \"안ㄴ녕하세요\"\n >>> join_jamos()\n \"\"\"\n last_t = 0\n queue = []\n new_string = \"\"\n\n def flush(n=0):\n new_queue = []\n while len(queue) > n:\n new_queue.append(queue.pop())\n if len(new_queue) == 1:\n if not ignore_err:\n raise ValueError(f\"invalid jamo character: {new_queue[0]}\")\n result = new_queue[0]\n elif len(new_queue) >= 2:\n try:\n result = join_jamos_char(*new_queue)\n except (ValueError, KeyError):\n # Invalid jamo combination\n if not ignore_err:\n raise ValueError(f\"invalid jamo characters: {new_queue}\")\n result = \"\".join(new_queue)\n else:\n result = None\n return result\n\n for c in s:\n if c not in CHARSET:\n if queue:\n new_c = flush() + c\n else:\n new_c = c\n last_t = 0\n else:\n t = get_jamo_type(c)\n new_c = None\n if t & FINAL == FINAL:\n if not (last_t == MEDIAL):\n new_c = flush()\n elif t == INITIAL:\n new_c = flush()\n elif t == MEDIAL:\n if last_t & INITIAL == INITIAL:\n new_c = flush(1)\n else:\n new_c = flush()\n last_t = t\n queue.insert(0, c)\n if new_c:\n new_string += new_c\n if queue:\n new_string += flush()\n return new_string\n"},"license":{"kind":"string","value":"gpl-3.0"},"hash":{"kind":"number","value":3778202042101361700,"string":"3,778,202,042,101,361,700"},"line_mean":{"kind":"number","value":29.8207885305,"string":"29.820789"},"line_max":{"kind":"number","value":79,"string":"79"},"alpha_frac":{"kind":"number","value":0.5512268868,"string":"0.551227"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":2.954982817869416,"string":"2.954983"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44991,"cells":{"repo_name":{"kind":"string","value":"drnextgis/QGIS"},"path":{"kind":"string","value":"python/plugins/processing/core/parameters.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"55397"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\n\"\"\"\n***************************************************************************\n Parameters.py\n ---------------------\n Date : August 2012\n Copyright : (C) 2012 by Victor Olaya\n Email : volayaf at gmail dot com\n***************************************************************************\n* *\n* This program is free software; you can redistribute it and/or modify *\n* it under the terms of the GNU General Public License as published by *\n* the Free Software Foundation; either version 2 of the License, or *\n* (at your option) any later version. *\n* *\n***************************************************************************\n\"\"\"\nfrom builtins import str\nfrom builtins import range\nfrom builtins import object\n\n__author__ = 'Victor Olaya'\n__date__ = 'August 2012'\n__copyright__ = '(C) 2012, Victor Olaya'\n\n# This will get replaced with a git SHA1 when you do a git archive\n\n__revision__ = '$Format:%H$'\n\nimport sys\nimport os\nimport math\nfrom inspect import isclass\nfrom copy import deepcopy\nimport numbers\n\nfrom qgis.utils import iface\nfrom qgis.PyQt.QtCore import QCoreApplication\nfrom qgis.core import (QgsRasterLayer, QgsVectorLayer, QgsMapLayer, QgsCoordinateReferenceSystem,\n QgsExpressionContext, QgsExpressionContextUtils, QgsExpression, QgsExpressionContextScope)\n\nfrom processing.tools.vector import resolveFieldIndex, features\nfrom processing.tools import dataobjects\nfrom processing.core.outputs import OutputNumber, OutputRaster, OutputVector\nfrom processing.tools.dataobjects import getObject\n\n\ndef parseBool(s):\n if s is None or s == str(None).lower():\n return None\n return str(s).lower() == str(True).lower()\n\n\ndef _splitParameterOptions(line):\n tokens = line.split('=', 1)\n if tokens[1].lower().strip().startswith('optional'):\n isOptional = True\n definition = tokens[1].strip()[len('optional') + 1:]\n else:\n isOptional = False\n definition = tokens[1]\n return isOptional, tokens[0], definition\n\n\ndef _createDescriptiveName(s):\n return s.replace('_', ' ')\n\n\ndef _expressionContext():\n context = QgsExpressionContext()\n context.appendScope(QgsExpressionContextUtils.globalScope())\n context.appendScope(QgsExpressionContextUtils.projectScope())\n\n if iface.mapCanvas():\n context.appendScope(QgsExpressionContextUtils.mapSettingsScope(iface.mapCanvas().mapSettings()))\n\n processingScope = QgsExpressionContextScope()\n\n extent = iface.mapCanvas().fullExtent()\n processingScope.setVariable('fullextent_minx', extent.xMinimum())\n processingScope.setVariable('fullextent_miny', extent.yMinimum())\n processingScope.setVariable('fullextent_maxx', extent.xMaximum())\n processingScope.setVariable('fullextent_maxy', extent.yMaximum())\n context.appendScope(processingScope)\n return context\n\n\ndef _resolveLayers(value):\n layers = dataobjects.getAllLayers()\n if value:\n inputlayers = value.split(';')\n for i, inputlayer in enumerate(inputlayers):\n for layer in layers:\n if layer.name() == inputlayer:\n inputlayers[i] = layer.source()\n break\n return \";\".join(inputlayers)\n\n\nclass Parameter(object):\n\n \"\"\"\n Base class for all parameters that a geoalgorithm might\n take as input.\n \"\"\"\n\n default_metadata = {}\n\n def __init__(self, name='', description='', default=None, optional=False,\n metadata={}):\n self.name = name\n self.description = description\n self.default = default\n self.value = default\n\n self.isAdvanced = False\n\n # A hidden parameter can be used to set a hard-coded value.\n # It can be used as any other parameter, but it will not be\n # shown to the user\n self.hidden = False\n\n self.optional = parseBool(optional)\n\n # TODO: make deep copy and deep update\n self.metadata = deepcopy(self.default_metadata)\n self.metadata.update(deepcopy(metadata))\n\n def setValue(self, obj):\n \"\"\"\n Sets the value of the parameter.\n\n Returns true if the value passed is correct for the type\n of parameter.\n \"\"\"\n if obj is None:\n if not self.optional:\n return False\n self.value = None\n return True\n\n self.value = str(obj)\n return True\n\n def setDefaultValue(self):\n \"\"\"\n Sets the value of the parameter to the default one\n\n Returns true if the default value is correct for the type\n of parameter.\n \"\"\"\n return self.setValue(self.default)\n\n def __str__(self):\n return u'{} <{}>'.format(self.name, self.__class__.__name__)\n\n def getValueAsCommandLineParameter(self):\n \"\"\"\n Returns the value of this parameter as it should have been\n entered in the console if calling an algorithm using the\n Processing.runalg() method.\n \"\"\"\n return str(self.value)\n\n def typeName(self):\n return self.__class__.__name__.replace('Parameter', '').lower()\n\n def todict(self):\n o = deepcopy(self.__dict__)\n del o['metadata']\n return o\n\n def tr(self, string, context=''):\n if context == '':\n context = 'Parameter'\n return QCoreApplication.translate(context, string)\n\n def wrapper(self, dialog, row=0, col=0):\n wrapper = self.metadata.get('widget_wrapper', None)\n # wrapper metadata should be a class path\n if isinstance(wrapper, str):\n tokens = wrapper.split('.')\n mod = __import__('.'.join(tokens[:-1]), fromlist=[tokens[-1]])\n wrapper = getattr(mod, tokens[-1])\n # or directly a class object\n if isclass(wrapper):\n wrapper = wrapper(self, dialog, row, col)\n # or a wrapper instance\n return wrapper\n\n def evaluate(self, alg):\n pass\n\n def evaluateForModeler(self, value, model):\n return value\n\n\nclass ParameterBoolean(Parameter):\n\n default_metadata = {\n 'widget_wrapper': 'processing.gui.wrappers.BooleanWidgetWrapper'\n }\n\n def __init__(self, name='', description='', default=None, optional=False, metadata={}):\n Parameter.__init__(self, name, description, parseBool(default), optional, metadata)\n\n def setValue(self, value):\n if value is None:\n if not self.optional:\n return False\n self.value = None\n return True\n\n if isinstance(value, str):\n self.value = str(value).lower() == str(True).lower()\n else:\n self.value = bool(value)\n return True\n\n def getAsScriptCode(self):\n param_type = ''\n if self.optional:\n param_type += 'optional '\n param_type += 'boolean '\n return '##' + self.name + '=' + param_type + str(self.default)\n\n @classmethod\n def fromScriptCode(self, line):\n isOptional, name, definition = _splitParameterOptions(line)\n if definition.startswith(\"boolean\"):\n descName = _createDescriptiveName(name)\n default = definition.strip()[len('boolean') + 1:]\n if default:\n param = ParameterBoolean(name, descName, default)\n else:\n param = ParameterBoolean(name, descName)\n param.optional = isOptional\n return param\n\n\nclass ParameterCrs(Parameter):\n\n default_metadata = {\n 'widget_wrapper': 'processing.gui.wrappers.CrsWidgetWrapper'\n }\n\n def __init__(self, name='', description='', default=None, optional=False, metadata={}):\n '''The value is a string that uniquely identifies the\n coordinate reference system. Typically it is the auth id of the CRS\n (if the authority is EPSG) or proj4 string of the CRS (in case\n of other authorities or user defined projections).'''\n Parameter.__init__(self, name, description, default, optional, metadata)\n\n def setValue(self, value):\n if not bool(value):\n if not self.optional:\n return False\n self.value = None\n return True\n\n if isinstance(value, QgsCoordinateReferenceSystem):\n self.value = value.authid()\n return True\n if isinstance(value, QgsMapLayer):\n self.value = value.crs().authid()\n return True\n try:\n layer = dataobjects.getObjectFromUri(value)\n if layer is not None:\n self.value = layer.crs().authid()\n return True\n except:\n pass\n\n # TODO: check it is a valid authid\n self.value = value\n return True\n\n def getValueAsCommandLineParameter(self):\n return '\"' + str(self.value) + '\"'\n\n def getAsScriptCode(self):\n param_type = ''\n if self.optional:\n param_type += 'optional '\n param_type += 'crs '\n return '##' + self.name + '=' + param_type + str(self.default)\n\n @classmethod\n def fromScriptCode(self, line):\n isOptional, name, definition = _splitParameterOptions(line)\n if definition.startswith(\"crs\"):\n descName = _createDescriptiveName(name)\n default = definition.strip()[len('crs') + 1:]\n if default:\n return ParameterCrs(name, descName, default, isOptional)\n else:\n return ParameterCrs(name, descName, None, isOptional)\n\n\nclass ParameterDataObject(Parameter):\n\n def getValueAsCommandLineParameter(self):\n if self.value is None:\n return str(None)\n else:\n s = dataobjects.normalizeLayerSource(str(self.value))\n s = '\"%s\"' % s\n return s\n\n def evaluate(self, alg):\n self.value = _resolveLayers(self.value)\n\n\nclass ParameterExtent(Parameter):\n\n default_metadata = {\n 'widget_wrapper': 'processing.gui.wrappers.ExtentWidgetWrapper'\n }\n\n USE_MIN_COVERING_EXTENT = 'USE_MIN_COVERING_EXTENT'\n\n def __init__(self, name='', description='', default=None, optional=True):\n Parameter.__init__(self, name, description, default, optional)\n # The value is a string in the form \"xmin, xmax, ymin, ymax\"\n\n def setValue(self, value):\n if not value:\n if not self.optional:\n return False\n self.value = None\n return True\n\n if isinstance(value, QgsMapLayer):\n rect = value.extent()\n self.value = '{},{},{},{}'.format(\n rect.xMinimum(), rect.xMaximum(), rect.yMinimum(), rect.yMaximum())\n return True\n\n try:\n layer = dataobjects.getObjectFromUri(value)\n if layer is not None:\n rect = layer.extent()\n self.value = '{},{},{},{}'.format(\n rect.xMinimum(), rect.xMaximum(), rect.yMinimum(), rect.yMaximum())\n return True\n except:\n pass\n\n tokens = str(value).split(',')\n if len(tokens) != 4:\n return False\n try:\n float(tokens[0])\n float(tokens[1])\n float(tokens[2])\n float(tokens[3])\n self.value = value\n return True\n except:\n return False\n\n def getValueAsCommandLineParameter(self):\n return '\"' + str(self.value) + '\"'\n\n def getAsScriptCode(self):\n param_type = ''\n if self.optional:\n param_type += 'optional '\n param_type += 'extent'\n return '##' + self.name + '=' + param_type\n\n @classmethod\n def fromScriptCode(self, line):\n isOptional, name, definition = _splitParameterOptions(line)\n if definition.startswith(\"extent\"):\n descName = _createDescriptiveName(name)\n default = definition.strip()[len('extent') + 1:] or None\n return ParameterExtent(name, descName, default, isOptional)\n\n def evaluate(self, alg):\n if self.optional and not bool(self.value):\n self.value = self.getMinCoveringExtent(alg)\n\n def getMinCoveringExtent(self, alg):\n first = True\n found = False\n for param in alg.parameters:\n if param.value:\n if isinstance(param, (ParameterRaster, ParameterVector)):\n if isinstance(param.value, (QgsRasterLayer,\n QgsVectorLayer)):\n layer = param.value\n else:\n layer = dataobjects.getObject(param.value)\n if layer:\n found = True\n self.addToRegion(layer, first)\n first = False\n elif isinstance(param, ParameterMultipleInput):\n layers = param.value.split(';')\n for layername in layers:\n layer = dataobjects.getObject(layername)\n if layer:\n found = True\n self.addToRegion(layer, first)\n first = False\n if found:\n return '{},{},{},{}'.format(\n self.xmin, self.xmax, self.ymin, self.ymax)\n else:\n return None\n\n def addToRegion(self, layer, first):\n if first:\n self.xmin = layer.extent().xMinimum()\n self.xmax = layer.extent().xMaximum()\n self.ymin = layer.extent().yMinimum()\n self.ymax = layer.extent().yMaximum()\n else:\n self.xmin = min(self.xmin, layer.extent().xMinimum())\n self.xmax = max(self.xmax, layer.extent().xMaximum())\n self.ymin = min(self.ymin, layer.extent().yMinimum())\n self.ymax = max(self.ymax, layer.extent().yMaximum())\n\n\nclass ParameterPoint(Parameter):\n\n default_metadata = {\n 'widget_wrapper': 'processing.gui.wrappers.PointWidgetWrapper'\n }\n\n def __init__(self, name='', description='', default=None, optional=False):\n Parameter.__init__(self, name, description, default, optional)\n # The value is a string in the form \"x, y\"\n\n def setValue(self, text):\n if text is None:\n if not self.optional:\n return False\n self.value = None\n return True\n\n tokens = str(text).split(',')\n if len(tokens) != 2:\n return False\n try:\n float(tokens[0])\n float(tokens[1])\n self.value = text\n return True\n except:\n return False\n\n def getValueAsCommandLineParameter(self):\n return '\"' + str(self.value) + '\"'\n\n def getAsScriptCode(self):\n param_type = ''\n if self.optional:\n param_type += 'optional '\n param_type += 'point'\n return '##' + self.name + '=' + param_type\n\n @classmethod\n def fromScriptCode(self, line):\n isOptional, name, definition = _splitParameterOptions(line)\n if definition.startswith(\"point\"):\n descName = _createDescriptiveName(name)\n default = definition.strip()[len('point') + 1:] or None\n return ParameterPoint(name, descName, default, isOptional)\n\n\nclass ParameterFile(Parameter):\n\n default_metadata = {\n 'widget_wrapper': 'processing.gui.wrappers.FileWidgetWrapper'\n }\n\n def __init__(self, name='', description='', isFolder=False, optional=True, ext=None):\n Parameter.__init__(self, name, description, None, parseBool(optional))\n self.ext = ext\n self.isFolder = parseBool(isFolder)\n\n def getValueAsCommandLineParameter(self):\n return '\"' + str(self.value) + '\"'\n\n def setValue(self, obj):\n if obj is None or obj.strip() == '':\n if not self.optional:\n return False\n self.value = None if obj is None else obj.strip()\n return True\n\n if self.ext is not None and obj != '' and not obj.endswith(self.ext):\n return False\n self.value = str(obj)\n return True\n\n def typeName(self):\n if self.isFolder:\n return 'directory'\n else:\n return 'file'\n\n def getAsScriptCode(self):\n param_type = ''\n if self.optional:\n param_type += 'optional '\n if self.isFolder:\n param_type += 'folder'\n else:\n param_type += 'file'\n return '##' + self.name + '=' + param_type\n\n @classmethod\n def fromScriptCode(self, line):\n isOptional, name, definition = _splitParameterOptions(line)\n if definition.startswith(\"file\") or definition.startswith(\"folder\"):\n descName = _createDescriptiveName(name)\n return ParameterFile(name, descName, definition.startswith(\"folder\"), isOptional)\n\n\nclass ParameterFixedTable(Parameter):\n\n def __init__(self, name='', description='', numRows=3,\n cols=['value'], fixedNumOfRows=False, optional=False):\n Parameter.__init__(self, name, description, None, optional)\n self.cols = cols\n if isinstance(cols, str):\n self.cols = self.cols.split(\";\")\n self.numRows = int(numRows)\n self.fixedNumOfRows = parseBool(fixedNumOfRows)\n\n def setValue(self, obj):\n if obj is None:\n if not self.optional:\n return False\n self.value = None\n return True\n\n # TODO: check that it contains a correct number of elements\n if isinstance(obj, str):\n self.value = obj\n else:\n self.value = ParameterFixedTable.tableToString(obj)\n return True\n\n def getValueAsCommandLineParameter(self):\n return '\"' + str(self.value) + '\"'\n\n @staticmethod\n def tableToString(table):\n tablestring = ''\n for i in range(len(table)):\n for j in range(len(table[0])):\n tablestring = tablestring + table[i][j] + ','\n tablestring = tablestring[:-1]\n return tablestring\n\n @classmethod\n def fromScriptCode(self, line):\n isOptional, name, definition = _splitParameterOptions(line)\n if definition.startswith(\"point\"):\n descName = _createDescriptiveName(name)\n default = definition.strip()[len('point') + 1:] or None\n return ParameterPoint(name, descName, default, isOptional)\n\n\nclass ParameterMultipleInput(ParameterDataObject):\n\n \"\"\"A parameter representing several data objects.\n\n Its value is a string with substrings separated by semicolons,\n each of which represents the data source location of each element.\n \"\"\"\n\n default_metadata = {\n 'widget_wrapper': 'processing.gui.wrappers.MultipleInputWidgetWrapper'\n }\n\n exported = None\n\n def __init__(self, name='', description='', datatype=-1, optional=False):\n ParameterDataObject.__init__(self, name, description, None, optional)\n self.datatype = int(float(datatype))\n self.exported = None\n self.minNumInputs = 0\n\n \"\"\" Set minimum required number of inputs for parameter\n\n By default minimal number of inputs is set to 1\n\n @type _minNumInputs: numeric type or None\n @param _minNumInputs: required minimum number of inputs for parameter. \\\n If user will pass None as parameter, we will use default minimal number of inputs (1)\n @return: result, if the minimum number of inputs were set.\n \"\"\"\n\n def setMinNumInputs(self, _minNumInputs):\n if _minNumInputs is None:\n self.minNumInputs = 0\n return True\n\n if _minNumInputs < 1 and not self.optional:\n # don't allow to set negative or null number of inputs if parameter isn't optional\n return False\n\n self.minNumInputs = int(_minNumInputs)\n return True\n\n \"\"\" Get minimum required number of inputs for parameter\n\n @return: minimum number of inputs required for this parameter\n @see: setMinNumInputs()\n \"\"\"\n\n def getMinNumInputs(self):\n return self.minNumInputs\n\n def setValue(self, obj):\n self.exported = None\n if obj is None:\n if not self.optional:\n return False\n self.value = None\n return True\n\n if isinstance(obj, list):\n if len(obj) == 0:\n if self.optional:\n self.value = None\n return True\n else:\n return False\n # prevent setting value if we didn't provide required minimal number of inputs\n elif len(obj) < self.minNumInputs:\n return False\n\n self.value = \";\".join([self.getAsString(lay) for lay in obj])\n return True\n else:\n self.value = str(obj)\n return True\n\n def getSafeExportedLayers(self):\n \"\"\"\n Returns not the value entered by the user, but a string with\n semicolon-separated filenames which contains the data of the\n selected layers, but saved in a standard format (currently\n shapefiles for vector layers and GeoTiff for raster) so that\n they can be opened by most external applications.\n\n If there is a selection and QGIS is configured to use just the\n selection, it exports the layer even if it is already in a\n suitable format.\n\n Works only if the layer represented by the parameter value is\n currently loaded in QGIS. Otherwise, it will not perform any\n export and return the current value string.\n\n If the current value represents a layer in a suitable format,\n it does no export at all and returns that value.\n\n Currently, it works just for vector layer. In the case of\n raster layers, it returns the parameter value.\n\n The layers are exported just the first time the method is\n called. The method can be called several times and it will\n always return the same string, performing the export only the\n first time.\n \"\"\"\n\n if self.exported:\n return self.exported\n self.exported = self.value\n layers = self.value.split(';')\n if layers is None or len(layers) == 0:\n return self.value\n if self.datatype == dataobjects.TYPE_RASTER:\n for layerfile in layers:\n layer = dataobjects.getObjectFromUri(layerfile, False)\n if layer:\n filename = dataobjects.exportRasterLayer(layer)\n self.exported = self.exported.replace(layerfile, filename)\n return self.exported\n elif self.datatype == dataobjects.TYPE_FILE:\n return self.value\n else:\n for layerfile in layers:\n layer = dataobjects.getObjectFromUri(layerfile, False)\n if layer:\n filename = dataobjects.exportVectorLayer(layer)\n self.exported = self.exported.replace(layerfile, filename)\n return self.exported\n\n def getAsString(self, value):\n if self.datatype == dataobjects.TYPE_RASTER:\n if isinstance(value, QgsRasterLayer):\n return str(value.dataProvider().dataSourceUri())\n else:\n s = str(value)\n layers = dataobjects.getRasterLayers()\n for layer in layers:\n if layer.name() == s:\n return str(layer.dataProvider().dataSourceUri())\n return s\n\n if self.datatype == dataobjects.TYPE_FILE:\n return str(value)\n else:\n if isinstance(value, QgsVectorLayer):\n return str(value.source())\n else:\n s = str(value)\n layers = dataobjects.getVectorLayers([self.datatype])\n for layer in layers:\n if layer.name() == s:\n return str(layer.source())\n return s\n\n def getFileFilter(self):\n if self.datatype == dataobjects.TYPE_RASTER:\n exts = dataobjects.getSupportedOutputRasterLayerExtensions()\n elif self.datatype == dataobjects.TYPE_FILE:\n return self.tr('All files (*.*)', 'ParameterMultipleInput')\n else:\n exts = dataobjects.getSupportedOutputVectorLayerExtensions()\n for i in range(len(exts)):\n exts[i] = self.tr('%s files(*.%s)', 'ParameterMultipleInput') % (exts[i].upper(), exts[i].lower())\n return ';;'.join(exts)\n\n def dataType(self):\n if self.datatype == dataobjects.TYPE_VECTOR_POINT:\n return 'points'\n elif self.datatype == dataobjects.TYPE_VECTOR_LINE:\n return 'lines'\n elif self.datatype == dataobjects.TYPE_VECTOR_POLYGON:\n return 'polygons'\n elif self.datatype == dataobjects.TYPE_RASTER:\n return 'rasters'\n elif self.datatype == dataobjects.TYPE_FILE:\n return 'files'\n else:\n return 'any vectors'\n\n def getAsScriptCode(self):\n param_type = ''\n if self.optional:\n param_type += 'optional '\n if self.datatype == dataobjects.TYPE_RASTER:\n param_type += 'multiple raster'\n if self.datatype == dataobjects.TYPE_FILE:\n param_type += 'multiple file'\n else:\n param_type += 'multiple vector'\n return '##' + self.name + '=' + param_type\n\n @classmethod\n def fromScriptCode(self, line):\n isOptional, name, definition = _splitParameterOptions(line)\n descName = _createDescriptiveName(name)\n if definition.lower().strip() == 'multiple raster':\n return ParameterMultipleInput(name, descName,\n dataobjects.TYPE_RASTER, isOptional)\n elif definition.lower().strip() == 'multiple vector':\n return ParameterMultipleInput(name, definition,\n dataobjects.TYPE_VECTOR_ANY, isOptional)\n\n def evaluate(self, alg):\n self.value = _resolveLayers(self.value)\n\n\nclass ParameterNumber(Parameter):\n\n default_metadata = {\n 'widget_wrapper': 'processing.gui.wrappers.NumberWidgetWrapper'\n }\n\n def __init__(self, name='', description='', minValue=None, maxValue=None,\n default=None, optional=False):\n Parameter.__init__(self, name, description, default, optional)\n\n if default is not None:\n try:\n self.default = int(str(default))\n self.isInteger = True\n except ValueError:\n self.default = float(default)\n self.isInteger = False\n else:\n self.isInteger = False\n\n if minValue is not None:\n self.min = int(float(minValue)) if self.isInteger else float(minValue)\n else:\n self.min = None\n if maxValue is not None:\n self.max = int(float(maxValue)) if self.isInteger else float(maxValue)\n else:\n self.max = None\n self.value = self.default\n\n def setValue(self, n):\n if n is None:\n if not self.optional:\n return False\n self.value = None\n return True\n\n if isinstance(n, str):\n try:\n v = self._evaluate(n)\n self.value = float(v)\n if self.isInteger:\n self.value = int(math.floor(self.value))\n return True\n except:\n return False\n else:\n try:\n if float(n) - int(float(n)) == 0:\n value = int(float(n))\n else:\n value = float(n)\n if self.min is not None:\n if value < self.min:\n return False\n if self.max is not None:\n if value > self.max:\n return False\n self.value = value\n return True\n except:\n raise\n return False\n\n def getAsScriptCode(self):\n param_type = ''\n if self.optional:\n param_type += 'optional '\n param_type += 'number'\n code = '##' + self.name + '=' + param_type\n if self.default:\n code += str(self.default)\n return code\n\n @classmethod\n def fromScriptCode(self, line):\n\n isOptional, name, definition = _splitParameterOptions(line)\n descName = _createDescriptiveName(name)\n if definition.lower().strip().startswith('number'):\n default = definition.strip()[len('number'):] or None\n if default == 'None':\n default = None\n return ParameterNumber(name, descName, default=default, optional=isOptional)\n\n def _evaluate(self, value):\n exp = QgsExpression(value)\n if exp.hasParserError():\n raise ValueError(self.tr(\"Error in parameter expression: \") + exp.parserErrorString())\n result = exp.evaluate(_expressionContext())\n if exp.hasEvalError():\n raise ValueError(\"Error evaluating parameter expression: \" + exp.evalErrorString())\n if self.isInteger:\n return math.floor(result)\n else:\n return result\n\n def evaluate(self, alg):\n if isinstance(self.value, str) and bool(self.value):\n self.value = self._evaluate(self.value)\n\n def _layerVariables(self, element, alg=None):\n variables = {}\n layer = getObject(element.value)\n if layer is not None:\n name = element.name if alg is None else \"%s_%s\" % (alg.name, element.name)\n variables['@%s_minx' % name] = layer.extent().xMinimum()\n variables['@%s_miny' % name] = layer.extent().yMinimum()\n variables['@%s_maxx' % name] = layer.extent().yMaximum()\n variables['@%s_maxy' % name] = layer.extent().yMaximum()\n if isinstance(element, (ParameterRaster, OutputRaster)):\n stats = layer.dataProvider().bandStatistics(1)\n variables['@%s_avg' % name] = stats.mean\n variables['@%s_stddev' % name] = stats.stdDev\n variables['@%s_min' % name] = stats.minimumValue\n variables['@%s_max' % name] = stats.maximumValue\n return variables\n\n def evaluateForModeler(self, value, model):\n if isinstance(value, numbers.Number):\n return value\n variables = {}\n for param in model.parameters:\n if isinstance(param, ParameterNumber):\n variables[\"@\" + param.name] = param.value\n if isinstance(param, (ParameterRaster, ParameterVector)):\n variables.update(self._layerVariables(param))\n\n for alg in list(model.algs.values()):\n for out in alg.algorithm.outputs:\n if isinstance(out, OutputNumber):\n variables[\"@%s_%s\" % (alg.name, out.name)] = out.value\n if isinstance(out, (OutputRaster, OutputVector)):\n variables.update(self._layerVariables(out, alg))\n for k, v in list(variables.items()):\n value = value.replace(k, str(v))\n\n return value\n\n def expressionContext(self):\n return _expressionContext()\n\n def getValueAsCommandLineParameter(self):\n if self.value is None:\n return str(None)\n if isinstance(self.value, str):\n return '\"%s\"' + self.value\n return str(self.value)\n\n\nclass ParameterRange(Parameter):\n\n def __init__(self, name='', description='', default=None, optional=False):\n Parameter.__init__(self, name, description, default, optional)\n\n if default is not None:\n values = default.split(',')\n try:\n int(values[0])\n int(values[1])\n self.isInteger = True\n except:\n self.isInteger = False\n else:\n self.isInteger = False\n\n def setValue(self, text):\n if text is None:\n if not self.optional:\n return False\n self.value = None\n return True\n\n tokens = text.split(',')\n if len(tokens) != 2:\n return False\n try:\n float(tokens[0])\n float(tokens[1])\n self.value = text\n return True\n except:\n return False\n\n def getValueAsCommandLineParameter(self):\n return '\"' + str(self.value) + '\"' if self.value is not None else str(None)\n\n\nclass ParameterRaster(ParameterDataObject):\n\n default_metadata = {\n 'widget_wrapper': 'processing.gui.wrappers.RasterWidgetWrapper'\n }\n\n def __init__(self, name='', description='', optional=False, showSublayersDialog=True):\n ParameterDataObject.__init__(self, name, description, None, optional)\n self.showSublayersDialog = parseBool(showSublayersDialog)\n self.exported = None\n\n def getSafeExportedLayer(self):\n \"\"\"Returns not the value entered by the user, but a string with\n a filename which contains the data of this layer, but saved in\n a standard format (currently always a geotiff file) so that it\n can be opened by most external applications.\n\n Works only if the layer represented by the parameter value is\n currently loaded in QGIS. Otherwise, it will not perform any\n export and return the current value string.\n\n If the current value represents a layer in a suitable format,\n it does not export at all and returns that value.\n\n The layer is exported just the first time the method is called.\n The method can be called several times and it will always\n return the same file, performing the export only the first\n time.\n \"\"\"\n\n if self.exported:\n return self.exported\n layer = dataobjects.getObjectFromUri(self.value, False)\n if layer:\n self.exported = dataobjects.exportRasterLayer(layer)\n else:\n self.exported = self.value\n return self.exported\n\n def setValue(self, obj):\n self.exported = None\n if obj is None:\n if not self.optional:\n return False\n self.value = None\n return True\n\n if isinstance(obj, QgsRasterLayer):\n self.value = str(obj.dataProvider().dataSourceUri())\n return True\n else:\n self.value = str(obj)\n return True\n\n def getFileFilter(self):\n exts = dataobjects.getSupportedOutputRasterLayerExtensions()\n for i in range(len(exts)):\n exts[i] = self.tr('%s files(*.%s)', 'ParameterRaster') % (exts[i].upper(), exts[i].lower())\n return ';;'.join(exts)\n\n def getAsScriptCode(self):\n param_type = ''\n if self.optional:\n param_type += 'optional '\n param_type += 'raster'\n return '##' + self.name + '=' + param_type\n\n @classmethod\n def fromScriptCode(self, line):\n isOptional, name, definition = _splitParameterOptions(line)\n descName = _createDescriptiveName(name)\n if definition.lower().strip().startswith('raster'):\n return ParameterRaster(name, descName, optional=isOptional)\n\n\nclass ParameterSelection(Parameter):\n\n default_metadata = {\n 'widget_wrapper': 'processing.gui.wrappers.SelectionWidgetWrapper'\n }\n\n def __init__(self, name='', description='', options=[], default=None, isSource=False,\n multiple=False, optional=False):\n Parameter.__init__(self, name, description, default, optional)\n self.multiple = multiple\n isSource = parseBool(isSource)\n self.options = options\n if isSource:\n self.options = []\n layer = QgsVectorLayer(options[0], \"layer\", \"ogr\")\n if layer.isValid():\n try:\n index = resolveFieldIndex(layer, options[1])\n feats = features(layer)\n for feature in feats:\n self.options.append(str(feature.attributes()[index]))\n except ValueError:\n pass\n elif isinstance(self.options, str):\n self.options = self.options.split(\";\")\n\n if default is not None:\n try:\n self.default = int(default)\n except:\n self.default = 0\n self.value = self.default\n\n def setValue(self, value):\n if value is None:\n if not self.optional:\n return False\n self.value = 0\n return True\n\n if isinstance(value, list):\n if not self.multiple:\n return False\n values = []\n for v in value:\n try:\n n = int(v)\n values.append(n)\n except:\n return False\n if not self.optional and len(values) == 0:\n return False\n self.value = values\n return True\n else:\n try:\n n = int(value)\n self.value = n\n return True\n except:\n return False\n\n @classmethod\n def fromScriptCode(self, line):\n isOptional, name, definition = _splitParameterOptions(line)\n descName = _createDescriptiveName(name)\n if definition.lower().strip().startswith('selectionfromfile'):\n options = definition.strip()[len('selectionfromfile '):].split(';')\n return ParameterSelection(name, descName, options, isSource=True, optional=isOptional)\n elif definition.lower().strip().startswith('selection'):\n options = definition.strip()[len('selection '):].split(';')\n return ParameterSelection(name, descName, options, optional=isOptional)\n elif definition.lower().strip().startswith('multipleselectionfromfile'):\n options = definition.strip()[len('multipleselectionfromfile '):].split(';')\n return ParameterSelection(name, descName, options, isSource=True,\n multiple=True, optional=isOptional)\n elif definition.lower().strip().startswith('multipleselection'):\n options = definition.strip()[len('multipleselection '):].split(';')\n return ParameterSelection(name, descName, options, multiple=True, optional=isOptional)\n\n\nclass ParameterEvaluationException(Exception):\n\n def __init__(self, param, msg):\n Exception.__init__(msg)\n self.param = param\n\n\nclass ParameterString(Parameter):\n\n default_metadata = {\n 'widget_wrapper': 'processing.gui.wrappers.StringWidgetWrapper'\n }\n\n NEWLINE = '\\n'\n ESCAPED_NEWLINE = '\\\\n'\n\n def __init__(self, name='', description='', default=None, multiline=False,\n optional=False, evaluateExpressions=False):\n Parameter.__init__(self, name, description, default, optional)\n self.multiline = parseBool(multiline)\n self.evaluateExpressions = parseBool(evaluateExpressions)\n\n def setValue(self, obj):\n if not bool(obj):\n if not self.optional:\n return False\n self.value = None\n return True\n\n self.value = str(obj).replace(\n ParameterString.ESCAPED_NEWLINE,\n ParameterString.NEWLINE\n )\n return True\n\n def getValueAsCommandLineParameter(self):\n return ('\"' + str(self.value.replace(ParameterString.NEWLINE,\n ParameterString.ESCAPED_NEWLINE)) + '\"'\n if self.value is not None else str(None))\n\n def getAsScriptCode(self):\n param_type = ''\n if self.optional:\n param_type += 'optional '\n param_type += 'string'\n return '##' + self.name + '=' + param_type + self.default\n\n @classmethod\n def fromScriptCode(self, line):\n isOptional, name, definition = _splitParameterOptions(line)\n descName = _createDescriptiveName(name)\n if definition.lower().strip().startswith('string'):\n default = definition.strip()[len('string') + 1:]\n if default:\n return ParameterString(name, descName, default, optional=isOptional)\n else:\n return ParameterString(name, descName, optional=isOptional)\n elif definition.lower().strip().startswith('longstring'):\n default = definition.strip()[len('longstring') + 1:]\n if default:\n return ParameterString(name, descName, default, multiline=True, optional=isOptional)\n else:\n return ParameterString(name, descName, multiline=True, optional=isOptional)\n\n def evaluate(self, alg):\n if isinstance(self.value, str) and bool(self.value) and self.evaluateExpressions:\n exp = QgsExpression(self.value)\n if exp.hasParserError():\n raise ValueError(self.tr(\"Error in parameter expression: \") + exp.parserErrorString())\n result = exp.evaluate(_expressionContext())\n if exp.hasEvalError():\n raise ValueError(\"Error evaluating parameter expression: \" + exp.evalErrorString())\n self.value = result\n\n def expressionContext(self):\n return _expressionContext()\n\n\nclass ParameterExpression(Parameter):\n\n default_metadata = {\n 'widget_wrapper': 'processing.gui.wrappers.ExpressionWidgetWrapper'\n }\n\n NEWLINE = '\\n'\n ESCAPED_NEWLINE = '\\\\n'\n\n def __init__(self, name='', description='', default=None, optional=False, parent_layer=None):\n Parameter.__init__(self, name, description, default, optional)\n self.parent_layer = parent_layer\n\n def setValue(self, obj):\n if not bool(obj):\n if not self.optional:\n return False\n self.value = None\n return True\n\n self.value = str(obj).replace(\n ParameterString.ESCAPED_NEWLINE,\n ParameterString.NEWLINE\n )\n return True\n\n def getValueAsCommandLineParameter(self):\n return ('\"' + str(self.value.replace(ParameterExpression.NEWLINE,\n ParameterExpression.ESCAPED_NEWLINE)) + '\"'\n if self.value is not None else str(None))\n\n def getAsScriptCode(self):\n param_type = ''\n if self.optional:\n param_type += 'optional '\n param_type += 'expression'\n return '##' + self.name + '=' + param_type + self.default\n\n @classmethod\n def fromScriptCode(self, line):\n isOptional, name, definition = _splitParameterOptions(line)\n if definition.lower().strip().startswith('expression'):\n descName = _createDescriptiveName(name)\n default = definition.strip()[len('expression') + 1:]\n if default:\n return ParameterExpression(name, descName, default, optional=isOptional)\n else:\n return ParameterExpression(name, descName, optional=isOptional)\n\n\nclass ParameterTable(ParameterDataObject):\n\n default_metadata = {\n 'widget_wrapper': 'processing.gui.wrappers.TableWidgetWrapper'\n }\n\n def __init__(self, name='', description='', optional=False):\n ParameterDataObject.__init__(self, name, description, None, optional)\n self.exported = None\n\n def setValue(self, obj):\n self.exported = None\n if obj is None:\n if not self.optional:\n return False\n self.value = None\n return True\n\n if isinstance(obj, QgsVectorLayer):\n source = str(obj.source())\n self.value = source\n return True\n else:\n self.value = str(obj)\n layers = dataobjects.getTables()\n for layer in layers:\n if layer.name() == self.value or layer.source() == self.value:\n source = str(layer.source())\n self.value = source\n return True\n val = str(obj)\n self.value = val\n return os.path.exists(self.value)\n\n def getSafeExportedTable(self):\n \"\"\"Returns not the value entered by the user, but a string with\n a filename which contains the data of this table, but saved in\n a standard format (currently always a DBF file) so that it can\n be opened by most external applications.\n\n Works only if the table represented by the parameter value is\n currently loaded in QGIS. Otherwise, it will not perform any\n export and return the current value string.\n\n If the current value represents a table in a suitable format,\n it does not export at all and returns that value.\n\n The table is exported just the first time the method is called.\n The method can be called several times and it will always\n return the same file, performing the export only the first\n time.\n \"\"\"\n\n if self.exported:\n return self.exported\n table = dataobjects.getObjectFromUri(self.value, False)\n if table:\n self.exported = dataobjects.exportTable(table)\n else:\n self.exported = self.value\n return self.exported\n\n def getFileFilter(self):\n exts = ['csv', 'dbf']\n for i in range(len(exts)):\n exts[i] = self.tr('%s files(*.%s)', 'ParameterTable') % (exts[i].upper(), exts[i].lower())\n return ';;'.join(exts)\n\n def getAsScriptCode(self):\n param_type = ''\n if self.optional:\n param_type += 'optional '\n param_type += 'table'\n return '##' + self.name + '=' + param_type\n\n @classmethod\n def fromScriptCode(self, line):\n isOptional, name, definition = _splitParameterOptions(line)\n descName = _createDescriptiveName(name)\n if definition.lower().strip().startswith('table'):\n return ParameterTable(name, descName, isOptional)\n\n\nclass ParameterTableField(Parameter):\n\n \"\"\"A parameter representing a table field.\n Its value is a string that represents the name of the field.\n \"\"\"\n\n default_metadata = {\n 'widget_wrapper': 'processing.gui.wrappers.TableFieldWidgetWrapper'\n }\n\n DATA_TYPE_NUMBER = 0\n DATA_TYPE_STRING = 1\n DATA_TYPE_DATETIME = 2\n DATA_TYPE_ANY = -1\n\n def __init__(self, name='', description='', parent=None, datatype=-1,\n optional=False, multiple=False):\n Parameter.__init__(self, name, description, None, optional)\n self.parent = parent\n self.multiple = multiple\n self.datatype = int(datatype)\n\n def getValueAsCommandLineParameter(self):\n return '\"' + str(self.value) + '\"' if self.value is not None else str(None)\n\n def setValue(self, value):\n if not bool(value):\n if not self.optional:\n return False\n self.value = None\n return True\n\n if isinstance(value, list):\n if not self.multiple and len(value) > 1:\n return False\n self.value = \";\".join(value)\n return True\n else:\n self.value = str(value)\n return True\n\n def __str__(self):\n return self.name + ' <' + self.__module__.split('.')[-1] + ' from ' \\\n + self.parent + '>'\n\n def dataType(self):\n if self.datatype == self.DATA_TYPE_NUMBER:\n return 'numeric'\n elif self.datatype == self.DATA_TYPE_STRING:\n return 'string'\n elif self.datatype == self.DATA_TYPE_DATETIME:\n return 'datetime'\n else:\n return 'any'\n\n def getAsScriptCode(self):\n param_type = ''\n if self.optional:\n param_type += 'optional '\n param_type += 'field'\n return '##' + self.name + '=' + param_type + self.parent\n\n @classmethod\n def fromScriptCode(self, line):\n isOptional, name, definition = _splitParameterOptions(line)\n descName = _createDescriptiveName(name)\n if definition.lower().strip().startswith('field'):\n if definition.lower().strip().startswith('field number'):\n parent = definition.strip()[len('field number') + 1:]\n datatype = ParameterTableField.DATA_TYPE_NUMBER\n elif definition.lower().strip().startswith('field string'):\n parent = definition.strip()[len('field string') + 1:]\n datatype = ParameterTableField.DATA_TYPE_STRING\n elif definition.lower().strip().startswith('field datetime'):\n parent = definition.strip()[len('field datetime') + 1:]\n datatype = ParameterTableField.DATA_TYPE_DATETIME\n else:\n parent = definition.strip()[len('field') + 1:]\n datatype = ParameterTableField.DATA_TYPE_ANY\n\n return ParameterTableField(name, descName, parent, datatype, isOptional)\n\n\nclass ParameterVector(ParameterDataObject):\n\n default_metadata = {\n 'widget_wrapper': 'processing.gui.wrappers.VectorWidgetWrapper'\n }\n\n def __init__(self, name='', description='', datatype=[-1],\n optional=False):\n ParameterDataObject.__init__(self, name, description, None, optional)\n if isinstance(datatype, int):\n datatype = [datatype]\n elif isinstance(datatype, str):\n datatype = [int(t) for t in datatype.split(',')]\n self.datatype = datatype\n self.exported = None\n self.allowOnlyOpenedLayers = False\n\n def setValue(self, obj):\n self.exported = None\n if obj is None:\n if not self.optional:\n return False\n self.value = None\n return True\n\n if isinstance(obj, QgsVectorLayer):\n self.value = str(obj.source())\n return True\n else:\n self.value = str(obj)\n return True\n\n def getSafeExportedLayer(self):\n \"\"\"Returns not the value entered by the user, but a string with\n a filename which contains the data of this layer, but saved in\n a standard format (currently always a shapefile) so that it can\n be opened by most external applications.\n\n If there is a selection and QGIS is configured to use just the\n selection, if exports the layer even if it is already in a\n suitable format.\n\n Works only if the layer represented by the parameter value is\n currently loaded in QGIS. Otherwise, it will not perform any\n export and return the current value string.\n\n If the current value represents a layer in a suitable format,\n it does not export at all and returns that value.\n\n The layer is exported just the first time the method is called.\n The method can be called several times and it will always\n return the same file, performing the export only the first\n time.\n \"\"\"\n\n if self.exported:\n return self.exported\n layer = dataobjects.getObjectFromUri(self.value, False)\n if layer:\n self.exported = dataobjects.exportVectorLayer(layer)\n else:\n self.exported = self.value\n return self.exported\n\n def getFileFilter(self):\n exts = dataobjects.getSupportedOutputVectorLayerExtensions()\n for i in range(len(exts)):\n exts[i] = self.tr('%s files(*.%s)', 'ParameterVector') % (exts[i].upper(), exts[i].lower())\n return ';;'.join(exts)\n\n def dataType(self):\n return dataobjects.vectorDataType(self)\n\n def getAsScriptCode(self):\n param_type = ''\n if self.optional:\n param_type += 'optional '\n param_type += 'vector'\n return '##' + self.name + '=' + param_type\n\n @classmethod\n def fromScriptCode(self, line):\n isOptional, name, definition = _splitParameterOptions(line)\n descName = _createDescriptiveName(name)\n if definition.lower().strip() == 'vector':\n return ParameterVector(name, descName,\n [dataobjects.TYPE_VECTOR_ANY], isOptional)\n elif definition.lower().strip() == 'vector point':\n return ParameterVector(name, descName,\n [dataobjects.TYPE_VECTOR_POINT], isOptional)\n elif definition.lower().strip() == 'vector line':\n return ParameterVector(name, descName,\n [dataobjects.TYPE_VECTOR_LINE], isOptional)\n elif definition.lower().strip() == 'vector polygon':\n return ParameterVector(name, descName,\n [dataobjects.TYPE_VECTOR_POLYGON], isOptional)\n\n\nclass ParameterGeometryPredicate(Parameter):\n\n predicates = ('intersects',\n 'contains',\n 'disjoint',\n 'equals',\n 'touches',\n 'overlaps',\n 'within',\n 'crosses')\n\n def __init__(self, name='', description='', left=None, right=None,\n optional=False, enabledPredicates=None):\n Parameter.__init__(self, name, description, None, optional)\n self.left = left\n self.right = right\n self.value = None\n self.enabledPredicates = enabledPredicates\n if self.enabledPredicates is None:\n self.enabledPredicates = self.predicates\n\n def getValueAsCommandLineParameter(self):\n return str(self.value)\n\n def setValue(self, value):\n if value is None:\n if not self.optional:\n return False\n self.value = None\n return True\n elif len(value) == 0 and not self.optional:\n return False\n\n if isinstance(value, str):\n self.value = value.split(';') # relates to ModelerAlgorithm.resolveValue\n else:\n self.value = value\n return True\n\n\nparamClasses = [c for c in list(sys.modules[__name__].__dict__.values()) if isclass(c) and issubclass(c, Parameter)]\n\n\ndef getParameterFromString(s):\n # Try the parameter definitions used in description files\n if '|' in s and (s.startswith(\"Parameter\") or s.startswith(\"*Parameter\")):\n isAdvanced = False\n if s.startswith(\"*\"):\n s = s[1:]\n isAdvanced = True\n tokens = s.split(\"|\")\n params = [t if str(t) != str(None) else None for t in tokens[1:]]\n try:\n clazz = getattr(sys.modules[__name__], tokens[0])\n param = clazz(*params)\n param.isAdvanced = isAdvanced\n return param\n except:\n return None\n else: # try script syntax\n for paramClass in paramClasses:\n try:\n param = paramClass.fromScriptCode(s)\n if param is not None:\n return param\n except AttributeError:\n pass\n except:\n return None\n"},"license":{"kind":"string","value":"gpl-2.0"},"hash":{"kind":"number","value":6668968050453547000,"string":"6,668,968,050,453,547,000"},"line_mean":{"kind":"number","value":34.0835972134,"string":"34.083597"},"line_max":{"kind":"number","value":116,"string":"116"},"alpha_frac":{"kind":"number","value":0.5736050689,"string":"0.573605"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.626054279749478,"string":"4.626054"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44992,"cells":{"repo_name":{"kind":"string","value":"andrewk1/Climb-Bot"},"path":{"kind":"string","value":"climb-bot.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"3083"},"content":{"kind":"string","value":"import praw\nimport requests\nimport json\nimport time \nimport re\n\n# Function iterates over each submission title and checks if the title contains route syntax that indicates the post is about a route\ndef parse_titles(bot, subreddit):\n\tstart_time = time.time()\n\tfor submission in subreddit.stream.submissions():\n\t\tif (submission.created_utc < start_time):\n\t\t\tcontinue\t\t\n\n\t\ttitle = submission.title\n\t\t# regex matches sequence of capitalized words followed by climb grade notation (V or 5.)\n\t\troute_regex = '([A-Z][a-z]+(?=\\s[A-Z])(?:\\s[A-Z][a-z]+)+) [( ]?(5.[0-9][0-9]?[A-Za-z]|[Vv][0-9][0-9]?)'\n\t\troute_name = re.search(route_regex, title)\n\t\tprint route_name\n\t\tcomment = make_get_request(route_name.group(0))\n\t\tif comment != 'NA':\n\t\t\tsubmission.reply(comment)\n\n# Call custom google search engine API to parse the formulated title and gather theCrag's metadata for the route\ndef make_get_request(route):\n\tkey = 'key=***' \n\tcx = 'cx=***' \n\tquery= 'q='+route\n\tgoogle_url = 'https://www.googleapis.com/customsearch/v1?' + key + cx + query\n\tresponse = requests.get(google_url)\n\tparsed_response= json.loads(response.text)\n\treturn form_post(parsed_response)\n\n# Extract data from google's JSON response and form a post\ndef form_post(parsed_response):\n\t# Check if Google search received a hit\n\tif parsed_response['searchInformation']['totalResults'] == 0 or 'items' not in parsed_response:\n\t\treturn 'NA'\n\ttitle = parsed_response['items'][0]['title']\n\tprint title\n\tbreadcrumb = parsed_response['items'][0]['pagemap']['breadcrumb']\n\tcount = 0\n\t# Build up region string\n\tregion_string = ''\n\tfor key in breadcrumb:\n\t\tregion = breadcrumb[count]['title']\n\t\tif (count > 0) :\n\t\t\tregion_string = region + ', ' + region_string\n\t\telse :\n\t\t\tregion_string = region;\n\t\tcount+=1\n\n\tmetatags = parsed_response['items'][0]['pagemap']['metatags']\n\tcountry = breadcrumb[0]['title']\n\tlatitude = metatags[0]['place:location:latitude']\n\tlongitude = metatags[0]['place:location:longitude']\n\tgoogle_pin = 'https://www.google.com/maps/@?api=1&map_action=map&basemap=satellite&zoom=19&center=' + latitude + ',' + longitude\n\tlink = metatags[0]['og:url']\n\tif (' in ' in title):\n\t\ttitle = title[:title.index(' in ')]\n\t# Truncate values to 3rd decimal place\n\tlat_decimal = latitude.index('.')\n\tlatitude = latitude[:lat_decimal+4]\n\tlong_decimal = longitude.index('.')\t\n\tlongitude = longitude[:long_decimal+4]\n\n\t# Format comment response\n\treturn 'I found a route! [' + title + '](' + link + ') in ' + region_string + '\\n\\nGPS Location: [' + latitude + ', ' + longitude + ']('+google_pin+')' + '\\n\\n ' + '\\n\\n^^^I ^^^am ^^^a ^^^bot ^^^| ^^^Data ^^^from ^^^[theCrag.com](https://www.thecrag.com/) ^^^| ^^^Feedback ^^^welcome ^^^at ^^^[r/climbBot](https://www.reddit.com/r/climbBot/)'\n\nif __name__ == \"__main__\":\n\tbot = praw.Reddit(\n\t\tuser_agent='climb-bot posts additional information on climbing routes it finds, created by /u/Akondrich, email: andrewkondrich@gmail.com',\n\t\tclient_id='***', \n\t\tclient_secret='***', \n\t\tusername='climb-bot',\n\t\tpassword='***') \n\tsubreddit = bot.subreddit('climbBot')\n\tparse_titles(bot, subreddit)\n\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-518196464358046460,"string":"-518,196,464,358,046,460"},"line_mean":{"kind":"number","value":38.5256410256,"string":"38.525641"},"line_max":{"kind":"number","value":343,"string":"343"},"alpha_frac":{"kind":"number","value":0.6733700941,"string":"0.67337"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.0195886385896182,"string":"3.019589"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44993,"cells":{"repo_name":{"kind":"string","value":"yuxng/Deep_ISM"},"path":{"kind":"string","value":"ISM/lib/setup.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"6351"},"content":{"kind":"string","value":"# --------------------------------------------------------\n# Fast R-CNN\n# Copyright (c) 2015 Microsoft\n# Licensed under The MIT License [see LICENSE for details]\n# Written by Ross Girshick\n# --------------------------------------------------------\n\nimport os\nfrom os.path import join as pjoin\nimport numpy as np\nfrom distutils.core import setup\nfrom distutils.extension import Extension\nfrom Cython.Distutils import build_ext\n\ndef find_in_path(name, path):\n \"Find a file in a search path\"\n #adapted fom http://code.activestate.com/recipes/52224-find-a-file-given-a-search-path/\n for dir in path.split(os.pathsep):\n binpath = pjoin(dir, name)\n if os.path.exists(binpath):\n return os.path.abspath(binpath)\n return None\n\ndef locate_cuda():\n \"\"\"Locate the CUDA environment on the system\n\n Returns a dict with keys 'home', 'nvcc', 'include', and 'lib64'\n and values giving the absolute path to each directory.\n\n Starts by looking for the CUDAHOME env variable. If not found, everything\n is based on finding 'nvcc' in the PATH.\n \"\"\"\n\n # first check if the CUDAHOME env variable is in use\n if 'CUDAHOME' in os.environ:\n home = os.environ['CUDAHOME']\n nvcc = pjoin(home, 'bin', 'nvcc')\n else:\n # otherwise, search the PATH for NVCC\n default_path = pjoin(os.sep, 'usr', 'local', 'cuda', 'bin')\n nvcc = find_in_path('nvcc', os.environ['PATH'] + os.pathsep + default_path)\n if nvcc is None:\n raise EnvironmentError('The nvcc binary could not be '\n 'located in your $PATH. Either add it to your path, or set $CUDAHOME')\n home = os.path.dirname(os.path.dirname(nvcc))\n\n cudaconfig = {'home':home, 'nvcc':nvcc,\n 'include': pjoin(home, 'include'),\n 'lib64': pjoin(home, 'lib64')}\n for k, v in cudaconfig.iteritems():\n if not os.path.exists(v):\n raise EnvironmentError('The CUDA %s path could not be located in %s' % (k, v))\n\n return cudaconfig\nCUDA = locate_cuda()\n\n# Obtain the numpy include directory. This logic works across numpy versions.\ntry:\n numpy_include = np.get_include()\nexcept AttributeError:\n numpy_include = np.get_numpy_include()\n\ndef customize_compiler_for_nvcc(self):\n \"\"\"inject deep into distutils to customize how the dispatch\n to gcc/nvcc works.\n\n If you subclass UnixCCompiler, it's not trivial to get your subclass\n injected in, and still have the right customizations (i.e.\n distutils.sysconfig.customize_compiler) run on it. So instead of going\n the OO route, I have this. Note, it's kindof like a wierd functional\n subclassing going on.\"\"\"\n\n # tell the compiler it can processes .cu\n self.src_extensions.append('.cu')\n\n # save references to the default compiler_so and _comple methods\n default_compiler_so = self.compiler_so\n super = self._compile\n\n # now redefine the _compile method. This gets executed for each\n # object but distutils doesn't have the ability to change compilers\n # based on source extension: we add it.\n def _compile(obj, src, ext, cc_args, extra_postargs, pp_opts):\n if os.path.splitext(src)[1] == '.cu':\n # use the cuda for .cu files\n self.set_executable('compiler_so', CUDA['nvcc'])\n # use only a subset of the extra_postargs, which are 1-1 translated\n # from the extra_compile_args in the Extension class\n postargs = extra_postargs['nvcc']\n else:\n postargs = extra_postargs['gcc']\n\n super(obj, src, ext, cc_args, postargs, pp_opts)\n # reset the default compiler_so, which we might have changed for cuda\n self.compiler_so = default_compiler_so\n\n # inject our redefined _compile method into the class\n self._compile = _compile\n\n\n# run the customize_compiler\nclass custom_build_ext(build_ext):\n def build_extensions(self):\n customize_compiler_for_nvcc(self.compiler)\n build_ext.build_extensions(self)\n\next_modules = [\n Extension(\n \"utils.cython_bbox\",\n [\"utils/bbox.pyx\"],\n extra_compile_args={'gcc': [\"-Wno-cpp\", \"-Wno-unused-function\"]},\n ),\n Extension(\n \"utils.cython_nms\",\n [\"utils/nms.pyx\"],\n extra_compile_args={'gcc': [\"-Wno-cpp\", \"-Wno-unused-function\"]},\n ),\n Extension(\n \"nms.cpu_nms\",\n [\"nms/cpu_nms.pyx\"],\n extra_compile_args={'gcc': [\"-Wno-cpp\", \"-Wno-unused-function\"]},\n include_dirs = [numpy_include]\n ),\n Extension('nms.gpu_nms',\n ['nms/nms_kernel.cu', 'nms/gpu_nms.pyx'],\n library_dirs=[CUDA['lib64']],\n libraries=['cudart'],\n language='c++',\n runtime_library_dirs=[CUDA['lib64']],\n # this syntax is specific to this build system\n # we're only going to use certain compiler args with nvcc and not with gcc\n # the implementation of this trick is in customize_compiler() below\n extra_compile_args={'gcc': [\"-Wno-unused-function\"],\n 'nvcc': ['-arch=sm_35',\n '--ptxas-options=-v',\n '-c',\n '--compiler-options',\n \"'-fPIC'\"]},\n include_dirs = [numpy_include, CUDA['include']]\n ),\n Extension('normals.gpu_normals',\n ['normals/compute_normals.cu', 'normals/gpu_normals.pyx'],\n library_dirs=[CUDA['lib64']],\n libraries=['cudart'],\n language='c++',\n runtime_library_dirs=[CUDA['lib64']],\n # this syntax is specific to this build system\n # we're only going to use certain compiler args with nvcc and not with gcc\n # the implementation of this trick is in customize_compiler() below\n extra_compile_args={'gcc': [\"-Wno-unused-function\"],\n 'nvcc': ['-arch=sm_35',\n '--ptxas-options=-v',\n '-c',\n '--compiler-options',\n \"'-fPIC'\"]},\n include_dirs = [numpy_include, CUDA['include'], '/usr/local/include/eigen3']\n )\n]\n\nsetup(\n name='fast_rcnn',\n ext_modules=ext_modules,\n # inject our custom trigger\n cmdclass={'build_ext': custom_build_ext},\n)\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-73697840488066960,"string":"-73,697,840,488,066,960"},"line_mean":{"kind":"number","value":37.4909090909,"string":"37.490909"},"line_max":{"kind":"number","value":91,"string":"91"},"alpha_frac":{"kind":"number","value":0.5877814517,"string":"0.587781"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.9059040590405902,"string":"3.905904"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44994,"cells":{"repo_name":{"kind":"string","value":"gamechanger/kafka-python"},"path":{"kind":"string","value":"kafka/protocol/admin.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1182"},"content":{"kind":"string","value":"from .struct import Struct\nfrom .types import Array, Bytes, Int16, Schema, String\n\n\nclass ListGroupsResponse(Struct):\n SCHEMA = Schema(\n ('error_code', Int16),\n ('groups', Array(\n ('group', String('utf-8')),\n ('protocol_type', String('utf-8'))))\n )\n\n\nclass ListGroupsRequest(Struct):\n API_KEY = 16\n API_VERSION = 0\n RESPONSE_TYPE = ListGroupsResponse\n SCHEMA = Schema()\n\n\nclass DescribeGroupsResponse(Struct):\n SCHEMA = Schema(\n ('groups', Array(\n ('error_code', Int16),\n ('group', String('utf-8')),\n ('state', String('utf-8')),\n ('protocol_type', String('utf-8')),\n ('protocol', String('utf-8')),\n ('members', Array(\n ('member_id', String('utf-8')),\n ('client_id', String('utf-8')),\n ('client_host', String('utf-8')),\n ('member_metadata', Bytes),\n ('member_assignment', Bytes)))))\n )\n\n\nclass DescribeGroupsRequest(Struct):\n API_KEY = 15\n API_VERSION = 0\n RESPONSE_TYPE = DescribeGroupsResponse\n SCHEMA = Schema(\n ('groups', Array(String('utf-8')))\n )\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":-8683488429018159000,"string":"-8,683,488,429,018,159,000"},"line_mean":{"kind":"number","value":25.8636363636,"string":"25.863636"},"line_max":{"kind":"number","value":54,"string":"54"},"alpha_frac":{"kind":"number","value":0.5262267343,"string":"0.526227"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.9531772575250836,"string":"3.953177"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44995,"cells":{"repo_name":{"kind":"string","value":"UTSA-ICS/keystone-SID"},"path":{"kind":"string","value":"keystone/tests/test_auth.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"44678"},"content":{"kind":"string","value":"# Copyright 2012 OpenStack Foundation\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\"); you may\n# not use this file except in compliance with the License. You may obtain\n# a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS, WITHOUT\n# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the\n# License for the specific language governing permissions and limitations\n# under the License.\n\nimport copy\nimport datetime\nimport uuid\n\nimport mock\n\nfrom keystone import assignment\nfrom keystone import auth\nfrom keystone.common import authorization\nfrom keystone.common import environment\nfrom keystone import config\nfrom keystone import exception\nfrom keystone.openstack.common import timeutils\nfrom keystone import tests\nfrom keystone.tests import default_fixtures\nfrom keystone import token\nfrom keystone import trust\n\n\nCONF = config.CONF\nTIME_FORMAT = '%Y-%m-%dT%H:%M:%S.%fZ'\nDEFAULT_DOMAIN_ID = CONF.identity.default_domain_id\n\nHOST_URL = 'http://keystone:5001'\n\n\ndef _build_user_auth(token=None, user_id=None, username=None,\n password=None, tenant_id=None, tenant_name=None,\n trust_id=None):\n \"\"\"Build auth dictionary.\n\n It will create an auth dictionary based on all the arguments\n that it receives.\n \"\"\"\n auth_json = {}\n if token is not None:\n auth_json['token'] = token\n if username or password:\n auth_json['passwordCredentials'] = {}\n if username is not None:\n auth_json['passwordCredentials']['username'] = username\n if user_id is not None:\n auth_json['passwordCredentials']['userId'] = user_id\n if password is not None:\n auth_json['passwordCredentials']['password'] = password\n if tenant_name is not None:\n auth_json['tenantName'] = tenant_name\n if tenant_id is not None:\n auth_json['tenantId'] = tenant_id\n if trust_id is not None:\n auth_json['trust_id'] = trust_id\n return auth_json\n\n\nclass AuthTest(tests.TestCase):\n def setUp(self):\n super(AuthTest, self).setUp()\n\n self.load_backends()\n self.load_fixtures(default_fixtures)\n\n # need to register the token provider first because auth controller\n # depends on it\n token.provider.Manager()\n self.context_with_remote_user = {'environment':\n {'REMOTE_USER': 'FOO',\n 'AUTH_TYPE': 'Negotiate'}}\n self.empty_context = {'environment': {}}\n\n self.controller = token.controllers.Auth()\n #This call sets up, among other things, the call to popen\n #that will be used to run the CMS command. These tests were\n #passing only due to the global nature of the call. If the\n #tests in this file are run alone, API calls return unauthorized.\n environment.use_eventlet(monkeypatch_thread=False)\n\n def assertEqualTokens(self, a, b):\n \"\"\"Assert that two tokens are equal.\n\n Compare two tokens except for their ids. This also truncates\n the time in the comparison.\n \"\"\"\n def normalize(token):\n token['access']['token']['id'] = 'dummy'\n del token['access']['token']['expires']\n del token['access']['token']['issued_at']\n return token\n\n self.assertCloseEnoughForGovernmentWork(\n timeutils.parse_isotime(a['access']['token']['expires']),\n timeutils.parse_isotime(b['access']['token']['expires']))\n self.assertCloseEnoughForGovernmentWork(\n timeutils.parse_isotime(a['access']['token']['issued_at']),\n timeutils.parse_isotime(b['access']['token']['issued_at']))\n return self.assertDictEqual(normalize(a), normalize(b))\n\n\nclass AuthBadRequests(AuthTest):\n def setUp(self):\n super(AuthBadRequests, self).setUp()\n\n def test_no_external_auth(self):\n \"\"\"Verify that _authenticate_external() raises exception if N/A.\"\"\"\n self.assertRaises(\n token.controllers.ExternalAuthNotApplicable,\n self.controller._authenticate_external,\n {}, {})\n\n def test_no_token_in_auth(self):\n \"\"\"Verify that _authenticate_token() raises exception if no token.\"\"\"\n self.assertRaises(\n exception.ValidationError,\n self.controller._authenticate_token,\n None, {})\n\n def test_no_credentials_in_auth(self):\n \"\"\"Verify that _authenticate_local() raises exception if no creds.\"\"\"\n self.assertRaises(\n exception.ValidationError,\n self.controller._authenticate_local,\n None, {})\n\n def test_authenticate_blank_request_body(self):\n \"\"\"Verify sending empty json dict raises the right exception.\"\"\"\n self.assertRaises(exception.ValidationError,\n self.controller.authenticate,\n {}, {})\n\n def test_authenticate_blank_auth(self):\n \"\"\"Verify sending blank 'auth' raises the right exception.\"\"\"\n body_dict = _build_user_auth()\n self.assertRaises(exception.ValidationError,\n self.controller.authenticate,\n {}, body_dict)\n\n def test_authenticate_invalid_auth_content(self):\n \"\"\"Verify sending invalid 'auth' raises the right exception.\"\"\"\n self.assertRaises(exception.ValidationError,\n self.controller.authenticate,\n {}, {'auth': 'abcd'})\n\n def test_authenticate_user_id_too_large(self):\n \"\"\"Verify sending large 'userId' raises the right exception.\"\"\"\n body_dict = _build_user_auth(user_id='0' * 65, username='FOO',\n password='foo2')\n self.assertRaises(exception.ValidationSizeError,\n self.controller.authenticate,\n {}, body_dict)\n\n def test_authenticate_username_too_large(self):\n \"\"\"Verify sending large 'username' raises the right exception.\"\"\"\n body_dict = _build_user_auth(username='0' * 65, password='foo2')\n self.assertRaises(exception.ValidationSizeError,\n self.controller.authenticate,\n {}, body_dict)\n\n def test_authenticate_tenant_id_too_large(self):\n \"\"\"Verify sending large 'tenantId' raises the right exception.\"\"\"\n body_dict = _build_user_auth(username='FOO', password='foo2',\n tenant_id='0' * 65)\n self.assertRaises(exception.ValidationSizeError,\n self.controller.authenticate,\n {}, body_dict)\n\n def test_authenticate_tenant_name_too_large(self):\n \"\"\"Verify sending large 'tenantName' raises the right exception.\"\"\"\n body_dict = _build_user_auth(username='FOO', password='foo2',\n tenant_name='0' * 65)\n self.assertRaises(exception.ValidationSizeError,\n self.controller.authenticate,\n {}, body_dict)\n\n def test_authenticate_token_too_large(self):\n \"\"\"Verify sending large 'token' raises the right exception.\"\"\"\n body_dict = _build_user_auth(token={'id': '0' * 8193})\n self.assertRaises(exception.ValidationSizeError,\n self.controller.authenticate,\n {}, body_dict)\n\n def test_authenticate_password_too_large(self):\n \"\"\"Verify sending large 'password' raises the right exception.\"\"\"\n length = CONF.identity.max_password_length + 1\n body_dict = _build_user_auth(username='FOO', password='0' * length)\n self.assertRaises(exception.ValidationSizeError,\n self.controller.authenticate,\n {}, body_dict)\n\n\nclass AuthWithToken(AuthTest):\n def setUp(self):\n super(AuthWithToken, self).setUp()\n\n def test_unscoped_token(self):\n \"\"\"Verify getting an unscoped token with password creds.\"\"\"\n body_dict = _build_user_auth(username='FOO',\n password='foo2')\n unscoped_token = self.controller.authenticate({}, body_dict)\n self.assertNotIn('tenant', unscoped_token['access']['token'])\n\n def test_auth_invalid_token(self):\n \"\"\"Verify exception is raised if invalid token.\"\"\"\n body_dict = _build_user_auth(token={\"id\": uuid.uuid4().hex})\n self.assertRaises(\n exception.Unauthorized,\n self.controller.authenticate,\n {}, body_dict)\n\n def test_auth_bad_formatted_token(self):\n \"\"\"Verify exception is raised if invalid token.\"\"\"\n body_dict = _build_user_auth(token={})\n self.assertRaises(\n exception.ValidationError,\n self.controller.authenticate,\n {}, body_dict)\n\n def test_auth_unscoped_token_no_project(self):\n \"\"\"Verify getting an unscoped token with an unscoped token.\"\"\"\n body_dict = _build_user_auth(\n username='FOO',\n password='foo2')\n unscoped_token = self.controller.authenticate({}, body_dict)\n\n body_dict = _build_user_auth(\n token=unscoped_token[\"access\"][\"token\"])\n unscoped_token_2 = self.controller.authenticate({}, body_dict)\n\n self.assertEqualTokens(unscoped_token, unscoped_token_2)\n\n def test_auth_unscoped_token_project(self):\n \"\"\"Verify getting a token in a tenant with an unscoped token.\"\"\"\n # Add a role in so we can check we get this back\n self.assignment_api.add_role_to_user_and_project(\n self.user_foo['id'],\n self.tenant_bar['id'],\n self.role_member['id'])\n # Get an unscoped tenant\n body_dict = _build_user_auth(\n username='FOO',\n password='foo2')\n unscoped_token = self.controller.authenticate({}, body_dict)\n # Get a token on BAR tenant using the unscoped tenant\n body_dict = _build_user_auth(\n token=unscoped_token[\"access\"][\"token\"],\n tenant_name=\"BAR\")\n scoped_token = self.controller.authenticate({}, body_dict)\n\n tenant = scoped_token[\"access\"][\"token\"][\"tenant\"]\n roles = scoped_token[\"access\"][\"metadata\"][\"roles\"]\n self.assertEqual(self.tenant_bar['id'], tenant[\"id\"])\n self.assertEqual(self.role_member['id'], roles[0])\n\n def test_auth_token_project_group_role(self):\n \"\"\"Verify getting a token in a tenant with group roles.\"\"\"\n # Add a v2 style role in so we can check we get this back\n self.assignment_api.add_role_to_user_and_project(\n self.user_foo['id'],\n self.tenant_bar['id'],\n self.role_member['id'])\n # Now create a group role for this user as well\n domain1 = {'id': uuid.uuid4().hex, 'name': uuid.uuid4().hex}\n self.assignment_api.create_domain(domain1['id'], domain1)\n new_group = {'id': uuid.uuid4().hex, 'domain_id': domain1['id'],\n 'name': uuid.uuid4().hex}\n self.identity_api.create_group(new_group['id'], new_group)\n self.identity_api.add_user_to_group(self.user_foo['id'],\n new_group['id'])\n self.assignment_api.create_grant(\n group_id=new_group['id'],\n project_id=self.tenant_bar['id'],\n role_id=self.role_admin['id'])\n\n # Get a scoped token for the tenant\n body_dict = _build_user_auth(\n username='FOO',\n password='foo2',\n tenant_name=\"BAR\")\n\n scoped_token = self.controller.authenticate({}, body_dict)\n\n tenant = scoped_token[\"access\"][\"token\"][\"tenant\"]\n roles = scoped_token[\"access\"][\"metadata\"][\"roles\"]\n self.assertEqual(self.tenant_bar['id'], tenant[\"id\"])\n self.assertIn(self.role_member['id'], roles)\n self.assertIn(self.role_admin['id'], roles)\n\n def test_auth_token_cross_domain_group_and_project(self):\n \"\"\"Verify getting a token in cross domain group/project roles.\"\"\"\n # create domain, project and group and grant roles to user\n domain1 = {'id': uuid.uuid4().hex, 'name': uuid.uuid4().hex}\n self.assignment_api.create_domain(domain1['id'], domain1)\n project1 = {'id': uuid.uuid4().hex, 'name': uuid.uuid4().hex,\n 'domain_id': domain1['id']}\n self.assignment_api.create_project(project1['id'], project1)\n role_foo_domain1 = {'id': uuid.uuid4().hex,\n 'name': uuid.uuid4().hex}\n self.assignment_api.create_role(role_foo_domain1['id'],\n role_foo_domain1)\n role_group_domain1 = {'id': uuid.uuid4().hex,\n 'name': uuid.uuid4().hex}\n self.assignment_api.create_role(role_group_domain1['id'],\n role_group_domain1)\n self.assignment_api.add_user_to_project(project1['id'],\n self.user_foo['id'])\n new_group = {'id': uuid.uuid4().hex, 'domain_id': domain1['id'],\n 'name': uuid.uuid4().hex}\n self.identity_api.create_group(new_group['id'], new_group)\n self.identity_api.add_user_to_group(self.user_foo['id'],\n new_group['id'])\n self.assignment_api.create_grant(\n user_id=self.user_foo['id'],\n project_id=project1['id'],\n role_id=self.role_member['id'])\n self.assignment_api.create_grant(\n group_id=new_group['id'],\n project_id=project1['id'],\n role_id=self.role_admin['id'])\n self.assignment_api.create_grant(\n user_id=self.user_foo['id'],\n domain_id=domain1['id'],\n role_id=role_foo_domain1['id'])\n self.assignment_api.create_grant(\n group_id=new_group['id'],\n domain_id=domain1['id'],\n role_id=role_group_domain1['id'])\n\n # Get a scoped token for the tenant\n body_dict = _build_user_auth(\n username=self.user_foo['name'],\n password=self.user_foo['password'],\n tenant_name=project1['name'])\n\n scoped_token = self.controller.authenticate({}, body_dict)\n tenant = scoped_token[\"access\"][\"token\"][\"tenant\"]\n roles = scoped_token[\"access\"][\"metadata\"][\"roles\"]\n self.assertEqual(project1['id'], tenant[\"id\"])\n self.assertIn(self.role_member['id'], roles)\n self.assertIn(self.role_admin['id'], roles)\n self.assertNotIn(role_foo_domain1['id'], roles)\n self.assertNotIn(role_group_domain1['id'], roles)\n\n def test_belongs_to_no_tenant(self):\n r = self.controller.authenticate(\n {},\n auth={\n 'passwordCredentials': {\n 'username': self.user_foo['name'],\n 'password': self.user_foo['password']\n }\n })\n unscoped_token_id = r['access']['token']['id']\n self.assertRaises(\n exception.Unauthorized,\n self.controller.validate_token,\n dict(is_admin=True, query_string={'belongsTo': 'BAR'}),\n token_id=unscoped_token_id)\n\n def test_belongs_to(self):\n body_dict = _build_user_auth(\n username='FOO',\n password='foo2',\n tenant_name=\"BAR\")\n\n scoped_token = self.controller.authenticate({}, body_dict)\n scoped_token_id = scoped_token['access']['token']['id']\n\n self.assertRaises(\n exception.Unauthorized,\n self.controller.validate_token,\n dict(is_admin=True, query_string={'belongsTo': 'me'}),\n token_id=scoped_token_id)\n\n self.assertRaises(\n exception.Unauthorized,\n self.controller.validate_token,\n dict(is_admin=True, query_string={'belongsTo': 'BAR'}),\n token_id=scoped_token_id)\n\n def test_token_auth_with_binding(self):\n self.config_fixture.config(group='token', bind=['kerberos'])\n body_dict = _build_user_auth()\n unscoped_token = self.controller.authenticate(\n self.context_with_remote_user, body_dict)\n\n # the token should have bind information in it\n bind = unscoped_token['access']['token']['bind']\n self.assertEqual('FOO', bind['kerberos'])\n\n body_dict = _build_user_auth(\n token=unscoped_token['access']['token'],\n tenant_name='BAR')\n\n # using unscoped token without remote user context fails\n self.assertRaises(\n exception.Unauthorized,\n self.controller.authenticate,\n self.empty_context, body_dict)\n\n # using token with remote user context succeeds\n scoped_token = self.controller.authenticate(\n self.context_with_remote_user, body_dict)\n\n # the bind information should be carried over from the original token\n bind = scoped_token['access']['token']['bind']\n self.assertEqual('FOO', bind['kerberos'])\n\n def test_deleting_role_revokes_token(self):\n role_controller = assignment.controllers.Role()\n project1 = {'id': 'Project1', 'name': uuid.uuid4().hex,\n 'domain_id': DEFAULT_DOMAIN_ID}\n self.assignment_api.create_project(project1['id'], project1)\n role_one = {'id': 'role_one', 'name': uuid.uuid4().hex}\n self.assignment_api.create_role(role_one['id'], role_one)\n self.assignment_api.add_role_to_user_and_project(\n self.user_foo['id'], project1['id'], role_one['id'])\n no_context = {}\n\n # Get a scoped token for the tenant\n body_dict = _build_user_auth(\n username=self.user_foo['name'],\n password=self.user_foo['password'],\n tenant_name=project1['name'])\n token = self.controller.authenticate(no_context, body_dict)\n # Ensure it is valid\n token_id = token['access']['token']['id']\n self.controller.validate_token(\n dict(is_admin=True, query_string={}),\n token_id=token_id)\n\n # Delete the role, which should invalidate the token\n role_controller.delete_role(\n dict(is_admin=True, query_string={}), role_one['id'])\n\n # Check the token is now invalid\n self.assertRaises(\n exception.TokenNotFound,\n self.controller.validate_token,\n dict(is_admin=True, query_string={}),\n token_id=token_id)\n\n\nclass AuthWithPasswordCredentials(AuthTest):\n def setUp(self):\n super(AuthWithPasswordCredentials, self).setUp()\n\n def test_auth_invalid_user(self):\n \"\"\"Verify exception is raised if invalid user.\"\"\"\n body_dict = _build_user_auth(\n username=uuid.uuid4().hex,\n password=uuid.uuid4().hex)\n self.assertRaises(\n exception.Unauthorized,\n self.controller.authenticate,\n {}, body_dict)\n\n def test_auth_valid_user_invalid_password(self):\n \"\"\"Verify exception is raised if invalid password.\"\"\"\n body_dict = _build_user_auth(\n username=\"FOO\",\n password=uuid.uuid4().hex)\n self.assertRaises(\n exception.Unauthorized,\n self.controller.authenticate,\n {}, body_dict)\n\n def test_auth_empty_password(self):\n \"\"\"Verify exception is raised if empty password.\"\"\"\n body_dict = _build_user_auth(\n username=\"FOO\",\n password=\"\")\n self.assertRaises(\n exception.Unauthorized,\n self.controller.authenticate,\n {}, body_dict)\n\n def test_auth_no_password(self):\n \"\"\"Verify exception is raised if empty password.\"\"\"\n body_dict = _build_user_auth(username=\"FOO\")\n self.assertRaises(\n exception.ValidationError,\n self.controller.authenticate,\n {}, body_dict)\n\n def test_authenticate_blank_password_credentials(self):\n \"\"\"Sending empty dict as passwordCredentials raises a 400 error.\"\"\"\n body_dict = {'passwordCredentials': {}, 'tenantName': 'demo'}\n self.assertRaises(exception.ValidationError,\n self.controller.authenticate,\n {}, body_dict)\n\n def test_authenticate_no_username(self):\n \"\"\"Verify skipping username raises the right exception.\"\"\"\n body_dict = _build_user_auth(password=\"pass\",\n tenant_name=\"demo\")\n self.assertRaises(exception.ValidationError,\n self.controller.authenticate,\n {}, body_dict)\n\n def test_bind_without_remote_user(self):\n self.config_fixture.config(group='token', bind=['kerberos'])\n body_dict = _build_user_auth(username='FOO', password='foo2',\n tenant_name='BAR')\n token = self.controller.authenticate({}, body_dict)\n self.assertNotIn('bind', token['access']['token'])\n\n def test_change_default_domain_id(self):\n # If the default_domain_id config option is not the default then the\n # user in auth data is from the new default domain.\n\n # 1) Create a new domain.\n new_domain_id = uuid.uuid4().hex\n new_domain = {\n 'description': uuid.uuid4().hex,\n 'enabled': True,\n 'id': new_domain_id,\n 'name': uuid.uuid4().hex,\n }\n\n self.assignment_api.create_domain(new_domain_id, new_domain)\n\n # 2) Create user \"foo\" in new domain with different password than\n # default-domain foo.\n new_user_id = uuid.uuid4().hex\n new_user_password = uuid.uuid4().hex\n new_user = {\n 'id': new_user_id,\n 'name': self.user_foo['name'],\n 'domain_id': new_domain_id,\n 'password': new_user_password,\n 'email': 'foo@bar2.com',\n }\n\n self.identity_api.create_user(new_user_id, new_user)\n\n # 3) Update the default_domain_id config option to the new domain\n\n self.config_fixture.config(group='identity',\n default_domain_id=new_domain_id)\n\n # 4) Authenticate as \"foo\" using the password in the new domain.\n\n body_dict = _build_user_auth(\n username=self.user_foo['name'],\n password=new_user_password)\n\n # The test is successful if this doesn't raise, so no need to assert.\n self.controller.authenticate({}, body_dict)\n\n\nclass AuthWithRemoteUser(AuthTest):\n def setUp(self):\n super(AuthWithRemoteUser, self).setUp()\n\n def test_unscoped_remote_authn(self):\n \"\"\"Verify getting an unscoped token with external authn.\"\"\"\n body_dict = _build_user_auth(\n username='FOO',\n password='foo2')\n local_token = self.controller.authenticate(\n {}, body_dict)\n\n body_dict = _build_user_auth()\n remote_token = self.controller.authenticate(\n self.context_with_remote_user, body_dict)\n\n self.assertEqualTokens(local_token, remote_token)\n\n def test_unscoped_remote_authn_jsonless(self):\n \"\"\"Verify that external auth with invalid request fails.\"\"\"\n self.assertRaises(\n exception.ValidationError,\n self.controller.authenticate,\n {'REMOTE_USER': 'FOO'},\n None)\n\n def test_scoped_remote_authn(self):\n \"\"\"Verify getting a token with external authn.\"\"\"\n body_dict = _build_user_auth(\n username='FOO',\n password='foo2',\n tenant_name='BAR')\n local_token = self.controller.authenticate(\n {}, body_dict)\n\n body_dict = _build_user_auth(\n tenant_name='BAR')\n remote_token = self.controller.authenticate(\n self.context_with_remote_user, body_dict)\n\n self.assertEqualTokens(local_token, remote_token)\n\n def test_scoped_nometa_remote_authn(self):\n \"\"\"Verify getting a token with external authn and no metadata.\"\"\"\n body_dict = _build_user_auth(\n username='TWO',\n password='two2',\n tenant_name='BAZ')\n local_token = self.controller.authenticate(\n {}, body_dict)\n\n body_dict = _build_user_auth(tenant_name='BAZ')\n remote_token = self.controller.authenticate(\n {'environment': {'REMOTE_USER': 'TWO'}}, body_dict)\n\n self.assertEqualTokens(local_token, remote_token)\n\n def test_scoped_remote_authn_invalid_user(self):\n \"\"\"Verify that external auth with invalid user fails.\"\"\"\n body_dict = _build_user_auth(tenant_name=\"BAR\")\n self.assertRaises(\n exception.Unauthorized,\n self.controller.authenticate,\n {'environment': {'REMOTE_USER': uuid.uuid4().hex}},\n body_dict)\n\n def test_bind_with_kerberos(self):\n self.config_fixture.config(group='token', bind=['kerberos'])\n body_dict = _build_user_auth(tenant_name=\"BAR\")\n token = self.controller.authenticate(self.context_with_remote_user,\n body_dict)\n self.assertEqual('FOO', token['access']['token']['bind']['kerberos'])\n\n def test_bind_without_config_opt(self):\n self.config_fixture.config(group='token', bind=['x509'])\n body_dict = _build_user_auth(tenant_name='BAR')\n token = self.controller.authenticate(self.context_with_remote_user,\n body_dict)\n self.assertNotIn('bind', token['access']['token'])\n\n\nclass AuthWithTrust(AuthTest):\n def setUp(self):\n super(AuthWithTrust, self).setUp()\n\n trust.Manager()\n self.trust_controller = trust.controllers.TrustV3()\n self.auth_v3_controller = auth.controllers.Auth()\n self.trustor = self.user_foo\n self.trustee = self.user_two\n self.assigned_roles = [self.role_member['id'],\n self.role_browser['id']]\n for assigned_role in self.assigned_roles:\n self.assignment_api.add_role_to_user_and_project(\n self.trustor['id'], self.tenant_bar['id'], assigned_role)\n\n self.sample_data = {'trustor_user_id': self.trustor['id'],\n 'trustee_user_id': self.trustee['id'],\n 'project_id': self.tenant_bar['id'],\n 'impersonation': True,\n 'roles': [{'id': self.role_browser['id']},\n {'name': self.role_member['name']}]}\n expires_at = timeutils.strtime(timeutils.utcnow() +\n datetime.timedelta(minutes=10),\n fmt=TIME_FORMAT)\n self.create_trust(expires_at=expires_at)\n\n def config_overrides(self):\n super(AuthWithTrust, self).config_overrides()\n self.config_fixture.config(group='trust', enabled=True)\n\n def _create_auth_context(self, token_id):\n token_ref = self.token_api.get_token(token_id)\n auth_context = authorization.token_to_auth_context(\n token_ref['token_data'])\n return {'environment': {authorization.AUTH_CONTEXT_ENV: auth_context},\n 'token_id': token_id,\n 'host_url': HOST_URL}\n\n def create_trust(self, expires_at=None, impersonation=True):\n username = self.trustor['name']\n password = 'foo2'\n body_dict = _build_user_auth(username=username, password=password)\n self.unscoped_token = self.controller.authenticate({}, body_dict)\n context = self._create_auth_context(\n self.unscoped_token['access']['token']['id'])\n trust_data = copy.deepcopy(self.sample_data)\n trust_data['expires_at'] = expires_at\n trust_data['impersonation'] = impersonation\n\n self.new_trust = self.trust_controller.create_trust(\n context, trust=trust_data)['trust']\n\n def build_v2_token_request(self, username, password):\n body_dict = _build_user_auth(username=username, password=password)\n self.unscoped_token = self.controller.authenticate({}, body_dict)\n unscoped_token_id = self.unscoped_token['access']['token']['id']\n request_body = _build_user_auth(token={'id': unscoped_token_id},\n trust_id=self.new_trust['id'],\n tenant_id=self.tenant_bar['id'])\n return request_body\n\n def test_create_trust_bad_data_fails(self):\n context = self._create_auth_context(\n self.unscoped_token['access']['token']['id'])\n bad_sample_data = {'trustor_user_id': self.trustor['id'],\n 'project_id': self.tenant_bar['id'],\n 'roles': [{'id': self.role_browser['id']}]}\n\n self.assertRaises(exception.ValidationError,\n self.trust_controller.create_trust,\n context, trust=bad_sample_data)\n\n def test_create_trust_no_roles(self):\n context = {'token_id': self.unscoped_token['access']['token']['id']}\n self.sample_data['roles'] = []\n self.assertRaises(exception.Forbidden,\n self.trust_controller.create_trust,\n context, trust=self.sample_data)\n\n def test_create_trust(self):\n self.assertEqual(self.trustor['id'], self.new_trust['trustor_user_id'])\n self.assertEqual(self.trustee['id'], self.new_trust['trustee_user_id'])\n role_ids = [self.role_browser['id'], self.role_member['id']]\n self.assertTrue(timeutils.parse_strtime(self.new_trust['expires_at'],\n fmt=TIME_FORMAT))\n self.assertIn('%s/v3/OS-TRUST/' % HOST_URL,\n self.new_trust['links']['self'])\n self.assertIn('%s/v3/OS-TRUST/' % HOST_URL,\n self.new_trust['roles_links']['self'])\n\n for role in self.new_trust['roles']:\n self.assertIn(role['id'], role_ids)\n\n def test_create_trust_expires_bad(self):\n self.assertRaises(exception.ValidationTimeStampError,\n self.create_trust,\n expires_at=\"bad\")\n self.assertRaises(exception.ValidationTimeStampError,\n self.create_trust,\n expires_at=\"\")\n self.assertRaises(exception.ValidationTimeStampError,\n self.create_trust,\n expires_at=\"Z\")\n\n def test_get_trust(self):\n context = {'token_id': self.unscoped_token['access']['token']['id'],\n 'host_url': HOST_URL}\n trust = self.trust_controller.get_trust(context,\n self.new_trust['id'])['trust']\n self.assertEqual(self.trustor['id'], trust['trustor_user_id'])\n self.assertEqual(self.trustee['id'], trust['trustee_user_id'])\n role_ids = [self.role_browser['id'], self.role_member['id']]\n for role in self.new_trust['roles']:\n self.assertIn(role['id'], role_ids)\n\n def test_create_trust_no_impersonation(self):\n self.create_trust(expires_at=None, impersonation=False)\n self.assertEqual(self.trustor['id'], self.new_trust['trustor_user_id'])\n self.assertEqual(self.trustee['id'], self.new_trust['trustee_user_id'])\n self.assertIs(self.new_trust['impersonation'], False)\n auth_response = self.fetch_v2_token_from_trust()\n token_user = auth_response['access']['user']\n self.assertEqual(token_user['id'], self.new_trust['trustee_user_id'])\n\n # TODO(ayoung): Endpoints\n\n def test_create_trust_impersonation(self):\n self.create_trust(expires_at=None)\n self.assertEqual(self.trustor['id'], self.new_trust['trustor_user_id'])\n self.assertEqual(self.trustee['id'], self.new_trust['trustee_user_id'])\n self.assertIs(self.new_trust['impersonation'], True)\n auth_response = self.fetch_v2_token_from_trust()\n token_user = auth_response['access']['user']\n self.assertEqual(token_user['id'], self.new_trust['trustor_user_id'])\n\n def test_token_from_trust_wrong_user_fails(self):\n request_body = self.build_v2_token_request('FOO', 'foo2')\n self.assertRaises(\n exception.Forbidden,\n self.controller.authenticate, {}, request_body)\n\n def fetch_v2_token_from_trust(self):\n request_body = self.build_v2_token_request('TWO', 'two2')\n auth_response = self.controller.authenticate({}, request_body)\n return auth_response\n\n def fetch_v3_token_from_trust(self):\n v3_password_data = {\n 'identity': {\n \"methods\": [\"password\"],\n \"password\": {\n \"user\": {\n \"id\": self.trustee[\"id\"],\n \"password\": self.trustee[\"password\"]}}\n },\n 'scope': {\n 'project': {\n 'id': self.tenant_baz['id']}}}\n auth_response = (self.auth_v3_controller.authenticate_for_token\n ({'environment': {},\n 'query_string': {}},\n v3_password_data))\n token = auth_response.headers['X-Subject-Token']\n\n v3_req_with_trust = {\n \"identity\": {\n \"methods\": [\"token\"],\n \"token\": {\"id\": token}},\n \"scope\": {\n \"OS-TRUST:trust\": {\"id\": self.new_trust['id']}}}\n token_auth_response = (self.auth_v3_controller.authenticate_for_token\n ({'environment': {},\n 'query_string': {}},\n v3_req_with_trust))\n return token_auth_response\n\n def test_create_v3_token_from_trust(self):\n auth_response = self.fetch_v3_token_from_trust()\n\n trust_token_user = auth_response.json['token']['user']\n self.assertEqual(self.trustor['id'], trust_token_user['id'])\n\n trust_token_trust = auth_response.json['token']['OS-TRUST:trust']\n self.assertEqual(trust_token_trust['id'], self.new_trust['id'])\n self.assertEqual(self.trustor['id'],\n trust_token_trust['trustor_user']['id'])\n self.assertEqual(self.trustee['id'],\n trust_token_trust['trustee_user']['id'])\n\n trust_token_roles = auth_response.json['token']['roles']\n self.assertEqual(2, len(trust_token_roles))\n\n def test_v3_trust_token_get_token_fails(self):\n auth_response = self.fetch_v3_token_from_trust()\n trust_token = auth_response.headers['X-Subject-Token']\n v3_token_data = {'identity': {\n 'methods': ['token'],\n 'token': {'id': trust_token}\n }}\n self.assertRaises(\n exception.Forbidden,\n self.auth_v3_controller.authenticate_for_token,\n {'environment': {},\n 'query_string': {}}, v3_token_data)\n\n def test_token_from_trust(self):\n auth_response = self.fetch_v2_token_from_trust()\n\n self.assertIsNotNone(auth_response)\n self.assertEqual(2,\n len(auth_response['access']['metadata']['roles']),\n \"user_foo has three roles, but the token should\"\n \" only get the two roles specified in the trust.\")\n\n def assert_token_count_for_trust(self, expected_value):\n tokens = self.trust_controller.token_api._list_tokens(\n self.trustee['id'], trust_id=self.new_trust['id'])\n token_count = len(tokens)\n self.assertEqual(expected_value, token_count)\n\n def test_delete_tokens_for_user_invalidates_tokens_from_trust(self):\n self.assert_token_count_for_trust(0)\n self.fetch_v2_token_from_trust()\n self.assert_token_count_for_trust(1)\n self.token_api.delete_tokens_for_user(self.trustee['id'])\n self.assert_token_count_for_trust(0)\n\n def test_token_from_trust_cant_get_another_token(self):\n auth_response = self.fetch_v2_token_from_trust()\n trust_token_id = auth_response['access']['token']['id']\n request_body = _build_user_auth(token={'id': trust_token_id},\n tenant_id=self.tenant_bar['id'])\n self.assertRaises(\n exception.Forbidden,\n self.controller.authenticate, {}, request_body)\n\n def test_delete_trust_revokes_token(self):\n context = self._create_auth_context(\n self.unscoped_token['access']['token']['id'])\n self.fetch_v2_token_from_trust()\n trust_id = self.new_trust['id']\n tokens = self.token_api._list_tokens(self.trustor['id'],\n trust_id=trust_id)\n self.assertEqual(1, len(tokens))\n self.trust_controller.delete_trust(context, trust_id=trust_id)\n tokens = self.token_api._list_tokens(self.trustor['id'],\n trust_id=trust_id)\n self.assertEqual(0, len(tokens))\n\n def test_token_from_trust_with_no_role_fails(self):\n for assigned_role in self.assigned_roles:\n self.assignment_api.remove_role_from_user_and_project(\n self.trustor['id'], self.tenant_bar['id'], assigned_role)\n request_body = self.build_v2_token_request('TWO', 'two2')\n self.assertRaises(\n exception.Forbidden,\n self.controller.authenticate, {}, request_body)\n\n def test_expired_trust_get_token_fails(self):\n expiry = \"1999-02-18T10:10:00Z\"\n self.create_trust(expiry)\n request_body = self.build_v2_token_request('TWO', 'two2')\n self.assertRaises(\n exception.Forbidden,\n self.controller.authenticate, {}, request_body)\n\n def test_token_from_trust_with_wrong_role_fails(self):\n self.assignment_api.add_role_to_user_and_project(\n self.trustor['id'],\n self.tenant_bar['id'],\n self.role_other['id'])\n for assigned_role in self.assigned_roles:\n self.assignment_api.remove_role_from_user_and_project(\n self.trustor['id'], self.tenant_bar['id'], assigned_role)\n\n request_body = self.build_v2_token_request('TWO', 'two2')\n\n self.assertRaises(\n exception.Forbidden,\n self.controller.authenticate, {}, request_body)\n\n\nclass TokenExpirationTest(AuthTest):\n\n @mock.patch.object(timeutils, 'utcnow')\n def _maintain_token_expiration(self, mock_utcnow):\n \"\"\"Token expiration should be maintained after re-auth & validation.\"\"\"\n now = datetime.datetime.utcnow()\n mock_utcnow.return_value = now\n\n r = self.controller.authenticate(\n {},\n auth={\n 'passwordCredentials': {\n 'username': self.user_foo['name'],\n 'password': self.user_foo['password']\n }\n })\n unscoped_token_id = r['access']['token']['id']\n original_expiration = r['access']['token']['expires']\n\n mock_utcnow.return_value = now + datetime.timedelta(seconds=1)\n\n r = self.controller.validate_token(\n dict(is_admin=True, query_string={}),\n token_id=unscoped_token_id)\n self.assertEqual(original_expiration, r['access']['token']['expires'])\n\n mock_utcnow.return_value = now + datetime.timedelta(seconds=2)\n\n r = self.controller.authenticate(\n {},\n auth={\n 'token': {\n 'id': unscoped_token_id,\n },\n 'tenantId': self.tenant_bar['id'],\n })\n scoped_token_id = r['access']['token']['id']\n self.assertEqual(original_expiration, r['access']['token']['expires'])\n\n mock_utcnow.return_value = now + datetime.timedelta(seconds=3)\n\n r = self.controller.validate_token(\n dict(is_admin=True, query_string={}),\n token_id=scoped_token_id)\n self.assertEqual(original_expiration, r['access']['token']['expires'])\n\n def test_maintain_uuid_token_expiration(self):\n self.config_fixture.config(group='signing', token_format='UUID')\n self._maintain_token_expiration()\n\n\nclass AuthCatalog(tests.SQLDriverOverrides, AuthTest):\n \"\"\"Tests for the catalog provided in the auth response.\"\"\"\n\n def config_files(self):\n config_files = super(AuthCatalog, self).config_files()\n # We need to use a backend that supports disabled endpoints, like the\n # SQL backend.\n config_files.append(tests.dirs.tests_conf('backend_sql.conf'))\n return config_files\n\n def _create_endpoints(self):\n def create_endpoint(service_id, region, **kwargs):\n id_ = uuid.uuid4().hex\n ref = {\n 'id': id_,\n 'interface': 'public',\n 'region': region,\n 'service_id': service_id,\n 'url': 'http://localhost/%s' % uuid.uuid4().hex,\n }\n ref.update(kwargs)\n self.catalog_api.create_endpoint(id_, ref)\n return ref\n\n # Create a service for use with the endpoints.\n def create_service(**kwargs):\n id_ = uuid.uuid4().hex\n ref = {\n 'id': id_,\n 'name': uuid.uuid4().hex,\n 'type': uuid.uuid4().hex,\n }\n ref.update(kwargs)\n self.catalog_api.create_service(id_, ref)\n return ref\n\n enabled_service_ref = create_service(enabled=True)\n disabled_service_ref = create_service(enabled=False)\n\n region = uuid.uuid4().hex\n\n # Create endpoints\n enabled_endpoint_ref = create_endpoint(\n enabled_service_ref['id'], region)\n create_endpoint(\n enabled_service_ref['id'], region, enabled=False,\n interface='internal')\n create_endpoint(\n disabled_service_ref['id'], region)\n\n return enabled_endpoint_ref\n\n def test_auth_catalog_disabled_endpoint(self):\n \"\"\"On authenticate, get a catalog that excludes disabled endpoints.\"\"\"\n endpoint_ref = self._create_endpoints()\n\n # Authenticate\n body_dict = _build_user_auth(\n username='FOO',\n password='foo2',\n tenant_name=\"BAR\")\n\n token = self.controller.authenticate({}, body_dict)\n\n # Check the catalog\n self.assertEqual(1, len(token['access']['serviceCatalog']))\n endpoint = token['access']['serviceCatalog'][0]['endpoints'][0]\n self.assertEqual(\n 1, len(token['access']['serviceCatalog'][0]['endpoints']))\n\n exp_endpoint = {\n 'id': endpoint_ref['id'],\n 'publicURL': endpoint_ref['url'],\n 'region': endpoint_ref['region'],\n }\n\n self.assertEqual(exp_endpoint, endpoint)\n\n def test_validate_catalog_disabled_endpoint(self):\n \"\"\"On validate, get back a catalog that excludes disabled endpoints.\"\"\"\n endpoint_ref = self._create_endpoints()\n\n # Authenticate\n body_dict = _build_user_auth(\n username='FOO',\n password='foo2',\n tenant_name=\"BAR\")\n\n token = self.controller.authenticate({}, body_dict)\n\n # Validate\n token_id = token['access']['token']['id']\n validate_ref = self.controller.validate_token(\n dict(is_admin=True, query_string={}),\n token_id=token_id)\n\n # Check the catalog\n self.assertEqual(1, len(token['access']['serviceCatalog']))\n endpoint = validate_ref['access']['serviceCatalog'][0]['endpoints'][0]\n self.assertEqual(\n 1, len(token['access']['serviceCatalog'][0]['endpoints']))\n\n exp_endpoint = {\n 'id': endpoint_ref['id'],\n 'publicURL': endpoint_ref['url'],\n 'region': endpoint_ref['region'],\n }\n\n self.assertEqual(exp_endpoint, endpoint)\n\n\nclass NonDefaultAuthTest(tests.TestCase):\n\n def test_add_non_default_auth_method(self):\n self.config_fixture.config(group='auth',\n methods=['password', 'token', 'custom'])\n config.setup_authentication()\n self.assertTrue(hasattr(CONF.auth, 'custom'))\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":159340296657682560,"string":"159,340,296,657,682,560"},"line_mean":{"kind":"number","value":39.8391224863,"string":"39.839122"},"line_max":{"kind":"number","value":79,"string":"79"},"alpha_frac":{"kind":"number","value":0.5754062402,"string":"0.575406"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.143758115377481,"string":"4.143758"},"config_test":{"kind":"bool","value":true,"string":"true"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44996,"cells":{"repo_name":{"kind":"string","value":"kritak/textdungeon"},"path":{"kind":"string","value":"Internal/pricerandomtester.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1114"},"content":{"kind":"string","value":"\"\"\"testing random frequency of items based on price for item.\n a cheap item is more common, a expensive item is very rare\"\"\"\n\nimport random\n\nd = {\"healing\":50, \n \"berserk\":60,\n \"clever\":100,\n \"swiftness\":100,\n \"might\":100,\n \"awesomeness\":500,\n }\n \n# reverse d\n\ndr = [[1/b,a] for [a,b] in d.items()] # list of [price, drinkname]\ndr.sort() # sort this list by price\npricelist1 = [a for [a,b] in dr] # list of price only\ndrinklist = [b for [a,b] in dr] # list of drinkname only\npricelist2 = [] # list of added up prices\nkprice = 0\nfor p in pricelist1:\n kprice += p\n pricelist2.append(kprice)\n \n\nprint(pricelist1, pricelist2)\n\nresult = {}\nprint(\"calculating please wait...\")\nfor x in range(10000):\n \n \n y = random.random()*(pricelist2[-1]) # 1 to maxprice\n for p in pricelist2:\n if y < p:\n drinkname = drinklist[pricelist2.index(p)]\n if drinkname in result:\n result[drinkname] += 1\n else:\n result[drinkname] = 1\n break\nprint(result)\n"},"license":{"kind":"string","value":"gpl-2.0"},"hash":{"kind":"number","value":-7916032930120072000,"string":"-7,916,032,930,120,072,000"},"line_mean":{"kind":"number","value":24.9069767442,"string":"24.906977"},"line_max":{"kind":"number","value":66,"string":"66"},"alpha_frac":{"kind":"number","value":0.5619389587,"string":"0.561939"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.375757575757576,"string":"3.375758"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44997,"cells":{"repo_name":{"kind":"string","value":"unt-libraries/django-name"},"path":{"kind":"string","value":"name/api/serializers.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"6208"},"content":{"kind":"string","value":"\"\"\"Serializers for the Name App Models.\n\nThis module leverages the Django Rest Framework's Serializer\ncomponents to build JSON representations of the models defined\nin this app.\n\nThese JSON representations are designed to be backwards compatible\nwith the API documented in previous versions.\n\nFor documentation regarding the Django Rest Framework Serializers go\nto http://www.django-rest-framework.org/api-guide/serializers/\n\"\"\"\n\nfrom rest_framework import serializers\nfrom .. import models\n\n\nclass IdentifierSerializer(serializers.ModelSerializer):\n \"\"\"Serializer for the Identifier Model.\n\n The following fields have been renamed for backwards compatibility\n with previous versions of the API.\n label -> identifier.type\n href -> identifier.value\n \"\"\"\n label = serializers.StringRelatedField(source='type')\n href = serializers.CharField(source='value')\n\n class Meta:\n model = models.Identifier\n fields = ('label', 'href')\n\n\nclass NoteSerializer(serializers.ModelSerializer):\n \"\"\"Serializer for the Note Model.\"\"\"\n type = serializers.SerializerMethodField()\n\n class Meta:\n model = models.Note\n fields = ('note', 'type')\n\n def get_type(self, obj):\n \"\"\"Sets the type field.\n\n Returns the Note Type label, instead of the Note Type ID, which\n is the default behavior.\n \"\"\"\n return obj.get_note_type_label().lower()\n\n\nclass VariantSerializer(serializers.ModelSerializer):\n \"\"\"Serializer for the Variant Model.\"\"\"\n type = serializers.SerializerMethodField()\n\n class Meta:\n model = models.Variant\n fields = ('variant', 'type')\n\n def get_type(self, obj):\n \"\"\"Sets the type field.\n\n Returns the Variant Type label, instead of the Variant Type ID,\n which is the default behavior.\n \"\"\"\n return obj.get_variant_type_label().lower()\n\n\nclass NameSerializer(serializers.ModelSerializer):\n \"\"\"Serializer for the Name Model.\n\n This serializes the the Name model to include detailed information\n about the object, including the related Variants, Notes, and\n Identifiers.\n\n The following fields have been renamed for backwards compatibility\n with previous versions of the API.\n authoritative_name -> name.name\n begin_date -> name.begin\n end_date -> name.end\n\n The identifier field is the absolute url to the name detail\n page for the model instance.\n \"\"\"\n authoritative_name = serializers.CharField(source='name')\n begin_date = serializers.CharField(source='begin')\n name_type = serializers.SerializerMethodField()\n end_date = serializers.CharField(source='end')\n links = IdentifierSerializer(many=True, source='identifier_set')\n notes = NoteSerializer(many=True, source='note_set')\n variants = VariantSerializer(many=True, source='variant_set')\n identifier = serializers.HyperlinkedIdentityField(\n view_name='name:detail', lookup_field='name_id')\n\n class Meta:\n model = models.Name\n fields = ('authoritative_name', 'name_type', 'begin_date', 'end_date',\n 'identifier', 'links', 'notes', 'variants',)\n\n def get_name_type(self, obj):\n \"\"\"Sets the name_type field.\n\n Returns the Name Type label, instead of the Name Type ID, which\n is the default behavior.\n \"\"\"\n return obj.get_name_type_label().lower()\n\n\nclass NameSearchSerializer(serializers.ModelSerializer):\n \"\"\"Name Model Serializer for the Name search/autocompletion\n endpoint.\n\n The following fields have been renamed for backwards compatibility\n with previous versions of the API.\n begin_date -> name.begin\n type -> name.get_name_type_label()\n label -> Formats name.name and name.disambiguation.\n\n The URL field is the absolute url to the name detail page for\n the model instance.\n \"\"\"\n begin_date = serializers.CharField(source='begin')\n type = serializers.SerializerMethodField()\n label = serializers.SerializerMethodField()\n URL = serializers.HyperlinkedIdentityField(\n view_name='name:detail', lookup_field='name_id')\n\n class Meta:\n model = models.Name\n fields = ('id', 'name', 'label', 'type', 'begin_date',\n 'disambiguation', 'URL')\n\n def get_type(self, obj):\n \"\"\"Sets the type field.\n\n Returns the Name Type label, instead of the Name Type ID, which\n is the default behavior.\n \"\"\"\n return obj.get_name_type_label().lower()\n\n def get_label(self, obj):\n \"\"\"Sets the label field.\n\n Returns a string in the form of\n \" ()\"\n \"\"\"\n if obj.disambiguation:\n return '{0} ({1})'.format(obj.name, obj.disambiguation)\n return obj.name\n\n\nclass LocationSerializer(serializers.ModelSerializer):\n \"\"\"Serailizer for the Locations Model.\n\n This includes the related Name via the belong_to_name field. The\n belong_to_name field uses the NameSerializer to nest the related\n Name model.\n \"\"\"\n belong_to_name = NameSerializer()\n\n class Meta:\n model = models.Location\n fields = '__all__'\n\n\nclass NameStatisticsMonthSerializer(serializers.Serializer):\n \"\"\"Serializer for the NameStatisticsMonth object.\"\"\"\n total = serializers.IntegerField()\n total_to_date = serializers.IntegerField()\n month = serializers.DateTimeField()\n\n\nclass NameStatisticsTypeSerializer(serializers.Serializer):\n \"\"\"Serializer for the NameStatisticsType object.\n\n This serializer utilizes the NameStatisticsTypeMonth to serialize\n the NameStatisticsMonth instances that the object instance contains.\n \"\"\"\n running_total = serializers.IntegerField()\n stats = NameStatisticsMonthSerializer(many=True)\n\n\nclass NameStatisticsSerializer(serializers.Serializer):\n \"\"\"Serializer for the NameStatistics object.\n\n This serializer utilizes the NameStatisticsTypeSerializer to\n serialize the NameStatisticsType instances that the object instance\n contains.\n \"\"\"\n created = NameStatisticsTypeSerializer()\n modified = NameStatisticsTypeSerializer()\n name_type_totals = serializers.DictField()\n"},"license":{"kind":"string","value":"bsd-3-clause"},"hash":{"kind":"number","value":-1052281697192771800,"string":"-1,052,281,697,192,771,800"},"line_mean":{"kind":"number","value":31.502617801,"string":"31.502618"},"line_max":{"kind":"number","value":78,"string":"78"},"alpha_frac":{"kind":"number","value":0.6875,"string":"0.6875"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.568064753495217,"string":"4.568065"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44998,"cells":{"repo_name":{"kind":"string","value":"mithron/opendatahack"},"path":{"kind":"string","value":"web/main.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1805"},"content":{"kind":"string","value":"from datetime import datetime\nimport json\nimport os\nfrom urlparse import urlparse\nfrom pymongo.connection import Connection\n\nimport tornado.httpserver\nimport tornado.ioloop\nimport tornado.options\nimport tornado.web\n\nfrom tornado.options import define, options\n\n\nMONGO_URL = \"\" # found with $>heroku config\nwe_live = True\n\nclass Application(tornado.web.Application):\n def __init__(self):\n handlers = [\n (r\"/list/\", MainHandler),\n (r\"/([0-9]+)/\", SchoolHandler)\n ]\n settings = dict(\n autoescape=None,\n )\n tornado.web.Application.__init__(self, handlers, **settings)\n\n if we_live:\n self.con = Connection(MONGO_URL)\n self.database = self.con[urlparse(MONGO_URL).path[1:]]\n else:\n self.con = Connection('localhost', 27017)\n self.database = self.con[\"moscow\"]\n\n\nclass BaseHandler(tornado.web.RequestHandler):\n @property\n def db(self):\n return self.application.database\n\n\nclass SchoolHandler(BaseHandler):\n def get(self, inn=None):\n if inn:\n suppliers = list(self.db[\"suppliers\"].find({'inn': int(inn)}, fields={\"_id\": False}))\n self.write(json.dumps(suppliers, ensure_ascii=False, encoding='utf8'))\n else:\n self.write(\"[]\")\n\n\nclass MainHandler(BaseHandler):\n def get(self):\n schools = list(self.db[\"suppliers\"].find(fields={\"full_name\": True, \"inn\": True, \"_id\": False}))\n self.write(json.dumps(schools, ensure_ascii=False, encoding='utf8'))\n\n\ndef main():\n tornado.options.parse_command_line()\n http_server = tornado.httpserver.HTTPServer(Application())\n http_server.listen(int(os.environ.get(\"PORT\", 8888)))\n tornado.ioloop.IOLoop.instance().start()\n\n\nif __name__ == \"__main__\":\n main()"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":941218873183261400,"string":"941,218,873,183,261,400"},"line_mean":{"kind":"number","value":26.3636363636,"string":"26.363636"},"line_max":{"kind":"number","value":104,"string":"104"},"alpha_frac":{"kind":"number","value":0.6282548476,"string":"0.628255"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.7525987525987525,"string":"3.752599"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":44999,"cells":{"repo_name":{"kind":"string","value":"CloudBoltSoftware/cloudbolt-forge"},"path":{"kind":"string","value":"ui_extensions/veeam_admin_extension/restore_backup.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1717"},"content":{"kind":"string","value":"import requests\nimport time\nfrom xml.dom import minidom\n\nfrom common.methods import set_progress\nfrom xui.veeam.veeam_admin import VeeamManager\n\n\ndef run(server, *args, **kwargs):\n set_progress(f\"Starting Veeam Backup restoration... \")\n veeam = VeeamManager()\n server_ci = veeam.get_connection_info()\n url = f'http://{server_ci.ip}:9399/api/vmRestorePoints/' + \\\n kwargs.get('restore_point_href') + '?action=restore'\n session_id = veeam.get_veeam_server_session_id()\n header = {\"X-RestSvcSessionId\": session_id}\n\n response = requests.post(url=url, headers=header)\n task = minidom.parseString(response.content.decode('utf-8'))\n items = task.getElementsByTagName('Task')[0].attributes.items()\n restoration_url = [item for item in items if item[0] == 'Href'][0][-1]\n\n def check_state():\n\n response = requests.get(restoration_url, headers=header)\n\n dom = minidom.parseString(response.content.decode('utf-8'))\n state = dom.getElementsByTagName('State')[0]\n child = state.firstChild\n return child\n\n # Wait until the restoration to completed.\n\n while check_state().data == 'Running':\n # wait\n set_progress(\"Waiting for restoration to complete...\")\n time.sleep(10)\n\n if check_state().data == 'Finished':\n set_progress(\"Server restoration completed successfully\")\n return \"SUCCESS\", \"Server restoration completed successfully\", \"\"\n else:\n set_progress(\"Server restoration didn't complete successfully\")\n return \"FAILURE\", \"\", \"Server restoration didn't complete successfully\"\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":4563522579595640300,"string":"4,563,522,579,595,640,300"},"line_mean":{"kind":"number","value":38.0227272727,"string":"38.022727"},"line_max":{"kind":"number","value":83,"string":"83"},"alpha_frac":{"kind":"number","value":0.6301688992,"string":"0.630169"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.127403846153846,"string":"4.127404"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}}],"truncated":false,"partial":false},"paginationData":{"pageIndex":449,"numItemsPerPage":100,"numTotalItems":45404,"offset":44900,"length":100}},"jwt":"eyJhbGciOiJFZERTQSJ9.eyJyZWFkIjp0cnVlLCJwZXJtaXNzaW9ucyI6eyJyZXBvLmNvbnRlbnQucmVhZCI6dHJ1ZX0sImlhdCI6MTc1Njg5NTYwMCwic3ViIjoiL2RhdGFzZXRzL2NvZGVwYXJyb3QvY29kZXBhcnJvdC12YWxpZC12Mi1uZWFyLWRlZHVwIiwiZXhwIjoxNzU2ODk5MjAwLCJpc3MiOiJodHRwczovL2h1Z2dpbmdmYWNlLmNvIn0.A2Y86i5rMdZ_p2bEe2dtKP6o8QeDWvh-m4_dsyT0ZZIZ_4JauLu6PgAY7d7dE2MPDlPRx3bow23K3TgiUS33Bw","displayUrls":true},"discussionsStats":{"closed":1,"open":0,"total":1},"fullWidth":true,"hasGatedAccess":true,"hasFullAccess":true,"isEmbedded":false,"savedQueries":{"community":[],"user":[]}}">
repo_name
stringlengths
5
92
path
stringlengths
4
221
copies
stringclasses
19 values
size
stringlengths
4
6
content
stringlengths
766
896k
license
stringclasses
15 values
hash
int64
-9,223,277,421,539,062,000
9,223,102,107B
line_mean
float64
6.51
99.9
line_max
int64
32
997
alpha_frac
float64
0.25
0.96
autogenerated
bool
1 class
ratio
float64
1.5
13.6
config_test
bool
2 classes
has_no_keywords
bool
2 classes
few_assignments
bool
1 class
mgeorgehansen/FIFE_Technomage
engine/python/fife/extensions/fife_settings.py
1
15915
# -*- coding: utf-8 -*- # #################################################################### # Copyright (C) 2005-2010 by the FIFE team # http://www.fifengine.net # This file is part of FIFE. # # FIFE is free software; you can redistribute it and/or # modify it under the terms of the GNU Lesser General Public # License as published by the Free Software Foundation; either # version 2.1 of the License, or (at your option) any later version. # # This library is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU # Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public # License along with this library; if not, write to the # Free Software Foundation, Inc., # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA # #################################################################### """ Settings ================================== This module provides a nice framework for loading and saving game settings. It is by no means complete but it does provide a good starting point. """ import shutil import os from StringIO import StringIO from fife.extensions import pychan from fife.extensions.fife_utils import getUserDataDirectory from fife.extensions.serializers.simplexml import SimpleXMLSerializer SETTINGS_GUI_XML="""\ <Window name="Settings" title="Settings"> <Label text="Settings menu!" /> <HBox> <VBox> <Label text="Resolution:" /> <Label text="Renderer:" /> <Label text="Light Model:" /> </VBox> <VBox min_size="120,60"> <DropDown name="screen_resolution" min_size="120,0" /> <DropDown name="render_backend" min_size="120,0" /> <DropDown name="lighting_model" min_size="120,0" /> </VBox> </HBox> <CheckBox name="enable_fullscreen" text="Use the full screen mode" /> <CheckBox name="enable_sound" text="Enable sound" /> <HBox> <Spacer /> <Button name="cancelButton" text="Cancel" /> <Button name="okButton" text="Ok" /> <Button name="defaultButton" text="Defaults" /> </HBox> </Window> """ CHANGES_REQUIRE_RESTART="""\ <Window title="Changes require restart"> <Label text="Some of your changes require you to restart." /> <HBox> <Spacer /> <Button name="closeButton" text="Ok" /> </HBox> </Window> """ FIFE_MODULE = "FIFE" class Setting(object): """ This class manages loading and saving of game settings. Usage:: from fife.extensions.fife_settings import Setting settings = Setting(app_name="myapp") screen_width = settings.get("FIFE", "ScreenWidth", 1024) screen_height = settings.get("FIFE", "ScreenHeight", 768) """ def __init__(self, app_name="", settings_file="", default_settings_file= "settings-dist.xml", settings_gui_xml="", changes_gui_xml="", copy_dist=True, serializer=None): """ Initializes the Setting object. @param app_name: The applications name. If this parameter is provided alone it will try to read the settings file from the users home directory. In windows this will be something like: C:\Documents and Settings\user\Application Data\fife @type app_name: C{string} @param settings_file: The name of the settings file. If this parameter is provided it will look for the setting file as you specify it, first looking in the working directory. It will NOT look in the users home directory. @type settings_file: C{string} @param default_settings_file: The name of the default settings file. If the settings_file does not exist this file will be copied into the place of the settings_file. This file must exist in the root directory of your project! @type default_settings_file: C{string} @param settings_gui_xml: If you specify this parameter you can customize the look of the settings dialog box. @param copy_dist: Copies the default settings file to the settings_file location. If this is False it will create a new empty setting file. @param serializer: Overrides the default XML serializer @type serializer: C{SimpleSerializer} """ self._app_name = app_name self._settings_file = settings_file self._default_settings_file = default_settings_file self._settings_gui_xml = settings_gui_xml self._changes_gui_xml = changes_gui_xml self.OptionsDlg = None # Holds SettingEntries self._entries = {} if self._settings_file == "": self._settings_file = "settings.xml" self._appdata = getUserDataDirectory("fife", self._app_name) else: self._appdata = os.path.dirname(self._settings_file) self._settings_file = os.path.basename(self._settings_file) if self._settings_gui_xml == "": self._settings_gui_xml = SETTINGS_GUI_XML if self._changes_gui_xml == "": self._changes_gui_xml = CHANGES_REQUIRE_RESTART if not os.path.exists(os.path.join(self._appdata, self._settings_file)): if os.path.exists(self._default_settings_file) and copy_dist: shutil.copyfile(self._default_settings_file, os.path.join(self._appdata, self._settings_file)) #default settings self._resolutions = ['640x480', '800x600', '1024x768', '1280x800', '1440x900'] self._renderbackends = ['OpenGL', 'SDL'] self._lightingmodels = [0, 1, 2] #Used to stylize the options gui self._gui_style = "default" #Initialize the serializer if serializer: self._serializer = serializer else: self._serializer = SimpleXMLSerializer() self.initSerializer() self._initDefaultSettingEntries() def initSerializer(self): self._serializer.load(os.path.join(self._appdata, self._settings_file)) def _initDefaultSettingEntries(self): """Initializes the default fife setting entries. Not to be called from outside this class.""" self.createAndAddEntry(FIFE_MODULE, "PlaySounds", "enable_sound", requiresrestart=True) self.createAndAddEntry(FIFE_MODULE, "FullScreen", "enable_fullscreen", requiresrestart=True) self.createAndAddEntry(FIFE_MODULE, "ScreenResolution", "screen_resolution", initialdata = self._resolutions, requiresrestart=True) self.createAndAddEntry(FIFE_MODULE, "RenderBackend", "render_backend", initialdata = self._renderbackends, requiresrestart=True) self.createAndAddEntry(FIFE_MODULE, "Lighting", "lighting_model", initialdata = self._lightingmodels, requiresrestart=True) def createAndAddEntry(self, module, name, widgetname, applyfunction=None, initialdata=None, requiresrestart=False): """" @param module: The Setting module this Entry belongs to @type module: C{String} @param name: The Setting's name @type name: C{String} @param widgetname: The name of the widget that is used to change this setting @type widgetname: C{String} @param applyfunction: function that makes the changes when the Setting is saved @type applyfunction: C{function} @param initialdata: If the widget supports the setInitialData() function this can be used to set the initial data @type initialdata: C{String} or C{Boolean} @param requiresrestart: Whether or not the changing of this setting requires a restart @type requiresrestart: C{Boolean} """ entry = SettingEntry(module, name, widgetname, applyfunction, initialdata, requiresrestart) self.addEntry(entry) def addEntry(self, entry): """Adds a new C{SettingEntry} to the Settting @param entry: A new SettingEntry that is to be added @type entry: C{SettingEntry} """ if entry.module not in self._entries: self._entries[entry.module] = {} self._entries[entry.module][entry.name] = entry # Make sure the new entry is available if self.get(entry.module, entry.name) is None: print "Updating", self._settings_file, "to the default, it is missing the entry:"\ , entry.name ,"for module", entry.module self.setDefaults() if self.get(entry.module, entry.name) is None: print "WARNING:", entry.module, ":", entry.name, "still not found!" def saveSettings(self, filename=""): """ Writes the settings to the settings file @param filename: Specifies the file to save the settings to. If it is not specified the original settings file is used. @type filename: C{string} """ if self._serializer: if filename == "": self._serializer.save(os.path.join(self._appdata, self._settings_file)) else: self._serializer.save(filename) def get(self, module, name, defaultValue=None): """ Gets the value of a specified setting @param module: Name of the module to get the setting from @param name: Setting name @param defaultValue: Specifies the default value to return if the setting is not found @type defaultValue: C{str} or C{unicode} or C{int} or C{float} or C{bool} or C{list} or C{dict} """ if self._serializer: return self._serializer.get(module, name, defaultValue) else: return None def set(self, module, name, value, extra_attrs={}): """ Sets a setting to specified value. @param module: Module where the setting should be set @param name: Name of setting @param value: Value to assign to setting @type value: C{str} or C{unicode} or C{int} or C{float} or C{bool} or C{list} or C{dict} @param extra_attrs: Extra attributes to be stored in the XML-file @type extra_attrs: C{dict} """ if self._serializer: self._serializer.set(module, name, value, extra_attrs) def setGuiStyle(self, style): """ Set a custom gui style used for the option dialog. @param style: Pychan style to be used @type style: C{string} """ self._gui_style = style def onOptionsPress(self): """ Opens the options dialog box. Usually you would bind this to a button. """ self.changesRequireRestart = False self.isSetToDefault = False if not self.OptionsDlg: self.loadSettingsDialog() self.fillWidgets() self.OptionsDlg.show() def loadSettingsDialog(self): """ Load up the settings xml and return the widget. """ self.OptionsDlg = self._loadWidget(self._settings_gui_xml) self.OptionsDlg.stylize(self._gui_style) self.OptionsDlg.mapEvents({ 'okButton' : self.applySettings, 'cancelButton' : self.OptionsDlg.hide, 'defaultButton' : self.setDefaults }) return self.OptionsDlg def _loadWidget(self, dialog): """Loads a widget. Can load both files and pure xml strings""" if os.path.isfile(self._settings_gui_xml): return pychan.loadXML(dialog) else: return pychan.loadXML(StringIO(dialog)) def fillWidgets(self): for module in self._entries.itervalues(): for entry in module.itervalues(): widget = self.OptionsDlg.findChildByName(entry.settingwidgetname) value = self.get(entry.module, entry.name) if type(entry.initialdata) is list: try: value = entry.initialdata.index(value) except ValueError: raise ValueError("\"" + value + "\" is not a valid value for " + entry.name + ". Valid options: " + str(entry.initialdata)) entry.initializeWidget(widget, value) def applySettings(self): """ Writes the settings file. If a change requires a restart of the engine it notifies you with a small dialog box. """ for module in self._entries.itervalues(): for entry in module.itervalues(): widget = self.OptionsDlg.findChildByName(entry.settingwidgetname) data = widget.getData() # If the data is a list we need to get the correct selected data # from the list. This is needed for e.g. dropdowns or listboxs if type(entry.initialdata) is list: data = entry.initialdata[data] # only take action if something really changed if data != self.get(entry.module, entry.name): self.set(entry.module, entry.name, data) entry.onApply(data) if entry.requiresrestart: self.changesRequireRestart = True self.saveSettings() self.OptionsDlg.hide() if self.changesRequireRestart: self._showChangeRequireRestartDialog() def _showChangeRequireRestartDialog(self): """Shows a dialog that informes the user that a restart is required to perform the changes.""" RestartDlg = self._loadWidget(self._changes_gui_xml) RestartDlg.stylize(self._gui_style) RestartDlg.mapEvents({ 'closeButton' : RestartDlg.hide }) RestartDlg.show() def setAvailableScreenResolutions(self, reslist): """ A list of valid default screen resolutions. This should be called once right after you instantiate Settings. Valid screen resolutions must be strings in the form of: WIDTHxHEIGHT Example: settings.setAvailableScreenResolutions(["800x600", "1024x768"]) """ self._resolutions = reslist def setDefaults(self): """ Overwrites the setting file with the default settings file. """ shutil.copyfile(self._default_settings_file, os.path.join(self._appdata, self._settings_file)) self.changesRequireRestart = True self.initSerializer() #update all widgets with the new data self.fillWidgets() def _getEntries(self): return self._entries def _setEntries(self, entries): self._entries = entries def _getSerializer(self): return self._serializer entries = property(_getEntries, _setEntries) serializer = property(_getSerializer) class SettingEntry(object): def __init__(self, module, name, widgetname, applyfunction=None, initialdata=None, requiresrestart=False): """ @param module: The Setting module this Entry belongs to @type module: C{String} @param name: The Setting's name @type name: C{String} @param widgetname: The name of the widget that is used to change this setting @type widgetname: C{String} @param applyfunction: function that makes the changes when the Setting is saved @type applyfunction: C{function} @param initialdata: If the widget supports the setInitialData() function this can be used to set the initial data @type initialdata: C{String} or C{Boolean} @param requiresrestart: Whether or not the changing of this setting requires a restart @type requiresrestart: C{Boolean} """ self._module = module self._name = name self._settingwidgetname = widgetname self._requiresrestart = requiresrestart self._initialdata = initialdata self._applyfunction = applyfunction def initializeWidget(self, widget, currentValue): """Initialize the widget with needed data""" if self._initialdata is not None: widget.setInitialData(self._initialdata) widget.setData(currentValue) def onApply(self, data): """Implement actions that need to be taken when the setting is changed here. """ if self._applyfunction is not None: self._applyfunction(data) def _getModule(self): return self._module def _setModule(self, module): self._module = module def _getName(self): return self._name def _setName(self, name): self._name = name def _getSettingWidgetName(self): return self._settingwidgetname def _setSettingWidgetName(self, settingwidgetname): self._settingwidgetname = settingwidgetname def _getRequiresRestart(self): return self._requiresrestart def _setRequiresRestart(self, requiresrestart): self._requiresrestart = requiresrestart def _getInitialData(self): return self._initialdata def _setInitialData(self, initialdata): self._initialdata = initialdata def _getApplyFunction(self): return self._applyfunction def _setApplyFunction(self, applyfunction): self._applyfunction = applyfunction module = property(_getModule, _setModule) name = property(_getName, _setName) settingwidgetname = property(_getSettingWidgetName, _setSettingWidgetName) requiresrestart = property(_getRequiresRestart, _setRequiresRestart) initialdata = property(_getInitialData, _setInitialData) applyfunction = property(_getApplyFunction, _setApplyFunction) def __str__(self): return "SettingEntry: " + self.name + " Module: " + self.module + " Widget: " + \ self.settingwidgetname + " requiresrestart: " + str(self.requiresrestart) + \ " initialdata: " + str(self.initialdata)
lgpl-2.1
3,252,405,455,924,976,600
32.861702
169
0.711781
false
3.47565
false
false
false
aenon/OnlineJudge
leetcode/5.BitManipulation/477.TotalHammingDistance.py
1
1100
# 477. Total Hamming Distance # The Hamming distance between two integers is the number of positions at which the corresponding bits are different. # Now your job is to find the total Hamming distance between all pairs of the given numbers. # Example: # Input: 4, 14, 2 # Output: 6 # Explanation: In binary representation, the 4 is 0100, 14 is 1110, and 2 is 0010 (just # showing the four bits relevant in this case). So the answer will be: # HammingDistance(4, 14) + HammingDistance(4, 2) + HammingDistance(14, 2) = 2 + 2 + 2 = 6. # Note: # Elements of the given array are in the range of 0 to 10^9 # Length of the array will not exceed 10^4. class Solution(object): def totalHammingDistance(self, nums): """ :type nums: List[int] :rtype: int loop through all the digits """ result = 0 for i in xrange(32): counts = [0] * 2 # the number of 0's and 1's in the ith digit for number in nums: counts[number>>i & 1] += 1 result += counts[0] * counts[1] return result
mit
-7,870,830,576,520,058,000
31.382353
117
0.626364
false
3.536977
false
false
false
f-prettyland/angr
angr/engines/vex/statements/loadg.py
1
2392
from .... import sim_options as o from ....state_plugins.sim_action_object import SimActionObject from ....state_plugins.sim_action import SimActionData from . import SimIRStmt, SimStatementError class SimIRStmt_LoadG(SimIRStmt): def _execute(self): addr = self._translate_expr(self.stmt.addr) alt = self._translate_expr(self.stmt.alt) guard = self._translate_expr(self.stmt.guard) read_type, converted_type = self.stmt.cvt_types read_size = self.size_bytes(read_type) converted_size = self.size_bytes(converted_type) read_expr = self.state.memory.load(addr.expr, read_size, endness=self.stmt.end) if read_size == converted_size: converted_expr = read_expr elif "S" in self.stmt.cvt: converted_expr = read_expr.sign_extend(converted_size*self.state.arch.byte_width - read_size*self.state.arch.byte_width) elif "U" in self.stmt.cvt: converted_expr = read_expr.zero_extend(converted_size*self.state.arch.byte_width - read_size*self.state.arch.byte_width) else: raise SimStatementError("Unrecognized IRLoadGOp %s!" % self.stmt.cvt) read_expr = self.state.se.If(guard.expr != 0, converted_expr, alt.expr) if o.ACTION_DEPS in self.state.options: reg_deps = addr.reg_deps() | alt.reg_deps() | guard.reg_deps() tmp_deps = addr.tmp_deps() | alt.tmp_deps() | guard.tmp_deps() else: reg_deps = None tmp_deps = None self.state.scratch.store_tmp(self.stmt.dst, read_expr, reg_deps, tmp_deps) if o.TRACK_MEMORY_ACTIONS in self.state.options: data_ao = SimActionObject(converted_expr) alt_ao = SimActionObject(alt.expr, reg_deps=alt.reg_deps(), tmp_deps=alt.tmp_deps()) addr_ao = SimActionObject(addr.expr, reg_deps=addr.reg_deps(), tmp_deps=addr.tmp_deps()) guard_ao = SimActionObject(guard.expr, reg_deps=guard.reg_deps(), tmp_deps=guard.tmp_deps()) size_ao = SimActionObject(self.size_bits(converted_type)) r = SimActionData(self.state, self.state.memory.id, SimActionData.READ, addr=addr_ao, data=data_ao, condition=guard_ao, size=size_ao, fallback=alt_ao) self.actions.append(r)
bsd-2-clause
-9,205,185,699,880,460,000
49.893617
162
0.621237
false
3.441727
false
false
false
moozilla/dvcticker
dvcticker/main.py
1
12328
#todo: raise exceptions, then catch them to generate error images import webapp2 from google.appengine.api import urlfetch import json from PIL import Image, ImageDraw, ImageFont from google.appengine.api import memcache import StringIO import jinja2 import os from decimal import * #used fixed point math for better accuracy from google.appengine import runtime # for catching DeadlineExceededError from google.appengine.api import urlfetch_errors # " JINJA_ENVIRONMENT = jinja2.Environment( loader=jinja2.FileSystemLoader(os.path.dirname(__file__))) #imgFont = ImageFont.load('static/font/ncenB12.pil') # for testing locally, can't get truetype to work locally imgFont = ImageFont.truetype('static/font/tahoma_bold.ttf', 14, encoding='unic') def urlfetch_cache(url,exchange): # fetches a url, but using memcache to not hammer the exchanges server data = memcache.get(url) if data is not None: return process_json(data, exchange) else: try: result = urlfetch.fetch(url,deadline=30) #timeout after 30 sec if result.status_code == 200: value = process_json(result.content, exchange) memcache.add(url, result.content, 30) #cache for 30 sec memcache.add('longcache'+url, result.content, 3000) #also cache for 5min in case of timeouts return value else: return 'Error: '+exchange+' status code '+str(result.status_code) #'Error accessing Vircurex API' except runtime.DeadlineExceededError: #raised if the overall request times out data = memcache.get('longcache'+url) if data is not None: return process_json(data, exchange) else: return 'Error: '+exchange+' timeout' except runtime.apiproxy_errors.DeadlineExceededError: #raised if an RPC exceeded its deadline (set) data = memcache.get('longcache'+url) if data is not None: return process_json(data, exchange) else: return 'Error: '+exchange+' timeout' except urlfetch_errors.DeadlineExceededError: #raised if the URLFetch times out data = memcache.get('longcache'+url) if data is not None: return process_json(data, exchange) else: return 'Error: '+exchange+' timeout' except urlfetch.Error: #catch DownloadError data = memcache.get('longcache'+url) if data is not None: return process_json(data, exchange) else: return 'Error: '+exchange+' timeout' def process_json(txt, exchange): #should probably add error handling in case bad json is passed if exchange == 'vircurex': if txt == '"Unknown currency"': return 'Error: bad Vircurex API result' obj = json.loads(txt) return obj['value'] elif exchange == 'mtgox_bid': obj = json.loads(txt) if obj['result'] == 'success': return obj['return']['buy']['value'] else: return 'Error: bad MTGox API result' elif exchange == 'mtgox_ask': obj = json.loads(txt) if obj['result'] == 'success': return obj['return']['sell']['value'] else: return 'Error: bad MTGox API result' elif exchange == 'btce_bid': obj = json.loads(txt) if not any('error' in s for s in obj): return str(obj['ticker']['buy']) else: return 'Error: bad BTC-E API result' elif exchange == 'btce_ask': obj = json.loads(txt) if not any('error' in s for s in obj): return str(obj['ticker']['sell']) else: return 'Error: bad BTC-E API result' elif exchange == 'campbx_bid': obj = json.loads(txt) # need to check for error return obj['Best Bid'] elif exchange == 'campbx_ask': obj = json.loads(txt) # need to check for error return obj['Best Ask'] else: return 'Error: invalid exchange' def get_campbx_value(base,alt,amount): url = 'http://campbx.com/api/xticker.php' reverse = False if base == 'btc': if alt != 'usd': return 'Error: only BTC/USD valid on CampBX' exch = 'campbx_bid' elif base == 'usd': if alt != 'btc': return 'Error: only BTC/USD valid on CampBX' exch = 'campbx_ask' reverse = True else: return 'Error: only BTC/USD valid on CampBX' value = urlfetch_cache(url,exch) if value.startswith('Error'): return value if reverse: return str((Decimal(amount) / Decimal(value)).quantize(Decimal('.00000001'), rounding=ROUND_DOWN)) # need to round to a certain number else: return str(Decimal(amount) * Decimal(value)) def get_mtgox_value(base,alt,amount): cur = ['usd', 'aud', 'cad', 'chf', 'cny', 'dkk', 'eur', 'gbp', 'hkd', 'jpy', 'nzd', 'pln', 'rub', 'sek', 'sgd', 'thb'] reverse = False # true if going from cur-> btc if base == 'btc': if not any(alt in s for s in cur): return 'Error: invalid destination currency' url = 'http://data.mtgox.com/api/1/btc'+alt+'/ticker' exch = 'mtgox_bid' elif any(base in s for s in cur): if alt != 'btc': return 'Error: destination currency must be BTC' url = 'http://data.mtgox.com/api/1/btc'+base+'/ticker' #mtgox api always has btc first exch = 'mtgox_ask' reverse = True else: return 'Error: invalid base currency' value = urlfetch_cache(url,exch) if value.startswith('Error'): return value if reverse: return str((Decimal(amount) / Decimal(value)).quantize(Decimal('.00000001'), rounding=ROUND_DOWN)) # need to round to a certain number else: return str(Decimal(amount) * Decimal(value)) def get_btce_value(base,alt,amount): # in BTC-e currencies must be traded in pairs, we also support going in reverse (buying) cur_fwd = {'btc':['usd','rur','eur'], 'ltc':['btc','usd','rur'], 'nmc':['btc'], 'usd':['rur'], 'eur':['usd'], 'nvc':['btc'], 'trc':['btc'], 'ppc':['btc'], 'ftc':['btc'], 'cnc':['btc']} cur_rev = {'btc':['ltc','nmc','nvc','trc','ppc','ftc','cnc'], 'usd':['btc','ltc'], 'rur':['btc','usd'], 'eur':['btc']} reverse = False # if going from cur-> btc if any(base in s for s in cur_fwd) and any(alt in s for s in cur_fwd[base]): #if not any(alt in s for s in cur_fwd[base]): #return 'Error: invalid destination currency' # can't return here because some can be base or alt url = 'https://btc-e.com/api/2/'+base+'_'+alt+'/ticker' #https://btc-e.com/api/2/nmc_btc/ticker exch = 'btce_bid' else: if any(base in s for s in cur_rev): if not any(alt in s for s in cur_rev[base]): return 'Error: invalid currency pair' url = 'https://btc-e.com/api/2/'+alt+'_'+base+'/ticker' exch = 'btce_ask' reverse = True else: return 'Error: invalid currency pair' value = urlfetch_cache(url,exch) if value.startswith('Error'): return value if reverse: return str((Decimal(amount) / Decimal(value)).quantize(Decimal('.00000001'), rounding=ROUND_DOWN)) # need to round to a certain number else: return str(Decimal(amount) * Decimal(value)) def get_vircurex_value(type, base, alt, amount): # gets json from vircurex about bid/ask prices # eg. https://vircurex.com/api/get_highest_bid.json?base=BTC&alt=NMC if type == 'bid': url = 'https://vircurex.com/api/get_highest_bid.json' elif type == 'ask': url = 'https://vircurex.com/api/get_lowest_ask.json' else: return 'Error: Type must be either "bid" or "ask"' cur = ['btc', 'dvc', 'ixc', 'ltc', 'nmc', 'ppc', 'trc', 'usd', 'eur', 'ftc', 'frc', 'cnc'] if not any(base in s for s in cur): return 'Error: invalid currency' if not any(alt in s for s in cur): return 'Error: invalid currency' url += '?base=' + base + '&alt=' + alt value = urlfetch_cache(url,'vircurex') if value.startswith('Error'): return value return str(Decimal(amount)*Decimal(value)) # return amount * value def get_bid(exchange, amount, base, alt): if exchange == 'vircurex': return get_vircurex_value('bid',base,alt,amount) elif exchange == 'mtgox': return get_mtgox_value(base,alt,amount) elif exchange == 'btc-e': return get_btce_value(base,alt,amount) elif exchange == 'campbx': return get_campbx_value(base,alt,amount) else: return 'Error: bad exchange' def get_text_width(str): img = Image.new("RGBA", (1,1)) # just used to calculate the text size, size doesn't matter draw = ImageDraw.Draw(img) w, h = draw.textsize(str, imgFont) # calculate width font will take up return w # returns text, with optional coin icon, in string encoded form so it can be written to HTTP response def make_img(str, text_pos, coinimg=None): img = Image.new("RGBA", (get_text_width(str) + text_pos, 20)) draw = ImageDraw.Draw(img) # set draw to new image if coinimg != None: img.paste(coinimg, (0,2)) #paste the coin image into the generated image draw.text((text_pos,1), str, font=imgFont, fill='#555555') output = StringIO.StringIO() img.save(output, format='png') img_to_serve = output.getvalue() output.close() return img_to_serve class MainHandler(webapp2.RequestHandler): def get(self): #base = self.request.get('base','dvc') #alt = self.request.get('alt','btc') #value = get_vircurex_value('bid',base,alt) #template_values = { # 'value': value #} template = JINJA_ENVIRONMENT.get_template('index.html') self.response.write(template.render())#template_values)) class ImageHandler(webapp2.RequestHandler): def get(self,exchange,amount,base,alt): if amount == '': amount = '1' # default amount is 1 exchange = exchange.lower() # make sure everything is lowercase base = base.lower() if alt == None: if base == 'btc': alt = 'usd' # btc.png just shows btc value in usd else: alt = 'btc' # if no alt specified, default to BTC alt = alt.lower() value = get_bid(exchange,amount,base,alt) #if bid.startswith('Error'): value = bid #else: value = str(Decimal(amount)*Decimal(bid)) text_pos = 19 # 3 px after coin image (all are 16x16) if value.startswith('Error'): text_pos = 0 elif alt == 'usd': # round down to 2 decimal places value = '$ '+str(Decimal(value).quantize(Decimal('.01'), rounding=ROUND_DOWN)) text_pos = 2 elif alt == 'eur': # euro symbol in unicode (only works with truetype fonts) value = u'\u20AC '+str(Decimal(value).quantize(Decimal('.01'), rounding=ROUND_DOWN)) text_pos = 2 # have to position euro symbol so it doesn't cut off elif any(alt in s for s in ['aud', 'cad', 'chf', 'cny', 'dkk', 'gbp', 'hkd', 'jpy', 'nzd', 'pln', 'rub', 'sek', 'sgd', 'thb', 'rur', 'nvc']): value = alt.upper() + ' ' + value text_pos = 2 #text_pos 0 = error if text_pos!=0 and any(alt in s for s in ['btc', 'dvc', 'ixc', 'ltc', 'nmc', 'ppc', 'trc', 'ftc', 'frc', 'cnc']): coinimg = Image.open('static/img/'+alt+'.png') else: coinimg = None img_to_serve = make_img(value, text_pos, coinimg) self.response.headers['Content-Type'] = 'image/png' self.response.out.write(img_to_serve) class ErrorHandler(webapp2.RequestHandler): def get(self): img_to_serve = make_img('Error: Malformed URL', 0) self.response.headers['Content-Type'] = 'image/png' self.response.out.write(img_to_serve) app = webapp2.WSGIApplication([ ('/', MainHandler), ('/([^/]+)/(\d*\.?\d*)([A-Za-z]+)(?:/([A-Za-z]+))?(?:\.png)?', ImageHandler), ('/.*', ErrorHandler) ], debug=True)
mit
2,237,923,900,706,341,600
43.666667
188
0.589066
false
3.539477
false
false
false
seanjtaylor/out-for-justice
scripts/test_optimize.py
1
1921
import random import pickle import numpy as np import networkx as nx from app.optim import slow_compute_loss, step def main(input_file, num_police, num_steps, prob_step): """ Parameters ---------- num_police : the number of police to use num_steps : the number of steps to take prob_step : the probability of taking a step if it doesn't improve loss """ with open(input_file) as f: graph = pickle.load(f) graph = nx.convert_node_labels_to_integers(graph) N = graph.number_of_nodes() # compute random starting places starting_positions = np.zeros(N) places = random.sample(xrange(N), num_police) starting_positions[places] = 1 # one outcome that is uniformly distributed risks = np.ones(N).reshape((-1, 1)) import time start = time.time() # initialize the optimization positions = [starting_positions] losses = [slow_compute_loss(graph, positions[-1], risks)] current = positions[-1] tried = set() for i in range(num_steps): new_position = step(graph, current) pos_id = tuple(new_position.nonzero()[0]) if pos_id in tried: continue tried.add(pos_id) positions.append(new_position) losses.append(slow_compute_loss(graph, new_position, risks)) if (losses[-1] < losses[-2]) or (random.random() < prob_step): current = new_position print time.time() - start print sorted(losses)[:10] if __name__ == '__main__': from argparse import ArgumentParser parser = ArgumentParser() parser.add_argument('input_file') parser.add_argument('--num_police', type=int, default=1) parser.add_argument('--num_steps', type=int, default=100) parser.add_argument('--prob_step', type=float, default=0.25) args = parser.parse_args() main(args.input_file, args.num_police, args.num_steps, args.prob_step)
mit
3,145,182,075,389,221,000
25.680556
75
0.63925
false
3.63138
false
false
false
dothiko/mypaint
lib/layer/test.py
1
1433
# This file is part of MyPaint. # Copyright (C) 2011-2015 by Andrew Chadwick <[email protected]> # Copyright (C) 2007-2012 by Martin Renold <[email protected]> # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 2 of the License, or # (at your option) any later version. def make_test_stack(): """Makes a simple test RootLayerStack (2 branches of 3 leaves each) :return: The root stack, and a list of its leaves. :rtype: tuple """ import lib.layer.group import lib.layer.data import lib.layer.tree root = lib.layer.tree.RootLayerStack(doc=None) layer0 = lib.layer.group.LayerStack(name='0') root.append(layer0) layer00 = lib.layer.data.PaintingLayer(name='00') layer0.append(layer00) layer01 = lib.layer.data.PaintingLayer(name='01') layer0.append(layer01) layer02 = lib.layer.data.PaintingLayer(name='02') layer0.append(layer02) layer1 = lib.layer.group.LayerStack(name='1') root.append(layer1) layer10 = lib.layer.data.PaintingLayer(name='10') layer1.append(layer10) layer11 = lib.layer.data.PaintingLayer(name='11') layer1.append(layer11) layer12 = lib.layer.data.PaintingLayer(name='12') layer1.append(layer12) return (root, [layer00, layer01, layer02, layer10, layer11, layer12])
gpl-2.0
8,603,394,478,543,778,000
35.74359
73
0.707606
false
3.220225
false
false
false
delimitry/ascii_clock
asciicanvas.py
1
6119
#-*- coding: utf-8 -*- #----------------------------------------------------------------------- # Author: delimitry #----------------------------------------------------------------------- class AsciiCanvas(object): """ ASCII canvas for drawing in console using ASCII chars """ def __init__(self, cols, lines, fill_char=' '): """ Initialize ASCII canvas """ if cols < 1 or cols > 1000 or lines < 1 or lines > 1000: raise Exception('Canvas cols/lines must be in range [1..1000]') self.cols = cols self.lines = lines if not fill_char: fill_char = ' ' elif len(fill_char) > 1: fill_char = fill_char[0] self.fill_char = fill_char self.canvas = [[fill_char] * (cols) for _ in range(lines)] def clear(self): """ Fill canvas with empty chars """ self.canvas = [[self.fill_char] * (self.cols) for _ in range(self.lines)] def print_out(self): """ Print out canvas to console """ print(self.get_canvas_as_str()) def add_line(self, x0, y0, x1, y1, fill_char='o'): """ Add ASCII line (x0, y0 -> x1, y1) to the canvas, fill line with `fill_char` """ if not fill_char: fill_char = 'o' elif len(fill_char) > 1: fill_char = fill_char[0] if x0 > x1: # swap A and B x1, x0 = x0, x1 y1, y0 = y0, y1 # get delta x, y dx = x1 - x0 dy = y1 - y0 # if a length of line is zero just add point if dx == 0 and dy == 0: if self.check_coord_in_range(x0, y0): self.canvas[y0][x0] = fill_char return # when dx >= dy use fill by x-axis, and use fill by y-axis otherwise if abs(dx) >= abs(dy): for x in range(x0, x1 + 1): y = y0 if dx == 0 else y0 + int(round((x - x0) * dy / float((dx)))) if self.check_coord_in_range(x, y): self.canvas[y][x] = fill_char else: if y0 < y1: for y in range(y0, y1 + 1): x = x0 if dy == 0 else x0 + int(round((y - y0) * dx / float((dy)))) if self.check_coord_in_range(x, y): self.canvas[y][x] = fill_char else: for y in range(y1, y0 + 1): x = x0 if dy == 0 else x1 + int(round((y - y1) * dx / float((dy)))) if self.check_coord_in_range(x, y): self.canvas[y][x] = fill_char def add_text(self, x, y, text): """ Add text to canvas at position (x, y) """ for i, c in enumerate(text): if self.check_coord_in_range(x + i, y): self.canvas[y][x + i] = c def add_rect(self, x, y, w, h, fill_char=' ', outline_char='o'): """ Add rectangle filled with `fill_char` and outline with `outline_char` """ if not fill_char: fill_char = ' ' elif len(fill_char) > 1: fill_char = fill_char[0] if not outline_char: outline_char = 'o' elif len(outline_char) > 1: outline_char = outline_char[0] for px in range(x, x + w): for py in range(y, y + h): if self.check_coord_in_range(px, py): if px == x or px == x + w - 1 or py == y or py == y + h - 1: self.canvas[py][px] = outline_char else: self.canvas[py][px] = fill_char def add_nine_patch_rect(self, x, y, w, h, outline_3x3_chars=None): """ Add nine-patch rectangle """ default_outline_3x3_chars = ( '.', '-', '.', '|', ' ', '|', '`', '-', "'" ) if not outline_3x3_chars: outline_3x3_chars = default_outline_3x3_chars # filter chars filtered_outline_3x3_chars = [] for index, char in enumerate(outline_3x3_chars[0:9]): if not char: char = default_outline_3x3_chars[index] elif len(char) > 1: char = char[0] filtered_outline_3x3_chars.append(char) for px in range(x, x + w): for py in range(y, y + h): if self.check_coord_in_range(px, py): if px == x and py == y: self.canvas[py][px] = filtered_outline_3x3_chars[0] elif px == x and y < py < y + h - 1: self.canvas[py][px] = filtered_outline_3x3_chars[3] elif px == x and py == y + h - 1: self.canvas[py][px] = filtered_outline_3x3_chars[6] elif x < px < x + w - 1 and py == y: self.canvas[py][px] = filtered_outline_3x3_chars[1] elif x < px < x + w - 1 and py == y + h - 1: self.canvas[py][px] = filtered_outline_3x3_chars[7] elif px == x + w - 1 and py == y: self.canvas[py][px] = filtered_outline_3x3_chars[2] elif px == x + w - 1 and y < py < y + h - 1: self.canvas[py][px] = filtered_outline_3x3_chars[5] elif px == x + w - 1 and py == y + h - 1: self.canvas[py][px] = filtered_outline_3x3_chars[8] else: self.canvas[py][px] = filtered_outline_3x3_chars[4] def check_coord_in_range(self, x, y): """ Check that coordinate (x, y) is in range, to prevent out of range error """ return 0 <= x < self.cols and 0 <= y < self.lines def get_canvas_as_str(self): """ Return canvas as a string """ return '\n'.join([''.join(col) for col in self.canvas]) def __str__(self): """ Return canvas as a string """ return self.get_canvas_as_str()
mit
5,868,139,019,117,371,000
36.771605
87
0.440758
false
3.588856
false
false
false
m4nh/roars
scripts/nodes/examples/arp_detector_example.py
1
2688
#!/usr/bin/env python # -*- encoding: utf-8 -*- from roars.rosutils.rosnode import RosNode from roars.vision.cameras import CameraRGB from roars.vision.arucoutils import MarkerDetector from roars.vision.arp import ARP import roars.vision.cvutils as cvutils import cv2 import numpy as np import os import json #⬢⬢⬢⬢⬢➤ NODE node = RosNode("rosnode_example") #⬢⬢⬢⬢⬢➤ Sets HZ from parameters node.setHz(node.setupParameter("hz", 30)) #⬢⬢⬢⬢⬢➤ Creates Camera Proxy camera_topic = node.setupParameter( "camera_topic", "/camera/rgb/image_raw/compressed" ) camera_file = node.getFileInPackage( 'roars', 'data/camera_calibrations/asus_xtion.yml' ) camera = CameraRGB( configuration_file=camera_file, rgb_topic=camera_topic, compressed_image="compressed" in camera_topic ) #⬢⬢⬢⬢⬢➤ ARP arp_configuration = node.getFileInPackage( 'roars', 'data/arp_configurations/prototype_configuration.json' ) arp = ARP(configuration_file=arp_configuration, camera_file=camera_file) #⬢⬢⬢⬢⬢➤ Points storage points_per_object = node.setupParameter("points_per_object", 6) collected_points = [] output_file = node.setupParameter("output_file", "/tmp/arp_objects.json") #⬢⬢⬢⬢⬢➤ Camera Callback def cameraCallback(frame): #⬢⬢⬢⬢⬢➤ Grabs image from Frame img = frame.rgb_image.copy() arp_pose = arp.detect(img, debug_draw=True) if arp_pose: img_points = cvutils.reproject3DPoint( arp_pose.p.x(), arp_pose.p.y(), arp_pose.p.z(), camera=camera ) cv2.circle( img, (int(img_points[0]), int(img_points[1])), 5, (0, 0, 255), -1 ) #⬢⬢⬢⬢⬢➤ Show cv2.imshow("output", img) c = cv2.waitKey(1) if c == 113: node.close() if c == 32 and arp_pose != None: print("New Point Added", arp_pose.p) collected_points.append([ arp_pose.p.x(), arp_pose.p.y(), arp_pose.p.z() ]) if len(collected_points) % points_per_object == 0: print("New Object Stored") camera.registerUserCallabck(cameraCallback) #⬢⬢⬢⬢⬢➤ Main Loop while node.isActive(): node.tick() def chunks(l, n): """Yield successive n-sized chunks from l.""" for i in range(0, len(l), n): yield l[i:i + n] probable_objects = list(chunks(collected_points, points_per_object)) objects = [] for o in probable_objects: if len(o) == points_per_object: objects.append(o) with open(output_file, 'w') as handle: handle.write(json.dumps(objects, indent=4))
gpl-3.0
4,086,218,510,693,855,000
23.571429
73
0.625581
false
2.724393
true
false
false
IFAEControl/pirelay
pirelay/server.py
1
1591
#!/usr/bin/env python3 import time from concurrent import futures import grpc from .protos import pirelay_pb2 from .protos import pirelay_pb2_grpc from .relay import RelaysArray _ONE_DAY_IN_SECONDS = 60 * 60 * 24 PINS = [21] class PiRelayServer(pirelay_pb2_grpc.PiRelayServicer): def __init__(self, bcm_pins=[]): self._relays = RelaysArray(bcm_pins=bcm_pins) def Enable(self, request, context): try: self._relays.enable(request.channel) except Exception as ex: return pirelay_pb2.PiRelaysAnswer(type=pirelay_pb2.Error, message=str(ex)) else: return pirelay_pb2.PiRelaysAnswer(type=pirelay_pb2.Ok, message="") def Disable(self, request, context): try: self._relays.disable(request.channel) except Exception as ex: return pirelay_pb2.PiRelaysAnswer(type=pirelay_pb2.Error, message=str(ex)) else: return pirelay_pb2.PiRelaysAnswer(type=pirelay_pb2.Ok, message="") def serve(): server = grpc.server(futures.ThreadPoolExecutor(max_workers=10)) pirelay_pb2_grpc.add_PiRelayServicer_to_server(PiRelayServer(PINS), server) server.add_insecure_port('[::]:50051') server.start() try: while True: time.sleep(_ONE_DAY_IN_SECONDS) except KeyboardInterrupt: server.stop(0) if __name__ == '__main__': serve()
lgpl-3.0
-4,084,407,837,345,929,700
25.966102
79
0.574481
false
3.649083
false
false
false
tensorflow/model-optimization
tensorflow_model_optimization/g3doc/tools/build_docs.py
1
3663
# Copyright 2019 The TensorFlow Authors. All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # ============================================================================== """Tool to generate open source api_docs for tensorflow_model_optimization. To use: 1. Install the tensorflow docs package, which is only compatible with Python python3 -m pip install git+https://github.com/tensorflow/docs 2. Install TensorFlow Model Optimization. The API docs are generated from `tfmot` from the import of the tfmot package below, based on what is exposed under https://github.com/tensorflow/model-optimization/tree/master/tensorflow_model_optimization/python/core/api. See https://www.tensorflow.org/model_optimization/guide/install. 3. Run build_docs.py. python3 build_docs.py --output_dir=/tmp/model_optimization_api 4. View the generated markdown files on a viewer. One option is to fork https://github.com/tensorflow/model-optimization/, push a change that copies the files to tensorflow_model_optimization/g3doc, and then view the files on Github. Note: If duplicate or spurious docs are generated (e.g. internal names), consider blacklisting them via the `private_map` argument below. """ from __future__ import absolute_import from __future__ import division from __future__ import print_function import os from absl import app from absl import flags from tensorflow_docs.api_generator import generate_lib import tensorflow_model_optimization as tfmot flags.DEFINE_string("output_dir", "/tmp/model_optimization_api", "Where to output the docs") flags.DEFINE_string( "code_url_prefix", ("https://github.com/tensorflow/model-optimization/blob/master/" "tensorflow_model_optimization"), "The url prefix for links to code.") flags.DEFINE_bool("search_hints", True, "Include metadata search hints in the generated files") flags.DEFINE_string("site_path", "model_optimization/api_docs/python", "Path prefix in the _toc.yaml") FLAGS = flags.FLAGS def main(unused_argv): doc_generator = generate_lib.DocGenerator( root_title="TensorFlow Model Optimization", py_modules=[("tfmot", tfmot)], base_dir=os.path.dirname(tfmot.__file__), code_url_prefix=FLAGS.code_url_prefix, search_hints=FLAGS.search_hints, site_path=FLAGS.site_path, # TODO(tfmot): remove this once the next release after 0.3.0 happens. # This is needed in the interim because the API docs reflect # the latest release and the current release still wildcard imports # all of the classes below. private_map={ "tfmot.sparsity.keras": [ # List of internal classes which get exposed when imported. "InputLayer", "custom_object_scope", "pruning_sched", "pruning_wrapper", "absolute_import", "division", "print_function", "compat" ] }, ) doc_generator.build(output_dir=FLAGS.output_dir) if __name__ == "__main__": app.run(main)
apache-2.0
1,166,959,432,661,376,000
33.556604
110
0.677041
false
4.097315
false
false
false
owlabs/incubator-airflow
airflow/executors/__init__.py
1
3891
# -*- coding: utf-8 -*- # # Licensed to the Apache Software Foundation (ASF) under one # or more contributor license agreements. See the NOTICE file # distributed with this work for additional information # regarding copyright ownership. The ASF licenses this file # to you under the Apache License, Version 2.0 (the # "License"); you may not use this file except in compliance # with the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, # software distributed under the License is distributed on an # "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY # KIND, either express or implied. See the License for the # specific language governing permissions and limitations # under the License. import sys from airflow.utils.log.logging_mixin import LoggingMixin from airflow.configuration import conf from airflow.exceptions import AirflowException from airflow.executors.base_executor import BaseExecutor # noqa from airflow.executors.local_executor import LocalExecutor from airflow.executors.sequential_executor import SequentialExecutor DEFAULT_EXECUTOR = None def _integrate_plugins(): """Integrate plugins to the context.""" from airflow.plugins_manager import executors_modules for executors_module in executors_modules: sys.modules[executors_module.__name__] = executors_module globals()[executors_module._name] = executors_module def get_default_executor(): """Creates a new instance of the configured executor if none exists and returns it""" global DEFAULT_EXECUTOR if DEFAULT_EXECUTOR is not None: return DEFAULT_EXECUTOR executor_name = conf.get('core', 'EXECUTOR') DEFAULT_EXECUTOR = _get_executor(executor_name) log = LoggingMixin().log log.info("Using executor %s", executor_name) return DEFAULT_EXECUTOR class Executors: LocalExecutor = "LocalExecutor" SequentialExecutor = "SequentialExecutor" CeleryExecutor = "CeleryExecutor" DaskExecutor = "DaskExecutor" MesosExecutor = "MesosExecutor" KubernetesExecutor = "KubernetesExecutor" DebugExecutor = "DebugExecutor" def _get_executor(executor_name): """ Creates a new instance of the named executor. In case the executor name is not know in airflow, look for it in the plugins """ if executor_name == Executors.LocalExecutor: return LocalExecutor() elif executor_name == Executors.SequentialExecutor: return SequentialExecutor() elif executor_name == Executors.CeleryExecutor: from airflow.executors.celery_executor import CeleryExecutor return CeleryExecutor() elif executor_name == Executors.DaskExecutor: from airflow.executors.dask_executor import DaskExecutor return DaskExecutor() elif executor_name == Executors.MesosExecutor: from airflow.contrib.executors.mesos_executor import MesosExecutor return MesosExecutor() elif executor_name == Executors.KubernetesExecutor: from airflow.contrib.executors.kubernetes_executor import KubernetesExecutor return KubernetesExecutor() elif executor_name == Executors.DebugExecutor: from airflow.executors.debug_executor import DebugExecutor return DebugExecutor() else: # Loading plugins _integrate_plugins() executor_path = executor_name.split('.') if len(executor_path) != 2: raise AirflowException( "Executor {0} not supported: " "please specify in format plugin_module.executor".format(executor_name)) if executor_path[0] in globals(): return globals()[executor_path[0]].__dict__[executor_path[1]]() else: raise AirflowException("Executor {0} not supported.".format(executor_name))
apache-2.0
-8,116,916,838,794,192,000
36.776699
89
0.72038
false
4.347486
false
false
false
suutari/shoop
shuup/notify/template.py
1
3011
# -*- coding: utf-8 -*- # This file is part of Shuup. # # Copyright (c) 2012-2016, Shoop Commerce Ltd. All rights reserved. # # This source code is licensed under the AGPLv3 license found in the # LICENSE file in the root directory of this source tree. from __future__ import unicode_literals from django.utils.encoding import force_text from jinja2.sandbox import SandboxedEnvironment class NoLanguageMatches(Exception): pass def render_in_context(context, template_text, html_intent=False): """ Render the given Jinja2 template text in the script context. :param context: Script context. :type context: shuup.notify.script.Context :param template_text: Jinja2 template text. :type template_text: str :param html_intent: Is the template text intended for HTML output? This currently turns on autoescaping. :type html_intent: bool :return: Rendered template text :rtype: str :raises: Whatever Jinja2 might happen to raise """ # TODO: Add some filters/globals into this environment? env = SandboxedEnvironment(autoescape=html_intent) template = env.from_string(template_text) return template.render(context.get_variables()) class Template(object): def __init__(self, context, data): """ :param context: Script context :type context: shuup.notify.script.Context :param data: Template data dictionary :type data: dict """ self.context = context self.data = data def _get_language_data(self, language): return self.data.get(force_text(language).lower(), {}) def has_language(self, language, fields): data = self._get_language_data(language) return set(data.keys()) >= set(fields) def render(self, language, fields): """ Render this template in the given language, returning the given fields. :param language: Language code (ISO 639-1 or ISO 639-2) :type language: str :param fields: Desired fields to render. :type fields: list[str] :return: Dict of field -> rendered content. :rtype: dict[str, str] """ data = self._get_language_data(language) rendered = {} for field in fields: field_template = data.get(field) if field_template: # pragma: no branch rendered[field] = render_in_context(self.context, field_template, html_intent=False) return rendered def render_first_match(self, language_preferences, fields): # TODO: Document for language in language_preferences: if self.has_language(language, fields): rendered = self.render(language=language, fields=fields) rendered["_language"] = language return rendered raise NoLanguageMatches("No language in template matches any of languages %r for fields %r" % ( language_preferences, fields ))
agpl-3.0
-5,120,846,759,464,826,000
32.831461
103
0.645965
false
4.23488
false
false
false
danic96/Practica1
Practica1/Aplicacio/views.py
1
4321
# from django.shortcuts import render # Create your views here. # from django.http import HttpResponse from django.utils.decorators import method_decorator from django.contrib.auth.decorators import login_required from django.views.generic.edit import CreateView, UpdateView from django.views.generic import DetailView, DeleteView from rest_framework import generics from models import Movie, Character, Team, Power, Location from forms import MovieForm, CharacterForm, TeamForm, PowerForm, LocationForm from Practica1.serializers import MovieSerializer # Security Mixins class LoginRequiredMixin(object): @method_decorator(login_required()) def dispatch(self, *args, **kwargs): return super(LoginRequiredMixin, self).dispatch(*args, **kwargs) class CheckIsOwnerMixin(object): def get_object(self, *args, **kwargs): obj = super(CheckIsOwnerMixin, self).get_object(*args, **kwargs) if not obj.user == self.request.user: raise PermissionDenied return obj class LoginRequiredCheckIsOwnerUpdateView(LoginRequiredMixin, CheckIsOwnerMixin, UpdateView): template_name = 'Aplicacio/form.html' class MovieCreate(LoginRequiredMixin, CreateView): model = Movie template_name = 'Aplicacio/form.html' form_class = MovieForm def form_valid(self, form): form.instance.user = self.request.user return super(MovieCreate, self).form_valid(form) class CharacterCreate(LoginRequiredMixin, CreateView): model = Character template_name = 'Aplicacio/form.html' form_class = CharacterForm def form_valid(self, form): form.instance.user = self.request.user return super(CharacterCreate, self).form_valid(form) class TeamCreate(LoginRequiredMixin, CreateView): model = Team template_name = 'Aplicacio/form.html' form_class = TeamForm def form_valid(self, form): form.instance.user = self.request.user return super(TeamCreate, self).form_valid(form) class PowerCreate(LoginRequiredMixin, CreateView): model = Power template_name = 'Aplicacio/form.html' form_class = PowerForm def form_valid(self, form): form.instance.user = self.request.user return super(PowerCreate, self).form_valid(form) class LocationCreate(LoginRequiredMixin, CreateView): model = Location template_name = 'Aplicacio/form.html' form_class = LocationForm def form_valid(self, form): form.instance.user = self.request.user return super(LocationCreate, self).form_valid(form) """ class LocationDelete(LoginRequiredMixin, CreateView): model = Location template_name = 'Aplicacio/form.html' form_class = LocationForm def form_valid(self, form): form.instance.user = self.request.user return super(LocationDelete, self).form_valid(form) """ """ class Delete(DeleteView): model = Location success_url = reverse_lazy('all_locations') # This is where this view will # redirect the user template_name = 'Aplicacio/delete_location.html' """ class MovieDetail(DetailView): model = Movie template_name = 'Aplicacio/movie_detail.html' """ def get_context_data(self, **kwargs): context = super(MovieDetail, self).get_context_data(**kwargs) context['RATING_CHOICES'] = RestaurantReview.RATING_CHOICES return context """ class CharacterDetail(DetailView): model = Character template_name = 'Aplicacio/character_detail.html' class TeamDetail(DetailView): model = Team template_name = 'Aplicacio/team_detail.html' class PowerDetail(DetailView): model = Power template_name = 'Aplicacio/power_detail.html' class LocationDetail(DetailView): model = Location template_name = 'Aplicacio/location_detail.html' def form_valid(self, form): form.instance.user = self.request.user return super(CharacterCreate, self).form_valid(form) ### RESTful API views ### class APIMovieList(generics.ListCreateAPIView): model = Movie queryset = Movie.objects.all() serializer_class = MovieSerializer class APIMovieDetail(generics.RetrieveUpdateDestroyAPIView): model = Movie queryset = Movie.objects.all() serializer_class = MovieSerializer
mit
6,965,548,810,274,474,000
27.058442
93
0.707938
false
3.889289
false
false
false
CorundumGames/Invasodado
game/ufo.py
1
3605
from math import sin from random import choice, uniform, expovariate from pygame import Rect from core import color from core import config from core.particles import ParticleEmitter from game.block import get_block from game.gameobject import GameObject from game import gamedata ### Constants ################################################################## AVG_WAIT = 9000 #Expected time in frames between UFO appearance DEATH = config.load_sound('ufo_explosion.wav') FRAMES = tuple( Rect(64 * (i % 4), 192 + 32 * (i // 4), 64, 32) for i in range(10, -1, -1) ) INVADE = config.load_sound('ufo.wav') START_POS = (640, 16) UFO_FRAMES = color.get_colored_objects(FRAMES) UFO_STATES = ('IDLE', 'APPEARING', 'ACTIVE', 'DYING', 'LEAVING', 'LOWERING', 'GAMEOVER') ################################################################################ class UFO(GameObject): STATES = config.Enum(*UFO_STATES) GROUP = None BLOCK_GROUP = None def __init__(self): super().__init__() self._anim = 0.0 self.column = None self.current_frame_list = UFO_FRAMES self.image = config.get_sprite(FRAMES[0]) self.odds = expovariate(AVG_WAIT) self.position = list(START_POS) self.rect = Rect(START_POS, self.image.get_size()) self.state = UFO.STATES.IDLE self.emitter = ParticleEmitter(color.random_color_particles, self.rect) del self.acceleration def appear(self): ''' Appear on-screen, but not for very long! ''' INVADE.play(-1) self.position = list(START_POS) self.rect.topleft = list(START_POS) self.change_state(UFO.STATES.ACTIVE) self.velocity[0] = -2.0 def move(self): ''' Move left on the screen, and oscillate up and down. ''' position = self.position rect = self.rect self._anim += 0.5 self.image = UFO_FRAMES[id(choice(color.LIST)) ] \ [int(self._anim) % len(FRAMES)] position[0] += self.velocity[0] position[1] += sin(self._anim/4) rect.topleft = (position[0] + .5, position[1] + .5) if rect.right < 0: #If we've gone past the left edge of the screen... self.change_state(UFO.STATES.LEAVING) def die(self): ''' Vanish and release a special Block that clears lots of other Blocks. ''' self.emitter.rect = self.rect self.emitter.burst(30) DEATH.play() UFO.BLOCK_GROUP.add(get_block((self.rect.centerx, 0), special=True)) gamedata.score += 90 self.change_state(UFO.STATES.LEAVING) def leave(self): INVADE.stop() self.velocity[0] = 0 self.position = list(START_POS) self.rect.topleft = START_POS self.change_state(UFO.STATES.IDLE) def wait(self): ''' Wait off-screen, and only come back with a specific probability. ''' if uniform(0, 1) < self.odds: #With a certain probability... self.odds = expovariate(AVG_WAIT) self.change_state(UFO.STATES.APPEARING) actions = { STATES.IDLE : 'wait' , STATES.APPEARING: 'appear', STATES.ACTIVE : 'move' , STATES.DYING : 'die' , STATES.LEAVING : 'leave' , STATES.GAMEOVER : None , }
gpl-3.0
-1,058,903,097,034,391,700
32.700935
88
0.530929
false
3.583499
false
false
false
parksandwildlife/wastd
occurrence/migrations/0006_auto_20181129_1812.py
1
1084
# Generated by Django 2.0.8 on 2018-11-29 10:12 from django.db import migrations, models class Migration(migrations.Migration): dependencies = [ ('occurrence', '0005_auto_20181025_1720'), ] operations = [ migrations.AlterField( model_name='areaencounter', name='source', field=models.PositiveIntegerField(choices=[(0, 'Direct entry'), (1, 'Manual entry from paper datasheet'), (2, 'Digital data capture (ODK)'), (10, 'Threatened Fauna'), (11, 'Threatened Flora'), (12, 'Threatened Communities'), (13, 'Threatened Communities Boundaries'), (14, 'Threatened Communities Buffers'), (15, 'Threatened Communities Sites'), (20, 'Turtle Tagging Database WAMTRAM2'), (21, 'Ningaloo Turtle Program'), (22, 'Broome Turtle Program'), (23, 'Pt Hedland Turtle Program'), (24, 'Gnaraloo Turtle Program'), (25, 'Eco Beach Turtle Program'), (30, 'Cetacean Strandings Database'), (31, 'Pinniped Strandings Database')], default=0, help_text='Where was this record captured initially?', verbose_name='Data Source'), ), ]
mit
-6,071,923,042,693,717,000
59.222222
738
0.671587
false
3.519481
false
false
false
csdms/dakota
dakotathon/tests/test_plugin_hydrotrend_run.py
1
3466
#!/usr/bin/env python # # Test running the dakota.plugin.hydrotrend module. # # Call with: # $ nosetests -sv # # Mark Piper ([email protected]) import os import shutil # import filecmp import glob from nose.tools import with_setup, assert_true from dakotathon.dakota import Dakota from dakotathon.plugins.hydrotrend import is_installed as is_hydrotrend_installed from dakotathon.utils import is_dakota_installed from . import start_dir, data_dir # Global variables ----------------------------------------------------- run_dir = os.getcwd() config_file = os.path.join(run_dir, "dakota.yaml") known_config_file = os.path.join(data_dir, "dakota.yaml") # known_dat_file = os.path.join(data_dir, 'dakota.dat') # Fixtures ------------------------------------------------------------- def setup_module(): """Called before any tests are performed.""" print("\n*** " + __name__) def setup(): """Called at start of any test using it @with_setup()""" pass def teardown(): """Called at end of any test using it @with_setup()""" if os.path.exists(config_file): os.remove(config_file) if os.path.exists("dakota.in"): os.remove("dakota.in") if os.path.exists("run.log"): os.remove("run.log") if os.path.exists("stderr.log"): os.remove("stderr.log") if is_hydrotrend_installed(): for dname in glob.glob("HYDRO_*"): shutil.rmtree(dname) if is_dakota_installed(): for dname in glob.glob("run.*"): shutil.rmtree(dname) for fname in ["dakota." + ext for ext in ["dat", "out", "rst"]]: if os.path.exists(fname): os.remove(fname) def teardown_module(): """Called after all tests have completed.""" pass # Tests ---------------------------------------------------------------- @with_setup(setup, teardown) def test_run_by_setting_attributes(): """Test running a HydroTrend simulation.""" d = Dakota(method="vector_parameter_study", plugin="hydrotrend") d.template_file = os.path.join(data_dir, "HYDRO.IN.dtmpl") d.auxiliary_files = os.path.join(data_dir, "HYDRO0.HYPS") d.variables.descriptors = [ "starting_mean_annual_temperature", "total_annual_precipitation", ] d.variables.initial_point = [10.0, 1.5] d.method.final_point = [20.0, 2.5] d.method.n_steps = 5 d.responses.response_descriptors = ["Qs_median", "Q_mean"] d.responses.response_files = ["HYDROASCII.QS", "HYDROASCII.Q"] d.responses.response_statistics = ["median", "mean"] d.setup() assert_true(os.path.exists(d.input_file)) if is_dakota_installed() and is_hydrotrend_installed(): d.run() assert_true(os.path.exists(d.output_file)) # assert_true(filecmp.cmp(known_dat_file, d.environment.data_file)) @with_setup(setup, teardown) def test_run_from_config_file(): """Test running a HydroTrend simulation from a config file.""" d = Dakota.from_file_like(known_config_file) d.run_directory = run_dir d.template_file = os.path.join(data_dir, "HYDRO.IN.dtmpl") d.auxiliary_files = os.path.join(data_dir, "HYDRO0.HYPS") d.serialize(config_file) d.write_input_file() assert_true(os.path.exists(d.input_file)) if is_dakota_installed() and is_hydrotrend_installed(): d.run() assert_true(os.path.exists(d.output_file)) # assert_true(filecmp.cmp(known_dat_file, d.environment.data_file))
mit
-8,400,592,787,912,912,000
31.092593
81
0.617426
false
3.16819
true
false
false
kysolvik/reservoir-id
reservoir-id/classifier_train.py
1
6974
#!/usr/bin/env python """ Train random forest classifier Inputs: CSV from build_att_table, small area cutoff Outputs: Packaged up Random Forest model @authors: Kylen Solvik Date Create: 3/17/17 """ # Load libraries import pandas as pd from sklearn import model_selection from sklearn import preprocessing from sklearn.metrics import classification_report from sklearn.metrics import confusion_matrix from sklearn.metrics import accuracy_score from sklearn.externals import joblib from sklearn.cross_validation import train_test_split from sklearn.grid_search import GridSearchCV from sklearn.cross_validation import * import numpy as np import sys import argparse import os import xgboost as xgb # Parse arguments parser = argparse.ArgumentParser(description='Train Random Forest classifier.', formatter_class=argparse.ArgumentDefaultsHelpFormatter) parser.add_argument('prop_csv', help='Path to attribute table (from build_att_table.py).', type=str) parser.add_argument('xgb_pkl', help='Path to save random forest model as .pkl.', type=str) parser.add_argument('--area_lowbound', help='Lower area bound. All regions <= in size will be ignored', default=2, type=int) parser.add_argument('--path_prefix', help='To be placed at beginnings of all other path args', type=str,default='') args = parser.parse_args() def select_training_obs(full_csv_path): """Takes full csv and selects only the training observations. Writes out to csv for further use""" training_csv_path = full_csv_path.replace('.csv','_trainonly.csv') if not os.path.isfile(training_csv_path): dataset = pd.read_csv(full_csv_path,header=0) training_dataset = dataset.loc[dataset['class'] > 0] training_dataset.to_csv(training_csv_path,header=True,index=False) return(training_csv_path) def main(): # Set any attributes to exclude for this run exclude_att_patterns = [] # Load dataset training_csv = select_training_obs(args.path_prefix + args.prop_csv) dataset = pd.read_csv(training_csv,header=0) dataset_acut = dataset.loc[dataset['area'] > args.area_lowbound] # Exclude attributes matching user input patterns, or if they are all nans exclude_atts = [] for pattern in exclude_att_patterns: col_list = [col for col in dataset_acut.columns if pattern in col] exclude_atts.extend(col_list) for att in dataset.columns[1:]: if sum(np.isfinite(dataset[att])) == 0: exclude_atts.append(att) for att in list(set(exclude_atts)): del dataset_acut[att] (ds_y,ds_x) = dataset_acut.shape print(ds_y,ds_x) # Convert dataset to array feature_names = dataset_acut.columns[2:] array = dataset_acut.values X = array[:,2:ds_x].astype(float) Y = array[:,1].astype(int) Y = Y-1 # Convert from 1s and 2s to 0-1 # Set nans to 0 X = np.nan_to_num(X) # Separate test data test_size = 0.2 seed = 5 X_train, X_test, Y_train, Y_test = model_selection.train_test_split( X, Y, test_size=test_size, random_state=seed) # Convert data to xgboost matrices d_train = xgb.DMatrix(X_train,label=Y_train) # d_test = xgb.DMatrix(X_test,label=Y_test) #---------------------------------------------------------------------- # Paramater tuning # Step 1: Find approximate n_estimators to use early_stop_rounds = 40 n_folds = 5 xgb_model = xgb.XGBClassifier( learning_rate =0.1, n_estimators=1000, max_depth=5, min_child_weight=1, gamma=0, subsample=0.8, colsample_bytree=0.8, objective= 'binary:logistic', seed=27) xgb_params = xgb_model.get_xgb_params() cvresult = xgb.cv(xgb_params, d_train, num_boost_round=xgb_params['n_estimators'], nfold=n_folds, metrics='auc', early_stopping_rounds=early_stop_rounds, ) n_est_best = (cvresult.shape[0] - early_stop_rounds) print('Best number of rounds = {}'.format(n_est_best)) # Step 2: Tune hyperparameters xgb_model = xgb.XGBClassifier() params = {'max_depth': range(5,10,2), 'learning_rate': [0.1], 'gamma':[0,0.5,1], 'silent': [1], 'objective': ['binary:logistic'], 'n_estimators' : [n_est_best], 'subsample' : [0.7, 0.8,1], 'min_child_weight' : range(1,4,2), 'colsample_bytree':[0.7,0.8,1], } clf = GridSearchCV(xgb_model,params,n_jobs = 1, cv = StratifiedKFold(Y_train, n_folds=5, shuffle=True), scoring = 'roc_auc', verbose = 2, refit = True) clf.fit(X_train,Y_train) best_parameters,score,_ = max(clf.grid_scores_,key=lambda x: x[1]) print('Raw AUC score:',score) for param_name in sorted(best_parameters.keys()): print("%s: %r" % (param_name, best_parameters[param_name])) # Step 3: Decrease learning rate and up the # of trees #xgb_finalcv = XGBClassifier() tuned_params = clf.best_params_ tuned_params['n_estimators'] = 10000 tuned_params['learning_rate'] = 0.01 cvresult = xgb.cv(tuned_params, d_train, num_boost_round=tuned_params['n_estimators'], nfold=n_folds, metrics='auc', early_stopping_rounds=early_stop_rounds, ) # Train model with cv results and predict on test set For test accuracy n_est_final = int((cvresult.shape[0] - early_stop_rounds) / (1 - 1 / n_folds)) tuned_params['n_estimators'] = n_est_final print(tuned_params) xgb_train = xgb.XGBClassifier() xgb_train.set_params(**tuned_params) xgb_train.fit(X_train,Y_train) bst_preds = xgb_train.predict(X_test) print("Xgboost Test acc = " + str(accuracy_score(Y_test, bst_preds))) print(confusion_matrix(Y_test, bst_preds)) print(classification_report(Y_test, bst_preds)) # Export cv classifier joblib.dump(cvresult, args.path_prefix + args.xgb_pkl + 'cv') # Export classifier trained on full data set xgb_full = xgb.XGBClassifier() xgb_full.set_params(**tuned_params) xgb_full.fit(X,Y) joblib.dump(xgb_full, args.path_prefix + args.xgb_pkl) if __name__ == '__main__': main()
gpl-3.0
-8,813,554,001,576,761,000
37.10929
88
0.57571
false
3.680211
true
false
false
ambitioninc/django-user-guide
user_guide/templatetags/user_guide_tags.py
1
2767
""" Template tag for displaying user guides. """ import re from django import template from django.conf import settings from django.template import loader from django.template.defaulttags import CsrfTokenNode from user_guide.models import GuideInfo register = template.Library() # The maximum number of guides to show per page USER_GUIDE_SHOW_MAX = getattr(settings, 'USER_GUIDE_SHOW_MAX', 10) # Use cookies to determine if guides should be shown USER_GUIDE_USE_COOKIES = getattr(settings, 'USER_GUIDE_USE_COOKIES', False) # The url to any custom CSS USER_GUIDE_CSS_URL = getattr( settings, 'USER_GUIDE_CSS_URL', None ) # The url to any custom JS USER_GUIDE_JS_URL = getattr( settings, 'USER_GUIDE_JS_URL', None ) @register.simple_tag(takes_context=True) def user_guide(context, *args, **kwargs): """ Creates html items for all appropriate user guides. Kwargs: guide_name: A string name of a specific guide. guide_tags: An array of string guide tags. limit: An integer maxmimum number of guides to show at a single time. Returns: An html string containing the user guide scaffolding and any guide html. """ user = context['request'].user if 'request' in context and hasattr(context['request'], 'user') else None if user and user.is_authenticated(): # No one is logged in limit = kwargs.get('limit', USER_GUIDE_SHOW_MAX) filters = { 'user': user, 'is_finished': False } # Handle special filters if kwargs.get('guide_name'): filters['guide__guide_name'] = kwargs.get('guide_name') if kwargs.get('guide_tags'): filters['guide__guide_tag__in'] = kwargs.get('guide_tags') # Set the html html = ''.join(( '<div data-guide="{0}" class="django-user-guide-item">{1}</div>'.format( guide_info.id, guide_info.guide.html ) for guide_info in GuideInfo.objects.select_related('guide').filter(**filters).only('guide')[:limit] )) # Return the rendered template with the guide html return loader.render_to_string('user_guide/window.html', { 'html': re.sub(r'\{\s*static\s*\}', settings.STATIC_URL, html), 'css_href': '{0}user_guide/build/django-user-guide.css'.format(settings.STATIC_URL), 'js_src': '{0}user_guide/build/django-user-guide.js'.format(settings.STATIC_URL), 'custom_css_href': USER_GUIDE_CSS_URL, 'custom_js_src': USER_GUIDE_JS_URL, 'use_cookies': str(USER_GUIDE_USE_COOKIES).lower(), 'csrf_node': CsrfTokenNode().render(context) }) else: return ''
mit
-4,151,106,416,245,228,000
31.940476
113
0.62378
false
3.650396
false
false
false
praekelt/django-ultracache
bin/cache-purge-consumer.py
1
3973
"""Subscribe to RabbitMQ and listen for purge instructions continuously. Manage this script through eg. supervisor.""" import json import traceback from multiprocessing.pool import ThreadPool from optparse import OptionParser from time import sleep import pika import requests import yaml class Consumer: channel = None connection = None def __init__(self): self.pool = ThreadPool() parser = OptionParser() parser.add_option("-c", "--config", dest="config", help="Configuration file", metavar="FILE") (options, args) = parser.parse_args() config_file = options.config self.config = {} if config_file: self.config = yaml.load(open(config_file)) or {} def log(self, msg): name = self.config.get("logfile", None) if not name: return if name == "stdout": print(msg) return fp = open(name, "a") try: fp.write(msg + "\n") finally: fp.close() def connect(self): parameters = pika.URLParameters( self.config.get( "rabbit-url", "amqp://guest:[email protected]:5672/%2F" ) ) self.connection = pika.BlockingConnection(parameters) self.channel = self.connection.channel() self.channel.exchange_declare( exchange="purgatory", exchange_type="fanout" ) queue = self.channel.queue_declare(exclusive=True) queue_name = queue.method.queue self.channel.queue_bind(exchange="purgatory", queue=queue_name) self.channel.basic_qos(prefetch_count=1) self.channel.basic_consume( self.on_message, queue=queue_name, no_ack=False, exclusive=True ) def on_message(self, channel, method_frame, header_frame, body): self.pool.apply_async(self.handle_message, (body,)) channel.basic_ack(delivery_tag=method_frame.delivery_tag) def handle_message(self, body): if body: try: di = json.loads(body) except ValueError: path = body headers = {} else: path = di["path"] headers = di["headers"] self.log("Purging %s with headers %s" % (path, str(headers))) host = self.config.get("host", None) try: if host: final_headers = {"Host": host} final_headers.update(headers) response = requests.request( "PURGE", "http://" \ + self.config.get("proxy-address", "127.0.0.1") + path, headers=final_headers, timeout=10 ) else: response = requests.request( "PURGE", "http://" \ + self.config.get("proxy-address", "127.0.0.1") + path, timeout=10, headers=headers ) except Exception as exception: msg = traceback.format_exc() self.log("Error purging %s: %s" % (path, msg)) else: content = response.content def consume(self): loop = True while loop: try: if self.channel is None: raise pika.exceptions.ConnectionClosed() self.channel.start_consuming() except KeyboardInterrupt: loop = False self.channel.stop_consuming() except pika.exceptions.ConnectionClosed: try: self.connect() except pika.exceptions.ConnectionClosed: sleep(1) self.connection.close() consumer = Consumer() consumer.consume()
bsd-3-clause
-856,625,678,671,990,400
31.300813
83
0.511956
false
4.489266
true
false
false
myriasofo/CLRS_exercises
algos/testSuite.py
1
6292
''' WHAT: Simple test framework for checking algorithms TASK: *Handle output that's an object, eg. bst that gets modified *option3: optional param - Class (accept input/output as arrays and TURN INTO object) (option1: optional param - comparison function (instead of simple "!=") (option2: optional param - Class (automatically deconstruct objects in arrays) ''' import copy def init(*args, **kwargs): return TestSuite(*args, **kwargs) class TestSuite: def __init__(self, tests, dataStructures=None): self.tests = tests self.converter = DataStructureConverter(dataStructures) if dataStructures is not None else None def test(self, function): print('FUNCTION: {}'.format(function.__name__)) tests = copy.deepcopy(self.tests) for i, test in enumerate(tests): params, expected = test try: actual = self.runFunction(function, params) if actual != expected: self.printError(i+1, params, expected, actual) return except Exception as error: self.printError(i+1, params, expected, 'ERROR') raise error def printError(self, iteration, params, expected, actual): print() print('ERROR: Iteration {}'.format(iteration)) print() stringifiedParams = ', '.join([str(param) for param in params]) print('input: {}'.format(stringifiedParams)) print('ouptut expected: {}'.format(expected)) print('output actual: {}'.format(actual)) print() def runFunction(self, function, params): if self.converter is not None: params = self.converter.convertInput(params) params = copy.deepcopy(params) actual = function(*params) if self.converter is not None: actual = self.converter.convertOuptut(actual) return actual class DataStructureConverter: def __init__(self, config): self.config = config self.arrayToDs = { 'SinglyLinkedList': self.createSinglyLinkedList, #'DoublyLinkedList': createSinglyLinkedList, #'BinaryTree': createBinaryTree, #'Queue': createQueue, #'Stack': createStack, } self.dsToArray = { 'SinglyLinkedList': self.createArrayFromSinglyLinkedList, #'DoublyLinkedList': createSinglyLinkedList, #'BinaryTree': createBinaryTree, #'Queue': createQueue, #'Stack': createStack, } def convertInput(self, params): if isinstance(self.config, str): converted = [] for param in params: ds = self.convertArrayToDs(param, self.config) converted.append(ds) return converted elif isinstance(self.config, dict): converted = [] for param, dsName in zip(params, self.config['input']): if not isinstance(dsName, str): converted.append(param) else: ds = self.convertArrayToDs(param, dsName) converted.append(ds) return converted else: raise Exception('ERROR: This is not the right format for dataStructure: {}'.format(self.config)) def convertOuptut(self, output): if isinstance(self.config, str): return self.convertDsToArray(output, self.config) elif isinstance(self.config, dict): return self.convertDsToArray(output, self.config['output']) else: raise Exception('ERROR: This is not the right format for dataStructure: {}'.format(self.ds)) def convertArrayToDs(self, array, dsName): if dsName not in self.arrayToDs: raise Exception('ERROR: Name of dataStructure not supported: {}'.format(dsName)) dsConstructor = self.arrayToDs[dsName] ds = dsConstructor(array) return ds def convertDsToArray(self, ds, dsName): if dsName not in self.dsToArray: raise Exception('ERROR: Name of dataStructure not supported: {}'.format(dsName)) arrayConstructor = self.dsToArray[dsName] array = arrayConstructor(ds) return array class Node: # spec determined by leetcode def __init__(self, val): self.val = val self.next = None def createSinglyLinkedList(self, array, storeInArray=False): if storeInArray: container = [] head = None curr = None for elem in array: node = self.Node(elem) if storeInArray: container.append(node) if head is None: head = node curr = node continue curr.next = node curr = node if storeInArray: return container return head def createArrayFromSinglyLinkedList(self, head): array = [] while head is not None: array.append(head.val) head = head.next return array # custom def createIntersectingLinkedLists(self, nA, nB, nIntersection): headA = self.createSinglyLinkedList(range(nA)) headB = self.createSinglyLinkedList(range(nA, nA+nB)) if nIntersection is None or nIntersection == 0: return headA, headB, None headI = self.createSinglyLinkedList(range(nA+nB, nA+nB+nIntersection)) if headA is None: headA = headI else: self.getEndofList(headA).next = headI if headB is None: headB = headI else: self.getEndofList(headB).next = headI return headA, headB, headI def getEndofList(self, head): while head is not None and head.next is not None: head = head.next return head ### Example usage def main(): import sys sys.path.append('/Users/Abe/my/codingPractice/algos') import testSuite tests = [ ([[3,2,1,5,6,4], 2], 5), ([[3,2,3,1,2,4,5,5,6], 4], 4) ] t = testSuite.init(tests) t.test(v1) t.test(v2) t.test(v3)
mit
-4,231,904,569,753,463,300
30.148515
108
0.578512
false
4.205882
true
false
false
tis-intern-apparel/ApparelStrategy
server/dialogue_system/module/database.py
1
5633
# -*- coding: utf-8 -*- import os import codecs class Personal: point_id = '' user_name = '' user_pronoun = '' sex = '' phone = '' email = '' address = '' class Cloth: cloth_name = '' color_code = '' small_type = '' price = '' image_url = '' big_type = '' cloth_code = '' cloth_describe = '' class Evaluate: clothes = [] osyaredo = 0 class DataBaseManager: def __init__(self,data_dir): self.data_dir = data_dir self.clothes_path = os.path.join(data_dir,'clothes.csv') self.evaluate_path = os.path.join(data_dir,'evaluate.csv') self.personal_path = os.path.join(data_dir,'personal.csv') def __split_csvline(self,line): return line.replace('\n','').replace('"','').split(',') def __struct_personal(self,line): cols = self.__split_csvline(line) personal = Personal() personal.point_id = cols[0] personal.user_name = cols[1] personal.user_pronoun = cols[2] personal.sex = cols[3] personal.phone = cols[4] personal.email = cols[5] personal.address = cols[6] personal.age = cols[7] return personal def __struct_cloth(self,line): cols = self.__split_csvline(line) cloth = Cloth() cloth.cloth_name = cols[0] cloth.color_code = cols[1] cloth.small_type = cols[2] cloth.price = cols[3] cloth.image_url = cols[4] cloth.big_type = cols[5] cloth.cloth_code = cols[6] cloth.cloth_describe = cols[7] return cloth def __struct_evaluate(self,line): cols = self.__split_csvline(line) osyare = Evaluate() osyare.clothes = [] for c in cols: if c == 'null': break else: osyare.clothes.append(c) osyare.osyaredo = cols[3] return osyare def get_personal_from_id(self,point_id): """ read personal data from point id :param point_id: search point id :return: personal object """ with codecs.open(self.personal_path,'r','utf-8') as f: for line in f: personal = self.__struct_personal(line) if personal.point_id == point_id: return personal return None def get_clothes_from_code(self, cloth_code): """ read cloth data from cloth_code :param cloth_code: cloth code for searching :return: cloth object """ with codecs.open(self.clothes_path, 'r', 'utf-8') as f: for line in f: cloth = self.__struct_cloth(line) if cloth.cloth_code == cloth_code: return cloth return None def get_evaluate_from_code(self, cloth_code): """ read evaluate(osyaredo) from cloth code :param cloth_code: cloth code for searching evaluate :return: evaluate object list """ result = [] with codecs.open(self.evaluate_path, 'r', 'utf-8') as f: for line in f: ev = self.__struct_evaluate(line) if ev.clothes.count(cloth_code) > 0: result.append(ev) if len(result) > 0: return result else: return None def get_evaluate_from_codelist(self, cloth_codelist): """ read evaluate(osyaredo) from cloth code :param cloth_code: cloth code for searching evaluate :return: evaluate object list """ result = [] with codecs.open(self.evaluate_path, 'r', 'utf-8') as f: for line in f: ev = self.__struct_evaluate(line) isContain = True for cloth in cloth_codelist: if not cloth.cloth_code in ev.clothes: isContain = False break if isContain: result.append(ev) if len(result) > 0: return result else: return None def get_clothes_from_name(self, contains_name): """ read cloth data from keyword that contains cloth name :param contains_name: key contains cloth name :return: cloth object list """ result = [] with codecs.open(self.clothes_path, 'r', 'utf-8') as f: for line in f: cloth = self.__struct_cloth(line) if cloth.cloth_name.count(contains_name) > 0: result.append(cloth) if len(result) > 0: return result else: return None def get_clothes_from_keys(self, season,price = None): """ read cloth data from keyword that contains cloth name :param contains_name: key contains cloth name :return: cloth object list """ result = [] with codecs.open(self.clothes_path, 'r', 'utf-8') as f: for line in f: cloth = self.__struct_cloth(line) if cloth.cloth_describe.count(season) > 0 or cloth.cloth_name.count(season) > 0: result.append(cloth) if len(result) > 0: return result else: return None if __name__ == '__main__': script_dir = os.path.dirname(__file__) data_path = os.path.join(script_dir,'../../data') manager = DataBaseManager(data_path) personal = manager.get_clothes_from_name('ズボン') for p in personal: print(p.cloth_name)
mit
3,080,065,227,675,096,000
28.005155
96
0.52568
false
3.709295
false
false
false
agoose77/hivesystem
tutorial/layers/layer17/layers.py
1
2334
from __future__ import print_function # import the main and action components from maincomponent import maincomponent from action1 import action1component from action2 import action2component from action3 import action3component #import manager components from action3components import animationmanager from action3components import soundmanager #keyboard mainloop from keycodes import ascii_to_keycode from getch import getch, kbhit, change_termios, restore_termios def mainloop(keyfunc=None): change_termios() while True: while not kbhit(): continue key = getch() if isinstance(key, bytes) and bytes != str: key = key.decode() if key not in ascii_to_keycode: continue keycode = ascii_to_keycode[key] if keycode == "ESCAPE": break if keyfunc is not None: keyfunc(keycode) restore_termios() #define a generic pseudo-hive class import libcontext class pseudohive(object): components = {} def __init__(self): for componentname, componentclass in self.components.items(): component = componentclass() setattr(self, componentname, component) def build(self, contextname): self._contextname = contextname self._context = libcontext.context(self._contextname) def place(self): libcontext.push(self._contextname) for componentname, componentclass in self.components.items(): component = getattr(self, componentname) component.place() libcontext.pop() def close(self): self._context.close() #define the main (pseudo-)hive class mainhive(pseudohive): components = { #action3 manager components "animationmanager": animationmanager, "soundmanager": soundmanager, #main component and action components "maincomponent": maincomponent, "action1": action1component, "action2": action2component, "action3": action3component, } #Set up the main hive and run it #Give us a new mainhive instance main = mainhive() #Build a context named "main" main.build("main") #Declare sockets and plugins main.place() #Build all connections, and validate the connection network main.close() #Run the main loop main.maincomponent.start() mainloop(main.maincomponent.keypress)
bsd-2-clause
2,937,745,632,804,940,000
25.522727
70
0.696658
false
4.116402
false
false
false
DrSkippy/Gravitational-Three-Body-Symmetric
sim_pendulum.py
1
1975
#!/usr/bin/env python import csv import sys import numpy as np import pandas as pd import matplotlib.pyplot as plt plt.style.use('ggplot') # arg 1 = w init # arg 2 = n periods # arg 3 = n ratio # time step dt = np.float64(0.00010) # constants L_0 = np.float64(1.0) # unstretched length g = np.float64(9.81) # gravitation n = np.float64(sys.argv[3]) K_over_M = (n*n - 1)*g/L_0 # initial conditions theta = np.float64(0) L = L_0 + g/K_over_M # equilibrium length with gravity # 2mgl = 1/2 m l^2 w^2 w_sep = np.sqrt(4.*g/L) w_0 = np.float64(sys.argv[1]) w = w_0 # v_l_0 = 0 v_l = v_l_0 # periods T_p = 2.*np.pi/np.sqrt(g/L) T_k = 2.*np.pi/np.sqrt(K_over_M) # record some stuff print "Tp = {} T/dt = {}".format(T_p, T_p/dt) print "Tk = {} T/dt = {}".format(T_k, T_k/dt) print "Tk/Tp = {}".format(T_k/T_p) print "w_esc = {}".format(w_sep) t = np.float64(0.0) theta_last = theta # keep some records data = [] t_s = [] theta += w*dt/2. L += v_l*dt/2. for i in range(int(sys.argv[2])*int(T_p/dt)): w += -dt*g*np.sin(theta)/L v_l += -K_over_M*(L-L_0) + g*np.cos(theta) + w*w*L theta += w*dt theta = np.fmod(theta, 2.*np.pi) L += v_l*dt t += dt data.append([t, theta, w, L, v_l]) if theta_last < 0 and theta > 0: t_s.append(t) theta_last = theta # periods by measure t_s = [t_s[i] - t_s[i-1] for i in range(1,len(t_s)) ] print "avg period = {} std periods = {}".format(np.average(t_s), np.std(t_s)) # plots df = pd.DataFrame().from_records(data) df.columns = ["t", "theta", "omega", "l", "v_l"] df.set_index("t") ax = df.plot(kind="scatter", x="theta", y="omega", marker=".") fig = ax.get_figure() fig.savefig("phase1.png") ax = df.plot(kind="scatter", x="l", y="v_l", marker=".") fig = ax.get_figure() fig.savefig("phase2.png") # config space df["y_c"] = -df["l"] df["x_c"] = df["l"] * np.sin(df["theta"]) ax = df.plot(kind="scatter", x="x_c", y="y_c", marker=".") fig = ax.get_figure() fig.savefig("config.png")
cc0-1.0
3,132,915,243,086,640,600
20.944444
77
0.578734
false
2.214126
false
false
false
metpy/SHARPpy
sharppy/version.py
1
1931
import os.path import subprocess release = False __version__ = '0.2' _repository_path = os.path.split(__file__)[0] _git_file_path = os.path.join(_repository_path, '__git_version__.py') def _minimal_ext_cmd(cmd): # construct minimal environment env = {} for k in ['SYSTEMROOT', 'PATH']: v = os.environ.get(k) if v is not None: env[k] = v # LANGUAGE is used on win32 env['LANGUAGE'] = 'C' env['LANG'] = 'C' env['LC_ALL'] = 'C' out = subprocess.Popen(cmd, stdout=subprocess.PIPE, env=env).communicate()[0] return out def get_git_hash(): ''' Gets the last GIT commit hash and date for the repository, using the path to this file. ''' try: out = _minimal_ext_cmd(['git', 'rev-parse', 'HEAD']) GIT_REVISION = out.strip().decode('ascii') except: GIT_REVISION = None return GIT_REVISION def get_git_revision(): hash = get_git_hash() if hash : rev = '.dev.' + hash[:7] try: cmd = ['git', 'show', '%s' % (hash), '--date=short', '--format="(%ad)"'] date = _minimal_ext_cmd(cmd).split('"')[1] rev += date except: pass else: rev = ".dev.Unknown" return rev def write_git_version(): 'Write the GIT revision to a file.' rev = get_git_revision() if rev == ".dev.Unknown": if os.path.isfile(_git_file_path): return gitfile = open(_git_file_path, 'w') gitfile.write('rev = "%s"\n' % rev) gitfile.close() def get_version(): ''' Get the version of the package, including the GIT revision if this is an actual release. ''' version = __version__ if not release: try: import __git_version__ version += __git_version__.rev except ImportError: version += get_git_revision() return version
bsd-3-clause
6,243,977,662,548,874,000
23.75641
81
0.539617
false
3.504537
false
false
false
brian-o/CS-CourseWork
CS491/Program2/testForks.py
1
2677
############################################################ ''' testForks.py Written by: Brian O'Dell, Spetember 2017 A program to run each program a 500 times per thread count. Then uses the data collected to make graphs and tables that are useful to evaluate the programs running time. ''' ############################################################ from subprocess import * from numba import jit import numpy as np import csv as csv import pandas as pd from pandas.plotting import table import matplotlib.pyplot as plt ''' Call the C program multiple times with variable arguments to gather data The name of the executable should exist before running ''' @jit def doCount(name): j = 0 while (j < 1025): for i in range(0,501): call([name,"-t",str(j), "-w"]) if (j == 0): j = 1 else: j = 2*j; ''' Turn the data into something meaningful. Takes all the data gets the average and standard deviation for each number of threads. Then plots a graph based on it. Also, makes a csv with the avg and stddev ''' @jit def exportData(name): DF = pd.read_csv("data/"+name+".csv") f = {'ExecTime':['mean','std']} #group by the number of threads in the csv and #apply the mean and standard deviation functions to the groups avgDF = DF.groupby('NumThreads').agg(f) avgTable = DF.groupby('NumThreads', as_index=False).agg(f) #When the data csv was saved we used 0 to indicate serial execution #this was so the rows would be in numerical order instead of Alphabetical #Now rename index 0 to Serial to be an accurate representation indexList = avgDF.index.tolist() indexList[0] = 'Serial' avgDF.index = indexList #make the bar chart and set the axes avgPlot = avgDF.plot(kind='bar', title=('Run Times Using '+ name), legend='False', figsize=(15,8)) avgPlot.set_xlabel("Number of Forks") avgPlot.set_ylabel("Run Time (seconds)") #put the data values on top of the bars for clarity avgPlot.legend(['mean','std deviation']) for p in avgPlot.patches: avgPlot.annotate((str(p.get_height())[:6]), (p.get_x()-.01, p.get_height()), fontsize=9) #save the files we need plt.savefig('data/'+name+'Graph.png') avgTable.to_csv('data/'+name+'Table.csv', index=False, encoding='utf-8') def main(): doCount("./forkedSemaphor") doCount("./forkedPrivateCount") doCount("./forkedPrivateCount32") exportData("forkedSemaphor") exportData("forkedPrivateCount") exportData("forkedPrivateCount32") if __name__ == '__main__': main()
gpl-3.0
5,887,714,014,429,846,000
30.494118
82
0.623086
false
3.851799
false
false
false
PennyDreadfulMTG/Penny-Dreadful-Tools
modo_bugs/fetcher.py
1
4118
import os import sys from typing import Dict, List, Optional, Tuple from bs4 import BeautifulSoup from bs4.element import Tag from shared import fetch_tools, lazy def search_scryfall(query: str) -> Tuple[int, List[str], List[str]]: """Returns a tuple. First member is an integer indicating how many cards match the query total, second member is a list of card names up to the maximum that could be fetched in a timely fashion.""" if query == '': return 0, [], [] print(f'Searching scryfall for `{query}`') result_json = fetch_tools.fetch_json('https://api.scryfall.com/cards/search?q=' + fetch_tools.escape(query), character_encoding='utf-8') if 'code' in result_json.keys(): # The API returned an error if result_json['status'] == 404: # No cards found return 0, [], [] print('Error fetching scryfall data:\n', result_json) return 0, [], [] for warning in result_json.get('warnings', []): # scryfall-provided human-readable warnings print(warning) result_data = result_json['data'] result_data.sort(key=lambda x: x['legalities']['penny']) def get_frontside(scr_card: Dict) -> str: """If card is transform, returns first name. Otherwise, returns name. This is to make sure cards are later found in the database""" # not sure how to handle meld cards if scr_card['layout'] in ['transform', 'flip', 'modal_dfc']: return scr_card['card_faces'][0]['name'] return scr_card['name'] result_cardnames = [get_frontside(obj) for obj in result_data] return result_json['total_cards'], result_cardnames, result_json.get('warnings', []) def catalog_cardnames() -> List[str]: result_json = fetch_tools.fetch_json('https://api.scryfall.com/catalog/card-names') names: List[str] = result_json['data'] for n in names: if ' // ' in n: names.extend(n.split(' // ')) return names def update_redirect(file: str, title: str, redirect: str, **kwargs: str) -> bool: text = '---\ntitle: {title}\nredirect_to:\n - {url}\n'.format(title=title, url=redirect) for key, value in kwargs.items(): text += f'{key}: {value}\n' text = text + '---\n' fname = f'{file}.md' if not os.path.exists(fname): bb_jekyl = open(fname, mode='w') bb_jekyl.write('') bb_jekyl.close() bb_jekyl = open(fname, mode='r') orig = bb_jekyl.read() bb_jekyl.close() if orig != text: print(f'New {file} update!') bb_jekyl = open(fname, mode='w') bb_jekyl.write(text) bb_jekyl.close() return True if 'always-scrape' in sys.argv: return True return False def find_bug_blog() -> Tuple[Optional[str], bool]: bug_blogs = [a for a in get_article_archive() if str(a[0].string).startswith('Magic Online Bug Blog')] if not bug_blogs: return (None, False) (title, link) = bug_blogs[0] print('Found: {0} ({1})'.format(title, link)) new = update_redirect('bug_blog', title.text, link) return (link, new) def find_announcements() -> Tuple[str, bool]: articles = [a for a in get_article_archive() if str(a[0].string).startswith('Magic Online Announcements')] (title, link) = articles[0] print('Found: {0} ({1})'.format(title, link)) bn = 'Build Notes' in fetch_tools.fetch(link) new = update_redirect('announcements', title.text, link, has_build_notes=str(bn)) return (link, new) def parse_article_item_extended(a: Tag) -> Tuple[Tag, str]: title = a.find_all('h3')[0] link = 'http://magic.wizards.com' + a.find_all('a')[0]['href'] return (title, link) @lazy.lazy_property def get_article_archive() -> List[Tuple[Tag, str]]: try: html = fetch_tools.fetch('http://magic.wizards.com/en/articles/archive/184956') except fetch_tools.FetchException: html = fetch_tools.fetch('http://magic.wizards.com/en/articles/archive/') soup = BeautifulSoup(html, 'html.parser') return [parse_article_item_extended(a) for a in soup.find_all('div', class_='article-item-extended')]
gpl-3.0
-1,526,794,542,128,501,000
41.020408
140
0.629917
false
3.278662
false
false
false
heldergg/webpymail
webpymail/sabapp/models.py
1
2844
# -*- coding: utf-8 -*- # sabapp - Simple Address Book Application # Copyright (C) 2008 Helder Guerreiro # This file is part of sabapp. # # sabapp is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # sabapp is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with sabapp. If not, see <http://www.gnu.org/licenses/>. # # Helder Guerreiro <[email protected]> # from django.contrib.auth.models import User from django.db import models from django.db.models import Q from django.utils.translation import gettext_lazy as _ # Models: ADDRESSBOOKTYPE = ( (1, _('User address book')), (2, _('Server address book')), (3, _('Site address book')), ) class AddressManager(models.Manager): def for_request(self, request): '''Addresses available for request''' host = request.session['host'] return super(AddressManager, self).get_queryset().filter( Q(user__exact=request.user, imap_server__exact=host, ab_type__exact=1) | Q(imap_server__exact=host, ab_type__exact=2) | Q(ab_type__exact=3)) def have_addr(self, request, addr): address = self.for_request(request).filter(email__iexact=addr) return bool(address) class Address(models.Model): user = models.ForeignKey(User, null=True) imap_server = models.CharField(_('IMAP server'), max_length=128) nickname = models.CharField(max_length=64, blank=True) first_name = models.CharField(_('first name'), max_length=30, blank=True) last_name = models.CharField(_('last name'), max_length=64, blank=True) email = models.EmailField(_('e-mail address')) additional_info = models.CharField(_('aditional information'), max_length=128, blank=True) ab_type = models.IntegerField(choices=ADDRESSBOOKTYPE) objects = AddressManager() class Meta: verbose_name = _('Address') verbose_name_plural = _('Addresses') db_table = 'address_book' ordering = ['first_name', 'last_name', 'email'] def full_name(self): return ('%s %s' % (self.first_name, self.last_name)).strip() def mail_addr(self): name = ('%s %s' % (self.first_name, self.last_name)).strip() if name: return '"%s" <%s>' % (name, self.email) else: return self.email def __str__(self): return self.mail_addr()
gpl-3.0
-5,009,104,855,560,248,000
31.318182
77
0.645921
false
3.707953
false
false
false
silentfuzzle/calibre
src/calibre/devices/kobo/driver.py
1
147621
#!/usr/bin/env python2 # vim:fileencoding=UTF-8:ts=4:sw=4:sta:et:sts=4:ai from __future__ import division __license__ = 'GPL v3' __copyright__ = '2010-2012, Timothy Legge <[email protected]>, Kovid Goyal <[email protected]> and David Forrester <[email protected]>' __docformat__ = 'restructuredtext en' ''' Driver for Kobo ereaders. Supports all e-ink devices. Originally developed by Timothy Legge <[email protected]>. Extended to support Touch firmware 2.0.0 and later and newer devices by David Forrester <[email protected]> ''' import os, time, shutil from contextlib import closing from calibre.devices.usbms.books import BookList from calibre.devices.usbms.books import CollectionsBookList from calibre.devices.kobo.books import KTCollectionsBookList from calibre.devices.kobo.books import Book from calibre.devices.kobo.books import ImageWrapper from calibre.devices.mime import mime_type_ext from calibre.devices.usbms.driver import USBMS, debug_print from calibre import prints, fsync from calibre.ptempfile import PersistentTemporaryFile from calibre.constants import DEBUG from calibre.utils.config_base import prefs EPUB_EXT = '.epub' KEPUB_EXT = '.kepub' # Implementation of QtQHash for strings. This doesn't seem to be in the Python implementation. def qhash(inputstr): instr = b"" if isinstance(inputstr, bytes): instr = inputstr elif isinstance(inputstr, unicode): instr = inputstr.encode("utf8") else: return -1 h = 0x00000000 for x in bytearray(instr): h = (h << 4) + x h ^= (h & 0xf0000000) >> 23 h &= 0x0fffffff return h class DummyCSSPreProcessor(object): def __call__(self, data, add_namespace=False): return data class KOBO(USBMS): name = 'Kobo Reader Device Interface' gui_name = 'Kobo Reader' description = _('Communicate with the Kobo Reader') author = 'Timothy Legge and David Forrester' version = (2, 1, 8) dbversion = 0 fwversion = 0 supported_dbversion = 120 has_kepubs = False supported_platforms = ['windows', 'osx', 'linux'] booklist_class = CollectionsBookList book_class = Book # Ordered list of supported formats FORMATS = ['kepub', 'epub', 'pdf', 'txt', 'cbz', 'cbr'] CAN_SET_METADATA = ['collections'] VENDOR_ID = [0x2237] BCD = [0x0110, 0x0323, 0x0326] ORIGINAL_PRODUCT_ID = [0x4165] WIFI_PRODUCT_ID = [0x4161, 0x4162] PRODUCT_ID = ORIGINAL_PRODUCT_ID + WIFI_PRODUCT_ID VENDOR_NAME = ['KOBO_INC', 'KOBO'] WINDOWS_MAIN_MEM = WINDOWS_CARD_A_MEM = ['.KOBOEREADER', 'EREADER'] EBOOK_DIR_MAIN = '' SUPPORTS_SUB_DIRS = True SUPPORTS_ANNOTATIONS = True # "kepubs" do not have an extension. The name looks like a GUID. Using an empty string seems to work. VIRTUAL_BOOK_EXTENSIONS = frozenset(['kobo', '']) EXTRA_CUSTOMIZATION_MESSAGE = [ _('The Kobo supports several collections including ')+ 'Read, Closed, Im_Reading. ' + _('Create tags for automatic management'), _('Upload covers for books (newer readers)') + ':::'+_('Normally, the KOBO readers get the cover image from the' ' ebook file itself. With this option, calibre will send a ' 'separate cover image to the reader, useful if you ' 'have modified the cover.'), _('Upload Black and White Covers'), _('Show expired books') + ':::'+_('A bug in an earlier version left non kepubs book records' ' in the database. With this option Calibre will show the ' 'expired records and allow you to delete them with ' 'the new delete logic.'), _('Show Previews') + ':::'+_('Kobo previews are included on the Touch and some other versions' ' by default they are no longer displayed as there is no good reason to ' 'see them. Enable if you wish to see/delete them.'), _('Show Recommendations') + ':::'+_('Kobo now shows recommendations on the device. In some cases these have ' 'files but in other cases they are just pointers to the web site to buy. ' 'Enable if you wish to see/delete them.'), _('Attempt to support newer firmware') + ':::'+_('Kobo routinely updates the firmware and the ' 'database version. With this option calibre will attempt ' 'to perform full read-write functionality - Here be Dragons!! ' 'Enable only if you are comfortable with restoring your kobo ' 'to factory defaults and testing software'), ] EXTRA_CUSTOMIZATION_DEFAULT = [ ', '.join(['tags']), True, True, True, False, False, False ] OPT_COLLECTIONS = 0 OPT_UPLOAD_COVERS = 1 OPT_UPLOAD_GRAYSCALE_COVERS = 2 OPT_SHOW_EXPIRED_BOOK_RECORDS = 3 OPT_SHOW_PREVIEWS = 4 OPT_SHOW_RECOMMENDATIONS = 5 OPT_SUPPORT_NEWER_FIRMWARE = 6 def initialize(self): USBMS.initialize(self) self.dbversion = 7 def device_database_path(self): return self.normalize_path(self._main_prefix + '.kobo/KoboReader.sqlite') def books(self, oncard=None, end_session=True): from calibre.ebooks.metadata.meta import path_to_ext dummy_bl = BookList(None, None, None) if oncard == 'carda' and not self._card_a_prefix: self.report_progress(1.0, _('Getting list of books on device...')) return dummy_bl elif oncard == 'cardb' and not self._card_b_prefix: self.report_progress(1.0, _('Getting list of books on device...')) return dummy_bl elif oncard and oncard != 'carda' and oncard != 'cardb': self.report_progress(1.0, _('Getting list of books on device...')) return dummy_bl prefix = self._card_a_prefix if oncard == 'carda' else \ self._card_b_prefix if oncard == 'cardb' \ else self._main_prefix # Determine the firmware version try: with open(self.normalize_path(self._main_prefix + '.kobo/version'), 'rb') as f: self.fwversion = f.readline().split(',')[2] except: self.fwversion = 'unknown' if self.fwversion != '1.0' and self.fwversion != '1.4': self.has_kepubs = True debug_print('Version of driver: ', self.version, 'Has kepubs:', self.has_kepubs) debug_print('Version of firmware: ', self.fwversion, 'Has kepubs:', self.has_kepubs) self.booklist_class.rebuild_collections = self.rebuild_collections # get the metadata cache bl = self.booklist_class(oncard, prefix, self.settings) need_sync = self.parse_metadata_cache(bl, prefix, self.METADATA_CACHE) # make a dict cache of paths so the lookup in the loop below is faster. bl_cache = {} for idx,b in enumerate(bl): bl_cache[b.lpath] = idx def update_booklist(prefix, path, title, authors, mime, date, ContentType, ImageID, readstatus, MimeType, expired, favouritesindex, accessibility): changed = False try: lpath = path.partition(self.normalize_path(prefix))[2] if lpath.startswith(os.sep): lpath = lpath[len(os.sep):] lpath = lpath.replace('\\', '/') # debug_print("LPATH: ", lpath, " - Title: " , title) playlist_map = {} if lpath not in playlist_map: playlist_map[lpath] = [] if readstatus == 1: playlist_map[lpath].append('Im_Reading') elif readstatus == 2: playlist_map[lpath].append('Read') elif readstatus == 3: playlist_map[lpath].append('Closed') # Related to a bug in the Kobo firmware that leaves an expired row for deleted books # this shows an expired Collection so the user can decide to delete the book if expired == 3: playlist_map[lpath].append('Expired') # A SHORTLIST is supported on the touch but the data field is there on most earlier models if favouritesindex == 1: playlist_map[lpath].append('Shortlist') # Label Previews if accessibility == 6: playlist_map[lpath].append('Preview') elif accessibility == 4: playlist_map[lpath].append('Recommendation') path = self.normalize_path(path) # print "Normalized FileName: " + path idx = bl_cache.get(lpath, None) if idx is not None: bl_cache[lpath] = None if ImageID is not None: imagename = self.normalize_path(self._main_prefix + '.kobo/images/' + ImageID + ' - NickelBookCover.parsed') if not os.path.exists(imagename): # Try the Touch version if the image does not exist imagename = self.normalize_path(self._main_prefix + '.kobo/images/' + ImageID + ' - N3_LIBRARY_FULL.parsed') # print "Image name Normalized: " + imagename if not os.path.exists(imagename): debug_print("Strange - The image name does not exist - title: ", title) if imagename is not None: bl[idx].thumbnail = ImageWrapper(imagename) if (ContentType != '6' and MimeType != 'Shortcover'): if os.path.exists(self.normalize_path(os.path.join(prefix, lpath))): if self.update_metadata_item(bl[idx]): # print 'update_metadata_item returned true' changed = True else: debug_print(" Strange: The file: ", prefix, lpath, " does mot exist!") if lpath in playlist_map and \ playlist_map[lpath] not in bl[idx].device_collections: bl[idx].device_collections = playlist_map.get(lpath,[]) else: if ContentType == '6' and MimeType == 'Shortcover': book = Book(prefix, lpath, title, authors, mime, date, ContentType, ImageID, size=1048576) else: try: if os.path.exists(self.normalize_path(os.path.join(prefix, lpath))): book = self.book_from_path(prefix, lpath, title, authors, mime, date, ContentType, ImageID) else: debug_print(" Strange: The file: ", prefix, lpath, " does mot exist!") title = "FILE MISSING: " + title book = Book(prefix, lpath, title, authors, mime, date, ContentType, ImageID, size=1048576) except: debug_print("prefix: ", prefix, "lpath: ", lpath, "title: ", title, "authors: ", authors, "mime: ", mime, "date: ", date, "ContentType: ", ContentType, "ImageID: ", ImageID) raise # print 'Update booklist' book.device_collections = playlist_map.get(lpath,[]) # if lpath in playlist_map else [] if bl.add_book(book, replace_metadata=False): changed = True except: # Probably a path encoding error import traceback traceback.print_exc() return changed import sqlite3 as sqlite with closing(sqlite.connect( self.normalize_path(self._main_prefix + '.kobo/KoboReader.sqlite'))) as connection: # return bytestrings if the content cannot the decoded as unicode connection.text_factory = lambda x: unicode(x, "utf-8", "ignore") cursor = connection.cursor() cursor.execute('select version from dbversion') result = cursor.fetchone() self.dbversion = result[0] debug_print("Database Version: ", self.dbversion) opts = self.settings() if self.dbversion >= 33: query= ('select Title, Attribution, DateCreated, ContentID, MimeType, ContentType, ' 'ImageID, ReadStatus, ___ExpirationStatus, FavouritesIndex, Accessibility, IsDownloaded from content where ' 'BookID is Null %(previews)s %(recomendations)s and not ((___ExpirationStatus=3 or ___ExpirationStatus is Null) %(expiry)s') % dict(expiry=' and ContentType = 6)' if opts.extra_customization[self.OPT_SHOW_EXPIRED_BOOK_RECORDS] else ')', previews=' and Accessibility <> 6' if opts.extra_customization[self.OPT_SHOW_PREVIEWS] == False else '', recomendations=' and IsDownloaded in (\'true\', 1)' if opts.extra_customization[self.OPT_SHOW_RECOMMENDATIONS] == False else '') elif self.dbversion >= 16 and self.dbversion < 33: query= ('select Title, Attribution, DateCreated, ContentID, MimeType, ContentType, ' 'ImageID, ReadStatus, ___ExpirationStatus, FavouritesIndex, Accessibility, "1" as IsDownloaded from content where ' 'BookID is Null and not ((___ExpirationStatus=3 or ___ExpirationStatus is Null) %(expiry)s') % dict(expiry=' and ContentType = 6)' if opts.extra_customization[self.OPT_SHOW_EXPIRED_BOOK_RECORDS] else ')') elif self.dbversion < 16 and self.dbversion >= 14: query= ('select Title, Attribution, DateCreated, ContentID, MimeType, ContentType, ' 'ImageID, ReadStatus, ___ExpirationStatus, FavouritesIndex, "-1" as Accessibility, "1" as IsDownloaded from content where ' 'BookID is Null and not ((___ExpirationStatus=3 or ___ExpirationStatus is Null) %(expiry)s') % dict(expiry=' and ContentType = 6)' if opts.extra_customization[self.OPT_SHOW_EXPIRED_BOOK_RECORDS] else ')') elif self.dbversion < 14 and self.dbversion >= 8: query= ('select Title, Attribution, DateCreated, ContentID, MimeType, ContentType, ' 'ImageID, ReadStatus, ___ExpirationStatus, "-1" as FavouritesIndex, "-1" as Accessibility, "1" as IsDownloaded from content where ' 'BookID is Null and not ((___ExpirationStatus=3 or ___ExpirationStatus is Null) %(expiry)s') % dict(expiry=' and ContentType = 6)' if opts.extra_customization[self.OPT_SHOW_EXPIRED_BOOK_RECORDS] else ')') else: query= 'select Title, Attribution, DateCreated, ContentID, MimeType, ContentType, ' \ 'ImageID, ReadStatus, "-1" as ___ExpirationStatus, "-1" as FavouritesIndex, "-1" as Accessibility, "1" as IsDownloaded from content where BookID is Null' try: cursor.execute(query) except Exception as e: err = str(e) if not ('___ExpirationStatus' in err or 'FavouritesIndex' in err or 'Accessibility' in err or 'IsDownloaded' in err): raise query= ('select Title, Attribution, DateCreated, ContentID, MimeType, ContentType, ' 'ImageID, ReadStatus, "-1" as ___ExpirationStatus, "-1" as ' 'FavouritesIndex, "-1" as Accessibility from content where ' 'BookID is Null') cursor.execute(query) changed = False for i, row in enumerate(cursor): # self.report_progress((i+1) / float(numrows), _('Getting list of books on device...')) if not hasattr(row[3], 'startswith') or row[3].startswith("file:///usr/local/Kobo/help/"): # These are internal to the Kobo device and do not exist continue path = self.path_from_contentid(row[3], row[5], row[4], oncard) mime = mime_type_ext(path_to_ext(path)) if path.find('kepub') == -1 else 'application/epub+zip' # debug_print("mime:", mime) if oncard != 'carda' and oncard != 'cardb' and not row[3].startswith("file:///mnt/sd/"): changed = update_booklist(self._main_prefix, path, row[0], row[1], mime, row[2], row[5], row[6], row[7], row[4], row[8], row[9], row[10]) # print "shortbook: " + path elif oncard == 'carda' and row[3].startswith("file:///mnt/sd/"): changed = update_booklist(self._card_a_prefix, path, row[0], row[1], mime, row[2], row[5], row[6], row[7], row[4], row[8], row[9], row[10]) if changed: need_sync = True cursor.close() # Remove books that are no longer in the filesystem. Cache contains # indices into the booklist if book not in filesystem, None otherwise # Do the operation in reverse order so indices remain valid for idx in sorted(bl_cache.itervalues(), reverse=True): if idx is not None: need_sync = True del bl[idx] # print "count found in cache: %d, count of files in metadata: %d, need_sync: %s" % \ # (len(bl_cache), len(bl), need_sync) if need_sync: # self.count_found_in_bl != len(bl) or need_sync: if oncard == 'cardb': self.sync_booklists((None, None, bl)) elif oncard == 'carda': self.sync_booklists((None, bl, None)) else: self.sync_booklists((bl, None, None)) self.report_progress(1.0, _('Getting list of books on device...')) return bl def filename_callback(self, path, mi): # debug_print("Kobo:filename_callback:Path - {0}".format(path)) idx = path.rfind('.') ext = path[idx:] if ext == KEPUB_EXT: path = path + EPUB_EXT # debug_print("Kobo:filename_callback:New path - {0}".format(path)) return path def delete_via_sql(self, ContentID, ContentType): # Delete Order: # 1) shortcover_page # 2) volume_shorcover # 2) content import sqlite3 as sqlite debug_print('delete_via_sql: ContentID: ', ContentID, 'ContentType: ', ContentType) with closing(sqlite.connect(self.normalize_path(self._main_prefix + '.kobo/KoboReader.sqlite'))) as connection: # return bytestrings if the content cannot the decoded as unicode connection.text_factory = lambda x: unicode(x, "utf-8", "ignore") cursor = connection.cursor() t = (ContentID,) cursor.execute('select ImageID from content where ContentID = ?', t) ImageID = None for row in cursor: # First get the ImageID to delete the images ImageID = row[0] cursor.close() cursor = connection.cursor() if ContentType == 6 and self.dbversion < 8: # Delete the shortcover_pages first cursor.execute('delete from shortcover_page where shortcoverid in (select ContentID from content where BookID = ?)', t) # Delete the volume_shortcovers second cursor.execute('delete from volume_shortcovers where volumeid = ?', t) # Delete the rows from content_keys if self.dbversion >= 8: cursor.execute('delete from content_keys where volumeid = ?', t) # Delete the chapters associated with the book next t = (ContentID,) # Kobo does not delete the Book row (ie the row where the BookID is Null) # The next server sync should remove the row cursor.execute('delete from content where BookID = ?', t) if ContentType == 6: try: cursor.execute('update content set ReadStatus=0, FirstTimeReading = \'true\', ___PercentRead=0, ___ExpirationStatus=3 ' 'where BookID is Null and ContentID =?',t) except Exception as e: if 'no such column' not in str(e): raise try: cursor.execute('update content set ReadStatus=0, FirstTimeReading = \'true\', ___PercentRead=0 ' 'where BookID is Null and ContentID =?',t) except Exception as e: if 'no such column' not in str(e): raise cursor.execute('update content set ReadStatus=0, FirstTimeReading = \'true\' ' 'where BookID is Null and ContentID =?',t) else: cursor.execute('delete from content where BookID is Null and ContentID =?',t) connection.commit() cursor.close() if ImageID == None: print "Error condition ImageID was not found" print "You likely tried to delete a book that the kobo has not yet added to the database" # If all this succeeds we need to delete the images files via the ImageID return ImageID def delete_images(self, ImageID, book_path): if ImageID != None: path_prefix = '.kobo/images/' path = self._main_prefix + path_prefix + ImageID file_endings = (' - iPhoneThumbnail.parsed', ' - bbMediumGridList.parsed', ' - NickelBookCover.parsed', ' - N3_LIBRARY_FULL.parsed', ' - N3_LIBRARY_GRID.parsed', ' - N3_LIBRARY_LIST.parsed', ' - N3_SOCIAL_CURRENTREAD.parsed', ' - N3_FULL.parsed',) for ending in file_endings: fpath = path + ending fpath = self.normalize_path(fpath) if os.path.exists(fpath): # print 'Image File Exists: ' + fpath os.unlink(fpath) def delete_books(self, paths, end_session=True): if self.modify_database_check("delete_books") == False: return for i, path in enumerate(paths): self.report_progress((i+1) / float(len(paths)), _('Removing books from device...')) path = self.normalize_path(path) # print "Delete file normalized path: " + path extension = os.path.splitext(path)[1] ContentType = self.get_content_type_from_extension(extension) if extension != '' else self.get_content_type_from_path(path) ContentID = self.contentid_from_path(path, ContentType) ImageID = self.delete_via_sql(ContentID, ContentType) # print " We would now delete the Images for" + ImageID self.delete_images(ImageID, path) if os.path.exists(path): # Delete the ebook # print "Delete the ebook: " + path os.unlink(path) filepath = os.path.splitext(path)[0] for ext in self.DELETE_EXTS: if os.path.exists(filepath + ext): # print "Filename: " + filename os.unlink(filepath + ext) if os.path.exists(path + ext): # print "Filename: " + filename os.unlink(path + ext) if self.SUPPORTS_SUB_DIRS: try: # print "removed" os.removedirs(os.path.dirname(path)) except: pass self.report_progress(1.0, _('Removing books from device...')) def remove_books_from_metadata(self, paths, booklists): if self.modify_database_check("remove_books_from_metatata") == False: return for i, path in enumerate(paths): self.report_progress((i+1) / float(len(paths)), _('Removing books from device metadata listing...')) for bl in booklists: for book in bl: # print "Book Path: " + book.path if path.endswith(book.path): # print " Remove: " + book.path bl.remove_book(book) self.report_progress(1.0, _('Removing books from device metadata listing...')) def add_books_to_metadata(self, locations, metadata, booklists): metadata = iter(metadata) for i, location in enumerate(locations): self.report_progress((i+1) / float(len(locations)), _('Adding books to device metadata listing...')) info = metadata.next() blist = 2 if location[1] == 'cardb' else 1 if location[1] == 'carda' else 0 # Extract the correct prefix from the pathname. To do this correctly, # we must ensure that both the prefix and the path are normalized # so that the comparison will work. Book's __init__ will fix up # lpath, so we don't need to worry about that here. path = self.normalize_path(location[0]) if self._main_prefix: prefix = self._main_prefix if \ path.startswith(self.normalize_path(self._main_prefix)) else None if not prefix and self._card_a_prefix: prefix = self._card_a_prefix if \ path.startswith(self.normalize_path(self._card_a_prefix)) else None if not prefix and self._card_b_prefix: prefix = self._card_b_prefix if \ path.startswith(self.normalize_path(self._card_b_prefix)) else None if prefix is None: prints('in add_books_to_metadata. Prefix is None!', path, self._main_prefix) continue # print "Add book to metatdata: " # print "prefix: " + prefix lpath = path.partition(prefix)[2] if lpath.startswith('/') or lpath.startswith('\\'): lpath = lpath[1:] # print "path: " + lpath book = self.book_class(prefix, lpath, other=info) if book.size is None or book.size == 0: book.size = os.stat(self.normalize_path(path)).st_size b = booklists[blist].add_book(book, replace_metadata=True) if b: b._new_book = True self.report_progress(1.0, _('Adding books to device metadata listing...')) def contentid_from_path(self, path, ContentType): if ContentType == 6: extension = os.path.splitext(path)[1] if extension == '.kobo': ContentID = os.path.splitext(path)[0] # Remove the prefix on the file. it could be either ContentID = ContentID.replace(self._main_prefix, '') else: ContentID = path ContentID = ContentID.replace(self._main_prefix + self.normalize_path('.kobo/kepub/'), '') if self._card_a_prefix is not None: ContentID = ContentID.replace(self._card_a_prefix, '') elif ContentType == 999: # HTML Files ContentID = path ContentID = ContentID.replace(self._main_prefix, "/mnt/onboard/") if self._card_a_prefix is not None: ContentID = ContentID.replace(self._card_a_prefix, "/mnt/sd/") else: # ContentType = 16 ContentID = path ContentID = ContentID.replace(self._main_prefix, "file:///mnt/onboard/") if self._card_a_prefix is not None: ContentID = ContentID.replace(self._card_a_prefix, "file:///mnt/sd/") ContentID = ContentID.replace("\\", '/') return ContentID def get_content_type_from_path(self, path): # Strictly speaking the ContentType could be 6 or 10 # however newspapers have the same storage format if path.find('kepub') >= 0: ContentType = 6 return ContentType def get_content_type_from_extension(self, extension): if extension == '.kobo': # Kobo books do not have book files. They do have some images though # print "kobo book" ContentType = 6 elif extension == '.pdf' or extension == '.epub': # print "ePub or pdf" ContentType = 16 elif extension == '.rtf' or extension == '.txt' or extension == '.htm' or extension == '.html': # print "txt" if self.fwversion == '1.0' or self.fwversion == '1.4' or self.fwversion == '1.7.4': ContentType = 999 else: ContentType = 901 else: # if extension == '.html' or extension == '.txt': ContentType = 901 # Yet another hack: to get around Kobo changing how ContentID is stored return ContentType def path_from_contentid(self, ContentID, ContentType, MimeType, oncard): path = ContentID if oncard == 'cardb': print 'path from_contentid cardb' elif oncard == 'carda': path = path.replace("file:///mnt/sd/", self._card_a_prefix) # print "SD Card: " + path else: if ContentType == "6" and MimeType == 'Shortcover': # This is a hack as the kobo files do not exist # but the path is required to make a unique id # for calibre's reference path = self._main_prefix + path + '.kobo' # print "Path: " + path elif (ContentType == "6" or ContentType == "10") and MimeType == 'application/x-kobo-epub+zip': if path.startswith("file:///mnt/onboard/"): path = self._main_prefix + path.replace("file:///mnt/onboard/", '') else: path = self._main_prefix + '.kobo/kepub/' + path # print "Internal: " + path else: # if path.startswith("file:///mnt/onboard/"): path = path.replace("file:///mnt/onboard/", self._main_prefix) path = path.replace("/mnt/onboard/", self._main_prefix) # print "Internal: " + path return path def modify_database_check(self, function): # Checks to see whether the database version is supported # and whether the user has chosen to support the firmware version if self.dbversion > self.supported_dbversion: # Unsupported database opts = self.settings() if not opts.extra_customization[self.OPT_SUPPORT_NEWER_FIRMWARE]: debug_print('The database has been upgraded past supported version') self.report_progress(1.0, _('Removing books from device...')) from calibre.devices.errors import UserFeedback raise UserFeedback(_("Kobo database version unsupported - See details"), _('Your Kobo is running an updated firmware/database version.' ' As calibre does not know about this updated firmware,' ' database editing is disabled, to prevent corruption.' ' You can still send books to your Kobo with calibre, ' ' but deleting books and managing collections is disabled.' ' If you are willing to experiment and know how to reset' ' your Kobo to Factory defaults, you can override this' ' check by right clicking the device icon in calibre and' ' selecting "Configure this device" and then the ' ' "Attempt to support newer firmware" option.' ' Doing so may require you to perform a factory reset of' ' your Kobo.') + (( '\nDevice database version: %s.' '\nDevice firmware version: %s') % (self.dbversion, self.fwversion)) , UserFeedback.WARN) return False else: # The user chose to edit the database anyway return True else: # Supported database version return True def get_file(self, path, *args, **kwargs): tpath = self.munge_path(path) extension = os.path.splitext(tpath)[1] if extension == '.kobo': from calibre.devices.errors import UserFeedback raise UserFeedback(_("Not Implemented"), _('".kobo" files do not exist on the device as books; ' 'instead they are rows in the sqlite database. ' 'Currently they cannot be exported or viewed.'), UserFeedback.WARN) return USBMS.get_file(self, path, *args, **kwargs) @classmethod def book_from_path(cls, prefix, lpath, title, authors, mime, date, ContentType, ImageID): # debug_print("KOBO:book_from_path - title=%s"%title) from calibre.ebooks.metadata import MetaInformation if cls.settings().read_metadata or cls.MUST_READ_METADATA: mi = cls.metadata_from_path(cls.normalize_path(os.path.join(prefix, lpath))) else: from calibre.ebooks.metadata.meta import metadata_from_filename mi = metadata_from_filename(cls.normalize_path(os.path.basename(lpath)), cls.build_template_regexp()) if mi is None: mi = MetaInformation(os.path.splitext(os.path.basename(lpath))[0], [_('Unknown')]) size = os.stat(cls.normalize_path(os.path.join(prefix, lpath))).st_size book = cls.book_class(prefix, lpath, title, authors, mime, date, ContentType, ImageID, size=size, other=mi) return book def get_device_paths(self): paths = {} for prefix, path, source_id in [ ('main', 'metadata.calibre', 0), ('card_a', 'metadata.calibre', 1), ('card_b', 'metadata.calibre', 2) ]: prefix = getattr(self, '_%s_prefix'%prefix) if prefix is not None and os.path.exists(prefix): paths[source_id] = os.path.join(prefix, *(path.split('/'))) return paths def reset_readstatus(self, connection, oncard): cursor = connection.cursor() # Reset Im_Reading list in the database if oncard == 'carda': query= 'update content set ReadStatus=0, FirstTimeReading = \'true\' where BookID is Null and ContentID like \'file:///mnt/sd/%\'' elif oncard != 'carda' and oncard != 'cardb': query= 'update content set ReadStatus=0, FirstTimeReading = \'true\' where BookID is Null and ContentID not like \'file:///mnt/sd/%\'' try: cursor.execute(query) except: debug_print(' Database Exception: Unable to reset ReadStatus list') raise else: connection.commit() # debug_print(' Commit: Reset ReadStatus list') cursor.close() def set_readstatus(self, connection, ContentID, ReadStatus): cursor = connection.cursor() t = (ContentID,) cursor.execute('select DateLastRead from Content where BookID is Null and ContentID = ?', t) result = cursor.fetchone() if result is None: datelastread = '1970-01-01T00:00:00' else: datelastread = result[0] if result[0] is not None else '1970-01-01T00:00:00' t = (ReadStatus,datelastread,ContentID,) try: cursor.execute('update content set ReadStatus=?,FirstTimeReading=\'false\',DateLastRead=? where BookID is Null and ContentID = ?', t) except: debug_print(' Database Exception: Unable update ReadStatus') raise else: connection.commit() # debug_print(' Commit: Setting ReadStatus List') cursor.close() def reset_favouritesindex(self, connection, oncard): # Reset FavouritesIndex list in the database if oncard == 'carda': query= 'update content set FavouritesIndex=-1 where BookID is Null and ContentID like \'file:///mnt/sd/%\'' elif oncard != 'carda' and oncard != 'cardb': query= 'update content set FavouritesIndex=-1 where BookID is Null and ContentID not like \'file:///mnt/sd/%\'' cursor = connection.cursor() try: cursor.execute(query) except Exception as e: debug_print(' Database Exception: Unable to reset Shortlist list') if 'no such column' not in str(e): raise else: connection.commit() # debug_print(' Commit: Reset FavouritesIndex list') def set_favouritesindex(self, connection, ContentID): cursor = connection.cursor() t = (ContentID,) try: cursor.execute('update content set FavouritesIndex=1 where BookID is Null and ContentID = ?', t) except Exception as e: debug_print(' Database Exception: Unable set book as Shortlist') if 'no such column' not in str(e): raise else: connection.commit() # debug_print(' Commit: Set FavouritesIndex') def update_device_database_collections(self, booklists, collections_attributes, oncard): debug_print("Kobo:update_device_database_collections - oncard='%s'"%oncard) if self.modify_database_check("update_device_database_collections") == False: return # Only process categories in this list supportedcategories = { "Im_Reading":1, "Read":2, "Closed":3, "Shortlist":4, # "Preview":99, # Unsupported as we don't want to change it } # Define lists for the ReadStatus readstatuslist = { "Im_Reading":1, "Read":2, "Closed":3, } accessibilitylist = { "Preview":6, "Recommendation":4, } # debug_print('Starting update_device_database_collections', collections_attributes) # Force collections_attributes to be 'tags' as no other is currently supported # debug_print('KOBO: overriding the provided collections_attributes:', collections_attributes) collections_attributes = ['tags'] collections = booklists.get_collections(collections_attributes) # debug_print('Kobo:update_device_database_collections - Collections:', collections) # Create a connection to the sqlite database # Needs to be outside books collection as in the case of removing # the last book from the collection the list of books is empty # and the removal of the last book would not occur import sqlite3 as sqlite with closing(sqlite.connect(self.normalize_path(self._main_prefix + '.kobo/KoboReader.sqlite'))) as connection: # return bytestrings if the content cannot the decoded as unicode connection.text_factory = lambda x: unicode(x, "utf-8", "ignore") if collections: # Need to reset the collections outside the particular loops # otherwise the last item will not be removed self.reset_readstatus(connection, oncard) if self.dbversion >= 14: self.reset_favouritesindex(connection, oncard) # Process any collections that exist for category, books in collections.items(): if category in supportedcategories: # debug_print("Category: ", category, " id = ", readstatuslist.get(category)) for book in books: # debug_print(' Title:', book.title, 'category: ', category) if category not in book.device_collections: book.device_collections.append(category) extension = os.path.splitext(book.path)[1] ContentType = self.get_content_type_from_extension(extension) if extension != '' else self.get_content_type_from_path(book.path) ContentID = self.contentid_from_path(book.path, ContentType) if category in readstatuslist.keys(): # Manage ReadStatus self.set_readstatus(connection, ContentID, readstatuslist.get(category)) elif category == 'Shortlist' and self.dbversion >= 14: # Manage FavouritesIndex/Shortlist self.set_favouritesindex(connection, ContentID) elif category in accessibilitylist.keys(): # Do not manage the Accessibility List pass else: # No collections # Since no collections exist the ReadStatus needs to be reset to 0 (Unread) debug_print("No Collections - reseting ReadStatus") self.reset_readstatus(connection, oncard) if self.dbversion >= 14: debug_print("No Collections - reseting FavouritesIndex") self.reset_favouritesindex(connection, oncard) # debug_print('Finished update_device_database_collections', collections_attributes) def get_collections_attributes(self): collections = [] opts = self.settings() if opts.extra_customization and len(opts.extra_customization[self.OPT_COLLECTIONS]) > 0: collections = [x.lower().strip() for x in opts.extra_customization[self.OPT_COLLECTIONS].split(',')] return collections def sync_booklists(self, booklists, end_session=True): debug_print('KOBO:sync_booklists - start') paths = self.get_device_paths() blists = {} for i in paths: try: if booklists[i] is not None: #debug_print('Booklist: ', i) blists[i] = booklists[i] except IndexError: pass collections = self.get_collections_attributes() #debug_print('KOBO: collection fields:', collections) for i, blist in blists.items(): if i == 0: oncard = 'main' else: oncard = 'carda' self.update_device_database_collections(blist, collections, oncard) USBMS.sync_booklists(self, booklists, end_session=end_session) debug_print('KOBO:sync_booklists - end') def rebuild_collections(self, booklist, oncard): collections_attributes = [] self.update_device_database_collections(booklist, collections_attributes, oncard) def upload_cover(self, path, filename, metadata, filepath): ''' Upload book cover to the device. Default implementation does nothing. :param path: The full path to the directory where the associated book is located. :param filename: The name of the book file without the extension. :param metadata: metadata belonging to the book. Use metadata.thumbnail for cover :param filepath: The full path to the ebook file ''' opts = self.settings() if not opts.extra_customization[self.OPT_UPLOAD_COVERS]: # Building thumbnails disabled debug_print('KOBO: not uploading cover') return if not opts.extra_customization[self.OPT_UPLOAD_GRAYSCALE_COVERS]: uploadgrayscale = False else: uploadgrayscale = True debug_print('KOBO: uploading cover') try: self._upload_cover(path, filename, metadata, filepath, uploadgrayscale) except: debug_print('FAILED to upload cover', filepath) def _upload_cover(self, path, filename, metadata, filepath, uploadgrayscale): from calibre.utils.magick.draw import save_cover_data_to if metadata.cover: cover = self.normalize_path(metadata.cover.replace('/', os.sep)) if os.path.exists(cover): # Get ContentID for Selected Book extension = os.path.splitext(filepath)[1] ContentType = self.get_content_type_from_extension(extension) if extension != '' else self.get_content_type_from_path(filepath) ContentID = self.contentid_from_path(filepath, ContentType) import sqlite3 as sqlite with closing(sqlite.connect(self.normalize_path(self._main_prefix + '.kobo/KoboReader.sqlite'))) as connection: # return bytestrings if the content cannot the decoded as unicode connection.text_factory = lambda x: unicode(x, "utf-8", "ignore") cursor = connection.cursor() t = (ContentID,) cursor.execute('select ImageId from Content where BookID is Null and ContentID = ?', t) result = cursor.fetchone() if result is None: debug_print("No rows exist in the database - cannot upload") return else: ImageID = result[0] # debug_print("ImageId: ", result[0]) cursor.close() if ImageID != None: path_prefix = '.kobo/images/' path = self._main_prefix + path_prefix + ImageID file_endings = {' - iPhoneThumbnail.parsed':(103,150), ' - bbMediumGridList.parsed':(93,135), ' - NickelBookCover.parsed':(500,725), ' - N3_LIBRARY_FULL.parsed':(355,530), ' - N3_LIBRARY_GRID.parsed':(149,233), ' - N3_LIBRARY_LIST.parsed':(60,90), ' - N3_FULL.parsed':(600,800), ' - N3_SOCIAL_CURRENTREAD.parsed':(120,186)} for ending, resize in file_endings.items(): fpath = path + ending fpath = self.normalize_path(fpath.replace('/', os.sep)) if os.path.exists(fpath): with open(cover, 'rb') as f: data = f.read() # Return the data resized and in Grayscale if # required data = save_cover_data_to(data, 'dummy.jpg', grayscale=uploadgrayscale, resize_to=resize, return_data=True) with open(fpath, 'wb') as f: f.write(data) fsync(f) else: debug_print("ImageID could not be retreived from the database") def prepare_addable_books(self, paths): ''' The Kobo supports an encrypted epub refered to as a kepub Unfortunately Kobo decided to put the files on the device with no file extension. I just hope that decision causes them as much grief as it does me :-) This has to make a temporary copy of the book files with a epub extension to allow Calibre's normal processing to deal with the file appropriately ''' for idx, path in enumerate(paths): if path.find('kepub') >= 0: with closing(open(path, 'rb')) as r: tf = PersistentTemporaryFile(suffix='.epub') shutil.copyfileobj(r, tf) # tf.write(r.read()) paths[idx] = tf.name return paths def create_annotations_path(self, mdata, device_path=None): if device_path: return device_path return USBMS.create_annotations_path(self, mdata) def get_annotations(self, path_map): from calibre.devices.kobo.bookmark import Bookmark EPUB_FORMATS = [u'epub'] epub_formats = set(EPUB_FORMATS) def get_storage(): storage = [] if self._main_prefix: storage.append(os.path.join(self._main_prefix, self.EBOOK_DIR_MAIN)) if self._card_a_prefix: storage.append(os.path.join(self._card_a_prefix, self.EBOOK_DIR_CARD_A)) if self._card_b_prefix: storage.append(os.path.join(self._card_b_prefix, self.EBOOK_DIR_CARD_B)) return storage def resolve_bookmark_paths(storage, path_map): pop_list = [] book_ext = {} for id in path_map: file_fmts = set() for fmt in path_map[id]['fmts']: file_fmts.add(fmt) bookmark_extension = None if file_fmts.intersection(epub_formats): book_extension = list(file_fmts.intersection(epub_formats))[0] bookmark_extension = 'epub' if bookmark_extension: for vol in storage: bkmk_path = path_map[id]['path'] bkmk_path = bkmk_path if os.path.exists(bkmk_path): path_map[id] = bkmk_path book_ext[id] = book_extension break else: pop_list.append(id) else: pop_list.append(id) # Remove non-existent bookmark templates for id in pop_list: path_map.pop(id) return path_map, book_ext storage = get_storage() path_map, book_ext = resolve_bookmark_paths(storage, path_map) bookmarked_books = {} for id in path_map: extension = os.path.splitext(path_map[id])[1] ContentType = self.get_content_type_from_extension(extension) if extension != '' else self.get_content_type_from_path(path_map[id]) ContentID = self.contentid_from_path(path_map[id], ContentType) debug_print("get_annotations - ContentID: ", ContentID, "ContentType: ", ContentType) bookmark_ext = extension db_path = self.normalize_path(self._main_prefix + '.kobo/KoboReader.sqlite') myBookmark = Bookmark(db_path, ContentID, path_map[id], id, book_ext[id], bookmark_ext) bookmarked_books[id] = self.UserAnnotation(type='kobo_bookmark', value=myBookmark) # This returns as job.result in gui2.ui.annotations_fetched(self,job) return bookmarked_books def generate_annotation_html(self, bookmark): import calendar from calibre.ebooks.BeautifulSoup import BeautifulSoup, Tag, NavigableString # Returns <div class="user_annotations"> ... </div> #last_read_location = bookmark.last_read_location #timestamp = bookmark.timestamp percent_read = bookmark.percent_read debug_print("Date: ", bookmark.last_read) if bookmark.last_read is not None: try: last_read = time.strftime("%Y-%m-%d %H:%M:%S", time.localtime(calendar.timegm(time.strptime(bookmark.last_read, "%Y-%m-%dT%H:%M:%S")))) except: try: last_read = time.strftime("%Y-%m-%d %H:%M:%S", time.localtime(calendar.timegm(time.strptime(bookmark.last_read, "%Y-%m-%dT%H:%M:%S.%f")))) except: last_read = time.strftime("%Y-%m-%d %H:%M:%S", time.localtime(calendar.timegm(time.strptime(bookmark.last_read, "%Y-%m-%dT%H:%M:%SZ")))) else: #self.datetime = time.gmtime() last_read = time.strftime("%Y-%m-%d %H:%M:%S", time.gmtime()) # debug_print("Percent read: ", percent_read) ka_soup = BeautifulSoup() dtc = 0 divTag = Tag(ka_soup,'div') divTag['class'] = 'user_annotations' # Add the last-read location spanTag = Tag(ka_soup, 'span') spanTag['style'] = 'font-weight:normal' if bookmark.book_format == 'epub': spanTag.insert(0,NavigableString( _("<hr /><b>Book Last Read:</b> %(time)s<br /><b>Percentage Read:</b> %(pr)d%%<hr />") % dict(time=last_read, # loc=last_read_location, pr=percent_read))) else: spanTag.insert(0,NavigableString( _("<hr /><b>Book Last Read:</b> %(time)s<br /><b>Percentage Read:</b> %(pr)d%%<hr />") % dict(time=last_read, # loc=last_read_location, pr=percent_read))) divTag.insert(dtc, spanTag) dtc += 1 divTag.insert(dtc, Tag(ka_soup,'br')) dtc += 1 if bookmark.user_notes: user_notes = bookmark.user_notes annotations = [] # Add the annotations sorted by location for location in sorted(user_notes): if user_notes[location]['type'] == 'Bookmark': annotations.append( _('<b>Chapter %(chapter)d:</b> %(chapter_title)s<br /><b>%(typ)s</b><br /><b>Chapter Progress:</b> %(chapter_progress)s%%<br />%(annotation)s<br /><hr />') % dict(chapter=user_notes[location]['chapter'], dl=user_notes[location]['displayed_location'], typ=user_notes[location]['type'], chapter_title=user_notes[location]['chapter_title'], chapter_progress=user_notes[location]['chapter_progress'], annotation=user_notes[location]['annotation'] if user_notes[location]['annotation'] is not None else "")) elif user_notes[location]['type'] == 'Highlight': annotations.append( _('<b>Chapter %(chapter)d:</b> %(chapter_title)s<br /><b>%(typ)s</b><br /><b>Chapter Progress:</b> %(chapter_progress)s%%<br /><b>Highlight:</b> %(text)s<br /><hr />') % dict(chapter=user_notes[location]['chapter'], dl=user_notes[location]['displayed_location'], typ=user_notes[location]['type'], chapter_title=user_notes[location]['chapter_title'], chapter_progress=user_notes[location]['chapter_progress'], text=user_notes[location]['text'])) elif user_notes[location]['type'] == 'Annotation': annotations.append( _('<b>Chapter %(chapter)d:</b> %(chapter_title)s<br /><b>%(typ)s</b><br /><b>Chapter Progress:</b> %(chapter_progress)s%%<br /><b>Highlight:</b> %(text)s<br /><b>Notes:</b> %(annotation)s<br /><hr />') % dict(chapter=user_notes[location]['chapter'], dl=user_notes[location]['displayed_location'], typ=user_notes[location]['type'], chapter_title=user_notes[location]['chapter_title'], chapter_progress=user_notes[location]['chapter_progress'], text=user_notes[location]['text'], annotation=user_notes[location]['annotation'])) else: annotations.append( _('<b>Chapter %(chapter)d:</b> %(chapter_title)s<br /><b>%(typ)s</b><br /><b>Chapter Progress:</b> %(chapter_progress)s%%<br /><b>Highlight:</b> %(text)s<br /><b>Notes:</b> %(annotation)s<br /><hr />') % dict(chapter=user_notes[location]['chapter'], dl=user_notes[location]['displayed_location'], typ=user_notes[location]['type'], chapter_title=user_notes[location]['chapter_title'], chapter_progress=user_notes[location]['chapter_progress'], text=user_notes[location]['text'], annotation=user_notes[location]['annotation'])) for annotation in annotations: divTag.insert(dtc, annotation) dtc += 1 ka_soup.insert(0,divTag) return ka_soup def add_annotation_to_library(self, db, db_id, annotation): from calibre.ebooks.BeautifulSoup import Tag bm = annotation ignore_tags = set(['Catalog', 'Clippings']) if bm.type == 'kobo_bookmark': mi = db.get_metadata(db_id, index_is_id=True) debug_print("KOBO:add_annotation_to_library - Title: ", mi.title) user_notes_soup = self.generate_annotation_html(bm.value) if mi.comments: a_offset = mi.comments.find('<div class="user_annotations">') ad_offset = mi.comments.find('<hr class="annotations_divider" />') if a_offset >= 0: mi.comments = mi.comments[:a_offset] if ad_offset >= 0: mi.comments = mi.comments[:ad_offset] if set(mi.tags).intersection(ignore_tags): return if mi.comments: hrTag = Tag(user_notes_soup,'hr') hrTag['class'] = 'annotations_divider' user_notes_soup.insert(0, hrTag) mi.comments += unicode(user_notes_soup.prettify()) else: mi.comments = unicode(user_notes_soup.prettify()) # Update library comments db.set_comment(db_id, mi.comments) # Add bookmark file to db_id # NOTE: As it is, this copied the book from the device back to the library. That meant it replaced the # existing file. Taking this out for that reason, but some books have a ANNOT file that could be # copied. # db.add_format_with_hooks(db_id, bm.value.bookmark_extension, # bm.value.path, index_is_id=True) class KOBOTOUCH(KOBO): name = 'KoboTouch' gui_name = 'Kobo Touch/Glo/Mini/Aura HD' author = 'David Forrester' description = 'Communicate with the Kobo Touch, Glo, Mini and Aura HD ereaders. Based on the existing Kobo driver by %s.' % (KOBO.author) # icon = I('devices/kobotouch.jpg') supported_dbversion = 120 min_supported_dbversion = 53 min_dbversion_series = 65 min_dbversion_externalid = 65 min_dbversion_archive = 71 min_dbversion_images_on_sdcard = 77 min_dbversion_activity = 77 min_dbversion_keywords = 82 max_supported_fwversion = (3, 15, 1) # The following document firwmare versions where new function or devices were added. # Not all are used, but this feels a good place to record it. min_fwversion_shelves = (2, 0, 0) min_fwversion_images_on_sdcard = (2, 4, 1) min_fwversion_images_tree = (2, 9, 0) # Cover images stored in tree under .kobo-images min_aurah2o_fwversion = (3, 7, 0) min_reviews_fwversion = (3, 12, 0) min_glohd_fwversion = (3, 14, 0) has_kepubs = True booklist_class = KTCollectionsBookList book_class = Book MAX_PATH_LEN = 185 # 250 - (len(" - N3_LIBRARY_SHELF.parsed") + len("F:\.kobo\images\")) KOBO_EXTRA_CSSFILE = 'kobo_extra.css' EXTRA_CUSTOMIZATION_MESSAGE = [ _('The Kobo from firmware V2.0.0 supports bookshelves.' ' These are created on the Kobo. ' + 'Specify a tags type column for automatic management.'), _('Create Bookshelves') + ':::'+_('Create new bookshelves on the Kobo if they do not exist. This is only for firmware V2.0.0 or later.'), _('Delete Empty Bookshelves') + ':::'+_('Delete any empty bookshelves from the Kobo when syncing is finished. This is only for firmware V2.0.0 or later.'), _('Upload covers for books') + ':::'+_('Upload cover images from the calibre library when sending books to the device.'), _('Upload Black and White Covers'), _('Keep cover aspect ratio') + ':::'+_('When uploading covers, do not change the aspect ratio when resizing for the device.' ' This is for firmware versions 2.3.1 and later.'), _('Show archived books') + ':::'+_('Archived books are listed on the device but need to be downloaded to read.' ' Use this option to show these books and match them with books in the calibre library.'), _('Show Previews') + ':::'+_('Kobo previews are included on the Touch and some other versions' ' by default they are no longer displayed as there is no good reason to ' 'see them. Enable if you wish to see/delete them.'), _('Show Recommendations') + ':::'+_('Kobo shows recommendations on the device. In some cases these have ' 'files but in other cases they are just pointers to the web site to buy. ' 'Enable if you wish to see/delete them.'), _('Set Series information') + ':::'+_('The book lists on the Kobo devices can display series information. ' 'This is not read by the device from the sideloaded books. ' 'Series information can only be added to the device after the book has been processed by the device. ' 'Enable if you wish to set series information.'), _('Modify CSS') + ':::'+_('This allows addition of user CSS rules and removal of some CSS. ' 'When sending a book, the driver adds the contents of {0} to all stylesheets in the ePub. ' 'This file is searched for in the root directory of the main memory of the device. ' 'As well as this, if the file contains settings for the "orphans" or "widows", ' 'these are removed for all styles in the original stylesheet.').format(KOBO_EXTRA_CSSFILE), _('Attempt to support newer firmware') + ':::'+_('Kobo routinely updates the firmware and the ' 'database version. With this option Calibre will attempt ' 'to perform full read-write functionality - Here be Dragons!! ' 'Enable only if you are comfortable with restoring your kobo ' 'to factory defaults and testing software. ' 'This driver supports firmware V2.x.x and DBVersion up to ') + unicode(supported_dbversion), _('Title to test when debugging') + ':::'+_('Part of title of a book that can be used when doing some tests for debugging. ' 'The test is to see if the string is contained in the title of a book. ' 'The better the match, the less extraneous output.'), ] EXTRA_CUSTOMIZATION_DEFAULT = [ u'', False, False, False, False, False, False, False, False, False, False, False, u'' ] OPT_COLLECTIONS = 0 OPT_CREATE_BOOKSHELVES = 1 OPT_DELETE_BOOKSHELVES = 2 OPT_UPLOAD_COVERS = 3 OPT_UPLOAD_GRAYSCALE_COVERS = 4 OPT_KEEP_COVER_ASPECT_RATIO = 5 OPT_SHOW_ARCHIVED_BOOK_RECORDS = 6 OPT_SHOW_PREVIEWS = 7 OPT_SHOW_RECOMMENDATIONS = 8 OPT_UPDATE_SERIES_DETAILS = 9 OPT_MODIFY_CSS = 10 OPT_SUPPORT_NEWER_FIRMWARE = 11 OPT_DEBUGGING_TITLE = 12 opts = None TIMESTAMP_STRING = "%Y-%m-%dT%H:%M:%SZ" AURA_PRODUCT_ID = [0x4203] AURA_HD_PRODUCT_ID = [0x4193] AURA_H2O_PRODUCT_ID = [0x4213] GLO_PRODUCT_ID = [0x4173] GLO_HD_PRODUCT_ID = [0x4223] MINI_PRODUCT_ID = [0x4183] TOUCH_PRODUCT_ID = [0x4163] PRODUCT_ID = AURA_PRODUCT_ID + AURA_HD_PRODUCT_ID + AURA_H2O_PRODUCT_ID + \ GLO_PRODUCT_ID + GLO_HD_PRODUCT_ID + \ MINI_PRODUCT_ID + TOUCH_PRODUCT_ID BCD = [0x0110, 0x0326] # Image file name endings. Made up of: image size, min_dbversion, max_dbversion, isFullSize, # Note: "200" has been used just as a much larger number than the current versions. It is just a lazy # way of making it open ended. COVER_FILE_ENDINGS = { ' - N3_FULL.parsed':[(600,800),0, 200,True,], # Used for screensaver, home screen ' - N3_LIBRARY_FULL.parsed':[(355,473),0, 200,False,], # Used for Details screen before FW2.8.1, then for current book tile on home screen ' - N3_LIBRARY_GRID.parsed':[(149,198),0, 200,False,], # Used for library lists ' - N3_LIBRARY_LIST.parsed':[(60,90),0, 53,False,], ' - AndroidBookLoadTablet_Aspect.parsed':[(355,473), 82, 200,False,], # Used for Details screen from FW2.8.1 # ' - N3_LIBRARY_SHELF.parsed': [(40,60),0, 52,], } GLO_COVER_FILE_ENDINGS = { # Glo and Aura share resolution, so the image sizes should be the same. ' - N3_FULL.parsed':[(758,1024),0, 200,True,], # Used for screensaver, home screen ' - N3_LIBRARY_FULL.parsed':[(355,479),0, 200,False,], # Used for Details screen before FW2.8.1, then for current book tile on home screen ' - N3_LIBRARY_GRID.parsed':[(149,201),0, 200,False,], # Used for library lists ' - AndroidBookLoadTablet_Aspect.parsed':[(355,479), 88, 200,False,], # Used for Details screen from FW2.8.1 } AURA_HD_COVER_FILE_ENDINGS = { ' - N3_FULL.parsed': [(1080,1440), 0, 200,True,], # Used for screensaver, home screen ' - N3_LIBRARY_FULL.parsed':[(355, 471), 0, 200,False,], # Used for Details screen before FW2.8.1, then for current book tile on home screen ' - N3_LIBRARY_GRID.parsed':[(149, 198), 0, 200,False,], # Used for library lists ' - AndroidBookLoadTablet_Aspect.parsed':[(355, 471), 88, 200,False,], # Used for Details screen from FW2.8.1 } # Following are the sizes used with pre2.1.4 firmware # COVER_FILE_ENDINGS = { # ' - N3_LIBRARY_FULL.parsed':[(355,530),0, 99,], # Used for Details screen # ' - N3_LIBRARY_FULL.parsed':[(600,800),0, 99,], # ' - N3_LIBRARY_GRID.parsed':[(149,233),0, 99,], # Used for library lists # ' - N3_LIBRARY_LIST.parsed':[(60,90),0, 53,], # ' - N3_LIBRARY_SHELF.parsed': [(40,60),0, 52,], # ' - N3_FULL.parsed':[(600,800),0, 99,], # Used for screensaver if "Full screen" is checked. # } def initialize(self): super(KOBOTOUCH, self).initialize() self.bookshelvelist = [] def get_device_information(self, end_session=True): self.set_device_name() return super(KOBOTOUCH, self).get_device_information(end_session) def books(self, oncard=None, end_session=True): debug_print("KoboTouch:books - oncard='%s'"%oncard) from calibre.ebooks.metadata.meta import path_to_ext dummy_bl = self.booklist_class(None, None, None) if oncard == 'carda' and not self._card_a_prefix: self.report_progress(1.0, _('Getting list of books on device...')) debug_print("KoboTouch:books - Asked to process 'carda', but do not have one!") return dummy_bl elif oncard == 'cardb' and not self._card_b_prefix: self.report_progress(1.0, _('Getting list of books on device...')) debug_print("KoboTouch:books - Asked to process 'cardb', but do not have one!") return dummy_bl elif oncard and oncard != 'carda' and oncard != 'cardb': self.report_progress(1.0, _('Getting list of books on device...')) debug_print("KoboTouch:books - unknown card") return dummy_bl prefix = self._card_a_prefix if oncard == 'carda' else \ self._card_b_prefix if oncard == 'cardb' \ else self._main_prefix debug_print("KoboTouch:books - oncard='%s', prefix='%s'"%(oncard, prefix)) # Determine the firmware version try: with open(self.normalize_path(self._main_prefix + '.kobo/version'), 'rb') as f: self.fwversion = f.readline().split(',')[2] self.fwversion = tuple((int(x) for x in self.fwversion.split('.'))) except: self.fwversion = (0,0,0) debug_print('Kobo device: %s' % self.gui_name) debug_print('Version of driver:', self.version, 'Has kepubs:', self.has_kepubs) debug_print('Version of firmware:', self.fwversion, 'Has kepubs:', self.has_kepubs) debug_print('Firmware supports cover image tree:', self.fwversion >= self.min_fwversion_images_tree) self.booklist_class.rebuild_collections = self.rebuild_collections # get the metadata cache bl = self.booklist_class(oncard, prefix, self.settings) opts = self.settings() debug_print("KoboTouch:books - opts.extra_customization=", opts.extra_customization) debug_print("KoboTouch:books - prefs['manage_device_metadata']=", prefs['manage_device_metadata']) if opts.extra_customization: debugging_title = opts.extra_customization[self.OPT_DEBUGGING_TITLE] debug_print("KoboTouch:books - set_debugging_title to '%s'" % debugging_title) bl.set_debugging_title(debugging_title) debug_print("KoboTouch:books - length bl=%d"%len(bl)) need_sync = self.parse_metadata_cache(bl, prefix, self.METADATA_CACHE) debug_print("KoboTouch:books - length bl after sync=%d"%len(bl)) # make a dict cache of paths so the lookup in the loop below is faster. bl_cache = {} for idx,b in enumerate(bl): bl_cache[b.lpath] = idx def update_booklist(prefix, path, title, authors, mime, date, ContentID, ContentType, ImageID, readstatus, MimeType, expired, favouritesindex, accessibility, isdownloaded, series, seriesnumber, userid, bookshelves): show_debug = self.is_debugging_title(title) # show_debug = authors == 'L. Frank Baum' if show_debug: debug_print("KoboTouch:update_booklist - title='%s'"%title, "ContentType=%s"%ContentType, "isdownloaded=", isdownloaded) debug_print( " prefix=%s, mime=%s, date=%s, readstatus=%d, MimeType=%s, expired=%d, favouritesindex=%d, accessibility=%d, isdownloaded=%s"% (prefix, mime, date, readstatus, MimeType, expired, favouritesindex, accessibility, isdownloaded,)) changed = False try: lpath = path.partition(self.normalize_path(prefix))[2] if lpath.startswith(os.sep): lpath = lpath[len(os.sep):] lpath = lpath.replace('\\', '/') # debug_print("LPATH: ", lpath, " - Title: " , title) playlist_map = {} if lpath not in playlist_map: playlist_map[lpath] = [] allow_shelves = True if readstatus == 1: playlist_map[lpath].append('Im_Reading') elif readstatus == 2: playlist_map[lpath].append('Read') elif readstatus == 3: playlist_map[lpath].append('Closed') # Related to a bug in the Kobo firmware that leaves an expired row for deleted books # this shows an expired Collection so the user can decide to delete the book if expired == 3: playlist_map[lpath].append('Expired') allow_shelves = False # A SHORTLIST is supported on the touch but the data field is there on most earlier models if favouritesindex == 1: playlist_map[lpath].append('Shortlist') # The follwing is in flux: # - FW2.0.0, DBVersion 53,55 accessibility == 1 # - FW2.1.2 beta, DBVersion == 56, accessibility == -1: # So, the following should be OK if isdownloaded == 'false': if self.dbversion < 56 and accessibility <= 1 or self.dbversion >= 56 and accessibility == -1: playlist_map[lpath].append('Deleted') allow_shelves = False if show_debug: debug_print("KoboTouch:update_booklist - have a deleted book") elif self.supports_kobo_archive() and (accessibility == 1 or accessibility == 2): playlist_map[lpath].append('Archived') allow_shelves = True # Label Previews and Recommendations if accessibility == 6: if userid == '': playlist_map[lpath].append('Recommendation') allow_shelves = False else: playlist_map[lpath].append('Preview') allow_shelves = False elif accessibility == 4: # Pre 2.x.x firmware playlist_map[lpath].append('Recommendation') allow_shelves = False kobo_collections = playlist_map[lpath][:] if allow_shelves: # debug_print('KoboTouch:update_booklist - allowing shelves - title=%s' % title) if len(bookshelves) > 0: playlist_map[lpath].extend(bookshelves) if show_debug: debug_print('KoboTouch:update_booklist - playlist_map=', playlist_map) path = self.normalize_path(path) # print "Normalized FileName: " + path idx = bl_cache.get(lpath, None) if idx is not None: # and not (accessibility == 1 and isdownloaded == 'false'): if show_debug: self.debug_index = idx debug_print("KoboTouch:update_booklist - idx=%d"%idx) debug_print("KoboTouch:update_booklist - lpath=%s"%lpath) debug_print('KoboTouch:update_booklist - bl[idx].device_collections=', bl[idx].device_collections) debug_print('KoboTouch:update_booklist - playlist_map=', playlist_map) debug_print('KoboTouch:update_booklist - bookshelves=', bookshelves) debug_print('KoboTouch:update_booklist - kobo_collections=', kobo_collections) debug_print('KoboTouch:update_booklist - series="%s"' % bl[idx].series) debug_print('KoboTouch:update_booklist - the book=', bl[idx]) debug_print('KoboTouch:update_booklist - the authors=', bl[idx].authors) debug_print('KoboTouch:update_booklist - application_id=', bl[idx].application_id) bl_cache[lpath] = None if ImageID is not None: imagename = self.imagefilename_from_imageID(prefix, ImageID) if imagename is not None: bl[idx].thumbnail = ImageWrapper(imagename) if (ContentType == '6' and MimeType != 'application/x-kobo-epub+zip'): if os.path.exists(self.normalize_path(os.path.join(prefix, lpath))): if self.update_metadata_item(bl[idx]): # print 'update_metadata_item returned true' changed = True else: debug_print(" Strange: The file: ", prefix, lpath, " does not exist!") debug_print("KoboTouch:update_booklist - book size=", bl[idx].size) if show_debug: debug_print("KoboTouch:update_booklist - ContentID='%s'"%ContentID) bl[idx].contentID = ContentID bl[idx].kobo_series = series bl[idx].kobo_series_number = seriesnumber bl[idx].can_put_on_shelves = allow_shelves if lpath in playlist_map: bl[idx].device_collections = playlist_map.get(lpath,[]) bl[idx].current_shelves = bookshelves bl[idx].kobo_collections = kobo_collections if show_debug: debug_print('KoboTouch:update_booklist - updated bl[idx].device_collections=', bl[idx].device_collections) debug_print('KoboTouch:update_booklist - playlist_map=', playlist_map, 'changed=', changed) # debug_print('KoboTouch:update_booklist - book=', bl[idx]) debug_print("KoboTouch:update_booklist - book class=%s"%bl[idx].__class__) debug_print("KoboTouch:update_booklist - book title=%s"%bl[idx].title) else: if show_debug: debug_print('KoboTouch:update_booklist - idx is none') try: if os.path.exists(self.normalize_path(os.path.join(prefix, lpath))): book = self.book_from_path(prefix, lpath, title, authors, mime, date, ContentType, ImageID) else: if isdownloaded == 'true': # A recommendation or preview is OK to not have a file debug_print(" Strange: The file: ", prefix, lpath, " does not exist!") title = "FILE MISSING: " + title book = self.book_class(prefix, lpath, title, authors, mime, date, ContentType, ImageID, size=0) if show_debug: debug_print('KoboTouch:update_booklist - book file does not exist. ContentID="%s"'%ContentID) except Exception as e: debug_print("KoboTouch:update_booklist - exception creating book: '%s'"%str(e)) debug_print(" prefix: ", prefix, "lpath: ", lpath, "title: ", title, "authors: ", authors, "mime: ", mime, "date: ", date, "ContentType: ", ContentType, "ImageID: ", ImageID) raise if show_debug: debug_print('KoboTouch:update_booklist - class:', book.__class__) # debug_print(' resolution:', book.__class__.__mro__) debug_print(" contentid: '%s'"%book.contentID) debug_print(" title:'%s'"%book.title) debug_print(" the book:", book) debug_print(" author_sort:'%s'"%book.author_sort) debug_print(" bookshelves:", bookshelves) debug_print(" kobo_collections:", kobo_collections) # print 'Update booklist' book.device_collections = playlist_map.get(lpath,[]) # if lpath in playlist_map else [] book.current_shelves = bookshelves book.kobo_collections = kobo_collections book.contentID = ContentID book.kobo_series = series book.kobo_series_number = seriesnumber book.can_put_on_shelves = allow_shelves # debug_print('KoboTouch:update_booklist - title=', title, 'book.device_collections', book.device_collections) if bl.add_book(book, replace_metadata=False): changed = True if show_debug: debug_print(' book.device_collections', book.device_collections) debug_print(' book.title', book.title) except: # Probably a path encoding error import traceback traceback.print_exc() return changed def get_bookshelvesforbook(connection, ContentID): # debug_print("KoboTouch:get_bookshelvesforbook - " + ContentID) bookshelves = [] if not self.supports_bookshelves(): return bookshelves cursor = connection.cursor() query = "select ShelfName " \ "from ShelfContent " \ "where ContentId = ? " \ "and _IsDeleted = 'false' " \ "and ShelfName is not null" # This should never be nulll, but it is protection against an error cause by a sync to the Kobo server values = (ContentID, ) cursor.execute(query, values) for i, row in enumerate(cursor): bookshelves.append(row[0]) cursor.close() # debug_print("KoboTouch:get_bookshelvesforbook - count bookshelves=" + unicode(count_bookshelves)) return bookshelves self.debug_index = 0 import sqlite3 as sqlite with closing(sqlite.connect(self.device_database_path())) as connection: debug_print("KoboTouch:books - reading device database") # return bytestrings if the content cannot the decoded as unicode connection.text_factory = lambda x: unicode(x, "utf-8", "ignore") cursor = connection.cursor() cursor.execute('select version from dbversion') result = cursor.fetchone() self.dbversion = result[0] debug_print("Database Version=%d"%self.dbversion) self.bookshelvelist = self.get_bookshelflist(connection) debug_print("KoboTouch:books - shelf list:", self.bookshelvelist) opts = self.settings() columns = 'Title, Attribution, DateCreated, ContentID, MimeType, ContentType, ImageID, ReadStatus' if self.dbversion >= 16: columns += ', ___ExpirationStatus, FavouritesIndex, Accessibility' else: columns += ', "-1" as ___ExpirationStatus, "-1" as FavouritesIndex, "-1" as Accessibility' if self.dbversion >= 33: columns += ', IsDownloaded' else: columns += ', "1" as IsDownloaded' if self.supports_series(): columns += ", Series, SeriesNumber, ___UserID, ExternalId" else: columns += ', null as Series, null as SeriesNumber, ___UserID, null as ExternalId' where_clause = '' if self.supports_kobo_archive(): where_clause = (" where BookID is Null " " and ((Accessibility = -1 and IsDownloaded in ('true', 1 )) or (Accessibility in (1,2) %(expiry)s) " " %(previews)s %(recomendations)s )" " and not ((___ExpirationStatus=3 or ___ExpirationStatus is Null) and ContentType = 6)") % \ dict( expiry="" if opts.extra_customization[self.OPT_SHOW_ARCHIVED_BOOK_RECORDS] else "and IsDownloaded in ('true', 1)", previews=" or (Accessibility in (6) and ___UserID <> '')" if opts.extra_customization[self.OPT_SHOW_PREVIEWS] else "", recomendations=" or (Accessibility in (-1, 4, 6) and ___UserId = '')" if opts.extra_customization[ self.OPT_SHOW_RECOMMENDATIONS] else "" ) elif self.supports_series(): where_clause = (" where BookID is Null " " and ((Accessibility = -1 and IsDownloaded in ('true', 1)) or (Accessibility in (1,2)) %(previews)s %(recomendations)s )" " and not ((___ExpirationStatus=3 or ___ExpirationStatus is Null) %(expiry)s)") % \ dict( expiry=" and ContentType = 6" if opts.extra_customization[self.OPT_SHOW_ARCHIVED_BOOK_RECORDS] else "", previews=" or (Accessibility in (6) and ___UserID <> '')" if opts.extra_customization[self.OPT_SHOW_PREVIEWS] else "", recomendations=" or (Accessibility in (-1, 4, 6) and ___UserId = '')" if opts.extra_customization[ self.OPT_SHOW_RECOMMENDATIONS] else "" ) elif self.dbversion >= 33: where_clause = (' where BookID is Null %(previews)s %(recomendations)s and not ((___ExpirationStatus=3 or ___ExpirationStatus is Null) %(expiry)s)') % \ dict( expiry=' and ContentType = 6' if opts.extra_customization[self.OPT_SHOW_ARCHIVED_BOOK_RECORDS] else '', previews=' and Accessibility <> 6' if opts.extra_customization[self.OPT_SHOW_PREVIEWS] == False else '', recomendations=' and IsDownloaded in (\'true\', 1)' if opts.extra_customization[self.OPT_SHOW_RECOMMENDATIONS] == False else '' ) elif self.dbversion >= 16: where_clause = (' where BookID is Null ' 'and not ((___ExpirationStatus=3 or ___ExpirationStatus is Null) %(expiry)s)') % \ dict(expiry=' and ContentType = 6' if opts.extra_customization[self.OPT_SHOW_ARCHIVED_BOOK_RECORDS] else '') else: where_clause = ' where BookID is Null' # Note: The card condition should not need the contentId test for the SD # card. But the ExternalId does not get set for sideloaded kepubs on the # SD card. card_condition = '' if self.has_externalid(): card_condition = " AND (externalId IS NOT NULL AND externalId <> '' OR contentId LIKE 'file:///mnt/sd/%')" if oncard == 'carda' else " AND (externalId IS NULL OR externalId = '') AND contentId NOT LIKE 'file:///mnt/sd/%'" else: card_condition = " AND contentId LIKE 'file:///mnt/sd/%'" if oncard == 'carda' else " AND contentId NOT LIKE'file:///mnt/sd/%'" query = 'SELECT ' + columns + ' FROM content ' + where_clause + card_condition debug_print("KoboTouch:books - query=", query) try: cursor.execute(query) except Exception as e: err = str(e) if not ('___ExpirationStatus' in err or 'FavouritesIndex' in err or 'Accessibility' in err or 'IsDownloaded' in err or 'Series' in err or 'ExternalId' in err ): raise query= ('select Title, Attribution, DateCreated, ContentID, MimeType, ContentType, ' 'ImageID, ReadStatus, "-1" as ___ExpirationStatus, "-1" as ' 'FavouritesIndex, "-1" as Accessibility, "1" as IsDownloaded, null as Series, null as SeriesNumber' ' from content where BookID is Null') cursor.execute(query) changed = False for i, row in enumerate(cursor): # self.report_progress((i+1) / float(numrows), _('Getting list of books on device...')) show_debug = self.is_debugging_title(row[0]) if show_debug: debug_print("KoboTouch:books - looping on database - row=%d" % i) debug_print("KoboTouch:books - title='%s'"%row[0], "authors=", row[1]) debug_print("KoboTouch:books - row=", row) if not hasattr(row[3], 'startswith') or row[3].lower().startswith("file:///usr/local/kobo/help/") or row[3].lower().startswith("/usr/local/kobo/help/"): # These are internal to the Kobo device and do not exist continue externalId = None if row[15] and len(row[15]) == 0 else row[15] path = self.path_from_contentid(row[3], row[5], row[4], oncard, externalId) mime = mime_type_ext(path_to_ext(path)) if path.find('kepub') == -1 else 'application/x-kobo-epub+zip' # debug_print("mime:", mime) if show_debug: debug_print("KoboTouch:books - path='%s'"%path, " ContentID='%s'"%row[3], " externalId=%s" % externalId) bookshelves = get_bookshelvesforbook(connection, row[3]) prefix = self._card_a_prefix if oncard == 'carda' else self._main_prefix changed = update_booklist(prefix, path, row[0], row[1], mime, row[2], row[3], row[5], row[6], row[7], row[4], row[8], row[9], row[10], row[11], row[12], row[13], row[14], bookshelves) if changed: need_sync = True cursor.close() if not prefs['manage_device_metadata'] == 'on_connect': self.dump_bookshelves(connection) else: debug_print("KoboTouch:books - automatically managing metadata") # Remove books that are no longer in the filesystem. Cache contains # indices into the booklist if book not in filesystem, None otherwise # Do the operation in reverse order so indices remain valid for idx in sorted(bl_cache.itervalues(), reverse=True): if idx is not None: if not os.path.exists(self.normalize_path(os.path.join(prefix, bl[idx].lpath))): need_sync = True del bl[idx] # else: # debug_print("KoboTouch:books - Book in mtadata.calibre, on file system but not database - bl[idx].title:'%s'"%bl[idx].title) # print "count found in cache: %d, count of files in metadata: %d, need_sync: %s" % \ # (len(bl_cache), len(bl), need_sync) # Bypassing the KOBO sync_booklists as that does things we don't need to do # Also forcing sync to see if this solves issues with updating shelves and matching books. if need_sync or True: # self.count_found_in_bl != len(bl) or need_sync: debug_print("KoboTouch:books - about to sync_booklists") if oncard == 'cardb': USBMS.sync_booklists(self, (None, None, bl)) elif oncard == 'carda': USBMS.sync_booklists(self, (None, bl, None)) else: USBMS.sync_booklists(self, (bl, None, None)) debug_print("KoboTouch:books - have done sync_booklists") self.report_progress(1.0, _('Getting list of books on device...')) debug_print("KoboTouch:books - end - oncard='%s'"%oncard) return bl def path_from_contentid(self, ContentID, ContentType, MimeType, oncard, externalId): path = ContentID if not externalId: return super(KOBOTOUCH, self).path_from_contentid(ContentID, ContentType, MimeType, oncard) if oncard == 'cardb': print 'path from_contentid cardb' else: if (ContentType == "6" or ContentType == "10"): # and MimeType == 'application/x-kobo-epub+zip': if path.startswith("file:///mnt/onboard/"): path = self._main_prefix + path.replace("file:///mnt/onboard/", '') elif path.startswith("file:///mnt/sd/"): path = self._card_a_prefix + path.replace("file:///mnt/sd/", '') elif externalId: path = self._card_a_prefix + 'koboExtStorage/kepub/' + path else: path = self._main_prefix + '.kobo/kepub/' + path else: # Should never get here, but, just in case... # if path.startswith("file:///mnt/onboard/"): path = path.replace("file:///mnt/onboard/", self._main_prefix) path = path.replace("file:///mnt/sd/", self._card_a_prefix) path = path.replace("/mnt/onboard/", self._main_prefix) # print "Internal: " + path return path def imagefilename_from_imageID(self, prefix, ImageID): show_debug = self.is_debugging_title(ImageID) path = self.images_path(prefix, ImageID) # path = self.normalize_path(path.replace('/', os.sep)) for ending, cover_options in self.cover_file_endings().items(): fpath = path + ending if os.path.exists(fpath): if show_debug: debug_print("KoboTouch:imagefilename_from_imageID - have cover image fpath=%s" % (fpath)) return fpath if show_debug: debug_print("KoboTouch:imagefilename_from_imageID - no cover image found - ImageID=%s" % (ImageID)) return None def get_extra_css(self): extra_sheet = None if self.modifying_css(): extra_css_path = os.path.join(self._main_prefix, self.KOBO_EXTRA_CSSFILE) if os.path.exists(extra_css_path): from cssutils import parseFile as cssparseFile try: extra_sheet = cssparseFile(extra_css_path) debug_print("KoboTouch:get_extra_css: Using extra CSS in {0} ({1} rules)".format(extra_css_path, len(extra_sheet.cssRules))) if len(extra_sheet.cssRules) ==0: debug_print("KoboTouch:get_extra_css: Extra CSS file has no valid rules. CSS will not be modified.") extra_sheet = None except Exception as e: debug_print("KoboTouch:get_extra_css: Problem parsing extra CSS file {0}".format(extra_css_path)) debug_print("KoboTouch:get_extra_css: Exception {0}".format(e)) return extra_sheet def upload_books(self, files, names, on_card=None, end_session=True, metadata=None): debug_print('KoboTouch:upload_books - %d books'%(len(files))) debug_print('KoboTouch:upload_books - files=', files) if self.modifying_epub(): self.extra_sheet = self.get_extra_css() i = 0 for file, n, mi in zip(files, names, metadata): debug_print("KoboTouch:upload_books: Processing book: {0} by {1}".format(mi.title, " and ".join(mi.authors))) debug_print("KoboTouch:upload_books: file=%s, name=%s" % (file, n)) self.report_progress(i / float(len(files)), "Processing book: {0} by {1}".format(mi.title, " and ".join(mi.authors))) mi.kte_calibre_name = n self._modify_epub(file, mi) i += 1 self.report_progress(0, 'Working...') result = super(KOBOTOUCH, self).upload_books(files, names, on_card, end_session, metadata) # debug_print('KoboTouch:upload_books - result=', result) if self.dbversion >= 53: import sqlite3 as sqlite try: with closing(sqlite.connect(self.normalize_path(self._main_prefix + '.kobo/KoboReader.sqlite'))) as connection: connection.text_factory = lambda x: unicode(x, "utf-8", "ignore") cursor = connection.cursor() cleanup_query = "DELETE FROM content WHERE ContentID = ? AND Accessibility = 1 AND IsDownloaded = 'false'" for fname, cycle in result: show_debug = self.is_debugging_title(fname) contentID = self.contentid_from_path(fname, 6) if show_debug: debug_print('KoboTouch:upload_books: fname=', fname) debug_print('KoboTouch:upload_books: contentID=', contentID) cleanup_values = (contentID,) # debug_print('KoboTouch:upload_books: Delete record left if deleted on Touch') cursor.execute(cleanup_query, cleanup_values) self.set_filesize_in_device_database(connection, contentID, fname) if not self.copying_covers(): imageID = self.imageid_from_contentid(contentID) self.delete_images(imageID, fname) connection.commit() cursor.close() except Exception as e: debug_print('KoboTouch:upload_books - Exception: %s'%str(e)) return result def _modify_epub(self, file, metadata, container=None): debug_print("KoboTouch:_modify_epub:Processing {0} - {1}".format(metadata.author_sort, metadata.title)) # Currently only modifying CSS, so if no stylesheet, don't do anything if not self.extra_sheet: debug_print("KoboTouch:_modify_epub: no CSS file") return True commit_container = False if not container: commit_container = True try: from calibre.ebooks.oeb.polish.container import get_container debug_print("KoboTouch:_modify_epub: creating container") container = get_container(file) container.css_preprocessor = DummyCSSPreProcessor() except Exception as e: debug_print("KoboTouch:_modify_epub: exception from get_container {0} - {1}".format(metadata.author_sort, metadata.title)) debug_print("KoboTouch:_modify_epub: exception is: {0}".format(e)) return False else: debug_print("KoboTouch:_modify_epub: received container") from calibre.ebooks.oeb.base import OEB_STYLES for cssname, mt in container.mime_map.iteritems(): if mt in OEB_STYLES: newsheet = container.parsed(cssname) oldrules = len(newsheet.cssRules) # remove any existing @page rules in epub css # if css to be appended contains an @page rule if self.extra_sheet and len([r for r in self.extra_sheet if r.type == r.PAGE_RULE]): page_rules = [r for r in newsheet if r.type == r.PAGE_RULE] if len(page_rules) > 0: debug_print("KoboTouch:_modify_epub:Removing existing @page rules") for rule in page_rules: rule.style = '' # remove any existing widow/orphan settings in epub css # if css to be appended contains a widow/orphan rule or we there is no extra CSS file if (len([r for r in self.extra_sheet if r.type == r.STYLE_RULE and (r.style['widows'] or r.style['orphans'])]) > 0): widow_orphan_rules = [r for r in newsheet if r.type == r.STYLE_RULE and (r.style['widows'] or r.style['orphans'])] if len(widow_orphan_rules) > 0: debug_print("KoboTouch:_modify_epub:Removing existing widows/orphans attribs") for rule in widow_orphan_rules: rule.style.removeProperty('widows') rule.style.removeProperty('orphans') # append all rules from kobo extra css stylesheet for addrule in [r for r in self.extra_sheet.cssRules]: newsheet.insertRule(addrule, len(newsheet.cssRules)) debug_print("KoboTouch:_modify_epub:CSS rules {0} -> {1} ({2})".format(oldrules, len(newsheet.cssRules), cssname)) container.dirty(cssname) if commit_container: debug_print("KoboTouch:_modify_epub: committing container.") os.unlink(file) container.commit(file) return True def delete_via_sql(self, ContentID, ContentType): imageId = super(KOBOTOUCH, self).delete_via_sql(ContentID, ContentType) if self.dbversion >= 53: import sqlite3 as sqlite debug_print('KoboTouch:delete_via_sql: ContentID="%s"'%ContentID, 'ContentType="%s"'%ContentType) try: with closing(sqlite.connect(self.device_database_path())) as connection: debug_print('KoboTouch:delete_via_sql: have database connection') # return bytestrings if the content cannot the decoded as unicode connection.text_factory = lambda x: unicode(x, "utf-8", "ignore") cursor = connection.cursor() debug_print('KoboTouch:delete_via_sql: have cursor') t = (ContentID,) # Delete the Bookmarks debug_print('KoboTouch:delete_via_sql: Delete from Bookmark') cursor.execute('DELETE FROM Bookmark WHERE VolumeID = ?', t) # Delete from the Bookshelf debug_print('KoboTouch:delete_via_sql: Delete from the Bookshelf') cursor.execute('delete from ShelfContent where ContentID = ?', t) # ContentType 6 is now for all books. debug_print('KoboTouch:delete_via_sql: BookID is Null') cursor.execute('delete from content where BookID is Null and ContentID =?',t) # Remove the content_settings entry debug_print('KoboTouch:delete_via_sql: delete from content_settings') cursor.execute('delete from content_settings where ContentID =?',t) # Remove the ratings entry debug_print('KoboTouch:delete_via_sql: delete from ratings') cursor.execute('delete from ratings where ContentID =?',t) # Remove any entries for the Activity table - removes tile from new home page if self.has_activity_table(): debug_print('KoboTouch:delete_via_sql: delete from Activity') cursor.execute('delete from Activity where Id =?', t) connection.commit() cursor.close() debug_print('KoboTouch:delete_via_sql: finished SQL') debug_print('KoboTouch:delete_via_sql: After SQL, no exception') except Exception as e: debug_print('KoboTouch:delete_via_sql - Database Exception: %s'%str(e)) debug_print('KoboTouch:delete_via_sql: imageId="%s"'%imageId) if imageId is None: imageId = self.imageid_from_contentid(ContentID) return imageId def delete_images(self, ImageID, book_path): debug_print("KoboTouch:delete_images - ImageID=", ImageID) if ImageID != None: path = self.images_path(book_path, ImageID) debug_print("KoboTouch:delete_images - path=%s" % path) for ending in self.cover_file_endings().keys(): fpath = path + ending fpath = self.normalize_path(fpath) debug_print("KoboTouch:delete_images - fpath=%s" % fpath) if os.path.exists(fpath): debug_print("KoboTouch:delete_images - Image File Exists") os.unlink(fpath) try: os.removedirs(os.path.dirname(path)) except: pass def contentid_from_path(self, path, ContentType): show_debug = self.is_debugging_title(path) and True if show_debug: debug_print("KoboTouch:contentid_from_path - path='%s'"%path, "ContentType='%s'"%ContentType) debug_print("KoboTouch:contentid_from_path - self._main_prefix='%s'"%self._main_prefix, "self._card_a_prefix='%s'"%self._card_a_prefix) if ContentType == 6: extension = os.path.splitext(path)[1] if extension == '.kobo': ContentID = os.path.splitext(path)[0] # Remove the prefix on the file. it could be either ContentID = ContentID.replace(self._main_prefix, '') elif extension == '': ContentID = path ContentID = ContentID.replace(self._main_prefix + self.normalize_path('.kobo/kepub/'), '') else: ContentID = path ContentID = ContentID.replace(self._main_prefix, "file:///mnt/onboard/") if show_debug: debug_print("KoboTouch:contentid_from_path - 1 ContentID='%s'"%ContentID) if self._card_a_prefix is not None: ContentID = ContentID.replace(self._card_a_prefix, "file:///mnt/sd/") else: # ContentType = 16 debug_print("KoboTouch:contentid_from_path ContentType other than 6 - ContentType='%d'"%ContentType, "path='%s'"%path) ContentID = path ContentID = ContentID.replace(self._main_prefix, "file:///mnt/onboard/") if self._card_a_prefix is not None: ContentID = ContentID.replace(self._card_a_prefix, "file:///mnt/sd/") ContentID = ContentID.replace("\\", '/') if show_debug: debug_print("KoboTouch:contentid_from_path - end - ContentID='%s'"%ContentID) return ContentID def get_content_type_from_extension(self, extension): debug_print("KoboTouch:get_content_type_from_extension - start") # With new firmware, ContentType appears to be 6 for all types of sideloaded books. if self.fwversion >= (1,9,17) or extension == '.kobo' or extension == '.mobi': debug_print("KoboTouch:get_content_type_from_extension - V2 firmware") ContentType = 6 # For older firmware, it depends on the type of file. elif extension == '.kobo' or extension == '.mobi': ContentType = 6 else: ContentType = 901 return ContentType def update_device_database_collections(self, booklists, collections_attributes, oncard): debug_print("KoboTouch:update_device_database_collections - oncard='%s'"%oncard) if self.modify_database_check("update_device_database_collections") == False: return # Only process categories in this list supportedcategories = { "Im_Reading": 1, "Read": 2, "Closed": 3, "Shortlist": 4, "Archived": 5, # "Preview":99, # Unsupported as we don't want to change it } # Define lists for the ReadStatus readstatuslist = { "Im_Reading":1, "Read":2, "Closed":3, } accessibilitylist = { "Preview":6, "Recommendation":4, "Deleted":1, } # specialshelveslist = { # "Shortlist":1, # "Wishlist":2, # } # debug_print('KoboTouch:update_device_database_collections - collections_attributes=', collections_attributes) opts = self.settings() if opts.extra_customization: create_bookshelves = opts.extra_customization[self.OPT_CREATE_BOOKSHELVES] and self.supports_bookshelves() delete_empty_shelves = opts.extra_customization[self.OPT_DELETE_BOOKSHELVES] and self.supports_bookshelves() update_series_details = opts.extra_customization[self.OPT_UPDATE_SERIES_DETAILS] and self.supports_series() debugging_title = opts.extra_customization[self.OPT_DEBUGGING_TITLE] debug_print("KoboTouch:update_device_database_collections - set_debugging_title to '%s'" % debugging_title) booklists.set_debugging_title(debugging_title) else: delete_empty_shelves = False create_bookshelves = False update_series_details = False opts = self.settings() if opts.extra_customization: create_bookshelves = opts.extra_customization[self.OPT_CREATE_BOOKSHELVES] and self.supports_bookshelves() delete_empty_shelves = opts.extra_customization[self.OPT_DELETE_BOOKSHELVES] and self.supports_bookshelves() else: delete_empty_shelves = False bookshelf_attribute = len(collections_attributes) collections = booklists.get_collections(collections_attributes) if bookshelf_attribute else None # debug_print('KoboTouch:update_device_database_collections - Collections:', collections) # Create a connection to the sqlite database # Needs to be outside books collection as in the case of removing # the last book from the collection the list of books is empty # and the removal of the last book would not occur import sqlite3 as sqlite with closing(sqlite.connect(self.normalize_path(self._main_prefix + '.kobo/KoboReader.sqlite'))) as connection: # return bytestrings if the content cannot the decoded as unicode connection.text_factory = lambda x: unicode(x, "utf-8", "ignore") if collections: # debug_print("KoboTouch:update_device_database_collections - length collections=" + unicode(len(collections))) # Need to reset the collections outside the particular loops # otherwise the last item will not be removed if self.dbversion < 53: debug_print("KoboTouch:update_device_database_collections - calling reset_readstatus") self.reset_readstatus(connection, oncard) if self.dbversion >= 14 and self.fwversion < self.min_fwversion_shelves: debug_print("KoboTouch:update_device_database_collections - calling reset_favouritesindex") self.reset_favouritesindex(connection, oncard) # debug_print("KoboTouch:update_device_database_collections - length collections=", len(collections)) # debug_print("KoboTouch:update_device_database_collections - self.bookshelvelist=", self.bookshelvelist) # Process any collections that exist for category, books in collections.items(): debug_print("KoboTouch:update_device_database_collections - category='%s' books=%d"%(category, len(books))) if create_bookshelves and not (category in supportedcategories or category in readstatuslist or category in accessibilitylist): self.check_for_bookshelf(connection, category) # if category in self.bookshelvelist: # debug_print("Category: ", category, " id = ", readstatuslist.get(category)) for book in books: # debug_print(' Title:', book.title, 'category: ', category) show_debug = self.is_debugging_title(book.title) if show_debug: debug_print(' Title="%s"'%book.title, 'category="%s"'%category) # debug_print(book) debug_print(' class=%s'%book.__class__) debug_print(' book.contentID="%s"'%book.contentID) debug_print(' book.application_id="%s"'%book.application_id) if book.application_id is None: continue category_added = False if book.contentID is None: debug_print(' Do not know ContentID - Title="%s"'%book.title) extension = os.path.splitext(book.path)[1] ContentType = self.get_content_type_from_extension(extension) if extension != '' else self.get_content_type_from_path(book.path) book.contentID = self.contentid_from_path(book.path, ContentType) if category in self.bookshelvelist and self.supports_bookshelves(): if show_debug: debug_print(' length book.device_collections=%d'%len(book.device_collections)) if category not in book.device_collections: if show_debug: debug_print(' Setting bookshelf on device') self.set_bookshelf(connection, book, category) category_added = True elif category in readstatuslist.keys(): # Manage ReadStatus self.set_readstatus(connection, book.contentID, readstatuslist.get(category)) category_added = True elif category == 'Shortlist' and self.dbversion >= 14: if show_debug: debug_print(' Have an older version shortlist - %s'%book.title) # Manage FavouritesIndex/Shortlist if not self.supports_bookshelves(): if show_debug: debug_print(' and about to set it - %s'%book.title) self.set_favouritesindex(connection, book.contentID) category_added = True elif category in accessibilitylist.keys(): # Do not manage the Accessibility List pass if category_added and category not in book.device_collections: if show_debug: debug_print(' adding category to book.device_collections', book.device_collections) book.device_collections.append(category) else: if show_debug: debug_print(' category not added to book.device_collections', book.device_collections) debug_print("KoboTouch:update_device_database_collections - end for category='%s'"%category) elif bookshelf_attribute: # No collections but have set the shelf option # Since no collections exist the ReadStatus needs to be reset to 0 (Unread) debug_print("No Collections - reseting ReadStatus") if self.dbversion < 53: self.reset_readstatus(connection, oncard) if self.dbversion >= 14 and self.fwversion < self.min_fwversion_shelves: debug_print("No Collections - resetting FavouritesIndex") self.reset_favouritesindex(connection, oncard) # Set the series info and cleanup the bookshelves only if the firmware supports them and the user has set the options. if (self.supports_bookshelves() or self.supports_series()) and (bookshelf_attribute or update_series_details): debug_print("KoboTouch:update_device_database_collections - managing bookshelves and series.") self.series_set = 0 books_in_library = 0 for book in booklists: if book.application_id is not None: books_in_library += 1 show_debug = self.is_debugging_title(book.title) if show_debug: debug_print("KoboTouch:update_device_database_collections - book.title=%s" % book.title) if update_series_details: self.set_series(connection, book) if bookshelf_attribute: if show_debug: debug_print("KoboTouch:update_device_database_collections - about to remove a book from shelves book.title=%s" % book.title) self.remove_book_from_device_bookshelves(connection, book) book.device_collections.extend(book.kobo_collections) if not prefs['manage_device_metadata'] == 'manual' and delete_empty_shelves: debug_print("KoboTouch:update_device_database_collections - about to clear empty bookshelves") self.delete_empty_bookshelves(connection) debug_print("KoboTouch:update_device_database_collections - Number of series set=%d Number of books=%d" % (self.series_set, books_in_library)) self.dump_bookshelves(connection) debug_print('KoboTouch:update_device_database_collections - Finished ') def rebuild_collections(self, booklist, oncard): debug_print("KoboTouch:rebuild_collections") collections_attributes = self.get_collections_attributes() debug_print('KoboTouch:rebuild_collections: collection fields:', collections_attributes) self.update_device_database_collections(booklist, collections_attributes, oncard) def upload_cover(self, path, filename, metadata, filepath): ''' Upload book cover to the device. Default implementation does nothing. :param path: The full path to the directory where the associated book is located. :param filename: The name of the book file without the extension. :param metadata: metadata belonging to the book. Use metadata.thumbnail for cover :param filepath: The full path to the ebook file ''' debug_print("KoboTouch:upload_cover - path='%s' filename='%s' "%(path, filename)) debug_print(" filepath='%s' "%(filepath)) opts = self.settings() if not self.copying_covers(): # Building thumbnails disabled # debug_print('KoboTouch: not uploading cover') return # Only upload covers to SD card if that is supported if self._card_a_prefix and os.path.abspath(path).startswith(os.path.abspath(self._card_a_prefix)) and not self.supports_covers_on_sdcard(): return if not opts.extra_customization[self.OPT_UPLOAD_GRAYSCALE_COVERS]: uploadgrayscale = False else: uploadgrayscale = True # debug_print('KoboTouch: uploading cover') try: self._upload_cover(path, filename, metadata, filepath, uploadgrayscale, self.keep_cover_aspect()) except Exception as e: debug_print('KoboTouch: FAILED to upload cover=%s Exception=%s'%(filepath, str(e))) def imageid_from_contentid(self, ContentID): ImageID = ContentID.replace('/', '_') ImageID = ImageID.replace(' ', '_') ImageID = ImageID.replace(':', '_') ImageID = ImageID.replace('.', '_') return ImageID def images_path(self, path, imageId=None): if self._card_a_prefix and os.path.abspath(path).startswith(os.path.abspath(self._card_a_prefix)) and self.supports_covers_on_sdcard(): path_prefix = 'koboExtStorage/images-cache/' if self.supports_images_tree() else 'koboExtStorage/images/' path = os.path.join(self._card_a_prefix, path_prefix) else: path_prefix = '.kobo-images/' if self.supports_images_tree() else '.kobo/images/' path = os.path.join(self._main_prefix, path_prefix) if self.supports_images_tree() and imageId: hash1 = qhash(imageId) dir1 = hash1 & (0xff * 1) dir2 = (hash1 & (0xff00 * 1)) >> 8 path = os.path.join(path, "%s" % dir1, "%s" % dir2) if imageId: path = os.path.join(path, imageId) return path def _upload_cover(self, path, filename, metadata, filepath, uploadgrayscale, keep_cover_aspect=False): from calibre.utils.magick.draw import save_cover_data_to, identify_data debug_print("KoboTouch:_upload_cover - filename='%s' uploadgrayscale='%s' "%(filename, uploadgrayscale)) if metadata.cover: show_debug = self.is_debugging_title(filename) if show_debug: debug_print("KoboTouch:_upload_cover - path='%s'"%path, "filename='%s'"%filename) debug_print(" filepath='%s'"%filepath) cover = self.normalize_path(metadata.cover.replace('/', os.sep)) if os.path.exists(cover): # Get ContentID for Selected Book extension = os.path.splitext(filepath)[1] ContentType = self.get_content_type_from_extension(extension) if extension != '' else self.get_content_type_from_path(filepath) ContentID = self.contentid_from_path(filepath, ContentType) try: import sqlite3 as sqlite with closing(sqlite.connect(self.device_database_path())) as connection: # return bytestrings if the content cannot the decoded as unicode connection.text_factory = lambda x: unicode(x, "utf-8", "ignore") cursor = connection.cursor() t = (ContentID,) cursor.execute('select ImageId from Content where BookID is Null and ContentID = ?', t) result = cursor.fetchone() if result is None: ImageID = self.imageid_from_contentid(ContentID) debug_print("KoboTouch:_upload_cover - No rows exist in the database - generated ImageID='%s'" % ImageID) else: ImageID = result[0] # debug_print("ImageId: ", result[0]) cursor.close() if ImageID != None: path = self.images_path(path, ImageID) if show_debug: debug_print("KoboTouch:_upload_cover - About to loop over cover endings") image_dir = os.path.dirname(os.path.abspath(path)) if not os.path.exists(image_dir): debug_print("KoboTouch:_upload_cover - Image directory does not exust. Creating path='%s'" % (image_dir)) os.makedirs(image_dir) for ending, cover_options in self.cover_file_endings().items(): resize, min_dbversion, max_dbversion, isFullsize = cover_options if show_debug: debug_print("KoboTouch:_upload_cover - resize=%s min_dbversion=%d max_dbversion=%d" % (resize, min_dbversion, max_dbversion)) if self.dbversion >= min_dbversion and self.dbversion <= max_dbversion: if show_debug: debug_print("KoboTouch:_upload_cover - creating cover for ending='%s'"%ending) # , "resize'%s'"%resize) fpath = path + ending fpath = self.normalize_path(fpath.replace('/', os.sep)) with open(cover, 'rb') as f: data = f.read() if keep_cover_aspect: if isFullsize: resize = None else: width, height, fmt = identify_data(data) cover_aspect = width / height if cover_aspect > 1: resize = (resize[0], int(resize[0] / cover_aspect)) elif cover_aspect < 1: resize = (int(cover_aspect * resize[1]), resize[1]) # Return the data resized and in Grayscale if # required data = save_cover_data_to(data, 'dummy.jpg', grayscale=uploadgrayscale, resize_to=resize, return_data=True) with open(fpath, 'wb') as f: f.write(data) fsync(f) except Exception as e: err = str(e) debug_print("KoboTouch:_upload_cover - Exception string: %s"%err) raise else: debug_print("KoboTouch:_upload_cover - ImageID could not be retrieved from the database") def remove_book_from_device_bookshelves(self, connection, book): show_debug = self.is_debugging_title(book.title) # or True remove_shelf_list = set(book.current_shelves) - set(book.device_collections) if show_debug: debug_print('KoboTouch:remove_book_from_device_bookshelves - book.application_id="%s"'%book.application_id) debug_print('KoboTouch:remove_book_from_device_bookshelves - book.contentID="%s"'%book.contentID) debug_print('KoboTouch:remove_book_from_device_bookshelves - book.device_collections=', book.device_collections) debug_print('KoboTouch:remove_book_from_device_bookshelves - book.current_shelves=', book.current_shelves) debug_print('KoboTouch:remove_book_from_device_bookshelves - remove_shelf_list=', remove_shelf_list) if len(remove_shelf_list) == 0: return query = 'DELETE FROM ShelfContent WHERE ContentId = ?' values = [book.contentID,] if book.device_collections: placeholder = '?' placeholders = ','.join(placeholder for unused in book.device_collections) query += ' and ShelfName not in (%s)' % placeholders values.extend(book.device_collections) if show_debug: debug_print('KoboTouch:remove_book_from_device_bookshelves query="%s"'%query) debug_print('KoboTouch:remove_book_from_device_bookshelves values="%s"'%values) cursor = connection.cursor() cursor.execute(query, values) connection.commit() cursor.close() def set_filesize_in_device_database(self, connection, contentID, fpath): show_debug = self.is_debugging_title(fpath) if show_debug: debug_print('KoboTouch:set_filesize_in_device_database contentID="%s"'%contentID) test_query = 'SELECT ___FileSize ' \ 'FROM content ' \ 'WHERE ContentID = ? ' \ ' AND ContentType = 6' test_values = (contentID, ) updatequery = 'UPDATE content ' \ 'SET ___FileSize = ? ' \ 'WHERE ContentId = ? ' \ 'AND ContentType = 6' cursor = connection.cursor() cursor.execute(test_query, test_values) result = cursor.fetchone() if result is None: if show_debug: debug_print(' Did not find a record - new book on device') elif os.path.exists(fpath): file_size = os.stat(self.normalize_path(fpath)).st_size if show_debug: debug_print(' Found a record - will update - ___FileSize=', result[0], ' file_size=', file_size) if file_size != int(result[0]): update_values = (file_size, contentID, ) cursor.execute(updatequery, update_values) if show_debug: debug_print(' Size updated.') connection.commit() cursor.close() # debug_print("KoboTouch:set_filesize_in_device_database - end") def delete_empty_bookshelves(self, connection): debug_print("KoboTouch:delete_empty_bookshelves - start") delete_query = ("DELETE FROM Shelf " "WHERE Shelf._IsSynced = 'false' " "AND Shelf.InternalName not in ('Shortlist', 'Wishlist') " "AND NOT EXISTS " "(SELECT 1 FROM ShelfContent c " "WHERE Shelf.Name = C.ShelfName " "AND c._IsDeleted <> 'true')") update_query = ("UPDATE Shelf " "SET _IsDeleted = 'true' " "WHERE Shelf._IsSynced = 'true' " "AND Shelf.InternalName not in ('Shortlist', 'Wishlist') " "AND NOT EXISTS " "(SELECT 1 FROM ShelfContent C " "WHERE Shelf.Name = C.ShelfName " "AND c._IsDeleted <> 'true')") delete_activity_query = ("DELETE FROM Activity " "WHERE Type = 'Shelf' " "AND NOT EXISTS " "(SELECT 1 FROM Shelf " "WHERE Shelf.Name = Activity.Id " "AND Shelf._IsDeleted = 'false')" ) cursor = connection.cursor() cursor.execute(delete_query) cursor.execute(update_query) if self.has_activity_table(): cursor.execute(delete_activity_query) connection.commit() cursor.close() debug_print("KoboTouch:delete_empty_bookshelves - end") def get_bookshelflist(self, connection): # Retrieve the list of booksehelves # debug_print('KoboTouch:get_bookshelflist') bookshelves = [] if not self.supports_bookshelves(): return bookshelves query = 'SELECT Name FROM Shelf WHERE _IsDeleted = "false"' cursor = connection.cursor() cursor.execute(query) # count_bookshelves = 0 for i, row in enumerate(cursor): bookshelves.append(row[0]) # count_bookshelves = i + 1 cursor.close() # debug_print("KoboTouch:get_bookshelflist - count bookshelves=" + unicode(count_bookshelves)) return bookshelves def set_bookshelf(self, connection, book, shelfName): show_debug = self.is_debugging_title(book.title) if show_debug: debug_print('KoboTouch:set_bookshelf book.ContentID="%s"'%book.contentID) debug_print('KoboTouch:set_bookshelf book.current_shelves="%s"'%book.current_shelves) if shelfName in book.current_shelves: if show_debug: debug_print(' book already on shelf.') return test_query = 'SELECT _IsDeleted FROM ShelfContent WHERE ShelfName = ? and ContentId = ?' test_values = (shelfName, book.contentID, ) addquery = 'INSERT INTO ShelfContent ("ShelfName","ContentId","DateModified","_IsDeleted","_IsSynced") VALUES (?, ?, ?, "false", "false")' add_values = (shelfName, book.contentID, time.strftime(self.TIMESTAMP_STRING, time.gmtime()), ) updatequery = 'UPDATE ShelfContent SET _IsDeleted = "false" WHERE ShelfName = ? and ContentId = ?' update_values = (shelfName, book.contentID, ) cursor = connection.cursor() cursor.execute(test_query, test_values) result = cursor.fetchone() if result is None: if show_debug: debug_print(' Did not find a record - adding') cursor.execute(addquery, add_values) elif result[0] == 'true': if show_debug: debug_print(' Found a record - updating - result=', result) cursor.execute(updatequery, update_values) connection.commit() cursor.close() # debug_print("KoboTouch:set_bookshelf - end") def check_for_bookshelf(self, connection, bookshelf_name): show_debug = self.is_debugging_title(bookshelf_name) if show_debug: debug_print('KoboTouch:check_for_bookshelf bookshelf_name="%s"'%bookshelf_name) test_query = 'SELECT InternalName, Name, _IsDeleted FROM Shelf WHERE Name = ?' test_values = (bookshelf_name, ) addquery = 'INSERT INTO "main"."Shelf"' add_values = (time.strftime(self.TIMESTAMP_STRING, time.gmtime()), bookshelf_name, time.strftime(self.TIMESTAMP_STRING, time.gmtime()), bookshelf_name, "false", "true", "false", ) if self.dbversion < 64: addquery += ' ("CreationDate","InternalName","LastModified","Name","_IsDeleted","_IsVisible","_IsSynced")'\ ' VALUES (?, ?, ?, ?, ?, ?, ?)' else: addquery += ' ("CreationDate", "InternalName","LastModified","Name","_IsDeleted","_IsVisible","_IsSynced", "Id")'\ ' VALUES (?, ?, ?, ?, ?, ?, ?, ?)' add_values = add_values +(bookshelf_name,) if show_debug: debug_print('KoboTouch:check_for_bookshelf addquery=', addquery) debug_print('KoboTouch:check_for_bookshelf add_values=', add_values) updatequery = 'UPDATE Shelf SET _IsDeleted = "false" WHERE Name = ?' cursor = connection.cursor() cursor.execute(test_query, test_values) result = cursor.fetchone() if result is None: if show_debug: debug_print(' Did not find a record - adding shelf "%s"' % bookshelf_name) cursor.execute(addquery, add_values) elif result[2] == 'true': debug_print('KoboTouch:check_for_bookshelf - Shelf "%s" is deleted - undeleting. result[2]="%s"' % (bookshelf_name, unicode(result[2]))) cursor.execute(updatequery, test_values) connection.commit() cursor.close() # Update the bookshelf list. self.bookshelvelist = self.get_bookshelflist(connection) # debug_print("KoboTouch:set_bookshelf - end") def remove_from_bookshelves(self, connection, oncard, ContentID=None, bookshelves=None): debug_print('KoboTouch:remove_from_bookshelf ContentID=', ContentID) if not self.supports_bookshelves(): return query = 'DELETE FROM ShelfContent' values = [] if ContentID is not None: query += ' WHERE ContentId = ?' values.append(ContentID) else: if oncard == 'carda': query += ' WHERE ContentID like \'file:///mnt/sd/%\'' elif oncard != 'carda' and oncard != 'cardb': query += ' WHERE ContentID not like \'file:///mnt/sd/%\'' if bookshelves: placeholder = '?' placeholders = ','.join(placeholder for unused in bookshelves) query += ' and ShelfName in (%s)' % placeholders values.append(bookshelves) debug_print('KoboTouch:remove_from_bookshelf query=', query) debug_print('KoboTouch:remove_from_bookshelf values=', values) cursor = connection.cursor() cursor.execute(query, values) connection.commit() cursor.close() debug_print("KoboTouch:remove_from_bookshelf - end") def set_series(self, connection, book): show_debug = self.is_debugging_title(book.title) if show_debug: debug_print('KoboTouch:set_series book.kobo_series="%s"'%book.kobo_series) debug_print('KoboTouch:set_series book.series="%s"'%book.series) debug_print('KoboTouch:set_series book.series_index=', book.series_index) if book.series == book.kobo_series: kobo_series_number = None if book.kobo_series_number is not None: try: kobo_series_number = float(book.kobo_series_number) except: kobo_series_number = None if kobo_series_number == book.series_index: if show_debug: debug_print('KoboTouch:set_series - series info the same - not changing') return update_query = 'UPDATE content SET Series=?, SeriesNumber==? where BookID is Null and ContentID = ?' if book.series is None: update_values = (None, None, book.contentID, ) elif book.series_index is None: # This should never happen, but... update_values = (book.series, None, book.contentID, ) else: update_values = (book.series, "%g"%book.series_index, book.contentID, ) cursor = connection.cursor() try: if show_debug: debug_print('KoboTouch:set_series - about to set - parameters:', update_values) cursor.execute(update_query, update_values) self.series_set += 1 except: debug_print(' Database Exception: Unable to set series info') raise else: connection.commit() cursor.close() if show_debug: debug_print("KoboTouch:set_series - end") @classmethod def settings(cls): opts = cls._config().parse() if isinstance(cls.EXTRA_CUSTOMIZATION_DEFAULT, list): if opts.extra_customization is None: opts.extra_customization = [] if not isinstance(opts.extra_customization, list): opts.extra_customization = [opts.extra_customization] if len(cls.EXTRA_CUSTOMIZATION_DEFAULT) > len(opts.extra_customization): extra_options_offset = 0 extra_customization = [] for i,d in enumerate(cls.EXTRA_CUSTOMIZATION_DEFAULT): if i >= len(opts.extra_customization) + extra_options_offset: extra_customization.append(d) elif d.__class__ != opts.extra_customization[i - extra_options_offset].__class__: extra_options_offset += 1 extra_customization.append(d) else: extra_customization.append(opts.extra_customization[i - extra_options_offset]) opts.extra_customization = extra_customization return opts def isAura(self): return self.detected_device.idProduct in self.AURA_PRODUCT_ID def isAuraHD(self): return self.detected_device.idProduct in self.AURA_HD_PRODUCT_ID def isAuraH2O(self): return self.detected_device.idProduct in self.AURA_H2O_PRODUCT_ID def isGlo(self): return self.detected_device.idProduct in self.GLO_PRODUCT_ID def isGloHD(self): return self.detected_device.idProduct in self.GLO_HD_PRODUCT_ID def isMini(self): return self.detected_device.idProduct in self.MINI_PRODUCT_ID def isTouch(self): return self.detected_device.idProduct in self.TOUCH_PRODUCT_ID def cover_file_endings(self): return self.GLO_COVER_FILE_ENDINGS if self.isGlo() or self.isAura() \ else self.AURA_HD_COVER_FILE_ENDINGS if self.isAuraHD() or self.isAuraH2O() or self.isGloHD() \ else self.COVER_FILE_ENDINGS def set_device_name(self): device_name = self.gui_name if self.isAura(): device_name = 'Kobo Aura' elif self.isAuraHD(): device_name = 'Kobo Aura HD' elif self.isAuraH2O(): device_name = 'Kobo Aura H2O' elif self.isGlo(): device_name = 'Kobo Glo' elif self.isGloHD(): device_name = 'Kobo Glo HD' elif self.isMini(): device_name = 'Kobo Mini' elif self.isTouch(): device_name = 'Kobo Touch' self.__class__.gui_name = device_name return device_name def copying_covers(self): opts = self.settings() return opts.extra_customization[self.OPT_UPLOAD_COVERS] or opts.extra_customization[self.OPT_KEEP_COVER_ASPECT_RATIO] def keep_cover_aspect(self): opts = self.settings() return opts.extra_customization[self.OPT_KEEP_COVER_ASPECT_RATIO] def modifying_epub(self): return self.modifying_css() def modifying_css(self): opts = self.settings() return opts.extra_customization[self.OPT_MODIFY_CSS] def supports_bookshelves(self): return self.dbversion >= self.min_supported_dbversion def supports_series(self): return self.dbversion >= self.min_dbversion_series def supports_kobo_archive(self): return self.dbversion >= self.min_dbversion_archive def supports_covers_on_sdcard(self): return self.dbversion >= self.min_dbversion_images_on_sdcard and self.fwversion >= self.min_fwversion_images_on_sdcard def supports_images_tree(self): return self.fwversion >= self.min_fwversion_images_tree def has_externalid(self): return self.dbversion >= self.min_dbversion_externalid def has_activity_table(self): return self.dbversion >= self.min_dbversion_activity def modify_database_check(self, function): # Checks to see whether the database version is supported # and whether the user has chosen to support the firmware version # debug_print("KoboTouch:modify_database_check - self.fwversion > self.max_supported_fwversion=", self.fwversion > self.max_supported_fwversion) if self.dbversion > self.supported_dbversion or self.fwversion > self.max_supported_fwversion: # Unsupported database opts = self.settings() if not opts.extra_customization[self.OPT_SUPPORT_NEWER_FIRMWARE]: debug_print('The database has been upgraded past supported version') self.report_progress(1.0, _('Removing books from device...')) from calibre.devices.errors import UserFeedback raise UserFeedback(_("Kobo database version unsupported - See details"), _('Your Kobo is running an updated firmware/database version.' ' As calibre does not know about this updated firmware,' ' database editing is disabled, to prevent corruption.' ' You can still send books to your Kobo with calibre, ' ' but deleting books and managing collections is disabled.' ' If you are willing to experiment and know how to reset' ' your Kobo to Factory defaults, you can override this' ' check by right clicking the device icon in calibre and' ' selecting "Configure this device" and then the ' ' "Attempt to support newer firmware" option.' ' Doing so may require you to perform a factory reset of' ' your Kobo.') + ( '\nDevice database version: %s.' '\nDevice firmware version: %s' ) % (self.dbversion, self.fwversion), UserFeedback.WARN) return False else: # The user chose to edit the database anyway return True else: # Supported database version return True @classmethod def is_debugging_title(cls, title): if not DEBUG: return False # debug_print("KoboTouch:is_debugging - title=", title) is_debugging = False opts = cls.settings() if opts.extra_customization: debugging_title = opts.extra_customization[cls.OPT_DEBUGGING_TITLE] is_debugging = len(debugging_title) > 0 and title.lower().find(debugging_title.lower()) >= 0 or len(title) == 0 return is_debugging def dump_bookshelves(self, connection): if not (DEBUG and self.supports_bookshelves() and False): return debug_print('KoboTouch:dump_bookshelves - start') shelf_query = 'SELECT * FROM Shelf' shelfcontent_query = 'SELECT * FROM ShelfContent' placeholder = '%s' cursor = connection.cursor() prints('\nBookshelves on device:') cursor.execute(shelf_query) i = 0 for row in cursor: placeholders = ', '.join(placeholder for unused in row) prints(placeholders%row) i += 1 if i == 0: prints("No shelves found!!") else: prints("Number of shelves=%d"%i) prints('\nBooks on shelves on device:') cursor.execute(shelfcontent_query) i = 0 for row in cursor: placeholders = ', '.join(placeholder for unused in row) prints(placeholders%row) i += 1 if i == 0: prints("No books are on any shelves!!") else: prints("Number of shelved books=%d"%i) cursor.close() debug_print('KoboTouch:dump_bookshelves - end')
gpl-3.0
6,730,758,367,339,175,000
49.074966
237
0.549732
false
4.174212
false
false
false
gfyoung/pandas
pandas/tests/io/pytables/test_complex.py
1
6374
from warnings import catch_warnings import numpy as np import pytest import pandas.util._test_decorators as td import pandas as pd from pandas import DataFrame, Series import pandas._testing as tm from pandas.tests.io.pytables.common import ensure_clean_path, ensure_clean_store from pandas.io.pytables import read_hdf # TODO(ArrayManager) HDFStore relies on accessing the blocks pytestmark = td.skip_array_manager_not_yet_implemented def test_complex_fixed(setup_path): df = DataFrame( np.random.rand(4, 5).astype(np.complex64), index=list("abcd"), columns=list("ABCDE"), ) with ensure_clean_path(setup_path) as path: df.to_hdf(path, "df") reread = read_hdf(path, "df") tm.assert_frame_equal(df, reread) df = DataFrame( np.random.rand(4, 5).astype(np.complex128), index=list("abcd"), columns=list("ABCDE"), ) with ensure_clean_path(setup_path) as path: df.to_hdf(path, "df") reread = read_hdf(path, "df") tm.assert_frame_equal(df, reread) def test_complex_table(setup_path): df = DataFrame( np.random.rand(4, 5).astype(np.complex64), index=list("abcd"), columns=list("ABCDE"), ) with ensure_clean_path(setup_path) as path: df.to_hdf(path, "df", format="table") reread = read_hdf(path, "df") tm.assert_frame_equal(df, reread) df = DataFrame( np.random.rand(4, 5).astype(np.complex128), index=list("abcd"), columns=list("ABCDE"), ) with ensure_clean_path(setup_path) as path: df.to_hdf(path, "df", format="table", mode="w") reread = read_hdf(path, "df") tm.assert_frame_equal(df, reread) def test_complex_mixed_fixed(setup_path): complex64 = np.array( [1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j], dtype=np.complex64 ) complex128 = np.array( [1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j], dtype=np.complex128 ) df = DataFrame( { "A": [1, 2, 3, 4], "B": ["a", "b", "c", "d"], "C": complex64, "D": complex128, "E": [1.0, 2.0, 3.0, 4.0], }, index=list("abcd"), ) with ensure_clean_path(setup_path) as path: df.to_hdf(path, "df") reread = read_hdf(path, "df") tm.assert_frame_equal(df, reread) def test_complex_mixed_table(setup_path): complex64 = np.array( [1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j], dtype=np.complex64 ) complex128 = np.array( [1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j], dtype=np.complex128 ) df = DataFrame( { "A": [1, 2, 3, 4], "B": ["a", "b", "c", "d"], "C": complex64, "D": complex128, "E": [1.0, 2.0, 3.0, 4.0], }, index=list("abcd"), ) with ensure_clean_store(setup_path) as store: store.append("df", df, data_columns=["A", "B"]) result = store.select("df", where="A>2") tm.assert_frame_equal(df.loc[df.A > 2], result) with ensure_clean_path(setup_path) as path: df.to_hdf(path, "df", format="table") reread = read_hdf(path, "df") tm.assert_frame_equal(df, reread) def test_complex_across_dimensions_fixed(setup_path): with catch_warnings(record=True): complex128 = np.array([1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j]) s = Series(complex128, index=list("abcd")) df = DataFrame({"A": s, "B": s}) objs = [s, df] comps = [tm.assert_series_equal, tm.assert_frame_equal] for obj, comp in zip(objs, comps): with ensure_clean_path(setup_path) as path: obj.to_hdf(path, "obj", format="fixed") reread = read_hdf(path, "obj") comp(obj, reread) def test_complex_across_dimensions(setup_path): complex128 = np.array([1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j]) s = Series(complex128, index=list("abcd")) df = DataFrame({"A": s, "B": s}) with catch_warnings(record=True): objs = [df] comps = [tm.assert_frame_equal] for obj, comp in zip(objs, comps): with ensure_clean_path(setup_path) as path: obj.to_hdf(path, "obj", format="table") reread = read_hdf(path, "obj") comp(obj, reread) def test_complex_indexing_error(setup_path): complex128 = np.array( [1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j], dtype=np.complex128 ) df = DataFrame( {"A": [1, 2, 3, 4], "B": ["a", "b", "c", "d"], "C": complex128}, index=list("abcd"), ) msg = ( "Columns containing complex values can be stored " "but cannot be indexed when using table format. " "Either use fixed format, set index=False, " "or do not include the columns containing complex " "values to data_columns when initializing the table." ) with ensure_clean_store(setup_path) as store: with pytest.raises(TypeError, match=msg): store.append("df", df, data_columns=["C"]) def test_complex_series_error(setup_path): complex128 = np.array([1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j, 1.0 + 1.0j]) s = Series(complex128, index=list("abcd")) msg = ( "Columns containing complex values can be stored " "but cannot be indexed when using table format. " "Either use fixed format, set index=False, " "or do not include the columns containing complex " "values to data_columns when initializing the table." ) with ensure_clean_path(setup_path) as path: with pytest.raises(TypeError, match=msg): s.to_hdf(path, "obj", format="t") with ensure_clean_path(setup_path) as path: s.to_hdf(path, "obj", format="t", index=False) reread = read_hdf(path, "obj") tm.assert_series_equal(s, reread) def test_complex_append(setup_path): df = DataFrame( {"a": np.random.randn(100).astype(np.complex128), "b": np.random.randn(100)} ) with ensure_clean_store(setup_path) as store: store.append("df", df, data_columns=["b"]) store.append("df", df) result = store.select("df") tm.assert_frame_equal(pd.concat([df, df], 0), result)
bsd-3-clause
-5,007,679,795,284,820,000
30.554455
84
0.562441
false
3.067372
true
false
false
SelfDrivUTT/selfdrivutt
robot/raspberry/controls.py
1
3292
import socket import sys import os import curses from threading import Thread class RemoteControlServer(object): """docstring for Curses_control""" def __init__(self): super(RemoteControl, self).__init__() self.data = '' self.stopped = False self.HOST = os.environ.get('COMMAND_HOST', 'localhost') self.PORT = os.environ.get('COMMAND_PORT', 9089) def start(self): self.socket_server = socket.socket(socket.AF_INET,socket.SOCK_STREAM) print('Socket created') self.socket_server.bind((self.HOST, self.PORT)) print('Socket bind complete') self.socket_server.listen(10) print('Socket now listening') self.conn, self.addr = self.socket_server.accept() # Accept the connection once (for starter) print('Connected with ' + self.addr[0] + ':' + str(self.addr[1])) Thread(target=self.update, args=()).start() return self def update(self): while True: try: self.data = self.conn.recv(1024) self.conn.send(self.data) print(self.data) if self.data == 27: self.stop() return except socket.error as e: print(e) self.stop() return else: if len(self.data) == 0: print 'orderly shutdown on server end' self.stop() else: print(self.data) def read(self): return self.data def stop(self): self.stopped = True self.conn.close() self.socket_server.close() class CursesControl(object): """docstring for Curses_control""" def __init__(self): super(CursesControl, self).__init__() # self.screen.nodelay() self.event = 'unload' self.stopped = False def start(self): self.screen = curses.initscr() Thread(target=self.update, args=()).start() return self def update(self): while True: try: curses.noecho() curses.curs_set(0) self.screen.keypad(1) self.screen.addstr("Press a key, " + str(self.event)) self.event = self.screen.getch() finally: curses.endwin() if self.stopped or self.event == 27: return def read(self): if self.event == curses.KEY_LEFT: command = 'left' elif self.event == curses.KEY_RIGHT: command = 'right' elif self.event == curses.KEY_UP: command = 'up' elif self.event == curses.KEY_DOWN: command = 'down' elif self.event == 32: # SPACE command = 'stop' elif self.event == 27: # ESC key command = 'quit' elif self.event == ord('p'): # P key command = 'auto_logic_based' elif self.event == ord('o'): # O key command = 'stream' elif self.event == ord('m'): # O key command = 'auto_neural_network' else: command = '?' return command def stop(self): self.stopped = True
mit
2,659,452,182,422,635,000
28.132743
101
0.512151
false
4.182973
false
false
false
all-of-us/raw-data-repository
rdr_service/alembic/versions/434fb0f05794_add_ignore_and_dev_note_to_genomics_.py
1
1673
"""add ignore and dev note to genomics models. Revision ID: 434fb0f05794 Revises: 994dfe6e53ee Create Date: 2020-09-30 14:39:16.244636 """ from alembic import op import sqlalchemy as sa # revision identifiers, used by Alembic. revision = '434fb0f05794' down_revision = '994dfe6e53ee' branch_labels = None depends_on = None def upgrade(engine_name): globals()["upgrade_%s" % engine_name]() def downgrade(engine_name): globals()["downgrade_%s" % engine_name]() def upgrade_rdr(): # ### commands auto generated by Alembic - please adjust! ### op.add_column('genomic_gc_validation_metrics', sa.Column('dev_note', sa.String(length=255), nullable=True)) op.add_column('genomic_gc_validation_metrics', sa.Column('ignore_flag', sa.SmallInteger(), nullable=True)) op.add_column('genomic_set_member', sa.Column('dev_note', sa.String(length=255), nullable=True)) op.add_column('genomic_set_member_history', sa.Column('dev_note', sa.String(length=255), nullable=True)) # ### end Alembic commands ### def downgrade_rdr(): # ### commands auto generated by Alembic - please adjust! ### op.drop_column('genomic_set_member', 'dev_note') op.drop_column('genomic_set_member_history', 'dev_note') op.drop_column('genomic_gc_validation_metrics', 'ignore_flag') op.drop_column('genomic_gc_validation_metrics', 'dev_note') # ### end Alembic commands ### def upgrade_metrics(): # ### commands auto generated by Alembic - please adjust! ### pass # ### end Alembic commands ### def downgrade_metrics(): # ### commands auto generated by Alembic - please adjust! ### pass # ### end Alembic commands ###
bsd-3-clause
-7,922,045,653,497,436,000
28.875
111
0.679617
false
3.267578
false
false
false
dannyroberts/eulxml
eulxml/xmlmap/premis.py
1
5516
# file eulxml/xmlmap/premis.py # # Copyright 2010,2011 Emory University Libraries # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. ''' :mod:`eulxml.xmlmap` classes for dealing with the `PREMIS <http://www.loc.gov/standards/premis/>`_ metadata format for preservation metadata. ----- ''' from eulxml import xmlmap PREMIS_NAMESPACE = 'info:lc/xmlns/premis-v2' 'authoritative namespace for PREMIS' PREMIS_SCHEMA = 'http://www.loc.gov/standards/premis/v2/premis-v2-1.xsd' 'authoritative schema location for PREMIS' class BasePremis(xmlmap.XmlObject): '''Base PREMIS class with namespace declaration common to all PREMIS XmlObjects. .. Note:: This class is intended mostly for internal use, but could be useful when extending or adding additional PREMIS :class:`~eulxml.xmlmap.XmlObject` classes. The :attr:`PREMIS_NAMESPACE` is mapped to the prefix **p**. ''' ROOT_NS = PREMIS_NAMESPACE ROOT_NAMESPACES = { 'p': PREMIS_NAMESPACE, 'xsi': 'http://www.w3.org/2001/XMLSchema-instance' } class PremisRoot(BasePremis): '''Base class with a schema declaration for any of the root/stand-alone PREMIS elements: * ``<premis>`` - :class:`Premis` * ``<object>`` - :class:`Object` * ``<event>`` - :class:`Event` * ``<agent>`` * ``<rights>`` ''' XSD_SCHEMA = PREMIS_SCHEMA class Object(PremisRoot): '''Preliminary :class:`~eulxml.xmlmap.XmlObject` for a PREMIS object. Curently only includes the minimal required fields. ''' ROOT_NAME = 'object' type = xmlmap.StringField('@xsi:type') # file, representation, bitstream '''type of object (e.g., file, representation, bitstream). .. Note:: To be schema valid, object types must be in the PREMIS namespace, e.g.:: from eulxml.xmlmap import premis obj = premis.Object() obj.type = "p:file" ''' id_type = xmlmap.StringField('p:objectIdentifier/p:objectIdentifierType') 'identifier type (`objectIdentifier/objectIdentifierType`)' id = xmlmap.StringField('p:objectIdentifier/p:objectIdentifierValue') 'identifier value (`objectIdentifier/objectIdentifierValue`)' class Event(PremisRoot): '''Preliminary :class:`~eulxml.xmlmap.XmlObject` for a PREMIS event. .. Note:: The PREMIS schema requires that elements occur in a specified order, which :mod:`eulxml` does not currently handle or manage. As a work-around, when creating a new :class:`Event` from scratch, you should set the following required fields in this order: identifier (:attr:`id` and :attr:`ad_type` ''' ROOT_NAME = 'event' type = xmlmap.StringField('p:eventType') 'event type (``eventType``)' id_type = xmlmap.StringField('p:eventIdentifier/p:eventIdentifierType') 'identifier type (`eventIdentifier/eventIdentifierType`)' id = xmlmap.StringField('p:eventIdentifier/p:eventIdentifierValue') 'identifier value (`eventIdentifier/eventIdentifierValue`)' date = xmlmap.StringField('p:eventDateTime') 'date/time for the event (`eventDateTime`)' detail = xmlmap.StringField('p:eventDetail', required=False) 'event detail (`eventDetail`)' outcome = xmlmap.StringField('p:eventOutcomeInformation/p:eventOutcome', required=False) '''outcome of the event (`eventOutcomeInformation/eventOutcome`). .. Note:: In this preliminary implementation, the outcome detail fields are not mapped. ''' # leaving out outcome detail for now... # agent (optional, could be repeated) agent_type = xmlmap.StringField('p:linkingAgentIdentifier/p:linkingAgentIdentifierType') agent_id = xmlmap.StringField('p:linkingAgentIdentifier/p:linkingAgentIdentifierValue') # object (optional, could be repeated) object_type = xmlmap.StringField('p:linkingObjectIdentifier/p:linkingObjectIdentifierType') object_id = xmlmap.StringField('p:linkingObjectIdentifier/p:linkingObjectIdentifierValue') class Premis(PremisRoot): '''Preliminary :class:`~eulxml.xmlmap.XmlObject` for a PREMIS container element that can contain any of the other top-level PREMIS elements. Curently only includes mappings for a single object and list of events. ''' ROOT_NAME = 'premis' version = xmlmap.StringField('@version') '''Version of PREMIS in use; by default, new instances of :class:`Premis` will be initialized with a version of 2.1''' object = xmlmap.NodeField('p:object', Object) 'a single PREMIS :class:`object`' events = xmlmap.NodeListField('p:event', Event) 'list of PREMIS events, as instances of :class:`Event`' def __init__(self, *args, **kwargs): # version is required for schema-validity; don't override a # user-supplied version, but otherwise default to 2.1 if 'version' not in kwargs: kwargs['version'] = '2.1' super(Premis, self).__init__(*args, **kwargs)
apache-2.0
2,107,150,789,629,381,400
36.020134
95
0.688724
false
3.762619
false
false
false
mightbejosh/dj-braintree
djbraintree/admin.py
1
6860
# -*- coding: utf-8 -*- """ Note: Django 1.4 support was dropped in #107 https://github.com/pydanny/dj-braintree/pull/107 """ from django.contrib import admin from .models import Transaction from .models import Customer class CustomerHasCardListFilter(admin.SimpleListFilter): title = "card presence" parameter_name = "has_card" def lookups(self, request, model_admin): return [ ["yes", "Has Card"], ["no", "Does Not Have a Card"] ] def queryset(self, request, queryset): if self.value() == "yes": return queryset.exclude(card_fingerprint="") if self.value() == "no": return queryset.filter(card_fingerprint="") class InvoiceCustomerHasCardListFilter(admin.SimpleListFilter): title = "card presence" parameter_name = "has_card" def lookups(self, request, model_admin): return [ ["yes", "Has Card"], ["no", "Does Not Have a Card"] ] def queryset(self, request, queryset): if self.value() == "yes": return queryset.exclude(customer__card_fingerprint="") if self.value() == "no": return queryset.filter(customer__card_fingerprint="") # # class CustomerSubscriptionStatusListFilter(admin.SimpleListFilter): # title = "subscription status" # parameter_name = "sub_status" # # def lookups(self, request, model_admin): # statuses = [ # [x, x.replace("_", " ").title()] # for x in CurrentSubscription.objects.all().values_list( # "status", # flat=True # ).distinct() # ] # statuses.append(["none", "No Subscription"]) # return statuses # # def queryset(self, request, queryset): # if self.value() is None: # return queryset.all() # else: # return queryset.filter(current_subscription__status=self.value()) # # # def send_charge_receipt(modeladmin, request, queryset): # """ # Function for sending receipts from the admin if a receipt is not sent for # a specific charge. # """ # for charge in queryset: # charge.send_receipt() # # # admin.site.register( # Charge, # readonly_fields=('created',), # list_display=[ # "braintree_id", # "customer", # "amount", # "description", # "paid", # "disputed", # "refunded", # "fee", # "receipt_sent", # "created" # ], # search_fields=[ # "braintree_id", # "customer__braintree_id", # "card_last_4", # "invoice__braintree_id" # ], # list_filter=[ # "paid", # "disputed", # "refunded", # "card_kind", # "created" # ], # raw_id_fields=[ # "customer", # "invoice" # ], # actions=(send_charge_receipt,), # ) # # admin.site.register( # EventProcessingException, # readonly_fields=('created',), # list_display=[ # "message", # "event", # "created" # ], # search_fields=[ # "message", # "traceback", # "data" # ], # ) # # admin.site.register( # Event, # raw_id_fields=["customer"], # readonly_fields=('created',), # list_display=[ # "braintree_id", # "kind", # "livemode", # "valid", # "processed", # "created" # ], # list_filter=[ # "kind", # "created", # "valid", # "processed" # ], # search_fields=[ # "braintree_id", # "customer__braintree_id", # "validated_message" # ], # ) # # # class CurrentSubscriptionInline(admin.TabularInline): # model = CurrentSubscription # # # def subscription_status(obj): # return obj.current_subscription.status # subscription_status.short_description = "Subscription Status" # # # admin.site.register( # Customer, # raw_id_fields=["subscriber"], # readonly_fields=('created',), # list_display=[ # "braintree_id", # "subscriber", # "card_kind", # "card_last_4", # subscription_status, # "created" # ], # list_filter=[ # "card_kind", # CustomerHasCardListFilter, # CustomerSubscriptionStatusListFilter # ], # search_fields=[ # "braintree_id" # ], # inlines=[CurrentSubscriptionInline] # ) # # # class InvoiceItemInline(admin.TabularInline): # model = InvoiceItem # # # def customer_has_card(obj): # """ Returns True if the customer has a card attached to its account.""" # return obj.customer.card_fingerprint != "" # customer_has_card.short_description = "Customer Has Card" # # # def customer_email(obj): # """ Returns a string representation of the customer's email.""" # return str(obj.customer.subscriber.email) # customer_email.short_description = "Customer" # # # admin.site.register( # Invoice, # raw_id_fields=["customer"], # readonly_fields=('created',), # list_display=[ # "braintree_id", # "paid", # "closed", # customer_email, # customer_has_card, # "period_start", # "period_end", # "subtotal", # "total", # "created" # ], # search_fields=[ # "braintree_id", # "customer__braintree_id" # ], # list_filter=[ # InvoiceCustomerHasCardListFilter, # "paid", # "closed", # "attempted", # "attempts", # "created", # "date", # "period_end", # "total" # ], # inlines=[InvoiceItemInline] # ) # # # admin.site.register( # Transfer, # raw_id_fields=["event"], # readonly_fields=('created',), # list_display=[ # "braintree_id", # "amount", # "status", # "date", # "description", # "created" # ], # search_fields=[ # "braintree_id", # "event__braintree_id" # ] # ) # # # class PlanAdmin(admin.ModelAdmin): # # def save_model(self, request, obj, form, change): # """Update or create objects using our custom methods that # sync with Braintree.""" # # if change: # obj.update_name() # # else: # Plan.get_or_create(**form.cleaned_data) # # def get_readonly_fields(self, request, obj=None): # readonly_fields = list(self.readonly_fields) # if obj: # readonly_fields.extend([ # 'braintree_id', # 'amount', # 'currency', # 'interval', # 'interval_count', # 'trial_period_days']) # # return readonly_fields # # admin.site.register(Plan, PlanAdmin)
bsd-3-clause
6,652,920,508,881,095,000
23.326241
79
0.525364
false
3.418037
false
false
false
ericchill/gnofract4d
fract4d/fc.py
1
16906
#!/usr/bin/env python # A compiler from UltraFractal or Fractint formula files to C code # The UltraFractal manual is the best current description of the file # format. You can download it from http://www.ultrafractal.com/uf3-manual.zip # The implementation is based on the outline in "Modern Compiler # Implementation in ML: basic techniques" (Appel 1997, Cambridge) # Overall structure: # fractlexer.py and fractparser.py are the lexer and parser, respectively. # They use the PLY package to do lexing and SLR parsing, and produce as # output an abstract syntax tree (defined in the Absyn module). # The Translate module type-checks the code, maintains the symbol # table (symbol.py) and converts it into an intermediate form (ir.py) # Canon performs several simplifying passes on the IR to make it easier # to deal with, then codegen converts it into a linear sequence of # simple C instructions # Finally we invoke the C compiler to convert to a native code shared library import getopt import sys import commands import os.path import stat import random import hashlib import re import copy import fractconfig import fractparser import fractlexer import translate import codegen import fracttypes import absyn import preprocessor import cache import gradient class FormulaTypes: FRACTAL = 0 COLORFUNC = 1 TRANSFORM = 2 GRADIENT = 3 NTYPES = 4 GRAD_UGR=0 GRAD_MAP=1 GRAD_GGR=2 GRAD_CS=3 matches = [ re.compile(r'(\.frm\Z)|(\.ufm\Z)', re.IGNORECASE), re.compile(r'(\.cfrm\Z)|(\.ucl\Z)', re.IGNORECASE), re.compile(r'\.uxf\Z', re.IGNORECASE), re.compile(r'(\.ugr\Z)|(\.map\Z)|(\.ggr\Z)|(\.cs\Z)|(\.pal\Z)', re.IGNORECASE) ] # indexed by FormulaTypes above extensions = [ "frm", "cfrm", "uxf", "ggr", "pal"] @staticmethod def extension_from_type(t): return FormulaTypes.extensions[t] @staticmethod def guess_type_from_filename(filename): if FormulaTypes.matches[FormulaTypes.FRACTAL].search(filename): return translate.T elif FormulaTypes.matches[FormulaTypes.COLORFUNC].search(filename): return translate.ColorFunc elif FormulaTypes.matches[FormulaTypes.TRANSFORM].search(filename): return translate.Transform elif FormulaTypes.matches[FormulaTypes.GRADIENT].search(filename): return translate.GradientFunc @staticmethod def guess_formula_type_from_filename(filename): for i in xrange(FormulaTypes.NTYPES): if FormulaTypes.matches[i].search(filename): return i raise ValueError("Unknown file type for '%s'" % filename) @staticmethod def guess_gradient_subtype_from_filename(filename): filename = filename.lower() if filename.endswith(".ugr"): return FormulaTypes.GRAD_UGR if filename.endswith(".map") or filename.endswith(".pal"): return FormulaTypes.GRAD_MAP if filename.endswith(".ggr"): return FormulaTypes.GRAD_GGR if filename.endswith(".cs"): return FormulaTypes.GRAD_CS raise ValueError("Unknown gradient type for '%s'" % filename) @staticmethod def isFormula(filename): for matcher in FormulaTypes.matches: if matcher.search(filename): return True return False class FormulaFile: def __init__(self, formulas, contents,mtime,filename): self.formulas = formulas self.contents = contents self.mtime = mtime self.filename = filename self.file_backed = True def out_of_date(self): return self.file_backed and \ os.stat(self.filename)[stat.ST_MTIME] > self.mtime def get_formula(self,formula): return self.formulas.get(formula) def get_formula_names(self, skip_type=None): '''return all the coloring funcs except those marked as only suitable for the OTHER kind (inside vs outside)''' names = [] for name in self.formulas.keys(): sym = self.formulas[name].symmetry if sym == None or sym == "BOTH" or sym != skip_type: names.append(name) return names class Compiler: def __init__(self): self.parser = fractparser.parser self.lexer = fractlexer.lexer self.c_code = "" self.path_lists = [ [], [], [], [] ] self.cache = cache.T() self.cache_dir = os.path.expanduser("~/.gnofract4d-cache/") self.init_cache() if 'win' != sys.platform[:3]: self.compiler_name = "gcc" self.flags = "-fPIC -DPIC -g -O3 -shared" self.output_flag = "-o " self.libs = "-lm" else: self.compiler_name = "cl" self.flags = "/EHsc /Gd /nologo /W3 /LD /MT /TP /DWIN32 /DWINDOWS /D_USE_MATH_DEFINES" self.output_flag = "/Fe" self.libs = "/link /LIBPATH:\"%s/fract4d\" fract4d_stdlib.lib" % sys.path[0] # /DELAYLOAD:fract4d_stdlib.pyd DelayImp.lib self.tree_cache = {} self.leave_dirty = False self.next_inline_number = 0 def _get_files(self): return self.cache.files files = property(_get_files) def update_from_prefs(self,prefs): self.compiler_name = prefs.get("compiler","name") self.flags = prefs.get("compiler","options") self.set_func_path_list(prefs.get_list("formula_path")) self.path_lists[FormulaTypes.GRADIENT] = copy.copy( prefs.get_list("map_path")) def set_flags(self,flags): self.flags = flags def add_path(self,path,type): self.path_lists[type].append(path) def add_func_path(self,path): self.path_lists[FormulaTypes.FRACTAL].append(path) self.path_lists[FormulaTypes.COLORFUNC].append(path) self.path_lists[FormulaTypes.TRANSFORM].append(path) def set_func_path_list(self,list): self.path_lists[FormulaTypes.FRACTAL] = copy.copy(list) self.path_lists[FormulaTypes.COLORFUNC] = copy.copy(list) self.path_lists[FormulaTypes.TRANSFORM] = copy.copy(list) def init_cache(self): self.cache.init() def find_files(self,type): files = {} for dir in self.path_lists[type]: if not os.path.isdir(dir): continue for file in os.listdir(dir): if os.path.isfile(os.path.join(dir,file)): files[file] = 1 return files.keys() def find_files_of_type(self,type): matcher = FormulaTypes.matches[type] return [file for file in self.find_files(type) if matcher.search(file)] def find_formula_files(self): return self.find_files_of_type(FormulaTypes.FRACTAL) def find_colorfunc_files(self): return self.find_files_of_type(FormulaTypes.COLORFUNC) def find_transform_files(self): return self.find_files_of_type(FormulaTypes.TRANSFORM) def get_text(self,fname): file = self.files.get(fname) if not file: self.load_formula_file(fname) return self.files[fname].contents def nextInlineFile(self,type): self.next_inline_number += 1 ext = FormulaTypes.extension_from_type(type) return "__inline__%d.%s" % (self.next_inline_number, ext) def add_inline_formula(self,formbody, formtype): # formbody contains a string containing the contents of a formula formulas = self.parse_file(formbody) fname = self.nextInlineFile(formtype) ff = FormulaFile(formulas,formbody,0,fname) ff.file_backed = False self.files[fname] = ff names = ff.get_formula_names() if len(names) == 0: formName = "error" else: formName = names[0] return (fname, formName) def last_chance(self,filename): '''does nothing here, but can be overridden by GUI to prompt user.''' raise IOError("Can't find formula file %s in formula search path" % \ filename) def compile_one(self,formula): self.compile(formula) t = translate.T(absyn.Formula("",[],-1)) cg = self.compile(t) t.merge(formula,"") outputfile = os.path.abspath(self.generate_code(t, cg)) return outputfile def compile_all(self,formula,cf0,cf1,transforms,options={}): self.compile(formula,options) self.compile(cf0,options) self.compile(cf1,options) for transform in transforms: self.compile(transform,options) # create temp empty formula and merge everything into that t = translate.T(absyn.Formula("",[],-1)) cg = self.compile(t,options) t.merge(formula,"") t.merge(cf0,"cf0_") t.merge(cf1,"cf1_") for transform in transforms: t.merge(transform,"t_") outputfile = os.path.abspath(self.generate_code(t, cg)) return outputfile def find_file(self,filename,type): if os.path.exists(filename): dir = os.path.dirname(filename) if self.path_lists[type].count(dir) == 0: # add directory to search path self.path_lists[type].append(dir) return filename filename = os.path.basename(filename) for path in self.path_lists[type]: f = os.path.join(path,filename) if os.path.exists(f): return f return self.last_chance(filename) def add_endlines(self,result,final_line): "Add info on which is the final source line of each formula" if None == result: return l = len(result.children) for i in xrange(l): if i == l - 1: result.children[i].last_line = final_line else: result.children[i].last_line = result.children[i+1].pos-1 def parse_file(self,s): self.lexer.lineno = 1 result = None try: pp = preprocessor.T(s) result = self.parser.parse(pp.out()) except preprocessor.Error, err: # create an Error formula listing the problem result = self.parser.parse('error {\n}\n') result.children[0].children[0] = \ absyn.PreprocessorError(str(err), -1) #print result.pretty() self.add_endlines(result,self.lexer.lineno) formulas = {} for formula in result.children: formulas[formula.leaf] = formula return formulas def load_formula_file(self, filename): try: type = FormulaTypes.guess_formula_type_from_filename(filename) filename = self.find_file(filename,type) s = open(filename,"r").read() # read in a whole file basefile = os.path.basename(filename) mtime = os.stat(filename)[stat.ST_MTIME] if type == FormulaTypes.GRADIENT: # don't try and parse gradient files apart from UGRs subtype = FormulaTypes.guess_gradient_subtype_from_filename(filename) if subtype == FormulaTypes.GRAD_UGR: formulas = self.parse_file(s) else: formulas = {} else: formulas = self.parse_file(s) ff = FormulaFile(formulas,s,mtime,filename) self.files[basefile] = ff return ff except Exception, err: #print "Error parsing '%s' : %s" % (filename, err) raise def out_of_date(self,filename): basefile = os.path.basename(filename) ff = self.files.get(basefile) if not ff: self.load_formula_file(filename) ff = self.files.get(basefile) return ff.out_of_date() def get_file(self,filename): basefile = os.path.basename(filename) ff = self.files.get(basefile) if not ff: self.load_formula_file(filename) ff = self.files.get(basefile) elif ff.out_of_date(): self.load_formula_file(filename) ff = self.files.get(basefile) return ff def get_formula_text(self,filename,formname): ff = self.get_file(filename) form = ff.get_formula(formname) start_line = form.pos-1 last_line = form.last_line lines = ff.contents.splitlines() return "\n".join(lines[start_line:last_line]) def is_inline(self,filename, formname): return not self.files[filename].file_backed def compile(self,ir,options={}): cg = codegen.T(ir.symbols,options) cg.output_all(ir) return cg def hashcode(self,c_code): hash = hashlib.md5() hash.update(c_code) hash.update(self.compiler_name) hash.update(self.flags) hash.update(self.libs) return hash.hexdigest() def generate_code(self,ir, cg, outputfile=None,cfile=None): cg.output_decls(ir) self.c_code = cg.output_c(ir) hash = self.hashcode(self.c_code) if outputfile == None: outputfile = self.cache.makefilename(hash,".so") if os.path.exists(outputfile): # skip compilation - we already have this code return outputfile if cfile == None: cfile = self.cache.makefilename(hash,".c") if 'win' in sys.platform: objfile = self.cache.makefilename(hash, ".obj") open(cfile,"w").write(self.c_code) # -march=i686 for 10% speed gain cmd = "%s \"%s\" %s %s\"%s\"" % \ (self.compiler_name, cfile, self.flags, self.output_flag, outputfile) if 'win' == sys.platform[:3]: cmd += " /Fo\"%s\"" % objfile cmd += " %s" % self.libs #print "cmd: %s" % cmd (status,output) = commands.getstatusoutput(cmd) if status != 0: raise fracttypes.TranslationError( "Error reported by C compiler:%s" % output) return outputfile def get_parsetree(self,filename,formname): ff = self.get_file(filename) if ff == None : return None return ff.get_formula(formname) def guess_type_from_filename(self,filename): return FormulaTypes.guess_type_from_filename(filename) def get_formula(self, filename, formname,prefix=""): type = self.guess_type_from_filename(filename) f = self.get_parsetree(filename,formname) if f != None: f = type(f,prefix) return f def get_gradient(self, filename, formname): g = gradient.Gradient() if formname == None: g.load(open(self.find_file(filename, 3))) # FIXME else: compiled_gradient = self.get_formula(filename,formname) g.load_ugr(compiled_gradient) return g def get_random_gradient(self): return self.get_random_formula(3) # FIXME def get_random_formula(self,type): files = self.find_files_of_type(type) file = random.choice(files) if gradient.FileType.guess(file) == gradient.FileType.UGR: ff = self.get_file(file) formulas = ff.formulas.keys() formula = random.choice(formulas) else: formula = None return (file,formula) def clear_cache(self): self.cache.clear() def __del__(self): if not self.leave_dirty: self.clear_cache() instance = Compiler() instance.update_from_prefs(fractconfig.instance) def usage(): print "FC : a compiler from Fractint .frm files to C code" print "fc.py -o [outfile] -f [formula] infile" sys.exit(1) def generate(fc,formulafile, formula, outputfile, cfile): # find the function we want ir = fc.get_formula(formulafile,formula) if ir == None: raise Exception("Can't find formula %s in %s" % \ (formula, formulafile)) if ir.errors != []: print "Errors during translation" for e in ir.errors: print e raise Exception("Errors during translation") cg = fc.compile(ir) fc.generate_code(ir, cg, outputfile,cfile) def main(args): fc = Compiler() fc.leave_dirty = True for arg in args: ff = fc.load_formula_file(arg) for name in ff.get_formula_names(): print name form = fc.get_formula(arg,name) cg = fc.compile(form) if __name__ == '__main__': main(sys.argv[1:])
bsd-3-clause
-7,829,546,766,683,979,000
31.827184
133
0.588726
false
3.784643
false
false
false
sileht/pifpaf
pifpaf/drivers/zookeeper.py
1
2019
# Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or # implied. # See the License for the specific language governing permissions and # limitations under the License. import os from pifpaf import drivers class ZooKeeperDriver(drivers.Driver): DEFAULT_PORT = 2181 PATH = ["/usr/share/zookeeper/bin", "/usr/local/opt/zookeeper/libexec/bin"] def __init__(self, port=DEFAULT_PORT, **kwargs): """Create a new ZooKeeper server.""" super(ZooKeeperDriver, self).__init__(**kwargs) self.port = port @classmethod def get_options(cls): return [ {"param_decls": ["--port"], "type": int, "default": cls.DEFAULT_PORT, "help": "port to use for ZooKeeper"}, ] def _setUp(self): super(ZooKeeperDriver, self)._setUp() cfgfile = os.path.join(self.tempdir, "zoo.cfg") with open(cfgfile, "w") as f: f.write("""dataDir=%s clientPort=%s""" % (self.tempdir, self.port)) logdir = os.path.join(self.tempdir, "log") os.mkdir(logdir) self.putenv("ZOOCFGDIR", self.tempdir, True) self.putenv("ZOOCFG", cfgfile, True) self.putenv("ZOO_LOG_DIR", logdir, True) c, _ = self._exec( ["zkServer.sh", "start", cfgfile], wait_for_line="STARTED", path=self.PATH) self.addCleanup(self._exec, ["zkServer.sh", "stop", cfgfile], path=self.PATH) self.putenv("ZOOKEEPER_PORT", str(self.port)) self.putenv("URL", "zookeeper://localhost:%d" % self.port)
apache-2.0
3,448,701,531,717,726,000
30.061538
69
0.600792
false
3.605357
false
false
false
patrickhoefler/lwd
lwd.py
1
7546
#!/usr/bin/python # -*- coding: utf-8 -*- # Functions for turning the Wikidata dump into Linked Data import codecs import glob import gzip import json import math import os import sys import time import xml.etree.cElementTree as ET import settings def process_dump(): # Print some status info print 'Processing ' + settings.dump_filename # Make sure the output folders exist if not os.path.exists('output'): os.mkdir('output') if not os.path.exists('output/' + settings.output_folder): os.mkdir('output/' + settings.output_folder) if not os.path.exists('output/' + settings.output_folder + '/ttl'): os.mkdir('output/' + settings.output_folder + '/ttl') # Delete all old files for f in glob.glob('output/' + settings.output_folder + '/ttl/*.ttl'): os.remove(f) # Initiate variables entity_counter = 0 element_id = '' # Start the clock start_time = time.time() # Load the dump file and create the iterator context = ET.iterparse(settings.dump_filename, events=('start', 'end')) context = iter(context) event, root = context.next() # Iterate over the dump file for event, element in context: # Check if we have reached the max number of processed entities if settings.max_processed_entities > 0 and entity_counter == settings.max_processed_entities: break # Get the ID of the current entity if event == 'end' and element.tag == '{http://www.mediawiki.org/xml/export-0.8/}title': if element.text.find('Q') == 0: element_id = element.text elif element.text.find('Property:P') == 0: element_id = element.text.split(':')[1] # Get the data of the current entity if element_id and event == 'end' and element.tag == '{http://www.mediawiki.org/xml/export-0.8/}text': if element.text: triples = get_nt_for_entity(element_id, element.text) batch_id = str(int(math.floor(int(element_id[1:]) / settings.batchsize)) * settings.batchsize).zfill(8) batchfile_ttl_name = 'output/' + settings.output_folder + '/ttl/' + element_id[0] + '_Batch_' + batch_id + '.ttl' # If ttl file doesn't exist, create it and add the prefixes if not os.path.isfile(batchfile_ttl_name): prefixes = '# Extracted from ' + settings.dump_filename + ' with LWD (http://github.com/patrickhoefler/lwd)' prefixes += """ @prefix rdf: <http://www.w3.org/1999/02/22-rdf-syntax-ns#> . @prefix rdfs: <http://www.w3.org/2000/01/rdf-schema#> . @prefix wd: <http://www.wikidata.org/entity/> . """.replace(' ', '') with codecs.open(batchfile_ttl_name, 'a', 'utf-8') as batchfile_ttl: batchfile_ttl.write(prefixes) # Write the triples to the batchfile with codecs.open(batchfile_ttl_name, 'a', 'utf-8') as batchfile_ttl: batchfile_ttl.write(triples) # One more entity entity_counter += 1 # Print some progress if entity_counter % 1000 == 0: sys.stdout.write('.') sys.stdout.flush() # Print some statistics if entity_counter % 10000 == 0: lap_time = time.time() print '\nProcessed ' + str(entity_counter) + ' entities in ' + str(lap_time - start_time) + ' seconds, on average ' + str(entity_counter / (lap_time - start_time)) + ' per second' # Reset the element ID in preparation for the next iteration element_id = '' # Save the memory, save the world root.clear() # Stop the clock and print some final statistics end_time = time.time() print('\nProcessed ' + str(entity_counter) + ' entities in ' + str(end_time - start_time) + ' seconds, on average ' + str(entity_counter / (end_time - start_time)) + ' per second') number_of_files = len(os.listdir('output/' + settings.output_folder + '/ttl')) if number_of_files != 1: plural = 's' else: plural = '' print('Created ' + str(number_of_files) + ' .ttl file' + plural + ' in ./' + 'output/' + settings.output_folder + '/ttl') def get_nt_for_entity(element_id, element_data): # Turn the data JSON string into an object data = json.loads(element_data) entity_uri = 'wd:' + element_id triples = '' # Get the label in English try: triples = triples + entity_uri + ' rdfs:label ' + '"' + data['label']['en'].replace('\\', '\\\\').replace('"', '\\"') + '"@en .\n' except: # print 'No label for ' + element_id pass # Get the description in English try: triples = triples + entity_uri + ' rdfs:comment ' + '"' + data['description']['en'].replace('\\', '\\\\').replace('"', '\\"') + '"@en .\n' except: # print 'No description for ' + element_id pass # Are there any claims in the current element? if data.get('claims'): # Iterate over all claims for claim in data['claims']: predicate_id = 'P' + str(claim['m'][1]) predicate_uri = 'wd:' + predicate_id if len(claim['m']) > 2: # Is it an object property? if claim['m'][2] == 'wikibase-entityid': object_id = 'Q' + str(claim['m'][3]['numeric-id']) object_uri = 'wd:' + object_id triples = triples + entity_uri + ' ' + predicate_uri + ' ' + object_uri + ' .\n' # Add RDF type if predicate_id == 'P31': triples = triples + entity_uri + ' rdf:type ' + object_uri + ' .\n' # Is it a string value property? if claim['m'][2] == 'string': triples = triples + entity_uri + ' ' + predicate_uri + ' "' + claim['m'][3].replace('\\', '\\\\').replace('"', '\\"') + '" .\n' return triples def compress_ttl_files(): # Print some status info print 'Compressing' # Make sure the output folders exist if not os.path.exists('output'): os.mkdir('output') if not os.path.exists('output/' + settings.output_folder): os.mkdir('output/' + settings.output_folder) if not os.path.exists('output/' + settings.output_folder + '/gz'): os.mkdir('output/' + settings.output_folder + '/gz') # Delete all old files for f in glob.glob('output/' + settings.output_folder + '/gz/*.gz'): os.remove(f) # Compress all files for input_file_name in glob.glob('output/' + settings.output_folder + '/ttl/*.ttl'): with open(input_file_name, 'rb') as input_file: with gzip.open('output/' + settings.output_folder + '/gz/' + input_file_name.split('/')[-1] + '.gz', 'wb') as output_file: output_file.writelines(input_file) # Print some progress sys.stdout.write('.') sys.stdout.flush() # Print some final statistics number_of_files = len(os.listdir('output/' + settings.output_folder + '/gz')) if number_of_files != 1: plural = 's' else: plural = '' print('\nCreated ' + str(number_of_files) + ' .gz file' + plural + ' in ./' + 'output/' + settings.output_folder + '/gz')
mit
-7,322,916,570,662,439,000
37.111111
199
0.551816
false
3.811111
false
false
false
calebmadrigal/algorithms-in-python
heap.py
1
3668
"""heap.py - implementation of a heap priority queue. """ __author__ = "Caleb Madrigal" __date__ = "2015-02-17" import math from enum import Enum from autoresizelist import AutoResizeList class HeapType(Enum): maxheap = 1 minheap = 2 class Heap: def __init__(self, initial_data=None, heap_type=HeapType.maxheap): self.heap_type = heap_type if heap_type == HeapType.maxheap: self.comparator = lambda x, y: x > y else: self.comparator = lambda x, y: x < y self.data = AutoResizeList() if initial_data is not None: self.build_heap(initial_data) self._size = len(self.data) def _left_child(self, index): return 2*index + 1 def _right_child(self, index): return 2*index + 2 def _parent(self, index): return math.floor((index - 1) / 2.0) def _is_root(self, index): return index == 0 def _swap(self, i1, i2): self.data[i1], self.data[i2] = self.data[i2], self.data[i1] def build_heap(self, initial_data): for i in initial_data: self.data.prepend(i) self.heap_down(0) def heap_up(self, index): # If we are at the root, return - we are done if self._is_root(index): return # Else, compare the current node with the parent node, and if this node should be higher # then the parent node, then swap and recursively call on the parent index parent_index = self._parent(index) if self.comparator(self.data[index], self.data[parent_index]): self._swap(index, parent_index) self.heap_up(parent_index) def heap_down(self, index): left_index = self._left_child(index) right_index = self._right_child(index) try: left = self.data[left_index] except IndexError: left = None try: right = self.data[right_index] except IndexError: right = None # Find the largest child largest_child = left largest_child_index = left_index if left is not None and right is not None: if self.comparator(right, left): largest_child = right largest_child_index = right_index elif right is not None: largest_child = right largest_child_index = right_index # If the largest child is not None and is higher priority than the current, then swap # and recursively call on on the child index if largest_child is not None and self.comparator(largest_child, self.data[index]): self._swap(index, largest_child_index) self.heap_down(largest_child_index) def push(self, item): insert_index = self._size # Insert at the end self._size += 1 self.data[insert_index] = item self.heap_up(insert_index) return self def peek(self): return self.data[0] def pop(self): if len(self.data) < 1 or self.data[0] is None: return None # Take item from the root item = self.data[0] # Move the bottom-most, right-most item to the root self.data[0] = self.data[self._size-1] self.data[self._size-1] = None self._size -= 1 self.heap_down(0) return item def size(self): return self._size def __repr__(self): return str(self.data) if __name__ == "__main__": import unittest testsuite = unittest.TestLoader().discover('test', pattern="*heap*") unittest.TextTestRunner(verbosity=1).run(testsuite)
mit
-855,685,561,109,325,200
27.65625
96
0.581516
false
3.785346
true
false
false
unkyulee/elastic-cms
src/web/modules/post/services/config.py
1
2826
import web.util.tools as tools import os from web import app import lib.es as es def get(p): # get host and index from the global config h = tools.get_conf(p['host'], p['navigation']['id'], 'host', 'http://localhost:9200') n = tools.get_conf(p['host'], p['navigation']['id'], 'index', '') return { 'name': get_conf(h, n, 'name', ''), 'description': get_conf(h, n, 'description', ''), 'host': h, 'index': n, 'upload_dir': get_conf(h, n, 'upload_dir', os.path.join( app.config.get('BASE_DIR'), 'uploads' ) ), 'allowed_exts': get_conf(h, n, 'allowed_exts',''), 'page_size': get_conf(h, n, 'page_size', '10'), 'query': get_conf(h, n, 'query', '*'), 'sort_field': get_conf(h, n, 'sort_field', '_score'), 'sort_dir': get_conf(h, n, 'sort_dir', 'desc'), 'top': get_conf(h, n, 'top', ''), 'footer': get_conf(h, n, 'footer', ''), 'side': get_conf(h, n, 'side', ''), 'content_header': get_conf(h, n, 'content_header', ''), 'content_footer': get_conf(h, n, 'content_footer', ''), 'intro': get_conf(h, n, 'intro', ''), 'search_query': get_conf(h, n, 'search_query', ''), 'search_item_template': get_conf(h, n, 'search_item_template', ''), 'keep_history': get_conf(h, n, 'keep_history', 'Yes'), } def set(p): # get host, index host = p['c']['host'] if not host: host = tools.get('host') index = p['c']['index'] if not index: index = tools.get('index') # get host and index from the global config tools.set_conf(p['host'], p['navigation']['id'], 'host', host) tools.set_conf(p['host'], p['navigation']['id'], 'index', index) # set local config if p['c']['index']: # save local config only when index is already created set_conf(host, index, 'name', tools.get('name')) set_conf(host, index, 'description', tools.get('description')) set_conf(host, index, 'upload_dir', tools.get('upload_dir')) set_conf(host, index, 'allowed_exts', tools.get('allowed_exts')) set_conf(host, index, 'page_size', tools.get('page_size')) set_conf(host, index, 'query', tools.get('query')) set_conf(host, index, 'sort_field', tools.get('sort_field')) set_conf(host, index, 'sort_dir', tools.get('sort_dir')) set_conf(host, index, 'keep_history', tools.get('keep_history')) def get_conf(host, index, name, default): ret = es.get(host, index, "config", name) return ret.get('value') if ret and ret.get('value') else default def set_conf(host, index, name, value): config = { 'name': name, 'value': value } es.update(host, index, "config", name, config) es.flush(host, index)
mit
-7,525,611,961,569,722,000
37.189189
89
0.54954
false
3.18602
true
false
false
GutenkunstLab/SloppyCell
test/test_FixedPoints.py
1
3610
import unittest import scipy from SloppyCell.ReactionNetworks import * lorenz = Network('lorenz') lorenz.add_compartment('basic') lorenz.add_species('x', 'basic', 0.5) lorenz.add_species('y', 'basic', 0.5) lorenz.add_species('z', 'basic', 0.5) lorenz.add_parameter('sigma', 1.0) lorenz.add_parameter('r', 2.0) lorenz.add_parameter('b', 2.0) lorenz.add_rate_rule('x', 'sigma*(y-x)') lorenz.add_rate_rule('y', 'r*x - y - x*z') lorenz.add_rate_rule('z', 'x*y - b*z') class test_fixedpoints(unittest.TestCase): def test_basic(self): """ Test basic fixed-point finding """ net = lorenz.copy('test') fp = Dynamics.dyn_var_fixed_point(net, dv0=[1,1,1], with_logs=False) # This should find the fixed-point [sqrt(2), sqrt(2), 1] self.assertAlmostEqual(fp[0], scipy.sqrt(2), 6, 'Failed on basic 1,0.') self.assertAlmostEqual(fp[1], scipy.sqrt(2), 6, 'Failed on basic 1,1.') self.assertAlmostEqual(fp[2], 1, 6, 'Failed on basic 1,2.') fp = Dynamics.dyn_var_fixed_point(net, dv0=[-0.1,-0.1,-0.1], with_logs=False) # This should find the fixed-point [0, 0, 0] self.assertAlmostEqual(fp[0], 0, 6, 'Failed on basic 2,0.') self.assertAlmostEqual(fp[1], 0, 6, 'Failed on basic 2,1.') self.assertAlmostEqual(fp[2], 0, 6, 'Failed on basic 2,2.') def test_withlogs(self): """ Test fixed-point finding with logs """ net = lorenz.copy('test') fp = Dynamics.dyn_var_fixed_point(net, dv0=[1,1,1], with_logs=True) # This should find the fixed-point [sqrt(2), sqrt(2), 1] self.assertAlmostEqual(fp[0], scipy.sqrt(2), 6, 'Failed on logs 1,0.') self.assertAlmostEqual(fp[1], scipy.sqrt(2), 6, 'Failed on logs 1,1.') self.assertAlmostEqual(fp[2], 1, 6, 'Failed on logs 1,2.') fp = Dynamics.dyn_var_fixed_point(net, dv0=[0.1,0.1,0.1], with_logs=True) # This should find the fixed-point [0, 0, 0] self.assertAlmostEqual(fp[0], 0, 6, 'Failed on logs 2,0.') self.assertAlmostEqual(fp[1], 0, 6, 'Failed on logs 2,1.') self.assertAlmostEqual(fp[2], 0, 6, 'Failed on logs 2,2.') def test_stability(self): net = lorenz.copy('test') # The sqrt(b*(r-1)), sqrt(b*(r-1)), r-1 fixed point is stable for r < rH # Strogatz, Nonlinear Dynamics and Chaos (p. 316) fp, stable = Dynamics.dyn_var_fixed_point(net, dv0=[1,1,1], stability=True) self.assertEqual(stable, -1, 'Failed to classify stable fixed point') # (0,0,0) is a saddle here fp, stable = Dynamics.dyn_var_fixed_point(net, dv0=[0.01,0.01,0.01], stability=True) self.assertEqual(stable, 0, 'Failed to classify saddle') # (0,0,0) is a stable node here net.set_var_ic('r', 0.5) fp, stable = Dynamics.dyn_var_fixed_point(net, dv0=[0.1,0.1,0.1], stability=True) self.assertEqual(stable, -1, 'Failed to classify stable fixed point') # Now make the far fixed point a saddle... net.set_var_ic('sigma', 6.0) net.set_var_ic('r', 25) fp, stable = Dynamics.dyn_var_fixed_point(net, dv0=[10,10,10], stability=True) self.assertEqual(stable, 0, 'Failed to classify saddle') suite = unittest.makeSuite(test_fixedpoints) if __name__ == '__main__': unittest.main()
bsd-3-clause
-4,611,129,762,351,684,600
43.567901
80
0.565097
false
3.088109
true
false
false
tcarmelveilleux/IcarusAltimeter
Analysis/altitude_analysis.py
1
1202
# -*- coding: utf-8 -*- """ Created on Tue Jul 14 19:34:31 2015 @author: Tennessee """ import numpy as np import matplotlib.pyplot as plt def altitude(atm_hpa, sea_level_hpa): return 44330 * (1.0 - np.power(atm_hpa / sea_level_hpa, 0.1903)) def plot_alt(): default_msl = 101300.0 pressure = np.linspace(97772.58 / 100.0, 79495.0 / 100.0, 2000) alt_nominal = altitude(pressure, default_msl) - altitude(97772.58 / 100.0, default_msl) alt_too_high = altitude(pressure, default_msl + (1000 / 100.0)) - altitude(97772.58 / 100.0, default_msl + (1000 / 100.0)) alt_too_low = altitude(pressure, default_msl - (1000 / 100.0)) - altitude(97772.58 / 100.0, default_msl - (1000 / 100.0)) f1 = plt.figure() ax = f1.gca() ax.plot(pressure, alt_nominal, "b-", label="nom") ax.plot(pressure, alt_too_high, "r-", label="high") ax.plot(pressure, alt_too_low, "g-", label="low") ax.legend() f1.show() f2 = plt.figure() ax = f2.gca() ax.plot(pressure, alt_too_high - alt_nominal, "r-", label="high") ax.plot(pressure, alt_too_low - alt_nominal, "g-", label="low") ax.legend() f2.show()
mit
4,210,792,572,743,000,600
26.953488
126
0.58985
false
2.731818
false
false
false
aESeguridad/GERE
venv/lib/python2.7/site-packages/flask_weasyprint/__init__.py
1
7726
# coding: utf8 """ flask_weasyprint ~~~~~~~~~~~~~~~~ Flask-WeasyPrint: Make PDF in your Flask app with WeasyPrint. :copyright: (c) 2012 by Simon Sapin. :license: BSD, see LICENSE for more details. """ import weasyprint from flask import request, current_app from werkzeug.test import Client, ClientRedirectError from werkzeug.wrappers import Response try: import urlparse except ImportError: # Python 3 from urllib import parse as urlparse try: unicode except NameError: # Python 3 unicode = str VERSION = '0.5' __all__ = ['VERSION', 'make_flask_url_dispatcher', 'make_url_fetcher', 'HTML', 'CSS', 'render_pdf'] DEFAULT_PORTS = frozenset([('http', 80), ('https', 443)]) def make_flask_url_dispatcher(): """Return an URL dispatcher based on the current :ref:`request context <flask:request-context>`. You generally don’t need to call this directly. The context is used when the dispatcher is first created but not afterwards. It is not required after this function has returned. Dispatch to the context’s app URLs below the context’s root URL. If the app has a ``SERVER_NAME`` :ref:`config <flask:config>`, also accept URLs that have that domain name or a subdomain thereof. """ def parse_netloc(netloc): """Return (hostname, port).""" parsed = urlparse.urlsplit('http://' + netloc) return parsed.hostname, parsed.port app = current_app._get_current_object() root_path = request.script_root server_name = app.config.get('SERVER_NAME') if server_name: hostname, port = parse_netloc(server_name) def accept(url): """Accept any URL scheme; also accept subdomains.""" return url.hostname is not None and ( url.hostname == hostname or url.hostname.endswith('.' + hostname)) else: scheme = request.scheme hostname, port = parse_netloc(request.host) if (scheme, port) in DEFAULT_PORTS: port = None def accept(url): """Do not accept subdomains.""" return (url.scheme, url.hostname) == (scheme, hostname) def dispatch(url_string): if isinstance(url_string, bytes): url_string = url_string.decode('utf8') url = urlparse.urlsplit(url_string) url_port = url.port if (url.scheme, url_port) in DEFAULT_PORTS: url_port = None if accept(url) and url_port == port and url.path.startswith(root_path): netloc = url.netloc if url.port and not url_port: netloc = netloc.rsplit(':', 1)[0] # remove default port base_url = '%s://%s%s' % (url.scheme, netloc, root_path) path = url.path[len(root_path):] if url.query: path += '?' + url.query # Ignore url.fragment return app, base_url, path return dispatch def make_url_fetcher(dispatcher=None, next_fetcher=weasyprint.default_url_fetcher): """Return an function suitable as a ``url_fetcher`` in WeasyPrint. You generally don’t need to call this directly. If ``dispatcher`` is not provided, :func:`make_flask_url_dispatcher` is called to get one. This requires a request context. Otherwise, it must be a callable that take an URL and return either ``None`` or a ``(wsgi_callable, base_url, path)`` tuple. For None ``next_fetcher`` is used. (By default, fetch normally over the network.) For a tuple the request is made at the WSGI level. ``wsgi_callable`` must be a Flask application or another WSGI callable. ``base_url`` is the root URL for the application while ``path`` is the path within the application. Typically ``base_url + path`` is equal or equivalent to the passed URL. """ if dispatcher is None: dispatcher = make_flask_url_dispatcher() def flask_url_fetcher(url): redirect_chain = set() while 1: result = dispatcher(url) if result is None: return next_fetcher(url) app, base_url, path = result client = Client(app, response_wrapper=Response) if isinstance(path, unicode): # TODO: double-check this. Apparently Werzeug %-unquotes bytes # but not Unicode URLs. (IRI vs. URI or something.) path = path.encode('utf8') response = client.get(path, base_url=base_url) if response.status_code == 200: return dict( string=response.data, mime_type=response.mimetype, encoding=response.charset, redirected_url=url) # The test client can follow redirects, but do it ourselves # to get access to the redirected URL. elif response.status_code in (301, 302, 303, 305, 307): redirect_chain.add(url) url = response.location if url in redirect_chain: raise ClientRedirectError('loop detected') else: raise ValueError('Flask-WeasyPrint got HTTP status %s for %s%s' % (response.status, base_url, path)) return flask_url_fetcher def _wrapper(class_, *args, **kwargs): if args: guess = args[0] args = args[1:] else: guess = kwargs.pop('guess', None) if guess is not None and not hasattr(guess, 'read'): # Assume a (possibly relative) URL guess = urlparse.urljoin(request.url, guess) if 'string' in kwargs and 'base_url' not in kwargs: # Strings do not have an "intrinsic" base URL, use the request context. kwargs['base_url'] = request.url kwargs['url_fetcher'] = make_url_fetcher() return class_(guess, *args, **kwargs) def HTML(*args, **kwargs): """Like `weasyprint.HTML() <http://weasyprint.org/using/#the-weasyprint-html-class>`_ but: * :func:`make_url_fetcher` is used to create an ``url_fetcher`` * If ``guess`` is not a file object, it is an URL relative to the current request context. This means that you can just pass a result from :func:`flask.url_for`. * If ``string`` is passed, ``base_url`` defaults to the current request’s URL. This requires a Flask request context. """ return _wrapper(weasyprint.HTML, *args, **kwargs) def CSS(*args, **kwargs): return _wrapper(weasyprint.CSS, *args, **kwargs) CSS.__doc__ = HTML.__doc__.replace('HTML', 'CSS').replace('html', 'css') def render_pdf(html, stylesheets=None, download_filename=None): """Render a PDF to a response with the correct ``Content-Type`` header. :param html: Either a :class:`weasyprint.HTML` object or an URL to be passed to :func:`flask_weasyprint.HTML`. The latter case requires a request context. :param stylesheets: A list of user stylesheets, passed to :meth:`~weasyprint.HTML.write_pdf` :param download_filename: If provided, the ``Content-Disposition`` header is set so that most web browser will show the "Save as…" dialog with the value as the default filename. :returns: a :class:`flask.Response` object. """ if not hasattr(html, 'write_pdf'): html = HTML(html) pdf = html.write_pdf(stylesheets=stylesheets) response = current_app.response_class(pdf, mimetype='application/pdf') if download_filename: response.headers.add('Content-Disposition', 'attachment', filename=download_filename) return response
gpl-3.0
6,181,784,262,939,823,000
35.046729
79
0.612004
false
4.066421
false
false
false
ThomasHabets/python-pyhsm
examples/yhsm-monitor-exit.py
1
1480
#!/usr/bin/env python # # Copyright (c) 2011, Yubico AB # All rights reserved. # # Utility to send a MONITOR_EXIT command to a YubiHSM. # # MONITOR_EXIT only works if the YubiHSM is in debug mode. It would # be a security problem to allow remote reconfiguration of a production # YubiHSM. # # If your YubiHSM is not in debug mode, enter configuration mode by # pressing the small button while inserting the YubiHSM in the USB port. # import sys sys.path.append('Lib'); import pyhsm device = "/dev/ttyACM0" # simplified arguments parsing d_argv = dict.fromkeys(sys.argv) debug = d_argv.has_key('-v') raw = d_argv.has_key('-v') if d_argv.has_key('-h'): sys.stderr.write("Syntax: %s [-v] [-R]\n" % (sys.argv[0])) sys.stderr.write("\nOptions :\n") sys.stderr.write(" -v verbose\n") sys.stderr.write(" -R raw MONITOR_EXIT command\n") sys.exit(0) res = 0 try: s = pyhsm.base.YHSM(device=device, debug = debug) if raw: # No initialization s.write('\x7f\xef\xbe\xad\xba\x10\x41\x52\x45') else: print "Version: %s" % s.info() s.monitor_exit() print "Exited monitor-mode (maybe)" if raw: print "s.stick == %s" % s.stick print "s.stick.ser == %s" % s.stick.ser for _ in xrange(3): s.stick.ser.write("\n") line = s.stick.ser.readline() print "%s" % (line) except pyhsm.exception.YHSM_Error, e: print "ERROR: %s" % e res = 1 sys.exit(res)
bsd-2-clause
5,347,888,154,988,822,000
24.084746
72
0.618243
false
2.808349
false
false
false
darvin/qtdjango
src/qtdjango/settings.py
1
5503
# -*- coding: utf-8 -*- from qtdjango.helpers import test_connection __author__ = 'darvin' from qtdjango.connection import * __author__ = 'darvin' from PyQt4.QtCore import * from PyQt4.QtGui import * class BooleanEdit(QCheckBox): def text(self): return QVariant(self.checkState()).toString() def setText(self, text): self.setChecked(QVariant(text).toBool()) class SettingsDialog(QDialog): widgets_table = [ # (name, caption, widget object, default value), ("address", u"Адрес сервера", QLineEdit, "http://127.0.0.1:8000"), ("api_path", u"Путь к api сервера", QLineEdit, "/api/"), ("server_package", u"Название пакета сервера", QLineEdit, "none"), ("login", u"Ваш логин", QLineEdit, ""), ("password", u"Ваш пароль", QLineEdit, ""), ("open_links_in_external_browser", \ u"Открывать ссылки из окна информации во внешнем браузере", BooleanEdit, True), ] def __init__(self, parent=None, error_message=None, models_manager=None): super(SettingsDialog, self).__init__(parent) self.setWindowTitle(u"Настройки") self.setModal(True) self.formlayout = QFormLayout() self.models_manager = models_manager self.settings = QSettings() self.message_widget = QLabel() self.__widgets = [] for name, caption, widget_class, default in self.widgets_table: self.__widgets.append((name, caption, widget_class(), default)) for name, caption, widget, default in self.__widgets: self.formlayout.addRow(caption, widget) widget.setText(self.settings.value(name, default).toString()) self.formlayout.addRow(self.message_widget) if error_message is not None: self.message(**error_message) buttonBox = QDialogButtonBox(QDialogButtonBox.Save\ | QDialogButtonBox.Cancel |QDialogButtonBox.RestoreDefaults) testButton = QPushButton(u"Тестировать соединение") buttonBox.addButton(testButton, QDialogButtonBox.ActionRole) testButton.clicked.connect(self.test) buttonBox.accepted.connect(self.accept) buttonBox.rejected.connect(self.reject) buttonBox.button(QDialogButtonBox.RestoreDefaults).clicked.connect(self.restore) self.formlayout.addRow(buttonBox) self.setLayout(self.formlayout) def accept(self): if self.test(): for name, caption, widget, default in self.__widgets: self.settings.setValue(name, widget.text()) self.models_manager.set_connection_params(\ self.get_value("address"), \ self.get_value("api_path"), \ self.get_value("login"),\ self.get_value("password")) QDialog.accept(self) def restore(self): for name, caption, widget, default in self.__widgets: widget.setText(default) def message(self, text, error=False, works=False, fields=[]): self.message_widget.setText(text) if error: color = "red" elif works: color = "green" else: color = "black" css = "QLabel { color : %s; }" % color self.message_widget.setStyleSheet(css) for name, caption, widget, default in self.__widgets: self.formlayout.labelForField(widget).setStyleSheet("") if name in fields: self.formlayout.labelForField(widget).setStyleSheet(css) def get_value(self, name): return unicode(self.settings.value(name).toString()) def test(self): s = {} for name, caption, widget, default in self.__widgets: s[name] = unicode(widget.text()) try: remote_version = test_connection(s["address"],s["api_path"],s["login"],s["password"]) import qtdjango if qtdjango.__version__==remote_version: self.message(text=u"Удаленный сервер настроен правильно!", works=True) return True elif remote_version is not None: self.message(u"Версия системы на удаленном сервере отличается от\ версии системы на клиенте") return True except SocketError: self.message(text=u"Ошибка при подключении к удаленному серверу", error=True, fields=\ ("address",)) except ServerNotFoundError: self.message(text=u"Удаленный сервер недоступен", error=True, fields=\ ("address",)) except NotQtDjangoResponceError: self.message(text=u"Не правильно настроен путь на удаленном сервере или \ удаленный сервер не является сервером системы", error=True, fields=\ ("address","api_path")) except AuthError: self.message(text=u"Неверное имя пользователя или пароль", error=True, fields=\ ("login","password")) return False
gpl-2.0
3,427,938,179,775,995,000
34.326389
98
0.599568
false
3.418683
true
false
false
barbarahui/nuxeo-calisphere
s3stash/nxstash_mediajson.py
1
4444
#!/usr/bin/env python # -*- coding: utf-8 -*- from __future__ import unicode_literals import sys import os from s3stash.nxstashref import NuxeoStashRef from deepharvest.deepharvest_nuxeo import DeepHarvestNuxeo from deepharvest.mediajson import MediaJson from dplaingestion.mappers.ucldc_nuxeo_mapper import UCLDCNuxeoMapper import json import s3stash.s3tools FILENAME_FORMAT = "{}-media.json" class NuxeoStashMediaJson(NuxeoStashRef): ''' create and stash media.json file for a nuxeo object ''' def __init__(self, path, bucket, region, pynuxrc='~/.pynuxrc', replace=True, **kwargs): super(NuxeoStashMediaJson, self).__init__(path, bucket, region, pynuxrc, replace, **kwargs) self.dh = DeepHarvestNuxeo( self.path, self.bucket, pynuxrc=self.pynuxrc) self.mj = MediaJson() self.filename = FILENAME_FORMAT.format(self.uid) self.filepath = os.path.join(self.tmp_dir, self.filename) self._update_report('filename', self.filename) self._update_report('filepath', self.filepath) def nxstashref(self): return self.nxstash_mediajson() def nxstash_mediajson(self): ''' create media.json file for object and stash on s3 ''' self._update_report('stashed', False) # extract and transform metadata for parent obj and any components parent_md = self._get_parent_metadata(self.metadata) component_md = [ self._get_component_metadata(c) for c in self.dh.fetch_components(self.metadata) ] # create media.json file media_json = self.mj.create_media_json(parent_md, component_md) self._write_file(media_json, self.filepath) # stash media.json file on s3 stashed, s3_report = s3stash.s3tools.s3stash( self.filepath, self.bucket, self.filename, self.region, 'application/json', self.replace) self._update_report('s3_stash', s3_report) self._update_report('stashed', stashed) self._remove_tmp() return self.report def _get_parent_metadata(self, obj): ''' assemble top-level (parent) object metadata ''' metadata = {} metadata['label'] = obj['title'] # only provide id, href, format if Nuxeo Document has file attached full_metadata = self.nx.get_metadata(uid=obj['uid']) if self.dh.has_file(full_metadata): metadata['id'] = obj['uid'] metadata['href'] = self.dh.get_object_download_url(full_metadata) metadata['format'] = self.dh.get_calisphere_object_type(obj[ 'type']) if metadata['format'] == 'video': metadata['dimensions'] = self.dh.get_video_dimensions( full_metadata) return metadata def _get_component_metadata(self, obj): ''' assemble component object metadata ''' metadata = {} full_metadata = self.nx.get_metadata(uid=obj['uid']) metadata['label'] = obj['title'] metadata['id'] = obj['uid'] metadata['href'] = self.dh.get_object_download_url(full_metadata) # extract additional ucldc metadata from 'properties' element ucldc_md = self._get_ucldc_schema_properties(full_metadata) for key, value in ucldc_md.iteritems(): metadata[key] = value # map 'type' metadata['format'] = self.dh.get_calisphere_object_type(obj['type']) return metadata def _get_ucldc_schema_properties(self, metadata): ''' get additional metadata as mapped by harvester ''' properties = {} mapper = UCLDCNuxeoMapper(metadata) mapper.map_original_record() mapper.map_source_resource() properties = mapper.mapped_data['sourceResource'] properties.update(mapper.mapped_data['originalRecord']) return properties def _write_file(self, content_dict, filepath): """ convert dict to json and write to file """ content_json = json.dumps( content_dict, indent=4, separators=(',', ': '), sort_keys=False) with open(filepath, 'wb') as f: f.write(content_json) f.flush() def main(argv=None): pass if __name__ == "__main__": sys.exit(main())
bsd-3-clause
-6,770,037,951,671,929,000
32.413534
77
0.602835
false
3.788576
false
false
false
anjel-ershova/python_training
fixture/fixture_group.py
1
4896
from model.model_group import Group import random class GroupHelper: def __init__(self, app): self.app = app def select_group_by_index(self, index): wd = self.app.wd wd.find_elements_by_name("selected[]")[index].click() def select_group_by_id(self, id): wd = self.app.wd wd.find_element_by_css_selector("input[value='%s']" % id).click() def select_first_group(self): wd = self.app.wd self.select_group_by_index(0) def edit_if_not_none(self, field, text): wd = self.app.wd if text is not None: wd.find_element_by_name(field).click() wd.find_element_by_name(field).clear() wd.find_element_by_name(field).send_keys(text) else: pass def fill_group_form(self, group): wd = self.app.wd self.edit_if_not_none("group_name", group.name) self.edit_if_not_none("group_header", group.header) self.edit_if_not_none("group_footer", group.footer) def create(self, group): wd = self.app.wd # open_groups_page wd.find_element_by_link_text("groups").click() # init group creation wd.find_element_by_name("new").click() self.fill_group_form(group) # submit group creation wd.find_element_by_name("submit").click() self.return_to_groups_page() self.group_cache = None def edit_first_group(self): wd = self.app.wd self.edit_group_by_index(0) def edit_group_by_index(self, index, new_group_data): wd = self.app.wd self.app.navigation.open_groups_page() self.select_group_by_index(index) # click edit button wd.find_element_by_name("edit").click() self.fill_group_form(new_group_data) # submit edition wd.find_element_by_name("update").click() self.return_to_groups_page() self.group_cache = None def edit_group_by_id(self, id, new_group_data): wd = self.app.wd self.app.navigation.open_groups_page() self.select_group_by_id(id) # click edit button wd.find_element_by_name("edit").click() self.fill_group_form(new_group_data) # submit edition wd.find_element_by_name("update").click() self.return_to_groups_page() self.group_cache = None def add_selected_contact_to_selected_group_by_id(self, target_group): wd = self.app.wd # открыть выпадающий список to_group = wd.find_element_by_name("to_group") to_group.click() # выбор произвольной группы по value to_group.find_element_by_css_selector("[value='%s']" % target_group.id).click() wd.find_element_by_name("add").click() def select_some_group_to_view(self, target_group): wd = self.app.wd # открыть выпадающий список view_group = wd.find_element_by_name("group") view_group.click() # выбор произвольной группы по value view_group.find_element_by_css_selector("[value='%s']" % target_group.id).click() # def click_add_contact_to_group_button(self): # wd = self.app.wd # wd.find_element_by_name("add").click() # self.app.navigation.open_home_page() def delete_first_group(self): wd = self.app.wd self.delete_group_by_index(0) def delete_group_by_index(self, index): wd = self.app.wd self.app.navigation.open_groups_page() self.select_group_by_index(index) # submit deletion wd.find_element_by_name("delete").click() self.return_to_groups_page() self.group_cache = None def delete_group_by_id(self, id): wd = self.app.wd self.app.navigation.open_groups_page() self.select_group_by_id(id) wd.find_element_by_name("delete").click() self.return_to_groups_page() self.group_cache = None def return_to_groups_page(self): wd = self.app.wd wd.find_element_by_link_text("group page").click() def count(self): wd = self.app.wd self.app.navigation.open_groups_page() return len(wd.find_elements_by_name("selected[]")) group_cache = None def get_group_list(self): if self.group_cache is None: wd = self.app.wd self.app.navigation.open_groups_page() self.group_cache = [] wd.find_elements_by_css_selector("span.group") for element in wd.find_elements_by_css_selector("span.group"): text = element.text id = int(element.find_element_by_name("selected[]").get_attribute("value")) self.group_cache.append(Group(name=text, id=id)) return list(self.group_cache)
apache-2.0
4,500,193,398,506,461,700
33.285714
91
0.592708
false
3.219316
false
false
false
bb111189/Arky2
boilerplate/external/pycountry/__init__.py
1
3459
# vim:fileencoding=utf-8 # Copyright (c) 2008-2011 gocept gmbh & co. kg # See also LICENSE.txt # $Id$ """pycountry""" import os.path import pycountry.db LOCALES_DIR = os.path.join(os.path.dirname(__file__), 'locales') DATABASE_DIR = os.path.join(os.path.dirname(__file__), 'databases') class Countries(pycountry.db.Database): """Provides access to an ISO 3166 database (Countries).""" field_map = dict(alpha_2_code='alpha2', alpha_3_code='alpha3', numeric_code='numeric', name='name', official_name='official_name', common_name='common_name') data_class_name = 'Country' xml_tag = 'iso_3166_entry' class Scripts(pycountry.db.Database): """Providess access to an ISO 15924 database (Scripts).""" field_map = dict(alpha_4_code='alpha4', numeric_code='numeric', name='name') data_class_name = 'Script' xml_tag = 'iso_15924_entry' class Currencies(pycountry.db.Database): """Providess access to an ISO 4217 database (Currencies).""" field_map = dict(letter_code='letter', numeric_code='numeric', currency_name='name') data_class_name = 'Currency' xml_tag = 'iso_4217_entry' class Languages(pycountry.db.Database): """Providess access to an ISO 639-1/2 database (Languages).""" field_map = dict(iso_639_2B_code='bibliographic', iso_639_2T_code='terminology', iso_639_1_code='alpha2', common_name='common_name', name='name') data_class_name = 'Language' xml_tag = 'iso_639_entry' class Subdivision(pycountry.db.Data): parent_code = None def __init__(self, element, **kw): super(Subdivision, self).__init__(element, **kw) self.type = element.parentNode.attributes.get('type').value self.country_code = self.code.split('-')[0] if self.parent_code is not None: self.parent_code = '%s-%s' % (self.country_code, self.parent_code) @property def country(self): return countries.get(alpha2=self.country_code) @property def parent(self): return subdivisions.get(code=self.parent_code) class Subdivisions(pycountry.db.Database): # Note: subdivisions can be hierarchical to other subdivisions. The # parent_code attribute is related to other subdivisons, *not* # the country! xml_tag = 'iso_3166_2_entry' data_class_base = Subdivision data_class_name = 'Subdivision' field_map = dict(code='code', name='name', parent='parent_code') no_index = ['name', 'parent_code'] def __init__(self, *args, **kw): super(Subdivisions, self).__init__(*args, **kw) # Add index for the country code. self.indices['country_code'] = {} for subdivision in self: divs = self.indices['country_code'].setdefault( subdivision.country_code, set()) divs.add(subdivision) countries = Countries(os.path.join(DATABASE_DIR, 'iso3166.xml')) scripts = Scripts(os.path.join(DATABASE_DIR, 'iso15924.xml')) currencies = Currencies(os.path.join(DATABASE_DIR, 'iso4217.xml')) languages = Languages(os.path.join(DATABASE_DIR, 'iso639.xml')) subdivisions = Subdivisions(os.path.join(DATABASE_DIR, 'iso3166_2.xml'))
lgpl-3.0
8,592,734,702,324,915,000
30.445455
78
0.601619
false
3.51882
false
false
false
ecell/libmoleculizer
python-src/bngparser/src/moleculizer/moleculeinterpreter.py
1
6341
############################################################################### # BNGMZRConverter - A utility program for converting bngl input files to mzr # input files. # Copyright (C) 2007, 2008, 2009 The Molecular Sciences Institute # # Moleculizer is free software; you can redistribute it and/or modify # it under the terms of the GNU Lesser General Public License as published by # the Free Software Foundation; either version 3 of the License, or # (at your option) any later version. # # Moleculizer is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Lesser General Public License for more details. # # You should have received a copy of the GNU Lesser General Public License # along with Moleculizer; if not, write to the Free Software # Foundation, Inc., 59 Temple Place, Suite 330, Boston, MA 02111-1307 USA # # Original Author: # Nathan Addy, Scientific Programmer Email: [email protected] # The Molecular Sciences Institute Email: [email protected] # # ############################################################################### from moleculizermol import MoleculizerMol, MoleculizerSmallMol, MoleculizerModMol, isSmallMol, isModMol from util import DataUnifier from xmlobject import XmlObject import pdb # This class parses a Mols Block into a list of small-mols and big mols. # It also manages the list of modifications. class MoleculeDictionary: class DuplicateMolDefinitionException(Exception): pass class BadMolDefinitionException(Exception): pass listOfNullModifications = ["none"] def __init__(self, moleculeBlock, paramDict): self.rawMoleculeDefinitions = moleculeBlock[:] self.paramDict = paramDict self.registeredMoleculesDictionary = {} self.smallMolsDictionary = {} self.modMolsDictionary = {} self.initialize() def initialize(self): self.rawMoleculeDefinitions = DataUnifier( self.rawMoleculeDefinitions ) for line in self.rawMoleculeDefinitions: if isSmallMol(line): print "SM: %s" % line MoleculizerSmallMol(line) elif isModMol(line): print "MM: %s" % line MoleculizerModMol(line) else: print "'%s' is neither a ModMol nor a SmallMol, according to the isSmallMol and isModMol functions." % line raise "Hello" def parseMoleculeTypesLine(self, moleculeTypesLine): parsedMol = MoleculizerMol(moleculeTypesLine) parsedMolName = parsedMol.getName() if parsedMolName in self.registeredMoleculesDictionary.keys(): raise DuplicateMolDefinitionException("Error, molecule %s already defined in the MoleculeInterpreter" % parsedMolName) self.registeredMoleculesDictionary[parsedMolName] = parsedMol def getUniversalModificationList(self): return MoleculizerMol.modificationStates[:] def addModifications(self, parentElmt): for modification in self.getUniversalModificationList(): modificationTypeElmt = XmlObject("modification") modificationTypeElmt.addAttribute("name", modification) modificationTypeElmt.attachToParent(parentElmt) weightElmt = XmlObject("weight-delta") weightElmt.attachToParent(modificationTypeElmt) if self.representsNullModification(modification): weightDelta = 0.0 else: weightDelta = 1.0 weightElmt.addAttribute("daltons", weightDelta) def addMols(self, parentElmt): for molName in self.registeredMoleculesDictionary.keys(): self.addModMolElmtToMolsElmt(parentElmt, self.registeredMoleculesDictionary[molName]) def addModMolElmt(self, parentElmt): pass def addModMolElmtToMolsElmt(self, xmlObject, moleculizerMolObject): assert(isinstance(xmlObject, XmlObject)) assert(isinstance(moleculizerMolObject, MoleculizerMol)) newModMol = XmlObject("mod-mol") newModMol.addAttribute("name", moleculizerMolObject.getName()) weightElement = XmlObject("weight") # Obviously this is one of the big deficiencies of this thing. What shall # we set the (mandatory) weights to? For now, let's just put in something # arbitratry. But this is a big issue that ought to be fixed as soon as all # the basic facilities of the code have been built in. if moleculizerMolObject.getName() == "Pheromone": weightElement.addAttribute("daltons", 10.0) else: weightElement.addAttribute("daltons", 100.0) newModMol.addSubElement(weightElement) for binding in moleculizerMolObject.bindingSites: self.addBindingSiteElmtToModMolElmt(binding, moleculizerMolObject, newModMol) for modification in moleculizerMolObject.modificationSites: modSite, defaultModState = modification modSiteElmt = XmlObject("mod-site") modSiteElmt.addAttribute("name", modSite) defModRefElmt = XmlObject("default-mod-ref") defModRefElmt.addAttribute("name", defaultModState) defModRefElmt.attachToParent(modSiteElmt).attachToParent(newModMol) xmlObject.addSubElement(newModMol) return def addBindingSiteElmtToModMolElmt(self, bindingName, moleculizerMol, xmlObject): newBindingElmt = XmlObject("binding-site") newBindingElmt.addAttribute("name", bindingName) defaultShape = XmlObject("default-shape-ref") defaultShape.addAttribute("name", "default") defaultShape.attachToParent(newBindingElmt) for shapeName in moleculizerMol.bindingSites[bindingName]: siteShapeElmt = XmlObject("site-shape") siteShapeElmt.addAttribute("name", shapeName) siteShapeElmt.attachToParent(newBindingElmt) xmlObject.addSubElement(newBindingElmt) return def representsNullModification(self, modificationType): return modificationType.lower() in MoleculeDictionary.listOfNullModifications
gpl-2.0
4,373,819,553,800,396,000
37.664634
130
0.674972
false
4.04917
false
false
false
mpi-sws-rse/antevents-python
examples/event_library_comparison/event.py
1
8071
"""This version uses a traditional event-driven version, using continuation passing style. Each method call is passed a completion callback and an error callback """ from statistics import median import json import asyncio import random import time import hbmqtt.client from collections import deque from antevents.base import SensorEvent URL = "mqtt://localhost:1883" class RandomSensor: def __init__(self, sensor_id, mean=100.0, stddev=20.0, stop_after_events=None): self.sensor_id = sensor_id self.mean = mean self.stddev = stddev self.stop_after_events = stop_after_events if stop_after_events is not None: def generator(): for i in range(stop_after_events): yield round(random.gauss(mean, stddev), 1) else: # go on forever def generator(): while True: yield round(random.gauss(mean, stddev), 1) self.generator = generator() def sample(self): return self.generator.__next__() def __repr__(self): if self.stop_after_events is None: return 'RandomSensor(%s, mean=%s, stddev=%s)' % \ (self.sensor_id, self.mean, self.stddev) else: return 'RandomSensor(%s, mean=%s, stddev=%s, stop_after_events=%s)' % \ (self.sensor_id, self.mean, self.stddev, self.stop_after_events) class PeriodicMedianTransducer: """Emit an event once every ``period`` input events. The value is the median of the inputs received since the last emission. """ def __init__(self, period=5): self.period = period self.samples = [None for i in range(period)] self.events_since_last = 0 self.last_event = None # this is used in emitting the last event def step(self, v): self.samples[self.events_since_last] = v.val self.events_since_last += 1 if self.events_since_last==self.period: val = median(self.samples) event = SensorEvent(sensor_id=v.sensor_id, ts=v.ts, val=val) self.events_since_last = 0 return event else: self.last_event = v # save in case we complete before completing a period return None def complete(self): if self.events_since_last>0: # if we have some partial state, we emit one final event that # averages whatever we saw since the last emission. return SensorEvent(sensor_id=self.last_event.sensor_id, ts=self.last_event.ts, val=median(self.samples[0:self.events_since_last])) def csv_writer(evt): print("csv_writer(%s)" % repr(evt)) class MqttWriter: """All the processing is asynchronous. We ensure that a given send has completed and the callbacks called before we process the next one. """ def __init__(self, url, topic, event_loop): self.url = url self.topic = topic self.client = hbmqtt.client.MQTTClient(loop=event_loop) self.event_loop = event_loop self.connected = False self.pending_task = None self.request_queue = deque() def _to_message(self, msg): return bytes(json.dumps((msg.sensor_id, msg.ts, msg.val),), encoding='utf-8') def _request_done(self, f, completion_cb, error_cb): assert f==self.pending_task self.pending_task = None exc = f.exception() if exc: self.event_loop.call_soon(error_cb, exc) else: self.event_loop.call_soon(completion_cb) if len(self.request_queue)>0: self.event_loop.call_soon(self._process_queue) def _process_queue(self): assert self.pending_task == None assert len(self.request_queue)>0 (msg, completion_cb, error_cb) = self.request_queue.popleft() if msg is not None: print("send from queue: %s" % msg) self.pending_task = self.event_loop.create_task( self.client.publish(self.topic, msg) ) else: # None means that we wanted a disconnect print("disconnect") self.pending_task = self.event_loop.create_task( self.client.disconnect() ) self.pending_task.add_done_callback(lambda f: self._request_done(f, completion_cb, error_cb)) def send(self, msg, completion_cb, error_cb): if not self.connected: print("attempting connection") self.request_queue.append((self._to_message(msg), completion_cb, error_cb),) self.connected = True self.pending_task = self.event_loop.create_task(self.client.connect(self.url)) def connect_done(f): assert f==self.pending_task print("connected") self.pending_task = None self.event_loop.call_soon(self._process_queue) self.pending_task.add_done_callback(connect_done) elif self.pending_task: self.request_queue.append((self._to_message(msg), completion_cb, error_cb),) else: print("sending %s" % self._to_message(msg)) self.pending_task = self.event_loop.create_task( self.client.publish(self.topic, self._to_message(msg)) ) self.pending_task.add_done_callback(lambda f: self._request_done(f, completion_cb, error_cb)) def disconnect(self, completion_cb, error_cb, drop_queue=False): if not self.connected: return if len(self.request_queue)>0 and drop_queue: # for error situations self.request_queue = deque() if self.pending_task: self.request_queue.append((None, completion_cb, error_cb),) else: print("disconnecting") self.pending_task = self.event_loop.create_task( self.client.disconnect() ) self.pending_task.add_done_callback(lambda f: self._request_done(f, completion_cb, error_cb)) def sample_and_process(sensor, mqtt_writer, xducer, completion_cb, error_cb): try: sample = sensor.sample() except StopIteration: final_event = xducer.complete() if final_event: mqtt_writer.send(final_event, lambda: mqtt_writer.disconnect(lambda: completion_cb(False), error_cb), error_cb) else: mqtt_writer.disconnect(lambda: completion_cb(False), error_cb) return event = SensorEvent(sensor_id=sensor.sensor_id, ts=time.time(), val=sample) csv_writer(event) median_event = xducer.step(event) if median_event: mqtt_writer.send(median_event, lambda: completion_cb(True), error_cb) else: completion_cb(True) sensor = RandomSensor('sensor-2', stop_after_events=12) transducer = PeriodicMedianTransducer(5) event_loop = asyncio.get_event_loop() writer = MqttWriter(URL, sensor.sensor_id, event_loop) def loop(): def completion_cb(more): if more: event_loop.call_later(0.5, loop) else: print("all done, no more callbacks to schedule") event_loop.stop() def error_cb(e): print("Got error: %s" % e) event_loop.stop() event_loop.call_soon( lambda: sample_and_process(sensor, writer, transducer, completion_cb, error_cb) ) event_loop.call_soon(loop) event_loop.run_forever() print("that's all folks")
apache-2.0
4,810,702,886,399,499,000
37.251185
100
0.563127
false
4.031469
false
false
false
saikrishnar/vsm_preparer
scripts/quincontext.py
1
1778
#! /usr/bin/python import os def main(folder): #vectors = [] #f = open('../dictionary/vectors.txt') #for line in f: # representation = line.strip('\n') # vectors.append(representation) #f.close() for d, ds, fs in os.walk(folder): for fname in fs: if fname[-4:] != '.dur': continue fullfname = d + '/' + fname phone_array = [] dur_array = [] fr = open(fullfname) for line in fr: if line.split('\n')[0] == '#': continue [phone, dur] = line.rstrip('\n').split() phone_array.append(phone) dur_array.append(dur) fw = open(fullfname[:-4] + '.quindur', 'w') for i in range(2, len(dur_array) - 2 ): phoneme_2p = phone_array[i-2] #phoneme_2p_index = uniquephone_list.index(phoneme_2p) phoneme_1p = phone_array[i-1] #phoneme_1p_index = uniquephone_list.index(phoneme_1p) phoneme = phone_array[i] #phoneme_index = uniquephone_list.index(phoneme) phoneme_1n = phone_array[i+1] #phoneme_1n_index = uniquephone_list.index(phoneme_1n) phoneme_2n = phone_array[i+2] #phoneme_2n_index = uniquephone_list.index(phoneme_2n) duration = dur_array[i] fw.write( str(float(duration)) + ' ' + phoneme_2p + ' ' + phoneme_1p + ' ' + phoneme + ' ' + phoneme_1n + ' ' + phoneme_2n + '\n') fw.close() fr.close() if __name__ == '__main__': folder = '../lab' main(folder)
gpl-2.0
4,492,283,820,192,578,000
34.56
151
0.45838
false
3.493124
false
false
false
Eksmo/calibre
src/calibre/gui2/viewer/position.py
1
1815
#!/usr/bin/env python # vim:fileencoding=UTF-8:ts=4:sw=4:sta:et:sts=4:ai from __future__ import (unicode_literals, division, absolute_import, print_function) __license__ = 'GPL v3' __copyright__ = '2012, Kovid Goyal <[email protected]>' __docformat__ = 'restructuredtext en' import json class PagePosition(object): def __init__(self, document): self.document = document @property def viewport_cfi(self): ans = None res = self.document.mainFrame().evaluateJavaScript(''' ans = 'undefined'; if (window.paged_display) { ans = window.paged_display.current_cfi(); if (!ans) ans = 'undefined'; } ans; ''') if res.isValid() and not res.isNull() and res.type() == res.String: c = unicode(res.toString()) if c != 'undefined': ans = c return ans def scroll_to_cfi(self, cfi): if cfi: cfi = json.dumps(cfi) self.document.mainFrame().evaluateJavaScript( 'paged_display.jump_to_cfi(%s)'%cfi) @property def current_pos(self): ans = self.viewport_cfi if not ans: ans = self.document.scroll_fraction return ans def __enter__(self): self.save() def __exit__(self, *args): self.restore() def save(self): self._cpos = self.current_pos def restore(self): if self._cpos is None: return self.to_pos(self._cpos) self._cpos = None def to_pos(self, pos): if isinstance(pos, (int, float)): self.document.scroll_fraction = pos else: self.scroll_to_cfi(pos) def set_pos(self, pos): self._cpos = pos
gpl-3.0
-6,051,221,796,672,716,000
24.928571
75
0.534986
false
3.659274
false
false
false
openego/oeplatform
modelview/migrations/0022_auto_20160303_2233.py
1
1468
# -*- coding: utf-8 -*- # Generated by Django 1.9 on 2016-03-03 21:33 from __future__ import unicode_literals from django.db import migrations, models class Migration(migrations.Migration): dependencies = [("modelview", "0021_auto_20160303_2233")] operations = [ migrations.AlterField( model_name="energymodel", name="model_file_format", field=models.CharField( choices=[ (".exe", ".exe"), (".gms", ".gms"), (".py", ".py"), (".xls", ".xls"), ("other", "other"), ], default="other", help_text="In which format is the model saved?", max_length=5, verbose_name="Model file format", ), ), migrations.AlterField( model_name="energymodel", name="model_input", field=models.CharField( choices=[ (".csv", ".csv"), (".py", ".py"), ("text", "text"), (".xls", ".xls"), ("other", "other"), ], default="other", help_text="Of which file format are the input and output data?", max_length=5, verbose_name="Input/output data file format", ), ), ]
agpl-3.0
-647,503,568,038,892,000
30.234043
80
0.419619
false
4.781759
false
false
false
AjabWorld/ajabsacco
ajabsacco/core/facades/loans/transactions.py
1
8484
from ajabsacco.core.models import ( LoanTransactionEntry, LoanProduct, LoanAccount, Message as SMSMessage, ) from decimal import Decimal as D from django.db.models import Q, Sum, F from django.utils import timezone from django.db import transaction as db_transaction from ajabsacco.core import codes from ajabsacco.core.sms import templates from ajabsacco.core.utils import record_log, month_delta from ajabsacco.core.exceptions import * import ledger as ledger_facades from ajabsacco.core.facades import transactions as transaction_facades from ajabsacco.core.facades.loans import validations as validation_facades import logging logger = logging.getLogger('core.ajabsacco.loans') import uuid def allocate_repayment(loan_account, amount, *args, **kwargs): with db_transaction.atomic(): fee_accrued = ledger_facades.loan_account_fees_due(loan_account) penalties_accrued = ledger_facades.loan_account_penalties_due(loan_account) interest_accrued = ledger_facades.loan_account_interest_due(loan_account) principal_accrued = ledger_facades.loan_account_principal_due(loan_account) #1. Align the order we will deduct the accruals accruals = { LoanProduct.ALLOCATION_CHOICE_FEE: (fee_accrued or D('0.0'), post_loan_fee), LoanProduct.ALLOCATION_CHOICE_PENALTY: (penalties_accrued or D('0.0'), post_penalty_fee), LoanProduct.ALLOCATION_CHOICE_INTEREST: (interest_accrued or D('0.0'), post_loan_interest), } amount = (amount or 0) #get a sum of all accruals total_accruals = sum(i[0] for i in accruals.values()) #Ensure we have sane values if (amount > 0) and (principal_accrued > 0): transaction_id = uuid.uuid4() #setup allocation balance, to help us check to total allocation allocation_balance = amount if total_accruals > 0: items_allocated = 0 #Loop through the allocation order for allocation_item in LoanProduct.ALLOCATION_ORDER: #Loop through all the accruals we are expecting to collect for accrued_item, allocation_tuple in accruals.iteritems(): #put aside the variables from the turple accrued_amount, transaction_func = allocation_tuple #if allocation item is equal to accrued item code, and accrued amount is more than 1 #Check to ensure we do not get to negative numbers if (allocation_item == accrued_item) and (accrued_amount > 0) and (allocation_balance > 0): #if amount accrued is sizable, deduct transaction_func(loan_account, accrued_amount, transaction_id=transaction_id) #stamp new allocation items_allocated += 1 #deduct amount posted from balance allocation_balance -= accrued_amount post_loan_principal( loan_account, allocation_balance, transaction_id=transaction_id ) loan_account.last_repayment_date = timezone.now() loan_account.save() else: logger.debug("amount: %s and total_accruals %s" % (amount, total_accruals)) raise AmountNotSufficientException() def apply_accruals(loan_account, approved_by=None): with db_transaction.atomic(): date_disbursed = loan_account.date_disbursed if date_disbursed is None: raise ActionOnUndisbursedLoanException( "You cannot apply accruals on Un-disbursed Loan %s" % loan_account.account_number) date_today = timezone.now() month_diff = month_delta(date_disbursed, date_today, days_of_the_month=30) grace_period = loan_account.grace_period grace_period_type = loan_account.product.grace_period_type within_grace_period = ((month_diff - grace_period) < 1) within_repayment_period = ((month_diff - loan_account.repayment_period) < 1) if (not grace_period == 0): if (within_grace_period): if (grace_period_type == LoanProduct.FULL_GRACE_PERIOD): #No need to proceed, we don't want to accrue anything interest_due = 0 elif (grace_period_type == LoanProduct.PRINCIPAL_GRACE_PERIOD): principal_due = loan_account.amount interest_due = ( (principal_due * loan_account.interest_rate) / loan_account.repayment_period ) else: if within_repayment_period: principal_due = ledger_facades.loan_account_principal_due(loan_account) interest_due = ( (principal_due * (loan_account.interest_rate / D('100.0'))) / loan_account.repayment_period ) if interest_due > 0: apply_interest_to_account(loan_account, interest_due) def disburse_loan(loan_account, *args, **kwargs): with db_transaction.atomic(): validation_facades.validate_disbursement(loan_account) debit_entry, credit_entry = transaction_facades.create_transaction( LoanTransactionEntry, loan_account, loan_account.amount, transaction_type=codes.TRANSACTION_TYPE_LOAN_DISBURSAL, *args, **kwargs ) loan_account.status = LoanAccount.ACTIVE loan_account.date_disbursed = timezone.now() loan_account.save() return (debit_entry, credit_entry) def apply_interest_to_account(loan_account, amount, *args, **kwargs): return transaction_facades.create_transaction(LoanTransactionEntry, loan_account, amount, transaction_type=codes.TRANSACTION_TYPE_INTEREST_APPLY, *args, **kwargs) def apply_fee_to_account(loan_account, amount, *args, **kwargs): return transaction_facades.create_transaction(LoanTransactionEntry, loan_account, amount, transaction_type=codes.TRANSACTION_TYPE_FEE_APPLY, *args, **kwargs) def apply_penalty_to_account(loan_account, amount, *args, **kwargs): return transaction_facades.create_transaction(LoanTransactionEntry, loan_account, amount, transaction_type=codes.TRANSACTION_TYPE_PENALTY_APPLY, *args, **kwargs) def write_off_loan_principal(loan_account, amount, *args, **kwargs): return transaction_facades.create_transaction(LoanTransactionEntry, loan_account, amount, transaction_type=codes.TRANSACTION_TYPE_PRINCIPAL_WRITE_OFF, *args, **kwargs) def write_off_loan_interest(loan_account, amount, *args, **kwargs): return transaction_facades.create_transaction(LoanTransactionEntry, loan_account, amount, transaction_type=codes.TRANSACTION_TYPE_INTEREST_WRITE_OFF, *args, **kwargs) def write_off_loan_penalty(loan_account, amount, *args, **kwargs): return transaction_facades.create_transaction(LoanTransactionEntry, loan_account, amount, transaction_type=codes.TRANSACTION_TYPE_PENALTY_WRITE_OFF, *args, **kwargs) def write_off_loan_fee(loan_account, amount, *args, **kwargs): return transaction_facades.create_transaction(LoanTransactionEntry, loan_account, amount, transaction_type=codes.TRANSACTION_TYPE_FEE_WRITE_OFF, *args, **kwargs) def post_loan_principal(loan_account, amount, *args, **kwargs): return transaction_facades.create_transaction(LoanTransactionEntry, loan_account, amount, transaction_type=codes.TRANSACTION_TYPE_PRINCIPAL_POSTING, *args, **kwargs) def post_loan_interest(loan_account, amount, *args, **kwargs): return transaction_facades.create_transaction(LoanTransactionEntry, loan_account, amount, transaction_type=codes.TRANSACTION_TYPE_INTEREST_POSTING, *args, **kwargs) def post_loan_fee(loan_account, amount, *args, **kwargs): return transaction_facades.create_transaction(LoanTransactionEntry, loan_account, amount, transaction_type=codes.TRANSACTION_TYPE_FEE_POSTING, *args, **kwargs) def post_penalty_fee(loan_account, amount, *args, **kwargs): return transaction_facades.create_transaction(LoanTransactionEntry, loan_account, amount, transaction_type=codes.TRANSACTION_TYPE_PENALTY_POSTING, *args, **kwargs)
apache-2.0
3,779,830,831,397,354,500
45.360656
115
0.658298
false
3.649032
false
false
false
ArcherSys/ArcherSys
Lib/test/reperf.py
1
1754
<<<<<<< HEAD <<<<<<< HEAD import re import time def main(): s = "\13hello\14 \13world\14 " * 1000 p = re.compile(r"([\13\14])") timefunc(10, p.sub, "", s) timefunc(10, p.split, s) timefunc(10, p.findall, s) def timefunc(n, func, *args, **kw): t0 = time.perf_counter() try: for i in range(n): result = func(*args, **kw) return result finally: t1 = time.perf_counter() if n > 1: print(n, "times", end=' ') print(func.__name__, "%.3f" % (t1-t0), "CPU seconds") main() ======= import re import time def main(): s = "\13hello\14 \13world\14 " * 1000 p = re.compile(r"([\13\14])") timefunc(10, p.sub, "", s) timefunc(10, p.split, s) timefunc(10, p.findall, s) def timefunc(n, func, *args, **kw): t0 = time.perf_counter() try: for i in range(n): result = func(*args, **kw) return result finally: t1 = time.perf_counter() if n > 1: print(n, "times", end=' ') print(func.__name__, "%.3f" % (t1-t0), "CPU seconds") main() >>>>>>> b875702c9c06ab5012e52ff4337439b03918f453 ======= import re import time def main(): s = "\13hello\14 \13world\14 " * 1000 p = re.compile(r"([\13\14])") timefunc(10, p.sub, "", s) timefunc(10, p.split, s) timefunc(10, p.findall, s) def timefunc(n, func, *args, **kw): t0 = time.perf_counter() try: for i in range(n): result = func(*args, **kw) return result finally: t1 = time.perf_counter() if n > 1: print(n, "times", end=' ') print(func.__name__, "%.3f" % (t1-t0), "CPU seconds") main() >>>>>>> b875702c9c06ab5012e52ff4337439b03918f453
mit
-53,206,256,789,101,470
22.386667
61
0.513683
false
2.819936
false
false
false
rr-/ida-images
rgb-ida.py
1
3099
import idaapi import librgb from librgb.qt_shims import QtGui # important for PySide legacy IDA from librgb.qt_shims import QtWidgets try: MAJOR, MINOR = map(int, idaapi.get_kernel_version().split(".")) except AttributeError: MAJOR, MINOR = 6, 6 USING_IDA7API = MAJOR > 6 USING_PYQT5 = USING_IDA7API or (MAJOR == 6 and MINOR >= 9) class DockableShim(object): def __init__(self, title): self._title = title # IDA 7+ Widgets if USING_IDA7API: import sip self._form = idaapi.create_empty_widget(self._title) self.widget = sip.wrapinstance(long(self._form), QtWidgets.QWidget) # legacy IDA PluginForm's else: self._form = idaapi.create_tform(self._title, None) if USING_PYQT5: self.widget = idaapi.PluginForm.FormToPyQtWidget(self._form) else: self.widget = idaapi.PluginForm.FormToPySideWidget(self._form) def show(self): if USING_IDA7API: flags = ( idaapi.PluginForm.WOPN_TAB | idaapi.PluginForm.WOPN_MENU | idaapi.PluginForm.WOPN_RESTORE | idaapi.PluginForm.WOPN_PERSIST ) idaapi.display_widget(self._form, flags) # legacy IDA PluginForm's else: flags = ( idaapi.PluginForm.FORM_TAB | idaapi.PluginForm.FORM_MENU | idaapi.PluginForm.FORM_RESTORE | idaapi.PluginForm.FORM_PERSIST | 0x80 ) # idaapi.PluginForm.FORM_QWIDGET idaapi.open_tform(self._form, flags) class ImagePreviewPlugin(idaapi.plugin_t): flags = 0 wanted_name = "Image previewer" wanted_hotkey = "Alt + I" comment = "Preview memory as image" help = "https://github.com/rr-/ida-images" def init(self): return idaapi.PLUGIN_OK def term(self): pass def run(self, arg): class IdaWindowAdapter(librgb.GenericWindowAdapter): def ask_address(self, address): return AskAddr(address, "Please enter an address") def ask_file(self): return AskFile(1, "*.png", "Save the image as...") image_preview_form = DockableShim("Image preview") params = librgb.RendererParams() params.readers = [librgb.MemoryReader()] params.format = librgb.PixelFormats.GRAY8 params.width = 800 params.height = 600 params.flip = False params.brightness = 50 adapter = IdaWindowAdapter(params) shortcut_manager = librgb.ShortcutManager(adapter, params) for shortcut, func in shortcut_manager.shortcuts.items(): adapter.define_shortcut(shortcut, image_preview_form.widget, func) layout = adapter.create_layout() image_preview_form.widget.setLayout(layout) adapter.draw() image_preview_form.show() def PLUGIN_ENTRY(): return ImagePreviewPlugin() if __name__ == "__main__": ImagePreviewPlugin().run(0)
mit
-2,430,317,480,103,620,600
29.683168
79
0.595999
false
3.663121
false
false
false
zencore-dobetter/zencore-utils
src/zencore/utils/redis.py
1
3995
import uuid import math import time import logging import redis as engine from zencore.errors import WrongParameterTypeError from .types import smart_force_to_string logger = logging.getLogger(__name__) class RedisLock(object): def __init__(self, url, name=None, app_name=None, expire=None, prefix="zencore:lock:", tick=5, **kwargs): self.url = url self.connection = engine.Redis.from_url(url, **kwargs) self.app_name = app_name or str(uuid.uuid4()) self.prefix = prefix self.expire = expire self.tick = tick if name: self.setup(name) def setup(self, name): self.lock_name = ":".join([self.prefix, name]) self.signal_name = ":".join([self.prefix, name, "signal"]) def acquire(self, blocking=True, timeout=-1): stime = time.clock() while True: result = self.acquire_nowait() if result: return True if not blocking: return False if timeout == 0: return False if timeout > 0: delta = math.ceil(timeout - (time.clock() - stime)) if delta < 0: return False if delta > self.tick: delta = self.tick else: delta = self.tick event = self.connection.blpop(self.signal_name, timeout=delta) if event is None: return False def acquire_nowait(self): result = self.connection.setnx(self.lock_name, self.app_name) if result: if self.expire: self.connection.expire(self.lock_name, self.expire) self.connection.delete(self.signal_name) return True return False def release(self): if self.is_lock_owner(): self.connection.delete(self.lock_name) self.connection.rpush(self.signal_name, 1) def force_clean(self): self.connection.delete(self.lock_name) self.connection.rpush(self.signal_name, 1) def get_current_lock_owner(self, ): return smart_force_to_string(self.connection.get(self.lock_name)) def is_lock_owner(self): return self.get_current_lock_owner() == self.app_name class Counter(object): def __init__(self, connection, namespace): self.connection = connection self.namespace = namespace def incr(self, name): key = self.make_counter_key(name) self.connection.incr(key) def get(self, name): key = self.make_counter_key(name) return int(self.connection.get(key)) def getall(self): keys = self.connection.keys(self.make_counter_pattern()) if not keys: return {} keys = [key.decode("utf-8") for key in keys] values = [int(value) for value in self.connection.mget(*keys)] return dict(zip(keys, values)) def make_counter_key(self, name): return "{}:{}".format(self.namespace, name) def make_counter_pattern(self): return "{}:*".format(self.namespace) def get_redis(config): """ 从配置文件获取redis对象。 """ if isinstance(config, engine.StrictRedis): return config if isinstance(config, str): return engine.Redis.from_url(config) if isinstance(config, dict): url = config.get("url") host = config.get("host") if url: db = config.get("db", None) options = config.get("options", {}) return engine.Redis.from_url(url, db, **options) if host: return engine.Redis(**config) logger.error("get_redis got wrong parameter type error.") raise WrongParameterTypeError() # ########################################################################### # 重复或不推荐使用 # ########################################################################### make_redis_instance = get_redis
mit
3,164,183,319,776,613,000
29.929688
109
0.558474
false
3.9749
true
false
false
p/webracer
tests/request_via_form_test.py
1
1451
import webracer import nose.plugins.attrib from . import utils from .apps import form_app utils.app_runner_setup(__name__, form_app.app, 8059) @nose.plugins.attrib.attr('client') @webracer.config(host='localhost', port=8059) class RequestViaFormTest(webracer.WebTestCase): def test_get_form_as_url(self): self.get('/method_check_form') self.assert_status(200) form = self.response.form() self.get(form) self.assertEqual('GET', self.response.body) def test_post_form_as_url(self): self.get('/textarea') self.assert_status(200) form = self.response.form() self.post(form) self.assertEqual('{}', self.response.body) def test_post_form_with_elements(self): self.get('/textarea') self.assert_status(200) form = self.response.form() elements = form.elements self.post(form, elements) json = self.response.json self.assertEqual(dict(field='hello world'), json) def test_post_form_with_mutated_elements(self): self.get('/textarea') self.assert_status(200) form = self.response.form() elements = form.elements.mutable elements.set_value('field', 'changed') self.post(form, elements) json = self.response.json self.assertEqual(dict(field='changed'), json)
bsd-2-clause
4,729,082,334,174,765,000
28.02
57
0.598897
false
3.818421
true
false
false
Ichag/django-timelinejs3
timeline/migrations/0009_auto_20150819_0648.py
1
3020
# -*- coding: utf-8 -*- from __future__ import unicode_literals from django.db import models, migrations class Migration(migrations.Migration): dependencies = [ ('timeline', '0008_auto_20150818_2241'), ] operations = [ migrations.AlterField( model_name='options', name='duration', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='height', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='marker_height_min', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='marker_padding', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='marker_width_min', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='menubar_height', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='optimal_tick_width', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='scale_factor', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='skinny_size', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='slide_default_fade', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='slide_padding_lr', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='start_at_slide', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='timenav_height', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='timenav_height_min', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='timenav_height_percentage', field=models.IntegerField(null=True, blank=True), ), migrations.AlterField( model_name='options', name='width', field=models.IntegerField(null=True, blank=True), ), ]
bsd-3-clause
4,725,792,827,878,784,000
31.12766
61
0.54404
false
4.596651
false
false
false
whiteshield/EHScripter
EHScripter/netsparker.py
1
6143
##!/usr/bin/env python3 # -*- coding: utf-8 -*- import os import sys import re import string from io import StringIO from lxml import etree try: from .util import * except Exception as e: from util import * class NetsparkerToMarkdown: def __init__(self, options): self.options=options self.template=string.Template(self.options['template']) if self.options['merge']: self.template=string.Template(self.options['merge_template']) self.merge_findinglist_template=string.Template(self.options['merge_findinglist_template']) self.process() def process(self): if not os.path.exists(self.options['output_dir']): os.makedirs(self.options['output_dir']) filelist=[] if os.path.isfile(self.options['load_file']): filelist.append(self.options['load_file']) elif os.path.isdir(self.options['load_file']): for name in os.listdir(self.options["load_file"]): if os.path.isfile(self.options['load_file']+'/'+name) and len(name)>11 and name[-11:]==".netsparker": filelist.append(self.options["load_file"]+'/'+name) counter=1 findings={} for processfile in filelist: content=open(processfile).read() fileparts=content.split('<!-- Vulnerability Details -->') vulns=fileparts[1].split('<h1') fullparser=etree.HTMLParser() fullhtml=etree.parse(StringIO(content), fullparser) Target=self.attrib(fullhtml.xpath("//span[@class='dashboard-url']/a"),'href','N/A') for vuln in vulns[1:]: vuln='<h1'+vuln parser=etree.HTMLParser() vulnobj=etree.parse(StringIO(vuln), parser) h1=self.value(vulnobj.xpath('//h1//text()'),'N/A') Vulnerability=re.sub(r'\d+\\\. ','',h1) Risk=self.value(vulnobj.xpath("//div[@class='vuln-block']/div[2]//text()"),'N/A').title() VulnDesc=self.value(vulnobj.xpath("//div[@class='vulndesc']//text()"),'N/A') if Risk=='Information': Risk='Info' if Risk=='Important': Risk='High' VulnDetails=vulnobj.xpath("//div[@class='vulnerability-detail']") for VulnDetail in VulnDetails: h2=self.value(VulnDetail.xpath('./div/h2//text()'),'N/A') SubVulnerability=re.sub(r'\d+\.\d+\. ','',h2) Link=self.attrib(VulnDetail.xpath('./div/div[2]/a'),'href','N/A') ParamTableRows=VulnDetail.xpath('./div/table//tr') lines=0; ParamTable='' for ParamTableRow in ParamTableRows: ParamTableCells=ParamTableRow.xpath('./td') cells=0 for ParamTableCell in ParamTableCells: cell=self.value(ParamTableCell.xpath('.//text()'),'N/A').strip() ParamTable+='| %s '%cell cells+=1 ParamTable='%s|\n'%ParamTable if lines==0: sepstr='' for i in range(0,cells): sepstr+='| ------- ' sepstr='%s|\n'%sepstr ParamTable+=sepstr lines+=1 d={'Target':Target, 'Vulnerability':Vulnerability, 'Risk':Risk, 'VulnDesc':VulnDesc, 'SubVulnerability':SubVulnerability, 'Link':Link, 'ParamTable':ParamTable,'findinglist':''} if not self.options['merge']: dirname=slugify('%s-%s-%s-%04d-netsparker'%(Risk, Target, Vulnerability, counter)) if not os.path.exists(self.options['output_dir']+'/'+dirname): os.makedirs(self.options['output_dir']+'/'+dirname) counter+=1 temp=self.template text=temp.substitute(d) if self.options['result_overwrite'] or (not os.path.exists(self.options['output_dir']+'/'+dirname+'/document.md')): tmpfile = open(self.options['output_dir']+'/'+dirname+'/document.md', 'w'); tmpfile.write(text) tmpfile.close() else : slug=slugify('%s-%s-netsparker'%(Risk, Vulnerability)) if not findings.get(slug): findings[slug]=[] findings[slug].append(d) for key, values in findings.items(): findinglist = '' for d in values: d['VulnDesc']=d['VulnDesc'].replace('$','$$') d['ParamTable']=d['ParamTable'].replace('$','$$') d['Link']=d['Link'].replace('$','$$') temp=self.merge_findinglist_template text=temp.substitute(d) findinglist+=text+"\n\n" d['findinglist']=findinglist filename=key+".md"; temp=self.template text=temp.substitute(d) if self.options['result_overwrite'] or (not os.path.exists(self.options['output_dir']+'/'+filename)): tmpfile = open(self.options['output_dir']+'/'+filename, 'w'); tmpfile.write(text) tmpfile.close() def value(self, x, default): try: #ret=x[0].strip() ret="\n".join([html2markdown(html2markdown(y.strip(), True)) for y in x]) except Exception as e: try: ret=x.strip() except Exception as ee: ret=default return ret def attrib(self, x, attr, default): try: ret=x[0].attrib[attr] except Exception as e: try: ret=x.attrib[attr] except Exception as ee: ret=default return ret
gpl-2.0
4,605,033,301,372,981,000
44.503704
196
0.496988
false
4.122819
false
false
false
swcurran/tfrs
backend/api/models/UserViewModel.py
1
1507
""" REST API Documentation for the NRS TFRS Credit Trading Application The Transportation Fuels Reporting System is being designed to streamline compliance reporting for transportation fuel suppliers in accordance with the Renewable & Low Carbon Fuel Requirements Regulation. OpenAPI spec version: v1 Licensed under the Apache License, Version 2.0 (the "License"); you may not use this file except in compliance with the License. You may obtain a copy of the License at http://www.apache.org/licenses/LICENSE-2.0 Unless required by applicable law or agreed to in writing, software distributed under the License is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the License for the specific language governing permissions and limitations under the License. """ from django.db import models class UserViewModel(models.Model): given_name = models.CharField(max_length=255, blank=True, null=True) surname = models.CharField(max_length=255, blank=True, null=True) email = models.CharField(max_length=255, blank=True, null=True) active = models.BooleanField() sm_authorization_id = models.CharField(max_length=255, blank=True, null=True) user_roles = models.ManyToManyField('UserRole', related_name='UserViewModeluser_roles', blank=True) class Meta: abstract = True
apache-2.0
9,088,370,143,756,785,000
40.861111
208
0.704048
false
4.406433
false
false
false
vanesa/kid-o
kido/admin/utils.py
1
3921
# -*- coding: utf-8 -*- """ Flask-Admin utilities.""" from flask import abort, redirect, request, url_for from flask_admin import AdminIndexView, expose from flask_admin.base import MenuLink from flask_admin.contrib.sqla import ModelView from flask_login import current_user from functools import wraps from kido import app from kido.constants import PERMISSION_ADMIN def admin_required(f): @wraps(f) def decorated(*args, **kwargs): if not current_user.is_authenticated: return redirect(url_for("views.general.login", next=request.url)) users_permissions = current_user.permissions if PERMISSION_ADMIN not in users_permissions: app.logger.debug("Not an admin") abort(404) return f(*args, **kwargs) return decorated def permission_required(permissions): if not isinstance(permissions, (list, set, tuple)): permissions = [permissions] permissions = [x.upper() for x in permissions] def decorator(method): @wraps(method) def f(*args, **kwargs): if not current_user.is_authenticated: return redirect(url_for("views.general.login", next=request.url)) users_permissions = current_user.permissions if PERMISSION_ADMIN not in users_permissions: for permission in permissions: if permission not in users_permissions: app.logger.debug("Missing permission: {0}".format(permission)) abort(404) return method(*args, **kwargs) return f return decorator class AuthenticatedMenuLink(MenuLink): def is_accessible(self): return current_user.is_authenticated class CustomAdminIndexView(AdminIndexView): extra_css = None extra_js = None @expose("/") @admin_required def index(self): if not current_user.is_authenticated: return redirect(url_for("views.general.login", next=request.url)) return super(CustomAdminIndexView, self).index() @expose("/login/") def login_view(self): return redirect(url_for("views.general.login", next=request.url)) @expose("/logout/") def logout_view(self): return redirect("/logout") class CustomModelView(ModelView): page_size = 50 extra_css = None extra_js = None action_template = "admin/action.html" edit_template = "admin/model/edit.html" create_template = "admin/model/create.html" list_template = "admin/model/custom_list.html" _include = None class_attributes = [ "page_size", "can_create", "can_edit", "can_delete", "column_searchable_list", "column_filters", "column_exclude_list", "column_default_sort", ] def __init__(self, *args, **kwargs): if "exclude" in kwargs: self.form_excluded_columns = kwargs["exclude"] del kwargs["exclude"] if "include" in kwargs: self._include = kwargs["include"] del kwargs["include"] for item in self.class_attributes: if item in kwargs: setattr(self, item, kwargs[item]) del kwargs[item] super(CustomModelView, self).__init__(*args, **kwargs) def get_list_columns(self): if self._include: return self.get_column_names( only_columns=self.scaffold_list_columns() + self._include, excluded_columns=self.column_exclude_list, ) return super(CustomModelView, self).get_list_columns() def is_accessible(self): if not current_user.is_authenticated: return False users_permissions = current_user.permissions return PERMISSION_ADMIN in users_permissions def inaccessible_callback(self, name, **kwargs): return abort(404)
bsd-3-clause
-352,002,768,738,183,740
28.931298
86
0.61872
false
4.193583
false
false
false
eepgwde/pyeg0
gmus/GMus0.py
1
1699
## @file GMus0.py # @brief Application support class for the Unofficial Google Music API. # @author weaves # # @details # This class uses @c gmusicapi. # # @note # An application support class is one that uses a set of driver classes # to provide a set of higher-level application specific methods. # # @see # https://github.com/simon-weber/Unofficial-Google-Music-API # http://unofficial-google-music-api.readthedocs.org/en/latest/ from __future__ import print_function from GMus00 import GMus00 import logging import ConfigParser, os, logging import pandas as pd import json from gmusicapi import Mobileclient ## Set of file paths for the configuration file. paths = ['site.cfg', os.path.expanduser('~/share/site/.safe/gmusic.cfg')] ## Google Music API login, search and result cache. # # The class needs to a configuration file with these contents. (The # values of the keys must be a valid Google Play account.) # # <pre> # [credentials] # username=username\@gmail.com # password=SomePassword9 # </pre> class GMus0(GMus00): ## Ad-hoc method to find the indices of duplicated entries. def duplicated(self): # self._df = self._df.sort(['album', 'title', 'creationTimestamp'], # ascending=[1, 1, 0]) df = self.df[list(['title', 'album', 'creationTimestamp'])] df['n0'] = df['title'] + '|' + df['album'] df = df.sort(['n0','creationTimestamp'], ascending=[1, 0]) # Only rely on counts of 2. s0 = pd.Series(df.n0) s1 = s0.value_counts() s2 = set( (s1[s1.values >= 2]).index ) df1 = df[df.n0.isin(s2)] df1['d'] = df1.duplicated('n0') s3 = list(df1[df1.d].index) return s3
gpl-3.0
6,076,076,360,128,342,000
30.462963
74
0.656857
false
3.23619
false
false
false
mdmueller/ascii-profiling
parallel.py
1
4245
import timeit import time from astropy.io import ascii import pandas import numpy as np from astropy.table import Table, Column from tempfile import NamedTemporaryFile import random import string import matplotlib.pyplot as plt import webbrowser def make_table(table, size=10000, n_floats=10, n_ints=0, n_strs=0, float_format=None, str_val=None): if str_val is None: str_val = "abcde12345" cols = [] for i in xrange(n_floats): dat = np.random.uniform(low=1, high=10, size=size) cols.append(Column(dat, name='f{}'.format(i))) for i in xrange(n_ints): dat = np.random.randint(low=-9999999, high=9999999, size=size) cols.append(Column(dat, name='i{}'.format(i))) for i in xrange(n_strs): if str_val == 'random': dat = np.array([''.join([random.choice(string.letters) for j in range(10)]) for k in range(size)]) else: dat = np.repeat(str_val, size) cols.append(Column(dat, name='s{}'.format(i))) t = Table(cols) if float_format is not None: for col in t.columns.values(): if col.name.startswith('f'): col.format = float_format t.write(table.name, format='ascii') output_text = [] def plot_case(n_floats=10, n_ints=0, n_strs=0, float_format=None, str_val=None): global table1, output_text n_rows = (10000, 20000, 50000, 100000, 200000) # include 200000 for publish run numbers = (1, 1, 1, 1, 1) repeats = (3, 2, 1, 1, 1) times_fast = [] times_fast_parallel = [] times_pandas = [] for n_row, number, repeat in zip(n_rows, numbers, repeats): table1 = NamedTemporaryFile() make_table(table1, n_row, n_floats, n_ints, n_strs, float_format, str_val) t = timeit.repeat("ascii.read(table1.name, format='basic', guess=False, use_fast_converter=True)", setup='from __main__ import ascii, table1', number=number, repeat=repeat) times_fast.append(min(t) / number) t = timeit.repeat("ascii.read(table1.name, format='basic', guess=False, parallel=True, use_fast_converter=True)", setup='from __main__ import ascii, table1', number=number, repeat=repeat) times_fast_parallel.append(min(t) / number) t = timeit.repeat("pandas.read_csv(table1.name, sep=' ', header=0)", setup='from __main__ import table1, pandas', number=number, repeat=repeat) times_pandas.append(min(t) / number) plt.loglog(n_rows, times_fast, '-or', label='io.ascii Fast-c') plt.loglog(n_rows, times_fast_parallel, '-og', label='io.ascii Parallel Fast-c') plt.loglog(n_rows, times_pandas, '-oc', label='Pandas') plt.grid() plt.legend(loc='best') plt.title('n_floats={} n_ints={} n_strs={} float_format={} str_val={}'.format( n_floats, n_ints, n_strs, float_format, str_val)) plt.xlabel('Number of rows') plt.ylabel('Time (sec)') img_file = 'graph{}.png'.format(len(output_text) + 1) plt.savefig(img_file) plt.clf() text = 'Pandas to io.ascii Fast-C speed ratio: {:.2f} : 1<br/>'.format(times_fast[-1] / times_pandas[-1]) text += 'io.ascii parallel to Pandas speed ratio: {:.2f} : 1'.format(times_pandas[-1] / times_fast_parallel[-1]) output_text.append((img_file, text)) plot_case(n_floats=10, n_ints=0, n_strs=0) plot_case(n_floats=10, n_ints=10, n_strs=10) plot_case(n_floats=10, n_ints=10, n_strs=10, float_format='%.4f') plot_case(n_floats=10, n_ints=0, n_strs=0, float_format='%.4f') plot_case(n_floats=0, n_ints=0, n_strs=10) plot_case(n_floats=0, n_ints=0, n_strs=10, str_val="'asdf asdfa'") plot_case(n_floats=0, n_ints=0, n_strs=10, str_val="random") plot_case(n_floats=0, n_ints=10, n_strs=0) html_file = open('out.html', 'w') html_file.write('<html><head><meta charset="utf-8"/><meta content="text/html;charset=UTF-8" http-equiv="Content-type"/>') html_file.write('</html><body><h1 style="text-align:center;">Profile of io.ascii</h1>') for img, descr in output_text: html_file.write('<img src="{}"><p style="font-weight:bold;">{}</p><hr>'.format(img, descr)) html_file.write('</body></html>') html_file.close() webbrowser.open('out.html')
mit
-9,088,434,750,835,889,000
45.141304
122
0.623793
false
2.983134
false
false
false
patriciohc/carga-de-xls-a-MySQL
Choose_file.py
1
3639
# -*- coding: utf-8 -*- # Form implementation generated from reading ui file 'Choose_file.ui' # # Created: Sat Oct 17 15:55:19 2015 # by: PyQt4 UI code generator 4.10.4 # # WARNING! All changes made in this file will be lost! from PyQt4 import QtCore, QtGui try: _fromUtf8 = QtCore.QString.fromUtf8 except AttributeError: def _fromUtf8(s): return s try: _encoding = QtGui.QApplication.UnicodeUTF8 def _translate(context, text, disambig): return QtGui.QApplication.translate(context, text, disambig, _encoding) except AttributeError: def _translate(context, text, disambig): return QtGui.QApplication.translate(context, text, disambig) class Ui_MainWindow(object): def setupUi(self, MainWindow): MainWindow.setObjectName(_fromUtf8("MainWindow")) MainWindow.resize(524, 146) self.centralwidget = QtGui.QWidget(MainWindow) self.centralwidget.setObjectName(_fromUtf8("centralwidget")) self.verticalLayoutWidget = QtGui.QWidget(self.centralwidget) self.verticalLayoutWidget.setGeometry(QtCore.QRect(10, 10, 501, 81)) self.verticalLayoutWidget.setObjectName(_fromUtf8("verticalLayoutWidget")) self.verticalLayout = QtGui.QVBoxLayout(self.verticalLayoutWidget) self.verticalLayout.setMargin(0) self.verticalLayout.setObjectName(_fromUtf8("verticalLayout")) self.horizontalLayout_2 = QtGui.QHBoxLayout() self.horizontalLayout_2.setObjectName(_fromUtf8("horizontalLayout_2")) self.label = QtGui.QLabel(self.verticalLayoutWidget) self.label.setObjectName(_fromUtf8("label")) self.horizontalLayout_2.addWidget(self.label) self.txtFile = QtGui.QLineEdit(self.verticalLayoutWidget) self.txtFile.setObjectName(_fromUtf8("txtFile")) self.horizontalLayout_2.addWidget(self.txtFile) self.btChooseFile = QtGui.QPushButton(self.verticalLayoutWidget) self.btChooseFile.setObjectName(_fromUtf8("btChooseFile")) self.horizontalLayout_2.addWidget(self.btChooseFile) self.verticalLayout.addLayout(self.horizontalLayout_2) self.horizontalLayout = QtGui.QHBoxLayout() self.horizontalLayout.setObjectName(_fromUtf8("horizontalLayout")) self.btClose = QtGui.QPushButton(self.verticalLayoutWidget) self.btClose.setObjectName(_fromUtf8("btClose")) self.horizontalLayout.addWidget(self.btClose) self.btLoadFile = QtGui.QPushButton(self.verticalLayoutWidget) self.btLoadFile.setObjectName(_fromUtf8("btLoadFile")) self.horizontalLayout.addWidget(self.btLoadFile) self.verticalLayout.addLayout(self.horizontalLayout) MainWindow.setCentralWidget(self.centralwidget) self.menubar = QtGui.QMenuBar(MainWindow) self.menubar.setGeometry(QtCore.QRect(0, 0, 524, 25)) self.menubar.setObjectName(_fromUtf8("menubar")) MainWindow.setMenuBar(self.menubar) self.statusbar = QtGui.QStatusBar(MainWindow) self.statusbar.setObjectName(_fromUtf8("statusbar")) MainWindow.setStatusBar(self.statusbar) self.retranslateUi(MainWindow) QtCore.QMetaObject.connectSlotsByName(MainWindow) def retranslateUi(self, MainWindow): MainWindow.setWindowTitle(_translate("MainWindow", "MainWindow", None)) self.label.setText(_translate("MainWindow", "File", None)) self.btChooseFile.setText(_translate("MainWindow", "Choose", None)) self.btClose.setText(_translate("MainWindow", "Cerrar", None)) self.btLoadFile.setText(_translate("MainWindow", "Cargar Archivo", None))
apache-2.0
-8,237,645,389,629,048,000
46.25974
82
0.718054
false
4.206936
false
false
false
c0cky/mediathread
mediathread/djangosherd/api.py
1
4549
# pylint: disable-msg=R0904 from tastypie import fields from tastypie.resources import ModelResource from mediathread.api import UserResource, TagResource from mediathread.assetmgr.models import Asset from mediathread.djangosherd.models import SherdNote, DiscussionIndex from mediathread.projects.models import ProjectNote from mediathread.taxonomy.api import TermResource from mediathread.taxonomy.models import TermRelationship class SherdNoteResource(ModelResource): author = fields.ForeignKey(UserResource, 'author', full=True, null=True, blank=True) class Meta: queryset = SherdNote.objects.select_related('asset').order_by("id") excludes = ['tags', 'body', 'added', 'modified'] list_allowed_methods = [] detail_allowed_methods = [] def dehydrate(self, bundle): try: bundle.data['is_global_annotation'] = \ bundle.obj.is_global_annotation() bundle.data['asset_id'] = str(bundle.obj.asset.id) bundle.data['is_null'] = bundle.obj.is_null() bundle.data['annotation'] = bundle.obj.annotation() bundle.data['url'] = bundle.obj.get_absolute_url() modified = bundle.obj.modified.strftime("%m/%d/%y %I:%M %p") \ if bundle.obj.modified else '' bundle.data['metadata'] = { 'tags': TagResource().render_list(bundle.request, bundle.obj.tags_split()), 'body': bundle.obj.body.strip() if bundle.obj.body else '', 'primary_type': bundle.obj.asset.primary.label, 'modified': modified, 'timecode': bundle.obj.range_as_timecode(), 'title': bundle.obj.title } editable = (bundle.request.user.id == getattr(bundle.obj, 'author_id', -1)) citable = bundle.request.GET.get('citable', '') == 'true' # assumed: there is only one ProjectNote per annotation reference = ProjectNote.objects.filter( annotation__id=bundle.obj.id).first() if reference: # notes in a submitted response are not editable editable = editable and not reference.project.is_submitted() if citable: # this is a heavy operation. don't call it unless needed citable = reference.project.can_cite(bundle.request.course, bundle.request.user) bundle.data['editable'] = editable bundle.data['citable'] = citable termResource = TermResource() vocabulary = {} related = TermRelationship.objects.get_for_object( bundle.obj).prefetch_related('term__vocabulary') for rel in related: if rel.term.vocabulary.id not in vocabulary: vocabulary[rel.term.vocabulary.id] = { 'id': rel.term.vocabulary.id, 'display_name': rel.term.vocabulary.display_name, 'terms': [] } vocabulary[rel.term.vocabulary.id]['terms'].append( termResource.render_one(bundle.request, rel.term)) bundle.data['vocabulary'] = vocabulary.values() except Asset.DoesNotExist: bundle.data['asset_id'] = '' bundle.data['metadata'] = {'title': 'Item Deleted'} return bundle def render_one(self, request, selection, asset_key): # assumes user is allowed to see this note bundle = self.build_bundle(obj=selection, request=request) dehydrated = self.full_dehydrate(bundle) bundle.data['asset_key'] = '%s_%s' % (asset_key, bundle.data['asset_id']) return self._meta.serializer.to_simple(dehydrated, None) class DiscussionIndexResource(object): def render_list(self, request, indicies): collaborations = DiscussionIndex.with_permission(request, indicies) ctx = { 'references': [{ 'id': obj.collaboration.object_pk, 'title': obj.collaboration.title, 'type': obj.get_type_label(), 'url': obj.get_absolute_url(), 'modified': obj.modified.strftime("%m/%d/%y %I:%M %p")} for obj in collaborations]} return ctx
gpl-2.0
-7,704,276,080,529,471,000
41.915094
79
0.56386
false
4.275376
false
false
false
fdslight/fdslight
freenet/handlers/tundev.py
1
5566
#!/usr/bin/env python3 import os, sys import pywind.evtframework.handlers.handler as handler import freenet.lib.fn_utils as fn_utils import freenet.lib.simple_qos as simple_qos try: import fcntl except ImportError: pass class tun_base(handler.handler): __creator_fd = None # 要写入到tun的IP包 ___ip_packets_for_write = [] # 写入tun设备的最大IP数据包的个数 __MAX_WRITE_QUEUE_SIZE = 1024 # 当前需要写入tun设备的IP数据包的个数 __current_write_queue_n = 0 __BLOCK_SIZE = 16 * 1024 __qos = None def __create_tun_dev(self, name): """创建tun 设备 :param name: :return fd: """ tun_fd = fn_utils.tuntap_create(name, fn_utils.IFF_TUN | fn_utils.IFF_NO_PI) fn_utils.interface_up(name) if tun_fd < 0: raise SystemError("can not create tun device,please check your root") return tun_fd @property def creator(self): return self.__creator_fd def init_func(self, creator_fd, tun_dev_name, *args, **kwargs): """ :param creator_fd: :param tun_dev_name:tun 设备名称 :param subnet:如果是服务端则需要则个参数 """ tun_fd = self.__create_tun_dev(tun_dev_name) if tun_fd < 3: print("error:create tun device failed:%s" % tun_dev_name) sys.exit(-1) self.__creator_fd = creator_fd self.__qos = simple_qos.qos(simple_qos.QTYPE_DST) self.set_fileno(tun_fd) fcntl.fcntl(tun_fd, fcntl.F_SETFL, os.O_NONBLOCK) self.dev_init(tun_dev_name, *args, **kwargs) return tun_fd def dev_init(self, dev_name, *args, **kwargs): pass def evt_read(self): for i in range(32): try: ip_packet = os.read(self.fileno, self.__BLOCK_SIZE) except BlockingIOError: break self.__qos.add_to_queue(ip_packet) self.__qos_from_tundev() def task_loop(self): self.__qos_from_tundev() def __qos_from_tundev(self): results = self.__qos.get_queue() for ip_packet in results: self.handle_ip_packet_from_read(ip_packet) if not results: self.del_loop_task(self.fileno) else: self.add_to_loop_task(self.fileno) def evt_write(self): try: ip_packet = self.___ip_packets_for_write.pop(0) except IndexError: self.remove_evt_write(self.fileno) return self.__current_write_queue_n -= 1 try: os.write(self.fileno, ip_packet) except BlockingIOError: self.__current_write_queue_n += 1 self.___ip_packets_for_write.insert(0, ip_packet) return '''''' def handle_ip_packet_from_read(self, ip_packet): """处理读取过来的IP包,重写这个方法 :param ip_packet: :return None: """ pass def handle_ip_packet_for_write(self, ip_packet): """处理要写入的IP包,重写这个方法 :param ip_packet: :return new_ip_packet: """ pass def error(self): self.dev_error() def dev_error(self): """重写这个方法 :return: """ pass def timeout(self): self.dev_timeout() def dev_timeout(self): """重写这个方法 :return: """ pass def delete(self): self.dev_delete() def dev_delete(self): """重写这个方法 :return: """ pass def add_to_sent_queue(self, ip_packet): # 丢到超出规定的数据包,防止内存过度消耗 n_ip_message = self.handle_ip_packet_for_write(ip_packet) if not n_ip_message: return if self.__current_write_queue_n == self.__MAX_WRITE_QUEUE_SIZE: # 删除第一个包,防止队列过多 self.__current_write_queue_n -= 1 self.___ip_packets_for_write.pop(0) return self.__current_write_queue_n += 1 self.___ip_packets_for_write.append(n_ip_message) class tundevs(tun_base): """服务端的tun数据处理 """ def dev_init(self, dev_name): self.register(self.fileno) self.add_evt_read(self.fileno) def handle_ip_packet_from_read(self, ip_packet): self.dispatcher.send_msg_to_tunnel_from_tun(ip_packet) def handle_ip_packet_for_write(self, ip_packet): return ip_packet def dev_delete(self): self.unregister(self.fileno) os.close(self.fileno) def dev_error(self): self.delete_handler(self.fileno) def dev_timeout(self): pass def handle_msg_from_tunnel(self, message): self.add_to_sent_queue(message) self.add_evt_write(self.fileno) class tundevc(tun_base): def dev_init(self, dev_name): self.register(self.fileno) self.add_evt_read(self.fileno) def handle_ip_packet_from_read(self, ip_packet): self.dispatcher.handle_msg_from_tundev(ip_packet) def handle_ip_packet_for_write(self, ip_packet): return ip_packet def dev_delete(self): self.unregister(self.fileno) os.close(self.fileno) def dev_error(self): self.delete_handler(self.fileno) def dev_timeout(self): pass def msg_from_tunnel(self, message): self.add_to_sent_queue(message) self.add_evt_write(self.fileno)
bsd-2-clause
794,198,108,318,362,000
23.490741
84
0.567864
false
3.099004
false
false
false
vesellov/bitdust.devel
customer/data_sender.py
1
14665
#!/usr/bin/python # data_sender.py # # Copyright (C) 2008-2018 Veselin Penev, https://bitdust.io # # This file (data_sender.py) is part of BitDust Software. # # BitDust is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # BitDust Software is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with BitDust Software. If not, see <http://www.gnu.org/licenses/>. # # Please contact us if you have any questions at [email protected] # # # # """ .. module:: data_sender. .. raw:: html <a href="https://bitdust.io/automats/data_sender/data_sender.png" target="_blank"> <img src="https://bitdust.io/automats/data_sender/data_sender.png" style="max-width:100%;"> </a> A state machine to manage data sending process, acts very simple: 1) when new local data is created it tries to send it to the correct supplier 2) wait while ``p2p.io_throttle`` is doing some data transmission to remote suppliers 3) calls ``p2p.backup_matrix.ScanBlocksToSend()`` to get a list of pieces needs to be send 4) this machine is restarted every minute to check if some more data needs to be send 5) also can be restarted at any time when it is needed EVENTS: * :red:`block-acked` * :red:`block-failed` * :red:`init` * :red:`new-data` * :red:`restart` * :red:`scan-done` * :red:`timer-1min` * :red:`timer-1sec` """ #------------------------------------------------------------------------------ from __future__ import absolute_import from io import open #------------------------------------------------------------------------------ _Debug = True _DebugLevel = 12 #------------------------------------------------------------------------------ import os import time #------------------------------------------------------------------------------ from logs import lg from automats import automat from automats import global_state from lib import misc from lib import packetid from contacts import contactsdb from userid import my_id from main import settings from p2p import contact_status from . import io_throttle #------------------------------------------------------------------------------ _DataSender = None _ShutdownFlag = False #------------------------------------------------------------------------------ def A(event=None, arg=None): """ Access method to interact with the state machine. """ global _DataSender if _DataSender is None: _DataSender = DataSender( name='data_sender', state='READY', debug_level=_DebugLevel, log_events=_Debug, log_transitions=_Debug, ) if event is not None: _DataSender.automat(event, arg) return _DataSender def Destroy(): """ Destroy the state machine and remove the instance from memory. """ global _DataSender if _DataSender is None: return _DataSender.destroy() del _DataSender _DataSender = None class DataSender(automat.Automat): """ A class to manage process of sending data packets to remote suppliers. """ timers = { 'timer-1min': (60, ['READY']), 'timer-1min': (60, ['READY']), 'timer-1sec': (1.0, ['SENDING']), } statistic = {} def state_changed(self, oldstate, newstate, event, arg): global_state.set_global_state('DATASEND ' + newstate) def A(self, event, arg): #---READY--- if self.state == 'READY': if event == 'new-data' or event == 'timer-1min' or event == 'restart': self.state = 'SCAN_BLOCKS' self.doScanAndQueue(arg) elif event == 'init': pass #---SCAN_BLOCKS--- elif self.state == 'SCAN_BLOCKS': if event == 'scan-done' and self.isQueueEmpty(arg): self.state = 'READY' self.doRemoveUnusedFiles(arg) elif event == 'scan-done' and not self.isQueueEmpty(arg): self.state = 'SENDING' #---SENDING--- elif self.state == 'SENDING': if event == 'restart' or ( ( event == 'timer-1sec' or event == 'block-acked' or event == 'block-failed' or event == 'new-data' ) and self.isQueueEmpty(arg) ): self.state = 'SCAN_BLOCKS' self.doScanAndQueue(arg) return None def isQueueEmpty(self, arg): if not arg: return io_throttle.IsSendingQueueEmpty() remoteID, _ = arg return io_throttle.OkToSend(remoteID) def doScanAndQueue(self, arg): global _ShutdownFlag if _Debug: lg.out(_DebugLevel, 'data_sender.doScanAndQueue _ShutdownFlag=%r' % _ShutdownFlag) if _Debug: log = open(os.path.join(settings.LogsDir(), 'data_sender.log'), 'w') log.write(u'doScanAndQueue %s\n' % time.asctime()) # .decode('utf-8') if _ShutdownFlag: if _Debug: log.write(u'doScanAndQueue _ShutdownFlag is True\n') self.automat('scan-done') if _Debug: log.flush() log.close() return for customer_idurl in contactsdb.known_customers(): if '' not in contactsdb.suppliers(customer_idurl): from storage import backup_matrix for backupID in misc.sorted_backup_ids( list(backup_matrix.local_files().keys()), True): this_customer_idurl = packetid.CustomerIDURL(backupID) if this_customer_idurl != customer_idurl: continue packetsBySupplier = backup_matrix.ScanBlocksToSend(backupID) if _Debug: log.write(u'%s\n' % packetsBySupplier) for supplierNum in packetsBySupplier.keys(): supplier_idurl = contactsdb.supplier(supplierNum, customer_idurl=customer_idurl) if not supplier_idurl: lg.warn('unknown supplier_idurl supplierNum=%s for %s, customer_idurl=%s' % ( supplierNum, backupID, customer_idurl)) continue for packetID in packetsBySupplier[supplierNum]: backupID_, _, supplierNum_, _ = packetid.BidBnSnDp(packetID) if backupID_ != backupID: lg.warn('unexpected backupID supplierNum=%s for %s, customer_idurl=%s' % ( packetID, backupID, customer_idurl)) continue if supplierNum_ != supplierNum: lg.warn('unexpected supplierNum %s for %s, customer_idurl=%s' % ( packetID, backupID, customer_idurl)) continue if io_throttle.HasPacketInSendQueue( supplier_idurl, packetID): if _Debug: log.write(u'%s already in sending queue for %s\n' % (packetID, supplier_idurl)) continue if not io_throttle.OkToSend(supplier_idurl): if _Debug: log.write(u'skip, not ok to send %s\n' % supplier_idurl) continue customerGlobalID, pathID = packetid.SplitPacketID(packetID) # tranByID = gate.transfers_out_by_idurl().get(supplier_idurl, []) # if len(tranByID) > 3: # log.write(u'transfers by %s: %d\n' % (supplier_idurl, len(tranByID))) # continue customerGlobalID, pathID = packetid.SplitPacketID(packetID) filename = os.path.join( settings.getLocalBackupsDir(), customerGlobalID, pathID, ) if not os.path.isfile(filename): if _Debug: log.write(u'%s is not a file\n' % filename) continue if io_throttle.QueueSendFile( filename, packetID, supplier_idurl, my_id.getLocalID(), self._packetAcked, self._packetFailed, ): if _Debug: log.write(u'io_throttle.QueueSendFile %s\n' % packetID) else: if _Debug: log.write(u'io_throttle.QueueSendFile FAILED %s\n' % packetID) # lg.out(6, ' %s for %s' % (packetID, backupID)) # DEBUG # break self.automat('scan-done') if _Debug: log.flush() log.close() # def doPrintStats(self, arg): # """ # """ # if lg.is_debug(18): # transfers = transport_control.current_transfers() # bytes_stats = transport_control.current_bytes_transferred() # s = '' # for info in transfers: # s += '%s ' % (diskspace.MakeStringFromBytes(bytes_stats[info.transfer_id]).replace(' ', '').replace('bytes', 'b')) # lg.out(0, 'transfers: ' + s[:120]) def doRemoveUnusedFiles(self, arg): # we want to remove files for this block # because we only need them during rebuilding if settings.getBackupsKeepLocalCopies() is True: # if user set this in settings - he want to keep the local files return # ... user do not want to keep local backups if settings.getGeneralWaitSuppliers() is True: from customer import fire_hire # but he want to be sure - all suppliers are green for a long time if len(contact_status.listOfflineSuppliers()) > 0 or time.time( ) - fire_hire.GetLastFireTime() < 24 * 60 * 60: # some people are not there or we do not have stable team yet # do not remove the files because we need it to rebuild return count = 0 from storage import backup_matrix from storage import restore_monitor from storage import backup_rebuilder if _Debug: lg.out(_DebugLevel, 'data_sender.doRemoveUnusedFiles') for backupID in misc.sorted_backup_ids( list(backup_matrix.local_files().keys())): if restore_monitor.IsWorking(backupID): if _Debug: lg.out( _DebugLevel, ' %s : SKIP, because restoring' % backupID) continue if backup_rebuilder.IsBackupNeedsWork(backupID): if _Debug: lg.out( _DebugLevel, ' %s : SKIP, because needs rebuilding' % backupID) continue if not backup_rebuilder.ReadStoppedFlag(): if backup_rebuilder.A().currentBackupID is not None: if backup_rebuilder.A().currentBackupID == backupID: if _Debug: lg.out( _DebugLevel, ' %s : SKIP, because rebuilding is in process' % backupID) continue packets = backup_matrix.ScanBlocksToRemove( backupID, settings.getGeneralWaitSuppliers()) for packetID in packets: customer, pathID = packetid.SplitPacketID(packetID) filename = os.path.join(settings.getLocalBackupsDir(), customer, pathID) if os.path.isfile(filename): try: os.remove(filename) # lg.out(6, ' ' + os.path.basename(filename)) except: lg.exc() continue count += 1 if _Debug: lg.out(_DebugLevel, ' %d files were removed' % count) backup_matrix.ReadLocalFiles() def _packetAcked(self, packet, ownerID, packetID): from storage import backup_matrix backupID, blockNum, supplierNum, dataORparity = packetid.BidBnSnDp(packetID) backup_matrix.RemoteFileReport( backupID, blockNum, supplierNum, dataORparity, True) if ownerID not in self.statistic: self.statistic[ownerID] = [0, 0] self.statistic[ownerID][0] += 1 self.automat('block-acked', (ownerID, packetID)) def _packetFailed(self, remoteID, packetID, why): from storage import backup_matrix backupID, blockNum, supplierNum, dataORparity = packetid.BidBnSnDp( packetID) backup_matrix.RemoteFileReport( backupID, blockNum, supplierNum, dataORparity, False) if remoteID not in self.statistic: self.statistic[remoteID] = [0, 0] self.statistic[remoteID][1] += 1 self.automat('block-failed', (remoteID, packetID)) def statistic(): """ The ``data_sender()`` keeps track of sending results with every supplier. This is used by ``fire_hire()`` to decide how reliable is given supplier. """ global _DataSender if _DataSender is None: return {} return _DataSender.statistic def SetShutdownFlag(): """ Set flag to indicate that no need to send anything anymore. """ global _ShutdownFlag _ShutdownFlag = True
agpl-3.0
4,224,043,803,797,804,000
38.422043
170
0.512104
false
4.385467
false
false
false
agacek/camkes-tool
camkes/internal/version.py
1
1813
# # Copyright 2014, NICTA # # This software may be distributed and modified according to the terms of # the BSD 2-Clause license. Note that NO WARRANTY is provided. # See "LICENSE_BSD2.txt" for details. # # @TAG(NICTA_BSD) # '''Versioning functionality. This computes a version identifier based on the current source code state. It was decided this was more reliable while the tool is under active development. Note that any extraneous files in your source directory that match the version filters will be accumulated in the version computation.''' from memoization import memoized import hashlib, os, re @memoized def version(): # Files to consider relevant. Each entry should be a pair of (path, filter) # where 'path' is relative to the directory of this file and 'filter' is a # regex describing which filenames to match under the given path. SOURCES = [ ('../', r'^.*\.py$'), # Python sources ('../templates', r'.*'), # Templates ] my_path = os.path.dirname(os.path.abspath(__file__)) sources = set() # Accumulate all relevant source files. for s in SOURCES: path = os.path.join(my_path, s[0]) regex = re.compile(s[1]) for root, _, files in os.walk(path): for f in files: if regex.match(f): sources.add(os.path.abspath(os.path.join(root, f))) # Hash each file and hash a concatenation of these hashes. Note, hashing a # hash is not good practice for cryptography, but it's fine for this # purpose. hfinal = hashlib.sha1() #pylint: disable=E1101 for s in sources: with open(s, 'r') as f: h = hashlib.sha1(f.read()).hexdigest() #pylint: disable=E1101 hfinal.update('%s|' % h) #pylint: disable=E1101 return hfinal.hexdigest()
bsd-2-clause
-41,992,440,657,990,110
35.26
79
0.656922
false
3.832981
false
false
false
ibrica/universe-server
play.py
1
1073
from multiprocessing import Process import time import gym import universe from universe.spaces.vnc_event import keycode from envs import create_env def start_game(model, env_name): """regular Python process, not using torch""" p = Process(target=play_game, args=(model,env_name)) p.start() # Don't wait with join, respond to user request def play_game(model, env_name): """Play game with saved model if ther's no model play random""" env = create_env(env_name, client_id="play1",remotes=1) # Local docker container max_game_length = 10000 state = env.reset() reward_sum = 0 start_time = time.time() for step in range(max_game_length ): state, reward, done, _ = env.step( ['up' for i in range(60)]) #no saved model for now keep pressing up, 60 times in minute reward_sum += reward print("Time {}, game reward {}, game length {}".format( time.strftime("%Hh %Mm %Ss"), reward_sum, time.gmtime(time.time() - start_time))) if done: break
mit
-6,093,060,618,181,687,000
33.645161
130
0.630941
false
3.764912
false
false
false
droundy/deft
talks/colloquium/figs/plot-walls.py
1
3242
#!/usr/bin/python # We need the following two lines in order for matplotlib to work # without access to an X server. from __future__ import division import matplotlib matplotlib.use('Agg') import pylab, numpy, sys xmax = 2.5 xmin = -0.4 def plotit(dftdata, mcdata): dft_len = len(dftdata[:,0]) dft_dr = dftdata[2,0] - dftdata[1,0] mcdata = numpy.insert(mcdata,0,0,0) mcdata[0,0]=-10 mcoffset = 10/2 offset = -3/2 n0 = dftdata[:,6] nA = dftdata[:,8] nAmc = mcdata[:,11] n0mc = mcdata[:,10] pylab.figure(figsize=(6, 6)) pylab.subplots_adjust(hspace=0.001) n_plt = pylab.subplot(3,1,3) n_plt.plot(mcdata[:,0]/2+mcoffset,mcdata[:,1]*4*numpy.pi/3,"b-",label='$n$ Monte Carlo') n_plt.plot(dftdata[:,0]/2+offset,dftdata[:,1]*4*numpy.pi/3,"b--",label='$n$ DFT') n_plt.legend(loc='best', ncol=1).draw_frame(False) #.get_frame().set_alpha(0.5) n_plt.yaxis.set_major_locator(pylab.MaxNLocator(6,steps=[1,5,10],prune='upper')) pylab.ylim(ymin=0) pylab.xlim(xmin, xmax) pylab.xlabel("$z/\sigma$") pylab.ylabel("$n(\mathbf{r})$") n_plt.axvline(x=0, color='k', linestyle=':') n = len(mcdata[:,0]) #pylab.twinx() dftr = dftdata[:,0]/2+offset thiswork = dftdata[:,5] gross = dftdata[:,7] stop_here = int(dft_len - 1/dft_dr) print stop_here start_here = int(2.5/dft_dr) off = 1 me = 40 A_plt = pylab.subplot(3,1,1) A_plt.axvline(x=0, color='k', linestyle=':') A_plt.plot(mcdata[:,0]/2+mcoffset,mcdata[:,2+2*off]/nAmc,"r-",label="$g_\sigma^A$ Monte Carlo") A_plt.plot(dftr[dftr>=0],thiswork[dftr>=0],"ro",markevery=me*.8,label="$g_\sigma^A$ this work") A_plt.plot(dftr[dftr>=0],gross[dftr>=0],"rx",markevery=me,label="Gross", markerfacecolor='none',markeredgecolor='red', markeredgewidth=1) A_plt.legend(loc='best', ncol=1).draw_frame(False) #.get_frame().set_alpha(0.5) A_plt.yaxis.set_major_locator(pylab.MaxNLocator(integer=True,prune='upper')) pylab.ylim(ymin=0) pylab.ylabel("$g_\sigma^A$") pylab.xlim(xmin, xmax) n0mc[0]=1 mcdata[0,10]=1 S_plt = pylab.subplot(3,1,2) S_plt.axvline(x=0, color='k', linestyle=':') S_plt.plot(mcdata[:,0]/2+mcoffset,mcdata[:,3+2*off]/n0mc,"g-",label="$g_\sigma^S$ Monte Carlo") S_plt.plot(dftdata[:,0]/2+offset,dftdata[:,4],"gx",markevery=me/2,label="Yu and Wu") S_plt.legend(loc='best', ncol=1).draw_frame(False) #.get_frame().set_alpha(0.5) #pylab.ylim(ymax=12) S_plt.yaxis.set_major_locator(pylab.MaxNLocator(5,integer=True,prune='upper')) pylab.xlim(xmin, xmax) pylab.ylim(ymin=0) pylab.ylabel("$g_\sigma^S$") xticklabels = A_plt.get_xticklabels() + S_plt.get_xticklabels() pylab.setp(xticklabels, visible=False) mcdata10 = numpy.loadtxt('../../papers/contact/figs/mc-walls-20-196.dat') dftdata10 = numpy.loadtxt('../../papers/contact/figs/wallsWB-0.10.dat') mcdata40 = numpy.loadtxt('../../papers/contact/figs/mc-walls-20-817.dat') dftdata40 = numpy.loadtxt('../../papers/contact/figs/wallsWB-0.40.dat') plotit(dftdata10, mcdata10) pylab.savefig('figs/walls-10.pdf', transparent=True) plotit(dftdata40, mcdata40) pylab.savefig('figs/walls-40.pdf', transparent=True)
gpl-2.0
-4,687,526,299,663,627,000
33.489362
99
0.637569
false
2.515128
false
false
false
AprilBrother/esptool
esptool.py
1
28432
#!/usr/bin/env python # # ESP8266 ROM Bootloader Utility # https://github.com/themadinventor/esptool # # Copyright (C) 2014 Fredrik Ahlberg # # This program is free software; you can redistribute it and/or modify it under # the terms of the GNU General Public License as published by the Free Software # Foundation; either version 2 of the License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, but WITHOUT # ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS # FOR A PARTICULAR PURPOSE. See the GNU General Public License for more details. # # You should have received a copy of the GNU General Public License along with # this program; if not, write to the Free Software Foundation, Inc., 51 Franklin # Street, Fifth Floor, Boston, MA 02110-1301 USA. import sys import struct import serial import time import argparse import os import subprocess import tempfile class ESPROM: # These are the currently known commands supported by the ROM ESP_FLASH_BEGIN = 0x02 ESP_FLASH_DATA = 0x03 ESP_FLASH_END = 0x04 ESP_MEM_BEGIN = 0x05 ESP_MEM_END = 0x06 ESP_MEM_DATA = 0x07 ESP_SYNC = 0x08 ESP_WRITE_REG = 0x09 ESP_READ_REG = 0x0a # Maximum block sized for RAM and Flash writes, respectively. ESP_RAM_BLOCK = 0x1800 ESP_FLASH_BLOCK = 0x100 # Default baudrate. The ROM auto-bauds, so we can use more or less whatever we want. ESP_ROM_BAUD = 115200 # First byte of the application image ESP_IMAGE_MAGIC = 0xe9 # Initial state for the checksum routine ESP_CHECKSUM_MAGIC = 0xef # OTP ROM addresses ESP_OTP_MAC0 = 0x3ff00050 ESP_OTP_MAC1 = 0x3ff00054 # Sflash stub: an assembly routine to read from spi flash and send to host SFLASH_STUB = "\x80\x3c\x00\x40\x1c\x4b\x00\x40\x21\x11\x00\x40\x00\x80" \ "\xfe\x3f\xc1\xfb\xff\xd1\xf8\xff\x2d\x0d\x31\xfd\xff\x41\xf7\xff\x4a" \ "\xdd\x51\xf9\xff\xc0\x05\x00\x21\xf9\xff\x31\xf3\xff\x41\xf5\xff\xc0" \ "\x04\x00\x0b\xcc\x56\xec\xfd\x06\xff\xff\x00\x00" def __init__(self, port=0, baud=ESP_ROM_BAUD): self._port = serial.Serial(port) # setting baud rate in a separate step is a workaround for # CH341 driver on some Linux versions (this opens at 9600 then # sets), shouldn't matter for other platforms/drivers. See # https://github.com/themadinventor/esptool/issues/44#issuecomment-107094446 self._port.baudrate = baud """ Read bytes from the serial port while performing SLIP unescaping """ def read(self, length=1): b = '' while len(b) < length: c = self._port.read(1) if c == '\xdb': c = self._port.read(1) if c == '\xdc': b = b + '\xc0' elif c == '\xdd': b = b + '\xdb' else: raise FatalError('Invalid SLIP escape') else: b = b + c return b """ Write bytes to the serial port while performing SLIP escaping """ def write(self, packet): buf = '\xc0' \ + (packet.replace('\xdb','\xdb\xdd').replace('\xc0','\xdb\xdc')) \ + '\xc0' self._port.write(buf) """ Calculate checksum of a blob, as it is defined by the ROM """ @staticmethod def checksum(data, state=ESP_CHECKSUM_MAGIC): for b in data: state ^= ord(b) return state """ Send a request and read the response """ def command(self, op=None, data=None, chk=0): if op: pkt = struct.pack('<BBHI', 0x00, op, len(data), chk) + data self.write(pkt) # tries to get a response until that response has the # same operation as the request or a retries limit has # exceeded. This is needed for some esp8266s that # reply with more sync responses than expected. retries = 100 while retries > 0: (op_ret, val, body) = self.receive_response() if op is None or op_ret == op: return val, body # valid response received retries = retries - 1 raise FatalError("Response doesn't match request") """ Receive a response to a command """ def receive_response(self): # Read header of response and parse if self._port.read(1) != '\xc0': raise FatalError('Invalid head of packet') hdr = self.read(8) (resp, op_ret, len_ret, val) = struct.unpack('<BBHI', hdr) if resp != 0x01: raise FatalError('Invalid response 0x%02x" to command' % resp) # The variable-length body body = self.read(len_ret) # Terminating byte if self._port.read(1) != chr(0xc0): raise FatalError('Invalid end of packet') return op_ret, val, body """ Perform a connection test """ def sync(self): self.command(ESPROM.ESP_SYNC, '\x07\x07\x12\x20' + 32 * '\x55') for i in xrange(7): self.command() """ Try connecting repeatedly until successful, or giving up """ def connect(self): print 'Connecting...' for _ in xrange(4): # worst-case latency timer should be 255ms (probably <20ms) self._port.timeout = 0.3 for _ in xrange(4): try: self._port.flushInput() self._port.flushOutput() self.sync() self._port.timeout = 5 return except: time.sleep(0.05) raise FatalError('Failed to connect to ESP8266') """ Read memory address in target """ def read_reg(self, addr): res = self.command(ESPROM.ESP_READ_REG, struct.pack('<I', addr)) if res[1] != "\0\0": raise FatalError('Failed to read target memory') return res[0] """ Write to memory address in target """ def write_reg(self, addr, value, mask, delay_us=0): if self.command(ESPROM.ESP_WRITE_REG, struct.pack('<IIII', addr, value, mask, delay_us))[1] != "\0\0": raise FatalError('Failed to write target memory') """ Start downloading an application image to RAM """ def mem_begin(self, size, blocks, blocksize, offset): if self.command(ESPROM.ESP_MEM_BEGIN, struct.pack('<IIII', size, blocks, blocksize, offset))[1] != "\0\0": raise FatalError('Failed to enter RAM download mode') """ Send a block of an image to RAM """ def mem_block(self, data, seq): if self.command(ESPROM.ESP_MEM_DATA, struct.pack('<IIII', len(data), seq, 0, 0) + data, ESPROM.checksum(data))[1] != "\0\0": raise FatalError('Failed to write to target RAM') """ Leave download mode and run the application """ def mem_finish(self, entrypoint=0): if self.command(ESPROM.ESP_MEM_END, struct.pack('<II', int(entrypoint == 0), entrypoint))[1] != "\0\0": raise FatalError('Failed to leave RAM download mode') """ Start downloading to Flash (performs an erase) """ def flash_begin(self, size, offset): old_tmo = self._port.timeout num_blocks = (size + ESPROM.ESP_FLASH_BLOCK - 1) / ESPROM.ESP_FLASH_BLOCK sectors_per_block = 16 sector_size = 4096 num_sectors = (size + sector_size - 1) / sector_size start_sector = offset / sector_size head_sectors = sectors_per_block - (start_sector % sectors_per_block) if num_sectors < head_sectors: head_sectors = num_sectors if num_sectors < 2 * head_sectors: erase_size = (num_sectors + 1) / 2 * sector_size else: erase_size = (num_sectors - head_sectors) * sector_size self._port.timeout = 10 result = self.command(ESPROM.ESP_FLASH_BEGIN, struct.pack('<IIII', erase_size, num_blocks, ESPROM.ESP_FLASH_BLOCK, offset))[1] if result != "\0\0": raise FatalError.WithResult('Failed to enter Flash download mode (result "%s")', result) self._port.timeout = old_tmo """ Write block to flash """ def flash_block(self, data, seq): result = self.command(ESPROM.ESP_FLASH_DATA, struct.pack('<IIII', len(data), seq, 0, 0) + data, ESPROM.checksum(data))[1] if result != "\0\0": raise FatalError.WithResult('Failed to write to target Flash after seq %d (got result %%s)' % seq, result) """ Leave flash mode and run/reboot """ def flash_finish(self, reboot=False): pkt = struct.pack('<I', int(not reboot)) if self.command(ESPROM.ESP_FLASH_END, pkt)[1] != "\0\0": raise FatalError('Failed to leave Flash mode') """ Run application code in flash """ def run(self, reboot=False): # Fake flash begin immediately followed by flash end self.flash_begin(0, 0) self.flash_finish(reboot) """ Read MAC from OTP ROM """ def read_mac(self): mac0 = self.read_reg(self.ESP_OTP_MAC0) mac1 = self.read_reg(self.ESP_OTP_MAC1) if ((mac1 >> 16) & 0xff) == 0: oui = (0x18, 0xfe, 0x34) elif ((mac1 >> 16) & 0xff) == 1: oui = (0xac, 0xd0, 0x74) else: raise FatalError("Unknown OUI") return oui + ((mac1 >> 8) & 0xff, mac1 & 0xff, (mac0 >> 24) & 0xff) """ Read SPI flash manufacturer and device id """ def flash_id(self): self.flash_begin(0, 0) self.write_reg(0x60000240, 0x0, 0xffffffff) self.write_reg(0x60000200, 0x10000000, 0xffffffff) flash_id = self.read_reg(0x60000240) self.flash_finish(False) return flash_id """ Read SPI flash """ def flash_read(self, offset, size, count=1): # Create a custom stub stub = struct.pack('<III', offset, size, count) + self.SFLASH_STUB # Trick ROM to initialize SFlash self.flash_begin(0, 0) # Download stub self.mem_begin(len(stub), 1, len(stub), 0x40100000) self.mem_block(stub, 0) self.mem_finish(0x4010001c) # Fetch the data data = '' for _ in xrange(count): if self._port.read(1) != '\xc0': raise FatalError('Invalid head of packet (sflash read)') data += self.read(size) if self._port.read(1) != chr(0xc0): raise FatalError('Invalid end of packet (sflash read)') return data """ Abuse the loader protocol to force flash to be left in write mode """ def flash_unlock_dio(self): # Enable flash write mode self.flash_begin(0, 0) # Reset the chip rather than call flash_finish(), which would have # write protected the chip again (why oh why does it do that?!) self.mem_begin(0,0,0,0x40100000) self.mem_finish(0x40000080) """ Perform a chip erase of SPI flash """ def flash_erase(self): # Trick ROM to initialize SFlash self.flash_begin(0, 0) # This is hacky: we don't have a custom stub, instead we trick # the bootloader to jump to the SPIEraseChip() routine and then halt/crash # when it tries to boot an unconfigured system. self.mem_begin(0,0,0,0x40100000) self.mem_finish(0x40004984) # Yup - there's no good way to detect if we succeeded. # It it on the other hand unlikely to fail. class ESPFirmwareImage: def __init__(self, filename=None): self.segments = [] self.entrypoint = 0 self.flash_mode = 0 self.flash_size_freq = 0 if filename is not None: f = file(filename, 'rb') (magic, segments, self.flash_mode, self.flash_size_freq, self.entrypoint) = struct.unpack('<BBBBI', f.read(8)) # some sanity check if magic != ESPROM.ESP_IMAGE_MAGIC or segments > 16: raise FatalError('Invalid firmware image') for i in xrange(segments): (offset, size) = struct.unpack('<II', f.read(8)) if offset > 0x40200000 or offset < 0x3ffe0000 or size > 65536: raise FatalError('Suspicious segment 0x%x, length %d' % (offset, size)) segment_data = f.read(size) if len(segment_data) < size: raise FatalError('End of file reading segment 0x%x, length %d (actual length %d)' % (offset, size, len(segment_data))) self.segments.append((offset, size, segment_data)) # Skip the padding. The checksum is stored in the last byte so that the # file is a multiple of 16 bytes. align = 15 - (f.tell() % 16) f.seek(align, 1) self.checksum = ord(f.read(1)) def add_segment(self, addr, data): # Data should be aligned on word boundary l = len(data) if l % 4: data += b"\x00" * (4 - l % 4) if l > 0: self.segments.append((addr, len(data), data)) def save(self, filename): f = file(filename, 'wb') f.write(struct.pack('<BBBBI', ESPROM.ESP_IMAGE_MAGIC, len(self.segments), self.flash_mode, self.flash_size_freq, self.entrypoint)) checksum = ESPROM.ESP_CHECKSUM_MAGIC for (offset, size, data) in self.segments: f.write(struct.pack('<II', offset, size)) f.write(data) checksum = ESPROM.checksum(data, checksum) align = 15 - (f.tell() % 16) f.seek(align, 1) f.write(struct.pack('B', checksum)) class ELFFile: def __init__(self, name): self.name = name self.symbols = None def _fetch_symbols(self): if self.symbols is not None: return self.symbols = {} try: tool_nm = "xtensa-lx106-elf-nm" if os.getenv('XTENSA_CORE') == 'lx106': tool_nm = "xt-nm" proc = subprocess.Popen([tool_nm, self.name], stdout=subprocess.PIPE) except OSError: print "Error calling %s, do you have Xtensa toolchain in PATH?" % tool_nm sys.exit(1) for l in proc.stdout: fields = l.strip().split() try: if fields[0] == "U": print "Warning: ELF binary has undefined symbol %s" % fields[1] continue self.symbols[fields[2]] = int(fields[0], 16) except ValueError: raise FatalError("Failed to strip symbol output from nm: %s" % fields) def get_symbol_addr(self, sym): self._fetch_symbols() return self.symbols[sym] def get_entry_point(self): tool_readelf = "xtensa-lx106-elf-readelf" if os.getenv('XTENSA_CORE') == 'lx106': tool_readelf = "xt-readelf" try: proc = subprocess.Popen([tool_readelf, "-h", self.name], stdout=subprocess.PIPE) except OSError: print "Error calling %s, do you have Xtensa toolchain in PATH?" % tool_readelf sys.exit(1) for l in proc.stdout: fields = l.strip().split() if fields[0] == "Entry": return int(fields[3], 0) def load_section(self, section): tool_objcopy = "xtensa-lx106-elf-objcopy" if os.getenv('XTENSA_CORE') == 'lx106': tool_objcopy = "xt-objcopy" tmpsection = tempfile.mktemp(suffix=".section") try: subprocess.check_call([tool_objcopy, "--only-section", section, "-Obinary", self.name, tmpsection]) with open(tmpsection, "rb") as f: data = f.read() finally: os.remove(tmpsection) return data def arg_auto_int(x): return int(x, 0) def div_roundup(a, b): """ Return a/b rounded up to nearest integer, equivalent result to int(math.ceil(float(int(a)) / float(int(b))), only without possible floating point accuracy errors. """ return (int(a) + int(b) - 1) / int(b) class FatalError(RuntimeError): """ Wrapper class for runtime errors that aren't caused by internal bugs, but by ESP8266 responses or input content. """ def __init__(self, message): RuntimeError.__init__(self, message) @staticmethod def WithResult(message, result): """ Return a fatal error object that includes the hex values of 'result' as a string formatted argument. """ return FatalError(message % ", ".join(hex(ord(x)) for x in result)) def main(): parser = argparse.ArgumentParser(description='ESP8266 ROM Bootloader Utility', prog='esptool') parser.add_argument( '--port', '-p', help='Serial port device', default='/dev/ttyUSB0') parser.add_argument( '--baud', '-b', help='Serial port baud rate', type=arg_auto_int, default=ESPROM.ESP_ROM_BAUD) subparsers = parser.add_subparsers( dest='operation', help='Run esptool {command} -h for additional help') parser_load_ram = subparsers.add_parser( 'load_ram', help='Download an image to RAM and execute') parser_load_ram.add_argument('filename', help='Firmware image') parser_dump_mem = subparsers.add_parser( 'dump_mem', help='Dump arbitrary memory to disk') parser_dump_mem.add_argument('address', help='Base address', type=arg_auto_int) parser_dump_mem.add_argument('size', help='Size of region to dump', type=arg_auto_int) parser_dump_mem.add_argument('filename', help='Name of binary dump') parser_read_mem = subparsers.add_parser( 'read_mem', help='Read arbitrary memory location') parser_read_mem.add_argument('address', help='Address to read', type=arg_auto_int) parser_write_mem = subparsers.add_parser( 'write_mem', help='Read-modify-write to arbitrary memory location') parser_write_mem.add_argument('address', help='Address to write', type=arg_auto_int) parser_write_mem.add_argument('value', help='Value', type=arg_auto_int) parser_write_mem.add_argument('mask', help='Mask of bits to write', type=arg_auto_int) parser_write_flash = subparsers.add_parser( 'write_flash', help='Write a binary blob to flash') parser_write_flash.add_argument('addr_filename', nargs='+', help='Address and binary file to write there, separated by space') parser_write_flash.add_argument('--flash_freq', '-ff', help='SPI Flash frequency', choices=['40m', '26m', '20m', '80m'], default='40m') parser_write_flash.add_argument('--flash_mode', '-fm', help='SPI Flash mode', choices=['qio', 'qout', 'dio', 'dout'], default='qio') parser_write_flash.add_argument('--flash_size', '-fs', help='SPI Flash size in Mbit', choices=['4m', '2m', '8m', '16m', '32m', '16m-c1', '32m-c1', '32m-c2'], default='4m') subparsers.add_parser( 'run', help='Run application code in flash') parser_image_info = subparsers.add_parser( 'image_info', help='Dump headers from an application image') parser_image_info.add_argument('filename', help='Image file to parse') parser_make_image = subparsers.add_parser( 'make_image', help='Create an application image from binary files') parser_make_image.add_argument('output', help='Output image file') parser_make_image.add_argument('--segfile', '-f', action='append', help='Segment input file') parser_make_image.add_argument('--segaddr', '-a', action='append', help='Segment base address', type=arg_auto_int) parser_make_image.add_argument('--entrypoint', '-e', help='Address of entry point', type=arg_auto_int, default=0) parser_elf2image = subparsers.add_parser( 'elf2image', help='Create an application image from ELF file') parser_elf2image.add_argument('input', help='Input ELF file') parser_elf2image.add_argument('--output', '-o', help='Output filename prefix', type=str) parser_elf2image.add_argument('--flash_freq', '-ff', help='SPI Flash frequency', choices=['40m', '26m', '20m', '80m'], default='40m') parser_elf2image.add_argument('--flash_mode', '-fm', help='SPI Flash mode', choices=['qio', 'qout', 'dio', 'dout'], default='qio') parser_elf2image.add_argument('--flash_size', '-fs', help='SPI Flash size in Mbit', choices=['4m', '2m', '8m', '16m', '32m', '16m-c1', '32m-c1', '32m-c2'], default='4m') subparsers.add_parser( 'read_mac', help='Read MAC address from OTP ROM') subparsers.add_parser( 'flash_id', help='Read SPI flash manufacturer and device ID') parser_read_flash = subparsers.add_parser( 'read_flash', help='Read SPI flash content') parser_read_flash.add_argument('address', help='Start address', type=arg_auto_int) parser_read_flash.add_argument('size', help='Size of region to dump', type=arg_auto_int) parser_read_flash.add_argument('filename', help='Name of binary dump') subparsers.add_parser( 'erase_flash', help='Perform Chip Erase on SPI flash') args = parser.parse_args() # Create the ESPROM connection object, if needed esp = None if args.operation not in ('image_info','make_image','elf2image'): esp = ESPROM(args.port, args.baud) esp.connect() # Do the actual work. Should probably be split into separate functions. if args.operation == 'load_ram': image = ESPFirmwareImage(args.filename) print 'RAM boot...' for (offset, size, data) in image.segments: print 'Downloading %d bytes at %08x...' % (size, offset), sys.stdout.flush() esp.mem_begin(size, div_roundup(size, esp.ESP_RAM_BLOCK), esp.ESP_RAM_BLOCK, offset) seq = 0 while len(data) > 0: esp.mem_block(data[0:esp.ESP_RAM_BLOCK], seq) data = data[esp.ESP_RAM_BLOCK:] seq += 1 print 'done!' print 'All segments done, executing at %08x' % image.entrypoint esp.mem_finish(image.entrypoint) elif args.operation == 'read_mem': print '0x%08x = 0x%08x' % (args.address, esp.read_reg(args.address)) elif args.operation == 'write_mem': esp.write_reg(args.address, args.value, args.mask, 0) print 'Wrote %08x, mask %08x to %08x' % (args.value, args.mask, args.address) elif args.operation == 'dump_mem': f = file(args.filename, 'wb') for i in xrange(args.size / 4): d = esp.read_reg(args.address + (i * 4)) f.write(struct.pack('<I', d)) if f.tell() % 1024 == 0: print '\r%d bytes read... (%d %%)' % (f.tell(), f.tell() * 100 / args.size), sys.stdout.flush() print 'Done!' elif args.operation == 'write_flash': assert len(args.addr_filename) % 2 == 0 flash_mode = {'qio':0, 'qout':1, 'dio':2, 'dout': 3}[args.flash_mode] flash_size_freq = {'4m':0x00, '2m':0x10, '8m':0x20, '16m':0x30, '32m':0x40, '16m-c1': 0x50, '32m-c1':0x60, '32m-c2':0x70}[args.flash_size] flash_size_freq += {'40m':0, '26m':1, '20m':2, '80m': 0xf}[args.flash_freq] flash_info = struct.pack('BB', flash_mode, flash_size_freq) while args.addr_filename: address = int(args.addr_filename[0], 0) filename = args.addr_filename[1] args.addr_filename = args.addr_filename[2:] image = file(filename, 'rb').read() print 'Erasing flash...' blocks = div_roundup(len(image), esp.ESP_FLASH_BLOCK) esp.flash_begin(blocks * esp.ESP_FLASH_BLOCK, address) seq = 0 written = 0 t = time.time() while len(image) > 0: print '\rWriting at 0x%08x... (%d %%)' % (address + seq * esp.ESP_FLASH_BLOCK, 100 * (seq + 1) / blocks), sys.stdout.flush() block = image[0:esp.ESP_FLASH_BLOCK] # Fix sflash config data if address == 0 and seq == 0 and block[0] == '\xe9': block = block[0:2] + flash_info + block[4:] # Pad the last block block = block + '\xff' * (esp.ESP_FLASH_BLOCK - len(block)) esp.flash_block(block, seq) image = image[esp.ESP_FLASH_BLOCK:] seq += 1 written += len(block) t = time.time() - t print '\rWrote %d bytes at 0x%08x in %.1f seconds (%.1f kbit/s)...' % (written, address, t, written / t * 8 / 1000) print '\nLeaving...' if args.flash_mode == 'dio': esp.flash_unlock_dio() else: esp.flash_begin(0, 0) esp.flash_finish(False) elif args.operation == 'run': esp.run() elif args.operation == 'image_info': image = ESPFirmwareImage(args.filename) print ('Entry point: %08x' % image.entrypoint) if image.entrypoint != 0 else 'Entry point not set' print '%d segments' % len(image.segments) print checksum = ESPROM.ESP_CHECKSUM_MAGIC for (idx, (offset, size, data)) in enumerate(image.segments): print 'Segment %d: %5d bytes at %08x' % (idx + 1, size, offset) checksum = ESPROM.checksum(data, checksum) print print 'Checksum: %02x (%s)' % (image.checksum, 'valid' if image.checksum == checksum else 'invalid!') elif args.operation == 'make_image': image = ESPFirmwareImage() if len(args.segfile) == 0: raise FatalError('No segments specified') if len(args.segfile) != len(args.segaddr): raise FatalError('Number of specified files does not match number of specified addresses') for (seg, addr) in zip(args.segfile, args.segaddr): data = file(seg, 'rb').read() image.add_segment(addr, data) image.entrypoint = args.entrypoint image.save(args.output) elif args.operation == 'elf2image': if args.output is None: args.output = args.input + '-' e = ELFFile(args.input) image = ESPFirmwareImage() image.entrypoint = e.get_entry_point() for section, start in ((".text", "_text_start"), (".data", "_data_start"), (".rodata", "_rodata_start")): data = e.load_section(section) image.add_segment(e.get_symbol_addr(start), data) image.flash_mode = {'qio':0, 'qout':1, 'dio':2, 'dout': 3}[args.flash_mode] image.flash_size_freq = {'4m':0x00, '2m':0x10, '8m':0x20, '16m':0x30, '32m':0x40, '16m-c1': 0x50, '32m-c1':0x60, '32m-c2':0x70}[args.flash_size] image.flash_size_freq += {'40m':0, '26m':1, '20m':2, '80m': 0xf}[args.flash_freq] image.save(args.output + "0x00000.bin") data = e.load_section(".irom0.text") off = e.get_symbol_addr("_irom0_text_start") - 0x40200000 assert off >= 0 f = open(args.output + "0x%05x.bin" % off, "wb") f.write(data) f.close() elif args.operation == 'read_mac': mac = esp.read_mac() print 'MAC: %s' % ':'.join(map(lambda x: '%02x' % x, mac)) elif args.operation == 'flash_id': flash_id = esp.flash_id() print 'Manufacturer: %02x' % (flash_id & 0xff) print 'Device: %02x%02x' % ((flash_id >> 8) & 0xff, (flash_id >> 16) & 0xff) elif args.operation == 'read_flash': print 'Please wait...' file(args.filename, 'wb').write(esp.flash_read(args.address, 1024, div_roundup(args.size, 1024))[:args.size]) elif args.operation == 'erase_flash': esp.flash_erase() if __name__ == '__main__': try: main() except FatalError as e: print '\nA fatal error occurred: %s' % e sys.exit(2)
gpl-2.0
1,992,661,783,218,690,600
38.709497
152
0.573579
false
3.507958
false
false
false
eharney/cinder
cinder/api/v3/attachments.py
1
11362
# Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. """The volumes attachments API.""" from oslo_log import log as logging import webob from cinder.api import common from cinder.api import microversions as mv from cinder.api.openstack import wsgi from cinder.api.v3.views import attachments as attachment_views from cinder import exception from cinder.i18n import _ from cinder import objects from cinder import utils from cinder.volume import api as volume_api LOG = logging.getLogger(__name__) class AttachmentsController(wsgi.Controller): """The Attachments API controller for the OpenStack API.""" _view_builder_class = attachment_views.ViewBuilder allowed_filters = {'volume_id', 'status', 'instance_id', 'attach_status'} def __init__(self, ext_mgr=None): """Initialize controller class.""" self.volume_api = volume_api.API() self.ext_mgr = ext_mgr super(AttachmentsController, self).__init__() @wsgi.Controller.api_version(mv.NEW_ATTACH) def show(self, req, id): """Return data about the given attachment.""" context = req.environ['cinder.context'] attachment = objects.VolumeAttachment.get_by_id(context, id) return attachment_views.ViewBuilder.detail(attachment) @wsgi.Controller.api_version(mv.NEW_ATTACH) def index(self, req): """Return a summary list of attachments.""" attachments = self._items(req) return attachment_views.ViewBuilder.list(attachments) @wsgi.Controller.api_version(mv.NEW_ATTACH) def detail(self, req): """Return a detailed list of attachments.""" attachments = self._items(req) return attachment_views.ViewBuilder.list(attachments, detail=True) @common.process_general_filtering('attachment') def _process_attachment_filtering(self, context=None, filters=None, req_version=None): utils.remove_invalid_filter_options(context, filters, self.allowed_filters) def _items(self, req): """Return a list of attachments, transformed through view builder.""" context = req.environ['cinder.context'] req_version = req.api_version_request # Pop out non search_opts and create local variables search_opts = req.GET.copy() sort_keys, sort_dirs = common.get_sort_params(search_opts) marker, limit, offset = common.get_pagination_params(search_opts) self._process_attachment_filtering(context=context, filters=search_opts, req_version=req_version) if search_opts.get('instance_id', None): search_opts['instance_uuid'] = search_opts.pop('instance_id', None) if context.is_admin and 'all_tenants' in search_opts: del search_opts['all_tenants'] return objects.VolumeAttachmentList.get_all( context, search_opts=search_opts, marker=marker, limit=limit, offset=offset, sort_keys=sort_keys, sort_direction=sort_dirs) else: return objects.VolumeAttachmentList.get_all_by_project( context, context.project_id, search_opts=search_opts, marker=marker, limit=limit, offset=offset, sort_keys=sort_keys, sort_direction=sort_dirs) @wsgi.Controller.api_version(mv.NEW_ATTACH) @wsgi.response(202) def create(self, req, body): """Create an attachment. This method can be used to create an empty attachment (reserve) or to create and initialize a volume attachment based on the provided input parameters. If the caller does not yet have the connector information but needs to reserve an attachment for the volume (ie Nova BootFromVolume) the create can be called with just the volume-uuid and the server identifier. This will reserve an attachment, mark the volume as reserved and prevent any new attachment_create calls from being made until the attachment is updated (completed). The alternative is that the connection can be reserved and initialized all at once with a single call if the caller has all of the required information (connector data) at the time of the call. NOTE: In Nova terms server == instance, the server_id parameter referenced below is the UUID of the Instance, for non-nova consumers this can be a server UUID or some other arbitrary unique identifier. Expected format of the input parameter 'body': .. code-block:: json { "attachment": { "volume_uuid": "volume-uuid", "instance_uuid": "nova-server-uuid", "connector": "null|<connector-object>" } } Example connector: .. code-block:: json { "connector": { "initiator": "iqn.1993-08.org.debian:01:cad181614cec", "ip":"192.168.1.20", "platform": "x86_64", "host": "tempest-1", "os_type": "linux2", "multipath": false, "mountpoint": "/dev/vdb", "mode": "null|rw|ro" } } NOTE all that's required for a reserve is volume_uuid and an instance_uuid. returns: A summary view of the attachment object """ context = req.environ['cinder.context'] instance_uuid = body['attachment'].get('instance_uuid', None) if not instance_uuid: raise webob.exc.HTTPBadRequest( explanation=_("Must specify 'instance_uuid' " "to create attachment.")) volume_uuid = body['attachment'].get('volume_uuid', None) if not volume_uuid: raise webob.exc.HTTPBadRequest( explanation=_("Must specify 'volume_uuid' " "to create attachment.")) volume_ref = objects.Volume.get_by_id( context, volume_uuid) connector = body['attachment'].get('connector', None) err_msg = None try: attachment_ref = ( self.volume_api.attachment_create(context, volume_ref, instance_uuid, connector=connector)) except exception.NotAuthorized: raise except exception.CinderException as ex: err_msg = _( "Unable to create attachment for volume (%s).") % ex.msg LOG.exception(err_msg) except Exception as ex: err_msg = _("Unable to create attachment for volume.") LOG.exception(err_msg) finally: if err_msg: raise webob.exc.HTTPInternalServerError(explanation=err_msg) return attachment_views.ViewBuilder.detail(attachment_ref) @wsgi.Controller.api_version(mv.NEW_ATTACH) def update(self, req, id, body): """Update an attachment record. Update a reserved attachment record with connector information and set up the appropriate connection_info from the driver. Expected format of the input parameter 'body': .. code:: json { "attachment": { "connector": { "initiator": "iqn.1993-08.org.debian:01:cad181614cec", "ip":"192.168.1.20", "platform": "x86_64", "host": "tempest-1", "os_type": "linux2", "multipath": False, "mountpoint": "/dev/vdb", "mode": None|"rw"|"ro", } } } """ context = req.environ['cinder.context'] attachment_ref = ( objects.VolumeAttachment.get_by_id(context, id)) connector = body['attachment'].get('connector', None) if not connector: raise webob.exc.HTTPBadRequest( explanation=_("Must specify 'connector' " "to update attachment.")) err_msg = None try: attachment_ref = ( self.volume_api.attachment_update(context, attachment_ref, connector)) except exception.NotAuthorized: raise except exception.CinderException as ex: err_msg = ( _("Unable to update attachment.(%s).") % ex.msg) LOG.exception(err_msg) except Exception: err_msg = _("Unable to update the attachment.") LOG.exception(err_msg) finally: if err_msg: raise webob.exc.HTTPInternalServerError(explanation=err_msg) # TODO(jdg): Test this out some more, do we want to return and object # or a dict? return attachment_views.ViewBuilder.detail(attachment_ref) @wsgi.Controller.api_version(mv.NEW_ATTACH) def delete(self, req, id): """Delete an attachment. Disconnects/Deletes the specified attachment, returns a list of any known shared attachment-id's for the effected backend device. returns: A summary list of any attachments sharing this connection """ context = req.environ['cinder.context'] attachment = objects.VolumeAttachment.get_by_id(context, id) attachments = self.volume_api.attachment_delete(context, attachment) return attachment_views.ViewBuilder.list(attachments) @wsgi.response(202) @wsgi.Controller.api_version(mv.NEW_ATTACH_COMPLETION) @wsgi.action('os-complete') def complete(self, req, id, body): """Mark a volume attachment process as completed (in-use).""" context = req.environ['cinder.context'] attachment_ref = ( objects.VolumeAttachment.get_by_id(context, id)) volume_ref = objects.Volume.get_by_id( context, attachment_ref.volume_id) attachment_ref.update({'attach_status': 'attached'}) attachment_ref.save() volume_ref.update({'status': 'in-use', 'attach_status': 'attached'}) volume_ref.save() def create_resource(ext_mgr): """Create the wsgi resource for this controller.""" return wsgi.Resource(AttachmentsController(ext_mgr))
apache-2.0
-5,867,306,877,933,996,000
38.451389
79
0.58106
false
4.6
false
false
false
turbokongen/home-assistant
homeassistant/components/plex/config_flow.py
1
15991
"""Config flow for Plex.""" import copy import logging from aiohttp import web_response import plexapi.exceptions from plexapi.gdm import GDM from plexauth import PlexAuth import requests.exceptions import voluptuous as vol from homeassistant import config_entries from homeassistant.components.http.view import HomeAssistantView from homeassistant.components.media_player import DOMAIN as MP_DOMAIN from homeassistant.const import ( CONF_CLIENT_ID, CONF_HOST, CONF_PORT, CONF_SOURCE, CONF_SSL, CONF_TOKEN, CONF_URL, CONF_VERIFY_SSL, ) from homeassistant.core import callback from homeassistant.helpers.aiohttp_client import async_get_clientsession import homeassistant.helpers.config_validation as cv from homeassistant.helpers.network import get_url from .const import ( # pylint: disable=unused-import AUTH_CALLBACK_NAME, AUTH_CALLBACK_PATH, AUTOMATIC_SETUP_STRING, CONF_IGNORE_NEW_SHARED_USERS, CONF_IGNORE_PLEX_WEB_CLIENTS, CONF_MONITORED_USERS, CONF_SERVER, CONF_SERVER_IDENTIFIER, CONF_USE_EPISODE_ART, DEFAULT_PORT, DEFAULT_SSL, DEFAULT_VERIFY_SSL, DOMAIN, MANUAL_SETUP_STRING, PLEX_SERVER_CONFIG, SERVERS, X_PLEX_DEVICE_NAME, X_PLEX_PLATFORM, X_PLEX_PRODUCT, X_PLEX_VERSION, ) from .errors import NoServersFound, ServerNotSpecified from .server import PlexServer _LOGGER = logging.getLogger(__package__) @callback def configured_servers(hass): """Return a set of the configured Plex servers.""" return { entry.data[CONF_SERVER_IDENTIFIER] for entry in hass.config_entries.async_entries(DOMAIN) } async def async_discover(hass): """Scan for available Plex servers.""" gdm = GDM() await hass.async_add_executor_job(gdm.scan) for server_data in gdm.entries: await hass.config_entries.flow.async_init( DOMAIN, context={CONF_SOURCE: config_entries.SOURCE_INTEGRATION_DISCOVERY}, data=server_data, ) class PlexFlowHandler(config_entries.ConfigFlow, domain=DOMAIN): """Handle a Plex config flow.""" VERSION = 1 CONNECTION_CLASS = config_entries.CONN_CLASS_LOCAL_PUSH @staticmethod @callback def async_get_options_flow(config_entry): """Get the options flow for this handler.""" return PlexOptionsFlowHandler(config_entry) def __init__(self): """Initialize the Plex flow.""" self.current_login = {} self.available_servers = None self.plexauth = None self.token = None self.client_id = None self._manual = False async def async_step_user( self, user_input=None, errors=None ): # pylint: disable=arguments-differ """Handle a flow initialized by the user.""" if user_input is not None: return await self.async_step_plex_website_auth() if self.show_advanced_options: return await self.async_step_user_advanced(errors=errors) return self.async_show_form(step_id="user", errors=errors) async def async_step_user_advanced(self, user_input=None, errors=None): """Handle an advanced mode flow initialized by the user.""" if user_input is not None: if user_input.get("setup_method") == MANUAL_SETUP_STRING: self._manual = True return await self.async_step_manual_setup() return await self.async_step_plex_website_auth() data_schema = vol.Schema( { vol.Required("setup_method", default=AUTOMATIC_SETUP_STRING): vol.In( [AUTOMATIC_SETUP_STRING, MANUAL_SETUP_STRING] ) } ) return self.async_show_form( step_id="user_advanced", data_schema=data_schema, errors=errors ) async def async_step_manual_setup(self, user_input=None, errors=None): """Begin manual configuration.""" if user_input is not None and errors is None: user_input.pop(CONF_URL, None) host = user_input.get(CONF_HOST) if host: port = user_input[CONF_PORT] prefix = "https" if user_input.get(CONF_SSL) else "http" user_input[CONF_URL] = f"{prefix}://{host}:{port}" elif CONF_TOKEN not in user_input: return await self.async_step_manual_setup( user_input=user_input, errors={"base": "host_or_token"} ) return await self.async_step_server_validate(user_input) previous_input = user_input or {} data_schema = vol.Schema( { vol.Optional( CONF_HOST, description={"suggested_value": previous_input.get(CONF_HOST)}, ): str, vol.Required( CONF_PORT, default=previous_input.get(CONF_PORT, DEFAULT_PORT) ): int, vol.Required( CONF_SSL, default=previous_input.get(CONF_SSL, DEFAULT_SSL) ): bool, vol.Required( CONF_VERIFY_SSL, default=previous_input.get(CONF_VERIFY_SSL, DEFAULT_VERIFY_SSL), ): bool, vol.Optional( CONF_TOKEN, description={"suggested_value": previous_input.get(CONF_TOKEN)}, ): str, } ) return self.async_show_form( step_id="manual_setup", data_schema=data_schema, errors=errors ) async def async_step_server_validate(self, server_config): """Validate a provided configuration.""" errors = {} self.current_login = server_config plex_server = PlexServer(self.hass, server_config) try: await self.hass.async_add_executor_job(plex_server.connect) except NoServersFound: _LOGGER.error("No servers linked to Plex account") errors["base"] = "no_servers" except (plexapi.exceptions.BadRequest, plexapi.exceptions.Unauthorized): _LOGGER.error("Invalid credentials provided, config not created") errors[CONF_TOKEN] = "faulty_credentials" except requests.exceptions.SSLError as error: _LOGGER.error("SSL certificate error: [%s]", error) errors["base"] = "ssl_error" except (plexapi.exceptions.NotFound, requests.exceptions.ConnectionError): server_identifier = ( server_config.get(CONF_URL) or plex_server.server_choice or "Unknown" ) _LOGGER.error("Plex server could not be reached: %s", server_identifier) errors[CONF_HOST] = "not_found" except ServerNotSpecified as available_servers: self.available_servers = available_servers.args[0] return await self.async_step_select_server() except Exception as error: # pylint: disable=broad-except _LOGGER.exception("Unknown error connecting to Plex server: %s", error) return self.async_abort(reason="unknown") if errors: if self._manual: return await self.async_step_manual_setup( user_input=server_config, errors=errors ) return await self.async_step_user(errors=errors) server_id = plex_server.machine_identifier url = plex_server.url_in_use token = server_config.get(CONF_TOKEN) entry_config = {CONF_URL: url} if self.client_id: entry_config[CONF_CLIENT_ID] = self.client_id if token: entry_config[CONF_TOKEN] = token if url.startswith("https"): entry_config[CONF_VERIFY_SSL] = server_config.get( CONF_VERIFY_SSL, DEFAULT_VERIFY_SSL ) data = { CONF_SERVER: plex_server.friendly_name, CONF_SERVER_IDENTIFIER: server_id, PLEX_SERVER_CONFIG: entry_config, } entry = await self.async_set_unique_id(server_id) if self.context[CONF_SOURCE] == config_entries.SOURCE_REAUTH: self.hass.config_entries.async_update_entry(entry, data=data) _LOGGER.debug("Updated config entry for %s", plex_server.friendly_name) await self.hass.config_entries.async_reload(entry.entry_id) return self.async_abort(reason="reauth_successful") self._abort_if_unique_id_configured() _LOGGER.debug("Valid config created for %s", plex_server.friendly_name) return self.async_create_entry(title=plex_server.friendly_name, data=data) async def async_step_select_server(self, user_input=None): """Use selected Plex server.""" config = dict(self.current_login) if user_input is not None: config[CONF_SERVER] = user_input[CONF_SERVER] return await self.async_step_server_validate(config) configured = configured_servers(self.hass) available_servers = [ name for (name, server_id) in self.available_servers if server_id not in configured ] if not available_servers: return self.async_abort(reason="all_configured") if len(available_servers) == 1: config[CONF_SERVER] = available_servers[0] return await self.async_step_server_validate(config) return self.async_show_form( step_id="select_server", data_schema=vol.Schema( {vol.Required(CONF_SERVER): vol.In(available_servers)} ), errors={}, ) async def async_step_integration_discovery(self, discovery_info): """Handle GDM discovery.""" machine_identifier = discovery_info["data"]["Resource-Identifier"] await self.async_set_unique_id(machine_identifier) self._abort_if_unique_id_configured() host = f"{discovery_info['from'][0]}:{discovery_info['data']['Port']}" name = discovery_info["data"]["Name"] self.context["title_placeholders"] = { "host": host, "name": name, } return await self.async_step_user() async def async_step_plex_website_auth(self): """Begin external auth flow on Plex website.""" self.hass.http.register_view(PlexAuthorizationCallbackView) hass_url = get_url(self.hass) headers = {"Origin": hass_url} payload = { "X-Plex-Device-Name": X_PLEX_DEVICE_NAME, "X-Plex-Version": X_PLEX_VERSION, "X-Plex-Product": X_PLEX_PRODUCT, "X-Plex-Device": self.hass.config.location_name, "X-Plex-Platform": X_PLEX_PLATFORM, "X-Plex-Model": "Plex OAuth", } session = async_get_clientsession(self.hass) self.plexauth = PlexAuth(payload, session, headers) await self.plexauth.initiate_auth() forward_url = f"{hass_url}{AUTH_CALLBACK_PATH}?flow_id={self.flow_id}" auth_url = self.plexauth.auth_url(forward_url) return self.async_external_step(step_id="obtain_token", url=auth_url) async def async_step_obtain_token(self, user_input=None): """Obtain token after external auth completed.""" token = await self.plexauth.token(10) if not token: return self.async_external_step_done(next_step_id="timed_out") self.token = token self.client_id = self.plexauth.client_identifier return self.async_external_step_done(next_step_id="use_external_token") async def async_step_timed_out(self, user_input=None): """Abort flow when time expires.""" return self.async_abort(reason="token_request_timeout") async def async_step_use_external_token(self, user_input=None): """Continue server validation with external token.""" server_config = {CONF_TOKEN: self.token} return await self.async_step_server_validate(server_config) async def async_step_reauth(self, data): """Handle a reauthorization flow request.""" self.current_login = dict(data) return await self.async_step_user() class PlexOptionsFlowHandler(config_entries.OptionsFlow): """Handle Plex options.""" def __init__(self, config_entry): """Initialize Plex options flow.""" self.options = copy.deepcopy(dict(config_entry.options)) self.server_id = config_entry.data[CONF_SERVER_IDENTIFIER] async def async_step_init(self, user_input=None): """Manage the Plex options.""" return await self.async_step_plex_mp_settings() async def async_step_plex_mp_settings(self, user_input=None): """Manage the Plex media_player options.""" plex_server = self.hass.data[DOMAIN][SERVERS][self.server_id] if user_input is not None: self.options[MP_DOMAIN][CONF_USE_EPISODE_ART] = user_input[ CONF_USE_EPISODE_ART ] self.options[MP_DOMAIN][CONF_IGNORE_NEW_SHARED_USERS] = user_input[ CONF_IGNORE_NEW_SHARED_USERS ] self.options[MP_DOMAIN][CONF_IGNORE_PLEX_WEB_CLIENTS] = user_input[ CONF_IGNORE_PLEX_WEB_CLIENTS ] account_data = { user: {"enabled": bool(user in user_input[CONF_MONITORED_USERS])} for user in plex_server.accounts } self.options[MP_DOMAIN][CONF_MONITORED_USERS] = account_data return self.async_create_entry(title="", data=self.options) available_accounts = {name: name for name in plex_server.accounts} available_accounts[plex_server.owner] += " [Owner]" default_accounts = plex_server.accounts known_accounts = set(plex_server.option_monitored_users) if known_accounts: default_accounts = { user for user in plex_server.option_monitored_users if plex_server.option_monitored_users[user]["enabled"] } for user in plex_server.accounts: if user not in known_accounts: available_accounts[user] += " [New]" if not plex_server.option_ignore_new_shared_users: for new_user in plex_server.accounts - known_accounts: default_accounts.add(new_user) return self.async_show_form( step_id="plex_mp_settings", data_schema=vol.Schema( { vol.Required( CONF_USE_EPISODE_ART, default=plex_server.option_use_episode_art, ): bool, vol.Optional( CONF_MONITORED_USERS, default=default_accounts ): cv.multi_select(available_accounts), vol.Required( CONF_IGNORE_NEW_SHARED_USERS, default=plex_server.option_ignore_new_shared_users, ): bool, vol.Required( CONF_IGNORE_PLEX_WEB_CLIENTS, default=plex_server.option_ignore_plexweb_clients, ): bool, } ), ) class PlexAuthorizationCallbackView(HomeAssistantView): """Handle callback from external auth.""" url = AUTH_CALLBACK_PATH name = AUTH_CALLBACK_NAME requires_auth = False async def get(self, request): """Receive authorization confirmation.""" hass = request.app["hass"] await hass.config_entries.flow.async_configure( flow_id=request.query["flow_id"], user_input=None ) return web_response.Response( headers={"content-type": "text/html"}, text="<script>window.close()</script>Success! This window can be closed", )
apache-2.0
1,489,924,755,053,045,500
36.36215
85
0.598837
false
4.022893
true
false
false
italomaia/turtle-linux
games/Dynamite/pgu/test.py
1
1624
import pygame from pygame.locals import * import gui screen = pygame.display.set_mode( (640, 480), FULLSCREEN ) # try adding DOUBLEBUF | HWSURFACE # pygame.mouse.set_visible(0) app = gui.App() c = gui.Container(width=640,height=480) ## ## dialog 1 ## t1 = gui.Table() t1.tr() t1.add(gui.Label("Gal Test")) t2 = gui.Table() t2.tr() t2.add(gui.Label("Gui Widgets")) t2.add(gui.Input()) t2.tr() t2.add(gui.Label("Button")) t2.add(gui.Button("Click Me!")) d1 = gui.Dialog(t1, t2) c.add(d1, 50, 150) ## ## dialog 2 ## t3 = gui.Table() t3.tr() t3.add(gui.Label("Another one")) t4 = gui.Table() t4.tr() t4.add(gui.Label("Name")) t4.add(gui.Input()) t4.tr() t4.add(gui.Label("Ohh")) b1 = gui.Button("OK") t4.add(b1) d2 = gui.Dialog(t3, t4) c.add(d2, 50, 300) ## ## some labels ## l1 = gui.Label("Suppose this is a menu", color=(255, 255, 255) ) c.add(l1, 50, 50) l2 = gui.Label("Click <SPACE> to hide top dialog", color=(255, 255, 255) ) c.add(l2, 50, 75) l3 = gui.Label("Opps... Did it happen?", color=(255, 255, 255) ) ## ## app begins ## app.init(widget=c,screen=screen) FRAME_EVT = USEREVENT + 1 pygame.event.Event(FRAME_EVT) pygame.time.set_timer(FRAME_EVT, 30) _quit = 0 while _quit == 0: event = pygame.event.wait() if event.type == FRAME_EVT: pygame.display.flip() continue if event.type == KEYDOWN: if event.key == K_ESCAPE: _quit = 1 continue elif event.key == K_SPACE: d1.close() c.add(l3, 100, 100) app._event(event) screen.fill((0,0,0)) app.paint(screen)
gpl-3.0
4,685,452,212,621,695,000
14.037037
68
0.589286
false
2.47561
false
false
false
wfx/epack
epack/libarchive/ffi.py
1
7623
# This file is part of a program licensed under the terms of the GNU Lesser # General Public License version 2 (or at your option any later version) # as published by the Free Software Foundation: http://www.gnu.org/licenses/ from __future__ import division, print_function, unicode_literals from ctypes import ( c_char_p, c_int, c_uint, c_longlong, c_size_t, c_void_p, c_wchar_p, CFUNCTYPE, POINTER, ) try: from ctypes import c_ssize_t except ImportError: from ctypes import c_longlong as c_ssize_t import ctypes from ctypes.util import find_library import logging import mmap import os from .exception import ArchiveError logger = logging.getLogger('libarchive') page_size = mmap.PAGESIZE libarchive_path = os.environ.get('LIBARCHIVE') or \ find_library('archive') or \ find_library('libarchive') or \ 'libarchive.so' libarchive = ctypes.cdll.LoadLibrary(libarchive_path) # Constants ARCHIVE_EOF = 1 # Found end of archive. ARCHIVE_OK = 0 # Operation was successful. ARCHIVE_RETRY = -10 # Retry might succeed. ARCHIVE_WARN = -20 # Partial success. ARCHIVE_FAILED = -25 # Current operation cannot complete. ARCHIVE_FATAL = -30 # No more operations are possible. AE_IFMT = 0o170000 AE_IFREG = 0o100000 AE_IFLNK = 0o120000 AE_IFSOCK = 0o140000 AE_IFCHR = 0o020000 AE_IFBLK = 0o060000 AE_IFDIR = 0o040000 AE_IFIFO = 0o010000 # Callback types WRITE_CALLBACK = CFUNCTYPE( c_ssize_t, c_void_p, c_void_p, POINTER(c_void_p), c_size_t ) OPEN_CALLBACK = CFUNCTYPE(c_int, c_void_p, c_void_p) CLOSE_CALLBACK = CFUNCTYPE(c_int, c_void_p, c_void_p) VOID_CB = lambda *_: ARCHIVE_OK # Type aliases, for readability c_archive_p = c_void_p c_archive_entry_p = c_void_p # Helper functions def _error_string(archive_p): msg = error_string(archive_p) if msg is None: return try: return msg.decode('ascii') except UnicodeDecodeError: return msg def archive_error(archive_p, retcode): msg = _error_string(archive_p) raise ArchiveError(msg, errno(archive_p), retcode, archive_p) def check_null(ret, func, args): if ret is None: raise ArchiveError(func.__name__+' returned NULL') return ret def check_int(retcode, func, args): if retcode >= 0: return retcode elif retcode == ARCHIVE_WARN: logger.warning(_error_string(args[0])) return retcode else: raise archive_error(args[0], retcode) def ffi(name, argtypes, restype, errcheck=None): f = getattr(libarchive, 'archive_'+name) f.argtypes = argtypes f.restype = restype if errcheck: f.errcheck = errcheck globals()[name] = f return f # FFI declarations # archive_util errno = ffi('errno', [c_archive_p], c_int) error_string = ffi('error_string', [c_archive_p], c_char_p) # archive_entry ffi('entry_new', [], c_archive_entry_p, check_null) ffi('entry_filetype', [c_archive_entry_p], c_int) ffi('entry_mtime', [c_archive_entry_p], c_int) ffi('entry_perm', [c_archive_entry_p], c_int) ffi('entry_pathname_w', [c_archive_entry_p], c_wchar_p) ffi('entry_sourcepath', [c_archive_entry_p], c_char_p) ffi('entry_size', [c_archive_entry_p], c_longlong) ffi('entry_size_is_set', [c_archive_entry_p], c_int) ffi('entry_update_pathname_utf8', [c_archive_entry_p, c_char_p], None) ffi('entry_clear', [c_archive_entry_p], c_archive_entry_p) ffi('entry_free', [c_archive_entry_p], None) # archive_read ffi('read_new', [], c_archive_p, check_null) READ_FORMATS = set(( '7zip', 'all', 'ar', 'cab', 'cpio', 'empty', 'iso9660', 'lha', 'mtree', 'rar', 'raw', 'tar', 'xar', 'zip' )) for f_name in list(READ_FORMATS): try: ffi('read_support_format_'+f_name, [c_archive_p], c_int, check_int) except AttributeError: # pragma: no cover logger.warning('read format "%s" is not supported' % f_name) READ_FORMATS.remove(f_name) READ_FILTERS = set(( 'all', 'bzip2', 'compress', 'grzip', 'gzip', 'lrzip', 'lzip', 'lzma', 'lzop', 'none', 'rpm', 'uu', 'xz' )) for f_name in list(READ_FILTERS): try: ffi('read_support_filter_'+f_name, [c_archive_p], c_int, check_int) except AttributeError: # pragma: no cover logger.warning('read filter "%s" is not supported' % f_name) READ_FILTERS.remove(f_name) ffi('read_open_fd', [c_archive_p, c_int, c_size_t], c_int, check_int) ffi('read_open_filename_w', [c_archive_p, c_wchar_p, c_size_t], c_int, check_int) ffi('read_open_memory', [c_archive_p, c_void_p, c_size_t], c_int, check_int) ffi('read_next_header', [c_archive_p, POINTER(c_void_p)], c_int, check_int) ffi('read_next_header2', [c_archive_p, c_void_p], c_int, check_int) ffi('read_close', [c_archive_p], c_int, check_int) ffi('read_free', [c_archive_p], c_int, check_int) # archive_read_disk ffi('read_disk_new', [], c_archive_p, check_null) ffi('read_disk_set_standard_lookup', [c_archive_p], c_int, check_int) ffi('read_disk_open', [c_archive_p, c_char_p], c_int, check_int) ffi('read_disk_open_w', [c_archive_p, c_wchar_p], c_int, check_int) ffi('read_disk_descend', [c_archive_p], c_int, check_int) # archive_read_data ffi('read_data_block', [c_archive_p, POINTER(c_void_p), POINTER(c_size_t), POINTER(c_longlong)], c_int, check_int) ffi('read_data', [c_archive_p, c_void_p, c_size_t], c_ssize_t, check_int) ffi('read_data_skip', [c_archive_p], c_int, check_int) # archive_write ffi('write_new', [], c_archive_p, check_null) ffi('write_disk_new', [], c_archive_p, check_null) ffi('write_disk_set_options', [c_archive_p, c_int], c_int, check_int) WRITE_FORMATS = set(( '7zip', 'ar_bsd', 'ar_svr4', 'cpio', 'cpio_newc', 'gnutar', 'iso9660', 'mtree', 'mtree_classic', 'pax', 'pax_restricted', 'shar', 'shar_dump', 'ustar', 'v7tar', 'xar', 'zip' )) for f_name in list(WRITE_FORMATS): try: ffi('write_set_format_'+f_name, [c_archive_p], c_int, check_int) except AttributeError: # pragma: no cover logger.warning('write format "%s" is not supported' % f_name) WRITE_FORMATS.remove(f_name) WRITE_FILTERS = set(( 'b64encode', 'bzip2', 'compress', 'grzip', 'gzip', 'lrzip', 'lzip', 'lzma', 'lzop', 'uuencode', 'xz' )) for f_name in list(WRITE_FILTERS): try: ffi('write_add_filter_'+f_name, [c_archive_p], c_int, check_int) except AttributeError: # pragma: no cover logger.warning('write filter "%s" is not supported' % f_name) WRITE_FILTERS.remove(f_name) ffi('write_open', [c_archive_p, c_void_p, OPEN_CALLBACK, WRITE_CALLBACK, CLOSE_CALLBACK], c_int, check_int) ffi('write_open_fd', [c_archive_p, c_int], c_int, check_int) ffi('write_open_filename', [c_archive_p, c_char_p], c_int, check_int) ffi('write_open_filename_w', [c_archive_p, c_wchar_p], c_int, check_int) ffi('write_open_memory', [c_archive_p, c_void_p, c_size_t, POINTER(c_size_t)], c_int, check_int) ffi('write_get_bytes_in_last_block', [c_archive_p], c_int, check_int) ffi('write_get_bytes_per_block', [c_archive_p], c_int, check_int) ffi('write_set_bytes_in_last_block', [c_archive_p, c_int], c_int, check_int) ffi('write_set_bytes_per_block', [c_archive_p, c_int], c_int, check_int) ffi('write_header', [c_archive_p, c_void_p], c_int, check_int) ffi('write_data', [c_archive_p, c_void_p, c_size_t], c_ssize_t, check_int) ffi('write_data_block', [c_archive_p, c_void_p, c_size_t, c_longlong], c_int, check_int) ffi('write_finish_entry', [c_archive_p], c_int, check_int) ffi('write_close', [c_archive_p], c_int, check_int) ffi('write_free', [c_archive_p], c_int, check_int)
gpl-3.0
-946,142,099,526,545,800
30.114286
79
0.647908
false
2.710882
false
false
false
chintak/scikit-image
skimage/feature/util.py
1
4726
import numpy as np from skimage.util import img_as_float class FeatureDetector(object): def __init__(self): self.keypoints_ = np.array([]) def detect(self, image): """Detect keypoints in image. Parameters ---------- image : 2D array Input image. """ raise NotImplementedError() class DescriptorExtractor(object): def __init__(self): self.descriptors_ = np.array([]) def extract(self, image, keypoints): """Extract feature descriptors in image for given keypoints. Parameters ---------- image : 2D array Input image. keypoints : (N, 2) array Keypoint locations as ``(row, col)``. """ raise NotImplementedError() def plot_matches(ax, image1, image2, keypoints1, keypoints2, matches, keypoints_color='k', matches_color=None, only_matches=False): """Plot matched features. Parameters ---------- ax : matplotlib.axes.Axes Matches and image are drawn in this ax. image1 : (N, M [, 3]) array First grayscale or color image. image2 : (N, M [, 3]) array Second grayscale or color image. keypoints1 : (K1, 2) array First keypoint coordinates as ``(row, col)``. keypoints2 : (K2, 2) array Second keypoint coordinates as ``(row, col)``. matches : (Q, 2) array Indices of corresponding matches in first and second set of descriptors, where ``matches[:, 0]`` denote the indices in the first and ``matches[:, 1]`` the indices in the second set of descriptors. keypoints_color : matplotlib color, optional Color for keypoint locations. matches_color : matplotlib color, optional Color for lines which connect keypoint matches. By default the color is chosen randomly. only_matches : bool, optional Whether to only plot matches and not plot the keypoint locations. """ image1 = img_as_float(image1) image2 = img_as_float(image2) new_shape1 = list(image1.shape) new_shape2 = list(image2.shape) if image1.shape[0] < image2.shape[0]: new_shape1[0] = image2.shape[0] elif image1.shape[0] > image2.shape[0]: new_shape2[0] = image1.shape[0] if image1.shape[1] < image2.shape[1]: new_shape1[1] = image2.shape[1] elif image1.shape[1] > image2.shape[1]: new_shape2[1] = image1.shape[1] if new_shape1 != image1.shape: new_image1 = np.zeros(new_shape1, dtype=image1.dtype) new_image1[:image1.shape[0], :image1.shape[1]] = image1 image1 = new_image1 if new_shape2 != image2.shape: new_image2 = np.zeros(new_shape2, dtype=image2.dtype) new_image2[:image2.shape[0], :image2.shape[1]] = image2 image2 = new_image2 image = np.concatenate([image1, image2], axis=1) offset = image1.shape if not only_matches: ax.scatter(keypoints1[:, 1], keypoints1[:, 0], facecolors='none', edgecolors=keypoints_color) ax.scatter(keypoints2[:, 1] + offset[1], keypoints2[:, 0], facecolors='none', edgecolors=keypoints_color) ax.imshow(image) ax.axis((0, 2 * offset[1], offset[0], 0)) for i in range(matches.shape[0]): idx1 = matches[i, 0] idx2 = matches[i, 1] if matches_color is None: color = np.random.rand(3, 1) else: color = matches_color ax.plot((keypoints1[idx1, 1], keypoints2[idx2, 1] + offset[1]), (keypoints1[idx1, 0], keypoints2[idx2, 0]), '-', color=color) def _prepare_grayscale_input_2D(image): image = np.squeeze(image) if image.ndim != 2: raise ValueError("Only 2-D gray-scale images supported.") return img_as_float(image) def _mask_border_keypoints(image_shape, keypoints, distance): """Mask coordinates that are within certain distance from the image border. Parameters ---------- image_shape : (2, ) array_like Shape of the image as ``(rows, cols)``. keypoints : (N, 2) array Keypoint coordinates as ``(rows, cols)``. distance : int Image border distance. Returns ------- mask : (N, ) bool array Mask indicating if pixels are within the image (``True``) or in the border region of the image (``False``). """ rows = image_shape[0] cols = image_shape[1] mask = (((distance - 1) < keypoints[:, 0]) & (keypoints[:, 0] < (rows - distance + 1)) & ((distance - 1) < keypoints[:, 1]) & (keypoints[:, 1] < (cols - distance + 1))) return mask
bsd-3-clause
973,310,001,294,730,000
28.354037
79
0.585485
false
3.71249
false
false
false
pavlov99/jsonapi
jsonapi/utils.py
1
2220
""" JSON:API utils.""" class _classproperty(property): """ Implement property behaviour for classes. class A(): @_classproperty @classmethod def name(cls): return cls.__name__ """ def __get__(self, obj, type_): return self.fget.__get__(None, type_)() def _cached(f): """ Decorator that makes a method cached.""" attr_name = '_cached_' + f.__name__ def wrapper(obj, *args, **kwargs): if not hasattr(obj, attr_name): setattr(obj, attr_name, f(obj, *args, **kwargs)) return getattr(obj, attr_name) return wrapper classproperty = lambda f: _classproperty(classmethod(f)) cached_property = lambda f: property(_cached(f)) cached_classproperty = lambda f: classproperty(_cached(f)) class Choices(object): """ Choices.""" def __init__(self, *choices): self._choices = [] self._choice_dict = {} for choice in choices: if isinstance(choice, (list, tuple)): if len(choice) == 2: choice = (choice[0], choice[1], choice[1]) elif len(choice) != 3: raise ValueError( "Choices can't handle a list/tuple of length {0}, only\ 2 or 3".format(choice)) else: choice = (choice, choice, choice) self._choices.append((choice[0], choice[2])) self._choice_dict[choice[1]] = choice[0] def __getattr__(self, attname): try: return self._choice_dict[attname] except KeyError: raise AttributeError(attname) def __iter__(self): return iter(self._choices) def __getitem__(self, index): return self._choices[index] def __delitem__(self, index): del self._choices[index] def __setitem__(self, index, value): self._choices[index] = value def __repr__(self): return "{0}({1})".format( self.__class__.__name__, self._choices ) def __len__(self): return len(self._choices) def __contains__(self, element): return element in self._choice_dict.values()
mit
-3,830,283,769,636,155,400
23.94382
79
0.530631
false
4.157303
false
false
false
NicWayand/xray
xarray/plot/utils.py
1
6442
import pkg_resources import numpy as np import pandas as pd from ..core.pycompat import basestring def _load_default_cmap(fname='default_colormap.csv'): """ Returns viridis color map """ from matplotlib.colors import LinearSegmentedColormap # Not sure what the first arg here should be f = pkg_resources.resource_stream(__name__, fname) cm_data = pd.read_csv(f, header=None).values return LinearSegmentedColormap.from_list('viridis', cm_data) def _determine_extend(calc_data, vmin, vmax): extend_min = calc_data.min() < vmin extend_max = calc_data.max() > vmax if extend_min and extend_max: extend = 'both' elif extend_min: extend = 'min' elif extend_max: extend = 'max' else: extend = 'neither' return extend def _build_discrete_cmap(cmap, levels, extend, filled): """ Build a discrete colormap and normalization of the data. """ import matplotlib as mpl if not filled: # non-filled contour plots extend = 'max' if extend == 'both': ext_n = 2 elif extend in ['min', 'max']: ext_n = 1 else: ext_n = 0 n_colors = len(levels) + ext_n - 1 pal = _color_palette(cmap, n_colors) new_cmap, cnorm = mpl.colors.from_levels_and_colors( levels, pal, extend=extend) # copy the old cmap name, for easier testing new_cmap.name = getattr(cmap, 'name', cmap) return new_cmap, cnorm def _color_palette(cmap, n_colors): import matplotlib.pyplot as plt from matplotlib.colors import ListedColormap colors_i = np.linspace(0, 1., n_colors) if isinstance(cmap, (list, tuple)): # we have a list of colors try: # first try to turn it into a palette with seaborn from seaborn.apionly import color_palette pal = color_palette(cmap, n_colors=n_colors) except ImportError: # if that fails, use matplotlib # in this case, is there any difference between mpl and seaborn? cmap = ListedColormap(cmap, N=n_colors) pal = cmap(colors_i) elif isinstance(cmap, basestring): # we have some sort of named palette try: # first try to turn it into a palette with seaborn from seaborn.apionly import color_palette pal = color_palette(cmap, n_colors=n_colors) except (ImportError, ValueError): # ValueError is raised when seaborn doesn't like a colormap # (e.g. jet). If that fails, use matplotlib try: # is this a matplotlib cmap? cmap = plt.get_cmap(cmap) except ValueError: # or maybe we just got a single color as a string cmap = ListedColormap([cmap], N=n_colors) pal = cmap(colors_i) else: # cmap better be a LinearSegmentedColormap (e.g. viridis) pal = cmap(colors_i) return pal def _determine_cmap_params(plot_data, vmin=None, vmax=None, cmap=None, center=None, robust=False, extend=None, levels=None, filled=True, cnorm=None): """ Use some heuristics to set good defaults for colorbar and range. Adapted from Seaborn: https://github.com/mwaskom/seaborn/blob/v0.6/seaborn/matrix.py#L158 Parameters ========== plot_data: Numpy array Doesn't handle xarray objects Returns ======= cmap_params : dict Use depends on the type of the plotting function """ ROBUST_PERCENTILE = 2.0 import matplotlib as mpl calc_data = np.ravel(plot_data[~pd.isnull(plot_data)]) # Setting center=False prevents a divergent cmap possibly_divergent = center is not False # Set center to 0 so math below makes sense but remember its state center_is_none = False if center is None: center = 0 center_is_none = True # Setting both vmin and vmax prevents a divergent cmap if (vmin is not None) and (vmax is not None): possibly_divergent = False # vlim might be computed below vlim = None if vmin is None: if robust: vmin = np.percentile(calc_data, ROBUST_PERCENTILE) else: vmin = calc_data.min() elif possibly_divergent: vlim = abs(vmin - center) if vmax is None: if robust: vmax = np.percentile(calc_data, 100 - ROBUST_PERCENTILE) else: vmax = calc_data.max() elif possibly_divergent: vlim = abs(vmax - center) if possibly_divergent: # kwargs not specific about divergent or not: infer defaults from data divergent = ((vmin < 0) and (vmax > 0)) or not center_is_none else: divergent = False # A divergent map should be symmetric around the center value if divergent: if vlim is None: vlim = max(abs(vmin - center), abs(vmax - center)) vmin, vmax = -vlim, vlim # Now add in the centering value and set the limits vmin += center vmax += center # Choose default colormaps if not provided if cmap is None: if divergent: cmap = "RdBu_r" else: cmap = "viridis" # Allow viridis before matplotlib 1.5 if cmap == "viridis": cmap = _load_default_cmap() # Handle discrete levels if levels is not None: if isinstance(levels, int): ticker = mpl.ticker.MaxNLocator(levels) levels = ticker.tick_values(vmin, vmax) vmin, vmax = levels[0], levels[-1] if extend is None: extend = _determine_extend(calc_data, vmin, vmax) if levels is not None: cmap, cnorm = _build_discrete_cmap(cmap, levels, extend, filled) return dict(vmin=vmin, vmax=vmax, cmap=cmap, extend=extend, levels=levels, norm=cnorm) def _infer_xy_labels(darray, x, y): """ Determine x and y labels. For use in _plot2d darray must be a 2 dimensional data array. """ if x is None and y is None: if darray.ndim != 2: raise ValueError('DataArray must be 2d') y, x = darray.dims elif x is None or y is None: raise ValueError('cannot supply only one of x and y') elif any(k not in darray.coords for k in (x, y)): raise ValueError('x and y must be coordinate variables') return x, y
apache-2.0
5,193,884,461,763,979,000
28.686636
78
0.603695
false
3.789412
false
false
false
xozzo/pyfootball
setup.py
1
1257
from setuptools import setup, find_packages import os if os.path.exists('README.rst'): readme_path = 'README.rst' else: readme_path = 'README.md' setup( name='pyfootball', version='1.0.1', description='A client library for the football-data.org REST API', long_description=open(readme_path).read(), url='https://github.com/xozzo/pyfootball', author='Timothy Ng', author_email='[email protected]', license='MIT', # See https://pypi.python.org/pypi?%3Aaction=list_classifiers classifiers=[ 'Development Status :: 5 - Production/Stable', 'Intended Audience :: Developers', 'Topic :: Software Development :: Libraries', 'License :: OSI Approved :: MIT License', 'Programming Language :: Python :: 3.5' ], keywords='api wrapper client library football data', packages=find_packages(exclude=['contrib', 'docs', 'tests', 'venv']), install_requires=['requests'], test_suite='tests', # List additional groups of dependencies here (e.g. development # dependencies). You can install these using the following syntax, # for example: # $ pip install -e .[dev] extras_require={ 'dev': ['sphinx', 'sphinx-autobuild'] } )
mit
-1,856,567,441,525,745,200
27.568182
73
0.6428
false
3.797583
false
false
false
foursquare/pants
contrib/go/src/python/pants/contrib/go/tasks/go_test.py
1
2117
# coding=utf-8 # Copyright 2015 Pants project contributors (see CONTRIBUTORS.md). # Licensed under the Apache License, Version 2.0 (see LICENSE). from __future__ import absolute_import, division, print_function, unicode_literals from builtins import filter from pants.base.exceptions import TaskError from pants.base.workunit import WorkUnitLabel from pants.contrib.go.tasks.go_workspace_task import GoWorkspaceTask class GoTest(GoWorkspaceTask): """Runs `go test` on Go packages. To run a library's tests, GoTest only requires a Go workspace to be initialized (see GoWorkspaceTask) with links to necessary source files. It does not require GoCompile to first compile the library to be tested -- in fact, GoTest will ignore any binaries in "$GOPATH/pkg/", because Go test files (which live in the package they are testing) are ignored in normal compilation, so Go test must compile everything from scratch. """ @classmethod def register_options(cls, register): super(GoTest, cls).register_options(register) register('--build-and-test-flags', default='', fingerprint=True, help='Flags to pass in to `go test` tool.') @classmethod def supports_passthru_args(cls): return True def execute(self): # Only executes the tests from the package specified by the target roots, so # we don't run the tests for _all_ dependencies of said package. targets = filter(self.is_local_src, self.context.target_roots) for target in targets: self.ensure_workspace(target) self._go_test(target) def _go_test(self, target): args = (self.get_options().build_and_test_flags.split() + [target.import_path] + self.get_passthru_args()) result, go_cmd = self.go_dist.execute_go_cmd('test', gopath=self.get_gopath(target), args=args, workunit_factory=self.context.new_workunit, workunit_labels=[WorkUnitLabel.TEST]) if result != 0: raise TaskError('{} failed with exit code {}'.format(go_cmd, result))
apache-2.0
-9,153,807,366,505,908,000
38.943396
99
0.683042
false
4.00189
true
false
false
bodylabs/blmath
blmath/geometry/transform/correspondence.py
1
2095
# FIXME -- move back to core def apply_correspondence(correspondence_src, correspondence_dst, vertices): """ Apply a correspondence defined between two vertex sets to a new set. Identifies a correspondence between `correspondence_src` and `correspondence_dst` then applies that correspondence to `vertices`. That is, `correspondence_src` is to `correspondence_dst` as `vertices` is to [ return value ]. `correspondence_src` and `vertices` must have the same topology. The return value will have the same topology as `correspondence_dst`. Arguments can be passed as `chumpy` or `numpy` arrays. The most common usecase here is establishing a relationship between an alignment and a pointcloud or set of landmarks. The pointcloud or landmarks can then be moved automatically as the alignment is adjusted (e.g. fit to a different mesh, reposed, etc). Args: correspondence_src: The source vertices for the correspondence correspondence_dst: The destination vertices for the correspondence vertices: The vertices to map using the defined correspondence Returns: the mapped version of `vertices` Example usage ------------- >>> transformed_scan_vertices = apply_correspondence( ... correspondence_src=alignment.v, ... correspondence_dst=scan.v, ... vertices=reposed_alignment.v ... ) >>> transformed_scan = Mesh(v=transformed_scan_vertices, vc=scan.vc) """ import chumpy as ch from bodylabs.mesh.landmarking.transformed_lm import TransformedCoeffs from bodylabs.mesh.landmarking.transformed_lm import TransformedLms ch_desired = any([ isinstance(correspondence_src, ch.Ch), isinstance(correspondence_dst, ch.Ch), isinstance(vertices, ch.Ch), ]) coeffs = TransformedCoeffs( src_v=correspondence_src, dst_v=correspondence_dst) transformed_vertices = TransformedLms( transformed_coeffs=coeffs, src_v=vertices) return transformed_vertices if ch_desired else transformed_vertices.r
bsd-2-clause
-4,415,321,806,514,047,000
36.410714
79
0.705967
false
4.052224
false
false
false
lepinkainen/pyfibot
pyfibot/modules/module_geoip.py
1
1389
from __future__ import unicode_literals, print_function, division import pygeoip import os.path import sys import socket try: from modules.module_usertrack import get_table user_track_available = True except ImportError: user_track_available = False # http://dev.maxmind.com/geoip/legacy/geolite/ DATAFILE = os.path.join(sys.path[0], "GeoIP.dat") # STANDARD = reload from disk # MEMORY_CACHE = load to memory # MMAP_CACHE = memory using mmap gi4 = pygeoip.GeoIP(DATAFILE, pygeoip.MEMORY_CACHE) def command_geoip(bot, user, channel, args): """Determine the user's country based on host or nick, if module_usertrack is used.""" if not args: return bot.say(channel, "usage: .geoip HOST/NICK") host = args nick = None if user_track_available: table = get_table(bot, channel) user = table.find_one(nick=args) if user: nick = user["nick"] host = user["host"] try: country = gi4.country_name_by_name(host) except socket.gaierror: country = None if country: if nick: return bot.say(channel, "%s (%s) is in %s" % (nick, host, country)) return bot.say(channel, "%s is in %s" % (host, country)) if nick: return bot.say(channel, "Host not found for %s (%s)" % (nick, host)) return bot.say(channel, "Host not found for %s" % host)
bsd-3-clause
-4,394,593,471,870,656,500
26.78
90
0.636429
false
3.412776
false
false
false
llou/panopticon
panopticon/core/database.py
1
7145
# database.py is part of Panopticon. # Panopticon is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # Panopticon is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # You should have received a copy of the GNU General Public License # along with Panopticon. If not, see <http://www.gnu.org/licenses/>. from contextlib import contextmanager from paramiko import RSAKey as pRSAKey, DSSKey from sqlalchemy import create_engine, Column, DateTime, String, Integer, Text, Boolean from sqlalchemy.orm import sessionmaker, relationship, backref from sqlalchemy.sql import not_ from sqlalchemy.schema import ForeignKey from sqlalchemy.pool import NullPool from sqlalchemy.ext.declarative import declarative_base from panopticon.core.util.database import key_value_property Base = declarative_base() class Value(Base): __tablename__ = "values" id = Column(Integer(), primary_key=True) name = Column(String(1000)) value = Column(String(1000), nullable=True) parent_id = Column(Integer, ForeignKey("values.id"), nullable=True) values = relationship("Value", backref=backref('parent', remote_side=[id], cascade="all")) type = Column(String(20)) def __init__(self, name, _type, value="", parent_id=None): self.name = name self.type = _type self.value = value self.parent_id = parent_id @property def root(self): return self.id == self.parent class Service(Base): __tablename__ = "services" name = Column(String(50), primary_key=True) class Computer(Base): __tablename__ = "computers" __table_args__ = {'sqlite_autoincrement':True} name = Column(String(255), primary_key=True) key_name = Column(String(100), ForeignKey('keys.name', onupdate="CASCADE")) active = Column(Boolean(), default=True) key = relationship("Key", backref=backref('computers')) logs = relationship("Log", backref="computer", order_by="Log.time") def __init__(self, name, key_name="", active=True): self.name = name self.active = active self.key_name = key_name class Log(Base): __tablename__ = "logs" id = Column('id', Integer, primary_key=True) time = Column(DateTime()) level = Column(String(10)) message = Column(Text()) computer_name = Column(String(255), ForeignKey('computers.name', ondelete="CASCADE", onupdate="CASCADE"), index=True) service_name = Column(String(255), ForeignKey('services.name', ondelete="CASCADE", onupdate="CASCADE"), index=True) role_name = Column(String(255), index=True) action_name = Column(String(255), index=True) def __init__(self, time, level, message, computer_name="", service_name="", role_name="", action_name=""): self.time = time self.level = level self.message = message self.computer_name = computer_name class FileTrack(Base): __tablename__ = "filetracks" uid = Column("uid", String(32), primary_key=True) _computer_name = Column("computer_name", String(255),ForeignKey('computers.name')) _path = Column("path", Text()) modification_time = Column("modification_time", DateTime()) md5 = Column("md5", String(32)) def __init__(self, computer_name, path, modification_time, md5=""): self.computer_name = computer_name self.path = path self.modification_time = modification_time self.md5 = md5 self.update_uid() @property def computer_name(self): return self._computer_name @computer_name.setter def computer_name(self, value): self._computer_name = value self.update_uid() @property def path(self): return self._path @path.setter def path(self, value): self._path = value self.update_uid() def update_uid(self): if self.computer_name and self.path: self.uid = "%s:%s" % (self.computer_name, self.path) else: self.uid = "" class Key(Base): __tablename__ = "keys" name = Column(String(100), primary_key=True) algorithm = Column(String(20)) v1 = Column(String(2048)) v2 = Column(String(2048)) v3 = Column(String(2048)) v4 = Column(String(2048)) key_class = None key_vals = [] __mapper_args__ = {'polymorphic_on' : algorithm} @classmethod def build_from_paramiko_key(cls, name, p_key): if isinstance(p_key, pRSAKey): return RSAKey(name, p_key.e, p_key.n) elif isinstance(p_key, DSSKey): return DSAKey(name, p_key.p, p_key.q, p_key.g, p_key.y) else: raise Exception("Not valid key") def __init__(self, name, algorithm, v1, v2, v3, v4): self.name = name self.algorithm = algorithm self.v1 = v1 self.v2 = v2 self.v3 = v3 self.v4 = v4 def get_paramiko_key(self): vals = [ getattr(self, x) for x in self.key_vals ] return self.key_class(vals=vals) class RSAKey(Key): __mapper_args__ = {'polymorphic_identity':'rsa'} key_class = pRSAKey key_vals = [ 'e', 'n' ] def __init__(self, name, e, n): self.name = name self.algorithm = "rsa" self.e = e self.n = n e = key_value_property("v1") n = key_value_property("v2") class DSAKey(Key): __mapper_args__ = {'polymorphic_identity':'dsa'} key_class = DSSKey key_vals = [ 'p', 'q', 'g', 'y' ] def __init__(self, name, p, q, g, y): self.name = name self.algorithm = "dsa" self.p = p self.q = q self.g = g self.y = y p = key_value_property("v1") q = key_value_property("v2") g = key_value_property("v3") y = key_value_property("v4") class PanopticonDB(object): def __init__(self, panopticon, engine=None): self.panopticon = panopticon self.engine = engine if engine is not None else create_engine(panopticon.db_url, poolclass=NullPool) Base.metadata.create_all(self.engine) self.Session = sessionmaker(bind=self.engine) self.sync() @contextmanager def get_session(self): session = self.Session() yield session session.commit() session.close() def purge(self,sure=False): if sure: Base.metadata.drop_all(self.engine) Base.metadata.create_all(self.engine) def sync(self): computer_names = [ x[0] for x in self.panopticon.computers ] with self.get_session() as session: session.execute(Computer.__table__.update().where(Computer.name.in_(computer_names)).values(active=True)) session.execute(Computer.__table__.update().where(not_(Computer.name.in_(computer_names))).values(active=True))
gpl-3.0
3,336,946,915,647,172,000
31.775229
123
0.626312
false
3.581454
false
false
false
i-namekawa/TopSideMonitor
plotting.py
1
37323
import os, sys, time from glob import glob import cv2 from pylab import * from mpl_toolkits.mplot3d import Axes3D from matplotlib.backends.backend_pdf import PdfPages matplotlib.rcParams['figure.facecolor'] = 'w' from scipy.signal import argrelextrema import scipy.stats as stats import scipy.io as sio from scipy import signal from xlwt import Workbook # specify these in mm to match your behavior chamber. CHMAMBER_LENGTH=235 WATER_HIGHT=40 # quick plot should also show xy_within and location_one_third etc # summary PDF: handle exception when a pickle file missing some fish in other pickle file ## these three taken from http://stackoverflow.com/a/18420730/566035 def strided_sliding_std_dev(data, radius=5): windowed = rolling_window(data, (2*radius, 2*radius)) shape = windowed.shape windowed = windowed.reshape(shape[0], shape[1], -1) return windowed.std(axis=-1) def rolling_window(a, window): """Takes a numpy array *a* and a sequence of (or single) *window* lengths and returns a view of *a* that represents a moving window.""" if not hasattr(window, '__iter__'): return rolling_window_lastaxis(a, window) for i, win in enumerate(window): if win > 1: a = a.swapaxes(i, -1) a = rolling_window_lastaxis(a, win) a = a.swapaxes(-2, i) return a def rolling_window_lastaxis(a, window): """Directly taken from Erik Rigtorp's post to numpy-discussion. <http://www.mail-archive.com/[email protected]/msg29450.html>""" if window < 1: raise ValueError, "`window` must be at least 1." if window > a.shape[-1]: raise ValueError, "`window` is too long." shape = a.shape[:-1] + (a.shape[-1] - window + 1, window) strides = a.strides + (a.strides[-1],) return np.lib.stride_tricks.as_strided(a, shape=shape, strides=strides) ## stealing ends here... // def filterheadxy(headx,heady,thrs_denom=10): b, a = signal.butter(8, 0.125) dhy = np.abs(np.hstack((0, np.diff(heady,1)))) thrs = np.nanstd(dhy)/thrs_denom ind2remove = dhy>thrs headx[ind2remove] = np.nan heady[ind2remove] = np.nan headx = interp_nan(headx) heady = interp_nan(heady) headx = signal.filtfilt(b, a, headx, padlen=150) heady = signal.filtfilt(b, a, heady, padlen=150) return headx,heady def smoothRad(theta, thrs=np.pi/4*3): jumps = (np.diff(theta) > thrs).nonzero()[0] print 'jumps.size', jumps.size while jumps.size: # print '%d/%d' % (jumps[0], theta.size) theta[jumps+1] -= np.pi jumps = (np.diff(theta) > thrs).nonzero()[0] return theta def datadct2array(data, key1, key2): # put these in a MATLAB CELL trialN = len(data[key1][key2]) matchedUSnameP = np.zeros((trialN,), dtype=np.object) fnameP = np.zeros((trialN,), dtype=np.object) # others to append to a list eventsP = [] speed3DP = [] movingSTDP = [] d2inflowP = [] xP, yP, zP = [], [], [] XP, YP, ZP = [], [], [] ringpixelsP = [] peaks_withinP = [] swimdir_withinP = [] xy_withinP = [] location_one_thirdP = [] dtheta_shapeP = [] dtheta_velP = [] turns_shapeP = [] turns_velP = [] for n, dct in enumerate(data[key1][key2]): # MATLAB CELL matchedUSnameP[n] = dct['matchedUSname'] fnameP[n] = dct['fname'] # 2D array eventsP.append([ele if type(ele) is not list else ele[0] for ele in dct['events']]) speed3DP.append(dct['speed3D']) movingSTDP.append(dct['movingSTD']) d2inflowP.append(dct['d2inflow']) xP.append(dct['x']) yP.append(dct['y']) zP.append(dct['z']) XP.append(dct['X']) YP.append(dct['Y']) ZP.append(dct['Z']) ringpixelsP.append(dct['ringpixels']) peaks_withinP.append(dct['peaks_within']) swimdir_withinP.append(dct['swimdir_within']) xy_withinP.append(dct['xy_within']) location_one_thirdP.append(dct['location_one_third']) dtheta_shapeP.append(dct['dtheta_shape']) dtheta_velP.append(dct['dtheta_vel']) turns_shapeP.append(dct['turns_shape']) turns_velP.append(dct['turns_vel']) TVroi = np.array(dct['TVroi']) SVroi = np.array(dct['SVroi']) return matchedUSnameP, fnameP, np.array(eventsP), np.array(speed3DP), np.array(d2inflowP), \ np.array(xP), np.array(yP), np.array(zP), np.array(XP), np.array(YP), np.array(ZP), \ np.array(ringpixelsP), np.array(peaks_withinP), np.array(swimdir_withinP), \ np.array(xy_withinP), np.array(dtheta_shapeP), np.array(dtheta_velP), \ np.array(turns_shapeP), np.array(turns_velP), TVroi, SVroi def pickle2mat(fp, data=None): # fp : full path to pickle file # data : option to provide data to skip np.load(fp) if not data: data = np.load(fp) for key1 in data.keys(): for key2 in data[key1].keys(): matchedUSname, fname, events, speed3D, d2inflow, x, y, z, X, Y, Z, \ ringpixels, peaks_within, swimdir_within, xy_within, dtheta_shape, dtheta_vel, \ turns_shape, turns_vel, TVroi, SVroi = datadct2array(data, key1, key2) datadict = { 'matchedUSname' : matchedUSname, 'fname' : fname, 'events' : events, 'speed3D' : speed3D, 'd2inflow' : d2inflow, 'x' : x, 'y' : y, 'z' : z, 'X' : X, 'Y' : Y, 'Z' : Z, 'ringpixels' : ringpixels, 'peaks_within' : peaks_within, 'swimdir_within' : swimdir_within, 'xy_within' : xy_within, 'dtheta_shape' : dtheta_shape, 'dtheta_vel' : dtheta_vel, 'turns_shape' : turns_shape, 'turns_vel' : turns_vel, 'TVroi' : TVroi, 'SVroi' : SVroi, } outfp = '%s_%s_%s.mat' % (fp[:-7],key1,key2) sio.savemat(outfp, datadict, oned_as='row', do_compression=True) def interp_nan(x): ''' Replace nan by interporation http://stackoverflow.com/questions/6518811/interpolate-nan-values-in-a-numpy-array ''' ok = -np.isnan(x) if (ok == False).all(): return x else: xp = ok.ravel().nonzero()[0] fp = x[ok] _x = np.isnan(x).ravel().nonzero()[0] x[-ok] = np.interp(_x, xp, fp) return x def polytest(x,y,rx,ry,rw,rh,rang): points=cv2.ellipse2Poly( (rx,ry), axes=(rw/2,rh/2), angle=rang, arcStart=0, arcEnd=360, delta=3 ) return cv2.pointPolygonTest(np.array(points), (x,y), measureDist=1) def depthCorrection(z,x,TVx1,TVx2,SVy1,SVy2,SVy3): z0 = z - SVy1 x0 = x - TVx1 mid = (SVy2-SVy1)/2 adj = (z0 - mid) / (SVy2-SVy1) * (SVy2-SVy3) * (1-(x0)/float(TVx2-TVx1)) return z0 + adj + SVy1 # back to abs coord def putNp2xls(array, ws): for r, row in enumerate(array): for c, val in enumerate(row): ws.write(r, c, val) def drawLines(mi, ma, events, fps=30.0): CS, USs, preRange = events plot([CS-preRange, CS-preRange], [mi,ma], '--c') # 2 min prior odor plot([CS , CS ], [mi,ma], '--g', linewidth=2) # CS onset if USs: if len(USs) > 3: colors = 'r' * len(USs) else: colors = [_ for _ in ['r','b','c'][:len(USs)]] for c,us in zip(colors, USs): plot([us, us],[mi,ma], linestyle='--', color=c, linewidth=2) # US onset plot([USs[0]+preRange/2,USs[0]+preRange/2], [mi,ma], linestyle='--', color=c, linewidth=2) # end of US window xtck = np.arange(0, max(CS+preRange, max(USs)), 0.5*60*fps) # every 0.5 min tick else: xtck = np.arange(0, CS+preRange, 0.5*60*fps) # every 0.5 min tick xticks(xtck, xtck/fps/60) gca().xaxis.set_minor_locator(MultipleLocator(5*fps)) # 5 s minor ticks def approachevents(x,y,z, ringpolyTVArray, ringpolySVArray, fishlength=134, thrs=None): ''' fishlength: some old scrits may call this with fishlength thrs: multitrack GUI provides this by ringAppearochLevel spin control. can be an numpy array (to track water level change etc) ''' smoothedz = np.convolve(np.hanning(10)/np.hanning(10).sum(), z, 'same') peaks = argrelextrema(smoothedz, np.less)[0] # less because 0 is top in image. # now filter peaks by height. ringLevel = ringpolySVArray[:,1] if thrs is None: thrs = ringLevel+fishlength/2 if type(thrs) == int: # can be numpy array or int thrs = ringLevel.mean() + thrs peaks = peaks[ z[peaks] < thrs ] else: # numpy array should be ready to use peaks = peaks[ z[peaks] < thrs[peaks] ] # now filter out by TVringCenter peaks_within = get_withinring(ringpolyTVArray, peaks, x, y) return smoothedz, peaks_within def get_withinring(ringpolyTVArray, timepoints, x, y): rx = ringpolyTVArray[:,0].astype(np.int) ry = ringpolyTVArray[:,1].astype(np.int) rw = ringpolyTVArray[:,2].astype(np.int) rh = ringpolyTVArray[:,3].astype(np.int) rang = ringpolyTVArray[:,4].astype(np.int) # poly test peaks_within = [] for p in timepoints: points=cv2.ellipse2Poly( (rx[p],ry[p]), axes=(rw[p]/2,rh[p]/2), angle=rang[p], arcStart=0, arcEnd=360, delta=3 ) inout = cv2.pointPolygonTest(np.array(points), (x[p],y[p]), measureDist=1) if inout > 0: peaks_within.append(p) return peaks_within def location_ring(x,y,ringpolyTVArray): rx = ringpolyTVArray[:,0].astype(np.int) ry = ringpolyTVArray[:,1].astype(np.int) rw = ringpolyTVArray[:,2].astype(np.int) rh = ringpolyTVArray[:,3].astype(np.int) d2ringcenter = np.sqrt((x-rx)**2 + (y-ry)**2) # filter by radius 20% buffer in case the ring moves around indices = (d2ringcenter < 1.2*max(rw.max(), rh.max())).nonzero()[0] xy_within = get_withinring(ringpolyTVArray, indices, x, y) return xy_within def swimdir_analysis(x,y,z,ringpolyTVArray,ringpolySVArray,TVx1,TVy1,TVx2,TVy2,fps=30.0): # smoothing # z = np.convolve(np.hanning(16)/np.hanning(16).sum(), z, 'same') # two cameras have different zoom settings. So, distance per pixel is different. But, for # swim direction, it does not matter how much x,y are compressed relative to z. # ring z level from SV rz = ringpolySVArray[:,1].astype(np.int) # ring all other params from TV rx = ringpolyTVArray[:,0].astype(np.int) ry = ringpolyTVArray[:,1].astype(np.int) rw = ringpolyTVArray[:,2].astype(np.int) rh = ringpolyTVArray[:,3].astype(np.int) rang = ringpolyTVArray[:,4].astype(np.int) speed3D = np.sqrt( np.diff(x)**2 + np.diff(y)**2 + np.diff(z)**2 ) speed3D = np.hstack(([0], speed3D)) # line in 3D http://tutorial.math.lamar.edu/Classes/CalcIII/EqnsOfLines.aspx # x-x0 y-y0 z-z0 # ---- = ---- = ---- # a b c # solve them for z = rz. x0,y0,z0 are tvx, tvy, svy # x = (a * (rz-z)) / c + x0 dt = 3 # define slope as diff between current and dt frame before a = np.hstack( (np.ones(dt), x[dt:]-x[:-dt]) ) b = np.hstack( (np.ones(dt), y[dt:]-y[:-dt]) ) c = np.hstack( (np.ones(dt), z[dt:]-z[:-dt]) ) c[c==0] = np.nan # avoid zero division water_x = (a * (rz-z) / c) + x water_y = (b * (rz-z) / c) + y upwards = c<-2/30.0*fps # not accurate when c is small or negative xok = (TVx1 < water_x) & (water_x < TVx2) yok = (TVy1 < water_y) & (water_y < TVy2) filtered = upwards & xok & yok# & -np.isinf(water_x) & -np.isinf(water_y) water_x[-filtered] = np.nan water_y[-filtered] = np.nan # figure() # ax = subplot(111) # ax.imshow(npData['TVbg'], cmap=cm.gray) # clip out from TVx1,TVy1 # ax.plot(x-TVx1, y-TVy1, 'c') # ax.plot(water_x-TVx1, water_y-TVy1, 'r.') # xlim([0, TVx2-TVx1]); ylim([TVy2-TVy1, 0]) # draw(); show() SwimDir = [] for n in filtered.nonzero()[0]: inout = polytest(water_x[n],water_y[n],rx[n],ry[n],rw[n],rh[n],rang[n]) SwimDir.append((n, inout, speed3D[n])) # inout>0 are inside return SwimDir, water_x, water_y def plot_eachTr(events, x, y, z, inflowpos, ringpixels, peaks_within, swimdir_within=None, pp=None, _title=None, fps=30.0, inmm=False): CS, USs, preRange = events # preRange = 3600 2 min prior and 1 min after CS. +900 for 0.5 min if USs: xmin, xmax = CS-preRange-10*fps, USs[0]+preRange/2+10*fps else: xmin, xmax = CS-preRange-10*fps, CS+preRange/2+(23+10)*fps fig = figure(figsize=(12,8), facecolor='w') subplot(511) # Swimming speed speed3D = np.sqrt( np.diff(x)**2 + np.diff(y)**2 + np.diff(z)**2 ) drawLines(np.nanmin(speed3D), np.nanmax(speed3D), events, fps) # go behind plot(speed3D) movingSTD = np.append( np.zeros(fps*10), strided_sliding_std_dev(speed3D, fps*10) ) plot(movingSTD, linewidth=2) plot(np.ones_like(speed3D) * speed3D.std()*6, '-.', color='gray') ylim([-5, speed3D[xmin:xmax].max()]) xlim([xmin,xmax]); title(_title) if inmm: ylabel('Speed 3D (mm),\n6SD thr'); else: ylabel('Speed 3D, 6SD thr'); ax = subplot(512) # z level drawLines(z.min(), z.max(), events) plot(z, 'b') pkx = peaks_within.nonzero()[0] if inmm: plot(pkx, peaks_within[pkx]*z[xmin:xmax].max()*0.97, 'mo') if swimdir_within is not None: ___x = swimdir_within.nonzero()[0] plot(___x, swimdir_within[___x]*z[xmin:xmax].max()*0.96, 'g+') ylim([z[xmin:xmax].min()*0.95, z[xmin:xmax].max()]) xlim([xmin,xmax]); ylabel('Z (mm)') else: plot(pkx, peaks_within[pkx]*z[xmin:xmax].min()*0.97, 'mo') if swimdir_within is not None: ___x = swimdir_within.nonzero()[0] plot(___x, swimdir_within[___x]*z[xmin:xmax].min()*0.96, 'g+') ylim([z[xmin:xmax].min()*0.95, z[xmin:xmax].max()]) ax.invert_yaxis(); xlim([xmin,xmax]); ylabel('z') subplot(513) # x drawLines(x.min(), x.max(), events) plot(x, 'b') plot(y, 'g') xlim([xmin,xmax]); ylabel('x,y') subplot(514) # Distance to the inflow tube xin, yin, zin = inflowpos d2inflow = np.sqrt((x-xin) ** 2 + (y-yin) ** 2 + (z-zin) ** 2 ) drawLines(d2inflow.min(), d2inflow.max(), events) plot(d2inflow) ylim([d2inflow[xmin:xmax].min(), d2inflow[xmin:xmax].max()]) xlim([xmin,xmax]); ylabel('distance to\ninflow tube') subplot(515) # ringpixels: it seems i never considered TV x,y for this rpmax, rpmin = np.nanmax(ringpixels[xmin:xmax]), np.nanmin(ringpixels[xmin:xmax]) drawLines(rpmin, rpmax, events) plot(ringpixels) plot(pkx, peaks_within[pkx]*rpmax*1.06, 'mo') if swimdir_within is not None: plot(___x, swimdir_within[___x]*rpmax*1.15, 'g+') ylim([-100, rpmax*1.2]) xlim([xmin,xmax]); ylabel('ringpixels') tight_layout() if pp: fig.savefig(pp, format='pdf') rng = np.arange(CS-preRange, CS+preRange, dtype=np.int) return speed3D[rng], movingSTD[rng], d2inflow[rng], ringpixels[rng] def plot_turnrates(events, dthetasum_shape,dthetasum_vel,turns_shape,turns_vel, pp=None, _title=None, thrs=np.pi/4*(133.33333333333334/120), fps=30.0): CS, USs, preRange = events # preRange = 3600 2 min prior and 1 min after CS. +900 for 0.5 min if USs: xmin, xmax = CS-preRange-10*fps, USs[0]+preRange/2+10*fps else: xmin, xmax = CS-preRange-10*fps, CS+preRange/2+(23+10)*fps fig = figure(figsize=(12,8), facecolor='w') subplot(211) drawLines(dthetasum_shape.min(), dthetasum_shape.max(), events) plot(np.ones_like(dthetasum_shape)*thrs,'gray',linestyle='--') plot(-np.ones_like(dthetasum_shape)*thrs,'gray',linestyle='--') plot(dthetasum_shape) dmax = dthetasum_shape[xmin:xmax].max() plot(turns_shape, (0.5+dmax)*np.ones_like(turns_shape), 'o') temp = np.zeros_like(dthetasum_shape) temp[turns_shape] = 1 shape_cumsum = np.cumsum(temp) shape_cumsum -= shape_cumsum[xmin] plot( shape_cumsum / shape_cumsum[xmax] * (dmax-dthetasum_shape.min()) + dthetasum_shape.min()) xlim([xmin,xmax]); ylabel('Shape based'); title('Orientation change per 4 frames: ' + _title) ylim([dthetasum_shape[xmin:xmax].min()-1, dmax+1]) subplot(212) drawLines(dthetasum_vel.min(), dthetasum_vel.max(), events) plot(np.ones_like(dthetasum_vel)*thrs,'gray',linestyle='--') plot(-np.ones_like(dthetasum_vel)*thrs,'gray',linestyle='--') plot(dthetasum_vel) dmax = dthetasum_vel[xmin:xmax].max() plot(turns_vel, (0.5+dmax)*np.ones_like(turns_vel), 'o') temp = np.zeros_like(dthetasum_vel) temp[turns_vel] = 1 vel_cumsum = np.cumsum(temp) vel_cumsum -= vel_cumsum[xmin] plot( vel_cumsum / vel_cumsum[xmax] * (dmax-dthetasum_shape.min()) + dthetasum_shape.min()) ylim([dthetasum_vel[xmin:xmax].min()-1, dmax+1]) xlim([xmin,xmax]); ylabel('Velocity based') tight_layout() if pp: fig.savefig(pp, format='pdf') def trajectory(x, y, z, rng, ax, _xlim=[0,640], _ylim=[480,480+300], _zlim=[150,340], color='b', fps=30.0, ringpolygon=None): ax.plot(x[rng],y[rng],z[rng], color=color) ax.view_init(azim=-75, elev=-180+15) if ringpolygon: rx, ry, rz = ringpolygon ax.plot(rx, ry, rz, color='gray') ax.set_xlim(_xlim[0],_xlim[1]) ax.set_ylim(_ylim[0],_ylim[1]) ax.set_zlim(_zlim[0],_zlim[1]) title(("(%2.1f min to %2.1f min)" % (rng[0]/fps/60.0,(rng[-1]+1)/60.0/fps))) draw() def plotTrajectory(x, y, z, events, _xlim=None, _ylim=None, _zlim=None, fps=30.0, pp=None, ringpolygon=None): CS, USs, preRange = events rng1 = np.arange(CS-preRange, CS-preRange/2, dtype=int) rng2 = np.arange(CS-preRange/2, CS, dtype=int) if USs: rng3 = np.arange(CS, min(USs), dtype=int) rng4 = np.arange(min(USs), min(USs)+preRange/2, dtype=int) combined = np.hstack((rng1,rng2,rng3,rng4)) else: combined = np.hstack((rng1,rng2)) if _xlim is None: _xlim = map( int, ( x[combined].min(), x[combined].max() ) ) if _ylim is None: _ylim = map( int, ( y[combined].min(), y[combined].max() ) ) if _zlim is None: _zlim = map( int, ( z[combined].min(), z[combined].max() ) ) if ringpolygon: _zlim[0] = min( _zlim[0], int(ringpolygon[2][0]) ) fig3D = plt.figure(figsize=(12,8), facecolor='w') ax = fig3D.add_subplot(221, projection='3d'); trajectory(x,y,z,rng1,ax,_xlim,_ylim,_zlim,'c',fps,ringpolygon) ax = fig3D.add_subplot(222, projection='3d'); trajectory(x,y,z,rng2,ax,_xlim,_ylim,_zlim,'c',fps,ringpolygon) if USs: ax = fig3D.add_subplot(223, projection='3d'); trajectory(x,y,z,rng3,ax,_xlim,_ylim,_zlim,'g',fps,ringpolygon) ax = fig3D.add_subplot(224, projection='3d'); trajectory(x,y,z,rng4,ax,_xlim,_ylim,_zlim,'r',fps,ringpolygon) tight_layout() if pp: fig3D.savefig(pp, format='pdf') def add2DataAndPlot(fp, fish, data, createPDF): if createPDF: pp = PdfPages(fp[:-7]+'_'+fish+'.pdf') else: pp = None params = np.load(fp) fname = os.path.basename(fp).split('.')[0] + '.avi' dirname = os.path.dirname(fp) preRange = params[(fname, 'mog')]['preRange'] fps = params[(fname, 'mog')]['fps'] TVx1 = params[(fname, fish)]['TVx1'] TVy1 = params[(fname, fish)]['TVy1'] TVx2 = params[(fname, fish)]['TVx2'] TVy2 = params[(fname, fish)]['TVy2'] SVx1 = params[(fname, fish)]['SVx1'] SVx2 = params[(fname, fish)]['SVx2'] SVx3 = params[(fname, fish)]['SVx3'] SVy1 = params[(fname, fish)]['SVy1'] SVy2 = params[(fname, fish)]['SVy2'] SVy3 = params[(fname, fish)]['SVy3'] ringAppearochLevel = params[(fname, fish)]['ringAppearochLevel'] _npz = os.path.join(dirname, os.path.join('%s_%s.npz' % (fname[:-4], fish))) # if os.path.exists(_npz): npData = np.load(_npz) tvx = npData['TVtracking'][:,0] # x with nan tvy = npData['TVtracking'][:,1] # y headx = npData['TVtracking'][:,3] # headx heady = npData['TVtracking'][:,4] # heady svy = npData['SVtracking'][:,1] # z InflowTubeTVArray = npData['InflowTubeTVArray'] InflowTubeSVArray = npData['InflowTubeSVArray'] inflowpos = InflowTubeTVArray[:,0], InflowTubeTVArray[:,1], InflowTubeSVArray[:,1] ringpixels = npData['ringpixel'] ringpolyTVArray = npData['ringpolyTVArray'] ringpolySVArray = npData['ringpolySVArray'] TVbg = npData['TVbg'] print os.path.basename(_npz), 'loaded.' x,y,z = map(interp_nan, [tvx,tvy,svy]) # z level correction by depth (x) z = depthCorrection(z,x,TVx1,TVx2,SVy1,SVy2,SVy3) smoothedz, peaks_within = approachevents(x, y, z, ringpolyTVArray, ringpolySVArray, thrs=ringAppearochLevel) # convert to numpy array from list temp = np.zeros_like(x) temp[peaks_within] = 1 peaks_within = temp # normalize to mm longaxis = float(max((TVx2-TVx1), (TVy2-TVy1))) # before rotation H is applied they are orthogonal waterlevel = float(SVy2-SVy1) X = (x-TVx1) / longaxis * CHMAMBER_LENGTH Y = (TVy2-y) / longaxis * CHMAMBER_LENGTH Z = (SVy2-z) / waterlevel * WATER_HIGHT # bottom of chamber = 0, higher more positive inflowpos_mm = ((inflowpos[0]-TVx1) / longaxis * CHMAMBER_LENGTH, (TVy2-inflowpos[1]) / longaxis * CHMAMBER_LENGTH, (SVy2-inflowpos[2]) / waterlevel * WATER_HIGHT ) # do the swim direction analysis here swimdir, water_x, water_y = swimdir_analysis(x,y,z, ringpolyTVArray,ringpolySVArray,TVx1,TVy1,TVx2,TVy2,fps) # all of swimdir are within ROI (frame#, inout, speed) but not necessary within ring sdir = np.array(swimdir) withinRing = sdir[:,1]>0 # inout>0 are inside ring temp = np.zeros_like(x) temp[ sdir[withinRing,0].astype(int) ] = 1 swimdir_within = temp # location_ring xy_within = location_ring(x,y, ringpolyTVArray) temp = np.zeros_like(x) temp[xy_within] = 1 xy_within = temp # location_one_third if (TVx2-TVx1) > (TVy2-TVy1): if np.abs(np.arange(TVx1, longaxis+TVx1, longaxis/3) + longaxis/6 - inflowpos[0].mean()).argmin() == 2: location_one_third = x-TVx1 > longaxis/3*2 else: location_one_third = x < longaxis/3 else: if np.abs(np.arange(TVy1, longaxis+TVy1, longaxis/3) + longaxis/6 - inflowpos[1].mean()).argmin() == 2: location_one_third = y-TVy1 > longaxis/3*2 else: location_one_third = y < longaxis/3 # turn rate analysis (shape based) heady, headx = map(interp_nan, [heady, headx]) headx, heady = filterheadxy(headx, heady) dy = heady - y dx = headx - x theta_shape = np.arctan2(dy, dx) # velocity based cx, cy = filterheadxy(x.copy(), y.copy()) # centroid x,y vx = np.append(0, np.diff(cx)) vy = np.append(0, np.diff(cy)) theta_vel = np.arctan2(vy, vx) # prepare ringpolygon for trajectory plot rx, ry, rw, rh, rang = ringpolyTVArray.mean(axis=0).astype(int) # use mm ver above rz = ringpolySVArray.mean(axis=0)[1].astype(int) RX = (rx-TVx1) / longaxis * CHMAMBER_LENGTH RY = (TVy2-ry) / longaxis * CHMAMBER_LENGTH RW = rw / longaxis * CHMAMBER_LENGTH / 2 RH = rh / longaxis * CHMAMBER_LENGTH / 2 RZ = (SVy2-rz) / waterlevel * WATER_HIGHT points = cv2.ellipse2Poly( (RX.astype(int),RY.astype(int)), axes=(RW.astype(int),RH.astype(int)), angle=rang, arcStart=0, arcEnd=360, delta=3 ) ringpolygon = [points[:,0], points[:,1], np.ones(points.shape[0]) * RZ] eventTypeKeys = params[(fname, fish)]['EventData'].keys() CSs = [_ for _ in eventTypeKeys if _.startswith('CS')] USs = [_ for _ in eventTypeKeys if _.startswith('US')] # print CSs, USs # events for CS in CSs: CS_Timings = params[(fname, fish)]['EventData'][CS] CS_Timings.sort() # initialize when needed if CS not in data[fish].keys(): data[fish][CS] = [] # now look around for US after it within preRange for t in CS_Timings: tr = len(data[fish][CS])+1 rng = np.arange(t-preRange, t+preRange, dtype=np.int) matchedUSname = None for us in USs: us_Timings = params[(fname, fish)]['EventData'][us] matched = [_ for _ in us_Timings if t-preRange < _ < t+preRange] if matched: events = [t, matched, preRange] # ex. CS+ matchedUSname = us break else: continue _title = '(%s, %s) trial#%02d %s (%s)' % (CS, matchedUSname[0], tr, fname, fish) print _title, events _speed3D, _movingSTD, _d2inflow, _ringpixels = plot_eachTr(events, X, Y, Z, inflowpos_mm, ringpixels, peaks_within, swimdir_within, pp, _title, fps, inmm=True) # 3d trajectory _xlim = (0, CHMAMBER_LENGTH) _zlim = (RZ.max(),0) plotTrajectory(X, Y, Z, events, _xlim=_xlim, _zlim=_zlim, fps=fps, pp=pp, ringpolygon=ringpolygon) # turn rate analysis # shape based theta_shape[rng] = smoothRad(theta_shape[rng].copy(), thrs=np.pi/2) dtheta_shape = np.append(0, np.diff(theta_shape)) # full length kernel = np.ones(4) dthetasum_shape = np.convolve(dtheta_shape, kernel, 'same') # 4 frames = 1000/30.0*4 = 133.3 ms thrs = (np.pi / 2) * (133.33333333333334/120) # Braubach et al 2009 90 degree in 120 ms peaks_shape = argrelextrema(abs(dthetasum_shape), np.greater)[0] turns_shape = peaks_shape[ (abs(dthetasum_shape[peaks_shape]) > thrs).nonzero()[0] ] # velocity based theta_vel[rng] = smoothRad(theta_vel[rng].copy(), thrs=np.pi/2) dtheta_vel = np.append(0, np.diff(theta_vel)) dthetasum_vel = np.convolve(dtheta_vel, kernel, 'same') peaks_vel = argrelextrema(abs(dthetasum_vel), np.greater)[0] turns_vel = peaks_vel[ (abs(dthetasum_vel[peaks_vel]) > thrs).nonzero()[0] ] plot_turnrates(events, dthetasum_shape, dthetasum_vel, turns_shape, turns_vel, pp, _title, fps=fps) _temp = np.zeros_like(dtheta_shape) _temp[turns_shape] = 1 turns_shape_array = _temp _temp = np.zeros_like(dtheta_vel) _temp[turns_vel] = 1 turns_vel_array = _temp # plot swim direction analysis fig = figure(figsize=(12,8), facecolor='w') ax1 = subplot(211) ax1.imshow(TVbg, cmap=cm.gray) # TVbg is clip out of ROI ax1.plot(x[rng]-TVx1, y[rng]-TVy1, 'gray') ax1.plot(water_x[t-preRange:t]-TVx1, water_y[t-preRange:t]-TVy1, 'c.') if matched: ax1.plot( water_x[t:matched[0]]-TVx1, water_y[t:matched[0]]-TVy1, 'g.') ax1.plot( water_x[matched[0]:matched[0]+preRange/4]-TVx1, water_y[matched[0]:matched[0]+preRange/4]-TVy1, 'r.') xlim([0, TVx2-TVx1]); ylim([TVy2-TVy1, 0]) title(_title) ax2 = subplot(212) ax2.plot( swimdir_within ) ax2.plot( peaks_within*1.15-0.1, 'mo' ) if matched: xmin, xmax = t-preRange-10*fps, matched[0]+preRange/4 else: xmin, xmax = t-preRange-10*fps, t+preRange/2+10*fps gzcs = np.cumsum(swimdir_within) gzcs -= gzcs[xmin] ax2.plot( gzcs/gzcs[xmax] ) drawLines(0,1.2, events) ylim([0,1.2]) xlim([xmin, xmax]) ylabel('|: SwimDirection\no: approach events') data[fish][CS].append( { 'fname' : fname, 'x': x[rng], 'y': y[rng], 'z': z[rng], 'X': X[rng], 'Y': Y[rng], 'Z': Z[rng], # calibrate space (mm) 'speed3D': _speed3D, # calibrate space (mm) 'movingSTD' : _movingSTD, # calibrate space (mm) 'd2inflow': _d2inflow, # calibrate space (mm) 'ringpixels': _ringpixels, 'peaks_within': peaks_within[rng], 'xy_within': xy_within[rng], 'location_one_third' : location_one_third[rng], 'swimdir_within' : swimdir_within[rng], 'dtheta_shape': dtheta_shape[rng], 'dtheta_vel': dtheta_vel[rng], 'turns_shape': turns_shape_array[rng], # already +/- preRange 'turns_vel': turns_vel_array[rng], 'events' : events, 'matchedUSname' : matchedUSname, 'TVroi' : (TVx1,TVy1,TVx2,TVy2), 'SVroi' : (SVx1,SVy1,SVx2,SVy2), } ) if pp: fig.savefig(pp, format='pdf') close('all') # release memory ASAP! if pp: pp.close() def getPDFs(pickle_files, fishnames=None, createPDF=True): # type checking args if type(pickle_files) is str: pickle_files = [pickle_files] # convert to a list or set of fish names if type(fishnames) is str: fishnames = [fishnames] elif not fishnames: fishnames = set() # re-organize trials into a dict "data" data = {} # figure out trial number (sometime many trials in one files) for each fish # go through all pickle_files and use timestamps of file to sort events. timestamps = [] for fp in pickle_files: # collect ctime of pickled files fname = os.path.basename(fp).split('.')[0] + '.avi' timestamps.append( time.strptime(fname, "%b-%d-%Y_%H_%M_%S.avi") ) # look into the pickle and collect fish analyzed params = np.load(fp) # loading pickled file! if type(fishnames) is set: for fish in [fs for fl,fs in params.keys() if fl == fname and fs != 'mog']: fishnames.add(fish) timestamps = sorted(range(len(timestamps)), key=timestamps.__getitem__) # For each fish, go thru all pickled files for fish in fishnames: data[fish] = {} # now go thru the sorted for ind in timestamps: fp = pickle_files[ind] print 'processing #%d\n%s' % (ind, fp) add2DataAndPlot(fp, fish, data, createPDF) return data def plotTrials(data, fish, CSname, key, step, offset=0, pp=None): fig = figure(figsize=(12,8), facecolor='w') ax1 = fig.add_subplot(121) # raw trace ax2 = fig.add_subplot(222) # learning curve ax3 = fig.add_subplot(224) # bar plot preP, postP, postP2 = [], [], [] longestUS = 0 for n, measurement in enumerate(data[fish][CSname]): tr = n+1 CS, USs, preRange = measurement['events'] subplot(ax1) mi = -step*(tr-1) ma = mi + step drawLines(mi, ma, (preRange, [preRange+(USs[0]-CS)], preRange)) longestUS = max([us-CS+preRange*3/2 for us in USs]+[longestUS]) # 'measurement[key]': vector around the CS timing (+/-) preRange. i.e., preRange is the center ax1.plot(measurement[key]-step*(tr-1)+offset) title(CSname+': '+key) # cf. preRange = 3600 frames pre = measurement[key][:preRange].mean()+offset # 2 min window post = measurement[key][preRange:preRange+(USs[0]-CS)].mean()+offset # 23 s window post2 = measurement[key][preRange+(USs[0]-CS):preRange*3/2+(USs[0]-CS)].mean()+offset # 1 min window after US preP.append(pre) postP.append(post) postP2.append(post2) ax3.plot([1, 2, 3], [pre, post, post2],'o-') ax1.set_xlim([0,longestUS]) ax1.axis('off') subplot(ax2) x = range(1, tr+1) y = np.diff((preP,postP), axis=0).ravel() ax2.plot( x, y, 'ko-', linewidth=2 ) ax2.plot( x, np.zeros_like(x), '-.', linewidth=1, color='gray' ) # grid() slope, intercept, rvalue, pval, stderr = stats.stats.linregress(x,y) title('slope = zero? p-value = %f' % pval) ax2.set_xlabel("Trial#") ax2.set_xlim([0.5,tr+0.5]) ax2.set_ylabel('CS - pre') subplot(ax3) ax3.bar([0.6, 1.6, 2.6], [np.nanmean(preP), np.nanmean(postP), np.nanmean(postP2)], facecolor='none') t, pval = stats.ttest_rel(postP, preP) title('paired t p-value = %f' % pval) ax3.set_xticks([1,2,3]) ax3.set_xticklabels(['pre', CSname, measurement['matchedUSname']]) ax3.set_xlim([0.5,3.5]) ax3.set_ylabel('Raw mean values') tight_layout(2, h_pad=1, w_pad=1) if pp: fig.savefig(pp, format='pdf') close('all') return np.vstack((preP, postP, postP2)) def getSummary(data, dirname=None): for fish in data.keys(): for CSname in data[fish].keys(): if dirname: pp = PdfPages(os.path.join(dirname, '%s_for_%s.pdf' % (CSname,fish))) print 'generating %s_for_%s.pdf' % (CSname,fish) book = Workbook() sheet1 = book.add_sheet('speed3D') avgs = plotTrials(data, fish, CSname, 'speed3D', 30, pp=pp) putNp2xls(avgs, sheet1) sheet2 = book.add_sheet('d2inflow') avgs = plotTrials(data, fish, CSname, 'd2inflow', 200, pp=pp) putNp2xls(avgs, sheet2) # sheet3 = book.add_sheet('smoothedz') sheet3 = book.add_sheet('Z') # avgs = plotTrials(data, fish, CSname, 'smoothedz', 100, pp=pp) avgs = plotTrials(data, fish, CSname, 'Z', 30, pp=pp) putNp2xls(avgs, sheet3) sheet4 = book.add_sheet('ringpixels') avgs = plotTrials(data, fish, CSname, 'ringpixels', 1200, pp=pp) putNp2xls(avgs, sheet4) sheet5 = book.add_sheet('peaks_within') avgs = plotTrials(data, fish, CSname, 'peaks_within', 1.5, pp=pp) putNp2xls(avgs, sheet5) sheet6 = book.add_sheet('swimdir_within') avgs = plotTrials(data, fish, CSname, 'swimdir_within', 1.5, pp=pp) putNp2xls(avgs, sheet6) sheet7 = book.add_sheet('xy_within') avgs = plotTrials(data, fish, CSname, 'xy_within', 1.5, pp=pp) putNp2xls(avgs, sheet7) sheet8 = book.add_sheet('turns_shape') avgs = plotTrials(data, fish, CSname, 'turns_shape', 1.5, pp=pp) putNp2xls(avgs, sheet8) sheet9 = book.add_sheet('turns_vel') avgs = plotTrials(data, fish, CSname, 'turns_vel', 1.5, pp=pp) putNp2xls(avgs, sheet9) if dirname: pp.close() book.save(os.path.join(dirname, '%s_for_%s.xls' % (CSname,fish))) close('all') else: show() def add2Pickles(dirname, pickle_files): # dirname : folder to look for pickle files # pickle_files : output, a list to be concatenated. pattern = os.path.join(dirname, '*.pickle') temp = [_ for _ in glob(pattern) if not _.endswith('- Copy.pickle') and not os.path.basename(_).startswith('Summary')] pickle_files += temp if __name__ == '__main__': pickle_files = [] # small test data # add2Pickles('R:/Data/itoiori/behav/adult whitlock/conditioning/NeuroD/Aug4/test', pickle_files) # outputdir = 'R:/Data/itoiori/behav/adult whitlock/conditioning/NeuroD/Aug4/test' # show me what you got for pf in pickle_files: print pf fp = os.path.join(outputdir, 'Summary.pickle') createPDF = True # useful when plotting etc code updated if 1: # refresh analysis data = getPDFs(pickle_files, createPDF=createPDF) import cPickle as pickle with open(os.path.join(outputdir, 'Summary.pickle'), 'wb') as f: pickle.dump(data, f) else: # or reuse previous data = np.load(fp) getSummary(data, outputdir) pickle2mat(fp, data)
bsd-3-clause
4,991,329,245,887,673,000
36.435306
124
0.567291
false
2.972286
false
false
false
jkunimune15/Map-Projections
src/zupplemental/compose_maps.py
1
5115
#compose_maps.py #make ALL the maps import math from generate_borders import generate_borders from generate_graticule import generate_graticule, generate_backdrop from generate_indicatrices import generate_indicatrices from generate_orthodromes import generate_orthodromes from generate_shape import plot_shapes from generate_labels import generate_topographical_labels, label_shapes, label_points def compose_landmasses(): print('\t<g transform="matrix(1,0,0,-1,180,90)">') print('\t\t<g class="land">') plot_shapes('ne_50m_land', trim_antarctica=True) print('\t\t</g>') print('\t\t<g class="water">') plot_shapes('ne_50m_lakes', max_rank=4) print('\t\t</g>') print('\t</g>') def compose_graticule(): print('\t<g transform="matrix(1,0,0,-1,180,90)">') print('\t\t<g class="graticule">') generate_graticule(5, 1, include_tropics=True, adjust_poles=True) print('\t\t</g>') print('\t</g>') def compose_graticule2(): print('\t<g transform="matrix(1,0,0,-1,180,90)">') print('\t\t<g class="graticule">') generate_graticule(15, .25, include_tropics=True, adjust_poles=True, double_dateline=True) print('\t\t</g>') print('\t</g>') def compose_compound(): print('\t<g transform="matrix(1,0,0,-1,180,90)">') print('\t\t<g class="land">') plot_shapes('ne_50m_land', trim_antarctica=True) print('\t\t</g>') print('\t\t<g class="river">') plot_shapes('ne_50m_rivers_lake_centerlines', max_rank=4) print('\t\t</g>') print('\t\t<g class="lakes">') plot_shapes('ne_50m_lakes', max_rank=4) print('\t\t</g>') print('\t\t<g class="graticule">') generate_graticule(15, 1, include_tropics=True, adjust_poles=True) print('\t\t</g>') print('\t</g>') def compose_indicatrices(): print('\t<g transform="matrix(1,0,0,-1,180,90)">') print('\t\t<g class="land">') plot_shapes('ne_50m_land', trim_antarctica=True) print('\t\t</g>') print('\t\t<g class="lakes">') plot_shapes('ne_50m_lakes', max_rank=4) print('\t\t</g>') print('\t\t<g class="tissot">') generate_indicatrices(15, math.radians(3.75), resolution=180, adjust_poles=True) print('\t\t</g>') print('\t</g>') def compose_indicatrices2(ctr_meridian): print('\t<g transform="matrix(1,0,0,-1,180,90)">') print('\t\t<g class="water">') generate_backdrop(.5, ctr_meridian=ctr_meridian) print('\t\t</g>') print('\t\t<g class="land">') plot_shapes('ne_110m_land', flesh_out_antarctica=True) print('\t\t</g>') print('\t\t<g class="lakes">') plot_shapes('ne_110m_lakes') print('\t\t</g>') print('\t\t<g class="graticule">') generate_graticule(10, .5, double_dateline=(ctr_meridian==0)) print('\t\t</g>') print('\t\t<g class="tissot">') generate_indicatrices(30, 500/6371, ctr_meridian=ctr_meridian, adjust_poles=True, resolution=120, side_res=5, pole_res=120) print('\t\t</g>') print('\t</g>') def compose_political(): print('\t<g transform="matrix(1,0,0,-1,180,90)">') print('\t\t<g class="country">') generate_borders('ne_50m', trim_antarctica=True) print('\t\t</g>') print('\t\t<g class="lakes">') plot_shapes('ne_50m_lakes', max_rank=4) print('\t\t</g>') print('\t</g>') label_shapes('ne_50m_admin_0_countries', "pol") def compose_orthodromes(): print('\t<g transform="matrix(1,0,0,-1,180,90)">') print('\t\t<g class="lines">') generate_orthodromes() print('\t\t</g>') print('\t</g>') def compose_everything(): print('\t<g transform="matrix(1,0,0,-1,180,90)">') print('\t\t<g class="country">') generate_borders('ne_10m', trim_antarctica=True, borders_only=False) print('\t\t<g class="border">') generate_borders('ne_10m', trim_antarctica=True, borders_only=True) print('\t\t</g>') print('\t\t</g>') print('\t\t<g class="sovereign">') plot_shapes('ne_10m_admin_0_map_units') print('\t\t</g>') print('\t\t<g class="admin">') plot_shapes('ne_10m_admin_1_states_provinces_lines', filter_field='adm0_a3', filter_vals=['RUS','CAN','CHN','USA','BRA','AUS','IND','ARG','KAZ']) print('\t\t</g>') print('\t\t<g class="dispute">') plot_shapes('ne_10m_admin_0_boundary_lines_disputed_areas') print('\t\t</g>') print('\t\t<g class="coastline">') plot_shapes('ne_10m_coastline', trim_antarctica=True) print('\t\t</g>') print('\t\t<g class="river">') plot_shapes('ne_10m_rivers_lake_centerlines', max_rank=5) print('\t\t</g>') print('\t\t<g class="lake">') plot_shapes('ne_10m_lakes', max_rank=4) print('\t\t</g>') print('\t\t<g class="graticule">') generate_graticule(5, 1, include_tropics=True, adjust_poles=True) plot_shapes('ne_10m_geographic_lines', clazz="dateline", filter_field='name', filter_vals=["International Date Line"]) print('\t\t</g>') print('\t</g>') generate_topographical_labels('ne_50m', max_rank=2, text_size=4) label_shapes('ne_10m_lakes', "sea", max_rank=1, text_size=1) label_shapes('ne_10m_admin_0_countries', "pol", text_size=4) label_points('cities_capital', "cap", text_size=1) label_points('cities_other', "cit", text_size=0) if __name__ == '__main__': # compose_landmasses() # compose_graticule() # compose_compound() # compose_indicatrices() # compose_indicatrices2(-0) # compose_political() # compose_orthodromes() compose_everything()
mit
-1,186,010,880,348,605,000
32.874172
124
0.657869
false
2.37355
false
false
false
francisco-dlp/hyperspy
hyperspy/drawing/utils.py
1
57321
# -*- coding: utf-8 -*- # Copyright 2007-2016 The HyperSpy developers # # This file is part of HyperSpy. # # HyperSpy is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # HyperSpy is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with HyperSpy. If not, see <http://www.gnu.org/licenses/>. import copy import itertools import textwrap from traits import trait_base import matplotlib.pyplot as plt import matplotlib as mpl from mpl_toolkits.axes_grid1 import make_axes_locatable from matplotlib.backend_bases import key_press_handler import warnings import numpy as np from distutils.version import LooseVersion import logging import hyperspy as hs _logger = logging.getLogger(__name__) def contrast_stretching(data, saturated_pixels): """Calculate bounds that leaves out a given percentage of the data. Parameters ---------- data: numpy array saturated_pixels: scalar, None The percentage of pixels that are left out of the bounds. For example, the low and high bounds of a value of 1 are the 0.5% and 99.5% percentiles. It must be in the [0, 100] range. If None, set the value to 0. Returns ------- vmin, vmax: scalar The low and high bounds Raises ------ ValueError if the value of `saturated_pixels` is out of the valid range. """ # Sanity check if saturated_pixels is None: saturated_pixels = 0 if not 0 <= saturated_pixels <= 100: raise ValueError( "saturated_pixels must be a scalar in the range[0, 100]") vmin = np.nanpercentile(data, saturated_pixels / 2.) vmax = np.nanpercentile(data, 100 - saturated_pixels / 2.) return vmin, vmax MPL_DIVERGING_COLORMAPS = [ "BrBG", "bwr", "coolwarm", "PiYG", "PRGn", "PuOr", "RdBu", "RdGy", "RdYIBu", "RdYIGn", "seismic", "Spectral", ] # Add reversed colormaps MPL_DIVERGING_COLORMAPS += [cmap + "_r" for cmap in MPL_DIVERGING_COLORMAPS] def centre_colormap_values(vmin, vmax): """Calculate vmin and vmax to set the colormap midpoint to zero. Parameters ---------- vmin, vmax : scalar The range of data to display. Returns ------- cvmin, cvmax : scalar The values to obtain a centre colormap. """ absmax = max(abs(vmin), abs(vmax)) return -absmax, absmax def create_figure(window_title=None, _on_figure_window_close=None, disable_xyscale_keys=False, **kwargs): """Create a matplotlib figure. This function adds the possibility to execute another function when the figure is closed and to easily set the window title. Any keyword argument is passed to the plt.figure function Parameters ---------- window_title : string _on_figure_window_close : function disable_xyscale_keys : bool, disable the `k`, `l` and `L` shortcuts which toggle the x or y axis between linear and log scale. Returns ------- fig : plt.figure """ fig = plt.figure(**kwargs) if window_title is not None: # remove non-alphanumeric characters to prevent file saving problems # This is a workaround for: # https://github.com/matplotlib/matplotlib/issues/9056 reserved_characters = r'<>"/\|?*' for c in reserved_characters: window_title = window_title.replace(c, '') window_title = window_title.replace('\n', ' ') window_title = window_title.replace(':', ' -') fig.canvas.set_window_title(window_title) if disable_xyscale_keys and hasattr(fig.canvas, 'toolbar'): # hack the `key_press_handler` to disable the `k`, `l`, `L` shortcuts manager = fig.canvas.manager fig.canvas.mpl_disconnect(manager.key_press_handler_id) manager.key_press_handler_id = manager.canvas.mpl_connect( 'key_press_event', lambda event: key_press_handler_custom(event, manager.canvas)) if _on_figure_window_close is not None: on_figure_window_close(fig, _on_figure_window_close) return fig def key_press_handler_custom(event, canvas): if event.key not in ['k', 'l', 'L']: key_press_handler(event, canvas, canvas.manager.toolbar) def on_figure_window_close(figure, function): """Connects a close figure signal to a given function. Parameters ---------- figure : mpl figure instance function : function """ def function_wrapper(evt): function() figure.canvas.mpl_connect('close_event', function_wrapper) def plot_RGB_map(im_list, normalization='single', dont_plot=False): """Plot 2 or 3 maps in RGB. Parameters ---------- im_list : list of Signal2D instances normalization : {'single', 'global'} dont_plot : bool Returns ------- array: RGB matrix """ # from widgets import cursors height, width = im_list[0].data.shape[:2] rgb = np.zeros((height, width, 3)) rgb[:, :, 0] = im_list[0].data.squeeze() rgb[:, :, 1] = im_list[1].data.squeeze() if len(im_list) == 3: rgb[:, :, 2] = im_list[2].data.squeeze() if normalization == 'single': for i in range(len(im_list)): rgb[:, :, i] /= rgb[:, :, i].max() elif normalization == 'global': rgb /= rgb.max() rgb = rgb.clip(0, rgb.max()) if not dont_plot: figure = plt.figure() ax = figure.add_subplot(111) ax.frameon = False ax.set_axis_off() ax.imshow(rgb, interpolation='nearest') # cursors.set_mpl_ax(ax) figure.canvas.draw_idle() else: return rgb def subplot_parameters(fig): """Returns a list of the subplot parameters of a mpl figure. Parameters ---------- fig : mpl figure Returns ------- tuple : (left, bottom, right, top, wspace, hspace) """ wspace = fig.subplotpars.wspace hspace = fig.subplotpars.hspace left = fig.subplotpars.left right = fig.subplotpars.right top = fig.subplotpars.top bottom = fig.subplotpars.bottom return left, bottom, right, top, wspace, hspace class ColorCycle: _color_cycle = [mpl.colors.colorConverter.to_rgba(color) for color in ('b', 'g', 'r', 'c', 'm', 'y', 'k')] def __init__(self): self.color_cycle = copy.copy(self._color_cycle) def __call__(self): if not self.color_cycle: self.color_cycle = copy.copy(self._color_cycle) return self.color_cycle.pop(0) def plot_signals(signal_list, sync=True, navigator="auto", navigator_list=None, **kwargs): """Plot several signals at the same time. Parameters ---------- signal_list : list of BaseSignal instances If sync is set to True, the signals must have the same navigation shape, but not necessarily the same signal shape. sync : True or False, default "True" If True: the signals will share navigation, all the signals must have the same navigation shape for this to work, but not necessarily the same signal shape. navigator : {"auto", None, "spectrum", "slider", BaseSignal}, default "auto" See signal.plot docstring for full description navigator_list : {List of navigator arguments, None}, default None Set different navigator options for the signals. Must use valid navigator arguments: "auto", None, "spectrum", "slider", or a hyperspy Signal. The list must have the same size as signal_list. If None, the argument specified in navigator will be used. **kwargs Any extra keyword arguments are passed to each signal `plot` method. Example ------- >>> s_cl = hs.load("coreloss.dm3") >>> s_ll = hs.load("lowloss.dm3") >>> hs.plot.plot_signals([s_cl, s_ll]) Specifying the navigator: >>> s_cl = hs.load("coreloss.dm3") >>> s_ll = hs.load("lowloss.dm3") >>> hs.plot.plot_signals([s_cl, s_ll], navigator="slider") Specifying the navigator for each signal: >>> s_cl = hs.load("coreloss.dm3") >>> s_ll = hs.load("lowloss.dm3") >>> s_edx = hs.load("edx.dm3") >>> s_adf = hs.load("adf.dm3") >>> hs.plot.plot_signals( [s_cl, s_ll, s_edx], navigator_list=["slider",None,s_adf]) """ import hyperspy.signal if navigator_list: if not (len(signal_list) == len(navigator_list)): raise ValueError( "signal_list and navigator_list must" " have the same size") if sync: axes_manager_list = [] for signal in signal_list: axes_manager_list.append(signal.axes_manager) if not navigator_list: navigator_list = [] if navigator is None: navigator_list.extend([None] * len(signal_list)) elif isinstance(navigator, hyperspy.signal.BaseSignal): navigator_list.append(navigator) navigator_list.extend([None] * (len(signal_list) - 1)) elif navigator == "slider": navigator_list.append("slider") navigator_list.extend([None] * (len(signal_list) - 1)) elif navigator == "spectrum": navigator_list.extend(["spectrum"] * len(signal_list)) elif navigator == "auto": navigator_list.extend(["auto"] * len(signal_list)) else: raise ValueError( "navigator must be one of \"spectrum\",\"auto\"," " \"slider\", None, a Signal instance") # Check to see if the spectra have the same navigational shapes temp_shape_first = axes_manager_list[0].navigation_shape for i, axes_manager in enumerate(axes_manager_list): temp_shape = axes_manager.navigation_shape if not (temp_shape_first == temp_shape): raise ValueError( "The spectra does not have the same navigation shape") axes_manager_list[i] = axes_manager.deepcopy() if i > 0: for axis0, axisn in zip(axes_manager_list[0].navigation_axes, axes_manager_list[i].navigation_axes): axes_manager_list[i]._axes[axisn.index_in_array] = axis0 del axes_manager for signal, navigator, axes_manager in zip(signal_list, navigator_list, axes_manager_list): signal.plot(axes_manager=axes_manager, navigator=navigator, **kwargs) # If sync is False else: if not navigator_list: navigator_list = [] navigator_list.extend([navigator] * len(signal_list)) for signal, navigator in zip(signal_list, navigator_list): signal.plot(navigator=navigator, **kwargs) def _make_heatmap_subplot(spectra): from hyperspy._signals.signal2d import Signal2D im = Signal2D(spectra.data, axes=spectra.axes_manager._get_axes_dicts()) im.metadata.General.title = spectra.metadata.General.title im.plot() return im._plot.signal_plot.ax def set_xaxis_lims(mpl_ax, hs_axis): """ Set the matplotlib axis limits to match that of a HyperSpy axis Parameters ---------- mpl_ax : :class:`matplotlib.axis.Axis` The ``matplotlib`` axis to change hs_axis : :class:`~hyperspy.axes.DataAxis` The data axis that contains the values that control the scaling """ x_axis_lower_lim = hs_axis.axis[0] x_axis_upper_lim = hs_axis.axis[-1] mpl_ax.set_xlim(x_axis_lower_lim, x_axis_upper_lim) def _make_overlap_plot(spectra, ax, color="blue", line_style='-'): if isinstance(color, str): color = [color] * len(spectra) if isinstance(line_style, str): line_style = [line_style] * len(spectra) for spectrum_index, (spectrum, color, line_style) in enumerate( zip(spectra, color, line_style)): x_axis = spectrum.axes_manager.signal_axes[0] spectrum = _transpose_if_required(spectrum, 1) ax.plot(x_axis.axis, spectrum.data, color=color, ls=line_style) set_xaxis_lims(ax, x_axis) _set_spectrum_xlabel(spectra if isinstance(spectra, hs.signals.BaseSignal) else spectra[-1], ax) ax.set_ylabel('Intensity') ax.autoscale(tight=True) def _make_cascade_subplot( spectra, ax, color="blue", line_style='-', padding=1): max_value = 0 for spectrum in spectra: spectrum_yrange = (np.nanmax(spectrum.data) - np.nanmin(spectrum.data)) if spectrum_yrange > max_value: max_value = spectrum_yrange if isinstance(color, str): color = [color] * len(spectra) if isinstance(line_style, str): line_style = [line_style] * len(spectra) for spectrum_index, (spectrum, color, line_style) in enumerate( zip(spectra, color, line_style)): x_axis = spectrum.axes_manager.signal_axes[0] spectrum = _transpose_if_required(spectrum, 1) data_to_plot = ((spectrum.data - spectrum.data.min()) / float(max_value) + spectrum_index * padding) ax.plot(x_axis.axis, data_to_plot, color=color, ls=line_style) set_xaxis_lims(ax, x_axis) _set_spectrum_xlabel(spectra if isinstance(spectra, hs.signals.BaseSignal) else spectra[-1], ax) ax.set_yticks([]) ax.autoscale(tight=True) def _plot_spectrum(spectrum, ax, color="blue", line_style='-'): x_axis = spectrum.axes_manager.signal_axes[0] ax.plot(x_axis.axis, spectrum.data, color=color, ls=line_style) set_xaxis_lims(ax, x_axis) def _set_spectrum_xlabel(spectrum, ax): x_axis = spectrum.axes_manager.signal_axes[0] ax.set_xlabel("%s (%s)" % (x_axis.name, x_axis.units)) def _transpose_if_required(signal, expected_dimension): # EDS profiles or maps have signal dimension = 0 and navigation dimension # 1 or 2. For convenience transpose the signal if possible if (signal.axes_manager.signal_dimension == 0 and signal.axes_manager.navigation_dimension == expected_dimension): return signal.T else: return signal def plot_images(images, cmap=None, no_nans=False, per_row=3, label='auto', labelwrap=30, suptitle=None, suptitle_fontsize=18, colorbar='multi', centre_colormap="auto", saturated_pixels=0, scalebar=None, scalebar_color='white', axes_decor='all', padding=None, tight_layout=False, aspect='auto', min_asp=0.1, namefrac_thresh=0.4, fig=None, vmin=None, vmax=None, *args, **kwargs): """Plot multiple images as sub-images in one figure. Extra keyword arguments are passed to `matplotlib.figure`. Parameters ---------- images : list of Signal2D or BaseSignal `images` should be a list of Signals to plot. For `BaseSignal` with navigation dimensions 2 and signal dimension 0, the signal will be tranposed to form a `Signal2D`. Multi-dimensional images will have each plane plotted as a separate image. If any signal shape is not suitable, a ValueError will be raised. cmap : matplotlib colormap, list, or ``'mpl_colors'``, *optional* The colormap used for the images, by default read from ``pyplot``. A list of colormaps can also be provided, and the images will cycle through them. Optionally, the value ``'mpl_colors'`` will cause the cmap to loop through the default ``matplotlib`` colors (to match with the default output of the :py:func:`~.drawing.utils.plot_spectra` method. Note: if using more than one colormap, using the ``'single'`` option for ``colorbar`` is disallowed. no_nans : bool, optional If True, set nans to zero for plotting. per_row : int, optional The number of plots in each row label : None, str, or list of str, optional Control the title labeling of the plotted images. If None, no titles will be shown. If 'auto' (default), function will try to determine suitable titles using Signal2D titles, falling back to the 'titles' option if no good short titles are detected. Works best if all images to be plotted have the same beginning to their titles. If 'titles', the title from each image's metadata.General.title will be used. If any other single str, images will be labeled in sequence using that str as a prefix. If a list of str, the list elements will be used to determine the labels (repeated, if necessary). labelwrap : int, optional integer specifying the number of characters that will be used on one line If the function returns an unexpected blank figure, lower this value to reduce overlap of the labels between each figure suptitle : str, optional Title to use at the top of the figure. If called with label='auto', this parameter will override the automatically determined title. suptitle_fontsize : int, optional Font size to use for super title at top of figure colorbar : {'multi', None, 'single'} Controls the type of colorbars that are plotted. If None, no colorbar is plotted. If 'multi' (default), individual colorbars are plotted for each (non-RGB) image If 'single', all (non-RGB) images are plotted on the same scale, and one colorbar is shown for all centre_colormap : {"auto", True, False} If True the centre of the color scheme is set to zero. This is specially useful when using diverging color schemes. If "auto" (default), diverging color schemes are automatically centred. saturated_pixels: None, scalar or list of scalar, optional, default: 0 If list of scalar, the length should match the number of images to show. If provide in the list, set the value to 0. The percentage of pixels that are left out of the bounds. For example, the low and high bounds of a value of 1 are the 0.5% and 99.5% percentiles. It must be in the [0, 100] range. scalebar : {None, 'all', list of ints}, optional If None (or False), no scalebars will be added to the images. If 'all', scalebars will be added to all images. If list of ints, scalebars will be added to each image specified. scalebar_color : str, optional A valid MPL color string; will be used as the scalebar color axes_decor : {'all', 'ticks', 'off', None}, optional Controls how the axes are displayed on each image; default is 'all' If 'all', both ticks and axis labels will be shown If 'ticks', no axis labels will be shown, but ticks/labels will If 'off', all decorations and frame will be disabled If None, no axis decorations will be shown, but ticks/frame will padding : None or dict, optional This parameter controls the spacing between images. If None, default options will be used Otherwise, supply a dictionary with the spacing options as keywords and desired values as values Values should be supplied as used in pyplot.subplots_adjust(), and can be: 'left', 'bottom', 'right', 'top', 'wspace' (width), and 'hspace' (height) tight_layout : bool, optional If true, hyperspy will attempt to improve image placement in figure using matplotlib's tight_layout If false, repositioning images inside the figure will be left as an exercise for the user. aspect : str or numeric, optional If 'auto', aspect ratio is auto determined, subject to min_asp. If 'square', image will be forced onto square display. If 'equal', aspect ratio of 1 will be enforced. If float (or int/long), given value will be used. min_asp : float, optional Minimum aspect ratio to be used when plotting images namefrac_thresh : float, optional Threshold to use for auto-labeling. This parameter controls how much of the titles must be the same for the auto-shortening of labels to activate. Can vary from 0 to 1. Smaller values encourage shortening of titles by auto-labeling, while larger values will require more overlap in titles before activing the auto-label code. fig : mpl figure, optional If set, the images will be plotted to an existing MPL figure vmin, vmax : scalar or list of scalar, optional, default: None If list of scalar, the length should match the number of images to show. A list of scalar is not compatible with a single colorbar. See vmin, vmax of matplotlib.imshow() for more details. *args, **kwargs, optional Additional arguments passed to matplotlib.imshow() Returns ------- axes_list : list a list of subplot axes that hold the images See Also -------- plot_spectra : Plotting of multiple spectra plot_signals : Plotting of multiple signals plot_histograms : Compare signal histograms Notes ----- `interpolation` is a useful parameter to provide as a keyword argument to control how the space between pixels is interpolated. A value of ``'nearest'`` will cause no interpolation between pixels. `tight_layout` is known to be quite brittle, so an option is provided to disable it. Turn this option off if output is not as expected, or try adjusting `label`, `labelwrap`, or `per_row` """ def __check_single_colorbar(cbar): if cbar == 'single': raise ValueError('Cannot use a single colorbar with multiple ' 'colormaps. Please check for compatible ' 'arguments.') from hyperspy.drawing.widgets import ScaleBar from hyperspy.misc import rgb_tools from hyperspy.signal import BaseSignal # Check that we have a hyperspy signal im = [images] if not isinstance(images, (list, tuple)) else images for image in im: if not isinstance(image, BaseSignal): raise ValueError("`images` must be a list of image signals or a " "multi-dimensional signal." " " + repr(type(images)) + " was given.") # For list of EDS maps, transpose the BaseSignal if isinstance(images, (list, tuple)): images = [_transpose_if_required(image, 2) for image in images] # If input is >= 1D signal (e.g. for multi-dimensional plotting), # copy it and put it in a list so labeling works out as (x,y) when plotting if isinstance(images, BaseSignal) and images.axes_manager.navigation_dimension > 0: images = [images._deepcopy_with_new_data(images.data)] n = 0 for i, sig in enumerate(images): if sig.axes_manager.signal_dimension != 2: raise ValueError("This method only plots signals that are images. " "The signal dimension must be equal to 2. " "The signal at position " + repr(i) + " was " + repr(sig) + ".") # increment n by the navigation size, or by 1 if the navigation size is # <= 0 n += (sig.axes_manager.navigation_size if sig.axes_manager.navigation_size > 0 else 1) # If no cmap given, get default colormap from pyplot: if cmap is None: cmap = [plt.get_cmap().name] elif cmap == 'mpl_colors': for n_color, c in enumerate(mpl.rcParams['axes.prop_cycle']): make_cmap(colors=['#000000', c['color']], name='mpl{}'.format(n_color)) cmap = ['mpl{}'.format(i) for i in range(len(mpl.rcParams['axes.prop_cycle']))] __check_single_colorbar(colorbar) # cmap is list, tuple, or something else iterable (but not string): elif hasattr(cmap, '__iter__') and not isinstance(cmap, str): try: cmap = [c.name for c in cmap] # convert colormap to string except AttributeError: cmap = [c for c in cmap] # c should be string if not colormap __check_single_colorbar(colorbar) elif isinstance(cmap, mpl.colors.Colormap): cmap = [cmap.name] # convert single colormap to list with string elif isinstance(cmap, str): cmap = [cmap] # cmap is single string, so make it a list else: # Didn't understand cmap input, so raise error raise ValueError('The provided cmap value was not understood. Please ' 'check input values.') # If any of the cmaps given are diverging, and auto-centering, set the # appropriate flag: if centre_colormap == "auto": centre_colormaps = [] for c in cmap: if c in MPL_DIVERGING_COLORMAPS: centre_colormaps.append(True) else: centre_colormaps.append(False) # if it was True, just convert to list elif centre_colormap: centre_colormaps = [True] # likewise for false elif not centre_colormap: centre_colormaps = [False] # finally, convert lists to cycle generators for adaptive length: centre_colormaps = itertools.cycle(centre_colormaps) cmap = itertools.cycle(cmap) def _check_arg(arg, default_value, arg_name): if isinstance(arg, list): if len(arg) != n: _logger.warning('The provided {} values are ignored because the ' 'length of the list does not match the number of ' 'images'.format(arg_name)) arg = [default_value] * n else: arg = [arg] * n return arg vmin = _check_arg(vmin, None, 'vmin') vmax = _check_arg(vmax, None, 'vmax') saturated_pixels = _check_arg(saturated_pixels, 0, 'saturated_pixels') # Sort out the labeling: div_num = 0 all_match = False shared_titles = False user_labels = False if label is None: pass elif label == 'auto': # Use some heuristics to try to get base string of similar titles label_list = [x.metadata.General.title for x in images] # Find the shortest common string between the image titles # and pull that out as the base title for the sequence of images # array in which to store arrays res = np.zeros((len(label_list), len(label_list[0]) + 1)) res[:, 0] = 1 # j iterates the strings for j in range(len(label_list)): # i iterates length of substring test for i in range(1, len(label_list[0]) + 1): # stores whether or not characters in title match res[j, i] = label_list[0][:i] in label_list[j] # sum up the results (1 is True, 0 is False) and create # a substring based on the minimum value (this will be # the "smallest common string" between all the titles if res.all(): basename = label_list[0] div_num = len(label_list[0]) all_match = True else: div_num = int(min(np.sum(res, 1))) basename = label_list[0][:div_num - 1] all_match = False # trim off any '(' or ' ' characters at end of basename if div_num > 1: while True: if basename[len(basename) - 1] == '(': basename = basename[:-1] elif basename[len(basename) - 1] == ' ': basename = basename[:-1] else: break # namefrac is ratio of length of basename to the image name # if it is high (e.g. over 0.5), we can assume that all images # share the same base if len(label_list[0]) > 0: namefrac = float(len(basename)) / len(label_list[0]) else: # If label_list[0] is empty, it means there was probably no # title set originally, so nothing to share namefrac = 0 if namefrac > namefrac_thresh: # there was a significant overlap of label beginnings shared_titles = True # only use new suptitle if one isn't specified already if suptitle is None: suptitle = basename else: # there was not much overlap, so default back to 'titles' mode shared_titles = False label = 'titles' div_num = 0 elif label == 'titles': # Set label_list to each image's pre-defined title label_list = [x.metadata.General.title for x in images] elif isinstance(label, str): # Set label_list to an indexed list, based off of label label_list = [label + " " + repr(num) for num in range(n)] elif isinstance(label, list) and all( isinstance(x, str) for x in label): label_list = label user_labels = True # If list of labels is longer than the number of images, just use the # first n elements if len(label_list) > n: del label_list[n:] if len(label_list) < n: label_list *= (n // len(label_list)) + 1 del label_list[n:] else: raise ValueError("Did not understand input of labels.") # Determine appropriate number of images per row rows = int(np.ceil(n / float(per_row))) if n < per_row: per_row = n # Set overall figure size and define figure (if not pre-existing) if fig is None: k = max(plt.rcParams['figure.figsize']) / max(per_row, rows) f = plt.figure(figsize=(tuple(k * i for i in (per_row, rows)))) else: f = fig # Initialize list to hold subplot axes axes_list = [] # Initialize list of rgb tags isrgb = [False] * len(images) # Check to see if there are any rgb images in list # and tag them using the isrgb list for i, img in enumerate(images): if rgb_tools.is_rgbx(img.data): isrgb[i] = True # Determine how many non-rgb Images there are non_rgb = list(itertools.compress(images, [not j for j in isrgb])) if len(non_rgb) == 0 and colorbar is not None: colorbar = None warnings.warn("Sorry, colorbar is not implemented for RGB images.") # Find global min and max values of all the non-rgb images for use with # 'single' scalebar if colorbar == 'single': # get a g_saturated_pixels from saturated_pixels if isinstance(saturated_pixels, list): g_saturated_pixels = min(np.array([v for v in saturated_pixels])) else: g_saturated_pixels = saturated_pixels # estimate a g_vmin and g_max from saturated_pixels g_vmin, g_vmax = contrast_stretching(np.concatenate( [i.data.flatten() for i in non_rgb]), g_saturated_pixels) # if vmin and vmax are provided, override g_min and g_max if isinstance(vmin, list): _logger.warning('vmin have to be a scalar to be compatible with a ' 'single colorbar') else: g_vmin = vmin if vmin is not None else g_vmin if isinstance(vmax, list): _logger.warning('vmax have to be a scalar to be compatible with a ' 'single colorbar') else: g_vmax = vmax if vmax is not None else g_vmax if next(centre_colormaps): g_vmin, g_vmax = centre_colormap_values(g_vmin, g_vmax) # Check if we need to add a scalebar for some of the images if isinstance(scalebar, list) and all(isinstance(x, int) for x in scalebar): scalelist = True else: scalelist = False idx = 0 ax_im_list = [0] * len(isrgb) # Replot: create a list to store references to the images replot_ims = [] # Loop through each image, adding subplot for each one for i, ims in enumerate(images): # Get handles for the signal axes and axes_manager axes_manager = ims.axes_manager if axes_manager.navigation_dimension > 0: ims = ims._deepcopy_with_new_data(ims.data) for j, im in enumerate(ims): ax = f.add_subplot(rows, per_row, idx + 1) axes_list.append(ax) data = im.data centre = next(centre_colormaps) # get next value for centreing # Enable RGB plotting if rgb_tools.is_rgbx(data): data = rgb_tools.rgbx2regular_array(data, plot_friendly=True) l_vmin, l_vmax = None, None else: data = im.data # Find min and max for contrast l_vmin, l_vmax = contrast_stretching( data, saturated_pixels[idx]) l_vmin = vmin[idx] if vmin[idx] is not None else l_vmin l_vmax = vmax[idx] if vmax[idx] is not None else l_vmax if centre: l_vmin, l_vmax = centre_colormap_values(l_vmin, l_vmax) # Remove NaNs (if requested) if no_nans: data = np.nan_to_num(data) # Get handles for the signal axes and axes_manager axes_manager = im.axes_manager axes = axes_manager.signal_axes # Set dimensions of images xaxis = axes[0] yaxis = axes[1] extent = ( xaxis.low_value, xaxis.high_value, yaxis.high_value, yaxis.low_value, ) if not isinstance(aspect, (int, float)) and aspect not in [ 'auto', 'square', 'equal']: _logger.warning("Did not understand aspect ratio input. " "Using 'auto' as default.") aspect = 'auto' if aspect == 'auto': if float(yaxis.size) / xaxis.size < min_asp: factor = min_asp * float(xaxis.size) / yaxis.size elif float(yaxis.size) / xaxis.size > min_asp ** -1: factor = min_asp ** -1 * float(xaxis.size) / yaxis.size else: factor = 1 asp = np.abs(factor * float(xaxis.scale) / yaxis.scale) elif aspect == 'square': asp = abs(extent[1] - extent[0]) / abs(extent[3] - extent[2]) elif aspect == 'equal': asp = 1 elif isinstance(aspect, (int, float)): asp = aspect if 'interpolation' not in kwargs.keys(): kwargs['interpolation'] = 'nearest' # Get colormap for this image: cm = next(cmap) # Plot image data, using vmin and vmax to set bounds, # or allowing them to be set automatically if using individual # colorbars if colorbar == 'single' and not isrgb[i]: axes_im = ax.imshow(data, cmap=cm, extent=extent, vmin=g_vmin, vmax=g_vmax, aspect=asp, *args, **kwargs) ax_im_list[i] = axes_im else: axes_im = ax.imshow(data, cmap=cm, extent=extent, vmin=l_vmin, vmax=l_vmax, aspect=asp, *args, **kwargs) ax_im_list[i] = axes_im # If an axis trait is undefined, shut off : if isinstance(xaxis.units, trait_base._Undefined) or \ isinstance(yaxis.units, trait_base._Undefined) or \ isinstance(xaxis.name, trait_base._Undefined) or \ isinstance(yaxis.name, trait_base._Undefined): if axes_decor == 'all': _logger.warning( 'Axes labels were requested, but one ' 'or both of the ' 'axes units and/or name are undefined. ' 'Axes decorations have been set to ' '\'ticks\' instead.') axes_decor = 'ticks' # If all traits are defined, set labels as appropriate: else: ax.set_xlabel(axes[0].name + " axis (" + axes[0].units + ")") ax.set_ylabel(axes[1].name + " axis (" + axes[1].units + ")") if label: if all_match: title = '' elif shared_titles: title = label_list[i][div_num - 1:] else: if len(ims) == n: # This is true if we are plotting just 1 # multi-dimensional Signal2D title = label_list[idx] elif user_labels: title = label_list[idx] else: title = label_list[i] if ims.axes_manager.navigation_size > 1 and not user_labels: title += " %s" % str(ims.axes_manager.indices) ax.set_title(textwrap.fill(title, labelwrap)) # Set axes decorations based on user input set_axes_decor(ax, axes_decor) # If using independent colorbars, add them if colorbar == 'multi' and not isrgb[i]: div = make_axes_locatable(ax) cax = div.append_axes("right", size="5%", pad=0.05) plt.colorbar(axes_im, cax=cax) # Add scalebars as necessary if (scalelist and idx in scalebar) or scalebar == 'all': ax.scalebar = ScaleBar( ax=ax, units=axes[0].units, color=scalebar_color, ) # Replot: store references to the images replot_ims.append(im) idx += 1 # If using a single colorbar, add it, and do tight_layout, ensuring that # a colorbar is only added based off of non-rgb Images: if colorbar == 'single': foundim = None for i in range(len(isrgb)): if (not isrgb[i]) and foundim is None: foundim = i if foundim is not None: f.subplots_adjust(right=0.8) cbar_ax = f.add_axes([0.9, 0.1, 0.03, 0.8]) f.colorbar(ax_im_list[foundim], cax=cbar_ax) if tight_layout: # tight_layout, leaving room for the colorbar plt.tight_layout(rect=[0, 0, 0.9, 1]) elif tight_layout: plt.tight_layout() elif tight_layout: plt.tight_layout() # Set top bounds for shared titles and add suptitle if suptitle: f.subplots_adjust(top=0.85) f.suptitle(suptitle, fontsize=suptitle_fontsize) # If we want to plot scalebars, loop through the list of axes and add them if scalebar is None or scalebar is False: # Do nothing if no scalebars are called for pass elif scalebar == 'all': # scalebars were taken care of in the plotting loop pass elif scalelist: # scalebars were taken care of in the plotting loop pass else: raise ValueError("Did not understand scalebar input. Must be None, " "\'all\', or list of ints.") # Adjust subplot spacing according to user's specification if padding is not None: plt.subplots_adjust(**padding) # Replot: connect function def on_dblclick(event): # On the event of a double click, replot the selected subplot if not event.inaxes: return if not event.dblclick: return subplots = [axi for axi in f.axes if isinstance(axi, mpl.axes.Subplot)] inx = list(subplots).index(event.inaxes) im = replot_ims[inx] # Use some of the info in the subplot cm = subplots[inx].images[0].get_cmap() clim = subplots[inx].images[0].get_clim() sbar = False if (scalelist and inx in scalebar) or scalebar == 'all': sbar = True im.plot(colorbar=bool(colorbar), vmin=clim[0], vmax=clim[1], no_nans=no_nans, aspect=asp, scalebar=sbar, scalebar_color=scalebar_color, cmap=cm) f.canvas.mpl_connect('button_press_event', on_dblclick) return axes_list def set_axes_decor(ax, axes_decor): if axes_decor == 'off': ax.axis('off') elif axes_decor == 'ticks': ax.set_xlabel('') ax.set_ylabel('') elif axes_decor == 'all': pass elif axes_decor is None: ax.set_xlabel('') ax.set_ylabel('') ax.set_xticklabels([]) ax.set_yticklabels([]) def make_cmap(colors, name='my_colormap', position=None, bit=False, register=True): """ Create a matplotlib colormap with customized colors, optionally registering it with matplotlib for simplified use. Adapted from Chris Slocum's code at: https://github.com/CSlocumWX/custom_colormap/blob/master/custom_colormaps.py and used under the terms of that code's BSD-3 license Parameters ---------- colors : iterable list of either tuples containing rgb values, or html strings Colors should be arranged so that the first color is the lowest value for the colorbar and the last is the highest. name : str name of colormap to use when registering with matplotlib position : None or iterable list containing the values (from [0,1]) that dictate the position of each color within the colormap. If None (default), the colors will be equally-spaced within the colorbar. bit : boolean True if RGB colors are given in 8-bit [0 to 255] or False if given in arithmetic basis [0 to 1] (default) register : boolean switch to control whether or not to register the custom colormap with matplotlib in order to enable use by just the name string """ def _html_color_to_rgb(color_string): """ convert #RRGGBB to an (R, G, B) tuple """ color_string = color_string.strip() if color_string[0] == '#': color_string = color_string[1:] if len(color_string) != 6: raise ValueError( "input #{} is not in #RRGGBB format".format(color_string)) r, g, b = color_string[:2], color_string[2:4], color_string[4:] r, g, b = [int(n, 16) / 255 for n in (r, g, b)] return r, g, b bit_rgb = np.linspace(0, 1, 256) if position is None: position = np.linspace(0, 1, len(colors)) else: if len(position) != len(colors): raise ValueError("position length must be the same as colors") elif position[0] != 0 or position[-1] != 1: raise ValueError("position must start with 0 and end with 1") cdict = {'red': [], 'green': [], 'blue': []} for pos, color in zip(position, colors): if isinstance(color, str): color = _html_color_to_rgb(color) elif bit: color = (bit_rgb[color[0]], bit_rgb[color[1]], bit_rgb[color[2]]) cdict['red'].append((pos, color[0], color[0])) cdict['green'].append((pos, color[1], color[1])) cdict['blue'].append((pos, color[2], color[2])) cmap = mpl.colors.LinearSegmentedColormap(name, cdict, 256) if register: mpl.cm.register_cmap(name, cmap) return cmap def plot_spectra( spectra, style='overlap', color=None, line_style=None, padding=1., legend=None, legend_picking=True, legend_loc='upper right', fig=None, ax=None, **kwargs): """Plot several spectra in the same figure. Extra keyword arguments are passed to `matplotlib.figure`. Parameters ---------- spectra : list of Signal1D or BaseSignal Ordered spectra list of signal to plot. If `style` is "cascade" or "mosaic" the spectra can have different size and axes. For `BaseSignal` with navigation dimensions 1 and signal dimension 0, the signal will be tranposed to form a `Signal1D`. style : {'overlap', 'cascade', 'mosaic', 'heatmap'} The style of the plot. color : matplotlib color or a list of them or `None` Sets the color of the lines of the plots (no action on 'heatmap'). If a list, if its length is less than the number of spectra to plot, the colors will be cycled. If `None`, use default matplotlib color cycle. line_style: matplotlib line style or a list of them or `None` Sets the line style of the plots (no action on 'heatmap'). The main line style are '-','--','steps','-.',':'. If a list, if its length is less than the number of spectra to plot, line_style will be cycled. If If `None`, use continuous lines, eg: ('-','--','steps','-.',':') padding : float, optional, default 0.1 Option for "cascade". 1 guarantees that there is not overlapping. However, in many cases a value between 0 and 1 can produce a tighter plot without overlapping. Negative values have the same effect but reverse the order of the spectra without reversing the order of the colors. legend: None or list of str or 'auto' If list of string, legend for "cascade" or title for "mosaic" is displayed. If 'auto', the title of each spectra (metadata.General.title) is used. legend_picking: bool If true, a spectrum can be toggle on and off by clicking on the legended line. legend_loc : str or int This parameter controls where the legend is placed on the figure; see the pyplot.legend docstring for valid values fig : matplotlib figure or None If None, a default figure will be created. Specifying fig will not work for the 'heatmap' style. ax : matplotlib ax (subplot) or None If None, a default ax will be created. Will not work for 'mosaic' or 'heatmap' style. **kwargs remaining keyword arguments are passed to matplotlib.figure() or matplotlib.subplots(). Has no effect on 'heatmap' style. Example ------- >>> s = hs.load("some_spectra") >>> hs.plot.plot_spectra(s, style='cascade', color='red', padding=0.5) To save the plot as a png-file >>> hs.plot.plot_spectra(s).figure.savefig("test.png") Returns ------- ax: matplotlib axes or list of matplotlib axes An array is returned when `style` is "mosaic". """ import hyperspy.signal def _reverse_legend(ax_, legend_loc_): """ Reverse the ordering of a matplotlib legend (to be more consistent with the default ordering of plots in the 'cascade' and 'overlap' styles Parameters ---------- ax_: matplotlib axes legend_loc_: str or int This parameter controls where the legend is placed on the figure; see the pyplot.legend docstring for valid values """ l = ax_.get_legend() labels = [lb.get_text() for lb in list(l.get_texts())] handles = l.legendHandles ax_.legend(handles[::-1], labels[::-1], loc=legend_loc_) # Before v1.3 default would read the value from prefereces. if style == "default": style = "overlap" if color is not None: if isinstance(color, str): color = itertools.cycle([color]) elif hasattr(color, "__iter__"): color = itertools.cycle(color) else: raise ValueError("Color must be None, a valid matplotlib color " "string or a list of valid matplotlib colors.") else: if LooseVersion(mpl.__version__) >= "1.5.3": color = itertools.cycle( plt.rcParams['axes.prop_cycle'].by_key()["color"]) else: color = itertools.cycle(plt.rcParams['axes.color_cycle']) if line_style is not None: if isinstance(line_style, str): line_style = itertools.cycle([line_style]) elif hasattr(line_style, "__iter__"): line_style = itertools.cycle(line_style) else: raise ValueError("line_style must be None, a valid matplotlib" " line_style string or a list of valid matplotlib" " line_style.") else: line_style = ['-'] * len(spectra) if legend is not None: if isinstance(legend, str): if legend == 'auto': legend = [spec.metadata.General.title for spec in spectra] else: raise ValueError("legend must be None, 'auto' or a list of" " string") elif hasattr(legend, "__iter__"): legend = itertools.cycle(legend) if style == 'overlap': if fig is None: fig = plt.figure(**kwargs) if ax is None: ax = fig.add_subplot(111) _make_overlap_plot(spectra, ax, color=color, line_style=line_style,) if legend is not None: ax.legend(legend, loc=legend_loc) _reverse_legend(ax, legend_loc) if legend_picking is True: animate_legend(fig=fig, ax=ax) elif style == 'cascade': if fig is None: fig = plt.figure(**kwargs) if ax is None: ax = fig.add_subplot(111) _make_cascade_subplot(spectra, ax, color=color, line_style=line_style, padding=padding) if legend is not None: plt.legend(legend, loc=legend_loc) _reverse_legend(ax, legend_loc) elif style == 'mosaic': default_fsize = plt.rcParams["figure.figsize"] figsize = (default_fsize[0], default_fsize[1] * len(spectra)) fig, subplots = plt.subplots( len(spectra), 1, figsize=figsize, **kwargs) if legend is None: legend = [legend] * len(spectra) for spectrum, ax, color, line_style, legend in zip( spectra, subplots, color, line_style, legend): spectrum = _transpose_if_required(spectrum, 1) _plot_spectrum(spectrum, ax, color=color, line_style=line_style) ax.set_ylabel('Intensity') if legend is not None: ax.set_title(legend) if not isinstance(spectra, hyperspy.signal.BaseSignal): _set_spectrum_xlabel(spectrum, ax) if isinstance(spectra, hyperspy.signal.BaseSignal): _set_spectrum_xlabel(spectrum, ax) fig.tight_layout() elif style == 'heatmap': if not isinstance(spectra, hyperspy.signal.BaseSignal): import hyperspy.utils spectra = [_transpose_if_required(spectrum, 1) for spectrum in spectra] spectra = hyperspy.utils.stack(spectra) with spectra.unfolded(): ax = _make_heatmap_subplot(spectra) ax.set_ylabel('Spectra') ax = ax if style != "mosaic" else subplots return ax def animate_legend(fig=None, ax=None): """Animate the legend of a figure. A spectrum can be toggle on and off by clicking on the legended line. Parameters ---------- fig: None | matplotlib.figure If None pick the current figure using "plt.gcf" ax: None | matplotlib.axes If None pick the current axes using "plt.gca". Note ---- Code inspired from legend_picking.py in the matplotlib gallery """ if fig is None: fig = plt.gcf() if ax is None: ax = plt.gca() lines = ax.lines[::-1] lined = dict() leg = ax.get_legend() for legline, origline in zip(leg.get_lines(), lines): legline.set_picker(5) # 5 pts tolerance lined[legline] = origline def onpick(event): # on the pick event, find the orig line corresponding to the # legend proxy line, and toggle the visibility legline = event.artist if legline.axes == ax: origline = lined[legline] vis = not origline.get_visible() origline.set_visible(vis) # Change the alpha on the line in the legend so we can see what lines # have been toggled if vis: legline.set_alpha(1.0) else: legline.set_alpha(0.2) fig.canvas.draw_idle() fig.canvas.mpl_connect('pick_event', onpick) def plot_histograms(signal_list, bins='freedman', range_bins=None, color=None, line_style=None, legend='auto', fig=None, **kwargs): """Plot the histogram of every signal in the list in the same figure. This function creates a histogram for each signal and plot the list with the `utils.plot.plot_spectra` function. Parameters ---------- signal_list : iterable Ordered spectra list to plot. If `style` is "cascade" or "mosaic" the spectra can have different size and axes. bins : int or list or str, optional If bins is a string, then it must be one of: 'knuth' : use Knuth's rule to determine bins 'scotts' : use Scott's rule to determine bins 'freedman' : use the Freedman-diaconis rule to determine bins 'blocks' : use bayesian blocks for dynamic bin widths range_bins : tuple or None, optional. the minimum and maximum range for the histogram. If not specified, it will be (x.min(), x.max()) color : valid matplotlib color or a list of them or `None`, optional. Sets the color of the lines of the plots. If a list, if its length is less than the number of spectra to plot, the colors will be cycled. If If `None`, use default matplotlib color cycle. line_style: valid matplotlib line style or a list of them or `None`, optional. The main line style are '-','--','steps','-.',':'. If a list, if its length is less than the number of spectra to plot, line_style will be cycled. If If `None`, use continuous lines, eg: ('-','--','steps','-.',':') legend: None or list of str or 'auto', optional. Display a legend. If 'auto', the title of each spectra (metadata.General.title) is used. legend_picking: bool, optional. If true, a spectrum can be toggle on and off by clicking on the legended line. fig : matplotlib figure or None, optional. If None, a default figure will be created. **kwargs other keyword arguments (weight and density) are described in np.histogram(). Example ------- Histograms of two random chi-square distributions >>> img = hs.signals.Signal2D(np.random.chisquare(1,[10,10,100])) >>> img2 = hs.signals.Signal2D(np.random.chisquare(2,[10,10,100])) >>> hs.plot.plot_histograms([img,img2],legend=['hist1','hist2']) Returns ------- ax: matplotlib axes or list of matplotlib axes An array is returned when `style` is "mosaic". """ hists = [] for obj in signal_list: hists.append(obj.get_histogram(bins=bins, range_bins=range_bins, **kwargs)) if line_style is None: line_style = 'steps' return plot_spectra(hists, style='overlap', color=color, line_style=line_style, legend=legend, fig=fig)
gpl-3.0
685,807,880,072,156,300
36.986083
82
0.581131
false
4.057262
false
false
false
rg3915/django-experience
djexperience/settings.py
1
3763
import os from decouple import config, Csv from dj_database_url import parse as dburl # Build paths inside the project like this: os.path.join(BASE_DIR, ...) BASE_DIR = os.path.dirname(os.path.dirname(os.path.abspath(__file__))) # Quick-start development settings - unsuitable for production # See https://docs.djangoproject.com/en/1.9/howto/deployment/checklist/ # SECURITY WARNING: keep the secret key used in production secret! SECRET_KEY = config('SECRET_KEY') DEBUG = config('DEBUG', default=False, cast=bool) ALLOWED_HOSTS = config('ALLOWED_HOSTS', default=[], cast=Csv()) # Application definition INSTALLED_APPS = [ # my apps 'djexperience.core', # default django apps 'django.contrib.admin', 'django.contrib.auth', 'django.contrib.contenttypes', 'django.contrib.sessions', 'django.contrib.messages', 'django.contrib.staticfiles', # thirty apps 'django_extensions', 'bootstrapform', 'widget_tweaks', 'daterange_filter', 'django_activeurl', 'import_export', 'django_tables2', # my apps 'djexperience.bookstore', 'djexperience.company', 'djexperience.crm', 'djexperience.myemail', 'djexperience.product', 'djexperience.selling', 'djexperience.service', ] MIDDLEWARE_CLASSES = [ 'django.middleware.security.SecurityMiddleware', 'django.contrib.sessions.middleware.SessionMiddleware', 'django.middleware.common.CommonMiddleware', 'django.middleware.csrf.CsrfViewMiddleware', 'django.contrib.auth.middleware.AuthenticationMiddleware', 'django.contrib.auth.middleware.SessionAuthenticationMiddleware', 'django.contrib.messages.middleware.MessageMiddleware', 'django.middleware.clickjacking.XFrameOptionsMiddleware', ] ROOT_URLCONF = 'djexperience.urls' TEMPLATES = [ { 'BACKEND': 'django.template.backends.django.DjangoTemplates', 'DIRS': [], 'APP_DIRS': True, 'OPTIONS': { 'context_processors': [ 'django.template.context_processors.debug', 'django.template.context_processors.request', 'django.contrib.auth.context_processors.auth', 'django.contrib.messages.context_processors.messages', ], }, }, ] WSGI_APPLICATION = 'djexperience.wsgi.application' # Database # https://docs.djangoproject.com/en/1.9/ref/settings/#databases default_dburl = 'sqlite:///' + os.path.join(BASE_DIR, 'db.sqlite3') DATABASES = { 'default': config('DATABASE_URL', default=default_dburl, cast=dburl), } # Password validation # https://docs.djangoproject.com/en/1.9/ref/settings/#auth-password-validators AUTH_PASSWORD_VALIDATORS = [ { 'NAME': 'django.contrib.auth.password_validation.UserAttributeSimilarityValidator', }, { 'NAME': 'django.contrib.auth.password_validation.MinimumLengthValidator', }, { 'NAME': 'django.contrib.auth.password_validation.CommonPasswordValidator', }, { 'NAME': 'django.contrib.auth.password_validation.NumericPasswordValidator', }, ] EMAIL_HOST = 'smtp.gmail.com' EMAIL_PORT = 587 EMAIL_HOST_USER = config('EMAIL_HOST_USER') EMAIL_HOST_PASSWORD = config('EMAIL_HOST_PASSWORD') EMAIL_USE_TLS = True DEFAULT_FROM_EMAIL = config('DEFAULT_FROM_EMAIL') # Internationalization # https://docs.djangoproject.com/en/1.9/topics/i18n/ LANGUAGE_CODE = 'pt-br' TIME_ZONE = 'America/Sao_Paulo' USE_I18N = True USE_L10N = True USE_TZ = True USE_THOUSAND_SEPARATOR = True DECIMAL_SEPARATOR = ',' # Static files (CSS, JavaScript, Images) # https://docs.djangoproject.com/en/1.9/howto/static-files/ STATIC_URL = '/static/' STATIC_ROOT = os.path.join(BASE_DIR, 'staticfiles') LOGIN_URL = '/admin/login/'
mit
-8,715,243,961,084,812,000
25.687943
91
0.687749
false
3.520112
true
false
false
shoyer/xray
xarray/backends/locks.py
1
5397
import multiprocessing import threading import weakref from typing import Any, MutableMapping try: from dask.utils import SerializableLock except ImportError: # no need to worry about serializing the lock SerializableLock = threading.Lock try: from dask.distributed import Lock as DistributedLock except ImportError: DistributedLock = None # Locks used by multiple backends. # Neither HDF5 nor the netCDF-C library are thread-safe. HDF5_LOCK = SerializableLock() NETCDFC_LOCK = SerializableLock() _FILE_LOCKS = weakref.WeakValueDictionary() # type: MutableMapping[Any, threading.Lock] # noqa def _get_threaded_lock(key): try: lock = _FILE_LOCKS[key] except KeyError: lock = _FILE_LOCKS[key] = threading.Lock() return lock def _get_multiprocessing_lock(key): # TODO: make use of the key -- maybe use locket.py? # https://github.com/mwilliamson/locket.py del key # unused return multiprocessing.Lock() _LOCK_MAKERS = { None: _get_threaded_lock, 'threaded': _get_threaded_lock, 'multiprocessing': _get_multiprocessing_lock, 'distributed': DistributedLock, } def _get_lock_maker(scheduler=None): """Returns an appropriate function for creating resource locks. Parameters ---------- scheduler : str or None Dask scheduler being used. See Also -------- dask.utils.get_scheduler_lock """ return _LOCK_MAKERS[scheduler] def _get_scheduler(get=None, collection=None): """Determine the dask scheduler that is being used. None is returned if no dask scheduler is active. See also -------- dask.base.get_scheduler """ try: # dask 0.18.1 and later from dask.base import get_scheduler actual_get = get_scheduler(get, collection) except ImportError: try: from dask.utils import effective_get actual_get = effective_get(get, collection) except ImportError: return None try: from dask.distributed import Client if isinstance(actual_get.__self__, Client): return 'distributed' except (ImportError, AttributeError): try: import dask.multiprocessing if actual_get == dask.multiprocessing.get: return 'multiprocessing' else: return 'threaded' except ImportError: return 'threaded' def get_write_lock(key): """Get a scheduler appropriate lock for writing to the given resource. Parameters ---------- key : str Name of the resource for which to acquire a lock. Typically a filename. Returns ------- Lock object that can be used like a threading.Lock object. """ scheduler = _get_scheduler() lock_maker = _get_lock_maker(scheduler) return lock_maker(key) def acquire(lock, blocking=True): """Acquire a lock, possibly in a non-blocking fashion. Includes backwards compatibility hacks for old versions of Python, dask and dask-distributed. """ if blocking: # no arguments needed return lock.acquire() elif DistributedLock is not None and isinstance(lock, DistributedLock): # distributed.Lock doesn't support the blocking argument yet: # https://github.com/dask/distributed/pull/2412 return lock.acquire(timeout=0) else: # "blocking" keyword argument not supported for: # - threading.Lock on Python 2. # - dask.SerializableLock with dask v1.0.0 or earlier. # - multiprocessing.Lock calls the argument "block" instead. return lock.acquire(blocking) class CombinedLock: """A combination of multiple locks. Like a locked door, a CombinedLock is locked if any of its constituent locks are locked. """ def __init__(self, locks): self.locks = tuple(set(locks)) # remove duplicates def acquire(self, blocking=True): return all(acquire(lock, blocking=blocking) for lock in self.locks) def release(self): for lock in self.locks: lock.release() def __enter__(self): for lock in self.locks: lock.__enter__() def __exit__(self, *args): for lock in self.locks: lock.__exit__(*args) def locked(self): return any(lock.locked for lock in self.locks) def __repr__(self): return "CombinedLock(%r)" % list(self.locks) class DummyLock: """DummyLock provides the lock API without any actual locking.""" def acquire(self, blocking=True): pass def release(self): pass def __enter__(self): pass def __exit__(self, *args): pass def locked(self): return False def combine_locks(locks): """Combine a sequence of locks into a single lock.""" all_locks = [] for lock in locks: if isinstance(lock, CombinedLock): all_locks.extend(lock.locks) elif lock is not None: all_locks.append(lock) num_locks = len(all_locks) if num_locks > 1: return CombinedLock(all_locks) elif num_locks == 1: return all_locks[0] else: return DummyLock() def ensure_lock(lock): """Ensure that the given object is a lock.""" if lock is None or lock is False: return DummyLock() return lock
apache-2.0
-7,480,206,169,277,232,000
24.578199
96
0.631277
false
4.119847
false
false
false
brahle/eval2
scripts/haski/actions/reviewaction.py
1
1578
#!/usr/bin/env python3.2 # Copyright 2011 Bruno Rahle # # This file is part of Evaluator. # # Evaluator is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # Evaluator is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public # License along with Evaluator. If not, see # <http://www.gnu.org/licenses/>. from actions.baseaction import BaseHaskiAction import argparse class ReviewAction(BaseHaskiAction): """This class is the class that does linting work. """ RB_ID_STR = 'reviewboard id' def __call__(self, params): """Fetches the desired revision and then sends it to reviewboard. """ commit = self.get_commit(params) if not params.skip_lint: commit.lint(params) rb_id = commit.review() if params.revision != 'HEAD': if self.RB_ID_STR not in commit.message.fields: print('[WARNING] Please edit the message to incorporate', '`ReviewBoardID` field.') else: commit.message.set_field(self.RB_ID_STR, rb_id) commit.amend() def main(): pass if __name__ == '__main__': main()
agpl-3.0
-8,740,087,895,962,332,000
31.204082
73
0.665399
false
3.905941
false
false
false
pelodelfuego/word2vec-toolbox
toolbox/mlLib/conceptPairFeature.py
1
4358
#!/usr/bin/env python # -*- coding: utf-8 -*- import __init__ import numpy as np from scipy.weave import inline from sklearn.ensemble import RandomForestClassifier import cpLib.concept as cp import utils.skUtils as sku # PROJECTION def projCosSim(c1, c2): v1 = c1.vect v2 = c2.vect dimCount = len(v1) arr = np.zeros(dimCount, 'f') code = """ for(int i = 0; i < dimCount; i++) { float norm_v1 = 0.0; float norm_v2 = 0.0; float dot_pdt = 0.0; for(int j = 0; j < dimCount; j++) { if(i != j) { dot_pdt += v1[j] * v2[j]; norm_v1 += v1[j] * v1[j]; norm_v2 += v2[j] * v2[j]; } } norm_v1 = sqrtf(norm_v1); norm_v2 = sqrtf(norm_v2); arr[i] = dot_pdt / norm_v1 / norm_v2; } return_val = 1; """ inline(code, ['v1', 'v2', 'dimCount', 'arr'], headers = ['<math.h>'], compiler = 'gcc') return arr def projEuclDist(c1, c2): v1 = c1.vect v2 = c2.vect dimCount = len(v1) arr = np.zeros(dimCount, 'f') code = """ for(int i = 0; i < dimCount; i++) { float dist = 0.0; for(int j = 0; j < dimCount; j++) { if(i != j) { dist += pow(v1[j] - v2[j], 2); } } arr[i] = sqrt(dist); } return_val = 1; """ inline(code, ['v1', 'v2', 'dimCount', 'arr'], headers = ['<math.h>'], compiler = 'gcc') return arr def projManaDist(c1, c2): v1 = c1.vect v2 = c2.vect dimCount = len(v1) arr = np.zeros(dimCount, 'f') code = """ for(int i = 0; i < dimCount; i++) { float dist = 0.0; for(int j = 0; j < dimCount; j++) { if(i != j) { dist += fabs(v1[i] - v2[i]); } } arr[i] = dist; } return_val = 1; """ inline(code, ['v1', 'v2', 'dimCount', 'arr'], headers = ['<math.h>'], compiler = 'gcc') return arr # COMMUTATIVE FEATURE def subCarth(conceptPair): return conceptPair[2].vect - conceptPair[0].vect def subPolar(conceptPair): return conceptPair[2].polarVect() - conceptPair[0].polarVect() def subAngular(conceptPair): return conceptPair[2].angularVect() - conceptPair[0].angularVect() def concatCarth(conceptPair): return np.concatenate((conceptPair[0].vect, conceptPair[2].vect)) def concatPolar(conceptPair): return np.concatenate((conceptPair[0].polarVect(), conceptPair[2].polarVect())) def concatAngular(conceptPair): return np.concatenate((conceptPair[0].angularVect(), conceptPair[2].angularVect())) # NON COMMUATIVE FEATURE # PROJECTION SIMILARITY def pCosSim(conceptPair): return projCosSim(conceptPair[0], conceptPair[2]) def pEuclDist(conceptPair): return projEuclDist(conceptPair[0], conceptPair[2]) def pManaDist(conceptPair): return projManaDist(conceptPair[0], conceptPair[2]) # PROJECTION DISSIMILARITY def _projectionDissimarilty(projectionMetric, globalMetric, conceptPair): projectedFeature = projectionMetric(conceptPair[0], conceptPair[2]) globalFeature = globalMetric(conceptPair[0], conceptPair[2]) return np.array([(globalFeature - v) for v in projectedFeature]) def pdCosSim(conceptPair): return _projectionDissimarilty(projCosSim, cp.cosSim, conceptPair) def pdEuclDist(conceptPair): return _projectionDissimarilty(projEuclDist, cp.euclDist, conceptPair) def pdManaDist(conceptPair): return _projectionDissimarilty(projManaDist, cp.manaDist, conceptPair) # CLF class ConceptPairClf(object): def __init__(self, clf, featureExtractionFct): self.clf = clf self.featureExtractionFct = featureExtractionFct def fit(self, X, y): self.clf.fit([self.featureExtractionFct(x) for x in X], y) self.classes_ = self.clf.classes_ def predict(self, X): return self.clf.predict([self.featureExtractionFct(x) for x in X]) def predict_proba(self, X): return self.clf.predict_proba([self.featureExtractionFct(x) for x in X])
gpl-3.0
-1,004,693,826,859,406,600
26.2375
91
0.562184
false
3.228148
false
false
false
skodapetr/lbvs-environment
scripts/libs/core.py
1
1664
#!/usr/bin/env python # -*- coding: utf-8 -*- import json import csv import os import logging import gzip __license__ = "X11" def init_logging(): logging.basicConfig( level=logging.DEBUG, format='%(asctime)s [%(levelname)s] - %(message)s', datefmt='%H:%M:%S') def create_directory(path): if not os.path.exists(path) and not path == "": os.makedirs(path) def create_parent_directory(path): parent_directory = os.path.dirname(path) if not os.path.exists(parent_directory) and not parent_directory == "": os.makedirs(parent_directory) def read_json(path): if path.endswith(".gz"): with gzip.open(path, "rt") as stream: return json.load(stream) else: with open(path, "r") as stream: return json.load(stream) def write_json(path, object_to_write): create_parent_directory(path) if path.endswith(".gz"): with gzip.open(path, "wt") as stream: json.dump(object_to_write, stream, indent=2) else: with open(path, "w") as stream: json.dump(object_to_write, stream, indent=2) def read_csv_as_object(path): """ Read CSV lines as objects. """ results = [] with open(path) as stream: reader = csv.reader(stream, delimiter=",", quotechar='"') header = next(reader) for row in reader: new_object = {} for index in range(0, len(row)): new_object[header[index]] = row[index] results.append(new_object) return results if __name__ == "__main__": raise Exception("This module can be used only as a library!")
mit
453,216,932,470,209,800
23.470588
75
0.590144
false
3.570815
false
false
false
kaniblu/hangul-utils
hangul_utils/unicode.py
1
8775
__all__ = ["split_syllable_char", "split_syllables", "join_jamos", "join_jamos_char", "CHAR_INITIALS", "CHAR_MEDIALS", "CHAR_FINALS"] import itertools INITIAL = 0x001 MEDIAL = 0x010 FINAL = 0x100 CHAR_LISTS = { INITIAL: list(map(chr, [ 0x3131, 0x3132, 0x3134, 0x3137, 0x3138, 0x3139, 0x3141, 0x3142, 0x3143, 0x3145, 0x3146, 0x3147, 0x3148, 0x3149, 0x314a, 0x314b, 0x314c, 0x314d, 0x314e ])), MEDIAL: list(map(chr, [ 0x314f, 0x3150, 0x3151, 0x3152, 0x3153, 0x3154, 0x3155, 0x3156, 0x3157, 0x3158, 0x3159, 0x315a, 0x315b, 0x315c, 0x315d, 0x315e, 0x315f, 0x3160, 0x3161, 0x3162, 0x3163 ])), FINAL: list(map(chr, [ 0x3131, 0x3132, 0x3133, 0x3134, 0x3135, 0x3136, 0x3137, 0x3139, 0x313a, 0x313b, 0x313c, 0x313d, 0x313e, 0x313f, 0x3140, 0x3141, 0x3142, 0x3144, 0x3145, 0x3146, 0x3147, 0x3148, 0x314a, 0x314b, 0x314c, 0x314d, 0x314e ])) } CHAR_INITIALS = CHAR_LISTS[INITIAL] CHAR_MEDIALS = CHAR_LISTS[MEDIAL] CHAR_FINALS = CHAR_LISTS[FINAL] CHAR_SETS = {k: set(v) for k, v in CHAR_LISTS.items()} CHARSET = set(itertools.chain(*CHAR_SETS.values())) CHAR_INDICES = {k: {c: i for i, c in enumerate(v)} for k, v in CHAR_LISTS.items()} def is_hangul_syllable(c): return 0xac00 <= ord(c) <= 0xd7a3 # Hangul Syllables def is_hangul_jamo(c): return 0x1100 <= ord(c) <= 0x11ff # Hangul Jamo def is_hangul_compat_jamo(c): return 0x3130 <= ord(c) <= 0x318f # Hangul Compatibility Jamo def is_hangul_jamo_exta(c): return 0xa960 <= ord(c) <= 0xa97f # Hangul Jamo Extended-A def is_hangul_jamo_extb(c): return 0xd7b0 <= ord(c) <= 0xd7ff # Hangul Jamo Extended-B def is_hangul(c): return (is_hangul_syllable(c) or is_hangul_jamo(c) or is_hangul_compat_jamo(c) or is_hangul_jamo_exta(c) or is_hangul_jamo_extb(c)) def is_supported_hangul(c): return is_hangul_syllable(c) or is_hangul_compat_jamo(c) def check_hangul(c, jamo_only=False): if not ((jamo_only or is_hangul_compat_jamo(c)) or is_supported_hangul(c)): raise ValueError(f"'{c}' is not a supported hangul character. " f"'Hangul Syllables' (0xac00 ~ 0xd7a3) and " f"'Hangul Compatibility Jamos' (0x3130 ~ 0x318f) are " f"supported at the moment.") def get_jamo_type(c): check_hangul(c) assert is_hangul_compat_jamo(c), f"not a jamo: {ord(c):x}" return sum(t for t, s in CHAR_SETS.items() if c in s) def split_syllable_char(c): """ Splits a given korean syllable into its components. Each component is represented by Unicode in 'Hangul Compatibility Jamo' range. Arguments: c: A Korean character. Returns: A triple (initial, medial, final) of Hangul Compatibility Jamos. If no jamo corresponds to a position, `None` is returned there. Example: >>> split_syllable_char("안") ("ㅇ", "ㅏ", "ㄴ") >>> split_syllable_char("고") ("ㄱ", "ㅗ", None) >>> split_syllable_char("ㅗ") (None, "ㅗ", None) >>> split_syllable_char("ㅇ") ("ㅇ", None, None) """ check_hangul(c) if len(c) != 1: raise ValueError("Input string must have exactly one character.") init, med, final = None, None, None if is_hangul_syllable(c): offset = ord(c) - 0xac00 x = (offset - offset % 28) // 28 init, med, final = x // 21, x % 21, offset % 28 if not final: final = None else: final -= 1 else: pos = get_jamo_type(c) if pos & INITIAL == INITIAL: pos = INITIAL elif pos & MEDIAL == MEDIAL: pos = MEDIAL elif pos & FINAL == FINAL: pos = FINAL idx = CHAR_INDICES[pos][c] if pos == INITIAL: init = idx elif pos == MEDIAL: med = idx else: final = idx return tuple(CHAR_LISTS[pos][idx] if idx is not None else None for pos, idx in zip([INITIAL, MEDIAL, FINAL], [init, med, final])) def split_syllables(s, ignore_err=True, pad=None): """ Performs syllable-split on a string. Arguments: s (str): A string (possibly mixed with non-Hangul characters). ignore_err (bool): If set False, it ensures that all characters in the string are Hangul-splittable and throws a ValueError otherwise. (default: True) pad (str): Pad empty jamo positions (initial, medial, or final) with `pad` character. This is useful for cases where fixed-length strings are needed. (default: None) Returns: Hangul-split string Example: >>> split_syllables("안녕하세요") "ㅇㅏㄴㄴㅕㅇㅎㅏㅅㅔㅇㅛ" >>> split_syllables("안녕하세요~~", ignore_err=False) ValueError: encountered an unsupported character: ~ (0x7e) >>> split_syllables("안녕하세요ㅛ", pad="x") 'ㅇㅏㄴㄴㅕㅇㅎㅏxㅅㅔxㅇㅛxxㅛx' """ def try_split(c): try: return split_syllable_char(c) except ValueError: if ignore_err: return (c,) raise ValueError(f"encountered an unsupported character: " f"{c} (0x{ord(c):x})") s = map(try_split, s) if pad is not None: tuples = map(lambda x: tuple(pad if y is None else y for y in x), s) else: tuples = map(lambda x: filter(None, x), s) return "".join(itertools.chain(*tuples)) def join_jamos_char(init, med, final=None): """ Combines jamos into a single syllable. Arguments: init (str): Initial jao. med (str): Medial jamo. final (str): Final jamo. If not supplied, the final syllable is made without the final. (default: None) Returns: A Korean syllable. """ chars = (init, med, final) for c in filter(None, chars): check_hangul(c, jamo_only=True) idx = tuple(CHAR_INDICES[pos][c] if c is not None else c for pos, c in zip((INITIAL, MEDIAL, FINAL), chars)) init_idx, med_idx, final_idx = idx # final index must be shifted once as # final index with 0 points to syllables without final final_idx = 0 if final_idx is None else final_idx + 1 return chr(0xac00 + 28 * 21 * init_idx + 28 * med_idx + final_idx) def join_jamos(s, ignore_err=True): """ Combines a sequence of jamos to produce a sequence of syllables. Arguments: s (str): A string (possible mixed with non-jamo characters). ignore_err (bool): If set False, it will ensure that all characters will be consumed for the making of syllables. It will throw a ValueError when it fails to do so. (default: True) Returns: A string Example: >>> join_jamos("ㅇㅏㄴㄴㅕㅇㅎㅏㅅㅔㅇㅛ") "안녕하세요" >>> join_jamos("ㅇㅏㄴㄴㄴㅕㅇㅎㅏㅅㅔㅇㅛ") "안ㄴ녕하세요" >>> join_jamos() """ last_t = 0 queue = [] new_string = "" def flush(n=0): new_queue = [] while len(queue) > n: new_queue.append(queue.pop()) if len(new_queue) == 1: if not ignore_err: raise ValueError(f"invalid jamo character: {new_queue[0]}") result = new_queue[0] elif len(new_queue) >= 2: try: result = join_jamos_char(*new_queue) except (ValueError, KeyError): # Invalid jamo combination if not ignore_err: raise ValueError(f"invalid jamo characters: {new_queue}") result = "".join(new_queue) else: result = None return result for c in s: if c not in CHARSET: if queue: new_c = flush() + c else: new_c = c last_t = 0 else: t = get_jamo_type(c) new_c = None if t & FINAL == FINAL: if not (last_t == MEDIAL): new_c = flush() elif t == INITIAL: new_c = flush() elif t == MEDIAL: if last_t & INITIAL == INITIAL: new_c = flush(1) else: new_c = flush() last_t = t queue.insert(0, c) if new_c: new_string += new_c if queue: new_string += flush() return new_string
gpl-3.0
3,778,202,042,101,361,700
29.820789
79
0.551227
false
2.954983
false
false
false
drnextgis/QGIS
python/plugins/processing/core/parameters.py
1
55397
# -*- coding: utf-8 -*- """ *************************************************************************** Parameters.py --------------------- Date : August 2012 Copyright : (C) 2012 by Victor Olaya Email : volayaf at gmail dot com *************************************************************************** * * * This program is free software; you can redistribute it and/or modify * * it under the terms of the GNU General Public License as published by * * the Free Software Foundation; either version 2 of the License, or * * (at your option) any later version. * * * *************************************************************************** """ from builtins import str from builtins import range from builtins import object __author__ = 'Victor Olaya' __date__ = 'August 2012' __copyright__ = '(C) 2012, Victor Olaya' # This will get replaced with a git SHA1 when you do a git archive __revision__ = '$Format:%H$' import sys import os import math from inspect import isclass from copy import deepcopy import numbers from qgis.utils import iface from qgis.PyQt.QtCore import QCoreApplication from qgis.core import (QgsRasterLayer, QgsVectorLayer, QgsMapLayer, QgsCoordinateReferenceSystem, QgsExpressionContext, QgsExpressionContextUtils, QgsExpression, QgsExpressionContextScope) from processing.tools.vector import resolveFieldIndex, features from processing.tools import dataobjects from processing.core.outputs import OutputNumber, OutputRaster, OutputVector from processing.tools.dataobjects import getObject def parseBool(s): if s is None or s == str(None).lower(): return None return str(s).lower() == str(True).lower() def _splitParameterOptions(line): tokens = line.split('=', 1) if tokens[1].lower().strip().startswith('optional'): isOptional = True definition = tokens[1].strip()[len('optional') + 1:] else: isOptional = False definition = tokens[1] return isOptional, tokens[0], definition def _createDescriptiveName(s): return s.replace('_', ' ') def _expressionContext(): context = QgsExpressionContext() context.appendScope(QgsExpressionContextUtils.globalScope()) context.appendScope(QgsExpressionContextUtils.projectScope()) if iface.mapCanvas(): context.appendScope(QgsExpressionContextUtils.mapSettingsScope(iface.mapCanvas().mapSettings())) processingScope = QgsExpressionContextScope() extent = iface.mapCanvas().fullExtent() processingScope.setVariable('fullextent_minx', extent.xMinimum()) processingScope.setVariable('fullextent_miny', extent.yMinimum()) processingScope.setVariable('fullextent_maxx', extent.xMaximum()) processingScope.setVariable('fullextent_maxy', extent.yMaximum()) context.appendScope(processingScope) return context def _resolveLayers(value): layers = dataobjects.getAllLayers() if value: inputlayers = value.split(';') for i, inputlayer in enumerate(inputlayers): for layer in layers: if layer.name() == inputlayer: inputlayers[i] = layer.source() break return ";".join(inputlayers) class Parameter(object): """ Base class for all parameters that a geoalgorithm might take as input. """ default_metadata = {} def __init__(self, name='', description='', default=None, optional=False, metadata={}): self.name = name self.description = description self.default = default self.value = default self.isAdvanced = False # A hidden parameter can be used to set a hard-coded value. # It can be used as any other parameter, but it will not be # shown to the user self.hidden = False self.optional = parseBool(optional) # TODO: make deep copy and deep update self.metadata = deepcopy(self.default_metadata) self.metadata.update(deepcopy(metadata)) def setValue(self, obj): """ Sets the value of the parameter. Returns true if the value passed is correct for the type of parameter. """ if obj is None: if not self.optional: return False self.value = None return True self.value = str(obj) return True def setDefaultValue(self): """ Sets the value of the parameter to the default one Returns true if the default value is correct for the type of parameter. """ return self.setValue(self.default) def __str__(self): return u'{} <{}>'.format(self.name, self.__class__.__name__) def getValueAsCommandLineParameter(self): """ Returns the value of this parameter as it should have been entered in the console if calling an algorithm using the Processing.runalg() method. """ return str(self.value) def typeName(self): return self.__class__.__name__.replace('Parameter', '').lower() def todict(self): o = deepcopy(self.__dict__) del o['metadata'] return o def tr(self, string, context=''): if context == '': context = 'Parameter' return QCoreApplication.translate(context, string) def wrapper(self, dialog, row=0, col=0): wrapper = self.metadata.get('widget_wrapper', None) # wrapper metadata should be a class path if isinstance(wrapper, str): tokens = wrapper.split('.') mod = __import__('.'.join(tokens[:-1]), fromlist=[tokens[-1]]) wrapper = getattr(mod, tokens[-1]) # or directly a class object if isclass(wrapper): wrapper = wrapper(self, dialog, row, col) # or a wrapper instance return wrapper def evaluate(self, alg): pass def evaluateForModeler(self, value, model): return value class ParameterBoolean(Parameter): default_metadata = { 'widget_wrapper': 'processing.gui.wrappers.BooleanWidgetWrapper' } def __init__(self, name='', description='', default=None, optional=False, metadata={}): Parameter.__init__(self, name, description, parseBool(default), optional, metadata) def setValue(self, value): if value is None: if not self.optional: return False self.value = None return True if isinstance(value, str): self.value = str(value).lower() == str(True).lower() else: self.value = bool(value) return True def getAsScriptCode(self): param_type = '' if self.optional: param_type += 'optional ' param_type += 'boolean ' return '##' + self.name + '=' + param_type + str(self.default) @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) if definition.startswith("boolean"): descName = _createDescriptiveName(name) default = definition.strip()[len('boolean') + 1:] if default: param = ParameterBoolean(name, descName, default) else: param = ParameterBoolean(name, descName) param.optional = isOptional return param class ParameterCrs(Parameter): default_metadata = { 'widget_wrapper': 'processing.gui.wrappers.CrsWidgetWrapper' } def __init__(self, name='', description='', default=None, optional=False, metadata={}): '''The value is a string that uniquely identifies the coordinate reference system. Typically it is the auth id of the CRS (if the authority is EPSG) or proj4 string of the CRS (in case of other authorities or user defined projections).''' Parameter.__init__(self, name, description, default, optional, metadata) def setValue(self, value): if not bool(value): if not self.optional: return False self.value = None return True if isinstance(value, QgsCoordinateReferenceSystem): self.value = value.authid() return True if isinstance(value, QgsMapLayer): self.value = value.crs().authid() return True try: layer = dataobjects.getObjectFromUri(value) if layer is not None: self.value = layer.crs().authid() return True except: pass # TODO: check it is a valid authid self.value = value return True def getValueAsCommandLineParameter(self): return '"' + str(self.value) + '"' def getAsScriptCode(self): param_type = '' if self.optional: param_type += 'optional ' param_type += 'crs ' return '##' + self.name + '=' + param_type + str(self.default) @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) if definition.startswith("crs"): descName = _createDescriptiveName(name) default = definition.strip()[len('crs') + 1:] if default: return ParameterCrs(name, descName, default, isOptional) else: return ParameterCrs(name, descName, None, isOptional) class ParameterDataObject(Parameter): def getValueAsCommandLineParameter(self): if self.value is None: return str(None) else: s = dataobjects.normalizeLayerSource(str(self.value)) s = '"%s"' % s return s def evaluate(self, alg): self.value = _resolveLayers(self.value) class ParameterExtent(Parameter): default_metadata = { 'widget_wrapper': 'processing.gui.wrappers.ExtentWidgetWrapper' } USE_MIN_COVERING_EXTENT = 'USE_MIN_COVERING_EXTENT' def __init__(self, name='', description='', default=None, optional=True): Parameter.__init__(self, name, description, default, optional) # The value is a string in the form "xmin, xmax, ymin, ymax" def setValue(self, value): if not value: if not self.optional: return False self.value = None return True if isinstance(value, QgsMapLayer): rect = value.extent() self.value = '{},{},{},{}'.format( rect.xMinimum(), rect.xMaximum(), rect.yMinimum(), rect.yMaximum()) return True try: layer = dataobjects.getObjectFromUri(value) if layer is not None: rect = layer.extent() self.value = '{},{},{},{}'.format( rect.xMinimum(), rect.xMaximum(), rect.yMinimum(), rect.yMaximum()) return True except: pass tokens = str(value).split(',') if len(tokens) != 4: return False try: float(tokens[0]) float(tokens[1]) float(tokens[2]) float(tokens[3]) self.value = value return True except: return False def getValueAsCommandLineParameter(self): return '"' + str(self.value) + '"' def getAsScriptCode(self): param_type = '' if self.optional: param_type += 'optional ' param_type += 'extent' return '##' + self.name + '=' + param_type @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) if definition.startswith("extent"): descName = _createDescriptiveName(name) default = definition.strip()[len('extent') + 1:] or None return ParameterExtent(name, descName, default, isOptional) def evaluate(self, alg): if self.optional and not bool(self.value): self.value = self.getMinCoveringExtent(alg) def getMinCoveringExtent(self, alg): first = True found = False for param in alg.parameters: if param.value: if isinstance(param, (ParameterRaster, ParameterVector)): if isinstance(param.value, (QgsRasterLayer, QgsVectorLayer)): layer = param.value else: layer = dataobjects.getObject(param.value) if layer: found = True self.addToRegion(layer, first) first = False elif isinstance(param, ParameterMultipleInput): layers = param.value.split(';') for layername in layers: layer = dataobjects.getObject(layername) if layer: found = True self.addToRegion(layer, first) first = False if found: return '{},{},{},{}'.format( self.xmin, self.xmax, self.ymin, self.ymax) else: return None def addToRegion(self, layer, first): if first: self.xmin = layer.extent().xMinimum() self.xmax = layer.extent().xMaximum() self.ymin = layer.extent().yMinimum() self.ymax = layer.extent().yMaximum() else: self.xmin = min(self.xmin, layer.extent().xMinimum()) self.xmax = max(self.xmax, layer.extent().xMaximum()) self.ymin = min(self.ymin, layer.extent().yMinimum()) self.ymax = max(self.ymax, layer.extent().yMaximum()) class ParameterPoint(Parameter): default_metadata = { 'widget_wrapper': 'processing.gui.wrappers.PointWidgetWrapper' } def __init__(self, name='', description='', default=None, optional=False): Parameter.__init__(self, name, description, default, optional) # The value is a string in the form "x, y" def setValue(self, text): if text is None: if not self.optional: return False self.value = None return True tokens = str(text).split(',') if len(tokens) != 2: return False try: float(tokens[0]) float(tokens[1]) self.value = text return True except: return False def getValueAsCommandLineParameter(self): return '"' + str(self.value) + '"' def getAsScriptCode(self): param_type = '' if self.optional: param_type += 'optional ' param_type += 'point' return '##' + self.name + '=' + param_type @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) if definition.startswith("point"): descName = _createDescriptiveName(name) default = definition.strip()[len('point') + 1:] or None return ParameterPoint(name, descName, default, isOptional) class ParameterFile(Parameter): default_metadata = { 'widget_wrapper': 'processing.gui.wrappers.FileWidgetWrapper' } def __init__(self, name='', description='', isFolder=False, optional=True, ext=None): Parameter.__init__(self, name, description, None, parseBool(optional)) self.ext = ext self.isFolder = parseBool(isFolder) def getValueAsCommandLineParameter(self): return '"' + str(self.value) + '"' def setValue(self, obj): if obj is None or obj.strip() == '': if not self.optional: return False self.value = None if obj is None else obj.strip() return True if self.ext is not None and obj != '' and not obj.endswith(self.ext): return False self.value = str(obj) return True def typeName(self): if self.isFolder: return 'directory' else: return 'file' def getAsScriptCode(self): param_type = '' if self.optional: param_type += 'optional ' if self.isFolder: param_type += 'folder' else: param_type += 'file' return '##' + self.name + '=' + param_type @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) if definition.startswith("file") or definition.startswith("folder"): descName = _createDescriptiveName(name) return ParameterFile(name, descName, definition.startswith("folder"), isOptional) class ParameterFixedTable(Parameter): def __init__(self, name='', description='', numRows=3, cols=['value'], fixedNumOfRows=False, optional=False): Parameter.__init__(self, name, description, None, optional) self.cols = cols if isinstance(cols, str): self.cols = self.cols.split(";") self.numRows = int(numRows) self.fixedNumOfRows = parseBool(fixedNumOfRows) def setValue(self, obj): if obj is None: if not self.optional: return False self.value = None return True # TODO: check that it contains a correct number of elements if isinstance(obj, str): self.value = obj else: self.value = ParameterFixedTable.tableToString(obj) return True def getValueAsCommandLineParameter(self): return '"' + str(self.value) + '"' @staticmethod def tableToString(table): tablestring = '' for i in range(len(table)): for j in range(len(table[0])): tablestring = tablestring + table[i][j] + ',' tablestring = tablestring[:-1] return tablestring @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) if definition.startswith("point"): descName = _createDescriptiveName(name) default = definition.strip()[len('point') + 1:] or None return ParameterPoint(name, descName, default, isOptional) class ParameterMultipleInput(ParameterDataObject): """A parameter representing several data objects. Its value is a string with substrings separated by semicolons, each of which represents the data source location of each element. """ default_metadata = { 'widget_wrapper': 'processing.gui.wrappers.MultipleInputWidgetWrapper' } exported = None def __init__(self, name='', description='', datatype=-1, optional=False): ParameterDataObject.__init__(self, name, description, None, optional) self.datatype = int(float(datatype)) self.exported = None self.minNumInputs = 0 """ Set minimum required number of inputs for parameter By default minimal number of inputs is set to 1 @type _minNumInputs: numeric type or None @param _minNumInputs: required minimum number of inputs for parameter. \ If user will pass None as parameter, we will use default minimal number of inputs (1) @return: result, if the minimum number of inputs were set. """ def setMinNumInputs(self, _minNumInputs): if _minNumInputs is None: self.minNumInputs = 0 return True if _minNumInputs < 1 and not self.optional: # don't allow to set negative or null number of inputs if parameter isn't optional return False self.minNumInputs = int(_minNumInputs) return True """ Get minimum required number of inputs for parameter @return: minimum number of inputs required for this parameter @see: setMinNumInputs() """ def getMinNumInputs(self): return self.minNumInputs def setValue(self, obj): self.exported = None if obj is None: if not self.optional: return False self.value = None return True if isinstance(obj, list): if len(obj) == 0: if self.optional: self.value = None return True else: return False # prevent setting value if we didn't provide required minimal number of inputs elif len(obj) < self.minNumInputs: return False self.value = ";".join([self.getAsString(lay) for lay in obj]) return True else: self.value = str(obj) return True def getSafeExportedLayers(self): """ Returns not the value entered by the user, but a string with semicolon-separated filenames which contains the data of the selected layers, but saved in a standard format (currently shapefiles for vector layers and GeoTiff for raster) so that they can be opened by most external applications. If there is a selection and QGIS is configured to use just the selection, it exports the layer even if it is already in a suitable format. Works only if the layer represented by the parameter value is currently loaded in QGIS. Otherwise, it will not perform any export and return the current value string. If the current value represents a layer in a suitable format, it does no export at all and returns that value. Currently, it works just for vector layer. In the case of raster layers, it returns the parameter value. The layers are exported just the first time the method is called. The method can be called several times and it will always return the same string, performing the export only the first time. """ if self.exported: return self.exported self.exported = self.value layers = self.value.split(';') if layers is None or len(layers) == 0: return self.value if self.datatype == dataobjects.TYPE_RASTER: for layerfile in layers: layer = dataobjects.getObjectFromUri(layerfile, False) if layer: filename = dataobjects.exportRasterLayer(layer) self.exported = self.exported.replace(layerfile, filename) return self.exported elif self.datatype == dataobjects.TYPE_FILE: return self.value else: for layerfile in layers: layer = dataobjects.getObjectFromUri(layerfile, False) if layer: filename = dataobjects.exportVectorLayer(layer) self.exported = self.exported.replace(layerfile, filename) return self.exported def getAsString(self, value): if self.datatype == dataobjects.TYPE_RASTER: if isinstance(value, QgsRasterLayer): return str(value.dataProvider().dataSourceUri()) else: s = str(value) layers = dataobjects.getRasterLayers() for layer in layers: if layer.name() == s: return str(layer.dataProvider().dataSourceUri()) return s if self.datatype == dataobjects.TYPE_FILE: return str(value) else: if isinstance(value, QgsVectorLayer): return str(value.source()) else: s = str(value) layers = dataobjects.getVectorLayers([self.datatype]) for layer in layers: if layer.name() == s: return str(layer.source()) return s def getFileFilter(self): if self.datatype == dataobjects.TYPE_RASTER: exts = dataobjects.getSupportedOutputRasterLayerExtensions() elif self.datatype == dataobjects.TYPE_FILE: return self.tr('All files (*.*)', 'ParameterMultipleInput') else: exts = dataobjects.getSupportedOutputVectorLayerExtensions() for i in range(len(exts)): exts[i] = self.tr('%s files(*.%s)', 'ParameterMultipleInput') % (exts[i].upper(), exts[i].lower()) return ';;'.join(exts) def dataType(self): if self.datatype == dataobjects.TYPE_VECTOR_POINT: return 'points' elif self.datatype == dataobjects.TYPE_VECTOR_LINE: return 'lines' elif self.datatype == dataobjects.TYPE_VECTOR_POLYGON: return 'polygons' elif self.datatype == dataobjects.TYPE_RASTER: return 'rasters' elif self.datatype == dataobjects.TYPE_FILE: return 'files' else: return 'any vectors' def getAsScriptCode(self): param_type = '' if self.optional: param_type += 'optional ' if self.datatype == dataobjects.TYPE_RASTER: param_type += 'multiple raster' if self.datatype == dataobjects.TYPE_FILE: param_type += 'multiple file' else: param_type += 'multiple vector' return '##' + self.name + '=' + param_type @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) descName = _createDescriptiveName(name) if definition.lower().strip() == 'multiple raster': return ParameterMultipleInput(name, descName, dataobjects.TYPE_RASTER, isOptional) elif definition.lower().strip() == 'multiple vector': return ParameterMultipleInput(name, definition, dataobjects.TYPE_VECTOR_ANY, isOptional) def evaluate(self, alg): self.value = _resolveLayers(self.value) class ParameterNumber(Parameter): default_metadata = { 'widget_wrapper': 'processing.gui.wrappers.NumberWidgetWrapper' } def __init__(self, name='', description='', minValue=None, maxValue=None, default=None, optional=False): Parameter.__init__(self, name, description, default, optional) if default is not None: try: self.default = int(str(default)) self.isInteger = True except ValueError: self.default = float(default) self.isInteger = False else: self.isInteger = False if minValue is not None: self.min = int(float(minValue)) if self.isInteger else float(minValue) else: self.min = None if maxValue is not None: self.max = int(float(maxValue)) if self.isInteger else float(maxValue) else: self.max = None self.value = self.default def setValue(self, n): if n is None: if not self.optional: return False self.value = None return True if isinstance(n, str): try: v = self._evaluate(n) self.value = float(v) if self.isInteger: self.value = int(math.floor(self.value)) return True except: return False else: try: if float(n) - int(float(n)) == 0: value = int(float(n)) else: value = float(n) if self.min is not None: if value < self.min: return False if self.max is not None: if value > self.max: return False self.value = value return True except: raise return False def getAsScriptCode(self): param_type = '' if self.optional: param_type += 'optional ' param_type += 'number' code = '##' + self.name + '=' + param_type if self.default: code += str(self.default) return code @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) descName = _createDescriptiveName(name) if definition.lower().strip().startswith('number'): default = definition.strip()[len('number'):] or None if default == 'None': default = None return ParameterNumber(name, descName, default=default, optional=isOptional) def _evaluate(self, value): exp = QgsExpression(value) if exp.hasParserError(): raise ValueError(self.tr("Error in parameter expression: ") + exp.parserErrorString()) result = exp.evaluate(_expressionContext()) if exp.hasEvalError(): raise ValueError("Error evaluating parameter expression: " + exp.evalErrorString()) if self.isInteger: return math.floor(result) else: return result def evaluate(self, alg): if isinstance(self.value, str) and bool(self.value): self.value = self._evaluate(self.value) def _layerVariables(self, element, alg=None): variables = {} layer = getObject(element.value) if layer is not None: name = element.name if alg is None else "%s_%s" % (alg.name, element.name) variables['@%s_minx' % name] = layer.extent().xMinimum() variables['@%s_miny' % name] = layer.extent().yMinimum() variables['@%s_maxx' % name] = layer.extent().yMaximum() variables['@%s_maxy' % name] = layer.extent().yMaximum() if isinstance(element, (ParameterRaster, OutputRaster)): stats = layer.dataProvider().bandStatistics(1) variables['@%s_avg' % name] = stats.mean variables['@%s_stddev' % name] = stats.stdDev variables['@%s_min' % name] = stats.minimumValue variables['@%s_max' % name] = stats.maximumValue return variables def evaluateForModeler(self, value, model): if isinstance(value, numbers.Number): return value variables = {} for param in model.parameters: if isinstance(param, ParameterNumber): variables["@" + param.name] = param.value if isinstance(param, (ParameterRaster, ParameterVector)): variables.update(self._layerVariables(param)) for alg in list(model.algs.values()): for out in alg.algorithm.outputs: if isinstance(out, OutputNumber): variables["@%s_%s" % (alg.name, out.name)] = out.value if isinstance(out, (OutputRaster, OutputVector)): variables.update(self._layerVariables(out, alg)) for k, v in list(variables.items()): value = value.replace(k, str(v)) return value def expressionContext(self): return _expressionContext() def getValueAsCommandLineParameter(self): if self.value is None: return str(None) if isinstance(self.value, str): return '"%s"' + self.value return str(self.value) class ParameterRange(Parameter): def __init__(self, name='', description='', default=None, optional=False): Parameter.__init__(self, name, description, default, optional) if default is not None: values = default.split(',') try: int(values[0]) int(values[1]) self.isInteger = True except: self.isInteger = False else: self.isInteger = False def setValue(self, text): if text is None: if not self.optional: return False self.value = None return True tokens = text.split(',') if len(tokens) != 2: return False try: float(tokens[0]) float(tokens[1]) self.value = text return True except: return False def getValueAsCommandLineParameter(self): return '"' + str(self.value) + '"' if self.value is not None else str(None) class ParameterRaster(ParameterDataObject): default_metadata = { 'widget_wrapper': 'processing.gui.wrappers.RasterWidgetWrapper' } def __init__(self, name='', description='', optional=False, showSublayersDialog=True): ParameterDataObject.__init__(self, name, description, None, optional) self.showSublayersDialog = parseBool(showSublayersDialog) self.exported = None def getSafeExportedLayer(self): """Returns not the value entered by the user, but a string with a filename which contains the data of this layer, but saved in a standard format (currently always a geotiff file) so that it can be opened by most external applications. Works only if the layer represented by the parameter value is currently loaded in QGIS. Otherwise, it will not perform any export and return the current value string. If the current value represents a layer in a suitable format, it does not export at all and returns that value. The layer is exported just the first time the method is called. The method can be called several times and it will always return the same file, performing the export only the first time. """ if self.exported: return self.exported layer = dataobjects.getObjectFromUri(self.value, False) if layer: self.exported = dataobjects.exportRasterLayer(layer) else: self.exported = self.value return self.exported def setValue(self, obj): self.exported = None if obj is None: if not self.optional: return False self.value = None return True if isinstance(obj, QgsRasterLayer): self.value = str(obj.dataProvider().dataSourceUri()) return True else: self.value = str(obj) return True def getFileFilter(self): exts = dataobjects.getSupportedOutputRasterLayerExtensions() for i in range(len(exts)): exts[i] = self.tr('%s files(*.%s)', 'ParameterRaster') % (exts[i].upper(), exts[i].lower()) return ';;'.join(exts) def getAsScriptCode(self): param_type = '' if self.optional: param_type += 'optional ' param_type += 'raster' return '##' + self.name + '=' + param_type @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) descName = _createDescriptiveName(name) if definition.lower().strip().startswith('raster'): return ParameterRaster(name, descName, optional=isOptional) class ParameterSelection(Parameter): default_metadata = { 'widget_wrapper': 'processing.gui.wrappers.SelectionWidgetWrapper' } def __init__(self, name='', description='', options=[], default=None, isSource=False, multiple=False, optional=False): Parameter.__init__(self, name, description, default, optional) self.multiple = multiple isSource = parseBool(isSource) self.options = options if isSource: self.options = [] layer = QgsVectorLayer(options[0], "layer", "ogr") if layer.isValid(): try: index = resolveFieldIndex(layer, options[1]) feats = features(layer) for feature in feats: self.options.append(str(feature.attributes()[index])) except ValueError: pass elif isinstance(self.options, str): self.options = self.options.split(";") if default is not None: try: self.default = int(default) except: self.default = 0 self.value = self.default def setValue(self, value): if value is None: if not self.optional: return False self.value = 0 return True if isinstance(value, list): if not self.multiple: return False values = [] for v in value: try: n = int(v) values.append(n) except: return False if not self.optional and len(values) == 0: return False self.value = values return True else: try: n = int(value) self.value = n return True except: return False @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) descName = _createDescriptiveName(name) if definition.lower().strip().startswith('selectionfromfile'): options = definition.strip()[len('selectionfromfile '):].split(';') return ParameterSelection(name, descName, options, isSource=True, optional=isOptional) elif definition.lower().strip().startswith('selection'): options = definition.strip()[len('selection '):].split(';') return ParameterSelection(name, descName, options, optional=isOptional) elif definition.lower().strip().startswith('multipleselectionfromfile'): options = definition.strip()[len('multipleselectionfromfile '):].split(';') return ParameterSelection(name, descName, options, isSource=True, multiple=True, optional=isOptional) elif definition.lower().strip().startswith('multipleselection'): options = definition.strip()[len('multipleselection '):].split(';') return ParameterSelection(name, descName, options, multiple=True, optional=isOptional) class ParameterEvaluationException(Exception): def __init__(self, param, msg): Exception.__init__(msg) self.param = param class ParameterString(Parameter): default_metadata = { 'widget_wrapper': 'processing.gui.wrappers.StringWidgetWrapper' } NEWLINE = '\n' ESCAPED_NEWLINE = '\\n' def __init__(self, name='', description='', default=None, multiline=False, optional=False, evaluateExpressions=False): Parameter.__init__(self, name, description, default, optional) self.multiline = parseBool(multiline) self.evaluateExpressions = parseBool(evaluateExpressions) def setValue(self, obj): if not bool(obj): if not self.optional: return False self.value = None return True self.value = str(obj).replace( ParameterString.ESCAPED_NEWLINE, ParameterString.NEWLINE ) return True def getValueAsCommandLineParameter(self): return ('"' + str(self.value.replace(ParameterString.NEWLINE, ParameterString.ESCAPED_NEWLINE)) + '"' if self.value is not None else str(None)) def getAsScriptCode(self): param_type = '' if self.optional: param_type += 'optional ' param_type += 'string' return '##' + self.name + '=' + param_type + self.default @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) descName = _createDescriptiveName(name) if definition.lower().strip().startswith('string'): default = definition.strip()[len('string') + 1:] if default: return ParameterString(name, descName, default, optional=isOptional) else: return ParameterString(name, descName, optional=isOptional) elif definition.lower().strip().startswith('longstring'): default = definition.strip()[len('longstring') + 1:] if default: return ParameterString(name, descName, default, multiline=True, optional=isOptional) else: return ParameterString(name, descName, multiline=True, optional=isOptional) def evaluate(self, alg): if isinstance(self.value, str) and bool(self.value) and self.evaluateExpressions: exp = QgsExpression(self.value) if exp.hasParserError(): raise ValueError(self.tr("Error in parameter expression: ") + exp.parserErrorString()) result = exp.evaluate(_expressionContext()) if exp.hasEvalError(): raise ValueError("Error evaluating parameter expression: " + exp.evalErrorString()) self.value = result def expressionContext(self): return _expressionContext() class ParameterExpression(Parameter): default_metadata = { 'widget_wrapper': 'processing.gui.wrappers.ExpressionWidgetWrapper' } NEWLINE = '\n' ESCAPED_NEWLINE = '\\n' def __init__(self, name='', description='', default=None, optional=False, parent_layer=None): Parameter.__init__(self, name, description, default, optional) self.parent_layer = parent_layer def setValue(self, obj): if not bool(obj): if not self.optional: return False self.value = None return True self.value = str(obj).replace( ParameterString.ESCAPED_NEWLINE, ParameterString.NEWLINE ) return True def getValueAsCommandLineParameter(self): return ('"' + str(self.value.replace(ParameterExpression.NEWLINE, ParameterExpression.ESCAPED_NEWLINE)) + '"' if self.value is not None else str(None)) def getAsScriptCode(self): param_type = '' if self.optional: param_type += 'optional ' param_type += 'expression' return '##' + self.name + '=' + param_type + self.default @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) if definition.lower().strip().startswith('expression'): descName = _createDescriptiveName(name) default = definition.strip()[len('expression') + 1:] if default: return ParameterExpression(name, descName, default, optional=isOptional) else: return ParameterExpression(name, descName, optional=isOptional) class ParameterTable(ParameterDataObject): default_metadata = { 'widget_wrapper': 'processing.gui.wrappers.TableWidgetWrapper' } def __init__(self, name='', description='', optional=False): ParameterDataObject.__init__(self, name, description, None, optional) self.exported = None def setValue(self, obj): self.exported = None if obj is None: if not self.optional: return False self.value = None return True if isinstance(obj, QgsVectorLayer): source = str(obj.source()) self.value = source return True else: self.value = str(obj) layers = dataobjects.getTables() for layer in layers: if layer.name() == self.value or layer.source() == self.value: source = str(layer.source()) self.value = source return True val = str(obj) self.value = val return os.path.exists(self.value) def getSafeExportedTable(self): """Returns not the value entered by the user, but a string with a filename which contains the data of this table, but saved in a standard format (currently always a DBF file) so that it can be opened by most external applications. Works only if the table represented by the parameter value is currently loaded in QGIS. Otherwise, it will not perform any export and return the current value string. If the current value represents a table in a suitable format, it does not export at all and returns that value. The table is exported just the first time the method is called. The method can be called several times and it will always return the same file, performing the export only the first time. """ if self.exported: return self.exported table = dataobjects.getObjectFromUri(self.value, False) if table: self.exported = dataobjects.exportTable(table) else: self.exported = self.value return self.exported def getFileFilter(self): exts = ['csv', 'dbf'] for i in range(len(exts)): exts[i] = self.tr('%s files(*.%s)', 'ParameterTable') % (exts[i].upper(), exts[i].lower()) return ';;'.join(exts) def getAsScriptCode(self): param_type = '' if self.optional: param_type += 'optional ' param_type += 'table' return '##' + self.name + '=' + param_type @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) descName = _createDescriptiveName(name) if definition.lower().strip().startswith('table'): return ParameterTable(name, descName, isOptional) class ParameterTableField(Parameter): """A parameter representing a table field. Its value is a string that represents the name of the field. """ default_metadata = { 'widget_wrapper': 'processing.gui.wrappers.TableFieldWidgetWrapper' } DATA_TYPE_NUMBER = 0 DATA_TYPE_STRING = 1 DATA_TYPE_DATETIME = 2 DATA_TYPE_ANY = -1 def __init__(self, name='', description='', parent=None, datatype=-1, optional=False, multiple=False): Parameter.__init__(self, name, description, None, optional) self.parent = parent self.multiple = multiple self.datatype = int(datatype) def getValueAsCommandLineParameter(self): return '"' + str(self.value) + '"' if self.value is not None else str(None) def setValue(self, value): if not bool(value): if not self.optional: return False self.value = None return True if isinstance(value, list): if not self.multiple and len(value) > 1: return False self.value = ";".join(value) return True else: self.value = str(value) return True def __str__(self): return self.name + ' <' + self.__module__.split('.')[-1] + ' from ' \ + self.parent + '>' def dataType(self): if self.datatype == self.DATA_TYPE_NUMBER: return 'numeric' elif self.datatype == self.DATA_TYPE_STRING: return 'string' elif self.datatype == self.DATA_TYPE_DATETIME: return 'datetime' else: return 'any' def getAsScriptCode(self): param_type = '' if self.optional: param_type += 'optional ' param_type += 'field' return '##' + self.name + '=' + param_type + self.parent @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) descName = _createDescriptiveName(name) if definition.lower().strip().startswith('field'): if definition.lower().strip().startswith('field number'): parent = definition.strip()[len('field number') + 1:] datatype = ParameterTableField.DATA_TYPE_NUMBER elif definition.lower().strip().startswith('field string'): parent = definition.strip()[len('field string') + 1:] datatype = ParameterTableField.DATA_TYPE_STRING elif definition.lower().strip().startswith('field datetime'): parent = definition.strip()[len('field datetime') + 1:] datatype = ParameterTableField.DATA_TYPE_DATETIME else: parent = definition.strip()[len('field') + 1:] datatype = ParameterTableField.DATA_TYPE_ANY return ParameterTableField(name, descName, parent, datatype, isOptional) class ParameterVector(ParameterDataObject): default_metadata = { 'widget_wrapper': 'processing.gui.wrappers.VectorWidgetWrapper' } def __init__(self, name='', description='', datatype=[-1], optional=False): ParameterDataObject.__init__(self, name, description, None, optional) if isinstance(datatype, int): datatype = [datatype] elif isinstance(datatype, str): datatype = [int(t) for t in datatype.split(',')] self.datatype = datatype self.exported = None self.allowOnlyOpenedLayers = False def setValue(self, obj): self.exported = None if obj is None: if not self.optional: return False self.value = None return True if isinstance(obj, QgsVectorLayer): self.value = str(obj.source()) return True else: self.value = str(obj) return True def getSafeExportedLayer(self): """Returns not the value entered by the user, but a string with a filename which contains the data of this layer, but saved in a standard format (currently always a shapefile) so that it can be opened by most external applications. If there is a selection and QGIS is configured to use just the selection, if exports the layer even if it is already in a suitable format. Works only if the layer represented by the parameter value is currently loaded in QGIS. Otherwise, it will not perform any export and return the current value string. If the current value represents a layer in a suitable format, it does not export at all and returns that value. The layer is exported just the first time the method is called. The method can be called several times and it will always return the same file, performing the export only the first time. """ if self.exported: return self.exported layer = dataobjects.getObjectFromUri(self.value, False) if layer: self.exported = dataobjects.exportVectorLayer(layer) else: self.exported = self.value return self.exported def getFileFilter(self): exts = dataobjects.getSupportedOutputVectorLayerExtensions() for i in range(len(exts)): exts[i] = self.tr('%s files(*.%s)', 'ParameterVector') % (exts[i].upper(), exts[i].lower()) return ';;'.join(exts) def dataType(self): return dataobjects.vectorDataType(self) def getAsScriptCode(self): param_type = '' if self.optional: param_type += 'optional ' param_type += 'vector' return '##' + self.name + '=' + param_type @classmethod def fromScriptCode(self, line): isOptional, name, definition = _splitParameterOptions(line) descName = _createDescriptiveName(name) if definition.lower().strip() == 'vector': return ParameterVector(name, descName, [dataobjects.TYPE_VECTOR_ANY], isOptional) elif definition.lower().strip() == 'vector point': return ParameterVector(name, descName, [dataobjects.TYPE_VECTOR_POINT], isOptional) elif definition.lower().strip() == 'vector line': return ParameterVector(name, descName, [dataobjects.TYPE_VECTOR_LINE], isOptional) elif definition.lower().strip() == 'vector polygon': return ParameterVector(name, descName, [dataobjects.TYPE_VECTOR_POLYGON], isOptional) class ParameterGeometryPredicate(Parameter): predicates = ('intersects', 'contains', 'disjoint', 'equals', 'touches', 'overlaps', 'within', 'crosses') def __init__(self, name='', description='', left=None, right=None, optional=False, enabledPredicates=None): Parameter.__init__(self, name, description, None, optional) self.left = left self.right = right self.value = None self.enabledPredicates = enabledPredicates if self.enabledPredicates is None: self.enabledPredicates = self.predicates def getValueAsCommandLineParameter(self): return str(self.value) def setValue(self, value): if value is None: if not self.optional: return False self.value = None return True elif len(value) == 0 and not self.optional: return False if isinstance(value, str): self.value = value.split(';') # relates to ModelerAlgorithm.resolveValue else: self.value = value return True paramClasses = [c for c in list(sys.modules[__name__].__dict__.values()) if isclass(c) and issubclass(c, Parameter)] def getParameterFromString(s): # Try the parameter definitions used in description files if '|' in s and (s.startswith("Parameter") or s.startswith("*Parameter")): isAdvanced = False if s.startswith("*"): s = s[1:] isAdvanced = True tokens = s.split("|") params = [t if str(t) != str(None) else None for t in tokens[1:]] try: clazz = getattr(sys.modules[__name__], tokens[0]) param = clazz(*params) param.isAdvanced = isAdvanced return param except: return None else: # try script syntax for paramClass in paramClasses: try: param = paramClass.fromScriptCode(s) if param is not None: return param except AttributeError: pass except: return None
gpl-2.0
6,668,968,050,453,547,000
34.083597
116
0.573605
false
4.626054
false
false
false
andrewk1/Climb-Bot
climb-bot.py
1
3083
import praw import requests import json import time import re # Function iterates over each submission title and checks if the title contains route syntax that indicates the post is about a route def parse_titles(bot, subreddit): start_time = time.time() for submission in subreddit.stream.submissions(): if (submission.created_utc < start_time): continue title = submission.title # regex matches sequence of capitalized words followed by climb grade notation (V or 5.) route_regex = '([A-Z][a-z]+(?=\s[A-Z])(?:\s[A-Z][a-z]+)+) [( ]?(5.[0-9][0-9]?[A-Za-z]|[Vv][0-9][0-9]?)' route_name = re.search(route_regex, title) print route_name comment = make_get_request(route_name.group(0)) if comment != 'NA': submission.reply(comment) # Call custom google search engine API to parse the formulated title and gather theCrag's metadata for the route def make_get_request(route): key = 'key=***' cx = 'cx=***' query= 'q='+route google_url = 'https://www.googleapis.com/customsearch/v1?' + key + cx + query response = requests.get(google_url) parsed_response= json.loads(response.text) return form_post(parsed_response) # Extract data from google's JSON response and form a post def form_post(parsed_response): # Check if Google search received a hit if parsed_response['searchInformation']['totalResults'] == 0 or 'items' not in parsed_response: return 'NA' title = parsed_response['items'][0]['title'] print title breadcrumb = parsed_response['items'][0]['pagemap']['breadcrumb'] count = 0 # Build up region string region_string = '' for key in breadcrumb: region = breadcrumb[count]['title'] if (count > 0) : region_string = region + ', ' + region_string else : region_string = region; count+=1 metatags = parsed_response['items'][0]['pagemap']['metatags'] country = breadcrumb[0]['title'] latitude = metatags[0]['place:location:latitude'] longitude = metatags[0]['place:location:longitude'] google_pin = 'https://www.google.com/maps/@?api=1&map_action=map&basemap=satellite&zoom=19&center=' + latitude + ',' + longitude link = metatags[0]['og:url'] if (' in ' in title): title = title[:title.index(' in ')] # Truncate values to 3rd decimal place lat_decimal = latitude.index('.') latitude = latitude[:lat_decimal+4] long_decimal = longitude.index('.') longitude = longitude[:long_decimal+4] # Format comment response return 'I found a route! [' + title + '](' + link + ') in ' + region_string + '\n\nGPS Location: [' + latitude + ', ' + longitude + ']('+google_pin+')' + '\n\n ' + '\n\n^^^I ^^^am ^^^a ^^^bot ^^^| ^^^Data ^^^from ^^^[theCrag.com](https://www.thecrag.com/) ^^^| ^^^Feedback ^^^welcome ^^^at ^^^[r/climbBot](https://www.reddit.com/r/climbBot/)' if __name__ == "__main__": bot = praw.Reddit( user_agent='climb-bot posts additional information on climbing routes it finds, created by /u/Akondrich, email: [email protected]', client_id='***', client_secret='***', username='climb-bot', password='***') subreddit = bot.subreddit('climbBot') parse_titles(bot, subreddit)
mit
-518,196,464,358,046,460
38.525641
343
0.67337
false
3.019589
false
false
false
yuxng/Deep_ISM
ISM/lib/setup.py
1
6351
# -------------------------------------------------------- # Fast R-CNN # Copyright (c) 2015 Microsoft # Licensed under The MIT License [see LICENSE for details] # Written by Ross Girshick # -------------------------------------------------------- import os from os.path import join as pjoin import numpy as np from distutils.core import setup from distutils.extension import Extension from Cython.Distutils import build_ext def find_in_path(name, path): "Find a file in a search path" #adapted fom http://code.activestate.com/recipes/52224-find-a-file-given-a-search-path/ for dir in path.split(os.pathsep): binpath = pjoin(dir, name) if os.path.exists(binpath): return os.path.abspath(binpath) return None def locate_cuda(): """Locate the CUDA environment on the system Returns a dict with keys 'home', 'nvcc', 'include', and 'lib64' and values giving the absolute path to each directory. Starts by looking for the CUDAHOME env variable. If not found, everything is based on finding 'nvcc' in the PATH. """ # first check if the CUDAHOME env variable is in use if 'CUDAHOME' in os.environ: home = os.environ['CUDAHOME'] nvcc = pjoin(home, 'bin', 'nvcc') else: # otherwise, search the PATH for NVCC default_path = pjoin(os.sep, 'usr', 'local', 'cuda', 'bin') nvcc = find_in_path('nvcc', os.environ['PATH'] + os.pathsep + default_path) if nvcc is None: raise EnvironmentError('The nvcc binary could not be ' 'located in your $PATH. Either add it to your path, or set $CUDAHOME') home = os.path.dirname(os.path.dirname(nvcc)) cudaconfig = {'home':home, 'nvcc':nvcc, 'include': pjoin(home, 'include'), 'lib64': pjoin(home, 'lib64')} for k, v in cudaconfig.iteritems(): if not os.path.exists(v): raise EnvironmentError('The CUDA %s path could not be located in %s' % (k, v)) return cudaconfig CUDA = locate_cuda() # Obtain the numpy include directory. This logic works across numpy versions. try: numpy_include = np.get_include() except AttributeError: numpy_include = np.get_numpy_include() def customize_compiler_for_nvcc(self): """inject deep into distutils to customize how the dispatch to gcc/nvcc works. If you subclass UnixCCompiler, it's not trivial to get your subclass injected in, and still have the right customizations (i.e. distutils.sysconfig.customize_compiler) run on it. So instead of going the OO route, I have this. Note, it's kindof like a wierd functional subclassing going on.""" # tell the compiler it can processes .cu self.src_extensions.append('.cu') # save references to the default compiler_so and _comple methods default_compiler_so = self.compiler_so super = self._compile # now redefine the _compile method. This gets executed for each # object but distutils doesn't have the ability to change compilers # based on source extension: we add it. def _compile(obj, src, ext, cc_args, extra_postargs, pp_opts): if os.path.splitext(src)[1] == '.cu': # use the cuda for .cu files self.set_executable('compiler_so', CUDA['nvcc']) # use only a subset of the extra_postargs, which are 1-1 translated # from the extra_compile_args in the Extension class postargs = extra_postargs['nvcc'] else: postargs = extra_postargs['gcc'] super(obj, src, ext, cc_args, postargs, pp_opts) # reset the default compiler_so, which we might have changed for cuda self.compiler_so = default_compiler_so # inject our redefined _compile method into the class self._compile = _compile # run the customize_compiler class custom_build_ext(build_ext): def build_extensions(self): customize_compiler_for_nvcc(self.compiler) build_ext.build_extensions(self) ext_modules = [ Extension( "utils.cython_bbox", ["utils/bbox.pyx"], extra_compile_args={'gcc': ["-Wno-cpp", "-Wno-unused-function"]}, ), Extension( "utils.cython_nms", ["utils/nms.pyx"], extra_compile_args={'gcc': ["-Wno-cpp", "-Wno-unused-function"]}, ), Extension( "nms.cpu_nms", ["nms/cpu_nms.pyx"], extra_compile_args={'gcc': ["-Wno-cpp", "-Wno-unused-function"]}, include_dirs = [numpy_include] ), Extension('nms.gpu_nms', ['nms/nms_kernel.cu', 'nms/gpu_nms.pyx'], library_dirs=[CUDA['lib64']], libraries=['cudart'], language='c++', runtime_library_dirs=[CUDA['lib64']], # this syntax is specific to this build system # we're only going to use certain compiler args with nvcc and not with gcc # the implementation of this trick is in customize_compiler() below extra_compile_args={'gcc': ["-Wno-unused-function"], 'nvcc': ['-arch=sm_35', '--ptxas-options=-v', '-c', '--compiler-options', "'-fPIC'"]}, include_dirs = [numpy_include, CUDA['include']] ), Extension('normals.gpu_normals', ['normals/compute_normals.cu', 'normals/gpu_normals.pyx'], library_dirs=[CUDA['lib64']], libraries=['cudart'], language='c++', runtime_library_dirs=[CUDA['lib64']], # this syntax is specific to this build system # we're only going to use certain compiler args with nvcc and not with gcc # the implementation of this trick is in customize_compiler() below extra_compile_args={'gcc': ["-Wno-unused-function"], 'nvcc': ['-arch=sm_35', '--ptxas-options=-v', '-c', '--compiler-options', "'-fPIC'"]}, include_dirs = [numpy_include, CUDA['include'], '/usr/local/include/eigen3'] ) ] setup( name='fast_rcnn', ext_modules=ext_modules, # inject our custom trigger cmdclass={'build_ext': custom_build_ext}, )
mit
-73,697,840,488,066,960
37.490909
91
0.587781
false
3.905904
false
false
false
gamechanger/kafka-python
kafka/protocol/admin.py
1
1182
from .struct import Struct from .types import Array, Bytes, Int16, Schema, String class ListGroupsResponse(Struct): SCHEMA = Schema( ('error_code', Int16), ('groups', Array( ('group', String('utf-8')), ('protocol_type', String('utf-8')))) ) class ListGroupsRequest(Struct): API_KEY = 16 API_VERSION = 0 RESPONSE_TYPE = ListGroupsResponse SCHEMA = Schema() class DescribeGroupsResponse(Struct): SCHEMA = Schema( ('groups', Array( ('error_code', Int16), ('group', String('utf-8')), ('state', String('utf-8')), ('protocol_type', String('utf-8')), ('protocol', String('utf-8')), ('members', Array( ('member_id', String('utf-8')), ('client_id', String('utf-8')), ('client_host', String('utf-8')), ('member_metadata', Bytes), ('member_assignment', Bytes))))) ) class DescribeGroupsRequest(Struct): API_KEY = 15 API_VERSION = 0 RESPONSE_TYPE = DescribeGroupsResponse SCHEMA = Schema( ('groups', Array(String('utf-8'))) )
apache-2.0
-8,683,488,429,018,159,000
25.863636
54
0.526227
false
3.953177
false
false
false
UTSA-ICS/keystone-SID
keystone/tests/test_auth.py
1
44678
# Copyright 2012 OpenStack Foundation # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import copy import datetime import uuid import mock from keystone import assignment from keystone import auth from keystone.common import authorization from keystone.common import environment from keystone import config from keystone import exception from keystone.openstack.common import timeutils from keystone import tests from keystone.tests import default_fixtures from keystone import token from keystone import trust CONF = config.CONF TIME_FORMAT = '%Y-%m-%dT%H:%M:%S.%fZ' DEFAULT_DOMAIN_ID = CONF.identity.default_domain_id HOST_URL = 'http://keystone:5001' def _build_user_auth(token=None, user_id=None, username=None, password=None, tenant_id=None, tenant_name=None, trust_id=None): """Build auth dictionary. It will create an auth dictionary based on all the arguments that it receives. """ auth_json = {} if token is not None: auth_json['token'] = token if username or password: auth_json['passwordCredentials'] = {} if username is not None: auth_json['passwordCredentials']['username'] = username if user_id is not None: auth_json['passwordCredentials']['userId'] = user_id if password is not None: auth_json['passwordCredentials']['password'] = password if tenant_name is not None: auth_json['tenantName'] = tenant_name if tenant_id is not None: auth_json['tenantId'] = tenant_id if trust_id is not None: auth_json['trust_id'] = trust_id return auth_json class AuthTest(tests.TestCase): def setUp(self): super(AuthTest, self).setUp() self.load_backends() self.load_fixtures(default_fixtures) # need to register the token provider first because auth controller # depends on it token.provider.Manager() self.context_with_remote_user = {'environment': {'REMOTE_USER': 'FOO', 'AUTH_TYPE': 'Negotiate'}} self.empty_context = {'environment': {}} self.controller = token.controllers.Auth() #This call sets up, among other things, the call to popen #that will be used to run the CMS command. These tests were #passing only due to the global nature of the call. If the #tests in this file are run alone, API calls return unauthorized. environment.use_eventlet(monkeypatch_thread=False) def assertEqualTokens(self, a, b): """Assert that two tokens are equal. Compare two tokens except for their ids. This also truncates the time in the comparison. """ def normalize(token): token['access']['token']['id'] = 'dummy' del token['access']['token']['expires'] del token['access']['token']['issued_at'] return token self.assertCloseEnoughForGovernmentWork( timeutils.parse_isotime(a['access']['token']['expires']), timeutils.parse_isotime(b['access']['token']['expires'])) self.assertCloseEnoughForGovernmentWork( timeutils.parse_isotime(a['access']['token']['issued_at']), timeutils.parse_isotime(b['access']['token']['issued_at'])) return self.assertDictEqual(normalize(a), normalize(b)) class AuthBadRequests(AuthTest): def setUp(self): super(AuthBadRequests, self).setUp() def test_no_external_auth(self): """Verify that _authenticate_external() raises exception if N/A.""" self.assertRaises( token.controllers.ExternalAuthNotApplicable, self.controller._authenticate_external, {}, {}) def test_no_token_in_auth(self): """Verify that _authenticate_token() raises exception if no token.""" self.assertRaises( exception.ValidationError, self.controller._authenticate_token, None, {}) def test_no_credentials_in_auth(self): """Verify that _authenticate_local() raises exception if no creds.""" self.assertRaises( exception.ValidationError, self.controller._authenticate_local, None, {}) def test_authenticate_blank_request_body(self): """Verify sending empty json dict raises the right exception.""" self.assertRaises(exception.ValidationError, self.controller.authenticate, {}, {}) def test_authenticate_blank_auth(self): """Verify sending blank 'auth' raises the right exception.""" body_dict = _build_user_auth() self.assertRaises(exception.ValidationError, self.controller.authenticate, {}, body_dict) def test_authenticate_invalid_auth_content(self): """Verify sending invalid 'auth' raises the right exception.""" self.assertRaises(exception.ValidationError, self.controller.authenticate, {}, {'auth': 'abcd'}) def test_authenticate_user_id_too_large(self): """Verify sending large 'userId' raises the right exception.""" body_dict = _build_user_auth(user_id='0' * 65, username='FOO', password='foo2') self.assertRaises(exception.ValidationSizeError, self.controller.authenticate, {}, body_dict) def test_authenticate_username_too_large(self): """Verify sending large 'username' raises the right exception.""" body_dict = _build_user_auth(username='0' * 65, password='foo2') self.assertRaises(exception.ValidationSizeError, self.controller.authenticate, {}, body_dict) def test_authenticate_tenant_id_too_large(self): """Verify sending large 'tenantId' raises the right exception.""" body_dict = _build_user_auth(username='FOO', password='foo2', tenant_id='0' * 65) self.assertRaises(exception.ValidationSizeError, self.controller.authenticate, {}, body_dict) def test_authenticate_tenant_name_too_large(self): """Verify sending large 'tenantName' raises the right exception.""" body_dict = _build_user_auth(username='FOO', password='foo2', tenant_name='0' * 65) self.assertRaises(exception.ValidationSizeError, self.controller.authenticate, {}, body_dict) def test_authenticate_token_too_large(self): """Verify sending large 'token' raises the right exception.""" body_dict = _build_user_auth(token={'id': '0' * 8193}) self.assertRaises(exception.ValidationSizeError, self.controller.authenticate, {}, body_dict) def test_authenticate_password_too_large(self): """Verify sending large 'password' raises the right exception.""" length = CONF.identity.max_password_length + 1 body_dict = _build_user_auth(username='FOO', password='0' * length) self.assertRaises(exception.ValidationSizeError, self.controller.authenticate, {}, body_dict) class AuthWithToken(AuthTest): def setUp(self): super(AuthWithToken, self).setUp() def test_unscoped_token(self): """Verify getting an unscoped token with password creds.""" body_dict = _build_user_auth(username='FOO', password='foo2') unscoped_token = self.controller.authenticate({}, body_dict) self.assertNotIn('tenant', unscoped_token['access']['token']) def test_auth_invalid_token(self): """Verify exception is raised if invalid token.""" body_dict = _build_user_auth(token={"id": uuid.uuid4().hex}) self.assertRaises( exception.Unauthorized, self.controller.authenticate, {}, body_dict) def test_auth_bad_formatted_token(self): """Verify exception is raised if invalid token.""" body_dict = _build_user_auth(token={}) self.assertRaises( exception.ValidationError, self.controller.authenticate, {}, body_dict) def test_auth_unscoped_token_no_project(self): """Verify getting an unscoped token with an unscoped token.""" body_dict = _build_user_auth( username='FOO', password='foo2') unscoped_token = self.controller.authenticate({}, body_dict) body_dict = _build_user_auth( token=unscoped_token["access"]["token"]) unscoped_token_2 = self.controller.authenticate({}, body_dict) self.assertEqualTokens(unscoped_token, unscoped_token_2) def test_auth_unscoped_token_project(self): """Verify getting a token in a tenant with an unscoped token.""" # Add a role in so we can check we get this back self.assignment_api.add_role_to_user_and_project( self.user_foo['id'], self.tenant_bar['id'], self.role_member['id']) # Get an unscoped tenant body_dict = _build_user_auth( username='FOO', password='foo2') unscoped_token = self.controller.authenticate({}, body_dict) # Get a token on BAR tenant using the unscoped tenant body_dict = _build_user_auth( token=unscoped_token["access"]["token"], tenant_name="BAR") scoped_token = self.controller.authenticate({}, body_dict) tenant = scoped_token["access"]["token"]["tenant"] roles = scoped_token["access"]["metadata"]["roles"] self.assertEqual(self.tenant_bar['id'], tenant["id"]) self.assertEqual(self.role_member['id'], roles[0]) def test_auth_token_project_group_role(self): """Verify getting a token in a tenant with group roles.""" # Add a v2 style role in so we can check we get this back self.assignment_api.add_role_to_user_and_project( self.user_foo['id'], self.tenant_bar['id'], self.role_member['id']) # Now create a group role for this user as well domain1 = {'id': uuid.uuid4().hex, 'name': uuid.uuid4().hex} self.assignment_api.create_domain(domain1['id'], domain1) new_group = {'id': uuid.uuid4().hex, 'domain_id': domain1['id'], 'name': uuid.uuid4().hex} self.identity_api.create_group(new_group['id'], new_group) self.identity_api.add_user_to_group(self.user_foo['id'], new_group['id']) self.assignment_api.create_grant( group_id=new_group['id'], project_id=self.tenant_bar['id'], role_id=self.role_admin['id']) # Get a scoped token for the tenant body_dict = _build_user_auth( username='FOO', password='foo2', tenant_name="BAR") scoped_token = self.controller.authenticate({}, body_dict) tenant = scoped_token["access"]["token"]["tenant"] roles = scoped_token["access"]["metadata"]["roles"] self.assertEqual(self.tenant_bar['id'], tenant["id"]) self.assertIn(self.role_member['id'], roles) self.assertIn(self.role_admin['id'], roles) def test_auth_token_cross_domain_group_and_project(self): """Verify getting a token in cross domain group/project roles.""" # create domain, project and group and grant roles to user domain1 = {'id': uuid.uuid4().hex, 'name': uuid.uuid4().hex} self.assignment_api.create_domain(domain1['id'], domain1) project1 = {'id': uuid.uuid4().hex, 'name': uuid.uuid4().hex, 'domain_id': domain1['id']} self.assignment_api.create_project(project1['id'], project1) role_foo_domain1 = {'id': uuid.uuid4().hex, 'name': uuid.uuid4().hex} self.assignment_api.create_role(role_foo_domain1['id'], role_foo_domain1) role_group_domain1 = {'id': uuid.uuid4().hex, 'name': uuid.uuid4().hex} self.assignment_api.create_role(role_group_domain1['id'], role_group_domain1) self.assignment_api.add_user_to_project(project1['id'], self.user_foo['id']) new_group = {'id': uuid.uuid4().hex, 'domain_id': domain1['id'], 'name': uuid.uuid4().hex} self.identity_api.create_group(new_group['id'], new_group) self.identity_api.add_user_to_group(self.user_foo['id'], new_group['id']) self.assignment_api.create_grant( user_id=self.user_foo['id'], project_id=project1['id'], role_id=self.role_member['id']) self.assignment_api.create_grant( group_id=new_group['id'], project_id=project1['id'], role_id=self.role_admin['id']) self.assignment_api.create_grant( user_id=self.user_foo['id'], domain_id=domain1['id'], role_id=role_foo_domain1['id']) self.assignment_api.create_grant( group_id=new_group['id'], domain_id=domain1['id'], role_id=role_group_domain1['id']) # Get a scoped token for the tenant body_dict = _build_user_auth( username=self.user_foo['name'], password=self.user_foo['password'], tenant_name=project1['name']) scoped_token = self.controller.authenticate({}, body_dict) tenant = scoped_token["access"]["token"]["tenant"] roles = scoped_token["access"]["metadata"]["roles"] self.assertEqual(project1['id'], tenant["id"]) self.assertIn(self.role_member['id'], roles) self.assertIn(self.role_admin['id'], roles) self.assertNotIn(role_foo_domain1['id'], roles) self.assertNotIn(role_group_domain1['id'], roles) def test_belongs_to_no_tenant(self): r = self.controller.authenticate( {}, auth={ 'passwordCredentials': { 'username': self.user_foo['name'], 'password': self.user_foo['password'] } }) unscoped_token_id = r['access']['token']['id'] self.assertRaises( exception.Unauthorized, self.controller.validate_token, dict(is_admin=True, query_string={'belongsTo': 'BAR'}), token_id=unscoped_token_id) def test_belongs_to(self): body_dict = _build_user_auth( username='FOO', password='foo2', tenant_name="BAR") scoped_token = self.controller.authenticate({}, body_dict) scoped_token_id = scoped_token['access']['token']['id'] self.assertRaises( exception.Unauthorized, self.controller.validate_token, dict(is_admin=True, query_string={'belongsTo': 'me'}), token_id=scoped_token_id) self.assertRaises( exception.Unauthorized, self.controller.validate_token, dict(is_admin=True, query_string={'belongsTo': 'BAR'}), token_id=scoped_token_id) def test_token_auth_with_binding(self): self.config_fixture.config(group='token', bind=['kerberos']) body_dict = _build_user_auth() unscoped_token = self.controller.authenticate( self.context_with_remote_user, body_dict) # the token should have bind information in it bind = unscoped_token['access']['token']['bind'] self.assertEqual('FOO', bind['kerberos']) body_dict = _build_user_auth( token=unscoped_token['access']['token'], tenant_name='BAR') # using unscoped token without remote user context fails self.assertRaises( exception.Unauthorized, self.controller.authenticate, self.empty_context, body_dict) # using token with remote user context succeeds scoped_token = self.controller.authenticate( self.context_with_remote_user, body_dict) # the bind information should be carried over from the original token bind = scoped_token['access']['token']['bind'] self.assertEqual('FOO', bind['kerberos']) def test_deleting_role_revokes_token(self): role_controller = assignment.controllers.Role() project1 = {'id': 'Project1', 'name': uuid.uuid4().hex, 'domain_id': DEFAULT_DOMAIN_ID} self.assignment_api.create_project(project1['id'], project1) role_one = {'id': 'role_one', 'name': uuid.uuid4().hex} self.assignment_api.create_role(role_one['id'], role_one) self.assignment_api.add_role_to_user_and_project( self.user_foo['id'], project1['id'], role_one['id']) no_context = {} # Get a scoped token for the tenant body_dict = _build_user_auth( username=self.user_foo['name'], password=self.user_foo['password'], tenant_name=project1['name']) token = self.controller.authenticate(no_context, body_dict) # Ensure it is valid token_id = token['access']['token']['id'] self.controller.validate_token( dict(is_admin=True, query_string={}), token_id=token_id) # Delete the role, which should invalidate the token role_controller.delete_role( dict(is_admin=True, query_string={}), role_one['id']) # Check the token is now invalid self.assertRaises( exception.TokenNotFound, self.controller.validate_token, dict(is_admin=True, query_string={}), token_id=token_id) class AuthWithPasswordCredentials(AuthTest): def setUp(self): super(AuthWithPasswordCredentials, self).setUp() def test_auth_invalid_user(self): """Verify exception is raised if invalid user.""" body_dict = _build_user_auth( username=uuid.uuid4().hex, password=uuid.uuid4().hex) self.assertRaises( exception.Unauthorized, self.controller.authenticate, {}, body_dict) def test_auth_valid_user_invalid_password(self): """Verify exception is raised if invalid password.""" body_dict = _build_user_auth( username="FOO", password=uuid.uuid4().hex) self.assertRaises( exception.Unauthorized, self.controller.authenticate, {}, body_dict) def test_auth_empty_password(self): """Verify exception is raised if empty password.""" body_dict = _build_user_auth( username="FOO", password="") self.assertRaises( exception.Unauthorized, self.controller.authenticate, {}, body_dict) def test_auth_no_password(self): """Verify exception is raised if empty password.""" body_dict = _build_user_auth(username="FOO") self.assertRaises( exception.ValidationError, self.controller.authenticate, {}, body_dict) def test_authenticate_blank_password_credentials(self): """Sending empty dict as passwordCredentials raises a 400 error.""" body_dict = {'passwordCredentials': {}, 'tenantName': 'demo'} self.assertRaises(exception.ValidationError, self.controller.authenticate, {}, body_dict) def test_authenticate_no_username(self): """Verify skipping username raises the right exception.""" body_dict = _build_user_auth(password="pass", tenant_name="demo") self.assertRaises(exception.ValidationError, self.controller.authenticate, {}, body_dict) def test_bind_without_remote_user(self): self.config_fixture.config(group='token', bind=['kerberos']) body_dict = _build_user_auth(username='FOO', password='foo2', tenant_name='BAR') token = self.controller.authenticate({}, body_dict) self.assertNotIn('bind', token['access']['token']) def test_change_default_domain_id(self): # If the default_domain_id config option is not the default then the # user in auth data is from the new default domain. # 1) Create a new domain. new_domain_id = uuid.uuid4().hex new_domain = { 'description': uuid.uuid4().hex, 'enabled': True, 'id': new_domain_id, 'name': uuid.uuid4().hex, } self.assignment_api.create_domain(new_domain_id, new_domain) # 2) Create user "foo" in new domain with different password than # default-domain foo. new_user_id = uuid.uuid4().hex new_user_password = uuid.uuid4().hex new_user = { 'id': new_user_id, 'name': self.user_foo['name'], 'domain_id': new_domain_id, 'password': new_user_password, 'email': '[email protected]', } self.identity_api.create_user(new_user_id, new_user) # 3) Update the default_domain_id config option to the new domain self.config_fixture.config(group='identity', default_domain_id=new_domain_id) # 4) Authenticate as "foo" using the password in the new domain. body_dict = _build_user_auth( username=self.user_foo['name'], password=new_user_password) # The test is successful if this doesn't raise, so no need to assert. self.controller.authenticate({}, body_dict) class AuthWithRemoteUser(AuthTest): def setUp(self): super(AuthWithRemoteUser, self).setUp() def test_unscoped_remote_authn(self): """Verify getting an unscoped token with external authn.""" body_dict = _build_user_auth( username='FOO', password='foo2') local_token = self.controller.authenticate( {}, body_dict) body_dict = _build_user_auth() remote_token = self.controller.authenticate( self.context_with_remote_user, body_dict) self.assertEqualTokens(local_token, remote_token) def test_unscoped_remote_authn_jsonless(self): """Verify that external auth with invalid request fails.""" self.assertRaises( exception.ValidationError, self.controller.authenticate, {'REMOTE_USER': 'FOO'}, None) def test_scoped_remote_authn(self): """Verify getting a token with external authn.""" body_dict = _build_user_auth( username='FOO', password='foo2', tenant_name='BAR') local_token = self.controller.authenticate( {}, body_dict) body_dict = _build_user_auth( tenant_name='BAR') remote_token = self.controller.authenticate( self.context_with_remote_user, body_dict) self.assertEqualTokens(local_token, remote_token) def test_scoped_nometa_remote_authn(self): """Verify getting a token with external authn and no metadata.""" body_dict = _build_user_auth( username='TWO', password='two2', tenant_name='BAZ') local_token = self.controller.authenticate( {}, body_dict) body_dict = _build_user_auth(tenant_name='BAZ') remote_token = self.controller.authenticate( {'environment': {'REMOTE_USER': 'TWO'}}, body_dict) self.assertEqualTokens(local_token, remote_token) def test_scoped_remote_authn_invalid_user(self): """Verify that external auth with invalid user fails.""" body_dict = _build_user_auth(tenant_name="BAR") self.assertRaises( exception.Unauthorized, self.controller.authenticate, {'environment': {'REMOTE_USER': uuid.uuid4().hex}}, body_dict) def test_bind_with_kerberos(self): self.config_fixture.config(group='token', bind=['kerberos']) body_dict = _build_user_auth(tenant_name="BAR") token = self.controller.authenticate(self.context_with_remote_user, body_dict) self.assertEqual('FOO', token['access']['token']['bind']['kerberos']) def test_bind_without_config_opt(self): self.config_fixture.config(group='token', bind=['x509']) body_dict = _build_user_auth(tenant_name='BAR') token = self.controller.authenticate(self.context_with_remote_user, body_dict) self.assertNotIn('bind', token['access']['token']) class AuthWithTrust(AuthTest): def setUp(self): super(AuthWithTrust, self).setUp() trust.Manager() self.trust_controller = trust.controllers.TrustV3() self.auth_v3_controller = auth.controllers.Auth() self.trustor = self.user_foo self.trustee = self.user_two self.assigned_roles = [self.role_member['id'], self.role_browser['id']] for assigned_role in self.assigned_roles: self.assignment_api.add_role_to_user_and_project( self.trustor['id'], self.tenant_bar['id'], assigned_role) self.sample_data = {'trustor_user_id': self.trustor['id'], 'trustee_user_id': self.trustee['id'], 'project_id': self.tenant_bar['id'], 'impersonation': True, 'roles': [{'id': self.role_browser['id']}, {'name': self.role_member['name']}]} expires_at = timeutils.strtime(timeutils.utcnow() + datetime.timedelta(minutes=10), fmt=TIME_FORMAT) self.create_trust(expires_at=expires_at) def config_overrides(self): super(AuthWithTrust, self).config_overrides() self.config_fixture.config(group='trust', enabled=True) def _create_auth_context(self, token_id): token_ref = self.token_api.get_token(token_id) auth_context = authorization.token_to_auth_context( token_ref['token_data']) return {'environment': {authorization.AUTH_CONTEXT_ENV: auth_context}, 'token_id': token_id, 'host_url': HOST_URL} def create_trust(self, expires_at=None, impersonation=True): username = self.trustor['name'] password = 'foo2' body_dict = _build_user_auth(username=username, password=password) self.unscoped_token = self.controller.authenticate({}, body_dict) context = self._create_auth_context( self.unscoped_token['access']['token']['id']) trust_data = copy.deepcopy(self.sample_data) trust_data['expires_at'] = expires_at trust_data['impersonation'] = impersonation self.new_trust = self.trust_controller.create_trust( context, trust=trust_data)['trust'] def build_v2_token_request(self, username, password): body_dict = _build_user_auth(username=username, password=password) self.unscoped_token = self.controller.authenticate({}, body_dict) unscoped_token_id = self.unscoped_token['access']['token']['id'] request_body = _build_user_auth(token={'id': unscoped_token_id}, trust_id=self.new_trust['id'], tenant_id=self.tenant_bar['id']) return request_body def test_create_trust_bad_data_fails(self): context = self._create_auth_context( self.unscoped_token['access']['token']['id']) bad_sample_data = {'trustor_user_id': self.trustor['id'], 'project_id': self.tenant_bar['id'], 'roles': [{'id': self.role_browser['id']}]} self.assertRaises(exception.ValidationError, self.trust_controller.create_trust, context, trust=bad_sample_data) def test_create_trust_no_roles(self): context = {'token_id': self.unscoped_token['access']['token']['id']} self.sample_data['roles'] = [] self.assertRaises(exception.Forbidden, self.trust_controller.create_trust, context, trust=self.sample_data) def test_create_trust(self): self.assertEqual(self.trustor['id'], self.new_trust['trustor_user_id']) self.assertEqual(self.trustee['id'], self.new_trust['trustee_user_id']) role_ids = [self.role_browser['id'], self.role_member['id']] self.assertTrue(timeutils.parse_strtime(self.new_trust['expires_at'], fmt=TIME_FORMAT)) self.assertIn('%s/v3/OS-TRUST/' % HOST_URL, self.new_trust['links']['self']) self.assertIn('%s/v3/OS-TRUST/' % HOST_URL, self.new_trust['roles_links']['self']) for role in self.new_trust['roles']: self.assertIn(role['id'], role_ids) def test_create_trust_expires_bad(self): self.assertRaises(exception.ValidationTimeStampError, self.create_trust, expires_at="bad") self.assertRaises(exception.ValidationTimeStampError, self.create_trust, expires_at="") self.assertRaises(exception.ValidationTimeStampError, self.create_trust, expires_at="Z") def test_get_trust(self): context = {'token_id': self.unscoped_token['access']['token']['id'], 'host_url': HOST_URL} trust = self.trust_controller.get_trust(context, self.new_trust['id'])['trust'] self.assertEqual(self.trustor['id'], trust['trustor_user_id']) self.assertEqual(self.trustee['id'], trust['trustee_user_id']) role_ids = [self.role_browser['id'], self.role_member['id']] for role in self.new_trust['roles']: self.assertIn(role['id'], role_ids) def test_create_trust_no_impersonation(self): self.create_trust(expires_at=None, impersonation=False) self.assertEqual(self.trustor['id'], self.new_trust['trustor_user_id']) self.assertEqual(self.trustee['id'], self.new_trust['trustee_user_id']) self.assertIs(self.new_trust['impersonation'], False) auth_response = self.fetch_v2_token_from_trust() token_user = auth_response['access']['user'] self.assertEqual(token_user['id'], self.new_trust['trustee_user_id']) # TODO(ayoung): Endpoints def test_create_trust_impersonation(self): self.create_trust(expires_at=None) self.assertEqual(self.trustor['id'], self.new_trust['trustor_user_id']) self.assertEqual(self.trustee['id'], self.new_trust['trustee_user_id']) self.assertIs(self.new_trust['impersonation'], True) auth_response = self.fetch_v2_token_from_trust() token_user = auth_response['access']['user'] self.assertEqual(token_user['id'], self.new_trust['trustor_user_id']) def test_token_from_trust_wrong_user_fails(self): request_body = self.build_v2_token_request('FOO', 'foo2') self.assertRaises( exception.Forbidden, self.controller.authenticate, {}, request_body) def fetch_v2_token_from_trust(self): request_body = self.build_v2_token_request('TWO', 'two2') auth_response = self.controller.authenticate({}, request_body) return auth_response def fetch_v3_token_from_trust(self): v3_password_data = { 'identity': { "methods": ["password"], "password": { "user": { "id": self.trustee["id"], "password": self.trustee["password"]}} }, 'scope': { 'project': { 'id': self.tenant_baz['id']}}} auth_response = (self.auth_v3_controller.authenticate_for_token ({'environment': {}, 'query_string': {}}, v3_password_data)) token = auth_response.headers['X-Subject-Token'] v3_req_with_trust = { "identity": { "methods": ["token"], "token": {"id": token}}, "scope": { "OS-TRUST:trust": {"id": self.new_trust['id']}}} token_auth_response = (self.auth_v3_controller.authenticate_for_token ({'environment': {}, 'query_string': {}}, v3_req_with_trust)) return token_auth_response def test_create_v3_token_from_trust(self): auth_response = self.fetch_v3_token_from_trust() trust_token_user = auth_response.json['token']['user'] self.assertEqual(self.trustor['id'], trust_token_user['id']) trust_token_trust = auth_response.json['token']['OS-TRUST:trust'] self.assertEqual(trust_token_trust['id'], self.new_trust['id']) self.assertEqual(self.trustor['id'], trust_token_trust['trustor_user']['id']) self.assertEqual(self.trustee['id'], trust_token_trust['trustee_user']['id']) trust_token_roles = auth_response.json['token']['roles'] self.assertEqual(2, len(trust_token_roles)) def test_v3_trust_token_get_token_fails(self): auth_response = self.fetch_v3_token_from_trust() trust_token = auth_response.headers['X-Subject-Token'] v3_token_data = {'identity': { 'methods': ['token'], 'token': {'id': trust_token} }} self.assertRaises( exception.Forbidden, self.auth_v3_controller.authenticate_for_token, {'environment': {}, 'query_string': {}}, v3_token_data) def test_token_from_trust(self): auth_response = self.fetch_v2_token_from_trust() self.assertIsNotNone(auth_response) self.assertEqual(2, len(auth_response['access']['metadata']['roles']), "user_foo has three roles, but the token should" " only get the two roles specified in the trust.") def assert_token_count_for_trust(self, expected_value): tokens = self.trust_controller.token_api._list_tokens( self.trustee['id'], trust_id=self.new_trust['id']) token_count = len(tokens) self.assertEqual(expected_value, token_count) def test_delete_tokens_for_user_invalidates_tokens_from_trust(self): self.assert_token_count_for_trust(0) self.fetch_v2_token_from_trust() self.assert_token_count_for_trust(1) self.token_api.delete_tokens_for_user(self.trustee['id']) self.assert_token_count_for_trust(0) def test_token_from_trust_cant_get_another_token(self): auth_response = self.fetch_v2_token_from_trust() trust_token_id = auth_response['access']['token']['id'] request_body = _build_user_auth(token={'id': trust_token_id}, tenant_id=self.tenant_bar['id']) self.assertRaises( exception.Forbidden, self.controller.authenticate, {}, request_body) def test_delete_trust_revokes_token(self): context = self._create_auth_context( self.unscoped_token['access']['token']['id']) self.fetch_v2_token_from_trust() trust_id = self.new_trust['id'] tokens = self.token_api._list_tokens(self.trustor['id'], trust_id=trust_id) self.assertEqual(1, len(tokens)) self.trust_controller.delete_trust(context, trust_id=trust_id) tokens = self.token_api._list_tokens(self.trustor['id'], trust_id=trust_id) self.assertEqual(0, len(tokens)) def test_token_from_trust_with_no_role_fails(self): for assigned_role in self.assigned_roles: self.assignment_api.remove_role_from_user_and_project( self.trustor['id'], self.tenant_bar['id'], assigned_role) request_body = self.build_v2_token_request('TWO', 'two2') self.assertRaises( exception.Forbidden, self.controller.authenticate, {}, request_body) def test_expired_trust_get_token_fails(self): expiry = "1999-02-18T10:10:00Z" self.create_trust(expiry) request_body = self.build_v2_token_request('TWO', 'two2') self.assertRaises( exception.Forbidden, self.controller.authenticate, {}, request_body) def test_token_from_trust_with_wrong_role_fails(self): self.assignment_api.add_role_to_user_and_project( self.trustor['id'], self.tenant_bar['id'], self.role_other['id']) for assigned_role in self.assigned_roles: self.assignment_api.remove_role_from_user_and_project( self.trustor['id'], self.tenant_bar['id'], assigned_role) request_body = self.build_v2_token_request('TWO', 'two2') self.assertRaises( exception.Forbidden, self.controller.authenticate, {}, request_body) class TokenExpirationTest(AuthTest): @mock.patch.object(timeutils, 'utcnow') def _maintain_token_expiration(self, mock_utcnow): """Token expiration should be maintained after re-auth & validation.""" now = datetime.datetime.utcnow() mock_utcnow.return_value = now r = self.controller.authenticate( {}, auth={ 'passwordCredentials': { 'username': self.user_foo['name'], 'password': self.user_foo['password'] } }) unscoped_token_id = r['access']['token']['id'] original_expiration = r['access']['token']['expires'] mock_utcnow.return_value = now + datetime.timedelta(seconds=1) r = self.controller.validate_token( dict(is_admin=True, query_string={}), token_id=unscoped_token_id) self.assertEqual(original_expiration, r['access']['token']['expires']) mock_utcnow.return_value = now + datetime.timedelta(seconds=2) r = self.controller.authenticate( {}, auth={ 'token': { 'id': unscoped_token_id, }, 'tenantId': self.tenant_bar['id'], }) scoped_token_id = r['access']['token']['id'] self.assertEqual(original_expiration, r['access']['token']['expires']) mock_utcnow.return_value = now + datetime.timedelta(seconds=3) r = self.controller.validate_token( dict(is_admin=True, query_string={}), token_id=scoped_token_id) self.assertEqual(original_expiration, r['access']['token']['expires']) def test_maintain_uuid_token_expiration(self): self.config_fixture.config(group='signing', token_format='UUID') self._maintain_token_expiration() class AuthCatalog(tests.SQLDriverOverrides, AuthTest): """Tests for the catalog provided in the auth response.""" def config_files(self): config_files = super(AuthCatalog, self).config_files() # We need to use a backend that supports disabled endpoints, like the # SQL backend. config_files.append(tests.dirs.tests_conf('backend_sql.conf')) return config_files def _create_endpoints(self): def create_endpoint(service_id, region, **kwargs): id_ = uuid.uuid4().hex ref = { 'id': id_, 'interface': 'public', 'region': region, 'service_id': service_id, 'url': 'http://localhost/%s' % uuid.uuid4().hex, } ref.update(kwargs) self.catalog_api.create_endpoint(id_, ref) return ref # Create a service for use with the endpoints. def create_service(**kwargs): id_ = uuid.uuid4().hex ref = { 'id': id_, 'name': uuid.uuid4().hex, 'type': uuid.uuid4().hex, } ref.update(kwargs) self.catalog_api.create_service(id_, ref) return ref enabled_service_ref = create_service(enabled=True) disabled_service_ref = create_service(enabled=False) region = uuid.uuid4().hex # Create endpoints enabled_endpoint_ref = create_endpoint( enabled_service_ref['id'], region) create_endpoint( enabled_service_ref['id'], region, enabled=False, interface='internal') create_endpoint( disabled_service_ref['id'], region) return enabled_endpoint_ref def test_auth_catalog_disabled_endpoint(self): """On authenticate, get a catalog that excludes disabled endpoints.""" endpoint_ref = self._create_endpoints() # Authenticate body_dict = _build_user_auth( username='FOO', password='foo2', tenant_name="BAR") token = self.controller.authenticate({}, body_dict) # Check the catalog self.assertEqual(1, len(token['access']['serviceCatalog'])) endpoint = token['access']['serviceCatalog'][0]['endpoints'][0] self.assertEqual( 1, len(token['access']['serviceCatalog'][0]['endpoints'])) exp_endpoint = { 'id': endpoint_ref['id'], 'publicURL': endpoint_ref['url'], 'region': endpoint_ref['region'], } self.assertEqual(exp_endpoint, endpoint) def test_validate_catalog_disabled_endpoint(self): """On validate, get back a catalog that excludes disabled endpoints.""" endpoint_ref = self._create_endpoints() # Authenticate body_dict = _build_user_auth( username='FOO', password='foo2', tenant_name="BAR") token = self.controller.authenticate({}, body_dict) # Validate token_id = token['access']['token']['id'] validate_ref = self.controller.validate_token( dict(is_admin=True, query_string={}), token_id=token_id) # Check the catalog self.assertEqual(1, len(token['access']['serviceCatalog'])) endpoint = validate_ref['access']['serviceCatalog'][0]['endpoints'][0] self.assertEqual( 1, len(token['access']['serviceCatalog'][0]['endpoints'])) exp_endpoint = { 'id': endpoint_ref['id'], 'publicURL': endpoint_ref['url'], 'region': endpoint_ref['region'], } self.assertEqual(exp_endpoint, endpoint) class NonDefaultAuthTest(tests.TestCase): def test_add_non_default_auth_method(self): self.config_fixture.config(group='auth', methods=['password', 'token', 'custom']) config.setup_authentication() self.assertTrue(hasattr(CONF.auth, 'custom'))
apache-2.0
159,340,296,657,682,560
39.839122
79
0.575406
false
4.143758
true
false
false
kritak/textdungeon
Internal/pricerandomtester.py
1
1114
"""testing random frequency of items based on price for item. a cheap item is more common, a expensive item is very rare""" import random d = {"healing":50, "berserk":60, "clever":100, "swiftness":100, "might":100, "awesomeness":500, } # reverse d dr = [[1/b,a] for [a,b] in d.items()] # list of [price, drinkname] dr.sort() # sort this list by price pricelist1 = [a for [a,b] in dr] # list of price only drinklist = [b for [a,b] in dr] # list of drinkname only pricelist2 = [] # list of added up prices kprice = 0 for p in pricelist1: kprice += p pricelist2.append(kprice) print(pricelist1, pricelist2) result = {} print("calculating please wait...") for x in range(10000): y = random.random()*(pricelist2[-1]) # 1 to maxprice for p in pricelist2: if y < p: drinkname = drinklist[pricelist2.index(p)] if drinkname in result: result[drinkname] += 1 else: result[drinkname] = 1 break print(result)
gpl-2.0
-7,916,032,930,120,072,000
24.906977
66
0.561939
false
3.375758
false
false
false
unt-libraries/django-name
name/api/serializers.py
1
6208
"""Serializers for the Name App Models. This module leverages the Django Rest Framework's Serializer components to build JSON representations of the models defined in this app. These JSON representations are designed to be backwards compatible with the API documented in previous versions. For documentation regarding the Django Rest Framework Serializers go to http://www.django-rest-framework.org/api-guide/serializers/ """ from rest_framework import serializers from .. import models class IdentifierSerializer(serializers.ModelSerializer): """Serializer for the Identifier Model. The following fields have been renamed for backwards compatibility with previous versions of the API. label -> identifier.type href -> identifier.value """ label = serializers.StringRelatedField(source='type') href = serializers.CharField(source='value') class Meta: model = models.Identifier fields = ('label', 'href') class NoteSerializer(serializers.ModelSerializer): """Serializer for the Note Model.""" type = serializers.SerializerMethodField() class Meta: model = models.Note fields = ('note', 'type') def get_type(self, obj): """Sets the type field. Returns the Note Type label, instead of the Note Type ID, which is the default behavior. """ return obj.get_note_type_label().lower() class VariantSerializer(serializers.ModelSerializer): """Serializer for the Variant Model.""" type = serializers.SerializerMethodField() class Meta: model = models.Variant fields = ('variant', 'type') def get_type(self, obj): """Sets the type field. Returns the Variant Type label, instead of the Variant Type ID, which is the default behavior. """ return obj.get_variant_type_label().lower() class NameSerializer(serializers.ModelSerializer): """Serializer for the Name Model. This serializes the the Name model to include detailed information about the object, including the related Variants, Notes, and Identifiers. The following fields have been renamed for backwards compatibility with previous versions of the API. authoritative_name -> name.name begin_date -> name.begin end_date -> name.end The identifier field is the absolute url to the name detail page for the model instance. """ authoritative_name = serializers.CharField(source='name') begin_date = serializers.CharField(source='begin') name_type = serializers.SerializerMethodField() end_date = serializers.CharField(source='end') links = IdentifierSerializer(many=True, source='identifier_set') notes = NoteSerializer(many=True, source='note_set') variants = VariantSerializer(many=True, source='variant_set') identifier = serializers.HyperlinkedIdentityField( view_name='name:detail', lookup_field='name_id') class Meta: model = models.Name fields = ('authoritative_name', 'name_type', 'begin_date', 'end_date', 'identifier', 'links', 'notes', 'variants',) def get_name_type(self, obj): """Sets the name_type field. Returns the Name Type label, instead of the Name Type ID, which is the default behavior. """ return obj.get_name_type_label().lower() class NameSearchSerializer(serializers.ModelSerializer): """Name Model Serializer for the Name search/autocompletion endpoint. The following fields have been renamed for backwards compatibility with previous versions of the API. begin_date -> name.begin type -> name.get_name_type_label() label -> Formats name.name and name.disambiguation. The URL field is the absolute url to the name detail page for the model instance. """ begin_date = serializers.CharField(source='begin') type = serializers.SerializerMethodField() label = serializers.SerializerMethodField() URL = serializers.HyperlinkedIdentityField( view_name='name:detail', lookup_field='name_id') class Meta: model = models.Name fields = ('id', 'name', 'label', 'type', 'begin_date', 'disambiguation', 'URL') def get_type(self, obj): """Sets the type field. Returns the Name Type label, instead of the Name Type ID, which is the default behavior. """ return obj.get_name_type_label().lower() def get_label(self, obj): """Sets the label field. Returns a string in the form of "<name.name> (<name.disambiguation>)" """ if obj.disambiguation: return '{0} ({1})'.format(obj.name, obj.disambiguation) return obj.name class LocationSerializer(serializers.ModelSerializer): """Serailizer for the Locations Model. This includes the related Name via the belong_to_name field. The belong_to_name field uses the NameSerializer to nest the related Name model. """ belong_to_name = NameSerializer() class Meta: model = models.Location fields = '__all__' class NameStatisticsMonthSerializer(serializers.Serializer): """Serializer for the NameStatisticsMonth object.""" total = serializers.IntegerField() total_to_date = serializers.IntegerField() month = serializers.DateTimeField() class NameStatisticsTypeSerializer(serializers.Serializer): """Serializer for the NameStatisticsType object. This serializer utilizes the NameStatisticsTypeMonth to serialize the NameStatisticsMonth instances that the object instance contains. """ running_total = serializers.IntegerField() stats = NameStatisticsMonthSerializer(many=True) class NameStatisticsSerializer(serializers.Serializer): """Serializer for the NameStatistics object. This serializer utilizes the NameStatisticsTypeSerializer to serialize the NameStatisticsType instances that the object instance contains. """ created = NameStatisticsTypeSerializer() modified = NameStatisticsTypeSerializer() name_type_totals = serializers.DictField()
bsd-3-clause
-1,052,281,697,192,771,800
31.502618
78
0.6875
false
4.568065
false
false
false
mithron/opendatahack
web/main.py
1
1805
from datetime import datetime import json import os from urlparse import urlparse from pymongo.connection import Connection import tornado.httpserver import tornado.ioloop import tornado.options import tornado.web from tornado.options import define, options MONGO_URL = "" # found with $>heroku config we_live = True class Application(tornado.web.Application): def __init__(self): handlers = [ (r"/list/", MainHandler), (r"/([0-9]+)/", SchoolHandler) ] settings = dict( autoescape=None, ) tornado.web.Application.__init__(self, handlers, **settings) if we_live: self.con = Connection(MONGO_URL) self.database = self.con[urlparse(MONGO_URL).path[1:]] else: self.con = Connection('localhost', 27017) self.database = self.con["moscow"] class BaseHandler(tornado.web.RequestHandler): @property def db(self): return self.application.database class SchoolHandler(BaseHandler): def get(self, inn=None): if inn: suppliers = list(self.db["suppliers"].find({'inn': int(inn)}, fields={"_id": False})) self.write(json.dumps(suppliers, ensure_ascii=False, encoding='utf8')) else: self.write("[]") class MainHandler(BaseHandler): def get(self): schools = list(self.db["suppliers"].find(fields={"full_name": True, "inn": True, "_id": False})) self.write(json.dumps(schools, ensure_ascii=False, encoding='utf8')) def main(): tornado.options.parse_command_line() http_server = tornado.httpserver.HTTPServer(Application()) http_server.listen(int(os.environ.get("PORT", 8888))) tornado.ioloop.IOLoop.instance().start() if __name__ == "__main__": main()
mit
941,218,873,183,261,400
26.363636
104
0.628255
false
3.752599
false
false
false
CloudBoltSoftware/cloudbolt-forge
ui_extensions/veeam_admin_extension/restore_backup.py
1
1717
import requests import time from xml.dom import minidom from common.methods import set_progress from xui.veeam.veeam_admin import VeeamManager def run(server, *args, **kwargs): set_progress(f"Starting Veeam Backup restoration... ") veeam = VeeamManager() server_ci = veeam.get_connection_info() url = f'http://{server_ci.ip}:9399/api/vmRestorePoints/' + \ kwargs.get('restore_point_href') + '?action=restore' session_id = veeam.get_veeam_server_session_id() header = {"X-RestSvcSessionId": session_id} response = requests.post(url=url, headers=header) task = minidom.parseString(response.content.decode('utf-8')) items = task.getElementsByTagName('Task')[0].attributes.items() restoration_url = [item for item in items if item[0] == 'Href'][0][-1] def check_state(): response = requests.get(restoration_url, headers=header) dom = minidom.parseString(response.content.decode('utf-8')) state = dom.getElementsByTagName('State')[0] child = state.firstChild return child # Wait until the restoration to completed. while check_state().data == 'Running': # wait set_progress("Waiting for restoration to complete...") time.sleep(10) if check_state().data == 'Finished': set_progress("Server restoration completed successfully") return "SUCCESS", "Server restoration completed successfully", "" else: set_progress("Server restoration didn't complete successfully") return "FAILURE", "", "Server restoration didn't complete successfully"
apache-2.0
4,563,522,579,595,640,300
38.022727
83
0.630169
false
4.127404
false
false
false