{ // 获取包含Hugging Face文本的span元素 const spans = link.querySelectorAll('span.whitespace-nowrap, span.hidden.whitespace-nowrap'); spans.forEach(span => { if (span.textContent && span.textContent.trim().match(/Hugging\s*Face/i)) { span.textContent = 'AI快站'; } }); }); // 替换logo图片的alt属性 document.querySelectorAll('img[alt*="Hugging"], img[alt*="Face"]').forEach(img => { if (img.alt.match(/Hugging\s*Face/i)) { img.alt = 'AI快站 logo'; } }); } // 替换导航栏中的链接 function replaceNavigationLinks() { // 已替换标记,防止重复运行 if (window._navLinksReplaced) { return; } // 已经替换过的链接集合,防止重复替换 const replacedLinks = new Set(); // 只在导航栏区域查找和替换链接 const headerArea = document.querySelector('header') || document.querySelector('nav'); if (!headerArea) { return; } // 在导航区域内查找链接 const navLinks = headerArea.querySelectorAll('a'); navLinks.forEach(link => { // 如果已经替换过,跳过 if (replacedLinks.has(link)) return; const linkText = link.textContent.trim(); const linkHref = link.getAttribute('href') || ''; // 替换Spaces链接 - 仅替换一次 if ( (linkHref.includes('/spaces') || linkHref === '/spaces' || linkText === 'Spaces' || linkText.match(/^s*Spacess*$/i)) && linkText !== 'OCR模型免费转Markdown' && linkText !== 'OCR模型免费转Markdown' ) { link.textContent = 'OCR模型免费转Markdown'; link.href = 'https://fast360.xyz'; link.setAttribute('target', '_blank'); link.setAttribute('rel', 'noopener noreferrer'); replacedLinks.add(link); } // 删除Posts链接 else if ( (linkHref.includes('/posts') || linkHref === '/posts' || linkText === 'Posts' || linkText.match(/^s*Postss*$/i)) ) { if (link.parentNode) { link.parentNode.removeChild(link); } replacedLinks.add(link); } // 替换Docs链接 - 仅替换一次 else if ( (linkHref.includes('/docs') || linkHref === '/docs' || linkText === 'Docs' || linkText.match(/^s*Docss*$/i)) && linkText !== '模型下载攻略' ) { link.textContent = '模型下载攻略'; link.href = '/'; replacedLinks.add(link); } // 删除Enterprise链接 else if ( (linkHref.includes('/enterprise') || linkHref === '/enterprise' || linkText === 'Enterprise' || linkText.match(/^s*Enterprises*$/i)) ) { if (link.parentNode) { link.parentNode.removeChild(link); } replacedLinks.add(link); } }); // 查找可能嵌套的Spaces和Posts文本 const textNodes = []; function findTextNodes(element) { if (element.nodeType === Node.TEXT_NODE) { const text = element.textContent.trim(); if (text === 'Spaces' || text === 'Posts' || text === 'Enterprise') { textNodes.push(element); } } else { for (const child of element.childNodes) { findTextNodes(child); } } } // 只在导航区域内查找文本节点 findTextNodes(headerArea); // 替换找到的文本节点 textNodes.forEach(node => { const text = node.textContent.trim(); if (text === 'Spaces') { node.textContent = node.textContent.replace(/Spaces/g, 'OCR模型免费转Markdown'); } else if (text === 'Posts') { // 删除Posts文本节点 if (node.parentNode) { node.parentNode.removeChild(node); } } else if (text === 'Enterprise') { // 删除Enterprise文本节点 if (node.parentNode) { node.parentNode.removeChild(node); } } }); // 标记已替换完成 window._navLinksReplaced = true; } // 替换代码区域中的域名 function replaceCodeDomains() { // 特别处理span.hljs-string和span.njs-string元素 document.querySelectorAll('span.hljs-string, span.njs-string, span[class*="hljs-string"], span[class*="njs-string"]').forEach(span => { if (span.textContent && span.textContent.includes('huggingface.co')) { span.textContent = span.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 替换hljs-string类的span中的域名(移除多余的转义符号) document.querySelectorAll('span.hljs-string, span[class*="hljs-string"]').forEach(span => { if (span.textContent && span.textContent.includes('huggingface.co')) { span.textContent = span.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 替换pre和code标签中包含git clone命令的域名 document.querySelectorAll('pre, code').forEach(element => { if (element.textContent && element.textContent.includes('git clone')) { const text = element.innerHTML; if (text.includes('huggingface.co')) { element.innerHTML = text.replace(/huggingface.co/g, 'aifasthub.com'); } } }); // 处理特定的命令行示例 document.querySelectorAll('pre, code').forEach(element => { const text = element.innerHTML; if (text.includes('huggingface.co')) { // 针对git clone命令的专门处理 if (text.includes('git clone') || text.includes('GIT_LFS_SKIP_SMUDGE=1')) { element.innerHTML = text.replace(/huggingface.co/g, 'aifasthub.com'); } } }); // 特别处理模型下载页面上的代码片段 document.querySelectorAll('.flex.border-t, .svelte_hydrator, .inline-block').forEach(container => { const content = container.innerHTML; if (content && content.includes('huggingface.co')) { container.innerHTML = content.replace(/huggingface.co/g, 'aifasthub.com'); } }); // 特别处理模型仓库克隆对话框中的代码片段 try { // 查找包含"Clone this model repository"标题的对话框 const cloneDialog = document.querySelector('.svelte_hydration_boundary, [data-target="MainHeader"]'); if (cloneDialog) { // 查找对话框中所有的代码片段和命令示例 const codeElements = cloneDialog.querySelectorAll('pre, code, span'); codeElements.forEach(element => { if (element.textContent && element.textContent.includes('huggingface.co')) { if (element.innerHTML.includes('huggingface.co')) { element.innerHTML = element.innerHTML.replace(/huggingface.co/g, 'aifasthub.com'); } else { element.textContent = element.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } } }); } // 更精确地定位克隆命令中的域名 document.querySelectorAll('[data-target]').forEach(container => { const codeBlocks = container.querySelectorAll('pre, code, span.hljs-string'); codeBlocks.forEach(block => { if (block.textContent && block.textContent.includes('huggingface.co')) { if (block.innerHTML.includes('huggingface.co')) { block.innerHTML = block.innerHTML.replace(/huggingface.co/g, 'aifasthub.com'); } else { block.textContent = block.textContent.replace(/huggingface.co/g, 'aifasthub.com'); } } }); }); } catch (e) { // 错误处理但不打印日志 } } // 当DOM加载完成后执行替换 if (document.readyState === 'loading') { document.addEventListener('DOMContentLoaded', () => { replaceHeaderBranding(); replaceNavigationLinks(); replaceCodeDomains(); // 只在必要时执行替换 - 3秒后再次检查 setTimeout(() => { if (!window._navLinksReplaced) { console.log('[Client] 3秒后重新检查导航链接'); replaceNavigationLinks(); } }, 3000); }); } else { replaceHeaderBranding(); replaceNavigationLinks(); replaceCodeDomains(); // 只在必要时执行替换 - 3秒后再次检查 setTimeout(() => { if (!window._navLinksReplaced) { console.log('[Client] 3秒后重新检查导航链接'); replaceNavigationLinks(); } }, 3000); } // 增加一个MutationObserver来处理可能的动态元素加载 const observer = new MutationObserver(mutations => { // 检查是否导航区域有变化 const hasNavChanges = mutations.some(mutation => { // 检查是否存在header或nav元素变化 return Array.from(mutation.addedNodes).some(node => { if (node.nodeType === Node.ELEMENT_NODE) { // 检查是否是导航元素或其子元素 if (node.tagName === 'HEADER' || node.tagName === 'NAV' || node.querySelector('header, nav')) { return true; } // 检查是否在导航元素内部 let parent = node.parentElement; while (parent) { if (parent.tagName === 'HEADER' || parent.tagName === 'NAV') { return true; } parent = parent.parentElement; } } return false; }); }); // 只在导航区域有变化时执行替换 if (hasNavChanges) { // 重置替换状态,允许再次替换 window._navLinksReplaced = false; replaceHeaderBranding(); replaceNavigationLinks(); } }); // 开始观察document.body的变化,包括子节点 if (document.body) { observer.observe(document.body, { childList: true, subtree: true }); } else { document.addEventListener('DOMContentLoaded', () => { observer.observe(document.body, { childList: true, subtree: true }); }); } })(); \"\n id = st.getState()\n if id == CREATED :\n st.set(\"cond\",\"0\")\n if int(st.get(\"cond\"))==0 :\n if st.getPlayer().getLevel() >= 33 :\n htmltext = \"7437-02.htm\"\n else:\n htmltext = \"7437-01.htm\"\n st.exitQuest(1)\n else :\n heart=st.getQuestItemsCount(GOLEM_HEARTSTONE)\n broken=st.getQuestItemsCount(BROKEN_HEARTSTONE)\n if broken+heart>0 :\n st.giveItems(ADENA,50*broken+1000*heart)\n st.takeItems(BROKEN_HEARTSTONE,-1)\n st.takeItems(GOLEM_HEARTSTONE,-1)\n htmltext = \"7437-05.htm\"\n else:\n htmltext = \"7437-04.htm\"\n return htmltext\n\n def onKill (self,npc,st):\n npcId = npc.getNpcId()\n n = st.getRandom(100)\n if npcId == 85 :\n if n<5 :\n st.giveItems(GOLEM_HEARTSTONE,1)\n st.playSound(\"ItemSound.quest_itemget\")\n elif n<58 :\n st.giveItems(BROKEN_HEARTSTONE,1)\n st.playSound(\"ItemSound.quest_itemget\")\n elif npcId == 83 :\n if n<6 :\n st.giveItems(GOLEM_HEARTSTONE,1)\n st.playSound(\"ItemSound.quest_itemget\")\n elif n<56 :\n st.giveItems(BROKEN_HEARTSTONE,1)\n st.playSound(\"ItemSound.quest_itemget\")\n return\n\nQUEST = Quest(329,\"329_CuriosityOfDwarf\",\"Curiosity Of Dwarf\")\nCREATED = State('Start', QUEST)\nSTARTED = State('Started', QUEST)\nCOMPLETED = State('Completed', QUEST)\n\nQUEST.setInitialState(CREATED)\n\nQUEST.addStartNpc(7437)\nCREATED.addTalkId(7437)\nSTARTED.addTalkId(7437)\n\nSTARTED.addKillId(83)\nSTARTED.addKillId(85)\n\nSTARTED.addQuestDrop(85,BROKEN_HEARTSTONE,1)\nSTARTED.addQuestDrop(85,GOLEM_HEARTSTONE,1)\n\nprint \"importing quests: 329: Curiosity Of Dwarf\"\n"},"license":{"kind":"string","value":"gpl-2.0"},"hash":{"kind":"number","value":4741307329138383000,"string":"4,741,307,329,138,383,000"},"line_mean":{"kind":"number","value":27.9186046512,"string":"27.918605"},"line_max":{"kind":"number","value":74,"string":"74"},"alpha_frac":{"kind":"number","value":0.6509851226,"string":"0.650985"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":2.729967069154775,"string":"2.729967"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43851,"cells":{"repo_name":{"kind":"string","value":"skuda/client-python"},"path":{"kind":"string","value":"kubernetes/client/models/v1beta1_role_ref.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"4581"},"content":{"kind":"string","value":"# coding: utf-8\n\n\"\"\"\n Kubernetes\n\n No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen)\n\n OpenAPI spec version: v1.6.1\n \n Generated by: https://github.com/swagger-api/swagger-codegen.git\n\"\"\"\n\n\nfrom pprint import pformat\nfrom six import iteritems\nimport re\n\n\nclass V1beta1RoleRef(object):\n \"\"\"\n NOTE: This class is auto generated by the swagger code generator program.\n Do not edit the class manually.\n \"\"\"\n def __init__(self, api_group=None, kind=None, name=None):\n \"\"\"\n V1beta1RoleRef - a model defined in Swagger\n\n :param dict swaggerTypes: The key is attribute name\n and the value is attribute type.\n :param dict attributeMap: The key is attribute name\n and the value is json key in definition.\n \"\"\"\n self.swagger_types = {\n 'api_group': 'str',\n 'kind': 'str',\n 'name': 'str'\n }\n\n self.attribute_map = {\n 'api_group': 'apiGroup',\n 'kind': 'kind',\n 'name': 'name'\n }\n\n self._api_group = api_group\n self._kind = kind\n self._name = name\n\n @property\n def api_group(self):\n \"\"\"\n Gets the api_group of this V1beta1RoleRef.\n APIGroup is the group for the resource being referenced\n\n :return: The api_group of this V1beta1RoleRef.\n :rtype: str\n \"\"\"\n return self._api_group\n\n @api_group.setter\n def api_group(self, api_group):\n \"\"\"\n Sets the api_group of this V1beta1RoleRef.\n APIGroup is the group for the resource being referenced\n\n :param api_group: The api_group of this V1beta1RoleRef.\n :type: str\n \"\"\"\n if api_group is None:\n raise ValueError(\"Invalid value for `api_group`, must not be `None`\")\n\n self._api_group = api_group\n\n @property\n def kind(self):\n \"\"\"\n Gets the kind of this V1beta1RoleRef.\n Kind is the type of resource being referenced\n\n :return: The kind of this V1beta1RoleRef.\n :rtype: str\n \"\"\"\n return self._kind\n\n @kind.setter\n def kind(self, kind):\n \"\"\"\n Sets the kind of this V1beta1RoleRef.\n Kind is the type of resource being referenced\n\n :param kind: The kind of this V1beta1RoleRef.\n :type: str\n \"\"\"\n if kind is None:\n raise ValueError(\"Invalid value for `kind`, must not be `None`\")\n\n self._kind = kind\n\n @property\n def name(self):\n \"\"\"\n Gets the name of this V1beta1RoleRef.\n Name is the name of resource being referenced\n\n :return: The name of this V1beta1RoleRef.\n :rtype: str\n \"\"\"\n return self._name\n\n @name.setter\n def name(self, name):\n \"\"\"\n Sets the name of this V1beta1RoleRef.\n Name is the name of resource being referenced\n\n :param name: The name of this V1beta1RoleRef.\n :type: str\n \"\"\"\n if name is None:\n raise ValueError(\"Invalid value for `name`, must not be `None`\")\n\n self._name = name\n\n def to_dict(self):\n \"\"\"\n Returns the model properties as a dict\n \"\"\"\n result = {}\n\n for attr, _ in iteritems(self.swagger_types):\n value = getattr(self, attr)\n if isinstance(value, list):\n result[attr] = list(map(\n lambda x: x.to_dict() if hasattr(x, \"to_dict\") else x,\n value\n ))\n elif hasattr(value, \"to_dict\"):\n result[attr] = value.to_dict()\n elif isinstance(value, dict):\n result[attr] = dict(map(\n lambda item: (item[0], item[1].to_dict())\n if hasattr(item[1], \"to_dict\") else item,\n value.items()\n ))\n else:\n result[attr] = value\n\n return result\n\n def to_str(self):\n \"\"\"\n Returns the string representation of the model\n \"\"\"\n return pformat(self.to_dict())\n\n def __repr__(self):\n \"\"\"\n For `print` and `pprint`\n \"\"\"\n return self.to_str()\n\n def __eq__(self, other):\n \"\"\"\n Returns true if both objects are equal\n \"\"\"\n return self.__dict__ == other.__dict__\n\n def __ne__(self, other):\n \"\"\"\n Returns true if both objects are not equal\n \"\"\"\n return not self == other\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":-5183765010237596000,"string":"-5,183,765,010,237,596,000"},"line_mean":{"kind":"number","value":25.6337209302,"string":"25.633721"},"line_max":{"kind":"number","value":105,"string":"105"},"alpha_frac":{"kind":"number","value":0.5311067453,"string":"0.531107"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.237742830712303,"string":"4.237743"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43852,"cells":{"repo_name":{"kind":"string","value":"DarthMaulware/EquationGroupLeaks"},"path":{"kind":"string","value":"Leak #5 - Lost In Translation/windows/Resources/Python/Core/Lib/multiprocessing/queues.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"9842"},"content":{"kind":"string","value":"# uncompyle6 version 2.9.10\n# Python bytecode 2.7 (62211)\n# Decompiled from: Python 3.6.0b2 (default, Oct 11 2016, 05:27:10) \n# [GCC 6.2.0 20161005]\n# Embedded file name: queues.py\n__all__ = [\n 'Queue', 'SimpleQueue', 'JoinableQueue']\nimport sys\nimport os\nimport threading\nimport collections\nimport time\nimport atexit\nimport weakref\nfrom Queue import Empty, Full\nimport _multiprocessing\nfrom multiprocessing import Pipe\nfrom multiprocessing.synchronize import Lock, BoundedSemaphore, Semaphore, Condition\nfrom multiprocessing.util import debug, info, Finalize, register_after_fork\nfrom multiprocessing.forking import assert_spawning\n\nclass Queue(object):\n\n def __init__(self, maxsize=0):\n if maxsize <= 0:\n maxsize = _multiprocessing.SemLock.SEM_VALUE_MAX\n self._maxsize = maxsize\n self._reader, self._writer = Pipe(duplex=False)\n self._rlock = Lock()\n self._opid = os.getpid()\n if sys.platform == 'win32':\n self._wlock = None\n else:\n self._wlock = Lock()\n self._sem = BoundedSemaphore(maxsize)\n self._after_fork()\n if sys.platform != 'win32':\n register_after_fork(self, Queue._after_fork)\n return\n\n def __getstate__(self):\n assert_spawning(self)\n return (\n self._maxsize, self._reader, self._writer,\n self._rlock, self._wlock, self._sem, self._opid)\n\n def __setstate__(self, state):\n self._maxsize, self._reader, self._writer, self._rlock, self._wlock, self._sem, self._opid = state\n self._after_fork()\n\n def _after_fork(self):\n debug('Queue._after_fork()')\n self._notempty = threading.Condition(threading.Lock())\n self._buffer = collections.deque()\n self._thread = None\n self._jointhread = None\n self._joincancelled = False\n self._closed = False\n self._close = None\n self._send = self._writer.send\n self._recv = self._reader.recv\n self._poll = self._reader.poll\n return\n\n def put(self, obj, block=True, timeout=None):\n if not self._sem.acquire(block, timeout):\n raise Full\n self._notempty.acquire()\n try:\n if self._thread is None:\n self._start_thread()\n self._buffer.append(obj)\n self._notempty.notify()\n finally:\n self._notempty.release()\n\n return\n\n def get(self, block=True, timeout=None):\n if block and timeout is None:\n self._rlock.acquire()\n try:\n res = self._recv()\n self._sem.release()\n return res\n finally:\n self._rlock.release()\n\n else:\n if block:\n deadline = time.time() + timeout\n if not self._rlock.acquire(block, timeout):\n raise Empty\n try:\n if not self._poll(block and deadline - time.time() or 0.0):\n raise Empty\n res = self._recv()\n self._sem.release()\n return res\n finally:\n self._rlock.release()\n\n return\n\n def qsize(self):\n return self._maxsize - self._sem._semlock._get_value()\n\n def empty(self):\n return not self._poll()\n\n def full(self):\n return self._sem._semlock._is_zero()\n\n def get_nowait(self):\n return self.get(False)\n\n def put_nowait(self, obj):\n return self.put(obj, False)\n\n def close(self):\n self._closed = True\n self._reader.close()\n if self._close:\n self._close()\n\n def join_thread(self):\n debug('Queue.join_thread()')\n if self._jointhread:\n self._jointhread()\n\n def cancel_join_thread(self):\n debug('Queue.cancel_join_thread()')\n self._joincancelled = True\n try:\n self._jointhread.cancel()\n except AttributeError:\n pass\n\n def _start_thread(self):\n debug('Queue._start_thread()')\n self._buffer.clear()\n self._thread = threading.Thread(target=Queue._feed, args=(\n self._buffer, self._notempty, self._send,\n self._wlock, self._writer.close), name='QueueFeederThread')\n self._thread.daemon = True\n debug('doing self._thread.start()')\n self._thread.start()\n debug('... done self._thread.start()')\n created_by_this_process = self._opid == os.getpid()\n if not self._joincancelled and not created_by_this_process:\n self._jointhread = Finalize(self._thread, Queue._finalize_join, [\n weakref.ref(self._thread)], exitpriority=-5)\n self._close = Finalize(self, Queue._finalize_close, [\n self._buffer, self._notempty], exitpriority=10)\n\n @staticmethod\n def _finalize_join(twr):\n debug('joining queue thread')\n thread = twr()\n if thread is not None:\n thread.join()\n debug('... queue thread joined')\n else:\n debug('... queue thread already dead')\n return\n\n @staticmethod\n def _finalize_close(buffer, notempty):\n debug('telling queue thread to quit')\n notempty.acquire()\n try:\n buffer.append(_sentinel)\n notempty.notify()\n finally:\n notempty.release()\n\n @staticmethod\n def _feed(buffer, notempty, send, writelock, close):\n debug('starting thread to feed data to pipe')\n from .util import is_exiting\n nacquire = notempty.acquire\n nrelease = notempty.release\n nwait = notempty.wait\n bpopleft = buffer.popleft\n sentinel = _sentinel\n if sys.platform != 'win32':\n wacquire = writelock.acquire\n wrelease = writelock.release\n else:\n wacquire = None\n try:\n while 1:\n nacquire()\n try:\n if not buffer:\n nwait()\n finally:\n nrelease()\n\n try:\n while 1:\n obj = bpopleft()\n if obj is sentinel:\n debug('feeder thread got sentinel -- exiting')\n close()\n return\n if wacquire is None:\n send(obj)\n else:\n wacquire()\n try:\n send(obj)\n finally:\n wrelease()\n\n except IndexError:\n pass\n\n except Exception as e:\n try:\n if is_exiting():\n info('error in queue thread: %s', e)\n else:\n import traceback\n traceback.print_exc()\n except Exception:\n pass\n\n return\n\n\n_sentinel = object()\n\nclass JoinableQueue(Queue):\n\n def __init__(self, maxsize=0):\n Queue.__init__(self, maxsize)\n self._unfinished_tasks = Semaphore(0)\n self._cond = Condition()\n\n def __getstate__(self):\n return Queue.__getstate__(self) + (self._cond, self._unfinished_tasks)\n\n def __setstate__(self, state):\n Queue.__setstate__(self, state[:-2])\n self._cond, self._unfinished_tasks = state[-2:]\n\n def put(self, obj, block=True, timeout=None):\n if not self._sem.acquire(block, timeout):\n raise Full\n self._notempty.acquire()\n self._cond.acquire()\n try:\n if self._thread is None:\n self._start_thread()\n self._buffer.append(obj)\n self._unfinished_tasks.release()\n self._notempty.notify()\n finally:\n self._cond.release()\n self._notempty.release()\n\n return\n\n def task_done(self):\n self._cond.acquire()\n try:\n if not self._unfinished_tasks.acquire(False):\n raise ValueError('task_done() called too many times')\n if self._unfinished_tasks._semlock._is_zero():\n self._cond.notify_all()\n finally:\n self._cond.release()\n\n def join(self):\n self._cond.acquire()\n try:\n if not self._unfinished_tasks._semlock._is_zero():\n self._cond.wait()\n finally:\n self._cond.release()\n\n\nclass SimpleQueue(object):\n\n def __init__(self):\n self._reader, self._writer = Pipe(duplex=False)\n self._rlock = Lock()\n if sys.platform == 'win32':\n self._wlock = None\n else:\n self._wlock = Lock()\n self._make_methods()\n return\n\n def empty(self):\n return not self._reader.poll()\n\n def __getstate__(self):\n assert_spawning(self)\n return (\n self._reader, self._writer, self._rlock, self._wlock)\n\n def __setstate__(self, state):\n self._reader, self._writer, self._rlock, self._wlock = state\n self._make_methods()\n\n def _make_methods(self):\n recv = self._reader.recv\n racquire, rrelease = self._rlock.acquire, self._rlock.release\n\n def get():\n racquire()\n try:\n return recv()\n finally:\n rrelease()\n\n self.get = get\n if self._wlock is None:\n self.put = self._writer.send\n else:\n send = self._writer.send\n wacquire, wrelease = self._wlock.acquire, self._wlock.release\n\n def put(obj):\n wacquire()\n try:\n return send(obj)\n finally:\n wrelease()\n\n self.put = put\n return"},"license":{"kind":"string","value":"unlicense"},"hash":{"kind":"number","value":1957727825150317600,"string":"1,957,727,825,150,317,600"},"line_mean":{"kind":"number","value":28.4700598802,"string":"28.47006"},"line_max":{"kind":"number","value":106,"string":"106"},"alpha_frac":{"kind":"number","value":0.5175777281,"string":"0.517578"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.3567950420540065,"string":"4.356795"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43853,"cells":{"repo_name":{"kind":"string","value":"HackerEarth/django-allauth"},"path":{"kind":"string","value":"allauth/socialaccount/providers/twitter/views.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1820"},"content":{"kind":"string","value":"from django.utils import simplejson\n\nfrom allauth.socialaccount.providers.oauth.client import OAuth\nfrom allauth.socialaccount.providers.oauth.views import (OAuthAdapter,\n OAuthLoginView,\n OAuthCallbackView)\nfrom allauth.socialaccount.models import SocialLogin, SocialAccount\nfrom allauth.utils import get_user_model\n\nfrom provider import TwitterProvider\n\nUser = get_user_model()\n\nclass TwitterAPI(OAuth):\n \"\"\"\n Verifying twitter credentials\n \"\"\"\n url = 'https://api.twitter.com/1.1/account/verify_credentials.json'\n\n def get_user_info(self):\n user = simplejson.loads(self.query(self.url))\n return user\n\n\nclass TwitterOAuthAdapter(OAuthAdapter):\n provider_id = TwitterProvider.id\n request_token_url = 'https://api.twitter.com/oauth/request_token'\n access_token_url = 'https://api.twitter.com/oauth/access_token'\n # Issue #42 -- this one authenticates over and over again...\n # authorize_url = 'https://api.twitter.com/oauth/authorize'\n authorize_url = 'https://api.twitter.com/oauth/authenticate'\n\n def complete_login(self, request, app, token):\n client = TwitterAPI(request, app.key, app.secret,\n self.request_token_url)\n extra_data = client.get_user_info()\n uid = extra_data['id']\n user = User(username=extra_data['screen_name'])\n account = SocialAccount(user=user,\n uid=uid,\n provider=TwitterProvider.id,\n extra_data=extra_data)\n return SocialLogin(account)\n\n\noauth_login = OAuthLoginView.adapter_view(TwitterOAuthAdapter)\noauth_callback = OAuthCallbackView.adapter_view(TwitterOAuthAdapter)\n\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":985280656928123300,"string":"985,280,656,928,123,300"},"line_mean":{"kind":"number","value":36.9166666667,"string":"36.916667"},"line_max":{"kind":"number","value":75,"string":"75"},"alpha_frac":{"kind":"number","value":0.6368131868,"string":"0.636813"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.193548387096774,"string":"4.193548"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43854,"cells":{"repo_name":{"kind":"string","value":"skibaa/smart-sweeper"},"path":{"kind":"string","value":"game/dbext.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"2811"},"content":{"kind":"string","value":"import logging\nfrom google.appengine.ext import db\nfrom google.appengine.api import datastore_errors\nimport cPickle\n\nlogger=logging.getLogger(\"smartSweeper.dbext\")\n\nclass PickledProperty(db.Property):\n data_type = db.Blob\n\n def __init__(self, force_type=None, *args, **kw):\n self.force_type=force_type\n super(PickledProperty, self).__init__(*args, **kw)\n\n def validate(self, value):\n value = super(PickledProperty, self).validate(value)\n if value is not None and self.force_type and \\\n not isinstance(value, self.force_type):\n raise datastore_errors.BadValueError(\n 'Property %s must be of type \"%s\".' % (self.name,\n self.force_type))\n return value\n\n def get_value_for_datastore(self, model_instance):\n value = self.__get__(model_instance, model_instance.__class__)\n if value is not None:\n return db.Text(cPickle.dumps(value))\n\n def make_value_from_datastore(self, value):\n if value is not None:\n return cPickle.loads(str(value))\n\nclass CachedReferenceProperty(db.ReferenceProperty):\n\n def __property_config__(self, model_class, property_name):\n super(CachedReferenceProperty, self).__property_config__(model_class,\n property_name)\n #Just carelessly override what super made\n setattr(self.reference_class,\n self.collection_name,\n _CachedReverseReferenceProperty(model_class, property_name,\n self.collection_name))\n\nclass _CachedReverseReferenceProperty(db._ReverseReferenceProperty):\n\n def __init__(self, model, prop, collection_name):\n super(_CachedReverseReferenceProperty, self).__init__(model, prop)\n self.__prop=prop\n self.__collection_name = collection_name\n\n def __get__(self, model_instance, model_class):\n if model_instance is None:\n return self\n logger.debug(\"cached reverse trying\")\n if self.__collection_name in model_instance.__dict__:# why does it get here at all?\n return model_instance.__dict__[self.__collection_name]\n\n logger.info(\"cached reverse miss %s\",self.__collection_name)\n query=super(_CachedReverseReferenceProperty, self).__get__(model_instance,\n model_class)\n #replace the attribute on the instance\n res=[]\n for c in query:\n resolved_name='_RESOLVED_'+self.__prop #WARNING: using internal\n setattr(c, resolved_name, model_instance)\n res += [c]\n model_instance.__dict__[self.__collection_name]=res\n return res\n\n def __delete__ (self, model_instance):\n if model_instance is not None:\n del model_instance.__dict__[self.__collection_name]\n\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":-9060400630525390000,"string":"-9,060,400,630,525,390,000"},"line_mean":{"kind":"number","value":37.5068493151,"string":"37.506849"},"line_max":{"kind":"number","value":91,"string":"91"},"alpha_frac":{"kind":"number","value":0.6264674493,"string":"0.626467"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.291603053435114,"string":"4.291603"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43855,"cells":{"repo_name":{"kind":"string","value":"allynt/tings"},"path":{"kind":"string","value":"T/tings/views/api/views_api_users.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1138"},"content":{"kind":"string","value":"from rest_framework import generics, permissions\nfrom django.contrib.auth.models import User\n# from T.tings.models.models_users import TUserProfile\nfrom T.tings.serializers.serializers_users import TUserSerializer\n\n\nclass TUserPermission(permissions.BasePermission):\n \"\"\"\n Custom permission to only allow owners of an object to edit it.\n \"\"\"\n\n def has_object_permission(self, request, view, obj):\n # anybody can submit GET, HEAD or OPTIONS requests...\n if request.method in permissions.SAFE_METHODS:\n return True\n # only the admin or collection owners can submit PUT, POST, or DELETE requests...\n user = request.user\n return user.is_superuser or user == obj\n\n\nclass TUserList(generics.ListCreateAPIView):\n\n queryset = User.objects.all()\n serializer_class = TUserSerializer\n permission_classes = (permissions.IsAuthenticatedOrReadOnly, TUserPermission,)\n\n\nclass TUserDetail(generics.RetrieveUpdateDestroyAPIView):\n queryset = User.objects.all()\n serializer_class = TUserSerializer\n permission_classes = (permissions.IsAuthenticatedOrReadOnly, TUserPermission,)\n\n\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":8404409644057363000,"string":"8,404,409,644,057,363,000"},"line_mean":{"kind":"number","value":33.4848484848,"string":"33.484848"},"line_max":{"kind":"number","value":89,"string":"89"},"alpha_frac":{"kind":"number","value":0.7425307557,"string":"0.742531"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.428015564202335,"string":"4.428016"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43856,"cells":{"repo_name":{"kind":"string","value":"akx/gentry"},"path":{"kind":"string","value":"gore/api/handlers/store.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1862"},"content":{"kind":"string","value":"import base64\nimport json\nimport logging\nimport zlib\nfrom datetime import datetime\n\nfrom django.conf import settings\nfrom django.db import transaction\nfrom django.http import JsonResponse\nfrom django.utils.encoding import force_str\nfrom django.utils.timezone import make_aware\nfrom pytz import UTC\n\nfrom gore.auth import validate_auth_header\nfrom gore.excs import InvalidAuth\nfrom gore.models import Event\nfrom gore.signals import event_received\nfrom gore.utils.event_grouper import group_event\n\nlogger = logging.getLogger(__name__)\n\n\ndef store_event(request, project):\n try:\n auth_header = validate_auth_header(request, project)\n except InvalidAuth as ia:\n return JsonResponse({'error': str(ia)}, status=401)\n\n body = request.body\n if request.META.get('HTTP_CONTENT_ENCODING') == 'deflate':\n body = zlib.decompress(body)\n\n elif auth_header.get('sentry_version') == '5': # Support older versions of Raven\n body = zlib.decompress(base64.b64decode(body)).decode('utf8')\n\n body = json.loads(force_str(body))\n timestamp = make_aware(datetime.fromtimestamp(float(auth_header['sentry_timestamp'])), timezone=UTC)\n with transaction.atomic():\n event = Event.objects.create_from_raven(project_id=project, body=body, timestamp=timestamp)\n try:\n with transaction.atomic():\n group = group_event(event.project, event)\n group.archived = False\n group.cache_values()\n group.save()\n except: # pragma: no cover\n logger.warning('event with ID %s could not be grouped' % event.id, exc_info=True)\n try:\n event_received.send(sender=event)\n except: # pragma: no cover\n logger.warning('event_received signal handling failed', exc_info=True)\n if settings.DEBUG:\n raise\n return JsonResponse({'id': event.id}, status=201)\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":4651106081188272000,"string":"4,651,106,081,188,272,000"},"line_mean":{"kind":"number","value":33.4814814815,"string":"33.481481"},"line_max":{"kind":"number","value":104,"string":"104"},"alpha_frac":{"kind":"number","value":0.6970998926,"string":"0.6971"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.936575052854123,"string":"3.936575"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43857,"cells":{"repo_name":{"kind":"string","value":"django-stars/dash2011"},"path":{"kind":"string","value":"presence/apps/shout/views.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"2081"},"content":{"kind":"string","value":"import logging\nimport json\n\nfrom django.shortcuts import render_to_response\nfrom django.http import Http404\nfrom django.template import RequestContext\nfrom django.http import HttpResponse\nfrom django.http import HttpResponseRedirect\nfrom django.http import HttpResponseForbidden\nfrom django.shortcuts import redirect\nfrom django.contrib.auth.decorators import login_required\nfrom django.core.urlresolvers import reverse\nfrom django.conf import settings\nfrom django.utils.translation import ugettext_lazy as _\n\nfrom shout.models import Shout\nfrom shout.forms import ShoutForm\n\nlogger = logging.getLogger(\"presence.%s\" % __name__)\n\n@login_required\ndef shout_new(request):\n if request.method == \"POST\":\n form = ShoutForm(request.POST)\n if form.is_valid():\n shout = form.save(user=request.user)\n logger.info('New %s shout from \"%s\"' % (('public', 'private')[shout.is_private], shout.user.username))\n if request.is_ajax():\n return HttpResponse(json.dumps({'response': 'OK'}), mimetype='application/json')\n return HttpResponseRedirect(reverse('shout-list'))\n else:\n if request.is_ajax():\n return HttpResponse(json.dumps({'response': 'ERR', 'reason': 'Shout text is required!'}), mimetype='application/json')\n else:\n form = ShoutForm()\n \n data = {\n 'form': form,\n }\n return render_to_response('shout/new.html', data, RequestContext(request))\n\n\n@login_required\ndef shout_list(request):\n #custom manager to get non provat or privat but my\n shouts = Shout.objects.filter_for_user(user=request.user)\n\n data = {\n 'shouts': shouts,\n }\n return render_to_response('shout/list.html', data, RequestContext(request))\n\n\n@login_required\ndef shout_detail(request, shout_id):\n try:\n shout = Shout.objects.get_for_user(user=request.user, id=shout_id)\n except Shout.DoesNotExist:\n raise Http404\n \n data = {\n 'shout': shout,\n }\n return render_to_response('shout/detail.html', data, RequestContext(request))\n"},"license":{"kind":"string","value":"bsd-3-clause"},"hash":{"kind":"number","value":7593957745665859000,"string":"7,593,957,745,665,859,000"},"line_mean":{"kind":"number","value":31.515625,"string":"31.515625"},"line_max":{"kind":"number","value":134,"string":"134"},"alpha_frac":{"kind":"number","value":0.6828447862,"string":"0.682845"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.8824626865671643,"string":"3.882463"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43858,"cells":{"repo_name":{"kind":"string","value":"JaviMerino/lisa"},"path":{"kind":"string","value":"libs/utils/analysis/frequency_analysis.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"24894"},"content":{"kind":"string","value":"# SPDX-License-Identifier: Apache-2.0\n#\n# Copyright (C) 2015, ARM Limited and contributors.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\"); you may\n# not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS, WITHOUT\n# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n#\n\n\"\"\" Frequency Analysis Module \"\"\"\n\nimport matplotlib.gridspec as gridspec\nimport matplotlib.pyplot as plt\nimport pandas as pd\nimport pylab as pl\nimport operator\nfrom trappy.utils import listify\nfrom devlib.utils.misc import memoized\nfrom collections import namedtuple\n\nfrom analysis_module import AnalysisModule\n\n# Configure logging\nimport logging\n\nNON_IDLE_STATE = 4294967295\n\nResidencyTime = namedtuple('ResidencyTime', ['total', 'active'])\nResidencyData = namedtuple('ResidencyData', ['label', 'residency'])\n\n\nclass FrequencyAnalysis(AnalysisModule):\n \"\"\"\n Support for plotting Frequency Analysis data\n\n :param trace: input Trace object\n :type trace: :mod:`libs.utils.Trace`\n \"\"\"\n\n def __init__(self, trace):\n super(FrequencyAnalysis, self).__init__(trace)\n\n###############################################################################\n# DataFrame Getter Methods\n###############################################################################\n\n def _dfg_cpu_frequency_residency(self, cpu, total=True):\n \"\"\"\n Get per-CPU frequency residency, i.e. amount of\n time CPU `cpu` spent at each frequency.\n\n :param cpu: CPU ID\n :type cpu: int\n\n :param total: if true returns the \"total\" time, otherwise the \"active\"\n time is returned\n :type total: bool\n\n :returns: :mod:`pandas.DataFrame` - \"total\" or \"active\" time residency\n at each frequency.\n \"\"\"\n residency = self._getCPUFrequencyResidency(cpu)\n if not residency:\n return None\n if total:\n return residency.total\n return residency.active\n\n def _dfg_cluster_frequency_residency(self, cluster, total=True):\n \"\"\"\n Get per-Cluster frequency residency, i.e. amount of time CLUSTER\n `cluster` spent at each frequency.\n\n :param cluster: this can be either a single CPU ID or a list of CPU IDs\n belonging to a cluster or the cluster name as specified in the\n platform description\n :type cluster: str or int or list(int)\n\n :param total: if true returns the \"total\" time, otherwise the \"active\"\n time is returned\n :type total: bool\n\n :returns: :mod:`pandas.DataFrame` - \"total\" or \"active\" time residency\n at each frequency.\n \"\"\"\n residency = self._getClusterFrequencyResidency(cluster)\n if not residency:\n return None\n if total:\n return residency.total\n return residency.active\n\n\n###############################################################################\n# Plotting Methods\n###############################################################################\n\n def plotClusterFrequencies(self, title='Clusters Frequencies'):\n \"\"\"\n Plot frequency trend for all clusters. If sched_overutilized events are\n available, the plots will also show the intervals of time where the\n cluster was overutilized.\n\n :param title: user-defined plot title\n :type title: str\n \"\"\"\n if not self._trace.hasEvents('cpu_frequency'):\n logging.warn('Events [cpu_frequency] not found, plot DISABLED!')\n return\n df = self._dfg_trace_event('cpu_frequency')\n\n pd.options.mode.chained_assignment = None\n\n # Extract LITTLE and big clusters frequencies\n # and scale them to [MHz]\n if len(self._platform['clusters']['little']):\n lfreq = df[df.cpu == self._platform['clusters']['little'][-1]]\n lfreq['frequency'] = lfreq['frequency']/1e3\n else:\n lfreq = []\n if len(self._platform['clusters']['big']):\n bfreq = df[df.cpu == self._platform['clusters']['big'][-1]]\n bfreq['frequency'] = bfreq['frequency']/1e3\n else:\n bfreq = []\n\n # Compute AVG frequency for LITTLE cluster\n avg_lfreq = 0\n if len(lfreq) > 0:\n lfreq['timestamp'] = lfreq.index\n lfreq['delta'] = (lfreq['timestamp'] -lfreq['timestamp'].shift()).fillna(0).shift(-1)\n lfreq['cfreq'] = (lfreq['frequency'] * lfreq['delta']).fillna(0)\n timespan = lfreq.iloc[-1].timestamp - lfreq.iloc[0].timestamp\n avg_lfreq = lfreq['cfreq'].sum()/timespan\n\n # Compute AVG frequency for big cluster\n avg_bfreq = 0\n if len(bfreq) > 0:\n bfreq['timestamp'] = bfreq.index\n bfreq['delta'] = (bfreq['timestamp'] - bfreq['timestamp'].shift()).fillna(0).shift(-1)\n bfreq['cfreq'] = (bfreq['frequency'] * bfreq['delta']).fillna(0)\n timespan = bfreq.iloc[-1].timestamp - bfreq.iloc[0].timestamp\n avg_bfreq = bfreq['cfreq'].sum()/timespan\n\n pd.options.mode.chained_assignment = 'warn'\n\n # Setup a dual cluster plot\n fig, pltaxes = plt.subplots(2, 1, figsize=(16, 8))\n plt.suptitle(title, y=.97, fontsize=16, horizontalalignment='center')\n\n # Plot Cluster frequencies\n axes = pltaxes[0]\n axes.set_title('big Cluster')\n if avg_bfreq > 0:\n axes.axhline(avg_bfreq, color='r', linestyle='--', linewidth=2)\n axes.set_ylim(\n (self._platform['freqs']['big'][0] - 100000)/1e3,\n (self._platform['freqs']['big'][-1] + 100000)/1e3\n )\n if len(bfreq) > 0:\n bfreq['frequency'].plot(style=['r-'], ax=axes,\n drawstyle='steps-post', alpha=0.4)\n else:\n logging.warn('NO big CPUs frequency events to plot')\n axes.set_xlim(self._trace.x_min, self._trace.x_max)\n axes.set_ylabel('MHz')\n axes.grid(True)\n axes.set_xticklabels([])\n axes.set_xlabel('')\n self._trace.analysis.status.plotOverutilized(axes)\n\n axes = pltaxes[1]\n axes.set_title('LITTLE Cluster')\n if avg_lfreq > 0:\n axes.axhline(avg_lfreq, color='b', linestyle='--', linewidth=2)\n axes.set_ylim(\n (self._platform['freqs']['little'][0] - 100000)/1e3,\n (self._platform['freqs']['little'][-1] + 100000)/1e3\n )\n if len(lfreq) > 0:\n lfreq['frequency'].plot(style=['b-'], ax=axes,\n drawstyle='steps-post', alpha=0.4)\n else:\n logging.warn('NO LITTLE CPUs frequency events to plot')\n axes.set_xlim(self._trace.x_min, self._trace.x_max)\n axes.set_ylabel('MHz')\n axes.grid(True)\n self._trace.analysis.status.plotOverutilized(axes)\n\n # Save generated plots into datadir\n figname = '{}/{}cluster_freqs.png'\\\n .format(self._trace.plots_dir, self._trace.plots_prefix)\n pl.savefig(figname, bbox_inches='tight')\n\n logging.info('LITTLE cluster average frequency: %.3f GHz',\n avg_lfreq/1e3)\n logging.info('big cluster average frequency: %.3f GHz',\n avg_bfreq/1e3)\n\n return (avg_lfreq/1e3, avg_bfreq/1e3)\n\n def plotCPUFrequencyResidency(self, cpus=None, pct=False, active=False):\n \"\"\"\n Plot per-CPU frequency residency. big CPUs are plotted first and then\n LITTLEs.\n\n Requires the following trace events:\n - cpu_frequency\n - cpu_idle\n\n :param cpus: List of cpus. By default plot all CPUs\n :type cpus: list(str)\n\n :param pct: plot residencies in percentage\n :type pct: bool\n\n :param active: for percentage plot specify whether to plot active or\n total time. Default is TOTAL time\n :type active: bool\n \"\"\"\n if not self._trace.hasEvents('cpu_frequency'):\n logging.warn('Events [cpu_frequency] not found, plot DISABLED!')\n return\n if not self._trace.hasEvents('cpu_idle'):\n logging.warn('Events [cpu_idle] not found, plot DISABLED!')\n return\n\n if cpus is None:\n # Generate plots only for available CPUs\n cpufreq_data = self._dfg_trace_event('cpu_frequency')\n _cpus = range(cpufreq_data.cpu.max()+1)\n else:\n _cpus = listify(cpus)\n\n # Split between big and LITTLE CPUs ordered from higher to lower ID\n _cpus.reverse()\n big_cpus = [c for c in _cpus if c in self._platform['clusters']['big']]\n little_cpus = [c for c in _cpus if c in\n self._platform['clusters']['little']]\n _cpus = big_cpus + little_cpus\n\n # Precompute active and total time for each CPU\n residencies = []\n xmax = 0.0\n for cpu in _cpus:\n res = self._getCPUFrequencyResidency(cpu)\n residencies.append(ResidencyData('CPU{}'.format(cpu), res))\n\n max_time = res.total.max().values[0]\n if xmax < max_time:\n xmax = max_time\n\n self._plotFrequencyResidency(residencies, 'cpu', xmax, pct, active)\n\n def plotClusterFrequencyResidency(self, clusters=None,\n pct=False, active=False):\n \"\"\"\n Plot the frequency residency in a given cluster, i.e. the amount of\n time cluster `cluster` spent at frequency `f_i`. By default, both 'big'\n and 'LITTLE' clusters data are plotted.\n\n Requires the following trace events:\n - cpu_frequency\n - cpu_idle\n\n :param clusters: name of the clusters to be plotted (all of them by\n default)\n :type clusters: str ot list(str)\n\n :param pct: plot residencies in percentage\n :type pct: bool\n\n :param active: for percentage plot specify whether to plot active or\n total time. Default is TOTAL time\n :type active: bool\n \"\"\"\n if not self._trace.hasEvents('cpu_frequency'):\n logging.warn('Events [cpu_frequency] not found, plot DISABLED!')\n return\n if not self._trace.hasEvents('cpu_idle'):\n logging.warn('Events [cpu_idle] not found, plot DISABLED!')\n return\n\n # Assumption: all CPUs in a cluster run at the same frequency, i.e. the\n # frequency is scaled per-cluster not per-CPU. Hence, we can limit the\n # cluster frequencies data to a single CPU\n if not self._trace.freq_coherency:\n logging.warn('Cluster frequency is not coherent, plot DISABLED!')\n return\n\n # Sanitize clusters\n if clusters is None:\n _clusters = self._platform['clusters'].keys()\n else:\n _clusters = listify(clusters)\n\n # Precompute active and total time for each cluster\n residencies = []\n xmax = 0.0\n for cluster in _clusters:\n res = self._getClusterFrequencyResidency(\n self._platform['clusters'][cluster.lower()])\n residencies.append(ResidencyData('{} Cluster'.format(cluster),\n res))\n\n max_time = res.total.max().values[0]\n if xmax < max_time:\n xmax = max_time\n\n self._plotFrequencyResidency(residencies, 'cluster', xmax, pct, active)\n\n###############################################################################\n# Utility Methods\n###############################################################################\n\n @memoized\n def _getCPUActiveSignal(self, cpu):\n \"\"\"\n Build a square wave representing the active (i.e. non-idle) CPU time,\n i.e.:\n cpu_active[t] == 1 if at least one CPU is reported to be\n non-idle by CPUFreq at time t\n cpu_active[t] == 0 otherwise\n\n :param cpu: CPU ID\n :type cpu: int\n \"\"\"\n if not self._trace.hasEvents('cpu_idle'):\n logging.warn('Events [cpu_idle] not found, '\n 'cannot compute CPU active signal!')\n return None\n\n idle_df = self._dfg_trace_event('cpu_idle')\n cpu_df = idle_df[idle_df.cpu_id == cpu]\n\n cpu_active = cpu_df.state.apply(\n lambda s: 1 if s == NON_IDLE_STATE else 0\n )\n\n start_time = 0.0\n if not self._trace.ftrace.normalized_time:\n start_time = self._trace.ftrace.basetime\n if cpu_active.index[0] != start_time:\n entry_0 = pd.Series(cpu_active.iloc[0] ^ 1, index=[start_time])\n cpu_active = pd.concat([entry_0, cpu_active])\n\n return cpu_active\n\n @memoized\n def _getClusterActiveSignal(self, cluster):\n \"\"\"\n Build a square wave representing the active (i.e. non-idle) cluster\n time, i.e.:\n cluster_active[t] == 1 if at least one CPU is reported to be\n non-idle by CPUFreq at time t\n cluster_active[t] == 0 otherwise\n\n :param cluster: list of CPU IDs belonging to a cluster\n :type cluster: list(int)\n \"\"\"\n cpu_active = {}\n for cpu in cluster:\n cpu_active[cpu] = self._getCPUActiveSignal(cpu)\n\n active = pd.DataFrame(cpu_active)\n active.fillna(method='ffill', inplace=True)\n\n # Cluster active is the OR between the actives on each CPU\n # belonging to that specific cluster\n cluster_active = reduce(\n operator.or_,\n [cpu_active.astype(int) for _, cpu_active in\n active.iteritems()]\n )\n\n return cluster_active\n\n @memoized\n def _getClusterFrequencyResidency(self, cluster):\n \"\"\"\n Get a DataFrame with per cluster frequency residency, i.e. amount of\n time spent at a given frequency in each cluster.\n\n :param cluster: this can be either a single CPU ID or a list of CPU IDs\n belonging to a cluster or the cluster name as specified in the\n platform description\n :type cluster: str or int or list(int)\n\n :returns: namedtuple(ResidencyTime) - tuple of total and active time\n dataframes\n\n :raises: KeyError\n \"\"\"\n if not self._trace.hasEvents('cpu_frequency'):\n logging.warn('Events [cpu_frequency] not found, '\n 'frequency residency computation not possible!')\n return None\n if not self._trace.hasEvents('cpu_idle'):\n logging.warn('Events [cpu_idle] not found, '\n 'frequency residency computation not possible!')\n return None\n\n if isinstance(cluster, str):\n try:\n _cluster = self._platform['clusters'][cluster.lower()]\n except KeyError:\n logging.warn('%s cluster not found!', cluster)\n return None\n else:\n _cluster = listify(cluster)\n\n freq_df = self._dfg_trace_event('cpu_frequency')\n # Assumption: all CPUs in a cluster run at the same frequency, i.e. the\n # frequency is scaled per-cluster not per-CPU. Hence, we can limit the\n # cluster frequencies data to a single CPU. This assumption is verified\n # by the Trace module when parsing the trace.\n if len(_cluster) > 1 and not self._trace.freq_coherency:\n logging.warn('Cluster frequency is NOT coherent,'\n 'cannot compute residency!')\n return None\n cluster_freqs = freq_df[freq_df.cpu == _cluster[0]]\n\n # Compute TOTAL Time\n time_intervals = cluster_freqs.index[1:] - cluster_freqs.index[:-1]\n total_time = pd.DataFrame({\n 'time': time_intervals,\n 'frequency': [f/1000.0 for f in cluster_freqs.iloc[:-1].frequency]\n })\n total_time = total_time.groupby(['frequency']).sum()\n\n # Compute ACTIVE Time\n cluster_active = self._getClusterActiveSignal(_cluster)\n\n # In order to compute the active time spent at each frequency we\n # multiply 2 square waves:\n # - cluster_active, a square wave of the form:\n # cluster_active[t] == 1 if at least one CPU is reported to be\n # non-idle by CPUFreq at time t\n # cluster_active[t] == 0 otherwise\n # - freq_active, square wave of the form:\n # freq_active[t] == 1 if at time t the frequency is f\n # freq_active[t] == 0 otherwise\n available_freqs = sorted(cluster_freqs.frequency.unique())\n new_idx = sorted(cluster_freqs.index.tolist() +\n cluster_active.index.tolist())\n cluster_freqs = cluster_freqs.reindex(new_idx, method='ffill')\n cluster_active = cluster_active.reindex(new_idx, method='ffill')\n nonidle_time = []\n for f in available_freqs:\n freq_active = cluster_freqs.frequency.apply(\n lambda x: 1 if x == f else 0\n )\n active_t = cluster_active * freq_active\n # Compute total time by integrating the square wave\n nonidle_time.append(self._trace.integrate_square_wave(active_t))\n\n active_time = pd.DataFrame({'time': nonidle_time},\n index=[f/1000.0 for f in available_freqs])\n active_time.index.name = 'frequency'\n return ResidencyTime(total_time, active_time)\n\n def _getCPUFrequencyResidency(self, cpu):\n \"\"\"\n Get a DataFrame with per-CPU frequency residency, i.e. amount of\n time CPU `cpu` spent at each frequency. Both total and active times\n will be computed.\n\n :param cpu: CPU ID\n :type cpu: int\n\n :returns: namedtuple(ResidencyTime) - tuple of total and active time\n dataframes\n \"\"\"\n return self._getClusterFrequencyResidency(cpu)\n\n def _plotFrequencyResidencyAbs(self, axes, residency, n_plots,\n is_first, is_last, xmax, title=''):\n \"\"\"\n Private method to generate frequency residency plots.\n\n :param axes: axes over which to generate the plot\n :type axes: matplotlib.axes.Axes\n\n :param residency: tuple of total and active time dataframes\n :type residency: namedtuple(ResidencyTime)\n\n :param n_plots: total number of plots\n :type n_plots: int\n\n :param is_first: if True this is the first plot\n :type is_first: bool\n\n :param is_last: if True this is the last plot\n :type is_last: bool\n\n :param xmax: x-axes higher bound\n :param xmax: double\n\n :param title: title of this subplot\n :type title: str\n \"\"\"\n yrange = 0.4 * max(6, len(residency.total)) * n_plots\n residency.total.plot.barh(ax=axes, color='g',\n legend=False, figsize=(16, yrange))\n residency.active.plot.barh(ax=axes, color='r',\n legend=False, figsize=(16, yrange))\n\n axes.set_xlim(0, 1.05*xmax)\n axes.set_ylabel('Frequency [MHz]')\n axes.set_title(title)\n axes.grid(True)\n if is_last:\n axes.set_xlabel('Time [s]')\n else:\n axes.set_xticklabels([])\n\n if is_first:\n # Put title on top of the figure. As of now there is no clean way\n # to make the title appear always in the same position in the\n # figure because figure heights may vary between different\n # platforms (different number of OPPs). Hence, we use annotation\n legend_y = axes.get_ylim()[1]\n axes.annotate('OPP Residency Time', xy=(0, legend_y),\n xytext=(-50, 45), textcoords='offset points',\n fontsize=18)\n axes.annotate('GREEN: Total', xy=(0, legend_y),\n xytext=(-50, 25), textcoords='offset points',\n color='g', fontsize=14)\n axes.annotate('RED: Active', xy=(0, legend_y),\n xytext=(50, 25), textcoords='offset points',\n color='r', fontsize=14)\n\n def _plotFrequencyResidencyPct(self, axes, residency_df, label,\n n_plots, is_first, is_last, res_type):\n \"\"\"\n Private method to generate PERCENTAGE frequency residency plots.\n\n :param axes: axes over which to generate the plot\n :type axes: matplotlib.axes.Axes\n\n :param residency_df: residency time dataframe\n :type residency_df: :mod:`pandas.DataFrame`\n\n :param label: label to be used for percentage residency dataframe\n :type label: str\n\n :param n_plots: total number of plots\n :type n_plots: int\n\n :param is_first: if True this is the first plot\n :type is_first: bool\n\n :param is_first: if True this is the last plot\n :type is_first: bool\n\n :param res_type: type of residency, either TOTAL or ACTIVE\n :type title: str\n \"\"\"\n # Compute sum of the time intervals\n duration = residency_df.time.sum()\n residency_pct = pd.DataFrame(\n {label: residency_df.time.apply(lambda x: x*100/duration)},\n index=residency_df.index\n )\n yrange = 3 * n_plots\n residency_pct.T.plot.barh(ax=axes, stacked=True, figsize=(16, yrange))\n\n axes.legend(loc='lower center', ncol=7)\n axes.set_xlim(0, 100)\n axes.grid(True)\n if is_last:\n axes.set_xlabel('Residency [%]')\n else:\n axes.set_xticklabels([])\n if is_first:\n legend_y = axes.get_ylim()[1]\n axes.annotate('OPP {} Residency Time'.format(res_type),\n xy=(0, legend_y), xytext=(-50, 35),\n textcoords='offset points', fontsize=18)\n\n def _plotFrequencyResidency(self, residencies, entity_name, xmax,\n pct, active):\n \"\"\"\n Generate Frequency residency plots for the given entities.\n\n :param residencies:\n :type residencies: namedtuple(ResidencyData) - tuple containing:\n 1) as first element, a label to be used as subplot title\n 2) as second element, a namedtuple(ResidencyTime)\n\n :param entity_name: name of the entity ('cpu' or 'cluster') used in the\n figure name\n :type entity_name: str\n\n :param xmax: upper bound of x-axes\n :type xmax: double\n\n :param pct: plot residencies in percentage\n :type pct: bool\n\n :param active: for percentage plot specify whether to plot active or\n total time. Default is TOTAL time\n :type active: bool\n \"\"\"\n n_plots = len(residencies)\n gs = gridspec.GridSpec(n_plots, 1)\n fig = plt.figure()\n\n figtype = \"\"\n for idx, data in enumerate(residencies):\n if data.residency is None:\n plt.close(fig)\n return\n\n axes = fig.add_subplot(gs[idx])\n is_first = idx == 0\n is_last = idx+1 == n_plots\n if pct and active:\n self._plotFrequencyResidencyPct(axes, data.residency.active,\n data.label, n_plots,\n is_first, is_last,\n 'ACTIVE')\n figtype = \"_pct_active\"\n continue\n if pct:\n self._plotFrequencyResidencyPct(axes, data.residency.total,\n data.label, n_plots,\n is_first, is_last,\n 'TOTAL')\n figtype = \"_pct_total\"\n continue\n\n self._plotFrequencyResidencyAbs(axes, data.residency,\n n_plots, is_first,\n is_last, xmax,\n title=data.label)\n\n figname = '{}/{}{}_freq_residency{}.png'\\\n .format(self._trace.plots_dir,\n self._trace.plots_prefix,\n entity_name, figtype)\n pl.savefig(figname, bbox_inches='tight')\n\n# vim :set tabstop=4 shiftwidth=4 expandtab\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":-7015758231730057000,"string":"-7,015,758,231,730,057,000"},"line_mean":{"kind":"number","value":37.1809815951,"string":"37.180982"},"line_max":{"kind":"number","value":98,"string":"98"},"alpha_frac":{"kind":"number","value":0.5556760665,"string":"0.555676"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.189498485358465,"string":"4.189498"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43859,"cells":{"repo_name":{"kind":"string","value":"cburmeister/flask-bones"},"path":{"kind":"string","value":"app/commands.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1163"},"content":{"kind":"string","value":"from faker import Faker\nimport click\n\nfrom app.database import db\nfrom app.user.models import User\n\n\n@click.option('--num_users', default=5, help='Number of users.')\ndef populate_db(num_users):\n \"\"\"Populates the database with seed data.\"\"\"\n fake = Faker()\n users = []\n for _ in range(num_users):\n users.append(\n User(\n username=fake.user_name(),\n email=fake.email(),\n password=fake.word() + fake.word(),\n remote_addr=fake.ipv4()\n )\n )\n users.append(\n User(\n username='cburmeister',\n email='cburmeister@discogs.com',\n password='test123',\n remote_addr=fake.ipv4(),\n active=True,\n is_admin=True\n )\n )\n for user in users:\n db.session.add(user)\n db.session.commit()\n\n\ndef create_db():\n \"\"\"Creates the database.\"\"\"\n db.create_all()\n\n\ndef drop_db():\n \"\"\"Drops the database.\"\"\"\n if click.confirm('Are you sure?', abort=True):\n db.drop_all()\n\n\ndef recreate_db():\n \"\"\"Same as running drop_db() and create_db().\"\"\"\n drop_db()\n create_db()\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-36645924411596520,"string":"-36,645,924,411,596,520"},"line_mean":{"kind":"number","value":21.8039215686,"string":"21.803922"},"line_max":{"kind":"number","value":64,"string":"64"},"alpha_frac":{"kind":"number","value":0.5365434222,"string":"0.536543"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.788273615635179,"string":"3.788274"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43860,"cells":{"repo_name":{"kind":"string","value":"rbuffat/pyidf"},"path":{"kind":"string","value":"tests/test_shadingsite.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"2163"},"content":{"kind":"string","value":"import os\nimport tempfile\nimport unittest\nimport logging\nfrom pyidf import ValidationLevel\nimport pyidf\nfrom pyidf.idf import IDF\nfrom pyidf.thermal_zones_and_surfaces import ShadingSite\n\nlog = logging.getLogger(__name__)\n\nclass TestShadingSite(unittest.TestCase):\n\n def setUp(self):\n self.fd, self.path = tempfile.mkstemp()\n\n def tearDown(self):\n os.remove(self.path)\n\n def test_create_shadingsite(self):\n\n pyidf.validation_level = ValidationLevel.error\n\n obj = ShadingSite()\n # alpha\n var_name = \"Name\"\n obj.name = var_name\n # real\n var_azimuth_angle = 180.0\n obj.azimuth_angle = var_azimuth_angle\n # real\n var_tilt_angle = 90.0\n obj.tilt_angle = var_tilt_angle\n # real\n var_starting_x_coordinate = 4.4\n obj.starting_x_coordinate = var_starting_x_coordinate\n # real\n var_starting_y_coordinate = 5.5\n obj.starting_y_coordinate = var_starting_y_coordinate\n # real\n var_starting_z_coordinate = 6.6\n obj.starting_z_coordinate = var_starting_z_coordinate\n # real\n var_length = 7.7\n obj.length = var_length\n # real\n var_height = 8.8\n obj.height = var_height\n\n idf = IDF()\n idf.add(obj)\n idf.save(self.path, check=False)\n\n with open(self.path, mode='r') as f:\n for line in f:\n log.debug(line.strip())\n\n idf2 = IDF(self.path)\n self.assertEqual(idf2.shadingsites[0].name, var_name)\n self.assertAlmostEqual(idf2.shadingsites[0].azimuth_angle, var_azimuth_angle)\n self.assertAlmostEqual(idf2.shadingsites[0].tilt_angle, var_tilt_angle)\n self.assertAlmostEqual(idf2.shadingsites[0].starting_x_coordinate, var_starting_x_coordinate)\n self.assertAlmostEqual(idf2.shadingsites[0].starting_y_coordinate, var_starting_y_coordinate)\n self.assertAlmostEqual(idf2.shadingsites[0].starting_z_coordinate, var_starting_z_coordinate)\n self.assertAlmostEqual(idf2.shadingsites[0].length, var_length)\n self.assertAlmostEqual(idf2.shadingsites[0].height, var_height)"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":-7739266213189500000,"string":"-7,739,266,213,189,500,000"},"line_mean":{"kind":"number","value":31.7878787879,"string":"31.787879"},"line_max":{"kind":"number","value":101,"string":"101"},"alpha_frac":{"kind":"number","value":0.6458622284,"string":"0.645862"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.5811258278145695,"string":"3.581126"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43861,"cells":{"repo_name":{"kind":"string","value":"mitmedialab/MediaCloud-Web-Tools"},"path":{"kind":"string","value":"server/views/topics/topiccreate.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"3535"},"content":{"kind":"string","value":"import logging\nfrom flask import jsonify, request\nimport flask_login\nimport mediacloud.error\n\nfrom server import app, mc\nfrom server.auth import user_mediacloud_client\nfrom server.util.request import form_fields_required, api_error_handler, json_error_response, arguments_required\n\nfrom server.views.topics.topic import topic_summary\n\nlogger = logging.getLogger(__name__)\nVERSION_1 = 1\nCOLLECTION_US_TOP_ONLINE = 58722749\n\n\n@app.route('/api/topics/create', methods=['PUT'])\n@flask_login.login_required\n@form_fields_required('name', 'description', 'solr_seed_query', 'start_date', 'end_date')\n@api_error_handler\ndef topic_create():\n user_mc = user_mediacloud_client()\n name = request.form['name']\n description = request.form['description']\n solr_seed_query = request.form['solr_seed_query']\n start_date = request.form['start_date']\n end_date = request.form['end_date']\n optional_args = {\n 'max_iterations': request.form['max_iterations'] if 'max_iterations' in request.form and request.form['max_iterations'] != 'null' else None,\n 'max_stories': request.form['max_stories'] if 'max_stories' in request.form and request.form['max_stories'] != 'null' else flask_login.current_user.profile['limits']['max_topic_stories'],\n }\n try:\n topic_result = user_mc.topicCreate(name=name, description=description, solr_seed_query=solr_seed_query,\n start_date=start_date, end_date=end_date,\n media_tags_ids=[COLLECTION_US_TOP_ONLINE], # HACK: can't save without one of these in place (for now)\n **optional_args,\n )['topics'][0]\n topics_id = topic_result['topics_id']\n logger.info(\"Created new topic \\\"{}\\\" as {}\".format(name, topics_id))\n # if this includes any of the US-centric collections, add the retweet partisanship subtopic by default\n # client will either make a empty snapshot, or a spidering one\n return topic_summary(topics_id)\n except mediacloud.error.MCException as e:\n logging.error(\"Topic creation failed {}\".format(name))\n logging.exception(e)\n return json_error_response(e.message, e.status_code)\n except Exception as e:\n logging.error(\"Topic creation failed {}\".format(name))\n logging.exception(e)\n return json_error_response(str(e), 500)\n\n\n@app.route('/api/topics/name-exists', methods=['GET'])\n@flask_login.login_required\n@arguments_required('searchStr')\n@api_error_handler\ndef topic_name_exists():\n # Check if topic with name exists already\n # Have to do this in a unique method, instead of in topic_search because we need to use an admin connection\n # to media cloud to list all topics, but we don't want to return topics a user can't see to them.\n # :return: boolean indicating if topic with this name exists for not (case insensive check)\n search_str = request.args['searchStr']\n topics_id = int(request.args['topicId']) if 'topicId' in request.args else None\n matching_topics = mc.topicList(name=search_str, limit=15)\n if topics_id:\n matching_topic_names = [t['name'].lower().strip() for t in matching_topics['topics']\n if t['topics_id'] != topics_id]\n else:\n matching_topic_names = [t['name'].lower().strip() for t in matching_topics['topics']]\n name_in_use = search_str.lower() in matching_topic_names\n return jsonify({'nameInUse': name_in_use})\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":-6057934450072376000,"string":"-6,057,934,450,072,376,000"},"line_mean":{"kind":"number","value":48.7887323944,"string":"48.788732"},"line_max":{"kind":"number","value":195,"string":"195"},"alpha_frac":{"kind":"number","value":0.6602545969,"string":"0.660255"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.7486744432661716,"string":"3.748674"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43862,"cells":{"repo_name":{"kind":"string","value":"jeffsilverm/presentation"},"path":{"kind":"string","value":"whats_new_in_python_3.6/type_hints_complicated.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1308"},"content":{"kind":"string","value":"#! /usr/bin/python3.6\n# -*- coding: utf-8 -*-\nimport time\nimport sys\n\nassert sys.version_info.major == 3 and sys.version_info.minor == 6, \"Not running python 3.6, running {}\".format(\n sys.version_info)\n\n\nclass A(object):\n def __init__(self, instance_mark) -> None:\n self.instance_mark_A = instance_mark\n\n def af_A(self, input):\n return input * 2\n\n def afo_A(self, input):\n return input * 4\n\n\nclass AA(A):\n def __init__(self, instance_marker) -> None:\n super()\n self.instance_marker = instance_marker\n\n def aaf_AA(self, method_input):\n return method_input * 20\n\n def afo_A(self, method_input):\n return method_input ** 2\n\n\nclass B(object):\n def __init__(self):\n pass\n\n def bf_B(self, method_input):\n return method_input * 9\n\n\na = A(\"marker a\")\naa = AA(\"marker aa\")\n\nprint(\"a.af_A(4) \", a.af_A(4))\nprint(\"a.afo_A(4) \", a.afo_A(4))\nprint(\"aa.aaf_AA(4) \", aa.aaf_AA(4))\nprint(\"aa.afo_A(4) \", aa.afo_A(4))\n\nprint(\"a.af_A('4') \", a.af_A('4'))\nprint(\"a.afo_A('4') \", a.afo_A('4'))\nprint(\"aa.aaf_AA('4') \", aa.aaf_AA('4'), flush=True)\ntry:\n print(\"aa.afo_A('4') \", aa.afo_A('4'))\nexcept TypeError as t:\n time.sleep(1)\n print(\"Exception TypeError was raised, as expected, when calling aa.afo_A('4'))\", file=sys.stderr)\n"},"license":{"kind":"string","value":"gpl-2.0"},"hash":{"kind":"number","value":859038877987351700,"string":"859,038,877,987,351,700"},"line_mean":{"kind":"number","value":22.3571428571,"string":"22.357143"},"line_max":{"kind":"number","value":112,"string":"112"},"alpha_frac":{"kind":"number","value":0.5810397554,"string":"0.58104"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":2.730688935281837,"string":"2.730689"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43863,"cells":{"repo_name":{"kind":"string","value":"Crowdcomputer/CC"},"path":{"kind":"string","value":"crowdcomputer/init_db.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1613"},"content":{"kind":"string","value":"'''\nCreated on Nov 26, 2012\n\n@author: stefanotranquillini\n'''\n\nfrom django.contrib.auth.models import User, Group\nfrom rest_framework.authtoken.models import Token\nfrom general.models import Application\nfrom uuid import uuid4\n\ndef init():\n initAppsAndCC()\n\ndef initAppsAndCC():\n try:\n user, c = User.objects.get_or_create(username='crowdcomputer',email=\"crowdcomputer@gmail.com\",password=\"this.is.spam\")\n user.save()\n print \"%s %s\"%(user.username,c)\n app, c = Application.objects.get_or_create(name=\"crowdcomputer\",url=\"http://www.crowdcomputer.org\",user=user)\n if c:\n app.token=str(uuid4()).replace('-','')\n app.save()\n print \"%s %s\" %(app.name, app.token)\n\n app, c = Application.objects.get_or_create(name=\"bpmn\",url=\"http://www.crowdcomputer.org\",user=user)\n \n if c:\n app.token=str(uuid4()).replace('-','')\n print \"%s %s\" %(app.name, app.token)\n app.save()\n bpmn, c = Group.objects.get_or_create(name='bpmn')\n bpmn.save()\n except Exception, e:\n print e\n print 'exception' \n\ndef createAdmin(username,password,email):\n try:\n admin, c = User.objects.get_or_create(email=email)\n if c:\n admin.set_password(password)\n admin.username=username\n admin.is_superuser = True\n admin.is_staff = True\n admin.save()\n print 'creato'\n else:\n admin.set_password(password)\n admin.save()\n print 'aggiornato'\n except Exception:\n print 'exception'\n\n "},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":-2273612954416833300,"string":"-2,273,612,954,416,833,300"},"line_mean":{"kind":"number","value":28.3454545455,"string":"28.345455"},"line_max":{"kind":"number","value":126,"string":"126"},"alpha_frac":{"kind":"number","value":0.5889646621,"string":"0.588965"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.506521739130435,"string":"3.506522"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43864,"cells":{"repo_name":{"kind":"string","value":"DailyActie/Surrogate-Model"},"path":{"kind":"string","value":"01-codes/numpy-master/numpy/matrixlib/defmatrix.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"34262"},"content":{"kind":"string","value":"from __future__ import division, absolute_import, print_function\n\n__all__ = ['matrix', 'bmat', 'mat', 'asmatrix']\n\nimport sys\nimport numpy.core.numeric as N\nfrom numpy.core.numeric import concatenate, isscalar, binary_repr, identity, asanyarray\nfrom numpy.core.numerictypes import issubdtype\n\n# make translation table\n_numchars = '0123456789.-+jeEL'\n\nif sys.version_info[0] >= 3:\n class _NumCharTable:\n def __getitem__(self, i):\n if chr(i) in _numchars:\n return chr(i)\n else:\n return None\n\n\n _table = _NumCharTable()\n\n\n def _eval(astr):\n str_ = astr.translate(_table)\n if not str_:\n raise TypeError(\"Invalid data string supplied: \" + astr)\n else:\n return eval(str_)\n\nelse:\n _table = [None] * 256\n for k in range(256):\n _table[k] = chr(k)\n _table = ''.join(_table)\n\n _todelete = []\n for k in _table:\n if k not in _numchars:\n _todelete.append(k)\n _todelete = ''.join(_todelete)\n del k\n\n\n def _eval(astr):\n str_ = astr.translate(_table, _todelete)\n if not str_:\n raise TypeError(\"Invalid data string supplied: \" + astr)\n else:\n return eval(str_)\n\n\ndef _convert_from_string(data):\n rows = data.split(';')\n newdata = []\n count = 0\n for row in rows:\n trow = row.split(',')\n newrow = []\n for col in trow:\n temp = col.split()\n newrow.extend(map(_eval, temp))\n if count == 0:\n Ncols = len(newrow)\n elif len(newrow) != Ncols:\n raise ValueError(\"Rows not the same size.\")\n count += 1\n newdata.append(newrow)\n return newdata\n\n\ndef asmatrix(data, dtype=None):\n \"\"\"\n Interpret the input as a matrix.\n\n Unlike `matrix`, `asmatrix` does not make a copy if the input is already\n a matrix or an ndarray. Equivalent to ``matrix(data, copy=False)``.\n\n Parameters\n ----------\n data : array_like\n Input data.\n dtype : data-type\n Data-type of the output matrix.\n\n Returns\n -------\n mat : matrix\n `data` interpreted as a matrix.\n\n Examples\n --------\n >>> x = np.array([[1, 2], [3, 4]])\n\n >>> m = np.asmatrix(x)\n\n >>> x[0,0] = 5\n\n >>> m\n matrix([[5, 2],\n [3, 4]])\n\n \"\"\"\n return matrix(data, dtype=dtype, copy=False)\n\n\ndef matrix_power(M, n):\n \"\"\"\n Raise a square matrix to the (integer) power `n`.\n\n For positive integers `n`, the power is computed by repeated matrix\n squarings and matrix multiplications. If ``n == 0``, the identity matrix\n of the same shape as M is returned. If ``n < 0``, the inverse\n is computed and then raised to the ``abs(n)``.\n\n Parameters\n ----------\n M : ndarray or matrix object\n Matrix to be \"powered.\" Must be square, i.e. ``M.shape == (m, m)``,\n with `m` a positive integer.\n n : int\n The exponent can be any integer or long integer, positive,\n negative, or zero.\n\n Returns\n -------\n M**n : ndarray or matrix object\n The return value is the same shape and type as `M`;\n if the exponent is positive or zero then the type of the\n elements is the same as those of `M`. If the exponent is\n negative the elements are floating-point.\n\n Raises\n ------\n LinAlgError\n If the matrix is not numerically invertible.\n\n See Also\n --------\n matrix\n Provides an equivalent function as the exponentiation operator\n (``**``, not ``^``).\n\n Examples\n --------\n >>> from numpy import linalg as LA\n >>> i = np.array([[0, 1], [-1, 0]]) # matrix equiv. of the imaginary unit\n >>> LA.matrix_power(i, 3) # should = -i\n array([[ 0, -1],\n [ 1, 0]])\n >>> LA.matrix_power(np.matrix(i), 3) # matrix arg returns matrix\n matrix([[ 0, -1],\n [ 1, 0]])\n >>> LA.matrix_power(i, 0)\n array([[1, 0],\n [0, 1]])\n >>> LA.matrix_power(i, -3) # should = 1/(-i) = i, but w/ f.p. elements\n array([[ 0., 1.],\n [-1., 0.]])\n\n Somewhat more sophisticated example\n\n >>> q = np.zeros((4, 4))\n >>> q[0:2, 0:2] = -i\n >>> q[2:4, 2:4] = i\n >>> q # one of the three quaternion units not equal to 1\n array([[ 0., -1., 0., 0.],\n [ 1., 0., 0., 0.],\n [ 0., 0., 0., 1.],\n [ 0., 0., -1., 0.]])\n >>> LA.matrix_power(q, 2) # = -np.eye(4)\n array([[-1., 0., 0., 0.],\n [ 0., -1., 0., 0.],\n [ 0., 0., -1., 0.],\n [ 0., 0., 0., -1.]])\n\n \"\"\"\n M = asanyarray(M)\n if len(M.shape) != 2 or M.shape[0] != M.shape[1]:\n raise ValueError(\"input must be a square array\")\n if not issubdtype(type(n), int):\n raise TypeError(\"exponent must be an integer\")\n\n from numpy.linalg import inv\n\n if n == 0:\n M = M.copy()\n M[:] = identity(M.shape[0])\n return M\n elif n < 0:\n M = inv(M)\n n *= -1\n\n result = M\n if n <= 3:\n for _ in range(n - 1):\n result = N.dot(result, M)\n return result\n\n # binary decomposition to reduce the number of Matrix\n # multiplications for n > 3.\n beta = binary_repr(n)\n Z, q, t = M, 0, len(beta)\n while beta[t - q - 1] == '0':\n Z = N.dot(Z, Z)\n q += 1\n result = Z\n for k in range(q + 1, t):\n Z = N.dot(Z, Z)\n if beta[t - k - 1] == '1':\n result = N.dot(result, Z)\n return result\n\n\nclass matrix(N.ndarray):\n \"\"\"\n matrix(data, dtype=None, copy=True)\n\n Returns a matrix from an array-like object, or from a string of data.\n A matrix is a specialized 2-D array that retains its 2-D nature\n through operations. It has certain special operators, such as ``*``\n (matrix multiplication) and ``**`` (matrix power).\n\n Parameters\n ----------\n data : array_like or string\n If `data` is a string, it is interpreted as a matrix with commas\n or spaces separating columns, and semicolons separating rows.\n dtype : data-type\n Data-type of the output matrix.\n copy : bool\n If `data` is already an `ndarray`, then this flag determines\n whether the data is copied (the default), or whether a view is\n constructed.\n\n See Also\n --------\n array\n\n Examples\n --------\n >>> a = np.matrix('1 2; 3 4')\n >>> print(a)\n [[1 2]\n [3 4]]\n\n >>> np.matrix([[1, 2], [3, 4]])\n matrix([[1, 2],\n [3, 4]])\n\n \"\"\"\n __array_priority__ = 10.0\n\n def __new__(subtype, data, dtype=None, copy=True):\n if isinstance(data, matrix):\n dtype2 = data.dtype\n if (dtype is None):\n dtype = dtype2\n if (dtype2 == dtype) and (not copy):\n return data\n return data.astype(dtype)\n\n if isinstance(data, N.ndarray):\n if dtype is None:\n intype = data.dtype\n else:\n intype = N.dtype(dtype)\n new = data.view(subtype)\n if intype != data.dtype:\n return new.astype(intype)\n if copy:\n return new.copy()\n else:\n return new\n\n if isinstance(data, str):\n data = _convert_from_string(data)\n\n # now convert data to an array\n arr = N.array(data, dtype=dtype, copy=copy)\n ndim = arr.ndim\n shape = arr.shape\n if (ndim > 2):\n raise ValueError(\"matrix must be 2-dimensional\")\n elif ndim == 0:\n shape = (1, 1)\n elif ndim == 1:\n shape = (1, shape[0])\n\n order = 'C'\n if (ndim == 2) and arr.flags.fortran:\n order = 'F'\n\n if not (order or arr.flags.contiguous):\n arr = arr.copy()\n\n ret = N.ndarray.__new__(subtype, shape, arr.dtype,\n buffer=arr,\n order=order)\n return ret\n\n def __array_finalize__(self, obj):\n self._getitem = False\n if (isinstance(obj, matrix) and obj._getitem): return\n ndim = self.ndim\n if (ndim == 2):\n return\n if (ndim > 2):\n newshape = tuple([x for x in self.shape if x > 1])\n ndim = len(newshape)\n if ndim == 2:\n self.shape = newshape\n return\n elif (ndim > 2):\n raise ValueError(\"shape too large to be a matrix.\")\n else:\n newshape = self.shape\n if ndim == 0:\n self.shape = (1, 1)\n elif ndim == 1:\n self.shape = (1, newshape[0])\n return\n\n def __getitem__(self, index):\n self._getitem = True\n\n try:\n out = N.ndarray.__getitem__(self, index)\n finally:\n self._getitem = False\n\n if not isinstance(out, N.ndarray):\n return out\n\n if out.ndim == 0:\n return out[()]\n if out.ndim == 1:\n sh = out.shape[0]\n # Determine when we should have a column array\n try:\n n = len(index)\n except:\n n = 0\n if n > 1 and isscalar(index[1]):\n out.shape = (sh, 1)\n else:\n out.shape = (1, sh)\n return out\n\n def __mul__(self, other):\n if isinstance(other, (N.ndarray, list, tuple)):\n # This promotes 1-D vectors to row vectors\n return N.dot(self, asmatrix(other))\n if isscalar(other) or not hasattr(other, '__rmul__'):\n return N.dot(self, other)\n return NotImplemented\n\n def __rmul__(self, other):\n return N.dot(other, self)\n\n def __imul__(self, other):\n self[:] = self * other\n return self\n\n def __pow__(self, other):\n return matrix_power(self, other)\n\n def __ipow__(self, other):\n self[:] = self ** other\n return self\n\n def __rpow__(self, other):\n return NotImplemented\n\n def __repr__(self):\n s = repr(self.__array__()).replace('array', 'matrix')\n # now, 'matrix' has 6 letters, and 'array' 5, so the columns don't\n # line up anymore. We need to add a space.\n l = s.splitlines()\n for i in range(1, len(l)):\n if l[i]:\n l[i] = ' ' + l[i]\n return '\\n'.join(l)\n\n def __str__(self):\n return str(self.__array__())\n\n def _align(self, axis):\n \"\"\"A convenience function for operations that need to preserve axis\n orientation.\n \"\"\"\n if axis is None:\n return self[0, 0]\n elif axis == 0:\n return self\n elif axis == 1:\n return self.transpose()\n else:\n raise ValueError(\"unsupported axis\")\n\n def _collapse(self, axis):\n \"\"\"A convenience function for operations that want to collapse\n to a scalar like _align, but are using keepdims=True\n \"\"\"\n if axis is None:\n return self[0, 0]\n else:\n return self\n\n # Necessary because base-class tolist expects dimension\n # reduction by x[0]\n def tolist(self):\n \"\"\"\n Return the matrix as a (possibly nested) list.\n\n See `ndarray.tolist` for full documentation.\n\n See Also\n --------\n ndarray.tolist\n\n Examples\n --------\n >>> x = np.matrix(np.arange(12).reshape((3,4))); x\n matrix([[ 0, 1, 2, 3],\n [ 4, 5, 6, 7],\n [ 8, 9, 10, 11]])\n >>> x.tolist()\n [[0, 1, 2, 3], [4, 5, 6, 7], [8, 9, 10, 11]]\n\n \"\"\"\n return self.__array__().tolist()\n\n # To preserve orientation of result...\n def sum(self, axis=None, dtype=None, out=None):\n \"\"\"\n Returns the sum of the matrix elements, along the given axis.\n\n Refer to `numpy.sum` for full documentation.\n\n See Also\n --------\n numpy.sum\n\n Notes\n -----\n This is the same as `ndarray.sum`, except that where an `ndarray` would\n be returned, a `matrix` object is returned instead.\n\n Examples\n --------\n >>> x = np.matrix([[1, 2], [4, 3]])\n >>> x.sum()\n 10\n >>> x.sum(axis=1)\n matrix([[3],\n [7]])\n >>> x.sum(axis=1, dtype='float')\n matrix([[ 3.],\n [ 7.]])\n >>> out = np.zeros((1, 2), dtype='float')\n >>> x.sum(axis=1, dtype='float', out=out)\n matrix([[ 3.],\n [ 7.]])\n\n \"\"\"\n return N.ndarray.sum(self, axis, dtype, out, keepdims=True)._collapse(axis)\n\n # To update docstring from array to matrix...\n def squeeze(self, axis=None):\n \"\"\"\n Return a possibly reshaped matrix.\n\n Refer to `numpy.squeeze` for more documentation.\n\n Parameters\n ----------\n axis : None or int or tuple of ints, optional\n Selects a subset of the single-dimensional entries in the shape.\n If an axis is selected with shape entry greater than one,\n an error is raised.\n\n Returns\n -------\n squeezed : matrix\n The matrix, but as a (1, N) matrix if it had shape (N, 1).\n\n See Also\n --------\n numpy.squeeze : related function\n\n Notes\n -----\n If `m` has a single column then that column is returned\n as the single row of a matrix. Otherwise `m` is returned.\n The returned matrix is always either `m` itself or a view into `m`.\n Supplying an axis keyword argument will not affect the returned matrix\n but it may cause an error to be raised.\n\n Examples\n --------\n >>> c = np.matrix([[1], [2]])\n >>> c\n matrix([[1],\n [2]])\n >>> c.squeeze()\n matrix([[1, 2]])\n >>> r = c.T\n >>> r\n matrix([[1, 2]])\n >>> r.squeeze()\n matrix([[1, 2]])\n >>> m = np.matrix([[1, 2], [3, 4]])\n >>> m.squeeze()\n matrix([[1, 2],\n [3, 4]])\n\n \"\"\"\n return N.ndarray.squeeze(self, axis=axis)\n\n # To update docstring from array to matrix...\n def flatten(self, order='C'):\n \"\"\"\n Return a flattened copy of the matrix.\n\n All `N` elements of the matrix are placed into a single row.\n\n Parameters\n ----------\n order : {'C', 'F', 'A', 'K'}, optional\n 'C' means to flatten in row-major (C-style) order. 'F' means to\n flatten in column-major (Fortran-style) order. 'A' means to\n flatten in column-major order if `m` is Fortran *contiguous* in\n memory, row-major order otherwise. 'K' means to flatten `m` in\n the order the elements occur in memory. The default is 'C'.\n\n Returns\n -------\n y : matrix\n A copy of the matrix, flattened to a `(1, N)` matrix where `N`\n is the number of elements in the original matrix.\n\n See Also\n --------\n ravel : Return a flattened array.\n flat : A 1-D flat iterator over the matrix.\n\n Examples\n --------\n >>> m = np.matrix([[1,2], [3,4]])\n >>> m.flatten()\n matrix([[1, 2, 3, 4]])\n >>> m.flatten('F')\n matrix([[1, 3, 2, 4]])\n\n \"\"\"\n return N.ndarray.flatten(self, order=order)\n\n def mean(self, axis=None, dtype=None, out=None):\n \"\"\"\n Returns the average of the matrix elements along the given axis.\n\n Refer to `numpy.mean` for full documentation.\n\n See Also\n --------\n numpy.mean\n\n Notes\n -----\n Same as `ndarray.mean` except that, where that returns an `ndarray`,\n this returns a `matrix` object.\n\n Examples\n --------\n >>> x = np.matrix(np.arange(12).reshape((3, 4)))\n >>> x\n matrix([[ 0, 1, 2, 3],\n [ 4, 5, 6, 7],\n [ 8, 9, 10, 11]])\n >>> x.mean()\n 5.5\n >>> x.mean(0)\n matrix([[ 4., 5., 6., 7.]])\n >>> x.mean(1)\n matrix([[ 1.5],\n [ 5.5],\n [ 9.5]])\n\n \"\"\"\n return N.ndarray.mean(self, axis, dtype, out, keepdims=True)._collapse(axis)\n\n def std(self, axis=None, dtype=None, out=None, ddof=0):\n \"\"\"\n Return the standard deviation of the array elements along the given axis.\n\n Refer to `numpy.std` for full documentation.\n\n See Also\n --------\n numpy.std\n\n Notes\n -----\n This is the same as `ndarray.std`, except that where an `ndarray` would\n be returned, a `matrix` object is returned instead.\n\n Examples\n --------\n >>> x = np.matrix(np.arange(12).reshape((3, 4)))\n >>> x\n matrix([[ 0, 1, 2, 3],\n [ 4, 5, 6, 7],\n [ 8, 9, 10, 11]])\n >>> x.std()\n 3.4520525295346629\n >>> x.std(0)\n matrix([[ 3.26598632, 3.26598632, 3.26598632, 3.26598632]])\n >>> x.std(1)\n matrix([[ 1.11803399],\n [ 1.11803399],\n [ 1.11803399]])\n\n \"\"\"\n return N.ndarray.std(self, axis, dtype, out, ddof, keepdims=True)._collapse(axis)\n\n def var(self, axis=None, dtype=None, out=None, ddof=0):\n \"\"\"\n Returns the variance of the matrix elements, along the given axis.\n\n Refer to `numpy.var` for full documentation.\n\n See Also\n --------\n numpy.var\n\n Notes\n -----\n This is the same as `ndarray.var`, except that where an `ndarray` would\n be returned, a `matrix` object is returned instead.\n\n Examples\n --------\n >>> x = np.matrix(np.arange(12).reshape((3, 4)))\n >>> x\n matrix([[ 0, 1, 2, 3],\n [ 4, 5, 6, 7],\n [ 8, 9, 10, 11]])\n >>> x.var()\n 11.916666666666666\n >>> x.var(0)\n matrix([[ 10.66666667, 10.66666667, 10.66666667, 10.66666667]])\n >>> x.var(1)\n matrix([[ 1.25],\n [ 1.25],\n [ 1.25]])\n\n \"\"\"\n return N.ndarray.var(self, axis, dtype, out, ddof, keepdims=True)._collapse(axis)\n\n def prod(self, axis=None, dtype=None, out=None):\n \"\"\"\n Return the product of the array elements over the given axis.\n\n Refer to `prod` for full documentation.\n\n See Also\n --------\n prod, ndarray.prod\n\n Notes\n -----\n Same as `ndarray.prod`, except, where that returns an `ndarray`, this\n returns a `matrix` object instead.\n\n Examples\n --------\n >>> x = np.matrix(np.arange(12).reshape((3,4))); x\n matrix([[ 0, 1, 2, 3],\n [ 4, 5, 6, 7],\n [ 8, 9, 10, 11]])\n >>> x.prod()\n 0\n >>> x.prod(0)\n matrix([[ 0, 45, 120, 231]])\n >>> x.prod(1)\n matrix([[ 0],\n [ 840],\n [7920]])\n\n \"\"\"\n return N.ndarray.prod(self, axis, dtype, out, keepdims=True)._collapse(axis)\n\n def any(self, axis=None, out=None):\n \"\"\"\n Test whether any array element along a given axis evaluates to True.\n\n Refer to `numpy.any` for full documentation.\n\n Parameters\n ----------\n axis : int, optional\n Axis along which logical OR is performed\n out : ndarray, optional\n Output to existing array instead of creating new one, must have\n same shape as expected output\n\n Returns\n -------\n any : bool, ndarray\n Returns a single bool if `axis` is ``None``; otherwise,\n returns `ndarray`\n\n \"\"\"\n return N.ndarray.any(self, axis, out, keepdims=True)._collapse(axis)\n\n def all(self, axis=None, out=None):\n \"\"\"\n Test whether all matrix elements along a given axis evaluate to True.\n\n Parameters\n ----------\n See `numpy.all` for complete descriptions\n\n See Also\n --------\n numpy.all\n\n Notes\n -----\n This is the same as `ndarray.all`, but it returns a `matrix` object.\n\n Examples\n --------\n >>> x = np.matrix(np.arange(12).reshape((3,4))); x\n matrix([[ 0, 1, 2, 3],\n [ 4, 5, 6, 7],\n [ 8, 9, 10, 11]])\n >>> y = x[0]; y\n matrix([[0, 1, 2, 3]])\n >>> (x == y)\n matrix([[ True, True, True, True],\n [False, False, False, False],\n [False, False, False, False]], dtype=bool)\n >>> (x == y).all()\n False\n >>> (x == y).all(0)\n matrix([[False, False, False, False]], dtype=bool)\n >>> (x == y).all(1)\n matrix([[ True],\n [False],\n [False]], dtype=bool)\n\n \"\"\"\n return N.ndarray.all(self, axis, out, keepdims=True)._collapse(axis)\n\n def max(self, axis=None, out=None):\n \"\"\"\n Return the maximum value along an axis.\n\n Parameters\n ----------\n See `amax` for complete descriptions\n\n See Also\n --------\n amax, ndarray.max\n\n Notes\n -----\n This is the same as `ndarray.max`, but returns a `matrix` object\n where `ndarray.max` would return an ndarray.\n\n Examples\n --------\n >>> x = np.matrix(np.arange(12).reshape((3,4))); x\n matrix([[ 0, 1, 2, 3],\n [ 4, 5, 6, 7],\n [ 8, 9, 10, 11]])\n >>> x.max()\n 11\n >>> x.max(0)\n matrix([[ 8, 9, 10, 11]])\n >>> x.max(1)\n matrix([[ 3],\n [ 7],\n [11]])\n\n \"\"\"\n return N.ndarray.max(self, axis, out, keepdims=True)._collapse(axis)\n\n def argmax(self, axis=None, out=None):\n \"\"\"\n Indexes of the maximum values along an axis.\n\n Return the indexes of the first occurrences of the maximum values\n along the specified axis. If axis is None, the index is for the\n flattened matrix.\n\n Parameters\n ----------\n See `numpy.argmax` for complete descriptions\n\n See Also\n --------\n numpy.argmax\n\n Notes\n -----\n This is the same as `ndarray.argmax`, but returns a `matrix` object\n where `ndarray.argmax` would return an `ndarray`.\n\n Examples\n --------\n >>> x = np.matrix(np.arange(12).reshape((3,4))); x\n matrix([[ 0, 1, 2, 3],\n [ 4, 5, 6, 7],\n [ 8, 9, 10, 11]])\n >>> x.argmax()\n 11\n >>> x.argmax(0)\n matrix([[2, 2, 2, 2]])\n >>> x.argmax(1)\n matrix([[3],\n [3],\n [3]])\n\n \"\"\"\n return N.ndarray.argmax(self, axis, out)._align(axis)\n\n def min(self, axis=None, out=None):\n \"\"\"\n Return the minimum value along an axis.\n\n Parameters\n ----------\n See `amin` for complete descriptions.\n\n See Also\n --------\n amin, ndarray.min\n\n Notes\n -----\n This is the same as `ndarray.min`, but returns a `matrix` object\n where `ndarray.min` would return an ndarray.\n\n Examples\n --------\n >>> x = -np.matrix(np.arange(12).reshape((3,4))); x\n matrix([[ 0, -1, -2, -3],\n [ -4, -5, -6, -7],\n [ -8, -9, -10, -11]])\n >>> x.min()\n -11\n >>> x.min(0)\n matrix([[ -8, -9, -10, -11]])\n >>> x.min(1)\n matrix([[ -3],\n [ -7],\n [-11]])\n\n \"\"\"\n return N.ndarray.min(self, axis, out, keepdims=True)._collapse(axis)\n\n def argmin(self, axis=None, out=None):\n \"\"\"\n Indexes of the minimum values along an axis.\n\n Return the indexes of the first occurrences of the minimum values\n along the specified axis. If axis is None, the index is for the\n flattened matrix.\n\n Parameters\n ----------\n See `numpy.argmin` for complete descriptions.\n\n See Also\n --------\n numpy.argmin\n\n Notes\n -----\n This is the same as `ndarray.argmin`, but returns a `matrix` object\n where `ndarray.argmin` would return an `ndarray`.\n\n Examples\n --------\n >>> x = -np.matrix(np.arange(12).reshape((3,4))); x\n matrix([[ 0, -1, -2, -3],\n [ -4, -5, -6, -7],\n [ -8, -9, -10, -11]])\n >>> x.argmin()\n 11\n >>> x.argmin(0)\n matrix([[2, 2, 2, 2]])\n >>> x.argmin(1)\n matrix([[3],\n [3],\n [3]])\n\n \"\"\"\n return N.ndarray.argmin(self, axis, out)._align(axis)\n\n def ptp(self, axis=None, out=None):\n \"\"\"\n Peak-to-peak (maximum - minimum) value along the given axis.\n\n Refer to `numpy.ptp` for full documentation.\n\n See Also\n --------\n numpy.ptp\n\n Notes\n -----\n Same as `ndarray.ptp`, except, where that would return an `ndarray` object,\n this returns a `matrix` object.\n\n Examples\n --------\n >>> x = np.matrix(np.arange(12).reshape((3,4))); x\n matrix([[ 0, 1, 2, 3],\n [ 4, 5, 6, 7],\n [ 8, 9, 10, 11]])\n >>> x.ptp()\n 11\n >>> x.ptp(0)\n matrix([[8, 8, 8, 8]])\n >>> x.ptp(1)\n matrix([[3],\n [3],\n [3]])\n\n \"\"\"\n return N.ndarray.ptp(self, axis, out)._align(axis)\n\n def getI(self):\n \"\"\"\n Returns the (multiplicative) inverse of invertible `self`.\n\n Parameters\n ----------\n None\n\n Returns\n -------\n ret : matrix object\n If `self` is non-singular, `ret` is such that ``ret * self`` ==\n ``self * ret`` == ``np.matrix(np.eye(self[0,:].size)`` all return\n ``True``.\n\n Raises\n ------\n numpy.linalg.LinAlgError: Singular matrix\n If `self` is singular.\n\n See Also\n --------\n linalg.inv\n\n Examples\n --------\n >>> m = np.matrix('[1, 2; 3, 4]'); m\n matrix([[1, 2],\n [3, 4]])\n >>> m.getI()\n matrix([[-2. , 1. ],\n [ 1.5, -0.5]])\n >>> m.getI() * m\n matrix([[ 1., 0.],\n [ 0., 1.]])\n\n \"\"\"\n M, N = self.shape\n if M == N:\n from numpy.dual import inv as func\n else:\n from numpy.dual import pinv as func\n return asmatrix(func(self))\n\n def getA(self):\n \"\"\"\n Return `self` as an `ndarray` object.\n\n Equivalent to ``np.asarray(self)``.\n\n Parameters\n ----------\n None\n\n Returns\n -------\n ret : ndarray\n `self` as an `ndarray`\n\n Examples\n --------\n >>> x = np.matrix(np.arange(12).reshape((3,4))); x\n matrix([[ 0, 1, 2, 3],\n [ 4, 5, 6, 7],\n [ 8, 9, 10, 11]])\n >>> x.getA()\n array([[ 0, 1, 2, 3],\n [ 4, 5, 6, 7],\n [ 8, 9, 10, 11]])\n\n \"\"\"\n return self.__array__()\n\n def getA1(self):\n \"\"\"\n Return `self` as a flattened `ndarray`.\n\n Equivalent to ``np.asarray(x).ravel()``\n\n Parameters\n ----------\n None\n\n Returns\n -------\n ret : ndarray\n `self`, 1-D, as an `ndarray`\n\n Examples\n --------\n >>> x = np.matrix(np.arange(12).reshape((3,4))); x\n matrix([[ 0, 1, 2, 3],\n [ 4, 5, 6, 7],\n [ 8, 9, 10, 11]])\n >>> x.getA1()\n array([ 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11])\n\n \"\"\"\n return self.__array__().ravel()\n\n def ravel(self, order='C'):\n \"\"\"\n Return a flattened matrix.\n\n Refer to `numpy.ravel` for more documentation.\n\n Parameters\n ----------\n order : {'C', 'F', 'A', 'K'}, optional\n The elements of `m` are read using this index order. 'C' means to\n index the elements in C-like order, with the last axis index\n changing fastest, back to the first axis index changing slowest.\n 'F' means to index the elements in Fortran-like index order, with\n the first index changing fastest, and the last index changing\n slowest. Note that the 'C' and 'F' options take no account of the\n memory layout of the underlying array, and only refer to the order\n of axis indexing. 'A' means to read the elements in Fortran-like\n index order if `m` is Fortran *contiguous* in memory, C-like order\n otherwise. 'K' means to read the elements in the order they occur\n in memory, except for reversing the data when strides are negative.\n By default, 'C' index order is used.\n\n Returns\n -------\n ret : matrix\n Return the matrix flattened to shape `(1, N)` where `N`\n is the number of elements in the original matrix.\n A copy is made only if necessary.\n\n See Also\n --------\n matrix.flatten : returns a similar output matrix but always a copy\n matrix.flat : a flat iterator on the array.\n numpy.ravel : related function which returns an ndarray\n\n \"\"\"\n return N.ndarray.ravel(self, order=order)\n\n def getT(self):\n \"\"\"\n Returns the transpose of the matrix.\n\n Does *not* conjugate! For the complex conjugate transpose, use ``.H``.\n\n Parameters\n ----------\n None\n\n Returns\n -------\n ret : matrix object\n The (non-conjugated) transpose of the matrix.\n\n See Also\n --------\n transpose, getH\n\n Examples\n --------\n >>> m = np.matrix('[1, 2; 3, 4]')\n >>> m\n matrix([[1, 2],\n [3, 4]])\n >>> m.getT()\n matrix([[1, 3],\n [2, 4]])\n\n \"\"\"\n return self.transpose()\n\n def getH(self):\n \"\"\"\n Returns the (complex) conjugate transpose of `self`.\n\n Equivalent to ``np.transpose(self)`` if `self` is real-valued.\n\n Parameters\n ----------\n None\n\n Returns\n -------\n ret : matrix object\n complex conjugate transpose of `self`\n\n Examples\n --------\n >>> x = np.matrix(np.arange(12).reshape((3,4)))\n >>> z = x - 1j*x; z\n matrix([[ 0. +0.j, 1. -1.j, 2. -2.j, 3. -3.j],\n [ 4. -4.j, 5. -5.j, 6. -6.j, 7. -7.j],\n [ 8. -8.j, 9. -9.j, 10.-10.j, 11.-11.j]])\n >>> z.getH()\n matrix([[ 0. +0.j, 4. +4.j, 8. +8.j],\n [ 1. +1.j, 5. +5.j, 9. +9.j],\n [ 2. +2.j, 6. +6.j, 10.+10.j],\n [ 3. +3.j, 7. +7.j, 11.+11.j]])\n\n \"\"\"\n if issubclass(self.dtype.type, N.complexfloating):\n return self.transpose().conjugate()\n else:\n return self.transpose()\n\n T = property(getT, None)\n A = property(getA, None)\n A1 = property(getA1, None)\n H = property(getH, None)\n I = property(getI, None)\n\n\ndef _from_string(str, gdict, ldict):\n rows = str.split(';')\n rowtup = []\n for row in rows:\n trow = row.split(',')\n newrow = []\n for x in trow:\n newrow.extend(x.split())\n trow = newrow\n coltup = []\n for col in trow:\n col = col.strip()\n try:\n thismat = ldict[col]\n except KeyError:\n try:\n thismat = gdict[col]\n except KeyError:\n raise KeyError(\"%s not found\" % (col,))\n\n coltup.append(thismat)\n rowtup.append(concatenate(coltup, axis=-1))\n return concatenate(rowtup, axis=0)\n\n\ndef bmat(obj, ldict=None, gdict=None):\n \"\"\"\n Build a matrix object from a string, nested sequence, or array.\n\n Parameters\n ----------\n obj : str or array_like\n Input data. Names of variables in the current scope may be\n referenced, even if `obj` is a string.\n ldict : dict, optional\n A dictionary that replaces local operands in current frame.\n Ignored if `obj` is not a string or `gdict` is `None`.\n gdict : dict, optional\n A dictionary that replaces global operands in current frame.\n Ignored if `obj` is not a string.\n\n Returns\n -------\n out : matrix\n Returns a matrix object, which is a specialized 2-D array.\n\n See Also\n --------\n matrix\n\n Examples\n --------\n >>> A = np.mat('1 1; 1 1')\n >>> B = np.mat('2 2; 2 2')\n >>> C = np.mat('3 4; 5 6')\n >>> D = np.mat('7 8; 9 0')\n\n All the following expressions construct the same block matrix:\n\n >>> np.bmat([[A, B], [C, D]])\n matrix([[1, 1, 2, 2],\n [1, 1, 2, 2],\n [3, 4, 7, 8],\n [5, 6, 9, 0]])\n >>> np.bmat(np.r_[np.c_[A, B], np.c_[C, D]])\n matrix([[1, 1, 2, 2],\n [1, 1, 2, 2],\n [3, 4, 7, 8],\n [5, 6, 9, 0]])\n >>> np.bmat('A,B; C,D')\n matrix([[1, 1, 2, 2],\n [1, 1, 2, 2],\n [3, 4, 7, 8],\n [5, 6, 9, 0]])\n\n \"\"\"\n if isinstance(obj, str):\n if gdict is None:\n # get previous frame\n frame = sys._getframe().f_back\n glob_dict = frame.f_globals\n loc_dict = frame.f_locals\n else:\n glob_dict = gdict\n loc_dict = ldict\n\n return matrix(_from_string(obj, glob_dict, loc_dict))\n\n if isinstance(obj, (tuple, list)):\n # [[A,B],[C,D]]\n arr_rows = []\n for row in obj:\n if isinstance(row, N.ndarray): # not 2-d\n return matrix(concatenate(obj, axis=-1))\n else:\n arr_rows.append(concatenate(row, axis=-1))\n return matrix(concatenate(arr_rows, axis=0))\n if isinstance(obj, N.ndarray):\n return matrix(obj)\n\n\nmat = asmatrix\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-4329534605734874600,"string":"-4,329,534,605,734,874,600"},"line_mean":{"kind":"number","value":26.3876898481,"string":"26.38769"},"line_max":{"kind":"number","value":89,"string":"89"},"alpha_frac":{"kind":"number","value":0.4712217617,"string":"0.471222"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.861377211766032,"string":"3.861377"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43865,"cells":{"repo_name":{"kind":"string","value":"Septima/qgis-qlrbrowser"},"path":{"kind":"string","value":"src/QlrBrowser/mysettings/qgissettingmanager/types/bool.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"3112"},"content":{"kind":"string","value":"#-----------------------------------------------------------\n#\n# QGIS setting manager is a python module to easily manage read/write\n# settings and set/get corresponding widgets.\n#\n# Copyright : (C) 2013 Denis Rouzaud\n# Email : denis.rouzaud@gmail.com\n#\n#-----------------------------------------------------------\n#\n# licensed under the terms of GNU GPL 2\n#\n# This program is free software; you can redistribute it and/or modify\n# it under the terms of the GNU General Public License as published by\n# the Free Software Foundation; either version 2 of the License, or\n# (at your option) any later version.\n#\n# This program is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU General Public License for more details.\n#\n# You should have received a copy of the GNU General Public License along\n# with this progsram; if not, write to the Free Software Foundation, Inc.,\n# 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA.\n#\n#---------------------------------------------------------------------\n\nfrom PyQt5.QtWidgets import QCheckBox\nfrom qgis.core import QgsProject\nfrom ..setting import Setting\nfrom ..setting_widget import SettingWidget\nfrom ..setting_manager import Debug\n\n\nclass Bool(Setting):\n\n def __init__(self, name, scope, default_value, options={}):\n Setting.__init__(self, name, scope, default_value, bool, QgsProject.instance().readBoolEntry, QgsProject.instance().writeEntryBool, options)\n\n def check(self, value):\n if type(value) != bool:\n raise NameError(\"Setting %s must be a boolean.\" % self.name)\n \n def config_widget(self, widget):\n if type(widget) == QCheckBox:\n return CheckBoxBoolWidget(self, widget, self.options)\n elif hasattr(widget, \"isCheckable\") and widget.isCheckable():\n return CheckableBoolWidget(self, widget, self.options)\n else:\n print(type(widget))\n raise NameError(\"SettingManager does not handle %s widgets for booleans at the moment (setting: %s)\" %\n (type(widget), self.name))\n\n\nclass CheckBoxBoolWidget(SettingWidget):\n def __init__(self, setting, widget, options):\n signal = widget.stateChanged\n SettingWidget.__init__(self, setting, widget, options, signal)\n\n def set_widget_value(self, value):\n if Debug:\n print(\"Bool: set_widget_value: {0}{1}\".format(value, self.setting.name))\n self.widget.setChecked(value)\n\n def widget_value(self):\n return self.widget.isChecked()\n\n\nclass CheckableBoolWidget(SettingWidget):\n def __init__(self, setting, widget, options):\n signal = widget.clicked\n SettingWidget.__init__(self, setting, widget, options, signal)\n\n def set_widget_value(self, value):\n self.widget.setChecked(value)\n\n def widget_value(self):\n return self.widget.isChecked()\n\n def widget_test(self, value):\n print('cannot test checkable groupbox at the moment')\n return False"},"license":{"kind":"string","value":"gpl-2.0"},"hash":{"kind":"number","value":4159583462942297000,"string":"4,159,583,462,942,297,000"},"line_mean":{"kind":"number","value":36.5060240964,"string":"36.506024"},"line_max":{"kind":"number","value":148,"string":"148"},"alpha_frac":{"kind":"number","value":0.6439588689,"string":"0.643959"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.31622746185853,"string":"4.316227"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43866,"cells":{"repo_name":{"kind":"string","value":"vhernandez/pygtksheet"},"path":{"kind":"string","value":"examples/complex_test.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"11754"},"content":{"kind":"string","value":"import sys\nsys.path += ['/usr/local/lib/python2.6/dist-packages/gtk-2.0']\nimport gtk\nfrom gtk import gdk\nimport pango\nimport gtksheet\nfrom bordercombo import BorderCombo\n#from gtkextra import BorderCombo\n#import gtkextra\n\nclass TestSheet(gtksheet.Sheet):\n def __init__(self):\n gtksheet.Sheet.__init__(self, 20, 20, \"Test\")\n colormap = gdk.colormap_get_system()\n\n self.default_bg_color = colormap.alloc_color(\"light yellow\")\n self.default_fg_color = colormap.alloc_color(\"black\")\n\n self.set_background(self.default_bg_color)\n self.set_grid(colormap.alloc_color(\"light blue\"))\n\n\n for column in xrange(self.get_columns_count()):\n name = chr(ord(\"A\") + column)\n self.column_button_add_label(column, name)\n self.set_column_title(column, name)\n\n self.default_font = self.style.font_desc\n \n\n\nclass TestWindow(gtk.Window):\n def __init__(self):\n gtk.Window.__init__(self)\n\n status_box = gtk.HBox(spacing=1)\n status_box.set_border_width(0)\n\n self.location = gtk.Label(\"\")\n (width, height) = self.location.size_request()\n self.location.set_size_request(160, height)\n status_box.pack_start(self.location, False)\n\n self.entry = gtk.Entry()\n self.entry.connect(\"changed\", self._show_sheet_entry_cb)\n status_box.pack_start(self.entry)\n \n t = gtk.Toolbar()\n ttips = gtk.Tooltips()\n def add_widget_to_toolbar(widget, separator=True, tooltip=None):\n ti = gtk.ToolItem()\n ti.add(widget)\n if tooltip is not None: \n ti.set_tooltip(ttips, tooltip)\n t.insert(ti, -1)\n if separator:\n t.insert(gtk.SeparatorToolItem(), -1) \n \n fontbutton = gtk.FontButton()\n fontbutton.connect(\"font-set\", self._font_changed_cb)\n add_widget_to_toolbar(fontbutton,\n tooltip=\"Change the font of the selected cells\");\n self.fontbutton = fontbutton\n\n items = \\\n ((\"justleft\", None, \n \"Justify selected cells to the left\",\n gtk.STOCK_JUSTIFY_LEFT, self._justification_cb, \n gtk.JUSTIFY_LEFT), \n (\"justcenter\", None, \n \"Justify selected cells to the center\",\n gtk.STOCK_JUSTIFY_CENTER, self._justification_cb, \n gtk.JUSTIFY_CENTER),\n (\"justright\", None, \n \"Justify selected cells to the right\",\n gtk.STOCK_JUSTIFY_RIGHT, self._justification_cb, \n gtk.JUSTIFY_RIGHT))\n for name, label, tooltip, stock_id, cb, cb_params in items:\n ti = gtk.Action(name, label, tooltip, stock_id)\n ti.connect(\"activate\", cb, cb_params)\n t.insert(ti.create_tool_item(), -1)\n \n bordercombo = BorderCombo()\n bordercombo.connect(\"changed\", self._border_changed_cb)\n add_widget_to_toolbar(bordercombo,\n tooltip=\"Change the border of the selected cells\")\n \n colormap = gdk.colormap_get_system()\n colorbtn = gtk.ColorButton(colormap.alloc_color(\"black\"))\n colorbtn.connect(\"color-set\", self._color_changed_cb, \"f\")\n add_widget_to_toolbar(colorbtn, separator=False,\n tooltip=\"Change the foreground color of the selected cells\")\n self.fgcolorbtn = colorbtn\n\n colorbtn = gtk.ColorButton(colormap.alloc_color(\"light yellow\"))\n colorbtn.connect(\"color-set\", self._color_changed_cb, \"b\")\n add_widget_to_toolbar(colorbtn, \n tooltip=\"Change the background color of the selected cells\");\n self.bgcolorbtn = colorbtn\n\n self.sheet = TestSheet()\n self.sheet.connect(\"activate\", self._activate_sheet_cell_cb)\n self.sheet.get_entry().connect(\"changed\", self._show_entry_cb)\n self.sheet.connect(\"changed\", self._sheet_changed_cb)\n ws = gtk.ScrolledWindow()\n ws.add(self.sheet)\n\n fd = self.sheet.default_font\n fontbutton.set_font_name(fd.to_string())\n\n vbox = gtk.VBox()\n vbox.pack_start(t, False, False, 0)\n vbox.pack_start(status_box, False, False, 0)\n vbox.pack_start(ws, True, True, 0)\n\n self.add(vbox)\n self.set_size_request(500,400)\n self.show_all()\n\n def _sheet_changed_cb(self, sheet, row, column):\n print \"Sheet change at row: %d, column: %d\" % (row, column)\n\n def _show_sheet_entry_cb(self, entry):\n if not entry.flags() & gtk.HAS_FOCUS:\n return\n sheet_entry = self.sheet.get_entry()\n text = entry.get_text()\n sheet_entry.set_text(text)\n\n def _show_entry_cb(self, sheet_entry, *args):\n if not sheet_entry.flags() & gtk.HAS_FOCUS:\n return\n text = sheet_entry.get_text()\n self.entry.set_text(text)\n\n def _activate_sheet_cell_cb(self, sheet, row, column):\n title = sheet.get_column_title(column)\n if title:\n cell = \" %s:%d \" % (title, row)\n else:\n cell = \" ROW: %d COLUMN: %d \" % (row, column)\n self.location.set_text(cell)\n\n # Set attributes\n attributes = sheet.get_attributes(row, column)\n if attributes:\n fd = attributes.font_desc if attributes.font_desc else self.sheet.default_font\n fgcolor = attributes.foreground\n bgcolor = attributes.background\n else:\n fd = self.sheet.default_font\n fgcolor = self.sheet.default_fg_color\n bgcolor = self.sheet.default_bg_color\n\n self.fontbutton.set_font_name(fd.to_string())\n self.fgcolorbtn.set_color(fgcolor)\n self.bgcolorbtn.set_color(bgcolor)\n\n # Set entry text\n sheet_entry = sheet.get_entry()\n self.entry.props.max_length = sheet_entry.props.max_length\n text = sheet.cell_get_text(row, column)\n if text:\n self.entry.set_text(text)\n else:\n self.entry.set_text(\"\")\n\n print self.sheet.props.active_cell\n\n\n def _font_changed_cb(self, widget):\n r = self.sheet.props.selected_range\n fd = pango.FontDescription(widget.get_font_name())\n self.sheet.range_set_font(r, fd)\n \n\n def _justification_cb(self, widget, data=None):\n if data is None:\n return\n r = self.sheet.props.selected_range\n if r:\n self.sheet.range_set_justification(r, data)\n\n def _border_changed_cb(self, widget):\n border = widget.get_active()\n range = self.sheet.props.selected_range\n border_width = 3\n self.sheet.range_set_border(range, 0, 0)\n if border == 1:\n border_mask = gtksheet.SHEET_TOP_BORDER\n range.rowi = range.row0\n self.sheet.range_set_border(range, border_mask, border_width)\n elif border == 2:\n border_mask = gtksheet.SHEET_BOTTOM_BORDER\n range.row0 = range.rowi\n self.sheet.range_set_border(range, border_mask, border_width)\n elif border == 3:\n border_mask = gtksheet.SHEET_RIGHT_BORDER\n range.col0 = range.coli\n self.sheet.range_set_border(range, border_mask, border_width)\n elif border == 4:\n border_mask = gtksheet.SHEET_LEFT_BORDER\n range.coli = range.col0\n self.sheet.range_set_border(range, border_mask, border_width)\n elif border == 5:\n if range.col0 == range.coli:\n border_mask = gtksheet.SHEET_LEFT_BORDER | gtksheet.SHEET_RIGHT_BORDER\n self.sheet.range_set_border(range, border_mask, border_width)\n else:\n border_mask = gtksheet.SHEET_LEFT_BORDER\n auxcol = range.coli\n range.coli = range.col0\n self.sheet.range_set_border(range, border_mask, border_width)\n border_mask = gtksheet.SHEET_RIGHT_BORDER\n range.col0 = range.coli = auxcol\n self.sheet.range_set_border(range, border_mask, border_width)\n elif border == 6:\n if range.row0 == range.rowi:\n border_mask = gtksheet.SHEET_TOP_BORDER | gtksheet.SHEET_BOTTOM_BORDER\n self.sheet.range_set_border(range, border_mask, border_width)\n else:\n border_mask = gtksheet.SHEET_TOP_BORDER\n auxrow = range.rowi\n range.rowi = range.row0\n self.sheet.range_set_border(range, border_mask, border_width)\n border_mask = gtksheet.SHEET_BOTTOM_BORDER\n range.row0 = range.rowi = auxrow\n self.sheet.range_set_border(range, border_mask, border_width)\n elif border == 7:\n border_mask = gtksheet.SHEET_RIGHT_BORDER | gtksheet.SHEET_LEFT_BORDER\n self.sheet.range_set_border(range, border_mask, border_width)\n elif border == 8:\n border_mask = gtksheet.SHEET_BOTTOM_BORDER | gtksheet.SHEET_TOP_BORDER\n self.sheet.range_set_border(range, border_mask, border_width)\n elif border == 9:\n self.sheet.range_set_border(range, 15, border_width)\n for i in xrange(range.row0, range.rowi + 1):\n for j in xrange(range.col0, range.coli + 1):\n border_mask = 15\n auxrange = sheet.SheetRange(i, j, i, j)\n if i == range.rowi:\n border_mask = border_mask ^ gtksheet.SHEET_BOTTOM_BORDER\n if i == range.row0:\n border_mask = border_mask ^ gtksheet.SHEET_TOP_BORDER\n if j == range.coli:\n border_mask = border_mask ^ gtksheet.SHEET_RIGHT_BORDER\n if j == range.col0:\n border_mask = border_mask ^ gtksheet.SHEET_LEFT_BORDER\n if border_mask != 15:\n self.sheet.range_set_border(auxrange, border_mask,\n border_width)\n elif border == 10:\n for i in xrange(range.row0, range.rowi + 1):\n for j in xrange(range.col0, range.coli + 1):\n border_mask = 0\n auxrange = gtksheet.SheetRange(i, j, i, j)\n if i == range.rowi:\n border_mask = border_mask | gtksheet.SHEET_BOTTOM_BORDER\n if i == range.row0:\n border_mask = border_mask | gtksheet.SHEET_TOP_BORDER\n if j == range.coli:\n border_mask = border_mask | gtksheet.SHEET_RIGHT_BORDER\n if j == range.col0:\n border_mask = border_mask | gtksheet.SHEET_LEFT_BORDER\n if border_mask != 0:\n self.sheet.range_set_border(auxrange, border_mask,\n border_width)\n elif border == 11:\n border_mask = 15\n self.sheet.range_set_border(range, border_mask, border_width)\n\n def _color_changed_cb(self, widget, data=None):\n # Bug in GtkSheet?: the color must be allocated with the system's \n # colormap, else it is ignored\n if data is None:\n return\n color = widget.get_color()\n _range = self.sheet.props.selected_range\n if data == \"f\":\n self.sheet.range_set_foreground(_range, color)\n else:\n self.sheet.range_set_background(_range, color)\n\n\ndef main():\n w = TestWindow()\n w.connect(\"delete-event\", lambda x,y: gtk.main_quit())\n gtk.main()\n \nif __name__=='__main__':\n main()\n\n"},"license":{"kind":"string","value":"gpl-2.0"},"hash":{"kind":"number","value":9136060946695285000,"string":"9,136,060,946,695,285,000"},"line_mean":{"kind":"number","value":39.2534246575,"string":"39.253425"},"line_max":{"kind":"number","value":90,"string":"90"},"alpha_frac":{"kind":"number","value":0.5617662072,"string":"0.561766"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.807580174927114,"string":"3.80758"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43867,"cells":{"repo_name":{"kind":"string","value":"nash-x/hws"},"path":{"kind":"string","value":"nova/huawei/scheduler/filters/disk_filter.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"2145"},"content":{"kind":"string","value":"# Copyright (c) 2012 OpenStack Foundation\n# All Rights Reserved.\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\"); you may\n# not use this file except in compliance with the License. You may obtain\n# a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS, WITHOUT\n# WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the\n# License for the specific language governing permissions and limitations\n# under the License.\n\nimport copy\nfrom nova.openstack.common.gettextutils import _\nfrom nova.openstack.common import log as logging\nfrom nova.scheduler.filters import disk_filter\nfrom nova.huawei import utils as h_utils\n\nLOG = logging.getLogger(__name__)\n\n\nclass HuaweiDiskFilter(disk_filter.DiskFilter):\n \"\"\"Disk Filter with over subscription flag.\"\"\"\n\n def host_passes(self, host_state, filter_properties):\n \"\"\"Filter based on disk usage.\"\"\"\n\n #deep copy a filter properties to avoid changing\n filter_properties_tmp = copy.deepcopy(filter_properties)\n\n context = filter_properties_tmp['context']\n instance = filter_properties_tmp['request_spec']['instance_properties']\n if h_utils.is_boot_from_volume(context, instance):\n # just process local disk(ephemeral and swap), so set\n # root_gb to zero\n filter_properties_tmp.get('instance_type')['root_gb'] = 0\n\n # if the request disk size is zero, we should return true.\n # In negative free disk size condition, the instance booted volume\n # is not create successfully.\n instance_type = filter_properties.get('instance_type')\n requested_disk = (1024 * (instance_type['ephemeral_gb']) +\n instance_type['swap'])\n if requested_disk == 0:\n return True\n\n return super(HuaweiDiskFilter, self).host_passes(host_state,\n filter_properties_tmp)\n\n\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":-566471726499216700,"string":"-566,471,726,499,216,700"},"line_mean":{"kind":"number","value":39.4716981132,"string":"39.471698"},"line_max":{"kind":"number","value":79,"string":"79"},"alpha_frac":{"kind":"number","value":0.6606060606,"string":"0.660606"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.41358024691358,"string":"4.41358"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43868,"cells":{"repo_name":{"kind":"string","value":"pglomski/shopnotes"},"path":{"kind":"string","value":"drill_speed_chart.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"2778"},"content":{"kind":"string","value":"#!/usr/bin/env python\n# -*- coding: UTF-8 -*-\n'''Produce a custom twist drill plot'''\n\nimport numpy as np\nimport matplotlib as mpl\nimport matplotlib.pyplot as plt\nplt.rc('text', usetex=True)\n\n# set some rcParams\nmpl.rcParams['font.weight'] = 'bold'\n\nmpl.rcParams['xtick.major.pad'] = 10\nmpl.rcParams['xtick.direction'] = 'inout'\nmpl.rcParams['xtick.labelsize'] = 26\n\nmpl.rcParams['ytick.direction'] = 'inout'\nmpl.rcParams['ytick.labelsize'] = 20\n\n# define the constants for our chart\nmaterials = [\n ('Acrylic' , 650 , 'c' , '-' ) ,\n ('Aluminum' , 300 , 'b' , '-' ) ,\n ('Brass' , 200 , 'g' , '-' ) ,\n ('LC Steel' , 110 , 'k' , '-' ) ,\n ('Wood' , 100 , 'brown' , '-' ) ,\n ('MC Steel' , 80 , 'darkgray' , '-' ) ,\n ('HC Steel' , 60 , 'lightgray' , '-' ) ,\n ('Stainless' , 50 , 'purple' , '-' ) ,\n ]\ndrill_speeds = [250, 340, 390, 510, 600, 650, 990, 1550, 1620, 1900, 2620, 3100] #rpm\n\nspeed_lims = (200., 4000.) # rpm\n\nmax_in = 1. # in.\nincr = 1./16. # in.\n\nim_sz = 25. # in.\nratio = 8.5/11.\n\nfig = plt.figure(figsize=(im_sz,ratio * im_sz), dpi=600)\nfig.patch.set_alpha(0)\n\n# generate a vector of drill bit diameter\nx = np.array([float(i) * incr for i in range(1,int(max_in/incr) + 1)]) # in.\n\n# calculate the drill speed curve for each material type and plot the curve\nfor name, speed, color, linestyle in materials:\n plt.loglog(x, 12/np.pi/x*speed, label=name, linewidth=5, color=color, linestyle=linestyle)\n\nax = plt.gca()\n\n# adjust the axis tick locators to match drill press speeds\nax.yaxis.set_major_locator(mpl.ticker.FixedLocator(drill_speeds))\nax.yaxis.set_major_formatter(mpl.ticker.FormatStrFormatter('%4d'))\nax.yaxis.set_minor_locator(mpl.ticker.NullLocator())\nax.set_ylim(speed_lims)\n\n# set the drill diameter locators and format the ticks with LaTeX\nax.xaxis.set_major_locator(mpl.ticker.MultipleLocator(base=incr))\nax.xaxis.set_minor_locator(mpl.ticker.NullLocator())\nax.set_xlim((incr, max_in))\nticks = ['0', r'$$\\frac{1}{16}$$' , r'$$\\frac{1}{8}$$' , r'$$\\frac{3}{16}$$' , r'$$\\frac{1}{4}$$' ,\n r'$$\\frac{5}{16}$$' , r'$$\\frac{3}{8}$$' , r'$$\\frac{7}{16}$$' , r'$$\\frac{1}{2}$$' ,\n r'$$\\frac{9}{16}$$' , r'$$\\frac{5}{8}$$' , r'$$\\frac{11}{16}$$' , r'$$\\frac{3}{4}$$' ,\n r'$$\\frac{13}{16}$$' , r'$$\\frac{7}{8}$$' , r'$$\\frac{15}{16}$$' , r'$$1$$' ]\nax.xaxis.set_ticklabels(ticks)\n\n# Add the Texts\nplt.xlabel('Bit Diameter (in.)', fontsize=26)\nplt.ylabel('Drill Speed (rpm)' , fontsize=26)\nplt.title('Twist Drill Speeds' , fontsize=50)\nplt.legend(ncol=2, loc=3, fontsize=40)\n\nplt.grid('on')\nplt.savefig('drill_speed_chart.png')\n\n"},"license":{"kind":"string","value":"agpl-3.0"},"hash":{"kind":"number","value":6025454394184277000,"string":"6,025,454,394,184,277,000"},"line_mean":{"kind":"number","value":35.0779220779,"string":"35.077922"},"line_max":{"kind":"number","value":102,"string":"102"},"alpha_frac":{"kind":"number","value":0.5691144708,"string":"0.569114"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":2.6035613870665415,"string":"2.603561"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43869,"cells":{"repo_name":{"kind":"string","value":"crmorse/weewx-waterflow"},"path":{"kind":"string","value":"bin/weedb/mysql.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"9153"},"content":{"kind":"string","value":"#\n# Copyright (c) 2012 Tom Keffer \n#\n# See the file LICENSE.txt for your full rights.\n#\n# $Revision$\n# $Author$\n# $Date$\n#\n\"\"\"Driver for the MySQL database\"\"\"\n\nimport decimal\n\nimport MySQLdb\nimport _mysql_exceptions\n\nfrom weeutil.weeutil import to_bool\nimport weedb\n\ndef connect(host='localhost', user='', password='', database='', driver='', **kwargs):\n \"\"\"Connect to the specified database\"\"\"\n return Connection(host=host, user=user, password=password, database=database, **kwargs)\n\ndef create(host='localhost', user='', password='', database='', driver='', **kwargs):\n \"\"\"Create the specified database. If it already exists,\n an exception of type weedb.DatabaseExists will be thrown.\"\"\"\n # Open up a connection w/o specifying the database.\n try:\n connect = MySQLdb.connect(host = host,\n user = user,\n passwd = password, **kwargs)\n cursor = connect.cursor()\n # An exception will get thrown if the database already exists.\n try:\n # Now create the database.\n cursor.execute(\"CREATE DATABASE %s\" % (database,))\n except _mysql_exceptions.ProgrammingError:\n # The database already exists. Change the type of exception.\n raise weedb.DatabaseExists(\"Database %s already exists\" % (database,))\n finally:\n cursor.close()\n except _mysql_exceptions.OperationalError, e:\n raise weedb.OperationalError(e)\n \ndef drop(host='localhost', user='', password='', database='', driver='', **kwargs):\n \"\"\"Drop (delete) the specified database.\"\"\"\n # Open up a connection\n try:\n connect = MySQLdb.connect(host = host,\n user = user,\n passwd = password, **kwargs)\n cursor = connect.cursor()\n try:\n cursor.execute(\"DROP DATABASE %s\" % database)\n except _mysql_exceptions.OperationalError:\n raise weedb.NoDatabase(\"\"\"Attempt to drop non-existent database %s\"\"\" % (database,))\n finally:\n cursor.close()\n except _mysql_exceptions.OperationalError, e:\n raise weedb.OperationalError(e)\n \nclass Connection(weedb.Connection):\n \"\"\"A wrapper around a MySQL connection object.\"\"\"\n \n def __init__(self, host='localhost', user='', password='', database='', **kwargs):\n \"\"\"Initialize an instance of Connection.\n\n Parameters:\n \n host: IP or hostname with the mysql database (required)\n user: User name (required)\n password: The password for the username (required)\n database: The database to be used. (required)\n kwargs: Any extra arguments you may wish to pass on to MySQL (optional)\n \n If the operation fails, an exception of type weedb.OperationalError will be raised.\n \"\"\"\n try:\n connection = MySQLdb.connect(host=host, user=user, passwd=password, db=database, **kwargs)\n except _mysql_exceptions.OperationalError, e:\n # The MySQL driver does not include the database in the\n # exception information. Tack it on, in case it might be useful.\n raise weedb.OperationalError(str(e) + \" while opening database '%s'\" % (database,))\n\n weedb.Connection.__init__(self, connection, database, 'mysql')\n \n # Allowing threads other than the main thread to see any transactions\n # seems to require an isolation level of READ UNCOMMITTED.\n self.query(\"SET TRANSACTION ISOLATION LEVEL READ UNCOMMITTED\") \n \n def cursor(self):\n \"\"\"Return a cursor object.\"\"\"\n # The implementation of the MySQLdb cursor is lame enough that we are\n # obliged to include a wrapper around it:\n return Cursor(self)\n \n def tables(self):\n \"\"\"Returns a list of tables in the database.\"\"\"\n \n table_list = list()\n try:\n # Get a cursor directly from MySQL\n cursor = self.connection.cursor()\n cursor.execute(\"\"\"SHOW TABLES;\"\"\")\n while True:\n row = cursor.fetchone()\n if row is None: break\n # Extract the table name. In case it's in unicode, convert to a regular string.\n table_list.append(str(row[0]))\n finally:\n cursor.close()\n return table_list\n \n def genSchemaOf(self, table):\n \"\"\"Return a summary of the schema of the specified table.\n \n If the table does not exist, an exception of type weedb.OperationalError is raised.\"\"\"\n \n try:\n # Get a cursor directly from MySQL:\n cursor = self.connection.cursor()\n # MySQL throws an exception if you try to show the columns of a\n # non-existing table\n try:\n cursor.execute(\"\"\"SHOW COLUMNS IN %s;\"\"\" % table)\n except _mysql_exceptions.ProgrammingError, e:\n # Table does not exist. Change the exception type:\n raise weedb.OperationalError(e)\n irow = 0\n while True:\n row = cursor.fetchone()\n if row is None: break\n # Append this column to the list of columns.\n colname = str(row[0])\n if row[1].upper()=='DOUBLE':\n coltype = 'REAL'\n elif row[1].upper().startswith('INT'):\n coltype = 'INTEGER'\n elif row[1].upper().startswith('CHAR'):\n coltype = 'STR'\n else:\n coltype = str(row[1]).upper()\n is_primary = True if row[3] == 'PRI' else False\n yield (irow, colname, coltype, to_bool(row[2]), row[4], is_primary)\n irow += 1\n finally:\n cursor.close()\n \n \n def columnsOf(self, table):\n \"\"\"Return a list of columns in the specified table. \n \n If the table does not exist, an exception of type weedb.OperationalError is raised.\"\"\"\n column_list = [row[1] for row in self.genSchemaOf(table)]\n return column_list\n \n def begin(self):\n \"\"\"Begin a transaction.\"\"\"\n self.query(\"START TRANSACTION\")\n \n def commit(self):\n try:\n weedb.Connection.commit(self)\n except _mysql_exceptions.OperationalError, e:\n raise weedb.OperationalError(e)\n \n def rollback(self):\n try:\n weedb.Connection.rollback(self)\n except _mysql_exceptions.OperationalError, e:\n raise weedb.OperationalError(e)\n \n def query(self, *args, **kwargs):\n try:\n self.connection.query(*args, **kwargs)\n except _mysql_exceptions.OperationalError, e:\n raise weedb.OperationalError(e)\n \nclass Cursor(object):\n \"\"\"A wrapper around the MySQLdb cursor object\"\"\"\n \n def __init__(self, connection):\n \"\"\"Initialize a Cursor from a connection.\n \n connection: An instance of db.mysql.Connection\"\"\"\n \n # Get the MySQLdb cursor and store it internally:\n self.cursor = connection.connection.cursor()\n \n def execute(self, sql_string, sql_tuple=() ):\n \"\"\"Execute a SQL statement on the MySQL server.\n \n sql_string: A SQL statement to be executed. It should use ? as\n a placeholder.\n \n sql_tuple: A tuple with the values to be used in the placeholders.\"\"\"\n \n # MySQL uses '%s' as placeholders, so replace the ?'s with %s\n mysql_string = sql_string.replace('?','%s')\n \n try:\n # Convert sql_tuple to a plain old tuple, just in case it actually\n # derives from tuple, but overrides the string conversion (as is the\n # case with a TimeSpan object):\n self.cursor.execute(mysql_string, tuple(sql_tuple))\n except (_mysql_exceptions.OperationalError, _mysql_exceptions.ProgrammingError), e:\n raise weedb.OperationalError(e)\n return self\n \n def fetchone(self):\n # Get a result from the MySQL cursor, then run it through the massage\n # filter below\n return massage(self.cursor.fetchone())\n\n def close(self):\n try:\n self.cursor.close()\n del self.cursor\n except:\n pass\n \n #\n # Supplying functions __iter__ and next allows the cursor to be used as an iterator.\n #\n def __iter__(self):\n return self\n \n def next(self):\n result = self.fetchone()\n if result is None:\n raise StopIteration\n return result\n\n#\n# This is a utility function for converting a result set that might contain\n# longs or decimal.Decimals (which MySQLdb uses) to something containing just ints.\n#\ndef massage(seq):\n # Return the massaged sequence if it exists, otherwise, return None\n if seq is not None:\n return [int(i) if isinstance(i, long) or isinstance(i,decimal.Decimal) else i for i in seq]\n"},"license":{"kind":"string","value":"gpl-3.0"},"hash":{"kind":"number","value":4721289113010788000,"string":"4,721,289,113,010,788,000"},"line_mean":{"kind":"number","value":36.979253112,"string":"36.979253"},"line_max":{"kind":"number","value":102,"string":"102"},"alpha_frac":{"kind":"number","value":0.5799191522,"string":"0.579919"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.629742033383915,"string":"4.629742"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43870,"cells":{"repo_name":{"kind":"string","value":"papaloizouc/peacehack"},"path":{"kind":"string","value":"peacehack/theapp/migrations/0001_initial.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"5492"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\nfrom __future__ import unicode_literals\n\nfrom django.db import models, migrations\n\n\nclass Migration(migrations.Migration):\n\n dependencies = [\n ]\n\n operations = [\n migrations.CreateModel(\n name='CrazyObject',\n fields=[\n ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)),\n ('ActionGeo_ADM1Code', models.CharField(max_length=10, null=True, blank=True)),\n ('ActionGeo_CountryCode', models.CharField(max_length=4, null=True, blank=True)),\n ('ActionGeo_FeatureID', models.CharField(max_length=4, null=True, blank=True)),\n ('ActionGeo_FullName', models.CharField(max_length=200, null=True, blank=True)),\n ('ActionGeo_Lat', models.CharField(max_length=4, null=True, blank=True)),\n ('ActionGeo_Long', models.TextField(null=True, blank=True)),\n ('ActionGeo_Type', models.TextField(null=True, blank=True)),\n ('Actor1Code', models.TextField(null=True, blank=True)),\n ('Actor1CountryCode', models.TextField(null=True, blank=True)),\n ('Actor1EthnicCode', models.TextField(null=True, blank=True)),\n ('Actor1Geo_ADM1Code', models.TextField(null=True, blank=True)),\n ('Actor1Geo_CountryCode', models.IntegerField(null=True, blank=True)),\n ('Actor1Geo_FeatureID', models.IntegerField(null=True, blank=True)),\n ('Actor1Geo_FullName', models.TextField(null=True, blank=True)),\n ('Actor1Geo_Lat', models.TextField(null=True, blank=True)),\n ('Actor1Geo_Long', models.TextField(null=True, blank=True)),\n ('Actor1Geo_Type', models.IntegerField(null=True, blank=True)),\n ('Actor1KnownGroupCode', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor1Name', models.TextField(null=True, blank=True)),\n ('Actor1Religion1Code', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor1Religion2Code', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor1Type1Code', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor1Type2Code', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor1Type3Code', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor2Code', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor2CountryCode', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor2EthnicCode', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor2Geo_ADM1Code', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor2Geo_CountryCode', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor2Geo_FeatureID', models.IntegerField(null=True, blank=True)),\n ('Actor2Geo_FullName', models.TextField(null=True, blank=True)),\n ('Actor2Geo_Lat', models.TextField(null=True, blank=True)),\n ('Actor2Geo_Long', models.TextField(null=True, blank=True)),\n ('Actor2Geo_Type', models.IntegerField(null=True, blank=True)),\n ('Actor2KnownGroupCode', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor2Name', models.TextField(null=True, blank=True)),\n ('Actor2Religion1Code', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor2Religion2Code', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor2Type1Code', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor2Type2Code', models.CharField(max_length=4, null=True, blank=True)),\n ('Actor2Type3Code', models.CharField(max_length=4, null=True, blank=True)),\n ('AvgTone', models.TextField(null=True, blank=True)),\n ('DATEADDED', models.IntegerField(null=True, blank=True)),\n ('EventBaseCode', models.IntegerField(null=True, blank=True)),\n ('EventCode', models.IntegerField(null=True, blank=True)),\n ('EventRootCode', models.IntegerField(null=True, blank=True)),\n ('FractionDate', models.TextField(null=True, blank=True)),\n ('GLOBALEVENTID', models.IntegerField(null=True, blank=True)),\n ('GoldsteinScale', models.TextField(null=True, blank=True)),\n ('IsRootEvent', models.IntegerField(null=True, blank=True)),\n ('MonthYear', models.IntegerField(null=True, blank=True)),\n ('NumArticles', models.IntegerField(null=True, blank=True)),\n ('NumMentions', models.IntegerField(null=True, blank=True)),\n ('NumSources', models.IntegerField(null=True, blank=True)),\n ('QuadClass', models.IntegerField(null=True, blank=True)),\n ('SOURCEURL', models.TextField(null=True, blank=True)),\n ('SQLDATE', models.IntegerField(null=True, blank=True)),\n ('Year', models.IntegerField(null=True, blank=True)),\n ('Day', models.IntegerField(null=True, blank=True)),\n ('Month', models.IntegerField(null=True, blank=True)),\n ],\n options={\n },\n bases=(models.Model,),\n ),\n ]\n"},"license":{"kind":"string","value":"gpl-2.0"},"hash":{"kind":"number","value":5515570037667942000,"string":"5,515,570,037,667,942,000"},"line_mean":{"kind":"number","value":65.9756097561,"string":"65.97561"},"line_max":{"kind":"number","value":114,"string":"114"},"alpha_frac":{"kind":"number","value":0.5994173343,"string":"0.599417"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.922857142857143,"string":"3.922857"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43871,"cells":{"repo_name":{"kind":"string","value":"ashishtilokani/Cloaking-Detection-Tool"},"path":{"kind":"string","value":"googleBot/googleBot/spiders/scrape2.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1236"},"content":{"kind":"string","value":"from scrapy.selector import HtmlXPathSelector\nfrom scrapy.spider import Spider\nimport html2text\nimport re\nimport os.path\n\nclass scrape(Spider):\n name = \"googleBot2\"\n\n start_urls = []\n \n with open('/home/ashish/Desktop/CloakingDetectionTool/url.txt','r') as f:\n for line in f:\n l=line.replace(\"/\", \"_\")\n try: \n f=open('/home/ashish/Desktop/CloakingDetectionTool/c2/'+ l + '.txt','r')\n f.close()\n except:\n start_urls.append(line)\n \n def parse(self, response):\n regex = re.compile('[^A-Za-z0-9_]')\n #First parameter is the replacement, second parameter is your input string\n d={}\n l=(response.url).replace(\"/\", \"_\")\n f=open('/home/ashish/Desktop/CloakingDetectionTool/c2/'+ l + '.txt','w')\n terms=[]\n terms = (response.body).split()\n c=0\n for word in terms:\n word=regex.sub('', word) \n if word not in d: \n d[word]=1\n f.write(word)\n f.write(' ') \n c=1\n \n if c==0: #empty \n f.write(' ')\n f.write('\\n')\n f.close()\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-6094454040259034000,"string":"-6,094,454,040,259,034,000"},"line_mean":{"kind":"number","value":29.1463414634,"string":"29.146341"},"line_max":{"kind":"number","value":88,"string":"88"},"alpha_frac":{"kind":"number","value":0.4862459547,"string":"0.486246"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.9238095238095236,"string":"3.92381"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43872,"cells":{"repo_name":{"kind":"string","value":"mprinc/McMap"},"path":{"kind":"string","value":"src/scripts/CSN_Archive/check_object_names.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"4677"},"content":{"kind":"string","value":"#!/usr/bin/env python\n\n# Copyright (c) 2015, Scott D. Peckham\n\n#------------------------------------------------------\n# S.D. Peckham\n# July 9, 2015\n#\n# Tool to extract the object part of every CSDMS Standard\n# Variable Name and generate a list of objects that\n# includes those as well as all parent objects.\n#\n# Example of use at a Unix prompt:\n#\n# % ./check_object_names.py CSN_VarNames_v0.82.txt\n#------------------------------------------------------\n#\n# Functions:\n# check_objects()\n#\n#------------------------------------------------------\n\nimport os.path\nimport sys\n\n#------------------------------------------------------\ndef check_objects( in_file='CSN_VarNames_v0.82.txt' ):\n\n #--------------------------------------------------\n # Open input file that contains copied names table\n #--------------------------------------------------\n try:\n in_unit = open( in_file, 'r' )\n except:\n print 'SORRY: Could not open TXT file named:'\n print ' ' + in_file\n\n #-------------------------\n # Open new CSV text file\n #-------------------------\n ## pos = in_file.rfind('.')\n ## prefix = in_file[0:pos]\n ## out_file = prefix + '.ttl'\n out_file = 'All_Object_Names.txt'\n #-------------------------------------------\n OUT_EXISTS = os.path.exists( out_file )\n if (OUT_EXISTS):\n print 'SORRY, A text file with the name'\n print ' ' + out_file\n print ' already exists.'\n return\n out_unit = open( out_file, 'w' )\n\n #--------------------------- \n # Parse all variable names\n #---------------------------\n n_objects = 0\n object_list1 = list()\n object_list2 = list()\n while (True):\n #------------------------------\n # Read data line from in_file\n #------------------------------ \n line = in_unit.readline()\n if (line == ''):\n break \n\n #--------------------------------------------------\n # Write object and quantity fullnames to TTL file\n #--------------------------------------------------\n line = line.strip() # (strip leading/trailing white space) \n main_parts = line.split('__')\n object_fullname = main_parts[0]\n # quantity_fullname = main_parts[1]\n\n #------------------------------------ \n # Append object name to object_list\n #------------------------------------\n object_list1.append( object_fullname )\n object_list2.append( object_fullname )\n\n #------------------------------------------------ \n # Append all parent object names to object_list\n #------------------------------------------------\n object_name = object_fullname\n while (True):\n pos = object_name.rfind('_')\n if (pos < 0):\n break \n object_name = object_name[:pos]\n object_list2.append( object_name )\n\n #---------------------------------------------\n # Create sorted lists of unique object names\n # Not fastest method, but simple.\n #---------------------------------------------\n old_list = sorted( set(object_list1) )\n new_list = sorted( set(object_list2) )\n n_objects1 = len( old_list )\n n_objects2 = len( new_list ) \n \n #--------------------------------------------\n # Write complete object list to output file\n #--------------------------------------------\n for k in xrange( n_objects2 ):\n out_unit.write( new_list[k] + '\\n' )\n\n #----------------------\n # Close the input file\n #----------------------\n in_unit.close()\n \n #----------------------------\n # Close the TXT output file\n #----------------------------\n out_unit.close()\n print 'Finished checking all object names.'\n print 'Number of old object names =', n_objects1, '.'\n print 'Number of new object names =', n_objects2, '.'\n print ' '\n \n# check_objects()\n#------------------------------------------------------\nif (__name__ == \"__main__\"):\n \n #-----------------------------------------------------\n # Note: First arg in sys.argv is the command itself.\n #-----------------------------------------------------\n n_args = len(sys.argv)\n if (n_args < 2):\n print 'ERROR: This tool requires an input'\n print ' text file argument.'\n print 'sys.argv =', sys.argv\n print ' '\n elif (n_args == 2):\n check_objects( sys.argv[1] )\n else:\n print 'ERROR: Invalid number of arguments.'\n \n#-----------------------------------------------------------------------\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-1015613779617027700,"string":"-1,015,613,779,617,027,700"},"line_mean":{"kind":"number","value":32.4071428571,"string":"32.407143"},"line_max":{"kind":"number","value":94,"string":"94"},"alpha_frac":{"kind":"number","value":0.3835792174,"string":"0.383579"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.753048780487805,"string":"4.753049"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43873,"cells":{"repo_name":{"kind":"string","value":"PrFalken/exaproxy"},"path":{"kind":"string","value":"lib/exaproxy/icap/response.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"2403"},"content":{"kind":"string","value":"\nclass ICAPResponse (object):\n\tdef __init__ (self, version, code, status, headers, icap_header, http_header):\n\t\tself.version = version\n\t\tself.code = code\n\t\tself.status = status\n\t\tself.headers = headers\n\n\t\ticap_len = len(icap_header)\n\t\thttp_len = len(http_header)\n\t\t\n\t\ticap_end = icap_len\n\n\t\tif http_header:\n\t\t\thttp_len_string = '%x\\n' % http_len\n\t\t\thttp_string = http_len_string + http_header + '0\\n'\n\n\t\t\thttp_offset = icap_end + len(http_len_string)\n\t\t\thttp_end = http_offset + http_len\n\n\t\telse:\n\t\t\thttp_string = http_header\n\t\t\thttp_offset = icap_end\n\t\t\thttp_end = icap_end\n\n\t\tself.response_view = memoryview(icap_header + http_string)\n\t\tself.icap_view = self.response_view[:icap_end]\n\t\tself.http_view = self.response_view[http_offset:http_end]\n\n\t@property\n\tdef response_string (self):\n\t\treturn self.response_view.tobytes()\n\n\t@property\n\tdef icap_header (self):\n\t\treturn self.icap_view.tobytes()\n\n\t@property\n\tdef http_header (self):\n\t\treturn self.http_view.tobytes()\n\n\t@property\n\tdef pragma (self):\n\t\treturn self.headers.get('pragma', {})\n\n\t@property\n\tdef is_permit (self):\n\t\treturn False\n\n\t@property\n\tdef is_modify (self):\n\t\treturn False\n\n\t@property\n\tdef is_content (self):\n\t\treturn False\n\n\t@property\n\tdef is_intercept (self):\n\t\treturn False\n\n\nclass ICAPRequestModification (ICAPResponse):\n\tdef __init__ (self, version, code, status, headers, icap_header, http_header, intercept_header=None):\n\t\tICAPResponse.__init__(self, version, code, status, headers, icap_header, http_header)\n\t\tself.intercept_header = intercept_header\n\n\t@property\n\tdef is_permit (self):\n\t\treturn self.code == 304\n\n\t@property\n\tdef is_modify (self):\n\t\treturn self.code == 200 and self.intercept_header is None\n\n\t@property\n\tdef is_intercept (self):\n\t\treturn self.code == 200 and self.intercept_header is not None\n\n\nclass ICAPResponseModification (ICAPResponse):\n\t@property\n\tdef is_content (self):\n\t\treturn self.code == 200\n\n\nclass ICAPResponseFactory:\n\tdef __init__ (self, configuration):\n\t\tself.configuration = configuration\n\n\tdef create (self, version, code, status, headers, icap_header, request_header, response_header, intercept_header=None):\n\t\tif response_header:\n\t\t\tresponse = ICAPResponseModification(version, code, status, headers, icap_header, response_header)\n\n\t\telse:\n\t\t\tresponse = ICAPRequestModification(version, code, status, headers, icap_header, request_header, intercept_header=intercept_header)\n\n\t\treturn response\n"},"license":{"kind":"string","value":"bsd-2-clause"},"hash":{"kind":"number","value":-2532343003033045000,"string":"-2,532,343,003,033,045,000"},"line_mean":{"kind":"number","value":23.5204081633,"string":"23.520408"},"line_max":{"kind":"number","value":133,"string":"133"},"alpha_frac":{"kind":"number","value":0.7145235123,"string":"0.714524"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.12890625,"string":"3.128906"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43874,"cells":{"repo_name":{"kind":"string","value":"yoe/veyepar"},"path":{"kind":"string","value":"dj/scripts/enc.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"23477"},"content":{"kind":"string","value":"#!/usr/bin/python\n\n\"\"\"\nassembles raw cuts into final, titles, tweaks audio, encodes to format for upload.\n\"\"\"\nimport re\nimport os\nimport sys\nimport subprocess\nimport xml.etree.ElementTree\n\nfrom mk_mlt import mk_mlt\n\nimport pprint\nfrom process import process\n\nfrom main.models import Client, Show, Location, Episode, Raw_File, Cut_List\n\nclass enc(process):\n\n ready_state = 2\n\n def mk_title_svg(self, raw_svg, texts):\n \"\"\"\n Make a title slide by filling in a pre-made svg with name/authors.\n return: svg\n \"\"\"\n tree = xml.etree.ElementTree.XMLID(raw_svg)\n\n for key in texts:\n if self.options.verbose:\n print(\"looking for:\", key)\n # tollerate template where tokens have been removed\n if key in tree[1]:\n\n if key == \"license\":\n # CC license image\n if self.options.verbose:\n print(\"found in svg:\", tree[1][key])\n print(\"replacing with:\", texts[key])\n t = tree[1][key]\n # import code; code.interact(local=locals())\n if texts[key] is None:\n # del(tree[1][key])\n # print tree[1].has_key(key)\n tree[1][key].clear()\n else:\n t.set('{http://www.w3.org/1999/xlink}href', texts[key])\n elif key == \"date\":\n if self.options.verbose:\n print(\"found in svg:\", tree[1][key].text)\n print(\"replacing with:\", re.split(',',texts[key])[0]) # .encode()\n tree[1][key].text = re.split(',',texts[key])[0]\n else:\n if self.options.verbose:\n print(\"found in svg:\", tree[1][key].text)\n print(\"replacing with:\", texts[key]) # .encode()\n tree[1][key].text = texts[key]\n\n # cooked_svg = xml.etree.ElementTree.tostring(tree[0])\n # print \"testing...\", \"license\" in cooked_svg\n\n if 'presenternames' in tree[1]:\n # some people like to add spiffy text near the presenter name(s)\n if texts['authors']:\n # prefix = u\"Featuring\" if \",\" in texts['authors'] else \"By\"\n # tree[1]['presenternames'].text=u\"%s %s\" % (prefix,texts['authors'])\n tree[1]['presenternames'].text = texts['authors']\n else:\n # remove the text (there is a placholder to make editing sane)\n tree[1]['presenternames'].text = \"\"\n\n cooked_svg = xml.etree.ElementTree.tostring(tree[0]).decode('ascii')\n\n return cooked_svg\n\n def get_title_text(self, episode):\n # lets try putting (stuff) on a new line\n title = episode.name\n authors = episode.authors\n\n if episode.show.slug == 'write_docs_na_2016':\n title = title.upper()\n authors = authors.upper()\n\n if False and episode.show.slug != 'pygotham_2015' and len(title) > 80: # crazy long titles need all the lines \n title2 = ''\n elif \": \" in title: # the space keeps 9:00 from breaking\n pos = title.index(\":\") + 1\n title, title2 = title[:pos], title[pos:].strip()\n elif \" - \" in title:\n # error if there is more than 1.\n title, title2 = title.split(' - ')\n elif \" -- \" in title:\n # error if there is more than 1.\n title, title2 = title.split(' -- ')\n elif \" (\" in title:\n pos = title.index(\" (\")\n # +1 skip space in \" (\"\n title, title2 = title[:pos], title[pos + 1:]\n elif \" using \" in title:\n pos = title.index(\" using \")\n title, title2 = title[:pos], title[pos + 1:]\n elif \";\" in title:\n pos = title.index(\";\") + 1\n title, title2 = title[:pos], title[pos:].strip()\n elif \"? \" in title: # ?(space) to not break on 'can you?' \n pos = title.index(\"?\") + 1\n title, title2 = title[:pos], title[pos:].strip()\n elif \". \" in title:\n pos = title.index(\". \") + 1\n title, title2 = title[:pos], title[pos:].strip()\n else:\n title2 = \"\"\n\n if episode.license:\n license = \"cc/{}.svg\".format(episode.license.lower())\n else:\n license = None\n\n if episode.tags:\n tags = episode.tags.split(',')\n tag1 = tags[0]\n else:\n tags = []\n tag1 = ''\n\n \"\"\"\n # split authors over two objects\n # breaking on comma, not space.\n if ',' in authors:\n authors = authors.split(', ')\n author2 = ', '.join(authors[1:])\n authors = authors[0].strip()\n else:\n author2 = ''\n \"\"\"\n author2 = ''\n\n date = episode.start.strftime(\"%B %-d, %Y\")\n\n # DebConf style\n # date = episode.start.strftime(\"%Y-%m-%-d\")\n\n texts = {\n 'client': episode.show.client.name,\n 'show': episode.show.name,\n 'title': title,\n 'title2': title2,\n 'tag1': tag1,\n 'authors': authors,\n 'author2': author2,\n 'presentertitle': \"\",\n 'twitter_id': episode.twitter_id,\n 'date': date,\n 'time': episode.start.strftime(\"%H:%M\"),\n 'license': license,\n 'room': episode.location.name,\n }\n\n return texts\n\n def svg2png(self, svg_name, png_name, episode):\n \"\"\"\n Make a title slide png file.\n melt uses librsvg which doesn't support flow, \n wich is needed for long titles, so render it to a .png using inkscape\n \"\"\"\n\n # create png file\n # inkscape does not return an error code on failure\n # so clean up previous run and\n # check for the existance of a new png\n if os.path.exists(png_name):\n os.remove(png_name)\n cmd = [\"inkscape\", svg_name,\n \"--export-png\", png_name,\n # \"--export-width\", \"720\",\n ]\n ret = self.run_cmds(episode, [cmd])\n ret = os.path.exists(png_name)\n\n # if self.options.verbose: print cooked_svg\n if self.options.verbose:\n print(png_name)\n\n if not ret:\n print(\"svg:\", svg_name)\n png_name = None\n\n return png_name\n\n def mk_title(self, episode):\n # make a title slide\n\n # if we find titles/custom/(slug).svg, use that\n # else make one from the tempalte\n custom_svg_name = os.path.join( \"..\",\n \"custom\", \"titles\", episode.slug + \".svg\")\n if self.options.verbose: print(\"custom:\", custom_svg_name)\n abs_path = os.path.join( self.show_dir, \"tmp\", custom_svg_name )\n if os.path.exists(abs_path):\n # cooked_svg_name = custom_svg_name\n cooked_svg_name = abs_path\n else:\n svg_name = episode.show.client.title_svg\n print(svg_name)\n template = os.path.join(\n os.path.split(os.path.abspath(__file__))[0],\n \"bling\",\n svg_name)\n\n raw_svg = open(template).read()\n\n # happy_filename = episode.slug.encode('utf-8')\n happy_filename = episode.slug\n # happy_filename = ''.join([c for c in happy_filename if c.isalpha()])\n # title_base = os.path.join(self.show_dir, \"titles\", happy_filename)\n title_base = os.path.join(\"..\", \"titles\", happy_filename)\n texts = self.get_title_text(episode)\n cooked_svg = self.mk_title_svg(raw_svg, texts)\n\n # save svg to a file\n # strip 'broken' chars because inkscape can't handle the truth\n # output_base=''.join([ c for c in output_base if c.isalpha()])\n # output_base=''.join([ c for c in output_base if ord(c)<128])\n # output_base=output_base.encode('utf-8','ignore')\n\n cooked_svg_name = os.path.join(\n self.show_dir, \"titles\", '{}.svg'.format(episode.slug))\n open(cooked_svg_name, 'w').write(cooked_svg)\n\n png_name = os.path.join( \"..\",\n \"titles\", '{}.png'.format(episode.slug))\n\n abs_path = os.path.join( self.show_dir, \"tmp\", png_name ) \n\n title_img = self.svg2png(cooked_svg_name, abs_path, episode)\n\n if title_img is None:\n print(\"missing title png\")\n return False\n\n return png_name\n\n def get_params(self, episode, rfs, cls):\n \"\"\"\n assemble a dict of params to send to mk_mlt\n mlt template, title screen image, \n filter parameters (currently just audio) \n and cutlist+raw filenames\n \"\"\"\n def get_title(episode):\n # if we find show_dir/custom/titles/(slug).svg, use that\n # else make one from the tempalte\n custom_png_name = os.path.join(\n self.show_dir, \"custom\", \"titles\", episode.slug + \".png\")\n print(\"custom:\", custom_png_name)\n if os.path.exists(custom_png_name):\n title_img = custom_png_name\n else:\n title_img = self.mk_title(episode)\n\n return title_img\n\n def get_foot(episode):\n credits_img = episode.show.client.credits\n credits_pathname = os.path.join(\"..\", \"assets\", credits_img )\n return credits_pathname\n\n def get_clips(rfs, ep):\n\n \"\"\"\n return list of possible input files\n this may get the files and store them localy.\n start/end segments are under get_cuts.\n ps. this is not used for encoding,\n just shows in ShotCut for easy dragging onto the timeline.\n \"\"\"\n\n clips = []\n for rf in rfs:\n\n clip = {'id': rf.id }\n\n # if rf.filename.startswith('\\\\'):\n # rawpathname = rf.filename\n # else:\n raw_pathname = os.path.join( \"../dv\", \n rf.location.slug, rf.filename)\n # self.episode_dir, rf.filename)\n\n # check for missing input file\n # typically due to incorrect fs mount\n abs_path = os.path.join( \n self.show_dir, \"tmp\", raw_pathname)\n \n if not os.path.exists(abs_path):\n print(( 'raw_pathname not found: \"{}\"'.format(\n abs_path)))\n return False\n\n clip['filename']=raw_pathname\n\n # trim start/end based on episode start/end\n if rf.start < ep.start < rf.end:\n # if the ep start falls durring this clip, \n # trim it\n d = ep.start - rf.start\n clip['in']=\"00:00:{}\".format(d.total_seconds())\n else:\n clip['in']=None\n\n # if \"mkv\" in rf.filename:\n # import code; code.interact(local=locals())\n\n if rf.start < ep.end < rf.end:\n # if the ep end falls durring this clip, \n d = ep.end - rf.start\n clip['out']=\"00:00:{}\".format(d.total_seconds())\n else:\n clip['out']=None\n\n pprint.pprint(clip)\n\n clips.append(clip)\n\n return clips\n\n\n def get_cuts(cls):\n\n \"\"\"\n gets the list of cuts.\n input file, start, end, filters\n ps, does not reference the clips above.\n \"\"\"\n\n def hms_to_clock(hms):\n \"\"\"\n Converts what media players show h:m:s\n to the mlt time format h:m:s.s \n for more on this:\n http://mltframework.blogspot.com/2012/04/time-properties.html\n \"\"\"\n if not hms:\n return None\n\n if \":\" not in hms:\n hms = \"0:\" + hms\n\n if \".\" not in hms:\n hms = hms + \".0\"\n\n return hms\n\n cuts = []\n for cl in cls:\n cut = {}\n\n cut['id'] = cl.id\n\n rawpathname = os.path.join( \"../dv\", \n cl.raw_file.location.slug, cl.raw_file.filename)\n # self.episode_dir, cl.raw_file.filename)\n # print(rawpathname)\n cut['filename'] = rawpathname\n\n # set start/end on the clips if they are set in the db\n # else None\n\n cut['in']=hms_to_clock(cl.start)\n cut['out']=hms_to_clock(cl.end)\n\n cut['length'] = cl.duration()\n\n if cl.episode.channelcopy:\n cut['channelcopy'] = cl.episode.channelcopy\n else:\n cut['channelcopy']='01'\n\n if cl.episode.normalise:\n cut['normalize'] = cl.episode.normalise\n else:\n cut['normalize']='-12.0'\n\n cut['video_delay']='0.0'\n\n cuts.append(cut)\n\n return cuts\n\n params = {}\n params['title_img'] = get_title(episode)\n params['foot_img'] = get_foot(episode)\n params['clips'] = get_clips(rfs, episode)\n params['cuts'] = get_cuts(cls)\n\n return params\n\n def enc_all(self, mlt_pathname, episode):\n\n def enc_one(ext):\n out_pathname = os.path.join(\n self.show_dir, ext, \"%s.%s\" % (episode.slug, ext))\n\n if ext == 'webm':\n\n parms = {\n 'dv_format': self.options.dv_format,\n 'mlt': mlt_pathname,\n 'out': out_pathname,\n 'threads': self.options.threads,\n 'test': '',\n }\n\n # cmds=[\"melt %s -profile dv_ntsc -consumer avformat:%s progress=1 acodec=libvorbis ab=128k ar=44100 vcodec=libvpx minrate=0 b=600k aspect=@4/3 maxrate=1800k g=120 qmax=42 qmin=10\"% (mlt_pathname,out_pathname,)]\n cmds = [\n \"melt -profile %(dv_format)s %(mlt)s force_aspect_ratio=@64/45 -consumer avformat:%(out)s progress=1 threads=0 ab=256k vb=2000k quality=good deadline=good deinterlace=1 deinterlace_method=yadif\" % parms]\n\n if ext == 'flv':\n cmds = [\n \"melt %(mlt)s -progress -profile %(dv_format)s -consumer avformat:%(out)s progressive=1 acodec=libfaac ab=96k ar=44100 vcodec=libx264 b=110k vpre=/usr/share/ffmpeg/libx264-hq.ffpreset\" % parms]\n\n if ext == 'flac':\n # 16kHz/mono\n cmds = [\"melt -verbose -progress %s -consumer avformat:%s ar=16000\" %\n (mlt_pathname, out_pathname)]\n\n if ext == 'mp3':\n cmds = [\"melt -verbose -progress %s -consumer avformat:%s\" %\n (mlt_pathname, out_pathname)]\n\n if ext == 'mp4':\n # High Quality Master 720x480 NTSC\n\n parms = {\n 'dv_format': self.options.dv_format,\n 'mlt': mlt_pathname,\n 'out': out_pathname,\n 'threads': self.options.threads,\n 'test': '',\n }\n\n cmd = \"melt -verbose -progress \"\\\n \"-profile %(dv_format)s %(mlt)s \"\\\n \"-consumer avformat:%(out)s \"\\\n \"threads=%(threads)s \"\\\n \"progressive=1 \"\\\n \"strict=-2 \"\\\n \"properties=x264-high \"\\\n \"ab=256k \"\\\n % parms\n\n cmd = cmd.split()\n # 2 pass causes no video track, so dumping this.\n # need to figure out how to switch between good and fast\n if False:\n cmds = [cmd + ['pass=1'],\n cmd + ['pass=2']]\n if True: # even faster!\n cmds[0].append('fastfirstpass=1')\n else:\n cmds = [cmd]\n\n # cmds.append( [\"qt-faststart\", tmp_pathname, out_pathname] )\n if self.options.rm_temp:\n cmds.append([\"rm\", tmp_pathname])\n\n if ext == 'm4v':\n # iPhone\n tmp_pathname = os.path.join(\n self.tmp_dir, \"%s.%s\" % (episode.slug, ext))\n # combine settings from 2 files\n ffpreset = open(\n '/usr/share/ffmpeg/libx264-default.ffpreset').read().split('\\n')\n ffpreset.extend(\n open('/usr/share/ffmpeg/libx264-ipod640.ffpreset').read().split('\\n'))\n ffpreset = [i for i in ffpreset if i]\n cmd = \"melt %(mlt)s -progress -profile %(dv_format)s -consumer avformat:%(tmp)s s=432x320 aspect=@4/3 progressive=1 acodec=libfaac ar=44100 ab=128k vcodec=libx264 b=70k\" % parms\n cmd = cmd.split()\n cmd.extend(ffpreset)\n cmds = [cmd]\n cmds.append([\"qt-faststart\", tmp_pathname, out_pathname])\n if self.options.rm_temp:\n cmds.append([\"rm\", tmp_pathname])\n\n if ext == 'dv':\n out_pathname = os.path.join(\n self.tmp_dir, \"%s.%s\" % (episode.slug, ext))\n cmds = [\"melt -verbose -progress %s -consumer avformat:%s pix_fmt=yuv411p progressive=1\" %\n (mlt_pathname, out_pathname)]\n if ext == 'ogv':\n # melt/ffmpeg ogv encoder is loopy,\n # so make a .dv and pass it to ffmpeg2theora\n ret = enc_one(\"dv\")\n if ret:\n dv_pathname = os.path.join(\n self.tmp_dir, \"%s.dv\" % (episode.slug,))\n cmds = [\n \"ffmpeg2theora --videoquality 5 -V 600 --audioquality 5 --channels 1 %s -o %s\" % (dv_pathname, out_pathname)]\n if self.options.rm_temp:\n cmds.append([\"rm\", dv_pathname])\n else:\n return ret\n\n # run encoder:\n if self.options.noencode:\n print(\"sorce files generated, skipping encode.\")\n if self.options.melt:\n self.run_cmd(['melt', mlt_pathname])\n ret = False\n else:\n ret = self.run_cmds(episode, cmds, )\n\n\n if ret and not os.path.exists(out_pathname):\n print(\"melt returned %ret, but no output: %s\" % \\\n (ret, out_pathname))\n ret = False\n\n return ret\n\n ret = True\n # create all the formats for uploading\n for ext in self.options.upload_formats:\n print(\"encoding to %s\" % (ext,))\n ret = enc_one(ext) and ret\n\n \"\"\"\n if self.options.enc_script:\n cmd = [self.options.enc_script,\n self.show_dir, episode.slug]\n ret = ret and self.run_cmds(episode, [cmd])\n \"\"\"\n\n return ret\n\n def dv2theora(self, episode, dv_path_name, cls, rfs):\n \"\"\"\n Not used any more.\n transcode dv to ogv\n \"\"\"\n oggpathname = os.path.join(\n self.show_dir, \"ogv\", \"%s.ogv\" % episode.slug)\n # cmd=\"ffmpeg2theora --videoquality 5 -V 600 --audioquality 5 --speedlevel 0 --optimize --keyint 256 --channels 1\".split()\n cmd = \"ffmpeg2theora --videoquality 5 -V 600 --audioquality 5 --keyint 256 --channels 1\".split()\n cmd += ['--output', oggpathname]\n cmd += [dv_path_name]\n return cmd\n\n def process_ep(self, episode):\n\n ret = False\n\n cls = Cut_List.objects.filter(\n episode=episode, apply=True).order_by('sequence')\n\n if cls:\n\n # get list of raw footage for this episode\n rfs = Raw_File.objects. \\\n filter(cut_list__episode=episode).\\\n exclude(trash=True).distinct()\n\n # get a .mlt file for this episode (mlt_pathname)\n # look for custom/slug.mlt and just use it, \n # else build one from client.template_mlt\n \n mlt_pathname = os.path.join(\n self.show_dir, \"custom\", \n \"{}.mlt\".format(episode.slug))\n\n if os.path.exists(mlt_pathname):\n print((\"found custom/slug.mlt:\\n{}\".format( mlt_pathname )))\n ret = True\n else:\n\n template_mlt = episode.show.client.template_mlt\n \n mlt_pathname = os.path.join(self.show_dir, \n \"mlt\", \"%s.mlt\" % episode.slug)\n\n params = self.get_params(episode, rfs, cls )\n\n pprint.pprint(params)\n print((2, mlt_pathname))\n ret = mk_mlt( template_mlt, mlt_pathname, params )\n\n if not ret:\n\n episode.state = 0\n episode.comment += \"\\nenc.py mlt = self.mkmlt_1 failed.\\n\"\n episode.save()\n return False\n\n# do the final encoding:\n# using melt\n ret = self.enc_all(mlt_pathname, episode)\n\n if self.options.load_temp and self.options.rm_temp:\n cmds = []\n for rf in rfs:\n dst_path = os.path.join(\n self.tmp_dir, episode.slug, os.path.dirname(rf.filename))\n rawpathname = os.path.join(\n self.tmp_dir, episode.slug, rf.filename)\n cmds.append(['rm', rawpathname])\n cmds.append(['rmdir', dst_path])\n dst_path = os.path.join(self.tmp_dir, episode.slug)\n cmds.append(['rmdir', dst_path])\n self.run_cmds(episode, cmds)\n\n else:\n\n err_msg = \"No cutlist found.\"\n episode.state = 0\n episode.comment += \"\\nenc error: %s\\n\" % (err_msg,)\n episode.save()\n\n print(err_msg)\n return False\n\n if self.options.test:\n ret = False\n\n # save the episode so the test suite can get the slug\n self.episode = episode\n\n return ret\n\n def add_more_options(self, parser):\n parser.add_option('--enc-script',\n help='encode shell script')\n parser.add_option('--noencode', action=\"store_true\",\n help=\"don't encode, just make svg, png, mlt\")\n parser.add_option('--melt', action=\"store_true\",\n help=\"call melt slug.melt (only w/noencode)\")\n parser.add_option('--load-temp', action=\"store_true\",\n help='copy .dv to temp files')\n parser.add_option('--rm-temp',\n help='remove large temp files')\n parser.add_option('--threads', \n help='thread parameter passed to encoder')\n\n def add_more_option_defaults(self, parser):\n parser.set_defaults(threads=0)\n\nif __name__ == '__main__':\n p = enc()\n p.main()\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":2883326822299327000,"string":"2,883,326,822,299,327,000"},"line_mean":{"kind":"number","value":35.0629800307,"string":"35.06298"},"line_max":{"kind":"number","value":226,"string":"226"},"alpha_frac":{"kind":"number","value":0.4814073348,"string":"0.481407"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.092921896792189,"string":"4.092922"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43875,"cells":{"repo_name":{"kind":"string","value":"GoodCloud/johnny-cache"},"path":{"kind":"string","value":"johnny/backends/memcached.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1842"},"content":{"kind":"string","value":"#!/usr/bin/env python\n# -*- coding: utf-8 -*-\n\n\"\"\"Infinite caching memcached class. Caches forever when passed a timeout\nof 0. For Django >= 1.3, this module also provides ``MemcachedCache`` and\n``PyLibMCCache``, which use the backends of their respective analogs in\ndjango's default backend modules.\n\"\"\"\n\nfrom django.core.cache.backends import memcached\nfrom django.utils.encoding import smart_str\nimport django\n\nclass CacheClass(memcached.CacheClass):\n \"\"\"By checking ``timeout is None`` rather than ``not timeout``, this\n cache class allows for non-expiring cache writes on certain backends,\n notably memcached.\"\"\"\n def _get_memcache_timeout(self, timeout=None):\n if timeout == 0: return 0 #2591999\n return super(CacheClass, self)._get_memcache_timeout(timeout)\n\nif django.VERSION[:2] > (1, 2):\n class MemcachedCache(memcached.MemcachedCache):\n \"\"\"Infinitely Caching version of django's MemcachedCache backend.\"\"\"\n def _get_memcache_timeout(self, timeout=None):\n if timeout == 0: return 0 #2591999\n return super(MemcachedCache, self)._get_memcache_timeout(timeout)\n\n class PyLibMCCache(memcached.PyLibMCCache):\n \"\"\"PyLibMCCache version that interprets 0 to mean, roughly, 30 days.\n This is because `pylibmc interprets 0 to mean literally zero seconds\n `_\n rather than \"infinity\" as memcached itself does. The maximum timeout\n memcached allows before treating the timeout as a timestamp is just\n under 30 days.\"\"\"\n def _get_memcache_timeout(self, timeout=None):\n # pylibmc doesn't like our definition of 0\n if timeout == 0: return 2591999\n return super(PyLibMCCache, self)._get_memcache_timeout(timeout)\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-7832698847422093000,"string":"-7,832,698,847,422,093,000"},"line_mean":{"kind":"number","value":46.2307692308,"string":"46.230769"},"line_max":{"kind":"number","value":93,"string":"93"},"alpha_frac":{"kind":"number","value":0.7014115092,"string":"0.701412"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.978401727861771,"string":"3.978402"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43876,"cells":{"repo_name":{"kind":"string","value":"freifunk-darmstadt/tools"},"path":{"kind":"string","value":"update-telemetry.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"8987"},"content":{"kind":"string","value":"#!/usr/bin/env python3\nimport psutil\nimport os\nimport json\nimport re\nimport itertools\nfrom contextlib import contextmanager\nimport pprint\nimport time\nimport socket\nimport subprocess\nimport logging\n\nlogger = logging.getLogger(__name__)\n\n\ndef pairwise(iterable):\n \"s -> (s0,s1), (s2,s3), (s4, s5), ...\"\n a = iter(iterable)\n return zip(a, a)\n\n\n@contextmanager\ndef get_socket(host, port):\n sock = socket.socket()\n sock.settimeout(1)\n sock.connect((host, port))\n yield sock\n sock.close()\n\n\n@contextmanager\ndef get_unix_socket(filename):\n sock = socket.socket(socket.AF_UNIX, socket.SOCK_STREAM)\n sock.settimeout(1)\n sock.connect(filename)\n yield sock\n sock.close()\n\n\ndef write_to_graphite(data, prefix='freifunk', hostname=socket.gethostname()):\n if '.' in hostname:\n hostname = hostname.split('.')[0]\n now = time.time()\n with get_socket('stats.darmstadt.freifunk.net', 2013) as s:\n for key, value in data.items():\n line = \"%s.%s.%s %s %s\\n\" % (prefix, hostname, key, value, now)\n s.sendall(line.encode('latin-1'))\n\ndef write_to_node_collector(filename, data, patterns, prefix='freifunk'):\n patterns = [re.compile(exp) for exp in patterns]\n print(data)\n updates = []\n for metric, value in data.items():\n for pattern in patterns:\n m = pattern.match(metric)\n if m:\n groups = m.groupdict()\n if all(key in groups for key in ['key']):\n updates.append([groups, value])\n break\n content = []\n for update, value in updates:\n key = update['key'].replace('.', '_')\n sub_key = update.pop('sub_key', None)\n if prefix:\n key = '{}_{}'.format(prefix, key)\n\n if sub_key:\n key += '_' + sub_key\n\n params =update.copy()\n params.pop('key')\n params = ','.join(['{}={}'.format(k, v) for k, v in params.items()])\n params = '{%s}' % (params)\n content.append('{key}{params} {value}'.format(key=key, params=params, value=value))\n with open(filename, 'w') as fh:\n fh.write('\\n'.join(content))\n\n\ndef read_from_fastd_socket(filename):\n with get_unix_socket(filename) as client:\n try:\n strings = []\n while True:\n s = client.recv(8096)\n if not s:\n break\n strings.append(s.decode('utf-8'))\n\n data = json.loads(''.join(strings))\n #pprint.pprint(data['statistics'])\n\n online_peers = len([None for name, d in data['peers'].items() if d['connection']])\n\n return {\n 'peers.count': len(data['peers']),\n 'peers.online': online_peers,\n 'rx.packets': data['statistics']['rx']['packets'],\n 'rx.bytes': data['statistics']['rx']['bytes'],\n 'rx.reordered.bytes': data['statistics']['rx_reordered']['bytes'],\n 'rx.reordered.packets': data['statistics']['rx_reordered']['packets'],\n 'tx.bytes': data['statistics']['tx']['bytes'],\n 'tx.packets': data['statistics']['tx']['packets'],\n 'tx.dropped.bytes': data['statistics']['tx_dropped']['bytes'],\n 'tx.dropped.packets': data['statistics']['tx_dropped']['packets'],\n }\n\n except Exception as e:\n print(e)\n return {}\n\n\ndef get_fastd_process_stats():\n for proc in psutil.process_iter():\n if proc.name() == 'fastd':\n # 11905: 00000000000000000000000001000000:0035 00000000000000000000000000000000:0000 07 00000000:00000000 00:00000000 00000000 0 0 4469598 2 ffff880519be5100 0\n drop_count = 0\n for proto in ['udp', 'udp6']:\n with open('/proc/{}/net/{}'.format(proc.pid, proto), 'r') as fh:\n for line in (line.strip() for line in fh.read().split('\\n')):\n if not line:\n continue\n\n if line.startswith('sl'):\n continue\n\n parts = line.split(' ')\n\n drop_count += int(parts[-1])\n\n return drop_count\n\n return None\n\n\ndef get_neighbour_table_states(family=socket.AF_INET6):\n if family is socket.AF_INET:\n family = '-4'\n elif family is socket.AF_INET6:\n family = '-6'\n else:\n return\n response = subprocess.check_output(\n ['/bin/ip', family, 'neigh', 'show', 'nud', 'all']\n ).decode()\n\n states = {'PERMANENT': 0, 'NOARP': 0, 'REACHABLE': 0, 'STALE': 0, 'NONE': 0,\n 'INCOMPLETE': 0, 'DELAY': 0, 'PROBE': 0, 'FAILED': 0}\n\n for neigh_entry in response.split('\\n'):\n if not neigh_entry:\n continue\n\n state = neigh_entry.split()[-1]\n if state not in states:\n continue\n\n states[state] += 1\n\n return states\n\n\ndef main():\n fastd_sockets = (\n ('0', '/run/fastd-ffda-vpn.sock'),\n ('1', '/run/fastd-ffda-vpn1.sock'),\n )\n\n device_name_mapping = {\n 'freifunk': 'ffda-br',\n 'bat0': 'ffda-bat',\n 'mesh-vpn': 'ffda-vpn'\n }\n device_whitelist = [\n 'eth0',\n 'ffda-vpn',\n 'ffda-vpn-1280',\n 'ffda-vpn-1312',\n 'ffda-bat',\n 'ffda-br',\n 'ffda-transport',\n 'services',\n ]\n\n fields = [\n 'bytes', 'packets', 'errs', 'drop', 'fifo',\n 'frame', 'compressed', 'multicast',\n ]\n field_format = '(?P<{direction}_{field}>\\d+)'\n\n pattern = re.compile(\n '^\\s*(?P[\\w-]+):\\s+' + '\\s+'.join(\n itertools.chain.from_iterable((field_format.format(direction=direction, field=field)\n for field in fields) for direction in ['rx', 'tx'])\n )\n )\n\n update = {}\n with open('/proc/net/dev') as fh:\n lines = fh.readlines()\n for line in lines:\n m = pattern.match(line)\n if m:\n groupdict = m.groupdict()\n device_name = groupdict.pop('device_name')\n device_name = device_name_mapping.get(device_name, device_name)\n if device_name in device_whitelist or device_name.endswith('-vpn') or \\\n device_name.endswith('-bat') or \\\n device_name.endswith('-br') or \\\n device_name.endswith('-transport'):\n for key, value in groupdict.items():\n direction, metric = key.split('_')\n update['%s.%s.%s' % (device_name, direction, metric)] = value\n\n with open('/proc/loadavg', 'r') as fh:\n line = fh.read()\n values = line.split(' ', 3)\n update['load.15'] = values[0]\n update['load.5'] = values[1]\n update['load.1'] = values[2]\n\n for key in ['count', 'max']:\n try:\n with open('/proc/sys/net/netfilter/nf_conntrack_%s' % key, 'r') as fh:\n update['netfilter.%s' % key] = fh.read().strip()\n except IOError as e:\n pass\n\n with open('/proc/net/snmp6', 'r') as fh:\n for line in fh.readlines():\n key, value = line.split(' ', 1)\n value = value.strip()\n update['ipv6.%s' % key] = value\n\n with open('/proc/net/snmp', 'r') as fh:\n for heading, values in pairwise(fh.readlines()):\n section, headings = heading.split(':')\n headings = headings.strip().split(' ')\n _, values = values.split(':')\n values = values.strip().split(' ')\n for key, value in zip(headings, values):\n update['ipv4.%s.%s' % (section, key)] = value\n\n for af, prefix in [(socket.AF_INET, 'ipv4.Neigh'),\n (socket.AF_INET6, 'ipv6.Neigh')]:\n for state, count in get_neighbour_table_states(af).items():\n update['{0}.{1}'.format(prefix, state.lower())] = count\n\n with open('/proc/stat', 'r') as fh:\n for line in fh.readlines():\n key, value = line.split(' ', 1)\n if key == 'ctxt':\n update['context_switches'] = value.strip()\n break\n\n for name, filename in fastd_sockets:\n if not os.path.exists(filename):\n continue\n\n data = read_from_fastd_socket(filename)\n if len(data) > 0:\n update.update({'fastd.%s.%s' % (name, key): value for (key, value) in data.items()})\n\n fastd_drops = get_fastd_process_stats()\n if fastd_drops:\n update['fastd.drops'] = fastd_drops\n\n #pprint.pprint(update)\n write_to_graphite(update)\n write_to_node_collector('/dev/shm/telemetry.prom', update, patterns=[\n# '^(?P[^.]+)\\.(?P(rx|tx).+)',\n '^(?Pfastd)\\.(?P.+)\\.(?P.+)',\n# '^(?Pload)\\.(?P\\d+)'\n ], prefix='ffda_')\n\nif __name__ == \"__main__\":\n main()\n"},"license":{"kind":"string","value":"agpl-3.0"},"hash":{"kind":"number","value":6942988969528593000,"string":"6,942,988,969,528,593,000"},"line_mean":{"kind":"number","value":31.3273381295,"string":"31.327338"},"line_max":{"kind":"number","value":182,"string":"182"},"alpha_frac":{"kind":"number","value":0.5168576833,"string":"0.516858"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.7665549036043586,"string":"3.766555"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43877,"cells":{"repo_name":{"kind":"string","value":"maferelo/saleor"},"path":{"kind":"string","value":"saleor/account/migrations/0001_initial.py"},"copies":{"kind":"string","value":"3"},"size":{"kind":"string","value":"19366"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\nfrom __future__ import unicode_literals\n\nimport django.db.models.deletion\nimport django.utils.timezone\nfrom django.db import migrations, models\n\n\nclass Migration(migrations.Migration):\n\n dependencies = [(\"auth\", \"0006_require_contenttypes_0002\")]\n\n replaces = [(\"userprofile\", \"0001_initial\")]\n\n operations = [\n migrations.CreateModel(\n name=\"User\",\n fields=[\n (\n \"id\",\n models.AutoField(\n verbose_name=\"ID\",\n serialize=False,\n auto_created=True,\n primary_key=True,\n ),\n ),\n (\n \"is_superuser\",\n models.BooleanField(\n default=False,\n help_text=(\n \"Designates that this user has all permissions \"\n \"without explicitly assigning them.\"\n ),\n verbose_name=\"superuser status\",\n ),\n ),\n (\"email\", models.EmailField(unique=True, max_length=254)),\n (\n \"is_staff\",\n models.BooleanField(default=False, verbose_name=\"staff status\"),\n ),\n (\n \"is_active\",\n models.BooleanField(default=False, verbose_name=\"active\"),\n ),\n (\n \"password\",\n models.CharField(\n verbose_name=\"password\", max_length=128, editable=False\n ),\n ),\n (\n \"date_joined\",\n models.DateTimeField(\n default=django.utils.timezone.now,\n verbose_name=\"date joined\",\n editable=False,\n ),\n ),\n (\n \"last_login\",\n models.DateTimeField(\n default=django.utils.timezone.now,\n verbose_name=\"last login\",\n editable=False,\n ),\n ),\n ],\n options={\"db_table\": \"userprofile_user\", \"abstract\": False},\n ),\n migrations.CreateModel(\n name=\"Address\",\n fields=[\n (\n \"id\",\n models.AutoField(\n verbose_name=\"ID\",\n serialize=False,\n auto_created=True,\n primary_key=True,\n ),\n ),\n (\n \"first_name\",\n models.CharField(max_length=256, verbose_name=\"first name\"),\n ),\n (\n \"last_name\",\n models.CharField(max_length=256, verbose_name=\"last name\"),\n ),\n (\n \"company_name\",\n models.CharField(\n max_length=256,\n verbose_name=\"company or organization\",\n blank=True,\n ),\n ),\n (\n \"street_address_1\",\n models.CharField(max_length=256, verbose_name=\"address\"),\n ),\n (\n \"street_address_2\",\n models.CharField(\n max_length=256, verbose_name=\"address\", blank=True\n ),\n ),\n (\"city\", models.CharField(max_length=256, verbose_name=\"city\")),\n (\n \"postal_code\",\n models.CharField(max_length=20, verbose_name=\"postal code\"),\n ),\n (\n \"country\",\n models.CharField(\n max_length=2,\n verbose_name=\"country\",\n choices=[\n (\"AF\", \"Afghanistan\"),\n (\"AX\", \"\\xc5land Islands\"),\n (\"AL\", \"Albania\"),\n (\"DZ\", \"Algeria\"),\n (\"AS\", \"American Samoa\"),\n (\"AD\", \"Andorra\"),\n (\"AO\", \"Angola\"),\n (\"AI\", \"Anguilla\"),\n (\"AQ\", \"Antarctica\"),\n (\"AG\", \"Antigua And Barbuda\"),\n (\"AR\", \"Argentina\"),\n (\"AM\", \"Armenia\"),\n (\"AW\", \"Aruba\"),\n (\"AU\", \"Australia\"),\n (\"AT\", \"Austria\"),\n (\"AZ\", \"Azerbaijan\"),\n (\"BS\", \"Bahamas\"),\n (\"BH\", \"Bahrain\"),\n (\"BD\", \"Bangladesh\"),\n (\"BB\", \"Barbados\"),\n (\"BY\", \"Belarus\"),\n (\"BE\", \"Belgium\"),\n (\"BZ\", \"Belize\"),\n (\"BJ\", \"Benin\"),\n (\"BM\", \"Bermuda\"),\n (\"BT\", \"Bhutan\"),\n (\"BO\", \"Bolivia\"),\n (\"BQ\", \"Bonaire, Saint Eustatius And Saba\"),\n (\"BA\", \"Bosnia And Herzegovina\"),\n (\"BW\", \"Botswana\"),\n (\"BV\", \"Bouvet Island\"),\n (\"BR\", \"Brazil\"),\n (\"IO\", \"British Indian Ocean Territory\"),\n (\"BN\", \"Brunei Darussalam\"),\n (\"BG\", \"Bulgaria\"),\n (\"BF\", \"Burkina Faso\"),\n (\"BI\", \"Burundi\"),\n (\"KH\", \"Cambodia\"),\n (\"CM\", \"Cameroon\"),\n (\"CA\", \"Canada\"),\n (\"CV\", \"Cape Verde\"),\n (\"KY\", \"Cayman Islands\"),\n (\"CF\", \"Central African Republic\"),\n (\"TD\", \"Chad\"),\n (\"CL\", \"Chile\"),\n (\"CN\", \"China\"),\n (\"CX\", \"Christmas Island\"),\n (\"CC\", \"Cocos (Keeling) Islands\"),\n (\"CO\", \"Colombia\"),\n (\"KM\", \"Comoros\"),\n (\"CG\", \"Congo\"),\n (\"CD\", \"Congo, The Democratic Republic of the\"),\n (\"CK\", \"Cook Islands\"),\n (\"CR\", \"Costa Rica\"),\n (\"CI\", \"C\\xf4te D'Ivoire\"),\n (\"HR\", \"Croatia\"),\n (\"CU\", \"Cuba\"),\n (\"CW\", \"Cura\\xe7o\"),\n (\"CY\", \"Cyprus\"),\n (\"CZ\", \"Czech Republic\"),\n (\"DK\", \"Denmark\"),\n (\"DJ\", \"Djibouti\"),\n (\"DM\", \"Dominica\"),\n (\"DO\", \"Dominican Republic\"),\n (\"EC\", \"Ecuador\"),\n (\"EG\", \"Egypt\"),\n (\"SV\", \"El Salvador\"),\n (\"GQ\", \"Equatorial Guinea\"),\n (\"ER\", \"Eritrea\"),\n (\"EE\", \"Estonia\"),\n (\"ET\", \"Ethiopia\"),\n (\"FK\", \"Falkland Islands (Malvinas)\"),\n (\"FO\", \"Faroe Islands\"),\n (\"FJ\", \"Fiji\"),\n (\"FI\", \"Finland\"),\n (\"FR\", \"France\"),\n (\"GF\", \"French Guiana\"),\n (\"PF\", \"French Polynesia\"),\n (\"TF\", \"French Southern Territories\"),\n (\"GA\", \"Gabon\"),\n (\"GM\", \"Gambia\"),\n (\"GE\", \"Georgia\"),\n (\"DE\", \"Germany\"),\n (\"GH\", \"Ghana\"),\n (\"GI\", \"Gibraltar\"),\n (\"GR\", \"Greece\"),\n (\"GL\", \"Greenland\"),\n (\"GD\", \"Grenada\"),\n (\"GP\", \"Guadeloupe\"),\n (\"GU\", \"Guam\"),\n (\"GT\", \"Guatemala\"),\n (\"GG\", \"Guernsey\"),\n (\"GN\", \"Guinea\"),\n (\"GW\", \"Guinea-Bissau\"),\n (\"GY\", \"Guyana\"),\n (\"HT\", \"Haiti\"),\n (\"HM\", \"Heard Island And Mcdonald Islands\"),\n (\"VA\", \"Holy See (Vatican City State)\"),\n (\"HN\", \"Honduras\"),\n (\"HK\", \"Hong Kong\"),\n (\"HU\", \"Hungary\"),\n (\"IS\", \"Iceland\"),\n (\"IN\", \"India\"),\n (\"ID\", \"Indonesia\"),\n (\"IR\", \"Iran, Islamic Republic of\"),\n (\"IQ\", \"Iraq\"),\n (\"IE\", \"Ireland\"),\n (\"IM\", \"Isle of Man\"),\n (\"IL\", \"Israel\"),\n (\"IT\", \"Italy\"),\n (\"JM\", \"Jamaica\"),\n (\"JP\", \"Japan\"),\n (\"JE\", \"Jersey\"),\n (\"JO\", \"Jordan\"),\n (\"KZ\", \"Kazakhstan\"),\n (\"KE\", \"Kenya\"),\n (\"KI\", \"Kiribati\"),\n (\"KP\", \"Korea, Democratic People's Republic of\"),\n (\"KR\", \"Korea, Republic of\"),\n (\"KW\", \"Kuwait\"),\n (\"KG\", \"Kyrgyzstan\"),\n (\"LA\", \"Lao People's Democratic Republic\"),\n (\"LV\", \"Latvia\"),\n (\"LB\", \"Lebanon\"),\n (\"LS\", \"Lesotho\"),\n (\"LR\", \"Liberia\"),\n (\"LY\", \"Libya\"),\n (\"LI\", \"Liechtenstein\"),\n (\"LT\", \"Lithuania\"),\n (\"LU\", \"Luxembourg\"),\n (\"MO\", \"Macao\"),\n (\"MK\", \"Macedonia, The Former Yugoslav Republic of\"),\n (\"MG\", \"Madagascar\"),\n (\"MW\", \"Malawi\"),\n (\"MY\", \"Malaysia\"),\n (\"MV\", \"Maldives\"),\n (\"ML\", \"Mali\"),\n (\"MT\", \"Malta\"),\n (\"MH\", \"Marshall Islands\"),\n (\"MQ\", \"Martinique\"),\n (\"MR\", \"Mauritania\"),\n (\"MU\", \"Mauritius\"),\n (\"YT\", \"Mayotte\"),\n (\"MX\", \"Mexico\"),\n (\"FM\", \"Micronesia, Federated States of\"),\n (\"MD\", \"Moldova, Republic of\"),\n (\"MC\", \"Monaco\"),\n (\"MN\", \"Mongolia\"),\n (\"ME\", \"Montenegro\"),\n (\"MS\", \"Montserrat\"),\n (\"MA\", \"Morocco\"),\n (\"MZ\", \"Mozambique\"),\n (\"MM\", \"Myanmar\"),\n (\"NA\", \"Namibia\"),\n (\"NR\", \"Nauru\"),\n (\"NP\", \"Nepal\"),\n (\"NL\", \"Netherlands\"),\n (\"NC\", \"New Caledonia\"),\n (\"NZ\", \"New Zealand\"),\n (\"NI\", \"Nicaragua\"),\n (\"NE\", \"Niger\"),\n (\"NG\", \"Nigeria\"),\n (\"NU\", \"Niue\"),\n (\"NF\", \"Norfolk Island\"),\n (\"MP\", \"Northern Mariana Islands\"),\n (\"NO\", \"Norway\"),\n (\"OM\", \"Oman\"),\n (\"PK\", \"Pakistan\"),\n (\"PW\", \"Palau\"),\n (\"PS\", \"Palestinian Territory, Occupied\"),\n (\"PA\", \"Panama\"),\n (\"PG\", \"Papua New Guinea\"),\n (\"PY\", \"Paraguay\"),\n (\"PE\", \"Peru\"),\n (\"PH\", \"Philippines\"),\n (\"PN\", \"Pitcairn\"),\n (\"PL\", \"Poland\"),\n (\"PT\", \"Portugal\"),\n (\"PR\", \"Puerto Rico\"),\n (\"QA\", \"Qatar\"),\n (\"RE\", \"R\\xe9union\"),\n (\"RO\", \"Romania\"),\n (\"RU\", \"Russian Federation\"),\n (\"RW\", \"Rwanda\"),\n (\"BL\", \"Saint Barth\\xe9lemy\"),\n (\"SH\", \"Saint Helena, Ascension And Tristan Da Cunha\"),\n (\"KN\", \"Saint Kitts And Nevis\"),\n (\"LC\", \"Saint Lucia\"),\n (\"MF\", \"Saint Martin (French Part)\"),\n (\"PM\", \"Saint Pierre And Miquelon\"),\n (\"VC\", \"Saint Vincent And the Grenadines\"),\n (\"WS\", \"Samoa\"),\n (\"SM\", \"San Marino\"),\n (\"ST\", \"Sao Tome And Principe\"),\n (\"SA\", \"Saudi Arabia\"),\n (\"SN\", \"Senegal\"),\n (\"RS\", \"Serbia\"),\n (\"SC\", \"Seychelles\"),\n (\"SL\", \"Sierra Leone\"),\n (\"SG\", \"Singapore\"),\n (\"SX\", \"Sint Maarten (Dutch Part)\"),\n (\"SK\", \"Slovakia\"),\n (\"SI\", \"Slovenia\"),\n (\"SB\", \"Solomon Islands\"),\n (\"SO\", \"Somalia\"),\n (\"ZA\", \"South Africa\"),\n (\"GS\", \"South Georgia and the South Sandwich Islands\"),\n (\"ES\", \"Spain\"),\n (\"LK\", \"Sri Lanka\"),\n (\"SD\", \"Sudan\"),\n (\"SR\", \"Suriname\"),\n (\"SJ\", \"Svalbard and Jan Mayen\"),\n (\"SZ\", \"Swaziland\"),\n (\"SE\", \"Sweden\"),\n (\"CH\", \"Switzerland\"),\n (\"SY\", \"Syria\"),\n (\"TW\", \"Taiwan\"),\n (\"TJ\", \"Tajikistan\"),\n (\"TZ\", \"Tanzania\"),\n (\"TH\", \"Thailand\"),\n (\"TL\", \"Timor-Leste\"),\n (\"TG\", \"Togo\"),\n (\"TK\", \"Tokelau\"),\n (\"TO\", \"Tonga\"),\n (\"TT\", \"Trinidad And Tobago\"),\n (\"TN\", \"Tunisia\"),\n (\"TR\", \"Turkey\"),\n (\"TM\", \"Turkmenistan\"),\n (\"TC\", \"Turks And Caicos Islands\"),\n (\"TV\", \"Tuvalu\"),\n (\"UG\", \"Uganda\"),\n (\"UA\", \"Ukraine\"),\n (\"AE\", \"United Arab Emirates\"),\n (\"GB\", \"United Kingdom\"),\n (\"US\", \"United States\"),\n (\"UM\", \"United States Minor Outlying Islands\"),\n (\"UY\", \"Uruguay\"),\n (\"UZ\", \"Uzbekistan\"),\n (\"VU\", \"Vanuatu\"),\n (\"VE\", \"Venezuela\"),\n (\"VN\", \"Viet Nam\"),\n (\"VG\", \"Virgin Islands, British\"),\n (\"VI\", \"Virgin Islands, U.S.\"),\n (\"WF\", \"Wallis And Futuna\"),\n (\"EH\", \"Western Sahara\"),\n (\"YE\", \"Yemen\"),\n (\"ZM\", \"Zambia\"),\n (\"ZW\", \"Zimbabwe\"),\n ],\n ),\n ),\n (\n \"country_area\",\n models.CharField(\n max_length=128, verbose_name=\"state or province\", blank=True\n ),\n ),\n (\n \"phone\",\n models.CharField(\n max_length=30, verbose_name=\"phone number\", blank=True\n ),\n ),\n ],\n options={\"db_table\": \"userprofile_address\"},\n ),\n migrations.AddField(\n model_name=\"user\",\n name=\"addresses\",\n field=models.ManyToManyField(to=\"account.Address\"),\n ),\n migrations.AddField(\n model_name=\"user\",\n name=\"default_billing_address\",\n field=models.ForeignKey(\n related_name=\"+\",\n on_delete=django.db.models.deletion.SET_NULL,\n verbose_name=\"default billing address\",\n blank=True,\n to=\"account.Address\",\n null=True,\n ),\n ),\n migrations.AddField(\n model_name=\"user\",\n name=\"default_shipping_address\",\n field=models.ForeignKey(\n related_name=\"+\",\n on_delete=django.db.models.deletion.SET_NULL,\n verbose_name=\"default shipping address\",\n blank=True,\n to=\"account.Address\",\n null=True,\n ),\n ),\n migrations.AddField(\n model_name=\"user\",\n name=\"groups\",\n field=models.ManyToManyField(\n related_query_name=\"user\",\n related_name=\"user_set\",\n to=\"auth.Group\",\n blank=True,\n help_text=(\n \"The groups this user belongs to. \"\n \"A user will get all permissions granted to each of their groups.\"\n ),\n verbose_name=\"groups\",\n ),\n ),\n migrations.AddField(\n model_name=\"user\",\n name=\"user_permissions\",\n field=models.ManyToManyField(\n related_query_name=\"user\",\n related_name=\"user_set\",\n to=\"auth.Permission\",\n blank=True,\n help_text=\"Specific permissions for this user.\",\n verbose_name=\"user permissions\",\n ),\n ),\n ]\n"},"license":{"kind":"string","value":"bsd-3-clause"},"hash":{"kind":"number","value":2425811758527500300,"string":"2,425,811,758,527,500,300"},"line_mean":{"kind":"number","value":42.6171171171,"string":"42.617117"},"line_max":{"kind":"number","value":86,"string":"86"},"alpha_frac":{"kind":"number","value":0.2917484251,"string":"0.291748"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":5.113810404013731,"string":"5.11381"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43878,"cells":{"repo_name":{"kind":"string","value":"ag-sc/QALD"},"path":{"kind":"string","value":"4/scripts/Evaluation.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"26257"},"content":{"kind":"string","value":"#!/usr/bin/env python\n# -*- coding: utf-8 -*-\n\nimport xml.dom.minidom as dom\nimport xml.dom\nfrom decimal import *\nimport sys\nimport os\nimport datetime\n#from Numeric import *\n\n\n# Dokument erzeugen\nimplement = xml.dom.getDOMImplementation()\n\n###################Globale Variablen###################\ntask=None\nchoosen_tag={}\nsystem_time=0\nfilename_out_html = None\nfilename_out_txt = None\nsystem_name=None\nconfiguration=None\ntesting=False\n\n###################Funktionen##########################\n \ndef set_system_name(name):\n global system_name\n system_name=name\n \ndef set_configuration(name):\n global configuration\n configuration=name\n \n \ndef _ausgabe_(ausgabe):\n print ausgabe\n \ndef set_filename_txt_out(time):\n global filename_out_txt\n filename_out_txt=\"upload/out\"+str(time)+\".txt\"\n \ndef set_filename_out(time):\n global filename_out_html\n filename_out_html=\"upload/out\"+str(time)+\".html\"\n\n \n \ndef _knoten_auslesen(knoten): \n try:\n string = knoten.firstChild.data.strip().encode(\"utf-8\")\n# print \"knoten_auslesen: \"+string\n return string\n\n except:\n# print \"Unexpected error:\", sys.exc_info()[0]\n pass\n\n#def _knoten_auslesen(knoten): \n# return eval(\"%s('%s')\" % (knoten.getAttribute(\"typ\"), \n# knoten.firstChild.data.strip()))\n\n\ndef lade_musterloesung(dateiname): \n d = {} \n global choosen_tag\n #baum = dom.parse(dateiname.encode( \"utf-8\" ))\n baum = dom.parse(dateiname)\n zaehler=1\n for eintrag in baum.firstChild.childNodes: \n \n if eintrag.nodeName == \"question\": \n id=(eintrag.attributes[\"id\"]).value\n question_text = query = None\n answer=[]\n for knoten in eintrag.childNodes: \n if knoten.nodeName == \"text\" or knoten.nodeName == \"string\": \n if (knoten.attributes[\"lang\"]).value == \"en\":\n question_text = _knoten_auslesen(knoten)\n elif (knoten.attributes[\"lang\"]).value == \"de\":\n question_text = _knoten_auslesen(knoten)\n elif (knoten.attributes[\"lang\"]).value == \"es\":\n question_text = _knoten_auslesen(knoten)\n elif (knoten.attributes[\"lang\"]).value == \"it\":\n question_text = _knoten_auslesen(knoten)\n elif (knoten.attributes[\"lang\"]).value == \"fr\":\n question_text = _knoten_auslesen(knoten)\n elif (knoten.attributes[\"lang\"]).value == \"nl\":\n question_text = _knoten_auslesen(knoten)\n \n# elif knoten.nodeName == \"query\": \n# query=knoten.firstChild.data.strip()\n if knoten.nodeName==\"answers\":\n answer_elem_1=[]\n for knoten_answer in knoten.childNodes:\n\t\t\t#here i have to check for optional. \n if knoten_answer.nodeName==\"answer\":\n answer_elem=[] \n for knoten_answer1 in knoten_answer.childNodes:\n for id_loesung,tag_loesung in choosen_tag.iteritems():\n if(id==id_loesung):\n ###########################\n #\n #\n # In QALD3 only uri/boolean/number and date are allowed, so string is \"turned off\"\n #\n #\n ###########################\n if knoten_answer1.nodeName == \"string\" and choosen_tag[id]==\"string\":\n try:\n answer_elem.append(knoten_answer1.firstChild.data.strip())\n except Exception:\n answer_elem.append(\" \")\n \n if knoten_answer1.nodeName == \"boolean\" and choosen_tag[id]==\"boolean\":\n try:\n answer_elem.append(knoten_answer1.firstChild.data.strip())\n except Exception:\n answer_elem.append(\" \")\n \n if knoten_answer1.nodeName == \"number\"and choosen_tag[id]==\"number\":\n try:\n answer_elem.append(knoten_answer1.firstChild.data.strip())\n except Exception:\n answer_elem.append(\" \")\n \n if knoten_answer1.nodeName == \"date\" and choosen_tag[id]==\"date\":\n try:\n answer_elem.append(knoten_answer1.firstChild.data.strip())\n except Exception:\n answer_elem.append(\" \")\n \n if knoten_answer1.nodeName == \"uri\" and choosen_tag[id]==\"uri\":\n try:\n answer_elem.append(knoten_answer1.firstChild.data.strip())\n except Exception:\n answer_elem.append(\" \")\n \n \n \n answer_elem_1.append(answer_elem)\n \n answer.append(answer_elem_1)\n # print(answer)\n d[id] = [query,question_text,answer]\n# print str(d)\n return d\n\n\n\ndef bearbeite_baum(dateiname):\n #setze Zeielnumbrueche, damit der Parser spaeter besser mit dem Dokument zurecht kommt\n fobj = open(dateiname, \"r\") \n string=\"\"\n for line1 in fobj: \n line=str(line1)\n line=line.replace('','\\n')\n line=line.replace('','\\n')\n line=line.replace('','\\n')\n line=line.replace('','\\n')\n line=line.replace('','\\n')\n line=line.replace('','\\n')\n line=line.replace('','\\n')\n line=line.replace('','\\n')\n line=line.replace('','\\n')\n line=line.replace('','\\n')\n line=line.replace('','\\n')\n line=line.replace('','\\n')\n #line=line.replace('&','&amp;')\n string+=line\n fobj.close()\n # print string\n fobj = open(dateiname, \"w\") \n fobj.write(string) \n fobj.close()\n\n\ndef lade_baum(dateiname): \n d = {}\n bearbeite_baum(dateiname)\n global choosen_tag\n global testing\n# print \"after bearbeite baum\"\n baum = dom.parse(dateiname.encode( \"utf-8\" ))\n zaehler=1\n# print \"after parsing baum\"\n for eintrag in baum.firstChild.childNodes: \n \n if(zaehler==1):\n knoten_id=((eintrag.parentNode).attributes[\"id\"]).value\n zaehler=2\n# print \"after 1\"\n \n if eintrag.nodeName == \"question\": \n# print \"in question\"\n id=(eintrag.attributes[\"id\"]).value\n# print \"id: \"+str(id)\n question_text = query = None\n answer=[]\n \n for knoten in eintrag.childNodes: #\n# print \"in for knoten in eintrag.childNodes: \"\n if knoten.nodeName == \"text\" or knoten.nodeName == \"string\": \n if (knoten.attributes[\"lang\"]).value == \"en\":\n question_text = _knoten_auslesen(knoten)\n elif (knoten.attributes[\"lang\"]).value == \"de\":\n question_text = _knoten_auslesen(knoten)\n elif (knoten.attributes[\"lang\"]).value == \"es\":\n question_text = _knoten_auslesen(knoten)\n elif (knoten.attributes[\"lang\"]).value == \"it\":\n question_text = _knoten_auslesen(knoten)\n elif (knoten.attributes[\"lang\"]).value == \"fr\":\n question_text = _knoten_auslesen(knoten)\n elif (knoten.attributes[\"lang\"]).value == \"nl\":\n question_text = _knoten_auslesen(knoten)\n\n# print str(question_txt)\n \n# elif knoten.nodeName == \"query\": \n# query=knoten.firstChild.data.strip()\n elif knoten.nodeName==\"answers\":\n try:\n answer_elem_1=[]\n for knoten_answer in knoten.childNodes:\n if knoten_answer.nodeName==\"answer\":\n answer_elem=[]\n \n ###########################\n #\n #\n # In QALD3 only uri/boolean/number and date are allowed, so string is \"turned off\"\n #\n #\n ###########################\n \n mehr_als_ein_typ=False\n eins=zwei=None\n eins=((knoten_answer.childNodes).item(1)).nodeName\n if((knoten_answer.childNodes).item(3)):\n zwei=((knoten_answer.childNodes).item(3)).nodeName\n else:\n zwei= None\n if(eins==zwei or zwei==None):\n mehr_als_ein_typ=False\n choosen_tag[id]=((knoten_answer.childNodes).item(1)).nodeName\n else:\n mehr_als_ein_typ=True\n #choosen_tag[id]=\"string\"\n choosen_tag[id]=\"uri\"\n \n \n for knoten_answer1 in knoten_answer.childNodes:\n if(knoten_answer1.nodeName!=\"#text\"):\n \n if knoten_answer1.nodeName == \"string\" and mehr_als_ein_typ==False:\n try:\n answer_elem.append(knoten_answer1.firstChild.data.strip())\n except Exception:\n answer_elem.append(\" \")\n if knoten_answer1.nodeName == \"boolean\" and mehr_als_ein_typ==False:\n try:\n answer_elem.append(knoten_answer1.firstChild.data.strip())\n except Exception:\n answer_elem.append(\" \")\n if knoten_answer1.nodeName == \"number\" and mehr_als_ein_typ==False:\n try:\n answer_elem.append(knoten_answer1.firstChild.data.strip())\n except Exception:\n answer_elem.append(\" \")\n if knoten_answer1.nodeName == \"date\" and mehr_als_ein_typ==False:\n try:\n answer_elem.append(knoten_answer1.firstChild.data.strip())\n except Exception:\n answer_elem.append(\" \")\n if knoten_answer1.nodeName == \"uri\" and mehr_als_ein_typ==False:\n try:\n answer_elem.append(knoten_answer1.firstChild.data.strip())\n except Exception:\n answer_elem.append(\" \")\n #if knoten_answer1.nodeName == choosen_tag[id] and mehr_als_ein_typ==True:\n # try:\n # answer_elem.append(knoten_answer1.firstChild.data.strip())\n # except Exception:\n # answer_elem.append(\" \")\n answer_elem_1.append(answer_elem)\n except Exception as inst:\n error= \" ERROR

\"+str(type(inst))+\"

\"+str(inst.args)+\"

\"+str(inst)+\"

\"+id+\"

PLEASE CHECK YOUR XML FILE

\"\n outfile=open(filename_out_html,\"w\")\n # _ausgabe_(filename_out_html)\n outfile.write(error)\n outfile.close()\n choosen_tag[id]=\"string\"\n answer_elem_1.append(\"ERROR IN FILE\")\n# print \"Unexpected error:\", sys.exc_info()[0]\n# print \"9\"\n \n \n answer.append(answer_elem_1)\n d[question_text] = [query,id,answer]\n# print str(d)\n return d\n\n \n\n\ndef sortedDictValues2(adict):\n keys = adict.keys()\n keys.sort()\n return [dict[key] for key in keys]\n\n\ndef _evaluation(loesung, musterloesung, task):\n anzahl_bearbeiteter_fragen=0\n anzahl_korrekter_antworten=0\n anzahl_falscher_antworten=0\n falsche_antworten=[]\n anzahl_bearbeiteter_fragen=len(loesung)\n bewertung_ausgabe={}\n #number_answers_goldstandard = 0\n number_answers_user = 0\n #for question_text, query_loesung in musterloesung.iteritems():\n # gold_loesung1=query_loesung[2]\n # gold_loesung=gold_loesung1[0]\n # number_answer_goldstandard += len(gold_loesung)\n \n \n for question_text, query_loesung in loesung.iteritems():\n \n \n anzahl_falscher_frageelemente=anzahl_richtiger_frageelemente=0\n R=P=F=0\n# print question_text\n# print\n# print str(query_loesung[2])\n answer_loesung1=query_loesung[2]\n answer_loesung=answer_loesung1[0]\n \n number_answers_user += len(answer_loesung)\n \n loesung_id=query_loesung[1]\n answer_musterloesung1=musterloesung[loesung_id]\n answer_musterloesung2=answer_musterloesung1[2]\n answer_musterloesung=answer_musterloesung2[0]\n \n #print \"user: \"+str(answer_loesung)\n #print \"gold: \"+str(answer_musterloesung)\n \n \n if len(answer_musterloesung) == len(answer_loesung) and len(answer_loesung) == 0:\n bewertung_ausgabe[loesung_id]=[question_text,str(1.0),str(1.0),str(1.0)]\n anzahl_korrekter_antworten+=1\n elif(len(answer_loesung)==0):\n # anzahl_falscher_fragen+=1\n anzahl_falscher_antworten+=1\n falsche_antworten.append(loesung_id)\n R=P=F=0\n bewertung_ausgabe[loesung_id]=[question_text,str(R),str(P),str(F)]\n \n \n \n else:\n if(len(answer_musterloesung)>len(answer_loesung)):\n anzahl_falscher_antworten+=1\n anzahl_falscher_frageelemente+=(len(answer_musterloesung)-len(answer_loesung))\n falsche_antworten.append(loesung_id)\n for i in range(0,len(answer_loesung)):\n for j in range(0,len(answer_musterloesung)):\n if(answer_loesung[i]==answer_musterloesung[j]):\n anzahl_richtiger_frageelemente+=1\n break\n if(anzahl_richtiger_frageelemente==0):\n R=F=P=0\n else:\n R1=Decimal(anzahl_richtiger_frageelemente)\n R2=Decimal(len(answer_musterloesung))\n R=round((R1/R2),5)\n P1=R1\n P2=Decimal(len(answer_loesung))\n P=round((P1/P2),5)\n F=round(((2*P*R)/(R+P)),5)\n \n bewertung_ausgabe[loesung_id]=[question_text,str(R),str(P),str(F)]\n \n \n else:\n for i in range(0,len(answer_loesung)):\n for j in range(0,len(answer_musterloesung)):\n if(answer_loesung[i]==answer_musterloesung[j]):\n anzahl_richtiger_frageelemente+=1\n break\n if(anzahl_richtiger_frageelemente==len(answer_loesung)):\n anzahl_korrekter_antworten+=1\n else:\n anzahl_falscher_antworten+=1\n falsche_antworten.append(loesung_id)\n if(anzahl_richtiger_frageelemente==0):\n R=F=P=0\n else:\n R1=Decimal(anzahl_richtiger_frageelemente)\n R2=Decimal(len(answer_musterloesung))\n R=round((R1/R2),5)\n P1=R1\n P2=Decimal(len(answer_loesung))\n P=round((P1/P2),5)\n F=round(((2*P*R)/(R+P)),5)\n\n bewertung_ausgabe[loesung_id]=[question_text,str(R),str(P),str(F)] \n \n \n if(anzahl_korrekter_antworten==0):\n fmeasure=recall=precision=0\n else:\n wert1=Decimal(anzahl_korrekter_antworten)\n wert2=Decimal(anzahl_bearbeiteter_fragen)\n recall=round(((wert1/len(musterloesung))),5)\n precision=round(((wert1/wert2)),5)\n fmeasure=round(((2*recall*precision)/(recall+precision)),5)\n \n recall=str(recall) \n precision=str(precision)\n fmeasure=str(fmeasure)\n number_correct_user_answers = anzahl_bearbeiteter_fragen\n anzahl_bearbeiteter_fragen=str(anzahl_bearbeiteter_fragen)\n anzahl_korrekter_antworten=str(anzahl_korrekter_antworten)\n anzahl_falscher_antworten=str(anzahl_falscher_antworten)\n\n ############################################################################################\n # #\n #Recall = Overall numbers of correct answers / overall number of goldstandard answers #\n #Precision = Overall numbers of correct answers / overall number of all answers(given xml)\n #F-Measure = (2*Recall*Precision)/(Recall+Precision) \n # # \n ############################################################################################\n\n \n global_precision=0.0\n global_recall=0.0\n global_fmeasure=0.0\n for id,value in bewertung_ausgabe.iteritems():\n tmp = id +\";\"\n x = value[0]\n x = x.decode(\"ascii\",\"ignore\")\n tmp += x +\";\"\n tmp += str(value[2])+\";\"\n tmp += str(value[1])+\";\"\n tmp += str(value[3])+\";\"\n #print\"tmp: \"+ tmp\n #tmp = (id+\";\"+str(value[0])+\";\"+str(value[2])+\";\"+str(value[1])+\";\"+str(value[3])+\"\\n\").encode(\"utf-8\")\n\tstring = \"qald-4_\"\n if task == 1: string += \"multilingual\"\n\tif task == 2: string += \"biomedical\"\n\tif task == 3: string += \"hybrid\"\n\tstring += tmp\n global_precision += float(value[2])\n global_recall += float(value[1])\n\n if global_recall == 0.0 or global_precision == 0.0:\n global_precision = str(0)\n global_recall = str(0)\n global_fmeasure = str(0)\n else:\n global_precision = global_precision/len(musterloesung)\n global_recall = global_recall/len(musterloesung)\n \n global_fmeasure=str((2*global_recall*global_precision)/(global_precision + global_recall))\n global_precision = str(global_precision)\n global_recall = str(global_recall)\n\n write_html(string,anzahl_falscher_antworten,anzahl_korrekter_antworten,anzahl_bearbeiteter_fragen,global_fmeasure,global_precision,global_recall,bewertung_ausgabe,falsche_antworten)\n\n\ndef write_txt(anzahl_falscher_antworten,anzahl_korrekter_antworten,anzahl_bearbeiteter_fragen,fmeasure,precision,recall,bewertung_ausgabe,falsche_antworten):\n \n #global system_name, configuration\n bla=\"\"\n bla=system_name+\";\"+configuration+\"\\n\"\n globale_uebersicht_txt= anzahl_bearbeiteter_fragen+\";\"+anzahl_korrekter_antworten+\";\"+anzahl_falscher_antworten+\";\"+recall+\";\"+precision+\";\"+fmeasure+\"\\n\"\n string=\"\"\n for id,answer in bewertung_ausgabe.iteritems():\n question = answer[0]\n question = question.decode(\"ascii\",\"ignore\")\n \n string += id+\";\"+question+\";\"+answer[1]+\";\"+answer[2]+\";\"+answer[3]+\"\\n\"\n\n outfile=open(filename_out_txt,\"w\")\n outfile.write(bla+globale_uebersicht_txt+string)\n outfile.close()\n _ausgabe_(filename_out_txt)\n \n \n \ndef write_html(string,anzahl_falscher_antworten,anzahl_korrekter_antworten,anzahl_bearbeiteter_fragen,fmeasure,precision,recall,bewertung_ausgabe,falsche_antworten):\n tabelle3=\"\"\n string_question =\"\"\n for i in range(0,len(falsche_antworten)):\n string_question+=\"\"\n end_tabelle3=\"
Failed questions (IDs)
\"+str(falsche_antworten[i])+\"
\"\n \n start_table= \" Evaluation of \"+string+\"

Evaluation

Skript Version 5.5

\"\n space=\"

\"\n tabelle1=\"\"\n tabelle2=\"
IDQuestionRecallPrecisionF-Measure
\"\n inhalt_tabelle2=\"\" \n end_tabelle2=\"
Number of constructed QueriesNumber of correct AnswersNumber of wrong AnswersGlobal RecallGlobal PrecisionGlobal F-Measure
\"+anzahl_bearbeiteter_fragen+\"\"+anzahl_korrekter_antworten+\"\"+anzahl_falscher_antworten+\"\"+recall+\"\"+precision+\"\"+fmeasure+\"
\"\n end_tabelle1=\"\"\n \n ende=\" \"\n string=\"\"\n for id,answer in bewertung_ausgabe.iteritems():\n question = answer[0]\n question = question.decode(\"ascii\",\"ignore\")\n string_bla=\"\"+id+\"\"+question+\"\"+answer[1]+\"\"+answer[2]+\"\"+answer[3]+\"\"\n string+=string_bla \n\n outfile=open(filename_out_html,\"w\")\n outfile.write(start_table+space+tabelle2+inhalt_tabelle2+end_tabelle2+space+tabelle1+string+end_tabelle1+space+tabelle3+string_question+end_tabelle3+ende)\n outfile.close()\n _ausgabe_(filename_out_html)\n\n\n\n################### MAIN ##################################################\n\ndef main():\n global system_time, testing, task\n \n system_time = datetime.datetime.now()\n set_filename_out(system_time)\n set_filename_txt_out(system_time)\n #print system_time\n #print filename_out_html\n\n # Train or Test\n if sys.argv[2] == \"test\": \n testing = True\n else:\n testing = False\n\n # Task\n task = sys.argv[3]\n\n # Set gold standard\n gold = '../data/qald-4_'\n if task == '1': gold += 'multilingual'\n elif task == '2': gold += 'biomedical'\n elif task == '3': gold += 'hybrid'\n if testing: gold += '_test'\n else: gold += '_train' \n gold += '_withanswers.xml'\n\n import urllib\n dateiname=sys.argv[1]\n if (len(sys.argv)>=6):\n set_system_name(sys.argv[4])\n set_configuration(sys.argv[5])\n else:\n set_system_name(\"None\")\n set_configuration(\"None\") \n \n loesung=None\n try:\n loesung=lade_baum(dateiname)\n except Exception as inst:\n error= \" ERROR

\"+str(type(inst))+\"

\"+str(inst.args)+\"

\"+str(inst)+\"

PLEASE CHECK YOUR XML FILE

\"\n outfile=open(filename_out_html,\"w\")\n outfile.write(error)\n outfile.close()\n _ausgabe_(filename_out_html) \n# print \"Unexpected error:\", sys.exc_info()[0]\n# print \"8\"\n \n \n gstandard_importet=True\n \n try:\n musterloesung=lade_musterloesung(urllib.urlopen(gold))\n except Exception as inst:\n error= \" ERROR

\"+str(type(inst))+\"

\"+str(inst.args)+\"

\"+str(inst)+\"

\"\n write_error(error)\n# print \"Unexpected error:\", sys.exc_info()[0]\n# print \"7\"\n \n else:\n _evaluation(loesung,musterloesung,task)\n# print \"Unexpected error:\", sys.exc_info()[0]\n# print \"6\"\n \n\n\ndef write_error(error):\n global filename_out_html\n outfile=open(filename_out_html,\"w\")\n outfile.write(error)\n outfile.close()\n _ausgabe_(filename_out_html)\n\nif __name__ == \"__main__\":\n main()\n \n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-724464349123768700,"string":"-724,464,349,123,768,700"},"line_mean":{"kind":"number","value":42.6888519135,"string":"42.688852"},"line_max":{"kind":"number","value":235,"string":"235"},"alpha_frac":{"kind":"number","value":0.473778421,"string":"0.473778"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.872142751806518,"string":"3.872143"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43879,"cells":{"repo_name":{"kind":"string","value":"Re4son/Kali-Pi"},"path":{"kind":"string","value":"Menus/menu_pause.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1785"},"content":{"kind":"string","value":"#!/usr/bin/env python\nimport pygame, os, sys, subprocess, time\nimport RPi.GPIO as GPIO\nfrom pygame.locals import *\nfrom subprocess import *\nif \"TFT\" in os.environ and os.environ[\"TFT\"] == \"0\":\n # No TFT screen\n SCREEN=0\n pass\nelif \"TFT\" in os.environ and os.environ[\"TFT\"] == \"2\":\n # TFT screen with mouse\n SCREEN=2\n os.environ[\"SDL_FBDEV\"] = \"/dev/fb1\"\nelif \"TFT\" in os.environ and os.environ[\"TFT\"] == \"3\":\n # HDMI touchscreen\n SCREEN=3\n os.environ[\"SDL_FBDEV\"] = \"/dev/fb0\"\n os.environ[\"SDL_MOUSEDEV\"] = \"/dev/input/touchscreen\"\n os.environ[\"SDL_MOUSEDRV\"] = \"TSLIB\"\nelif \"TFT\" in os.environ and os.environ[\"TFT\"] == \"4\":\n # Raspberry Pi 7\" touchscreen\n SCREEN=4\n from ft5406 import Touchscreen\n os.environ[\"SDL_FBDEV\"] = \"/dev/fb0\"\n ts = Touchscreen()\nelse:\n # TFT touchscreen\n SCREEN=1\n os.environ[\"SDL_FBDEV\"] = \"/dev/fb1\"\n os.environ[\"SDL_MOUSEDEV\"] = \"/dev/input/touchscreen\"\n os.environ[\"SDL_MOUSEDRV\"] = \"TSLIB\"\n\n# Initialize pygame modules individually (to avoid ALSA errors) and hide mouse\npygame.font.init()\npygame.display.init()\npygame.mouse.set_visible(0)\n\n# Initialise GPIO\nGPIO.setwarnings(False)\n\n\n#While loop to manage touch screen inputs\nstate = [False for x in range(10)]\nwhile 1:\n if SCREEN==4:\n for touch in ts.poll():\n if state[touch.slot] != touch.valid:\n if touch.valid:\n sys.exit()\n else:\n for event in pygame.event.get():\n if event.type == pygame.MOUSEBUTTONDOWN:\n sys.exit()\n\n #Debug:\n #ensure there is always a safe way to end the program if the touch screen fails\n ##if event.type == KEYDOWN:\n ## if event.key == K_ESCAPE:\n ## sys.exit()\n\n time.sleep(0.4)\n"},"license":{"kind":"string","value":"gpl-3.0"},"hash":{"kind":"number","value":3545909162319380500,"string":"3,545,909,162,319,380,500"},"line_mean":{"kind":"number","value":28.262295082,"string":"28.262295"},"line_max":{"kind":"number","value":87,"string":"87"},"alpha_frac":{"kind":"number","value":0.6145658263,"string":"0.614566"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.142605633802817,"string":"3.142606"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43880,"cells":{"repo_name":{"kind":"string","value":"foobarbazblarg/stayclean"},"path":{"kind":"string","value":"stayclean-2016-april/serve-signups-with-flask.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"8086"},"content":{"kind":"string","value":"#!/usr/bin/python\n\nimport subprocess\nimport praw\nfrom hashlib import sha1\nfrom flask import Flask\nfrom flask import Response\nfrom flask import request\nfrom cStringIO import StringIO\nfrom base64 import b64encode\nfrom base64 import b64decode\nfrom ConfigParser import ConfigParser\nimport OAuth2Util\nimport os\nimport markdown\nimport bleach\n# encoding=utf8\nimport sys\nfrom participantCollection import ParticipantCollection\n\nreload(sys)\nsys.setdefaultencoding('utf8')\n\n\n# Edit Me!\n# Each day after you post a signup post, copy its 6-character ID to this array.\nsignupPageSubmissionIds = [ '4bvb7i', '4c1crs', '4c5lvg', '4ca9ff', '4cf91t', '4ckta7', '4cp4ir' ]\nflaskport = 8883\n\napp = Flask(__name__)\napp.debug = True\ncommentHashesAndComments = {}\n\n\ndef loginAndReturnRedditSession():\n config = ConfigParser()\n config.read(\"../reddit-password-credentials.cfg\")\n user = config.get(\"Reddit\", \"user\")\n password = config.get(\"Reddit\", \"password\")\n # TODO: password auth is going away, and we will soon need to do oauth.\n redditSession = praw.Reddit(user_agent='Test Script by /u/foobarbazblarg')\n redditSession.login(user, password, disable_warning=True)\n # submissions = redditSession.get_subreddit('pornfree').get_hot(limit=5)\n # print [str(x) for x in submissions]\n return redditSession\n\n\ndef loginOAuthAndReturnRedditSession():\n redditSession = praw.Reddit(user_agent='Test Script by /u/foobarbazblarg')\n o = OAuth2Util.OAuth2Util(redditSession, print_log=True, configfile=\"../reddit-oauth-credentials.cfg\")\n o.refresh(force=True)\n return redditSession\n\n\ndef getSubmissionsForRedditSession(redditSession):\n submissions = [redditSession.get_submission(submission_id=submissionId) for submissionId in signupPageSubmissionIds]\n for submission in submissions:\n submission.replace_more_comments(limit=None, threshold=0)\n return submissions\n\n\ndef getCommentsForSubmissions(submissions):\n comments = []\n for submission in submissions:\n comments += praw.helpers.flatten_tree(submission.comments)\n return comments\n\n\ndef retireCommentHash(commentHash):\n with open(\"retiredcommenthashes.txt\", \"a\") as commentHashFile:\n commentHashFile.write(commentHash + '\\n')\n\n\ndef retiredCommentHashes():\n with open(\"retiredcommenthashes.txt\", \"r\") as commentHashFile:\n # return commentHashFile.readlines()\n return commentHashFile.read().splitlines()\n\n\n@app.route('/moderatesignups.html')\ndef moderatesignups():\n global commentHashesAndComments\n commentHashesAndComments = {}\n stringio = StringIO()\n stringio.write('\\n\\n\\n\\n')\n\n # redditSession = loginAndReturnRedditSession()\n redditSession = loginOAuthAndReturnRedditSession()\n submissions = getSubmissionsForRedditSession(redditSession)\n flat_comments = getCommentsForSubmissions(submissions)\n retiredHashes = retiredCommentHashes()\n i = 1\n stringio.write('\\n')\n stringio.write(\"

\")\n stringio.write(os.getcwd())\n stringio.write(\"
\\n\")\n for submission in submissions:\n stringio.write(submission.title)\n stringio.write(\"
\\n\")\n stringio.write(\"

\\n\\n\")\n stringio.write('
')\n stringio.write('')\n stringio.write('
')\n for comment in flat_comments:\n # print comment.is_root\n # print comment.score\n i += 1\n commentHash = sha1()\n commentHash.update(comment.permalink)\n commentHash.update(comment.body.encode('utf-8'))\n commentHash = commentHash.hexdigest()\n if commentHash not in retiredHashes:\n commentHashesAndComments[commentHash] = comment\n authorName = str(comment.author) # can be None if author was deleted. So check for that and skip if it's None.\n stringio.write(\"
\\n\")\n stringio.write('')\n stringio.write(authorName) # can be None if author was deleted. So check for that and skip if it's None.\n stringio.write('
')\n if ParticipantCollection().hasParticipantNamed(authorName):\n stringio.write(' (member)')\n # if ParticipantCollection().participantNamed(authorName).isStillIn:\n # stringio.write(' (in)')\n # else:\n # stringio.write(' (out)')\n else:\n stringio.write(' (not a member)')\n stringio.write('
')\n stringio.write('')\n # stringio.write('')\n # stringio.write('')\n # stringio.write('')\n stringio.write('')\n stringio.write('')\n stringio.write('')\n stringio.write('')\n stringio.write('')\n stringio.write('
')\n\n stringio.write(bleach.clean(markdown.markdown(comment.body.encode('utf-8')), tags=['p']))\n stringio.write(\"\\n

\\n\\n\")\n\n stringio.write('')\n pageString = stringio.getvalue()\n stringio.close()\n return Response(pageString, mimetype='text/html')\n\n\n@app.route('/takeaction.html', methods=[\"POST\"])\ndef takeaction():\n username = b64decode(request.form[\"username\"])\n commentHash = str(request.form[\"commenthash\"])\n # commentPermalink = request.form[\"commentpermalink\"]\n actionToTake = request.form[\"actiontotake\"]\n # print commentHashesAndComments\n comment = commentHashesAndComments[commentHash]\n # print \"comment: \" + str(comment)\n if actionToTake == 'Signup':\n print \"signup - \" + username\n subprocess.call(['./signup.py', username])\n comment.upvote()\n retireCommentHash(commentHash)\n # if actionToTake == 'Signup and checkin':\n # print \"signup and checkin - \" + username\n # subprocess.call(['./signup-and-checkin.sh', username])\n # comment.upvote()\n # retireCommentHash(commentHash)\n # elif actionToTake == 'Relapse':\n # print \"relapse - \" + username\n # subprocess.call(['./relapse.py', username])\n # comment.upvote()\n # retireCommentHash(commentHash)\n # elif actionToTake == 'Reinstate':\n # print \"reinstate - \" + username\n # subprocess.call(['./reinstate.py', username])\n # comment.upvote()\n # retireCommentHash(commentHash)\n elif actionToTake == 'Skip comment':\n print \"Skip comment - \" + username\n comment.upvote()\n retireCommentHash(commentHash)\n elif actionToTake == \"Skip comment and don't upvote\":\n print \"Skip comment and don't upvote - \" + username\n retireCommentHash(commentHash)\n return Response(\"hello\", mimetype='text/html')\n\n\n@app.route('/copydisplayduringsignuptoclipboard.html', methods=[\"POST\"])\ndef copydisplayduringsignuptoclipboard():\n print \"TODO: Copy display to clipboard\"\n subprocess.call(['./display-during-signup.py'])\n return Response(\"hello\", mimetype='text/html')\n\n\nif __name__ == '__main__':\n app.run(host='127.0.0.1', port=flaskport)\n\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":8488130493691722000,"string":"8,488,130,493,691,722,000"},"line_mean":{"kind":"number","value":40.2551020408,"string":"40.255102"},"line_max":{"kind":"number","value":129,"string":"129"},"alpha_frac":{"kind":"number","value":0.67350977,"string":"0.67351"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.771455223880597,"string":"3.771455"},"config_test":{"kind":"bool","value":true,"string":"true"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43881,"cells":{"repo_name":{"kind":"string","value":"zhibolau/webApp"},"path":{"kind":"string","value":"www/models.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1589"},"content":{"kind":"string","value":"#!/usr/bin/env python\n# -*- coding: utf-8 -*-\n\n__author__ = 'Zhibo Liu'\n\nimport time,uuid\nfrom transwarp.db import next_id # 直接from Import会出错 必须在那个目录下建立__init__.py 文件!!!!!!!!\nfrom transwarp.orm import Model, StringField, BooleanField, FloatField, TextField\n\nclass User(Model):\n __table__ = 'users'\n\n id = StringField(primary_key=True, default=next_id, ddl='varchar(50)')\n email = StringField(updatable=False, ddl='varchar(50)')\n password = StringField(ddl='varchar(50)')\n admin = BooleanField()\n name = StringField(ddl='varchar(50)')\n image = StringField(ddl='varchar(500)')\n created_at = FloatField(updatable=False, default=time.time)\n\nclass Blog(Model):\n __table__ = 'blogs'\n\n id = StringField(primary_key=True, default=next_id, ddl='varchar(50)')\n user_id = StringField(updatable=False, ddl='varchar(50)')\n user_name = StringField(ddl='varchar(50)')\n user_image = StringField(ddl='varchar(500)')\n name = StringField(ddl='varchar(50)')\n summary = StringField(ddl='varchar(200)')\n content = TextField()\n created_at = FloatField(updatable=False, default=time.time)\n\nclass Comment(Model):\n __table__ = 'comments'\n\n id = StringField(primary_key=True, default=next_id, ddl='varchar(50)')\n blog_id = StringField(updatable=False, ddl='varchar(50)')\n user_id = StringField(updatable=False, ddl='varchar(50)')\n user_name = StringField(ddl='varchar(50)')\n user_image = StringField(ddl='varchar(500)')\n content = TextField()\n created_at = FloatField(updatable=False, default=time.time)\n\n"},"license":{"kind":"string","value":"gpl-2.0"},"hash":{"kind":"number","value":-8860960697945917000,"string":"-8,860,960,697,945,917,000"},"line_mean":{"kind":"number","value":35.1627906977,"string":"35.162791"},"line_max":{"kind":"number","value":86,"string":"86"},"alpha_frac":{"kind":"number","value":0.677170418,"string":"0.67717"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.2061855670103094,"string":"3.206186"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43882,"cells":{"repo_name":{"kind":"string","value":"thomaserlang/XenBackup"},"path":{"kind":"string","value":"src/xenbackup/XenAPI.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"9750"},"content":{"kind":"string","value":"# Copyright (c) Citrix Systems, Inc.\n# All rights reserved.\n#\n# Redistribution and use in source and binary forms, with or without\n# modification, are permitted provided that the following conditions are\n# met:\n#\n# 1) Redistributions of source code must retain the above copyright\n# notice, this list of conditions and the following disclaimer.\n#\n# 2) Redistributions in binary form must reproduce the above copyright\n# notice, this list of conditions and the following disclaimer in\n# the documentation and/or other materials provided with the\n# distribution.\n#\n# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS\n# \"AS IS\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT\n# LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR\n# A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT\n# HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,\n# SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT\n# LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,\n# DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY\n# THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT\n# (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE\n# OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.\n# --------------------------------------------------------------------\n# Parts of this file are based upon xmlrpclib.py, the XML-RPC client\n# interface included in the Python distribution.\n#\n# Copyright (c) 1999-2002 by Secret Labs AB\n# Copyright (c) 1999-2002 by Fredrik Lundh\n#\n# By obtaining, using, and/or copying this software and/or its\n# associated documentation, you agree that you have read, understood,\n# and will comply with the following terms and conditions:\n#\n# Permission to use, copy, modify, and distribute this software and\n# its associated documentation for any purpose and without fee is\n# hereby granted, provided that the above copyright notice appears in\n# all copies, and that both that copyright notice and this permission\n# notice appear in supporting documentation, and that the name of\n# Secret Labs AB or the author not be used in advertising or publicity\n# pertaining to distribution of the software without specific, written\n# prior permission.\n#\n# SECRET LABS AB AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH REGARD\n# TO THIS SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANT-\n# ABILITY AND FITNESS. IN NO EVENT SHALL SECRET LABS AB OR THE AUTHOR\n# BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY\n# DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS,\n# WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS\n# ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE\n# OF THIS SOFTWARE.\n# --------------------------------------------------------------------\n\nimport gettext\nimport xmlrpclib\nimport httplib\nimport socket\nimport sys\nimport ssl\n\ntranslation = gettext.translation('xen-xm', fallback = True)\n\nAPI_VERSION_1_1 = '1.1'\nAPI_VERSION_1_2 = '1.2'\n\nclass Failure(Exception):\n def __init__(self, details):\n self.details = details\n\n def __str__(self):\n try:\n return str(self.details)\n except Exception, exn:\n import sys\n print >>sys.stderr, exn\n return \"Xen-API failure: %s\" % str(self.details)\n\n def _details_map(self):\n return dict([(str(i), self.details[i])\n for i in range(len(self.details))])\n\n\n# Just a \"constant\" that we use to decide whether to retry the RPC\n_RECONNECT_AND_RETRY = object()\n\nclass UDSHTTPConnection(httplib.HTTPConnection):\n \"\"\"HTTPConnection subclass to allow HTTP over Unix domain sockets. \"\"\"\n def connect(self):\n path = self.host.replace(\"_\", \"/\")\n self.sock = socket.socket(socket.AF_UNIX, socket.SOCK_STREAM)\n self.sock.connect(path)\n\nclass UDSHTTP(httplib.HTTP):\n _connection_class = UDSHTTPConnection\n\nclass UDSTransport(xmlrpclib.Transport):\n def __init__(self, use_datetime=0):\n self._use_datetime = use_datetime\n self._extra_headers=[]\n def add_extra_header(self, key, value):\n self._extra_headers += [ (key,value) ]\n def make_connection(self, host):\n # Python 2.4 compatibility\n if sys.version_info[0] <= 2 and sys.version_info[1] < 6:\n return UDSHTTP(host)\n else:\n return UDSHTTPConnection(host)\n def send_request(self, connection, handler, request_body):\n connection.putrequest(\"POST\", handler)\n for key, value in self._extra_headers:\n connection.putheader(key, value)\n\nclass Session(xmlrpclib.ServerProxy):\n \"\"\"A server proxy and session manager for communicating with xapi using\n the Xen-API.\n\n Example:\n\n session = Session('http://localhost/')\n session.login_with_password('me', 'mypassword')\n session.xenapi.VM.start(vm_uuid)\n session.xenapi.session.logout()\n \"\"\"\n\n def __init__(self, uri, transport=None, encoding=None, verbose=0,\n allow_none=1):\n try:\n xmlrpclib.ServerProxy.__init__(self, uri, transport, encoding,\n verbose, allow_none, context=ssl._create_unverified_context())\n except AttributeError:\n xmlrpclib.ServerProxy.__init__(self, uri, transport, encoding, verbose, allow_none)\n self.transport = transport\n self._session = None\n self.last_login_method = None\n self.last_login_params = None\n self.API_version = API_VERSION_1_1\n\n\n def xenapi_request(self, methodname, params):\n if methodname.startswith('login'):\n self._login(methodname, params)\n return None\n elif methodname == 'logout' or methodname == 'session.logout':\n self._logout()\n return None\n else:\n retry_count = 0\n while retry_count < 3:\n full_params = (self._session,) + params\n result = _parse_result(getattr(self, methodname)(*full_params))\n if result is _RECONNECT_AND_RETRY:\n retry_count += 1\n if self.last_login_method:\n self._login(self.last_login_method,\n self.last_login_params)\n else:\n raise xmlrpclib.Fault(401, 'You must log in')\n else:\n return result\n raise xmlrpclib.Fault(\n 500, 'Tried 3 times to get a valid session, but failed')\n\n\n def _login(self, method, params):\n result = _parse_result(getattr(self, 'session.%s' % method)(*params))\n if result is _RECONNECT_AND_RETRY:\n raise xmlrpclib.Fault(\n 500, 'Received SESSION_INVALID when logging in')\n self._session = result\n self.last_login_method = method\n self.last_login_params = params\n self.API_version = self._get_api_version()\n\n def _logout(self):\n try:\n if self.last_login_method.startswith(\"slave_local\"):\n return _parse_result(self.session.local_logout(self._session))\n else:\n return _parse_result(self.session.logout(self._session))\n finally:\n self._session = None\n self.last_login_method = None\n self.last_login_params = None\n self.API_version = API_VERSION_1_1\n\n def _get_api_version(self):\n pool = self.xenapi.pool.get_all()[0]\n host = self.xenapi.pool.get_master(pool)\n major = self.xenapi.host.get_API_version_major(host)\n minor = self.xenapi.host.get_API_version_minor(host)\n return \"%s.%s\"%(major,minor)\n\n def __getattr__(self, name):\n if name == 'handle':\n return self._session\n elif name == 'xenapi':\n return _Dispatcher(self.API_version, self.xenapi_request, None)\n elif name.startswith('login') or name.startswith('slave_local'):\n return lambda *params: self._login(name, params)\n else:\n return xmlrpclib.ServerProxy.__getattr__(self, name)\n\ndef xapi_local():\n return Session(\"http://_var_xapi_xapi/\", transport=UDSTransport())\n\ndef _parse_result(result):\n if type(result) != dict or 'Status' not in result:\n raise xmlrpclib.Fault(500, 'Missing Status in response from server' + result)\n if result['Status'] == 'Success':\n if 'Value' in result:\n return result['Value']\n else:\n raise xmlrpclib.Fault(500,\n 'Missing Value in response from server')\n else:\n if 'ErrorDescription' in result:\n if result['ErrorDescription'][0] == 'SESSION_INVALID':\n return _RECONNECT_AND_RETRY\n else:\n raise Failure(result['ErrorDescription'])\n else:\n raise xmlrpclib.Fault(\n 500, 'Missing ErrorDescription in response from server')\n\n\n# Based upon _Method from xmlrpclib.\nclass _Dispatcher:\n def __init__(self, API_version, send, name):\n self.__API_version = API_version\n self.__send = send\n self.__name = name\n\n def __repr__(self):\n if self.__name:\n return '' % self.__name\n else:\n return ''\n\n def __getattr__(self, name):\n if self.__name is None:\n return _Dispatcher(self.__API_version, self.__send, name)\n else:\n return _Dispatcher(self.__API_version, self.__send, \"%s.%s\" % (self.__name, name))\n\n def __call__(self, *args):\n return self.__send(self.__name, args)\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-7467321875946531000,"string":"-7,467,321,875,946,531,000"},"line_mean":{"kind":"number","value":38.156626506,"string":"38.156627"},"line_max":{"kind":"number","value":101,"string":"101"},"alpha_frac":{"kind":"number","value":0.6282051282,"string":"0.628205"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.263226934849147,"string":"4.263227"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43883,"cells":{"repo_name":{"kind":"string","value":"mohseniaref/PySAR-1"},"path":{"kind":"string","value":"pysar/pysarApp.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"21751"},"content":{"kind":"string","value":"#! /usr/bin/env python\n###############################################################################\n# \n# Project: PySAR \n# Purpose: Python Module for InSAR Time-series Analysis\n# Author: Heresh Fattahi\n# Created: July 2013\n# Modified: Yunjun Zhang, Feb 2015\n###############################################################################\n# Copyright (c) 2013, Heresh Fattahi\n#\n# Permission is hereby granted, free of charge, to any person obtaining a\n# copy of this software and associated documentation files (the \"Software\"),\n# to deal in the Software without restriction, including without limitation\n# the rights to use, copy, modify, merge, publish, distribute, sublicense,\n# and/or sell copies of the Software, and to permit persons to whom the\n# Software is furnished to do so, subject to the following conditions:\n#\n# The above copyright notice and this permission notice shall be included\n# in all copies or substantial portions of the Software.\n#\n# THE SOFTWARE IS PROVIDED \"AS IS\", WITHOUT WARRANTY OF ANY KIND, EXPRESS\n# OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,\n# FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL\n# THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER\n# LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING\n# FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER\n# DEALINGS IN THE SOFTWARE.\n###############################################################################\n\n\nimport os\nimport sys\nimport glob\nimport time\nimport _readfile as readfile\nimport h5py\nimport subprocess\nfrom pysar._pysar_utilities import check_variable_name\n\n\ndef radar_Or_geo(igramFile):\n\n h5file=h5py.File(igramFile,'r')\n \n igramList=h5file['interferograms'].keys()\n\n if 'X_FIRST' in h5file['interferograms'][igramList[0]].attrs.keys():\n rdr_geo='geo'\n else:\n rdr_geo='radar'\n h5file.close()\n return rdr_geo\n\n\ndef Usage():\n\n print '''\n*******************************************************\n*******************************************************\n*******************************************************\n*******************************************************\n********* OOOOO OOOOO O OOOO *********\n********* O O O O O O O O O *********\n********* OOOOO OOO OOOOO OOOOO OOOO ********* \n********* O O O O O O O *********\n********* O OOO OOOOO O O O O *********\n********* *********\n*******************************************************\n*******************************************************\n*******************************************************\n*******************************************************\nA Python Module for InSAR time-series analysis.\nPySAR v1.0 July 2013, InSAR Lab, RSMAS, University of Miami\n\nusage:\n \n pysarApp.py TEMPLATEFILE\n\nexample:\n\n pysarApp.py /nethome/hfattahi/SanAndreasT356EnvD.template\n pysarApp.py $TE/SanAndreasT356EnvD.template\n\n*******************************************************\nTemplate file options:\n\npysar.inputdata=/scratch/hfattahi/PROCESS/SanAndreasT356EnvD/DONE/IFG*/filt*0*c10.unw\npysar.CorFiles = /scratch/hfattahi/PROCESS/SanAndreasT356EnvD/DONE/IFG*/filt*0*.cor\npysar.wraped = /scratch/hfattahi/PROCESS/SanAndreasT356EnvD/DONE/IFG*/filt*0*.int\npysar.geomap = /scratch/hfattahi/PROCESS/SanAndreasT356EnvD/GEO/geomap_12/geomap_8rlks.trans\npysar.dem = /scratch/hfattahi/PROCESS/SanAndreasT356EnvD/DONE/IFG_20050102_20070809/radar_8lks.hgt\n\npysar.subset.yx = 1800:2000,700:800\npysar.seed.ll=31.5, 67 or pysar.seed.yx=257 , 151\n\npysar.unwrap_error = yes [no]\n\npysar.tropospheric_delay = yes ['no']\npysar.tropospheric_delay.method = pyaps ['height-correlation'] \npysar.Numerical_Weather_Model = ECMWF ['MERRA', 'NARR']\npysar.acquisition_time = 00:00 ['06:00', '12:00', '18:00']\n\npysar.topo_error = yes [no]\n\npysar.orbit_error = yes [np]\npysar.orbit_error.method = plane ['quadratic', 'plane', 'quardatic_range', 'quadratic_azimiuth', 'plane_range', 'plane_azimuth','baselineCor','BaseTropCor']\n\npysar.mask=yes\npysar.mask.threshold = 0.7\npysar.geocode = yes\n*******************************************************\n '''\n#########################################\ndef main(argv):\n try:\n templateFile = argv[1]\n except:\n Usage();sys.exit(1)\n\n projectName = os.path.basename(templateFile.partition('.')[0])\n\n try:\n tssarProjectDir = os.getenv('TSSARDIR') +'/'+projectName\n except:\n tssarProjectDir = os.getenv('SCRATCHDIR') + '/' + projectName + \"/TSSAR\" # FA 7/2015: adopted for new directory structure\n \n print \"QQ \" + tssarProjectDir\n if not os.path.isdir(tssarProjectDir): os.mkdir(tssarProjectDir)\n os.chdir(tssarProjectDir)\n\n igramFile = 'LoadedData.h5'\n Modified_igramFile = 'Modified_LoadedData.h5'\n if os.path.isfile(Modified_igramFile):\n print Modified_igramFile + ' already exists.'\n igramFile=Modified_igramFile\n\n template = readfile.read_template(templateFile)\n Rlooks = template['Rlooks_unw']\n\n#########################################\n# Loading interferograms\n#########################################\n print '******************************************'\n print''\n if os.path.isfile(igramFile):\n print igramFile + ' already exists.'\n else:\n loadCmd='load_data.py ' + templateFile \n print loadCmd\n os.system(loadCmd)\n\n# copyDemCmd='copy_dem_trans.py ' + templateFile\n# print copyDemCmd\n# os.system(copyDemCmd)\n print''\n print '******************************************'\n\n\n#########################################\n# Check the subset\n#########################################\n try:\n subset= template['pysar.subset.yx'].split(',')\n print subset\n print subset[0]\n subsetOutName='subset_'+igramFile\n subsetCmd='subset.py -f '+ igramFile + ' -y '+subset[0]+' -x '+subset[1] + ' -o ' + subsetOutName\n print '*****************************************'\n print 'Subset the area ...'\n print subsetCmd\n os.system(subsetCmd)\n igramFile=subsetOutName\n print '*****************************************'\n except:\n print '*****************************************'\n print 'No Subset selected. Processing the whole area'\n print '*****************************************'\n\n#########################################\n#Referencing all interferograms to the same pixel \n#########################################\n rdr_or_geo=radar_Or_geo(igramFile) \n print '******************************************'\n print''\n if os.path.isfile('Seeded_'+igramFile):\n igramFile = 'Seeded_'+igramFile\n print igramFile + ' already exists.'\n else:\n print 'referncing all interferograms to the same pixel.'\n if 'pysar.seed.ll' in template.keys():\n 'Checking the lat/lon refernce point' \n lat= template['pysar.seed.ll'].split(',')[0]\n lon= template['pysar.seed.ll'].split(',')[1]\n seedCmd= 'SeedData.py -f ' + igramFile + ' -l ' +lat+ ' -L '+lon\n elif 'pysar.seed.yx' in template.keys():\n 'Checking y/x reference point'\n y= template['pysar.seed.yx'].split(',')[0]\n x= template['pysar.seed.yx'].split(',')[1]\n seedCmd= 'seed_data.py -f ' + igramFile + ' -y ' +y+ ' -x '+x\n else: \n seedCmd= 'seed_data.py -f ' + igramFile\n\n igramFile = 'Seeded_'+igramFile\n print seedCmd \n os.system(seedCmd)\n print''\n print '******************************************'\n\n############################################\n#unwrapping error correction based on the \n# consistency of triplets of interferograms \n############################################\n print '******************************************'\n print''\n try:\n template['pysar.unwrap_error']\n if template['pysar.unwrap_error'] in ('y','yes','Yes','YES'):\n print 'unwrapping error correction might take a while depending on the size of your data set! '\n unwCmd='unwrap_error.py '+igramFile\n os.system(unwCmd)\n igramFile=igramFile.split('.')[0]+'_unwCor.h5' \n else:\n print 'No unwrapping error correction.'\n except:\n print 'No unwrapping error correction.'\n print''\n print '******************************************'\n\n#########################################\n# inversion of interferograms\n########################################\n print '******************************************'\n print''\n if os.path.isfile(igramFile.split('.')[0]+'_unwCor.h5'):\n igramFile = igramFile.split('.')[0]+'_unwCor.h5'\n print igramFile + ' exists.'\n\n if os.path.isfile('timeseries.h5'):\n print 'timeseries.h5 already exists, inversion is not needed.'\n else:\n invertCmd = 'igram_inversion.py '+ igramFile \n print invertCmd\n os.system(invertCmd)\n timeseriesFile='timeseries.h5'\n print''\n print '******************************************'\n\n##############################################\n#temporal coherence: \n#A parameter to evaluate the consistency of \n# timeseries with the interferograms\n##############################################\n print '******************************************'\n print''\n# if os.path.isfile('temporal_coherence.h5'):\n# print 'temporal_coherence.h5 already exists.'\n# else:\n# tempcohCmd='temporal_coherence.py '+igramFile+' '+timeseriesFile\n# print tempcohCmd\n# os.system(tempcohCmd)\n tempcohCmd='temporal_coherence.py '+igramFile+' '+timeseriesFile\n print tempcohCmd\n os.system(tempcohCmd)\n print''\n print '******************************************'\n\n\n##############################################\n#update Mask based on temporal coherence\n# add by Yunjun Feb 15, 2015\n##############################################\n print '******************************************'\n print''\n try:\n template['pysar.mask']\n if template['pysar.mask'] in ('yes','Yes','YES','y'):\n print 'Updating mask according to temporal coherence'\n cohT=template['pysar.mask.threshold']\n maskCmd='generate_mask.py -f temporal_coherence.h5 -m '+ cohT +' -M 1.0 -o Mask.h5'\n print maskCmd\n os.system(maskCmd)\n else:\n print 'No update for mask.'\n except:\n print 'No update for mask.'\n print''\n print '******************************************'\n\n\n##############################################\n# Generate incident angle\n# add by Yunjun Feb 15, 2015 \n##############################################\n print '******************************************'\n print''\n inciCmd='incidence_angle.py -f timeseries.h5'\n print inciCmd\n os.system(inciCmd)\n print''\n print '******************************************'\n\n##############################################\n#If Satellite is Envisat and if Coordinate\n#system is radar then LOD correction\n##############################################\n print '******************************************'\n print''\n h5file=h5py.File(timeseriesFile,'r')\n if rdr_or_geo =='radar':\n if h5file['timeseries'].attrs['PLATFORM']=='ENVISAT':\n LODcmd='lod.py '+timeseriesFile\n print LODcmd\n os.system(LODcmd)\n timeseriesFile=timeseriesFile.split('.')[0]+'_LODcor.h5'\n print''\n print '******************************************'\n\n\n##############################################\n# Tropospheric Correction\n##############################################\n print '******************************************'\n print''\n\n try:\n if (template['pysar.tropospheric_delay'] in ('y','yes','Yes','YES')) and template['pysar.orbit_error.method']=='BaseTropCor':\n print '''\n +++++++++++++++++++++++++++++++++++++++++++++++++++\n WARNING:\n Orbital error correction was BaseTropCor.\n Tropospheric correction was already applied simultaneous with baseline error correction.\n Tropospheric correction can not be applied again.\n To apply the tropospheric correction separate from baseline error correction, chhose other existing options for orbital error correction.\n +++++++++++++++++++++++++++++++++++++++++++++++++++ \n '''\n template['pysar.tropospheric_delay']='no'\n except:\n print 'Checking the tropospheric delay correction ...'\n\n if template['pysar.tropospheric_delay'] in ('y','yes','Yes','YES'): \n # demFile='radar_'+Rlooks+'rlks.hgt'\n demFile=template['pysar.dem']\n demFile=check_variable_name(demFile)\n# print 'DEM file: '+demFile\n if not os.path.isfile(demFile):\n print '++++++++++++++++++++++++++++++++++++++++++++++'\n print 'Error:'\n print 'DEM (radar_*rlks.hgt file) was not found!'\n print 'Continue without tropospheric correction ...'\n print '++++++++++++++++++++++++++++++++++++++++++++++'\n else: \n if template['pysar.tropospheric_delay.method'] in ['height-correlation','height_correlation','Height-Correlation','Height_Correlation']:\n print 'tropospheric delay correction with height-correlation approach'\n try:\n polyOrder=template['pysar.trop.polyOrder']\n except:\n print 'Deafult polynomial order for troposphreic correction = 1'\n polyOrder='1'\n cmdTrop='tropospheric_correction.py'+ ' -f '+ timeseriesFile + ' -d '+ demfile + ' -p '+ polyOrder\n os.system(cmdTrop)\n timeseriesFile=timeseriesFile.split('.')[0]+'_tropCor.h5'\n \n elif template['pysar.tropospheric_delay.method']=='pyaps':\n print 'Atmospheric correction using Numerical Weather Models (using PyAPS software)'\n print 'reading DEM, source of NWM and acquisition time from template file'\n source_of_NWM=template['pysar.Numerical_Weather_Model']\n print 'Numerical Weather Model: '+source_of_NWM\n acquisition_time=template['pysar.acquisition_time']\n print 'acquisition time: '+acquisition_time\n# cmdTrop = [\"tropcor_pyaps.py -f \",timeseriesFile,\" -d \",demFile,\" -s \",source_of_NWM,\" -h \",acquisition_time,\" -i incidence_angle.h5\"]\n cmdTrop = 'tropcor_pyaps.py -f '+timeseriesFile+ ' -d '+ demFile +' -s ' + source_of_NWM + ' -h '+ acquisition_time + ' -i incidence_angle.h5'\n print cmdTrop\n os.system(cmdTrop)\n# subprocess.Popen(cmdTrop).wait()\n timeseriesFile=timeseriesFile.split('.')[0]+'_'+source_of_NWM+'.h5'\n else:\n print 'Atmospheric correction method not recognized.'\n else:\n print 'No atmospheric delay correction.'\n print''\n print '******************************************'\n\n \n##############################################\n#topographic residuals\n##############################################\n print '******************************************'\n print''\n try:\n template['pysar.topo_error']\n if template['pysar.topo_error'] in ('yes','Yes','YES','y'):\n print 'Correcting topographic residuals'\n topoCmd='dem_error.py '+ timeseriesFile +' '+ igramFile\n print topoCmd\n os.system(topoCmd)\n timeseriesFile=timeseriesFile.split('.')[0]+'_demCor.h5'\n else:\n print 'No correction for topographic residuals.'\n except:\n print 'No correction for topographic residuals.' \n print''\n print '******************************************' \n\n##############################################\n#Orbit correction \n##############################################\n print '******************************************'\n print''\n try:\n template['pysar.orbit_error']\n if template['pysar.orbit_error'] in ('yes','Yes','YES','y'):\n try:\n orbit_error_method=template['pysar.orbit_error.method']\n print 'orbit error correction method : '+orbit_error_method\n if orbit_error_method in ['quadratic', 'plane', 'quardatic_range', 'quadratic_azimiuth', 'plane_range', 'plane_azimuth']: \n orbitCmd='remove_plane.py '+timeseriesFile+' '+template['pysar.orbit_error.method'] #+ ' Mask.h5'\n timeseriesFile=timeseriesFile.split('.')[0]+'_'+template['pysar.orbit_error.method']+'.h5'\n print orbitCmd\n os.system(orbitCmd)\n elif orbit_error_method == 'baselineCor':\n orbitCmd='baseline_error.py ' +timeseriesFile #+ ' Mask.h5'\n print orbitCmd\n \n try:\n h5file=h5py.File(timeseriesFile,'r')\n daz=float(h5file['timeseries'].attrs['AZIMUTH_PIXEL_SIZE'])\n os.system(orbitCmd)\n timeseriesFile=timeseriesFile.split('.')[0]+'_'+template['pysar.orbit_error.method']+'.h5'\n except:\n print 'WARNING!'\n print 'Skipping orbital error correction.'\n print 'baselineCor method can only be applied in radar coordinate'\n \n elif orbit_error_method =='BaseTropCor':\n demfile=template['pysar.dem']\n demfile=check_variable_name(demfile)\n try:\n polyOrder=template['pysar.trop.polyOrder']\n except:\n print 'Deafult polynomial order for troposphreic correction = 1'\n polyOrder=1 \n try:\n h5file=h5py.File(timeseriesFile,'r')\n daz=float(h5file['timeseries'].attrs['AZIMUTH_PIXEL_SIZE']) \n orbitCmd='baseline_trop.py '+timeseriesFile+' '+ demfile +' '+ polyOrder +'range_and_azimuth'\n print 'Joint estimation of Baseline error and tropospheric delay [height-correlation approach]'\n print orbitCmd\n os.system(orbitCmd)\n timeseriesFile=timeseriesFile.split('.')[0]+'_'+template['pysar.orbit_error.method']+'.h5'\n except:\n print 'WARNING!'\n print 'Skipping orbital error correction.'\n print 'baselineCor method can only be applied in radar coordinate'\n else:\n print '+++++++++++++++++++++++++++++++++++++++++++++++++++++++'\n print 'WARNING!'\n print 'Orbital error correction method was not recognized!'\n print 'Possible options are:'\n print 'quadratic, plane, quardatic_range, quadratic_azimiuth, plane_range, plane_azimuth,baselineCor,BaseTropCor'\n print 'Continue without orbital errors correction...'\n print '+++++++++++++++++++++++++++++++++++++++++++++++++++++++'\n \n except:\n print 'No orbital errors correction.'\n else:\n print 'No orbital errors correction.'\n except:\n print 'No orbital errors correction.'\n print''\n print '******************************************'\n\n#############################################\n#Velocity and rmse maps\n#############################################\n\n print '******************************************'\n print''\n velCmd='timeseries2velocity.py '+timeseriesFile\n print velCmd\n os.system(velCmd)\n print''\n print '******************************************'\n\n#############################################\n#Masking the velocity based on the temporal \n#coherence or rmse if it's specified\n#############################################\n print '******************************************'\n print''\n try:\n template['pysar.mask']\n if template['pysar.mask'] in ('yes','Yes','YES','y'):\n try: \n template['pysar.mask.threshold']\n maskCmd='masking.py -f velocity.h5 -m temporal_coherence.h5 -t '+template['pysar.mask.threshold']\n print 'Masking the velocity file using the temporal coherence with the threshold of '+template['pysar.mask.threshold']\n except:\n maskCmd='Masking.py -f velocity.h5 -m temporal_coherence.h5 -t 0.7'\n print 'Masking the velocity file using the temporal coherence with the threshold of 0.7'\n \n os.system(maskCmd)\n# rmCmd='rm velocity.h5'\n# os.system(rmCmd)\n# mvCmd='mv velocity_masked.h5 velocity.h5'\n# os.system(mvCmd)\n else:\n print 'No masking applied'\n except:\n print 'No masking applied'\n print''\n print '******************************************'\n\n############################################\n#Geocoding\n############################################\n print '******************************************'\n print''\n try:\n template['pysar.geocode']\n if template['pysar.geocode'] in ('y','yes','Yes','YES'):\n geomapFile='geomap_'+Rlooks+'rlks.trans'\n# geoCmd = 'geocode.py '+timeseriesFile+' '+geomapFile\n# print geoCmd\n# os.system(geoCmd)\n geoCmd = 'geocode.py velocity.h5 '+geomapFile\n print geoCmd\n os.system(geoCmd)\n geoCmd = 'geocode.py Mask.h5 '+geomapFile\n print geoCmd\n os.system(geoCmd)\n \n# maskCmd = 'Masking.py -f geo_'+timeseriesFile+' -m geo_Mask.h5'\n# print maskCmd\n# os.system(maskCmd)\n maskCmd = 'masking.py -f geo_velocity.h5 -m geo_Mask.h5'\n print maskCmd\n os.system(maskCmd)\n else:\n print 'No geocoding applied'\n except: \n print 'No geocoding applied'\n print''\n print '******************************************'\n\n\n#############################################\n# PySAR v1.0 #\n#############################################\n print''\n print '###############################################'\n print ''\n print 'End of PySAR processing.'\n print ''\n print '################################################'\n\n\nif __name__ == '__main__':\n main(sys.argv[:])\n\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":6423405613165199000,"string":"6,423,405,613,165,199,000"},"line_mean":{"kind":"number","value":37.8410714286,"string":"37.841071"},"line_max":{"kind":"number","value":157,"string":"157"},"alpha_frac":{"kind":"number","value":0.5073789711,"string":"0.507379"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.9785988659228098,"string":"3.978599"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43884,"cells":{"repo_name":{"kind":"string","value":"qbuat/rootpy"},"path":{"kind":"string","value":"rootpy/tree/model.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"5162"},"content":{"kind":"string","value":"# Copyright 2012 the rootpy developers\n# distributed under the terms of the GNU General Public License\nfrom __future__ import absolute_import\n\nimport inspect\nfrom cStringIO import StringIO\nimport types\n\nimport ROOT\n\nfrom .. import log; log = log[__name__]\nfrom .treetypes import Column\nfrom .treebuffer import TreeBuffer\n\n__all__ = [\n 'TreeModel',\n]\n\n\nclass TreeModelMeta(type):\n \"\"\"\n Metaclass for all TreeModels\n Addition/subtraction of TreeModels is handled\n as set union and difference of class attributes\n \"\"\"\n def __new__(cls, name, bases, dct):\n for attr, value in dct.items():\n TreeModelMeta.checkattr(attr, value)\n return type.__new__(cls, name, bases, dct)\n\n def __add__(cls, other):\n return type('_'.join([cls.__name__, other.__name__]),\n (cls, other), {})\n\n def __iadd__(cls, other):\n return cls.__add__(other)\n\n def __sub__(cls, other):\n attrs = dict(set(cls.get_attrs()).difference(set(other.get_attrs())))\n return type('_'.join([cls.__name__, other.__name__]),\n (TreeModel,), attrs)\n\n def __isub__(cls, other):\n return cls.__sub__(other)\n\n def __setattr__(cls, attr, value):\n TreeModelMeta.checkattr(attr, value)\n type.__setattr__(cls, attr, value)\n\n @classmethod\n def checkattr(metacls, attr, value):\n \"\"\"\n Only allow class attributes that are instances of\n rootpy.types.Column, ROOT.TObject, or ROOT.ObjectProxy\n \"\"\"\n if not isinstance(value, (\n types.MethodType,\n types.FunctionType,\n classmethod,\n staticmethod,\n property)):\n if attr in dir(type('dummy', (object,), {})) + \\\n ['__metaclass__']:\n return\n if attr.startswith('_'):\n raise SyntaxError(\n \"TreeModel attribute `{0}` \"\n \"must not start with `_`\".format(attr))\n if not inspect.isclass(value):\n if not isinstance(value, Column):\n raise TypeError(\n \"TreeModel attribute `{0}` \"\n \"must be an instance of \"\n \"`rootpy.tree.treetypes.Column`\".format(attr))\n return\n if not issubclass(value, (ROOT.TObject, ROOT.ObjectProxy)):\n raise TypeError(\n \"TreeModel attribute `{0}` must inherit \"\n \"from `ROOT.TObject` or `ROOT.ObjectProxy`\".format(\n attr))\n\n def prefix(cls, name):\n \"\"\"\n Create a new TreeModel where class attribute\n names are prefixed with ``name``\n \"\"\"\n attrs = dict([(name + attr, value) for attr, value in cls.get_attrs()])\n return TreeModelMeta(\n '_'.join([name, cls.__name__]),\n (TreeModel,), attrs)\n\n def suffix(cls, name):\n \"\"\"\n Create a new TreeModel where class attribute\n names are suffixed with ``name``\n \"\"\"\n attrs = dict([(attr + name, value) for attr, value in cls.get_attrs()])\n return TreeModelMeta(\n '_'.join([cls.__name__, name]),\n (TreeModel,), attrs)\n\n def get_attrs(cls):\n \"\"\"\n Get all class attributes ordered by definition\n \"\"\"\n ignore = dir(type('dummy', (object,), {})) + ['__metaclass__']\n attrs = [\n item for item in inspect.getmembers(cls) if item[0] not in ignore\n and not isinstance(\n item[1], (\n types.FunctionType,\n types.MethodType,\n classmethod,\n staticmethod,\n property))]\n # sort by idx and use attribute name to break ties\n attrs.sort(key=lambda attr: (getattr(attr[1], 'idx', -1), attr[0]))\n return attrs\n\n def to_struct(cls, name=None):\n \"\"\"\n Convert the TreeModel into a compiled C struct\n \"\"\"\n if name is None:\n name = cls.__name__\n basic_attrs = dict([(attr_name, value)\n for attr_name, value in cls.get_attrs()\n if isinstance(value, Column)])\n if not basic_attrs:\n return None\n src = 'struct {0} {{'.format(name)\n for attr_name, value in basic_attrs.items():\n src += '{0} {1};'.format(value.type.typename, attr_name)\n src += '};'\n if ROOT.gROOT.ProcessLine(src) != 0:\n return None\n return getattr(ROOT, name, None)\n\n def __repr__(cls):\n out = StringIO()\n for name, value in cls.get_attrs():\n print >> out, '{0} -> {1}'.format(name, value)\n return out.getvalue()[:-1]\n\n def __str__(cls):\n return repr(cls)\n\n\nclass TreeModel(object):\n __metaclass__ = TreeModelMeta\n\n def __new__(cls):\n \"\"\"\n Return a TreeBuffer for this TreeModel\n \"\"\"\n treebuffer = TreeBuffer()\n for name, attr in cls.get_attrs():\n treebuffer[name] = attr()\n return treebuffer\n"},"license":{"kind":"string","value":"gpl-3.0"},"hash":{"kind":"number","value":1867577259396475100,"string":"1,867,577,259,396,475,100"},"line_mean":{"kind":"number","value":31.465408805,"string":"31.465409"},"line_max":{"kind":"number","value":79,"string":"79"},"alpha_frac":{"kind":"number","value":0.5180162728,"string":"0.518016"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.45,"string":"4.45"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43885,"cells":{"repo_name":{"kind":"string","value":"jolid/script.module.donnie"},"path":{"kind":"string","value":"lib/donnie/furk.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"6496"},"content":{"kind":"string","value":"import urllib2, urllib, sys, os, re, random, copy\nfrom BeautifulSoup import BeautifulSoup, Tag, NavigableString\nimport xbmc,xbmcplugin,xbmcgui,xbmcaddon\nfrom t0mm0.common.net import Net\nfrom t0mm0.common.addon import Addon\nfrom scrapers import CommonScraper\nnet = Net()\ntry:\n\timport json\nexcept: \n\t# pre-frodo and python 2.4\n\timport simplejson as json\n\n\n''' ###########################################################\n\nUsage and helper functions\n\n\n ############################################################'''\n\nclass FurkServiceSracper(CommonScraper):\n\tdef __init__(self, settingsid, DB=None, REG=None):\n\t\tif DB:\n\t\t\tself.DB=DB\n\t\tif REG:\n\t\t\tself.REG=REG\n\t\tself.addon_id = 'script.module.donnie'\n\t\tself.service='furk'\n\t\tself.name = 'furk.net'\n\t\tself.raiseError = False\n\t\tself.referrer = 'http://www.furk.net/'\n\t\tself.base_url = 'https://api.furk.net/api/'\n\t\tself.user_agent = 'Mozilla/5.0 (Windows; U; Windows NT 5.1; en-GB; rv:1.9.0.3) Gecko/2008092417 Firefox/3.0.3'\n\t\tself.provides = []\n\t\tself.settingsid = settingsid\n\t\tself._loadsettings()\n\t\tself.settings_addon = self.addon\n\n\tdef _getShows(self, silent=False):\n\t\tself.log('Do Nothing here')\n\n\tdef _getRecentShows(self, silent=False):\n\t\tself.log('Do Nothing here')\n\n\tdef _getEpisodes(self, showid, show, url, pDialog, percent, silent):\n\t\tself.log('Do Nothing here')\n\n\n\tdef _getMovies(self, silent=False):\n\t\tself.log('Do Nothing here')\n\n\n\tdef _getRecentMovies(self, silent):\n\t\tself.log('Do Nothing here')\n\n\tdef _setKey(self, api_key):\n\t\txbmcaddon.Addon(id='script.module.donnie').setSetting('furk-apikey', api_key)\n\n\tdef _getKey(self):\n\t\tapi_key = xbmcaddon.Addon(id='script.module.donnie').getSetting('furk-apikey')\n\t\tif api_key == '':\n\t\t\treturn None\n\t\treturn api_key\n\tdef cleanQuery(self, query):\n\t\tself.log('Cleaning furk search string')\n\t\tcleaned = query\n\t\tif re.search('\\\\(\\\\d\\\\d\\\\d\\\\d\\\\)$', cleaned):\n\t\t\t\tcleaned = cleaned[0:len(cleaned)-7]\n\t\tcleaned = cleaned.replace(\":\", '')\n\t\tcleaned = cleaned.replace(\"'\", '')\n\t\tcleaned = cleaned.replace(\"-\", ' ')\n\t\tcleaned = cleaned.replace(\"_\", ' ')\n\t\tprint cleaned\n\t\treturn cleaned\n\n\tdef _login(self):\n\t\tapi_key = self._getKey()\n\t\tif api_key:\n\t\t\tself.log('Using cached api key')\n\t\t\treturn api_key\n\t\tloginurl = \"%slogin/login\" % self.base_url\n\t\tlogin = self.getSetting('furk-username')\n\t\tpassword = self.getSetting('furk-password')\n\t\tpost_dict = {\"login\": login, \"pwd\": password}\n\t\tcookiejar = os.path.join(self.cookie_path,'furk.lwp')\n\t\ttry:\n\t\t\tresponse = net.http_POST(loginurl, post_dict).content\n\t\t\tdata = json.loads(response)\n\t\t\tstatus = data['status']\n\t\t\tapi_key = data['api_key']\n\t\t\tself._setKey(api_key)\n\t\t\tself.log(\"Furk response: %s\", response)\n\t\t \tif status==\"ok\":\n\t\t\t\tnet.save_cookies(cookiejar)\n\t\t \telse:\n\t\t\t\tprint 'Furk Account: login failed'\n\t\t\treturn api_key\n\t\texcept Exception, e:\n\t\t \tprint '**** Furk Error: %s' % e\n\t\t \tpass\n\n\tdef _getStreams(self, episodeid=None, movieid=None):\n\t\tapi_key = self._login()\n\t\tquery = \"\"\n\t\tif episodeid:\n\t\t\trow = self.DB.query(\"SELECT rw_shows.showname, season, episode FROM rw_episodes JOIN rw_shows ON rw_shows.showid=rw_episodes.showid WHERE episodeid=?\", [episodeid])\n\t\t\tname = row[0].replace(\"'\", \"\")\n\t\t\tif re.search('\\\\(\\\\d\\\\d\\\\d\\\\d\\\\)$', row[0]):\n\t\t\t\tname = name[0:len(name)-7]\n\t\t\tseason = row[1].zfill(2)\n\t\t\tepisode = row[2].zfill(2)\n\t\t\tquery = str(\"%s S%sE%s\" % (name, season, episode))\n\t\telif movieid:\n\t\t\trow = self.DB.query(\"SELECT movie, year FROM rw_movies WHERE imdb=? LIMIT 1\", [movieid])\n\t\t\tmovie = self.cleanQuery(row[0])\n\t\t\tquery = \"%s %s\" %(movie, row[1])\n\t\tstreams = []\n\t\turl = \"%splugins/metasearch\" % self.base_url\n\t\tparams = {\"type\": \"video\", \"filter\": \"cached\", \"api_key\": api_key, \"q\": query}\n\t\tpagedata = net.http_POST(url, params).content\n\t\tif pagedata=='':\n\t\t\treturn False\n\t\tdata = json.loads(pagedata)\n\t\ttry:\n\t\t\tfiles = data['files']\n\t\t\tfor f in files:\n\t\t\t\tif f['type'] == 'video':\n\t\t\t\t\traw_url = f['id']\n\t\t\t\t\tname = f['name']\n\t\t\t\t\tsize = int(f['size']) / (1024 * 1024)\n\t\t\t\t\tif size > 2000:\n\t\t\t\t\t\tsize = size / 1024\n\t\t\t\t\t\tunit = 'GB'\n\t\t\t\t\telse :\n\t\t\t\t\t\tunit = 'MB'\n\t\t\t\t\tself.getStreamByPriority('Furk - %s ([COLOR blue]%s %s[/COLOR])' %(name, size, unit), self.service + '://' + raw_url)\n\t\texcept Exception, e:\n\t\t\tself.log(\"********Donnie Error: %s, %s\" % (self.service, e))\n\t\tself.DB.commit()\n\n\tdef getStreamByPriority(self, link, stream):\n\t\tself.log(link)\n\t\thost = 'furk.net'\n\t\tSQL = \t\"INSERT INTO rw_stream_list(stream, url, priority, machineid) \" \\\n\t\t\t\"SELECT ?, ?, priority, ? \" \\\n\t\t\t\"FROM rw_providers \" \\\n\t\t\t\"WHERE mirror=? and provider=?\"\n\t\tself.DB.execute(SQL, [link, stream, self.REG.getSetting('machine-id'), host, self.service])\n\n\tdef _getServicePriority(self, link):\n\t\tself.log(link)\n\t\thost = 'furk.net'\n\t\trow = self.DB.query(\"SELECT priority FROM rw_providers WHERE mirror=? and provider=?\", [host, self.service])\n\t\treturn row[0]\n\n\tdef _resolveStream(self, stream):\n\t\traw_url = stream.replace(self.service + '://', '')\n\t\tresolved_url = ''\n\t\tt_files = []\n\t\tt_options = []\n\t\tsdialog = xbmcgui.Dialog()\n\t\tapi_key = self._getKey()\n\t\tparams = {\"type\": \"video\", \"id\": raw_url, \"api_key\": api_key, 't_files': 1}\n\t\turl = \"%sfile/get\" % self.base_url\n\t\tpagedata = net.http_POST(url, params).content\n\t\tif pagedata=='':\n\t\t\treturn False\n\t\t#print pagedata\n\t\tdata = json.loads(str(pagedata))\n\t\ttry:\t\n\t\t\tfiles = data['files'][0]['t_files']\n\t\t\tfor f in files:\n\n\t\t\t\tif re.search('^video/', f['ct']):\n\t\t\t\t\tsize = int(f['size']) / (1024 * 1024)\n\t\t\t\t\tif size > 2000:\n\t\t\t\t\t\tsize = size / 1024\n\t\t\t\t\t\tunit = 'GB'\n\t\t\t\t\telse :\n\t\t\t\t\t\tunit = 'MB'\n\t\t\t\t\tt_files.append(\"%s ([COLOR blue]%s %s[/COLOR])\" %(f['name'], size, unit))\n\t\t\t\t\tt_options.append(f['url_dl'])\n\t\t\tfile_select = sdialog.select('Select Furk Stream', t_files)\n\t\t\tif file_select < 0:\n\t\t\t\treturn resolved_url\n\t\t\tresolved_url = str(t_options[file_select])\n\t\texcept Exception, e:\n\t\t\tself.log(\"********Donnie Error: %s, %s\" % (self.service, e))\n\t\tself.log(\"Furk retruned: %s\", resolved_url, level=0)\n\t\treturn resolved_url\n\n\tdef _resolveIMDB(self, uri):\t#Often needed if a sites movie index does not include imdb links but the movie page does\n\t\timdb = ''\n\t\tprint uri\n\t\tpagedata = self.getURL(uri, append_base_url=True)\t\t\n\t\tif pagedata=='':\n\t\t\treturn\n\t\timdb = re.search('http://www.imdb.com/title/(.+?)/', pagedata).group(1)\n\t\treturn imdb\n\n\n\tdef whichHost(self, host):\t#Sometimes needed\n\t\ttable = {\t'Watch Blah' \t: 'blah.com',\n\t\t\t\t'Watch Blah2' \t: 'blah2.com',\n\n\t\t}\n\n\t\ttry:\n\t\t\thost_url = table[host]\n\t\t\treturn host_url\n\t\texcept:\n\t\t\treturn 'Unknown'\n\t\t\n\n\n\t\n"},"license":{"kind":"string","value":"gpl-2.0"},"hash":{"kind":"number","value":5660529019860364000,"string":"5,660,529,019,860,364,000"},"line_mean":{"kind":"number","value":28.935483871,"string":"28.935484"},"line_max":{"kind":"number","value":167,"string":"167"},"alpha_frac":{"kind":"number","value":0.622229064,"string":"0.622229"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":2.8528765920070267,"string":"2.852877"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43886,"cells":{"repo_name":{"kind":"string","value":"twitterdev/twitter-leaderboard"},"path":{"kind":"string","value":"services/migrations/0001_initial.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1248"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n# Generated by Django 1.9.1 on 2016-01-28 08:34\nfrom __future__ import unicode_literals\n\nfrom django.conf import settings\nfrom django.db import migrations, models\nimport django.db.models.deletion\n\n\nclass Migration(migrations.Migration):\n\n initial = True\n\n dependencies = [\n migrations.swappable_dependency(settings.AUTH_USER_MODEL),\n ]\n\n operations = [\n migrations.CreateModel(\n name='UserProfile',\n fields=[\n ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')),\n ('timezone', models.CharField(blank=True, max_length=100, null=True)),\n ('curator_auth_token', models.CharField(blank=True, max_length=40, null=True)),\n ('twitter_id', models.CharField(blank=True, max_length=25, null=True)),\n ('twitter_access_token', models.CharField(blank=True, max_length=75, null=True)),\n ('twitter_access_token_secret', models.CharField(blank=True, max_length=75, null=True)),\n ('user', models.OneToOneField(on_delete=django.db.models.deletion.CASCADE, related_name='profile', to=settings.AUTH_USER_MODEL)),\n ],\n ),\n ]\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-8509788362144956000,"string":"-8,509,788,362,144,956,000"},"line_mean":{"kind":"number","value":39.2580645161,"string":"39.258065"},"line_max":{"kind":"number","value":145,"string":"145"},"alpha_frac":{"kind":"number","value":0.6314102564,"string":"0.63141"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.961904761904762,"string":"3.961905"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43887,"cells":{"repo_name":{"kind":"string","value":"jayrumi/walmart-reviews"},"path":{"kind":"string","value":"setup.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1197"},"content":{"kind":"string","value":"#!/usr/bin/env python\n# -*- coding: utf-8 -*-\n\nfrom setuptools import setup, find_packages\n\nfrom codecs import open\nfrom os import path\n\nhere = path.abspath(path.dirname(__file__))\n\nwith open(path.join(here, 'README.rst'), encoding='utf-8') as f:\n long_description = f.read()\n\nsetup(\n name = 'walmart-reviews',\n version = '1.2.0.dev1',\n packages = find_packages(),\n requires = ['python (>= 3.5)'],\n #install_requires = ['random', 'requests', 'lxml', 'datetime', 'time'],\n description = 'Parsing reviews from Walmart.com without using API',\n long_description = long_description, #'A package for parsing reviews and all information about reviewers from walmart.com for specific item. For more information read README.rst', #open('README.rst').read(),\n author = 'Yauheni Rumiantsau',\n author_email = 'jrumyantsev@gmail.com',\n url = 'https://github.com/jayrumi/walmart-reviews',\n #download_url = '',\n license = 'MIT License',\n keywords = 'walmart parsing',\n classifiers = [\n 'Intended Audience :: Developers',\n 'Programming Language :: Python :: 3.5',\n 'Programming Language :: Python :: 3.6',\n ],\n)\n\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":8552747381099799000,"string":"8,552,747,381,099,799,000"},"line_mean":{"kind":"number","value":34.2058823529,"string":"34.205882"},"line_max":{"kind":"number","value":211,"string":"211"},"alpha_frac":{"kind":"number","value":0.634085213,"string":"0.634085"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.5,"string":"3.5"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43888,"cells":{"repo_name":{"kind":"string","value":"harrylewis/python-uinames"},"path":{"kind":"string","value":"uinames/models.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1384"},"content":{"kind":"string","value":"from utils import PropertyUnavailable\n\n\nclass People(object):\n \"\"\"\n A collection of people, represented by the Person class.\n \"\"\"\n\n def __init__(self, json=None):\n self._json = json or {}\n self.data = [Person(identity) for identity in self._json]\n\n def __str__(self):\n return self.__unicode__()\n\n def __unicode__(self):\n return \"\".format(len(self.data))\n\n\nclass Person(object):\n \"\"\"\n A representation of a person identity, generated from the UINames API.\n \"\"\"\n\n def __init__(self, json=None):\n self._json = json or {}\n\n def __getattr__(self, item):\n try:\n obj = self._json[item]\n # determine if string or dict\n if isinstance(obj, str) or isinstance(obj, unicode):\n return obj.encode(\"utf-8\")\n return obj\n except KeyError:\n raise PropertyUnavailable(\n \"Property '{}' is does not exist or is not available for this \"\n \"Person.\".format(item))\n\n def __str__(self):\n return self.__unicode__()\n\n def __unicode__(self):\n return \"\".format(self.name,\n self.surname,\n self.region)\n\n\nif __name__ == \"__main__\":\n pass\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":8602743123588186000,"string":"8,602,743,123,588,186,000"},"line_mean":{"kind":"number","value":26.68,"string":"26.68"},"line_max":{"kind":"number","value":79,"string":"79"},"alpha_frac":{"kind":"number","value":0.5101156069,"string":"0.510116"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.644295302013423,"string":"4.644295"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43889,"cells":{"repo_name":{"kind":"string","value":"digwanderlust/pants"},"path":{"kind":"string","value":"tests/python/pants_test/base/test_payload_field.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"10723"},"content":{"kind":"string","value":"# coding=utf-8\n# Copyright 2014 Pants project contributors (see CONTRIBUTORS.md).\n# Licensed under the Apache License, Version 2.0 (see LICENSE).\n\nfrom __future__ import (absolute_import, division, generators, nested_scopes, print_function,\n unicode_literals, with_statement)\n\nfrom hashlib import sha1\n\nfrom pants.backend.jvm.targets.exclude import Exclude\nfrom pants.backend.jvm.targets.jar_dependency import IvyArtifact, JarDependency\nfrom pants.backend.python.python_requirement import PythonRequirement\nfrom pants.base.payload import Payload\nfrom pants.base.payload_field import (ExcludesField, FileField, FingerprintedField,\n FingerprintedMixin, JarsField, PrimitiveField,\n PythonRequirementsField, SourcesField, TargetListField)\nfrom pants_test.base_test import BaseTest\n\n\nclass PayloadTest(BaseTest):\n def test_excludes_field(self):\n empty = ExcludesField()\n empty_fp = empty.fingerprint()\n self.assertEqual(empty_fp, empty.fingerprint())\n normal = ExcludesField([Exclude('com', 'foozle'), Exclude('org')])\n normal_fp = normal.fingerprint()\n self.assertEqual(normal_fp, normal.fingerprint())\n normal_dup = ExcludesField([Exclude('com', 'foozle'), Exclude('org')])\n self.assertEqual(normal_fp, normal_dup.fingerprint())\n self.assertNotEqual(empty_fp, normal_fp)\n\n def test_jars_field_order(self):\n jar1 = JarDependency('com', 'foo', '1.0.0')\n jar2 = JarDependency('org', 'baz')\n\n self.assertNotEqual(\n JarsField([jar1, jar2]).fingerprint(),\n JarsField([jar2, jar1]).fingerprint(),\n )\n\n def test_jars_field_artifacts(self):\n jar1 = JarDependency('com', 'foo', '1.0.0').with_artifact('com', 'baz')\n jar2 = JarDependency('com', 'foo', '1.0.0')\n\n self.assertNotEqual(\n JarsField([jar1]).fingerprint(),\n JarsField([jar2]).fingerprint(),\n )\n\n def test_jars_field_artifacts_arg(self):\n jar1 = JarDependency('com', 'foo', '1.0.0', artifacts=[IvyArtifact('com', 'baz')])\n jar2 = JarDependency('com', 'foo', '1.0.0')\n\n self.assertNotEqual(\n JarsField([jar1]).fingerprint(),\n JarsField([jar2]).fingerprint(),\n )\n\n def test_jars_field_artifacts_arg_vs_method(self):\n jar1 = JarDependency('com', 'foo', '1.0.0', artifacts=[IvyArtifact('com', 'baz')])\n jar2 = JarDependency('com', 'foo', '1.0.0').with_artifact('com', 'baz')\n\n self.assertEqual(\n JarsField([jar1]).fingerprint(),\n JarsField([jar2]).fingerprint(),\n )\n\n def test_jars_field_artifacts(self):\n jar1 = (JarDependency('com', 'foo', '1.0.0')\n .with_artifact('com', 'baz')\n .with_artifact('org', 'bat'))\n jar2 = (JarDependency('com', 'foo', '1.0.0')\n .with_artifact('org', 'bat')\n .with_artifact('com', 'baz'))\n jar3 = (JarDependency('com', 'foo', '1.0.0')\n .with_artifact('org', 'bat'))\n\n jar4 = JarDependency('com', 'foo', '1.0.0')\n\n self.assertEqual(\n JarsField([jar1]).fingerprint(),\n JarsField([jar2]).fingerprint(),\n )\n self.assertNotEqual(\n JarsField([jar1]).fingerprint(),\n JarsField([jar3]).fingerprint(),\n )\n self.assertNotEqual(\n JarsField([jar1]).fingerprint(),\n JarsField([jar4]).fingerprint(),\n )\n self.assertNotEqual(\n JarsField([jar3]).fingerprint(),\n JarsField([jar4]).fingerprint(),\n )\n\n def test_jars_field_artifacts_ordering(self):\n \"\"\"JarDependencies throw away ordering information about their artifacts in the cache key.\n\n But they do not throw it away in their internal representation! In the future, this should be\n fixed: either they should sort them as they are added and keep a canonical representation, or\n the order information should be preserved.\n \"\"\"\n\n jar1 = (JarDependency('com', 'foo', '1.0.0')\n .with_artifact('com', 'baz')\n .with_artifact('org', 'bat'))\n jar2 = (JarDependency('com', 'foo', '1.0.0')\n .with_artifact('org', 'bat')\n .with_artifact('com', 'baz'))\n\n self.assertEqual(\n JarsField([jar1]).fingerprint(),\n JarsField([jar2]).fingerprint(),\n )\n\n def test_deprecated_jars_field_methods(self):\n \"\"\"with_sources() and with_docs() are now no-ops. This test shows they don't affect\n fingerprinting.\n \"\"\"\n jar1 = (JarDependency('com', 'foo', '1.0.0'))\n jar2 = (JarDependency('com', 'foo', '1.0.0')\n .with_sources()\n .with_docs())\n\n self.assertEqual(\n JarsField([jar1]).fingerprint(),\n JarsField([jar2]).fingerprint(),\n )\n\n def test_jars_field_apidocs(self):\n \"\"\"apidocs are not properly rolled into the cache key right now. Is this intentional?\"\"\"\n\n jar1 = JarDependency('com', 'foo', '1.0.0', apidocs='pantsbuild.github.io')\n jar2 = JarDependency('com', 'foo', '1.0.0', apidocs='someother.pantsbuild.github.io')\n\n self.assertEqual(\n JarsField([jar1]).fingerprint(),\n JarsField([jar2]).fingerprint(),\n )\n\n def test_python_requirements_field(self):\n req1 = PythonRequirement('foo==1.0')\n req2 = PythonRequirement('bar==1.0')\n\n self.assertNotEqual(\n PythonRequirementsField([req1]).fingerprint(),\n PythonRequirementsField([req2]).fingerprint(),\n )\n\n def test_python_requirements_field_version_filter(self):\n \"\"\"version_filter is a lambda and can't be hashed properly.\n\n Since in practice this is only ever used to differentiate between py3k and py2, it should use\n a tuple of strings or even just a flag instead.\n \"\"\"\n req1 = PythonRequirement('foo==1.0', version_filter=lambda py, pl: False)\n req2 = PythonRequirement('foo==1.0')\n\n self.assertEqual(\n PythonRequirementsField([req1]).fingerprint(),\n PythonRequirementsField([req2]).fingerprint(),\n )\n\n def test_primitive_field(self):\n self.assertEqual(\n PrimitiveField({'foo': 'bar'}).fingerprint(),\n PrimitiveField({'foo': 'bar'}).fingerprint(),\n )\n self.assertEqual(\n PrimitiveField(['foo', 'bar']).fingerprint(),\n PrimitiveField(('foo', 'bar')).fingerprint(),\n )\n self.assertEqual(\n PrimitiveField(['foo', 'bar']).fingerprint(),\n PrimitiveField(('foo', 'bar')).fingerprint(),\n )\n self.assertEqual(\n PrimitiveField('foo').fingerprint(),\n PrimitiveField(b'foo').fingerprint(),\n )\n self.assertNotEqual(\n PrimitiveField('foo').fingerprint(),\n PrimitiveField('bar').fingerprint(),\n )\n\n def test_excludes_field(self):\n self.assertEqual(\n ExcludesField([Exclude('com', 'foo')]).fingerprint(),\n ExcludesField([Exclude('com', 'foo')]).fingerprint(),\n )\n self.assertEqual(\n ExcludesField([]).fingerprint(),\n ExcludesField().fingerprint(),\n )\n self.assertNotEqual(\n ExcludesField([Exclude('com', 'foo')]).fingerprint(),\n ExcludesField([Exclude('com')]).fingerprint(),\n )\n self.assertNotEqual(\n ExcludesField([Exclude('com', 'foo'), Exclude('org', 'bar')]).fingerprint(),\n ExcludesField([Exclude('org', 'bar'), Exclude('com', 'foo')]).fingerprint(),\n )\n\n def test_sources_field(self):\n self.create_file('foo/bar/a.txt', 'a_contents')\n self.create_file('foo/bar/b.txt', 'b_contents')\n\n self.assertNotEqual(\n SourcesField(\n sources_rel_path='foo/bar',\n sources=['a.txt'],\n ).fingerprint(),\n SourcesField(\n sources_rel_path='foo/bar',\n sources=['b.txt'],\n ).fingerprint(),\n )\n\n self.assertEqual(\n SourcesField(\n sources_rel_path='foo/bar',\n sources=['a.txt'],\n ).fingerprint(),\n SourcesField(\n sources_rel_path='foo/bar',\n sources=['a.txt'],\n ).fingerprint(),\n )\n\n self.assertEqual(\n SourcesField(\n sources_rel_path='foo/bar',\n sources=['a.txt'],\n ).fingerprint(),\n SourcesField(\n sources_rel_path='foo/bar',\n sources=['a.txt'],\n ).fingerprint(),\n )\n\n self.assertEqual(\n SourcesField(\n sources_rel_path='foo/bar',\n sources=['a.txt', 'b.txt'],\n ).fingerprint(),\n SourcesField(\n sources_rel_path='foo/bar',\n sources=['b.txt', 'a.txt'],\n ).fingerprint(),\n )\n\n fp1 = SourcesField(\n sources_rel_path='foo/bar',\n sources=['a.txt'],\n ).fingerprint()\n self.create_file('foo/bar/a.txt', 'a_contents_different')\n fp2 = SourcesField(\n sources_rel_path='foo/bar',\n sources=['a.txt'],\n ).fingerprint()\n\n self.assertNotEqual(fp1, fp2)\n\n def test_fingerprinted_field(self):\n class TestValue(FingerprintedMixin):\n def __init__(self, test_value):\n self.test_value = test_value\n\n def fingerprint(self):\n hasher = sha1()\n hasher.update(self.test_value)\n return hasher.hexdigest()\n\n field1 = TestValue('field1')\n field1_same = TestValue('field1')\n field2 = TestValue('field2')\n self.assertEquals(field1.fingerprint(), field1_same.fingerprint())\n self.assertNotEquals(field1.fingerprint(), field2.fingerprint())\n\n fingerprinted_field1 = FingerprintedField(field1)\n fingerprinted_field1_same = FingerprintedField(field1_same)\n fingerprinted_field2 = FingerprintedField(field2)\n self.assertEquals(fingerprinted_field1.fingerprint(), fingerprinted_field1_same.fingerprint())\n self.assertNotEquals(fingerprinted_field1.fingerprint(), fingerprinted_field2.fingerprint())\n\n def test_unimplemented_fingerprinted_field(self):\n class TestUnimplementedValue(FingerprintedMixin):\n pass\n\n with self.assertRaises(NotImplementedError):\n FingerprintedField(TestUnimplementedValue()).fingerprint()\n\n def test_file_field(self):\n fp1 = FileField(self.create_file('foo/bar.config', contents='blah blah blah')).fingerprint()\n fp2 = FileField(self.create_file('foo/bar.config', contents='meow meow meow')).fingerprint()\n fp3 = FileField(self.create_file('spam/egg.config', contents='blah blah blah')).fingerprint()\n\n self.assertNotEquals(fp1, fp2)\n self.assertNotEquals(fp1, fp3)\n self.assertNotEquals(fp2, fp3)\n\n def test_target_list_field(self):\n specs = [':t1', ':t2', ':t3']\n payloads = [Payload() for i in range(3)]\n for i, (s, p) in enumerate(zip(specs, payloads)):\n p.add_field('foo', PrimitiveField(i))\n self.make_target(s, payload=p)\n\n s1, s2, s3 = specs\n\n context = self.context()\n\n fp1 = TargetListField([s1, s2]).fingerprint_with_context(context)\n fp2 = TargetListField([s2, s1]).fingerprint_with_context(context)\n fp3 = TargetListField([s1, s3]).fingerprint_with_context(context)\n\n self.assertEquals(fp1, fp2)\n self.assertNotEquals(fp1, fp3)\n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":7316399254146659000,"string":"7,316,399,254,146,659,000"},"line_mean":{"kind":"number","value":32.6144200627,"string":"32.61442"},"line_max":{"kind":"number","value":98,"string":"98"},"alpha_frac":{"kind":"number","value":0.6334980882,"string":"0.633498"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.665982905982906,"string":"3.665983"},"config_test":{"kind":"bool","value":true,"string":"true"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43890,"cells":{"repo_name":{"kind":"string","value":"pinax/pinax-eventlog"},"path":{"kind":"string","value":"pinax/eventlog/migrations/0001_initial.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1443"},"content":{"kind":"string","value":"# Generated by Django 3.1 on 2020-08-15 10:08\n\nfrom django.conf import settings\nimport django.core.serializers.json\nfrom django.db import migrations, models\nimport django.db.models.deletion\nimport django.utils.timezone\n\nfrom ..compat import JSONField\n\n\nclass Migration(migrations.Migration):\n\n initial = True\n\n dependencies = [\n ('contenttypes', '0002_remove_content_type_name'),\n migrations.swappable_dependency(settings.AUTH_USER_MODEL),\n ]\n\n operations = [\n migrations.CreateModel(\n name='Log',\n fields=[\n ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')),\n ('timestamp', models.DateTimeField(db_index=True, default=django.utils.timezone.now)),\n ('action', models.CharField(db_index=True, max_length=50)),\n ('object_id', models.PositiveIntegerField(blank=True, null=True)),\n ('extra', JSONField(blank=True, encoder=django.core.serializers.json.DjangoJSONEncoder)),\n ('content_type', models.ForeignKey(blank=True, null=True, on_delete=django.db.models.deletion.SET_NULL, to='contenttypes.contenttype')),\n ('user', models.ForeignKey(null=True, on_delete=django.db.models.deletion.SET_NULL, to=settings.AUTH_USER_MODEL)),\n ],\n options={\n 'ordering': ['-timestamp'],\n },\n ),\n ]\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":8742902873296838000,"string":"8,742,902,873,296,838,000"},"line_mean":{"kind":"number","value":38,"string":"38"},"line_max":{"kind":"number","value":152,"string":"152"},"alpha_frac":{"kind":"number","value":0.6347886348,"string":"0.634789"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":4.182608695652174,"string":"4.182609"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43891,"cells":{"repo_name":{"kind":"string","value":"NitrousPG/forkbot"},"path":{"kind":"string","value":"server_events.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"4992"},"content":{"kind":"string","value":"# LICENSE\n# This program is free software; you can redistribute it and/or modify\n# it under the terms of the GNU General Public License as published by\n# the Free Software Foundation; either version 3 of the License, or\n# (at your option) any later version.\n#\n# This program is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU General Public License for more details.\n\n\n\"\"\"server message handler\"\"\"\n# Numerics aggregated from https://www.alien.net.au/irc/irc2numerics.html\n\n\nclass Server_Events:\n \"\"\"handles events\"\"\"\n\n\n def __init__(self, forkbot):\n self.forkbot = forkbot\n self.server_msg = \"\"\n self.server_msg_info = \"\"\n self.num_switch = {\n #misc\n \"NOTICE\": self.not_implemented,\n\n # start-up\n \"001\": self.rpl_welcome, # welcome information\n \"002\": self.rpl_yourhost, # server information\n \"004\": self.not_implemented, # RPL_MYINFO, TODO\n \"005\": self.not_implemented, # RPL_BOUNCE\n\n # server info\n \"251\": self.not_implemented,\n \"252\": self.not_implemented,\n \"253\": self.not_implemented,\n \"254\": self.not_implemented,\n \"255\": self.not_implemented,\n \"265\": self.not_implemented,\n \"266\": self.not_implemented,\n\n # channel info\n \"315\": self.rpl_synirc_who_end, # end of WHO\n \"332\": self.rpl_topic, # topic of channel\n \"333\": self.not_implemented, # ??\n \"352\": self.rpl_synirc_who, # response to WHO\n \"353\": self.rpl_namreply, # user list\n \"366\": self.rpl_endofnames, # end of user list\n\n # motd\n \"372\": self.motd, # motd start/continuation\n \"375\": self.not_implemented,\n \"376\": self.motd, # end of motd\n\n }\n\n def not_implemented(self):\n \"\"\"000\"\"\"\n #placeholder function\n pass\n\n\n def motd(self):\n \"\"\"372, 376\"\"\"\n # for right now we do not\n # care about the MOTD\n pass\n\n\n def rpl_welcome(self):\n \"\"\"001\"\"\"\n self.forkbot.log(\"welcome recieved\")\n self.forkbot.hostmask = self.server_msg.split(\" \")[-1].replace(\"\\r\", \"\")\n self.forkbot.log(\"hostmask is \" + self.forkbot.hostmask)\n\n\n def rpl_yourhost(self):\n \"\"\"002\"\"\"\n pass\n\n def rpl_synirc_who_end(self):\n \"\"\"find out what this numeric for this is\"\"\"\n pass\n\n def rpl_topic(self):\n \"\"\"332\"\"\"\n channel = self.server_msg_info[-1]\n topic = self.server_msg[:-1]\n self.forkbot.channel_topics.update({channel: topic})\n\n\n def rpl_synirc_who(self):\n \"\"\"who request handler\"\"\"\n msg_info = self.server_msg_info\n host = msg_info[5]\n nick = msg_info[7]\n\n self.forkbot.users.hostmask.update({nick: host})\n\n\n def rpl_namreply(self):\n \"\"\"353\"\"\"\n names = self.server_msg.split(\" \")[:-1]\n channel = self.server_msg_info[-1]\n\n for name in names:\n name = \"\".join([x for x in name if x not in \"@+~\"])\n self.forkbot.users.add_user(channel, name)\n for name in names:\n op_type = \"\"\n if name.startswith(\"~\"):\n op_type = \"owner\"\n elif name.startswith(\"@\"):\n op_type = \"operator\"\n elif name.startswith(\"&\"):\n op_type = \"admin\"\n elif name.startswith(\"+\"):\n op_type = \"voice\"\n if op_type != \"\":\n self.forkbot.users.add_op(channel, \"\".join(\n [x for x in name if x not in \"@+&~\"]), op_type)\n\n\n def rpl_endofnames(self):\n \"\"\"366\"\"\"\n pass\n\n\n def process(self, msg_info, msg):\n \"\"\"processes and delegates the server event to the correct function\"\"\"\n self.server_msg_info = msg_info\n self.server_msg = msg\n\n # find the key given by the server, and\n # execute the function that deals with that key\n try:\n self.num_switch[msg_info[1]]()\n except KeyError as ex:\n self.forkbot.log(f\"Unsupported Numeric: {ex}\")\n\n\n def find_ops(self, nicks):\n \"\"\"parse the list of nicks given by the server and\n register the ops\"\"\"\n owner, operator, voice, none = [], [], [], []\n for nick in nicks:\n if nick.startswith(\"~\"):\n owner.append(nick[1:])\n elif nick.startswith(\"@\"):\n operator.append(nick[1:])\n elif nick.startswith(\"+\"):\n voice.append(nick[1:])\n else:\n none.append(nick)\n ops = {\n \"owner\": owner,\n \"operator\": operator,\n \"voice\": voice,\n \"none\": none\n }\n return ops\n"},"license":{"kind":"string","value":"gpl-3.0"},"hash":{"kind":"number","value":-7410502775914562000,"string":"-7,410,502,775,914,562,000"},"line_mean":{"kind":"number","value":29.6257668712,"string":"29.625767"},"line_max":{"kind":"number","value":80,"string":"80"},"alpha_frac":{"kind":"number","value":0.5272435897,"string":"0.527244"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.9245283018867925,"string":"3.924528"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43892,"cells":{"repo_name":{"kind":"string","value":"Pragmatismo/TimelapsePi-EasyControl"},"path":{"kind":"string","value":"webcamcap_show_numpy.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"8684"},"content":{"kind":"string","value":"#!/usr/bin/python\nimport time\nimport os\nimport sys\nimport pygame\nimport numpy\nfrom PIL import Image, ImageDraw, ImageChops\n\nprint(\"\")\nprint(\"\")\nprint(\" USE l=3 to take a photo every 3 somethings, try a 1000 or 2\")\nprint(\" t to take triggered photos \")\nprint(\" cap=/home/pi/folder/ to set caps path other than current dir\")\nprint(\" \")\npi_paper = False #updates pi wall paper, use -nopaper to turn it off.\n\ns_val = \"10\"\nc_val = \"2\"\ng_val = \"10\"\nb_val = \"15\"\nx_dim = 1600\ny_dim = 896\nadditonal_commands = \"-d/dev/video1 -w\"\n\n\ntry:\n cappath = os.getcwd()\n cappath += \"/\"\nexcept:\n print(\" COULD NOT GET CURRENT DIR SET WITH A FLAG \")\n cappath = \"./\"\n print(\" COULD NOT GET CURRENT DIR SET WITH A FLAG \")\n\nloc_settings = \"./camera_settings.txt\"\ntry:\n with open(loc_settings, \"r\") as f:\n for line in f:\n s_item = line.split(\"=\")\n if s_item[0] == \"s_val\":\n s_val = s_item[1].split(\"\\n\")[0]\n elif s_item[0] == \"c_val\":\n c_val = s_item[1].split(\"\\n\")[0]\n elif s_item[0] == \"g_val\":\n g_val = s_item[1].split(\"\\n\")[0]\n elif s_item[0] == \"b_val\":\n b_val = s_item[1].split(\"\\n\")[0]\n elif s_item[0] == \"x_dim\":\n x_dim = s_item[1].split(\"\\n\")[0]\n elif s_item[0] == \"y_dim\":\n y_dim = s_item[1].split(\"\\n\")[0]\n elif s_item[0] == \"additonal_commands\":\n additonal_commands = s_item[1].split(\"\\n\")[0]\nexcept:\n print(\"No config file for camera, using default\")\n print(\"Run cam_config.py to create one\")\n\ndef photo():\n # take and save photo\n timenow = time.time()\n timenow = str(timenow)[0:10]\n filename= \"cap_\"+str(timenow)+\".jpg\"\n #os.system(\"uvccapture \"+additonal_commands+\" -S\"+s_val+\" -C\" + c_val + \" -G\"+ g_val +\" -B\"+ b_val +\" -x\"+str(x_dim)+\" -y\"+str(y_dim)+\" -v -t0 -o\"+cappath+filename)\n cmd = str(\"uvccapture \"+additonal_commands+\" -x\"+str(x_dim)+\" -y\"+str(y_dim)+\" -v -t0 -o\"+cappath+filename)\n print(\"####\")\n print(\"####\")\n print cmd\n print(\"####\")\n print(\"####\")\n os.system(cmd)\n print(\"Image taken and saved to \"+cappath+filename)\n if pi_paper == True:\n os.system(\"export DISPLAY=:0 && pcmanfm --set-wallpaper \"+cappath+filename)\n return filename\n\nif 'wp' in sys.argv or 'wallpaper' in sys.argv:\n pi_paper = True\n print(\" Going to try changing wall paper\")\n\nloop = False\ntrig = False\nfor argu in sys.argv[1:]:\n try:\n thearg = str(argu).split('=')[0]\n except:\n thearg = str(argu)\n if thearg == 'cap' or thearg =='cappath':\n cappath = str(argu).split('=')[1]\n elif thearg == 'l' or thearg == 'looped':\n try:\n num = int(str(argu).split('=')[1])\n except:\n print(\"No speed supplied, taking every 10\")\n num = 10\n loop = True\n elif thearg == 't' or thearg == 'TRIGGERED':\n trig = True\nprint(\" Saving files to, \" + str(cappath))\n\npygame.init()\ndisplay_width = x_dim\ndisplay_height = y_dim\ngameDisplay = pygame.display.set_mode((display_width,display_height))\npygame.display.set_caption('Most recent image')\nblack = (0,0,0)\nwhite = (255,255,255)\nclock = pygame.time.Clock()\ncrashed = False\n\nimport matplotlib.pyplot as plt\n\n\ndef show_pic(imgtaken, x=0,y=0):\n gameDisplay.blit(imgtaken, (x,y))\n\ngameDisplay.fill(white)\n\nc_photo = photo()\npil_c_photo = Image.open(c_photo)\nnumpy_pic = numpy.array(pil_c_photo)\n\nb_photo = photo()\npil_b_photo = Image.open(b_photo)\nnumpy_pic_b = numpy.array(pil_b_photo)\n\nmask = numpy_pic_b > numpy_pic + 30 #the +30 gets rid of noise\nmask2 = numpy_pic_b < numpy_pic - 30\nlol = mask + mask2\ne_pic = numpy_pic.copy()\n\nnum = 0\nwhile not crashed:\n for event in pygame.event.get():\n if event.type == pygame.QUIT:\n crashed = True\n timenow = time.time()\n e_photo = str(timenow).split(\".\")[0]\n e_photo= \"numpy_\"+str(timenow)+\".jpg\"\n num = num + 1\n\n b_photo = c_photo\n\n c_photo = photo()\n numpy_pic_b = numpy_pic.copy()\n pil_c_photo = Image.open(c_photo)\n numpy_pic = numpy.array(pil_c_photo)\n\n print numpy_pic.size\n #print len(numpy_pic[3])\n print \"###\"\n #print numpy_pic[1:,1,1]\n\n #a = np.arange(100)\n print \"##########\"\n #numpy_pic[1:500, range(0, len(numpy_pic[2]), 10), 1] = 0\n #for x in numpy_pic[1:500, range(0, len(numpy_pic[2])), 1]:\n # if x >= 100:\n # x = 255\n #for x in range(10,170,10):\n # mask = numpy_pic < x\n # numpy_pic[mask] = 255-x #numpy_pic[mask] + numpy_pic[mask]\n #for x in range(200,255,5):\n # mask = numpy_pic > x\n # numpy_pic[mask] = 0+(x/10) # numpy_pic[mask] / numpy_pic[mask]+(numpy_pic[mask]/numpy_pic[mask])\n\n\n #print numpy_pic[1:,1,1]\n #print numpy_pic.min()\n print \"###\"\n #print numpy_pic.shape #Array dimensions\n #print numpy_pic.ndim #Number of array dimensions\n #print numpy_pic.dtype #Data type of array elements\n #print numpy_pic.dtype.name #Name of data type\n #print numpy_pic.mean()\n #print numpy_pic.max()\n #print numpy_pic.min()\n #print numpy.info(numpy.ndarray.dtype)\n #print numpy_pic.astype(int)\n\n\n\n #mask = numpy_pic > numpy_pic_b\n #mask = numpy_pic[:, :, 2] > 150\n #numpy_pic[mask] = [0, 0, 255]\n #lol = numpy_pic +\n\n #mask = numpy_pic_b > numpy_pic + 30 #the +30 gets rid of noise\n #mask2 = numpy_pic_b < numpy_pic - 30\n margin = 20\n maskr = numpy_pic[:, :, 0] < numpy_pic_b[:, :, 0] - margin\n maskg = numpy_pic[:, :, 1] < numpy_pic_b[:, :, 1] - margin\n maskb = numpy_pic[:, :, 2] < numpy_pic_b[:, :, 2] - margin\n maskr2 = numpy_pic[:, :, 0] > numpy_pic_b[:, :, 0] + margin\n maskg2 = numpy_pic[:, :, 1] > numpy_pic_b[:, :, 1] + margin\n maskb2 = numpy_pic[:, :, 2] > numpy_pic_b[:, :, 2] + margin\n #numpy_pic[mask] = [0, 0, 255]\n\n #lol_old = lol\n #lol = mask + mask2\n #lol = lol + lol_old\n persist = 'ohhh'\n if persist == 'True':\n numpy_pic[maskr] = [255, 0, 0]\n numpy_pic[maskg] = [0, 255, 0]\n numpy_pic[maskb] = [0, 0, 255]\n numpy_pic[maskb2] = [0, 0, 100]\n numpy_pic[maskr2] = [100, 0, 0]\n numpy_pic[maskg2] = [0, 100, 0]\n Image.fromarray(numpy_pic).save(e_photo)\n elif persist == 'False':\n old_e = e_pic\n e_pic = numpy_pic.copy()\n e_pic[maskr] = [255, 0, 0]\n e_pic[maskg] = [0, 255, 0]\n e_pic[maskb] = [0, 0, 255]\n e_pic[maskr2] = [100, 0, 0]\n e_pic[maskg2] = [0, 100, 0]\n e_pic[maskb2] = [0, 0, 100]\n show1 = 'waa'\n if show1 == '1':\n e_pic = ((e_pic/4) - (numpy_pic))*3\n e_pic = e_pic / 3 + old_e / 2\n elif show1 == 'tripsy':\n e_pic = ((e_pic/4) - (numpy_pic))*3\n e_pic = e_pic - old_e / 2\n elif show1 == 'waa':\n e_pic = ((e_pic/4) - (numpy_pic))*3\n #e_pic = old_e * 0.8 + e_pic * 0.2\n Image.fromarray(e_pic).save(e_photo)\n\n elif persist == 'ohhh':\n old_e = e_pic.copy()\n mask_b_pic = numpy_pic.copy()\n mask_d_pic = numpy_pic.copy()\n mask_b_pic[maskr] = [255, 255, 255]\n mask_b_pic[maskg] = [255, 255, 255]\n mask_b_pic[maskb] = [255, 255, 255]\n mask_d_pic[maskr2] = [0, 0, 0]\n mask_d_pic[maskg2] = [0, 0, 0]\n mask_d_pic[maskb2] = [0, 0, 0]\n #e_pic = e_pic/6 + old_e\n e_pic = [200, 200, 0]\n #e_pic = e_pic/2 - ((mask_d_pic) + (mask_b_pic))\n #e_pic = e_pic/2 + ((mask_d_pic) + (mask_b_pic))\n #choose one of the following\n #e_pic = mask_d_pic #shows when pixel is darker than it was\n #e_pic = mask_b_pic #shows when pixel is lighter than prior\n e_pic = mask_d_pic - mask_b_pic #black execpt for movement\n e_pic = mask_b_pic / (mask_d_pic / 100) #black execpt for movement\n #e_pic = mask_d_pic + mask_b_pic #looks odd\n\n Image.fromarray(e_pic).save(e_photo)\n\n #plt.imshow(lol)\n #plt.show()\n #Image.fromarray(numpy_pic).save(e_photo)\n onscreen = pygame.image.load(e_photo)\n gameDisplay.blit(onscreen, (0,0))\n pygame.display.update()\n\n if trig == True:\n print(\"Waiting for input before taking next image...\")\n tp = raw_input(\"press return to take picture; \")\n if tp == \"q\":\n print(\"---bye!\")\n exit()\n clock.tick(20)\n if loop == True:\n pygame.time.wait(num)\n clock.tick(20)\n elif trig == False and loop == False:\n crashed = True\n\n#while True:\n #pygame.time.wait(1000)\n #clock.tick(20)\n\npygame.quit()\nquit()\n"},"license":{"kind":"string","value":"gpl-2.0"},"hash":{"kind":"number","value":-2106105906145419300,"string":"-2,106,105,906,145,419,300"},"line_mean":{"kind":"number","value":30.2374100719,"string":"30.23741"},"line_max":{"kind":"number","value":168,"string":"168"},"alpha_frac":{"kind":"number","value":0.5398433901,"string":"0.539843"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":2.838836220987251,"string":"2.838836"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43893,"cells":{"repo_name":{"kind":"string","value":"mbj4668/pyang"},"path":{"kind":"string","value":"pyang/xpath.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"12087"},"content":{"kind":"string","value":"from . import xpath_lexer\nfrom . import xpath_parser\nfrom .error import err_add\nfrom .util import prefix_to_module, search_data_node, data_node_up\nfrom .syntax import re_identifier\n\ncore_functions = {\n 'last': ([], 'number'),\n 'position': ([], 'number'),\n 'count': (['node-set'], 'number'),\n 'id': (['object'], 'node-set'),\n 'local-name': (['node-set', '?'], 'string'),\n 'namespace-uri': (['node-set', '?'], 'string'),\n 'name': (['node-set', '?'], 'string'),\n 'string': (['object'], 'string'),\n 'concat': (['string', 'string', '*'], 'string'),\n 'starts-with': (['string', 'string'], 'boolean'),\n 'contains': (['string', 'string'], 'boolean'),\n 'substring-before': (['string', 'string'], 'string'),\n 'substring-after': (['string', 'string'], 'string'),\n 'substring': (['string', 'number', 'number', '?'], 'string'),\n 'string-length': (['string', '?'], 'number'),\n 'normalize-space': (['string', '?'], 'string'),\n 'translate': (['string', 'string', 'string'], 'string'),\n 'boolean': (['object'], 'boolean'),\n 'not': (['boolean'], 'boolean'),\n 'true': ([], 'boolean'),\n 'false': ([], 'boolean'),\n 'lang': (['string'], 'boolean'),\n 'number': (['object'], 'number'),\n 'sum': (['node-set'], 'number'),\n 'floor': (['number'], 'number'),\n 'ceiling': (['number'], 'number'),\n 'round': (['number'], 'number'),\n }\n\nyang_xpath_functions = {\n 'current': ([], 'node-set')\n }\n\nyang_1_1_xpath_functions = {\n 'bit-is-set': (['node-set', 'string'], 'boolean'),\n 'enum-value': (['string'], 'number'),\n 'deref': (['node-set'], 'node-set'),\n 'derived-from': (['node-set', 'qstring'], 'boolean'),\n 'derived-from-or-self': (['node-set', 'qstring'], 'boolean'),\n 're-match': (['string', 'string'], 'boolean'),\n }\n\nextra_xpath_functions = {\n 'deref': (['node-set'], 'node-set'), # pyang extension for 1.0\n }\n\ndef add_extra_xpath_function(name, input_params, output_param):\n extra_xpath_functions[name] = (input_params, output_param)\n\ndef add_prefix(prefix, s):\n \"Add `prefix` to all unprefixed names in `s`\"\n # tokenize the XPath expression\n toks = xpath_lexer.scan(s)\n # add default prefix to unprefixed names\n toks2 = [_add_prefix(prefix, tok) for tok in toks]\n # build a string of the patched expression\n ls = [x.value for x in toks2]\n return ''.join(ls)\n\ndef _add_prefix(prefix, tok):\n if tok.type == 'name':\n m = xpath_lexer.re_ncname.match(tok.value)\n if m.group(2) is None:\n tok.value = prefix + ':' + tok.value\n return tok\n\n## TODO: validate must/when after deviate\n\n# node is the initial context node or None if it is not known\ndef v_xpath(ctx, stmt, node):\n try:\n if hasattr(stmt, 'i_xpath') and stmt.i_xpath is not None:\n q = stmt.i_xpath\n else:\n q = xpath_parser.parse(stmt.arg)\n stmt.i_xpath = q\n chk_xpath_expr(ctx, stmt.i_orig_module, stmt.pos, node, node, q, None)\n except xpath_lexer.XPathError as e:\n err_add(ctx.errors, stmt.pos, 'XPATH_SYNTAX_ERROR', e.msg)\n stmt.i_xpath = None\n except SyntaxError as e:\n err_add(ctx.errors, stmt.pos, 'XPATH_SYNTAX_ERROR', e.msg)\n stmt.i_xpath = None\n\n# mod is the (sub)module where the stmt is defined, which we use to\n# resolve prefixes.\ndef chk_xpath_expr(ctx, mod, pos, initial, node, q, t):\n if isinstance(q, list):\n chk_xpath_path(ctx, mod, pos, initial, node, q)\n elif isinstance(q, tuple):\n if q[0] == 'absolute':\n chk_xpath_path(ctx, mod, pos, initial, 'root', q[1])\n elif q[0] == 'relative':\n chk_xpath_path(ctx, mod, pos, initial, node, q[1])\n elif q[0] == 'union':\n for qa in q[1]:\n chk_xpath_path(ctx, mod, pos, initial, node, qa)\n elif q[0] == 'comp':\n chk_xpath_expr(ctx, mod, pos, initial, node, q[2], None)\n chk_xpath_expr(ctx, mod, pos, initial, node, q[3], None)\n elif q[0] == 'arith':\n chk_xpath_expr(ctx, mod, pos, initial, node, q[2], None)\n chk_xpath_expr(ctx, mod, pos, initial, node, q[3], None)\n elif q[0] == 'bool':\n chk_xpath_expr(ctx, mod, pos, initial, node, q[2], None)\n chk_xpath_expr(ctx, mod, pos, initial, node, q[3], None)\n elif q[0] == 'negative':\n chk_xpath_expr(ctx, mod, pos, initial, node, q[1], None)\n elif q[0] == 'function_call':\n chk_xpath_function(ctx, mod, pos, initial, node, q[1], q[2])\n elif q[0] == 'path_expr':\n chk_xpath_expr(ctx, mod, pos, initial, node, q[1], t)\n elif q[0] == 'path': # q[1] == 'filter'\n chk_xpath_expr(ctx, mod, pos, initial, node, q[2], None)\n chk_xpath_expr(ctx, mod, pos, initial, node, q[3], None)\n elif q[0] == 'var':\n # NOTE: check if the variable is known; currently we don't\n # have any variables in YANG xpath expressions\n err_add(ctx.errors, pos, 'XPATH_VARIABLE', q[1])\n elif q[0] == 'literal':\n # kind of hack to detect qnames, and mark the prefixes\n # as being used in order to avoid warnings.\n s = q[1]\n if s[0] == s[-1] and s[0] in (\"'\", '\"'):\n s = s[1:-1]\n i = s.find(':')\n # make sure there is just one : present\n # FIXME: more colons should possibly be reported, instead\n if i != -1 and s.find(':', i + 1) == -1:\n prefix = s[:i]\n tag = s[i + 1:]\n if (re_identifier.search(prefix) is not None and\n re_identifier.search(tag) is not None):\n # we don't want to report an error; just mark the\n # prefix as being used.\n my_errors = []\n prefix_to_module(mod, prefix, pos, my_errors)\n for pos0, code, arg in my_errors:\n if code == 'PREFIX_NOT_DEFINED' and t == 'qstring':\n # we know for sure that this is an error\n err_add(ctx.errors, pos0,\n 'PREFIX_NOT_DEFINED', arg)\n else:\n # this may or may not be an error;\n # report a warning\n err_add(ctx.errors, pos0,\n 'WPREFIX_NOT_DEFINED', arg)\n\ndef chk_xpath_function(ctx, mod, pos, initial, node, func, args):\n signature = None\n if func in core_functions:\n signature = core_functions[func]\n elif func in yang_xpath_functions:\n signature = yang_xpath_functions[func]\n elif mod.i_version != '1' and func in yang_1_1_xpath_functions:\n signature = yang_1_1_xpath_functions[func]\n elif ctx.strict and func in extra_xpath_functions:\n err_add(ctx.errors, pos, 'STRICT_XPATH_FUNCTION', func)\n return None\n elif not ctx.strict and func in extra_xpath_functions:\n signature = extra_xpath_functions[func]\n\n if signature is None:\n err_add(ctx.errors, pos, 'XPATH_FUNCTION', func)\n return None\n\n # check that the number of arguments are correct\n nexp = len(signature[0])\n nargs = len(args)\n if nexp == 0:\n if nargs != 0:\n err_add(ctx.errors, pos, 'XPATH_FUNC_ARGS',\n (func, nexp, nargs))\n elif signature[0][-1] == '?':\n if nargs != (nexp - 1) and nargs != (nexp - 2):\n err_add(ctx.errors, pos, 'XPATH_FUNC_ARGS',\n (func, \"%s-%s\" % (nexp - 2, nexp - 1), nargs))\n elif signature[0][-1] == '*':\n if nargs < (nexp - 1):\n err_add(ctx.errors, pos, 'XPATH_FUNC_ARGS',\n (func, \"at least %s\" % (nexp - 1), nargs))\n elif nexp != nargs:\n err_add(ctx.errors, pos, 'XPATH_FUNC_ARGS',\n (func, nexp, nargs))\n\n # FIXME implement checks from check_function()\n\n # check the arguments - FIXME check type\n i = 0\n args_signature = signature[0][:]\n for arg in args:\n chk_xpath_expr(ctx, mod, pos, initial, node, arg, args_signature[i])\n if args_signature[i] == '*':\n args_signature.append('*')\n i = i + 1\n return signature[1]\n\ndef chk_xpath_path(ctx, mod, pos, initial, node, path):\n if len(path) == 0:\n return\n head = path[0]\n if head[0] == 'var':\n # check if the variable is known as a node-set\n # currently we don't have any variables, so this fails\n err_add(ctx.errors, pos, 'XPATH_VARIABLE', head[1])\n elif head[0] == 'function_call':\n func = head[1]\n args = head[2]\n rettype = chk_xpath_function(ctx, mod, pos, initial, node, func, args)\n if rettype is not None:\n # known function, check that it returns a node set\n if rettype != 'node-set':\n err_add(ctx.errors, pos, 'XPATH_NODE_SET_FUNC', func)\n if func == 'current':\n chk_xpath_path(ctx, mod, pos, initial, initial, path[1:])\n elif head[0] == 'step':\n axis = head[1]\n nodetest = head[2]\n preds = head[3]\n node1 = None\n if axis == 'self':\n pass\n elif axis == 'child' and nodetest[0] == 'name':\n prefix = nodetest[1]\n name = nodetest[2]\n if prefix is None:\n if initial is None:\n pmodule = None\n elif initial.keyword == 'module':\n pmodule = initial\n else:\n pmodule = initial.i_module\n else:\n pmodule = prefix_to_module(mod, prefix, pos, ctx.errors)\n # if node and initial are None, it means we're checking an XPath\n # expression when it is defined in a grouping or augment, i.e.,\n # when the full tree is not expanded. in this case we can't check\n # the paths\n if pmodule is not None and node is not None and initial is not None:\n if node == 'root':\n children = pmodule.i_children\n else:\n children = getattr(node, 'i_children', None) or []\n child = search_data_node(children, pmodule.i_modulename, name)\n if child is None and node == 'root':\n err_add(ctx.errors, pos, 'XPATH_NODE_NOT_FOUND2',\n (pmodule.i_modulename, name, pmodule.arg))\n elif child is None and node.i_module is not None:\n err_add(ctx.errors, pos, 'XPATH_NODE_NOT_FOUND1',\n (pmodule.i_modulename, name,\n node.i_module.i_modulename, node.arg))\n elif child is None:\n err_add(ctx.errors, pos, 'XPATH_NODE_NOT_FOUND2',\n (pmodule.i_modulename, name, node.arg))\n elif (getattr(initial, 'i_config', None) is True\n and getattr(child, 'i_config', None) is False):\n err_add(ctx.errors, pos, 'XPATH_REF_CONFIG_FALSE',\n (pmodule.i_modulename, name))\n else:\n node1 = child\n elif axis == 'parent' and nodetest == ('node_type', 'node'):\n if node is None:\n pass\n elif node == 'root':\n err_add(ctx.errors, pos, 'XPATH_PATH_TOO_MANY_UP', ())\n else:\n p = data_node_up(node)\n if p is None:\n err_add(ctx.errors, pos, 'XPATH_PATH_TOO_MANY_UP', ())\n else:\n node1 = p\n else:\n # we can't validate the steps on other axis, but we can validate\n # functions etc.\n pass\n for p in preds:\n chk_xpath_expr(ctx, mod, pos, initial, node1, p, None)\n chk_xpath_path(ctx, mod, pos, initial, node1, path[1:])\n"},"license":{"kind":"string","value":"isc"},"hash":{"kind":"number","value":-2654624637892220000,"string":"-2,654,624,637,892,220,000"},"line_mean":{"kind":"number","value":41.4105263158,"string":"41.410526"},"line_max":{"kind":"number","value":80,"string":"80"},"alpha_frac":{"kind":"number","value":0.5149333995,"string":"0.514933"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.653869407496977,"string":"3.653869"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43894,"cells":{"repo_name":{"kind":"string","value":"simone-campagna/zapper"},"path":{"kind":"string","value":"lib/python/zapper/lock_file.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1913"},"content":{"kind":"string","value":"#!/usr/bin/env python3\n#\n# Copyright 2013 Simone Campagna\n#\n# Licensed under the Apache License, Version 2.0 (the \"License\");\n# you may not use this file except in compliance with the License.\n# You may obtain a copy of the License at\n#\n# http://www.apache.org/licenses/LICENSE-2.0\n#\n# Unless required by applicable law or agreed to in writing, software\n# distributed under the License is distributed on an \"AS IS\" BASIS,\n# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.\n# See the License for the specific language governing permissions and\n# limitations under the License.\n#\n\n__author__ = 'Simone Campagna'\n\nimport os\nimport time\nimport errno\nimport fcntl\nimport contextlib\n\n@contextlib.contextmanager\ndef Lock(filename, mode=\"r\", blocking=True, timeout=10):\n # enter\n lock_op = fcntl.LOCK_EX\n if not blocking:\n lock_op += fcntl.LOCK_NB\n count = 0\n interval = 0.1\n if timeout is not None:\n count = int(round(timeout/interval, 0))\n if count <= 0:\n count = 1\n with open(filename, mode) as f:\n for i in range(count):\n try:\n #fcntl.fcntl(self.fileno(), lock_op, os.O_NDELAY)\n fcntl.lockf(f.fileno(), lock_op)\n except IOError as e:\n if e.errno in (errno.EACCES, errno.EAGAIN):\n if timeout:\n time.sleep(interval)\n continue\n except:\n import traceback\n traceback.print_exc()\n time.sleep(interval)\n yield f\n #exit\n fcntl.lockf(f.fileno(), fcntl.LOCK_UN)\n\nif __name__ == \"__main__\":\n import sys\n with Lock('a.lock', 'a') as f_out:\n for arg in sys.argv:\n f_out.write(arg + '\\n')\n f_out.flush()\n print(\"sleeping...\")\n time.sleep(10)\n print(\"done.\")\n f_out.write(\"finito!\\n\")\n\n \n \n"},"license":{"kind":"string","value":"apache-2.0"},"hash":{"kind":"number","value":7631584786992049000,"string":"7,631,584,786,992,049,000"},"line_mean":{"kind":"number","value":27.1323529412,"string":"27.132353"},"line_max":{"kind":"number","value":74,"string":"74"},"alpha_frac":{"kind":"number","value":0.5901725039,"string":"0.590173"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.8336673346693386,"string":"3.833667"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43895,"cells":{"repo_name":{"kind":"string","value":"LinguList/server"},"path":{"kind":"string","value":"app/settings/sound_classes/asjp/asjp.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"3293"},"content":{"kind":"string","value":"#! /usr/bin/env python\nfrom __future__ import division,print_function\nfrom lingpy.data.derive import compile_model\nfrom scipy.spatial.distance import squareform\nfrom time import sleep\nfrom pickle import dump\n\nasjp = {}\n\nscore = open('score','r').read()\nscore = score.split('\\n')\ndel score[-1]\n\ndicto = {}\nfor line in score:\n lin = line.split('\\t')\n dicto[lin[0]] = lin[1:]\n\nletters = []\nfor i in range(len(score)):\n score[i] = score[i].split('\\t')\n letters.append(score[i][0])\n del score[i][0]\n\nmatrix = []\nfor i in range(len(score)):\n for l in letters:\n if i < len(dicto[l]):\n matrix.append(float(dicto[l][i]))\n\nmatrix = squareform(matrix)\nconsonants = ['p'] + letters\nconsonant_matrix = matrix.copy()\n\nscore = open('vows_score','r').read()\nscore = score.split('\\n')\ndel score[-1]\n\ndicto = {}\nfor line in score:\n lin = line.split('\\t')\n dicto[lin[0]] = lin[1:]\n\nletters = []\nfor i in range(len(score)):\n score[i] = score[i].split('\\t')\n letters.append(score[i][0])\n del score[i][0]\n\nmatrix = []\nfor i in range(len(score)):\n for l in letters:\n if i < len(dicto[l]):\n matrix.append(float(dicto[l][i]))\n\nmatrix = squareform(matrix)\n\nvowel_matrix = matrix.copy()\nvowels = ['i'] + letters\n\nfor i in range(len(vowel_matrix)):\n vowel_matrix[i][i] = 40\n\nfor i in range(len(consonant_matrix)):\n consonant_matrix[i][i] = 40\n\nfor i in range(31):\n for j in range(31):\n asjp[consonants[i],consonants[j]] = consonant_matrix[i][j]\n\nfor i in range(7):\n for j in range(7):\n asjp[vowels[i],vowels[j]] = vowel_matrix[i][j]\n\nfor l in vowels:\n asjp[l,'X'] = 0\n asjp['X',l] = 0\n\nfor l in consonants:\n asjp[l,'X'] = 0\n asjp['X',l] = 0\n\nasjp['X','X'] = 0\nfor v in vowels:\n for c in consonants:\n asjp[v,c] = -20\n asjp[c,v] = -20\n\nfor key in asjp.keys():\n if asjp[key] == 0:\n asjp[key] = 0\n else:\n asjp[key] = int(asjp[key]+0.5)\n\nfor v1 in vowels:\n for v2 in vowels:\n asjp[v1,v2] = int(asjp[v1,v2] * 0.25 + 0.5) + 10\nasjp['i','y'] = -2\nasjp['y','i'] = -2\nasjp['u','w'] = -2\nasjp['w','u'] = -2\nasjp['u','v'] = -4\nasjp['v','u'] = -4\nasjp['u','f'] = -6\nasjp['f','u'] = -6\n\nkeys = []\nfor keyA,keyB in asjp.keys():\n keys.append((keyA,keyB))\n\nfor keyA,keyB in keys:\n asjp[keyA,'+'] = -20\n asjp['+',keyB] = -20\n asjp[keyA,'0'] = 0\n asjp['0',keyB] = 0\n\n\nasjp['X','+'] = -5\nasjp['+','X'] = -5\nasjp['+','+'] = 0 # swaps\nasjp['0','0'] = 0 # missing values\nasjp['X','0'] = 0\nasjp['0','X'] = 0\n\nfor i in '0123456':\n for j in '0123456':\n if i == j:\n asjp[i,j] = 10\n else:\n asjp[i,j] = 5\n\nkeys = []\nfor keyA,keyB in asjp.keys():\n keys.append((keyA,keyB))\n\n\nfor keyA,keyB in keys:\n for i in '123456':\n if keyA not in '123456' and keyB not in '123456':\n asjp[keyA,i] = -20\n asjp[i,keyB] = -20\n asjp[keyA,'_'] = -50\n asjp['_',keyB] = -50\n\nasjp['_','_'] = 0\n\nfor x in asjp.keys():\n asjp[x] = asjp[x] / 4.0\n if asjp[x] > 0 and asjp[x] != 10:\n asjp[x] += 0.75 * asjp[x]\n elif asjp[x] < 0:\n asjp[x] += 0.75 * asjp[x]\n\nout = open('scorer.bin','wb')\ndump(asjp,out)\nout.close()\ncompile_model('asjp')\nprint(\"[i] Compilation of the ASJP model was successful!\")\nsleep(1)\n"},"license":{"kind":"string","value":"gpl-2.0"},"hash":{"kind":"number","value":3162807456613274600,"string":"3,162,807,456,613,274,600"},"line_mean":{"kind":"number","value":19.7106918239,"string":"19.710692"},"line_max":{"kind":"number","value":66,"string":"66"},"alpha_frac":{"kind":"number","value":0.5463103553,"string":"0.54631"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":2.4852830188679245,"string":"2.485283"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43896,"cells":{"repo_name":{"kind":"string","value":"wevoice/wesub"},"path":{"kind":"string","value":"dev_settings_test.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"2112"},"content":{"kind":"string","value":"# Amara, universalsubtitles.org\n#\n# Copyright (C) 2013 Participatory Culture Foundation\n#\n# This program is free software: you can redistribute it and/or modify\n# it under the terms of the GNU Affero General Public License as\n# published by the Free Software Foundation, either version 3 of the\n# License, or (at your option) any later version.\n#\n# This program is distributed in the hope that it will be useful,\n# but WITHOUT ANY WARRANTY; without even the implied warranty of\n# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the\n# GNU Affero General Public License for more details.\n#\n# You should have received a copy of the GNU Affero General Public License\n# along with this program. If not, see\n# http://www.gnu.org/licenses/agpl-3.0.html.\n\nfrom dev_settings import *\n\nINSTALLED_APPS += (\n 'django_nose',\n)\n\nDATABASES = {\n 'default': {\n 'ENGINE': 'django.db.backends.sqlite3',\n 'NAME': ':memory:',\n 'USER': '',\n 'PASSWORD': '',\n 'HOST': '',\n 'PORT': '',\n }\n}\n\nCACHE_PREFIX = \"testcache\"\nCACHE_TIMEOUT = 60\nTEST_RUNNER = 'django_nose.NoseTestSuiteRunner'\nNOSE_PLUGINS = ['utils.test_utils.plugin.UnisubsTestPlugin']\nCELERY_ALWAYS_EAGER = True\n\nYOUTUBE_CLIENT_ID = 'test-youtube-id'\nYOUTUBE_CLIENT_SECRET = 'test-youtube-secret'\nYOUTUBE_API_KEY = 'test-youtube-api-key'\n\nAPI_ALWAYS_USE_FUTURE = True\n\n# Use MD5 password hashing, other algorithms are purposefully slow to increase\n# security. Also include the SHA1 hasher since some of the tests use it.\nPASSWORD_HASHERS = (\n 'django.contrib.auth.hashers.MD5PasswordHasher',\n 'django.contrib.auth.hashers.SHA1PasswordHasher',\n)\n\n# Let the nose CaptureLogging plugin handle logging. It doesn't display\n# logging at all, except if there's a test failure.\ndel LOGGING\n\nNOSE_ARGS = ['--logging-filter=test_steps, -remote_connection, '\n '-selenium.webdriver.remote.remote_connection',\n '--with-xunit', '--logging-level=ERROR',\n '--xunit-file=nosetests.xml',\n ]\n\ntry:\n from dev_settings_test_local import *\nexcept ImportError:\n pass\n"},"license":{"kind":"string","value":"agpl-3.0"},"hash":{"kind":"number","value":-7629318859687858000,"string":"-7,629,318,859,687,858,000"},"line_mean":{"kind":"number","value":30.0588235294,"string":"30.058824"},"line_max":{"kind":"number","value":78,"string":"78"},"alpha_frac":{"kind":"number","value":0.696969697,"string":"0.69697"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.6226415094339623,"string":"3.622642"},"config_test":{"kind":"bool","value":true,"string":"true"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43897,"cells":{"repo_name":{"kind":"string","value":"robotican/ric"},"path":{"kind":"string","value":"ric_board/scripts/RiCConfigurator/GUI/SimulationWindow.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"5700"},"content":{"kind":"string","value":"import GUI.MainWindow\n\n__author__ = 'tom'\nfrom PyQt4.QtGui import *\nfrom GUI.Schemes.gazeboGui import Ui_gazebo_gui\nfrom BAL.Interface.DeviceFrame import SERVO, BATTERY, SWITCH, IMU, PPM, GPS, RELAY, URF, CLOSE_LOP_ONE, CLOSE_LOP_TWO, \\\n OPEN_LOP, DIFF_CLOSE, DIFF_OPEN, EX_DEV, HOKUYO, OPRNNI, USBCAM, DIFF_CLOSE_FOUR, ROBOT_MODEL, SLAM, Keyboard, \\\n JOYSTICK, SMOOTHER\nimport rospkg\nimport pickle\nfrom PyQt4.QtCore import Qt\nfrom lxml.etree import Element, SubElement\n\n\nclass SimulationWindow(QDialog, Ui_gazebo_gui):\n def __init__(self, parent=None):\n super(SimulationWindow, self).__init__(parent)\n self.setupUi(self)\n self._devs = []\n\n self.loadButton.clicked.connect(self.loadEvent)\n self.launchButton.clicked.connect(self.launchEvent)\n self.devList.itemClicked.connect(self.listChangeEvent)\n\n self.loadFile()\n\n self.showSimDetail()\n\n def listChangeEvent(self, item):\n dev = self._devs[self.devList.row(item)]\n if item.checkState() > 0:\n dev[1] = True\n else:\n dev[1] = False\n\n def loadFile(self):\n self._devs = []\n pkg = rospkg.RosPack().get_path('ric_board')\n fileName = QFileDialog.getOpenFileName(self, self.tr(\"Open file\"), \"%s/DATA\" % pkg, self.tr(\"RiC File (*.RIC)\"))\n if fileName == '': return\n\n devices = pickle.load(open(fileName))[2]\n self.arrangeDevices(devices)\n\n def arrangeDevices(self, devices):\n for dev in devices:\n if dev['type'] in [DIFF_CLOSE, IMU, OPRNNI, HOKUYO, USBCAM, URF]:\n self._devs.append([dev, True])\n\n def showSimDetail(self):\n for dev in self._devs:\n if dev[0]['type'] == OPRNNI:\n listItem = QListWidgetItem('OpenniCamera')\n else:\n listItem = QListWidgetItem(dev[0]['name'])\n\n listItem.setCheckState(Qt.Checked)\n self.devList.addItem(listItem)\n\n def clearLst(self):\n size = self.devList.count()\n for i in xrange(size):\n self.devList.takeItem(0)\n\n def loadEvent(self):\n self.loadFile()\n self.clearLst()\n self.showSimDetail()\n\n def launchEvent(self):\n root = Element('launch')\n\n SubElement(root, 'arg', {\n 'name': 'paused',\n 'default': 'false'\n })\n SubElement(root, 'arg', {\n 'name': 'use_sim_time',\n 'default': 'true'\n })\n SubElement(root, 'arg', {\n 'name': 'gui',\n 'default': 'true'\n })\n SubElement(root, 'arg', {\n 'name': 'headless',\n 'default': 'false'\n })\n SubElement(root, 'arg', {\n 'name': 'debug',\n 'default': 'false'\n })\n\n world = SubElement(root, 'include', dict(file='$(find gazebo_ros)/launch/empty_world.launch'))\n SubElement(world, 'arg', {\n 'name': 'debug',\n 'value': '$(arg debug)'\n })\n SubElement(world, 'arg', {\n 'name': 'gui',\n 'value': '$(arg gui)'\n })\n SubElement(world, 'arg', {\n 'name': 'paused',\n 'value': '$(arg paused)'\n })\n SubElement(world, 'arg', {\n 'name': 'use_sim_time',\n 'value': '$(arg use_sim_time)'\n })\n SubElement(world, 'arg', {\n 'name': 'headless',\n 'value': '$(arg headless)'\n })\n\n SubElement(root, 'param', {\n 'name': 'robot_description',\n 'command': \"$(find xacro)/xacro.py '$(find ric_gazebo)/robots/komodo/komodo.xacro' ns:='init' color_name:='Grey'\"\n })\n\n haveCam = 'false'\n haveOpenNi = 'false'\n haveLaser = 'false'\n haveUrf = 'false'\n haveDiff = 'false'\n haveImu = 'false'\n\n for dev in self._devs:\n if dev[1]:\n if dev[0]['type'] == DIFF_CLOSE: haveDiff = 'true'\n if dev[0]['type'] == IMU: haveImu = 'true'\n if dev[0]['type'] == OPRNNI: haveOpenNi = 'true'\n if dev[0]['type'] == HOKUYO: haveLaser = 'true'\n if dev[0]['type'] == USBCAM: haveCam = 'true'\n if dev[0]['type'] == URF: haveUrf = 'true'\n\n amount = self.numberOfRobotsSpinBox.value()\n for i in xrange(amount):\n robotFile = SubElement(root, 'include', {'file': '$(find ric_gazebo)/launch/spawn_komodo.launch'})\n SubElement(robotFile, 'arg', dict(name='name', value='komodo_%d' % (i + 1)))\n SubElement(robotFile, 'arg', dict(name='color', value='White'))\n SubElement(robotFile, 'arg', dict(name='x', value='0.0'))\n SubElement(robotFile, 'arg', dict(name='y', value='%d.0' % i))\n SubElement(robotFile, 'arg', dict(name='z', value='0.1'))\n SubElement(robotFile, 'arg', dict(name='R', value='0.0'))\n SubElement(robotFile, 'arg', dict(name='P', value='0.0'))\n SubElement(robotFile, 'arg', dict(name='Y', value='0.0'))\n SubElement(robotFile, 'arg', dict(name='arm_camera', value='true'))\n\n SubElement(robotFile, 'arg', dict(name='front_camera', value=haveCam))\n SubElement(robotFile, 'arg', dict(name='isDiff', value=haveDiff))\n SubElement(robotFile, 'arg', dict(name='depth_camera', value=haveOpenNi))\n SubElement(robotFile, 'arg', dict(name='laser_scanner', value=haveLaser))\n SubElement(robotFile, 'arg', dict(name='urf', value=haveUrf))\n SubElement(robotFile, 'arg', dict(name='imu', value=haveImu))\n open('/home/tom/test.launch', 'w').write(GUI.MainWindow.prettify(root))\n"},"license":{"kind":"string","value":"bsd-3-clause"},"hash":{"kind":"number","value":-2762979084064864000,"string":"-2,762,979,084,064,864,000"},"line_mean":{"kind":"number","value":35.5384615385,"string":"35.538462"},"line_max":{"kind":"number","value":126,"string":"126"},"alpha_frac":{"kind":"number","value":0.5426315789,"string":"0.542632"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.490508266993264,"string":"3.490508"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43898,"cells":{"repo_name":{"kind":"string","value":"andrey-yemelyanov/competitive-programming"},"path":{"kind":"string","value":"cp-book/ch1/adhoc/chess/10849_MoveTheBishop.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1456"},"content":{"kind":"string","value":"# Problem name: 10849 Move the bishop\n# Problem url: https://uva.onlinejudge.org/external/108/10849.pdf\n# Author: Andrey Yemelyanov\n\nimport sys\nimport math\n\nWHITE, BLACK = 0, 1\nINFINITY = -1\n\ndef main():\n n_test_cases = int(sys.stdin.readline().strip())\n for i in range(n_test_cases):\n sys.stdin.readline()\n n_tests = int(sys.stdin.readline().strip())\n N = int(sys.stdin.readline().strip())\n for j in range(n_tests):\n from_row, from_col, to_row, to_col = [int(t) for t in sys.stdin.readline().split()]\n n_moves = count_bishop_moves(from_row, from_col, to_row, to_col)\n if n_moves == INFINITY:\n print(\"no move\")\n else:\n print(n_moves)\n\n\ndef count_bishop_moves(from_row, from_col, to_row, to_col):\n if from_row == to_row and from_col == to_col:\n return 0;\n elif square_color(from_row, from_col) != square_color(to_row, to_col):\n return INFINITY\n elif on_the_same_diagonal(from_row, from_col, to_row, to_col):\n return 1\n else:\n return 2\n\ndef on_the_same_diagonal(row1, col1, row2, col2):\n return abs(row1 - row2) == abs(col1 - col2)\n\ndef square_color(row, col):\n if row % 2 == 0:\n if col % 2 == 0:\n return WHITE\n else:\n return BLACK\n else:\n if col % 2 == 0:\n return BLACK\n else:\n return WHITE\n\nif __name__==\"__main__\":\n main()\n"},"license":{"kind":"string","value":"mit"},"hash":{"kind":"number","value":-4838296833532812000,"string":"-4,838,296,833,532,812,000"},"line_mean":{"kind":"number","value":27,"string":"27"},"line_max":{"kind":"number","value":95,"string":"95"},"alpha_frac":{"kind":"number","value":0.5604395604,"string":"0.56044"},"autogenerated":{"kind":"bool","value":false,"string":"false"},"ratio":{"kind":"number","value":3.1379310344827585,"string":"3.137931"},"config_test":{"kind":"bool","value":false,"string":"false"},"has_no_keywords":{"kind":"bool","value":false,"string":"false"},"few_assignments":{"kind":"bool","value":false,"string":"false"}}},{"rowIdx":43899,"cells":{"repo_name":{"kind":"string","value":"zfrxiaxia/Code-zfr"},"path":{"kind":"string","value":"计蒜客/比赛/2015/light.py"},"copies":{"kind":"string","value":"1"},"size":{"kind":"string","value":"1148"},"content":{"kind":"string","value":"# -*- coding: utf-8 -*-\n\"\"\"\nCreated on Sat May 28 19:17:42 2016\n\n@author: AtoZ\n\"\"\"\nN,M = raw_input().split()\nN,M = int(N),int(M)\nwhile(1):\n \ni0 = 0\nwhile(i0<2**(M*N)):\n bit = [0]*M*N\n t_bit = bin(i0)\n lt_bit = len(t_bit)\n for j0 in range(lt_bit-2):\n bit[j0] = int(t_bit[j0+2])\n i0 +=1\n print bit\n \n\"\"\"\nN,M = raw_input().split()\nN,M = int(N),int(M)\nL0 = [] \nL = []\ntime = 0\ndef change(h,l):\n global time\n time += 1\n if h == N-1:\n pass\n else:\n L[h*M+l] = not L[h*M+l] \n L[(h+1)*M+l] = not L[(h+1)*M+l]\n if l != 0:\n L[(h+1)*M+l-1] = not L[(h+1)*M+l-1]\n if l != M-1:\n L[(h+1)*M+l+1] = not L[(h+1)*M+l+1]\n if h != N-2:\n L[(h+2)*M+l] = not L[(h+2)*M+l]\n \nwhile(1):\n try:\n temp = raw_input()\n L0.append(temp.split())\n except:\n break\n \nfor i in range(N):\n for j in range(M):\n L.append(int(L0[i][j]))\nLL = [1]*N*M\nj = 0\nwhile(j
repo_name
stringlengths
5
92
path
stringlengths
4
221
copies
stringclasses
19 values
size
stringlengths
4
6
content
stringlengths
766
896k
license
stringclasses
15 values
hash
int64
-9,223,277,421,539,062,000
9,223,102,107B
line_mean
float64
6.51
99.9
line_max
int64
32
997
alpha_frac
float64
0.25
0.96
autogenerated
bool
1 class
ratio
float64
1.5
13.6
config_test
bool
2 classes
has_no_keywords
bool
2 classes
few_assignments
bool
1 class
cemarchi/biosphere
Src/BioAnalyzer/Analysis/GenePrioritization/Steps/DataIntegration/IntermediateRepresentation/Transformers/MicroRnaToGeneTransformer.py
1
4546
import math import statistics from itertools import groupby from random import randint from typing import Dict, Tuple, Counter import pandas as pd from Src.BioAnalyzer.Analysis.GenePrioritization.Steps.DataIntegration.IntermediateRepresentation.Generators import \ IntermediateRepresentationGeneratorBase from Src.BioAnalyzer.Analysis.GenePrioritization.Steps.DataIntegration.IntermediateRepresentation.Transformers.SampleTransformerBase import \ SampleTransformerBase from Src.BioDataManagement.CrossCutting.DTOs.ExpressionLevelStatusDto import ExpressionLevelStatusDto class MicroRnaToGeneTransformer(SampleTransformerBase): """ """ def __init__(self, intermediateRepresentationGenerator: IntermediateRepresentationGeneratorBase, get_global_diff_values_action, get_mirna_gene_target_action): super().__init__(intermediateRepresentationGenerator) self.__get_mirna_gene_target_action = get_mirna_gene_target_action self.__get_global_diff_values_action = get_global_diff_values_action def transform(self, from_sample_matrix: pd.DataFrame, is_highly_significant: bool) -> Tuple[pd.DataFrame, Dict[int, ExpressionLevelStatusDto]]: mirna_gene_targets = {mirna.lower(): g for mirna, g in self.__get_mirna_gene_targets(from_sample_matrix.columns.tolist()).items()} mirna_samples = self.__get_mirna_samples(from_sample_matrix, mirna_gene_targets) id_entrez_list = list(set([id_entrez for mirna_symbol, id_entrez_list in mirna_gene_targets.items() for id_entrez in id_entrez_list])) measure_matrix = dict([(g, []) for g in id_entrez_list]) key_func = lambda gene: gene[0] for patient_id, exp_values in mirna_samples.items(): gene_values = [(id_entrez, exp_value) for mirna_symbol, exp_value in exp_values.items() for id_entrez in mirna_gene_targets[mirna_symbol]] gene_values = sorted(gene_values, key=key_func) for id_entrez, measures in groupby(gene_values, key_func): measures = [measure for id_entrez, measure in list(measures) if not math.isnan(measure)] measure_matrix[id_entrez].append(float('NaN') if not measures else statistics.mean(measures)) gene_matrix = pd.DataFrame.from_dict(measure_matrix).dropna(axis=1,how='all') gene_matrix = self.intermediateRepresentationGenerator.generate(gene_matrix).dropna(axis=1,how='all') return gene_matrix, \ self.__get_gene_status(mirna_gene_targets, gene_matrix.columns.tolist(), is_highly_significant) def __get_mirna_gene_targets(self, mirnas): gene_targets = {} fe_target = self.__get_mirna_gene_target_action(mirnas) gene_targets.update(dict([(t.microrna_symbol, list(set(gene_targets[t.microrna_symbol] + t.id_entrez_genes))) if t.microrna_symbol in gene_targets else (t.microrna_symbol, t.id_entrez_genes) for t in fe_target.result_list])) return gene_targets def __get_mirna_samples(self, from_sample_matrix, mirna_gene_targets): from_sample_matrix = from_sample_matrix[list(mirna_gene_targets.keys()) + ['patient_id']] from_sample_matrix.set_index("patient_id", drop=True, inplace=True) return from_sample_matrix.to_dict(orient="index") def __get_gene_status(self, mirna_gene_targets, genes, is_highly_significant): diff_mirna = [diff for diff in self.__get_global_diff_values_action(is_highly_significant).result.values if diff.element_id in mirna_gene_targets] genes_status = [(g, diff.status) for diff in diff_mirna for g in mirna_gene_targets[diff.element_id] if g in genes] key_func = lambda gene: gene[0] genes_status = sorted(genes_status, key=key_func) genes_status_dict = {} for id_entrez, status in groupby(genes_status, key_func): status = list(status) status_counter = Counter(status) status = [k for k, v in status_counter.most_common()] len_status = len(status) - 1 genes_status_dict[id_entrez] = status[0] if len_status == 1 else status[randint(0, len_status)] return dict([(entrez_id, status[1]) for entrez_id, status in genes_status_dict.items()])
bsd-3-clause
261,306,271,858,045,380
49.522222
147
0.653322
false
3.625199
false
false
false
aplanas/kmanga
kmanga/core/models.py
1
21424
import os.path from django.conf import settings from django.db import connection from django.db import models from django.db.models import Count from django.db.models import F from django.db.models import Q from django.urls import reverse from django.utils import timezone class TimeStampedModel(models.Model): created = models.DateTimeField(auto_now_add=True) modified = models.DateTimeField(auto_now=True) class Meta: abstract = True class Source(TimeStampedModel): name = models.CharField(max_length=200) spider = models.CharField(max_length=80) url = models.URLField(unique=True) has_footer = models.BooleanField(default=False) enabled = models.BooleanField(default=True) def __str__(self): return self.name class SourceLanguage(TimeStampedModel): GERMAN = 'DE' ENGLISH = 'EN' SPANISH = 'ES' FRENCH = 'FR' ITALIAN = 'IT' RUSSIAN = 'RU' PORTUGUESE = 'PT' LANGUAGE_CHOICES = ( (ENGLISH, 'English'), (SPANISH, 'Spanish'), (GERMAN, 'German'), (FRENCH, 'French'), (ITALIAN, 'Italian'), (RUSSIAN, 'Russian'), (PORTUGUESE, 'Portuguese'), ) language = models.CharField(max_length=2, choices=LANGUAGE_CHOICES) source = models.ForeignKey(Source, on_delete=models.CASCADE) def __str__(self): return '%s (%s)' % (self.get_language_display(), self.language) class ConsolidateGenre(TimeStampedModel): name = models.CharField(max_length=200) def __str__(self): return self.name class Genre(TimeStampedModel): name = models.CharField(max_length=200) source = models.ForeignKey(Source, on_delete=models.CASCADE) # consolidategenre = models.ForeignKey(ConsolidateGenre, # on_delete=models.CASCADE) def __str__(self): return self.name class AdvRawQuerySet(models.query.RawQuerySet): """RawQuerySet subclass with advanced options.""" def __init__(self, raw_query, paged_query, count_query, model=None, query=None, params=None, translations=None, using=None, hints=None): super(AdvRawQuerySet, self).__init__(raw_query, model=model, query=query, params=params, translations=translations, using=using, hints=hints) self.raw_query = raw_query self.paged_query = paged_query self.count_query = count_query def __getitem__(self, key): if isinstance(key, slice): start, stop = key.start, key.stop else: start, stop = key, key + 1 if self.params: params = self.params + [stop-start, start] else: params = (stop-start, start) return models.query.RawQuerySet(self.paged_query, model=self.model, params=params, translations=self.translations, using=self._db, hints=self._hints) def __len__(self): cursor = connection.cursor() cursor.execute(self.count_query, self.params) return cursor.fetchone()[0] class MangaQuerySet(models.QuerySet): def latests(self): """Return the lastest mangas with new/updated issues.""" # The correct annotation expression is the next one, but due # to an error in Django ORM, this empression uses a full GROUP # BY with the data fields. This produce a slow query. # # return self.annotate( # models.Max('issue__modified') # ).order_by('-issue__modified__max') # # Alternative (without deferreds) # # extra_query = ''' # SELECT MAX(core_issue.modified) # FROM core_issue # WHERE core_issue.manga_id = core_manga.id # ''' # Manga.objects.extra({ # 'issue__modified__max': extra_query # }).order_by('-issue__modified__max') raw_query = ''' SELECT core_manga.id, MAX(core_issue.modified) AS issue__modified__max FROM core_manga LEFT OUTER JOIN core_issue ON (core_manga.id = core_issue.manga_id) GROUP BY core_manga.id ORDER BY issue__modified__max DESC NULLS LAST, core_manga.name ASC, core_manga.url ASC; ''' paged_query = ''' SELECT core_manga.id, MAX(core_issue.modified) AS issue__modified__max FROM core_manga LEFT OUTER JOIN core_issue ON (core_manga.id = core_issue.manga_id) GROUP BY core_manga.id ORDER BY issue__modified__max DESC NULLS LAST, core_manga.name ASC, core_manga.url ASC LIMIT %s OFFSET %s; ''' count_query = ''' SELECT COUNT(*) FROM core_manga; ''' return AdvRawQuerySet(raw_query=raw_query, paged_query=paged_query, count_query=count_query, model=self.model, using=self.db) def _to_tsquery(self, q): """Convert a query to a PostgreSQL tsquery.""" # Remove special chars (except parens) q = ''.join(c if c.isalnum() or c in '()' else ' ' for c in q) # Separate parentesis from words for token in ('(', ')'): q = q.replace(token, ' %s ' % token) # Parse the query op = { 'and': '&', 'or': '|', 'not': '-', '(': '(', ')': ')', } # Join operators j = '&|' # Operators that expect and join before ops_j = '-(' tsquery = [] for token in q.split(): if token in op: if tsquery and op[token] in ops_j and tsquery[-1] not in j: tsquery.append(op['and']) tsquery.append(op[token]) else: if tsquery and tsquery[-1] not in (j + ops_j): tsquery.append(op['and']) tsquery.append('%s:*' % token) # Add spaces between join operators tsquery = [(t if t not in j else ' %s ' % t) for t in tsquery] return ''.join(tsquery) def is_valid(self, q): """Check is the query is a valid query.""" q = self._to_tsquery(q) # Separate parentesis from words for token in ('(', ')'): q = q.replace(token, ' %s ' % token) s = [] for token in q.split(): if token == '(': s.append(token) elif token == ')': try: t = s.pop() except IndexError: return False if t != '(': return False return not len(s) def search(self, q): q = self._to_tsquery(q) raw_query = ''' SELECT core_manga.* FROM ( SELECT id FROM core_manga_fts_view, to_tsquery(%s) AS q WHERE document @@ q ORDER BY ts_rank(document, q) DESC, name ASC, url ASC ) AS ids INNER JOIN core_manga ON core_manga.id = ids.id; ''' paged_query = ''' SELECT core_manga.* FROM ( SELECT id FROM core_manga_fts_view, to_tsquery(%s) AS q WHERE document @@ q ORDER BY ts_rank(document, q) DESC, name ASC, url ASC LIMIT %s OFFSET %s ) AS ids INNER JOIN core_manga ON core_manga.id = ids.id; ''' count_query = ''' SELECT COUNT(*) FROM core_manga_fts_view WHERE document @@ to_tsquery(%s); ''' return AdvRawQuerySet(raw_query=raw_query, paged_query=paged_query, count_query=count_query, model=self.model, params=[q], using=self.db) def refresh(self): cursor = connection.cursor() cursor.execute('REFRESH MATERIALIZED VIEW core_manga_fts_view;') def _cover_path(instance, filename): return os.path.join(instance.source.spider, filename) class Manga(TimeStampedModel): LEFT_TO_RIGHT = 'LR' RIGHT_TO_LEFT = 'RL' READING_DIRECTION = ( (LEFT_TO_RIGHT, 'Left-to-right'), (RIGHT_TO_LEFT, 'Right-to-left'), ) ONGOING = 'O' COMPLETED = 'C' STATUS = ( (ONGOING, 'Ongoing'), (COMPLETED, 'Completed'), ) ASC = 'ASC' DESC = 'DESC' RANK_ORDER = ( (ASC, 'Ascending'), (DESC, 'Descending'), ) name = models.CharField(max_length=200, db_index=True) # slug = models.SlugField(max_length=200) # release = models.DateField() author = models.CharField(max_length=200) artist = models.CharField(max_length=200) reading_direction = models.CharField(max_length=2, choices=READING_DIRECTION, default=RIGHT_TO_LEFT) status = models.CharField(max_length=1, choices=STATUS, default=ONGOING) genres = models.ManyToManyField(Genre) rank = models.FloatField(null=True, blank=True) rank_order = models.CharField(max_length=4, choices=RANK_ORDER, default=ASC) description = models.TextField() cover = models.ImageField(upload_to=_cover_path) url = models.URLField(unique=True, db_index=True) source = models.ForeignKey(Source, on_delete=models.CASCADE) objects = MangaQuerySet.as_manager() def __str__(self): return self.name def subscribe(self, user, language=None, issues_per_day=4, paused=False): """Subscribe an User to the current manga.""" language = language if language else user.userprofile.language obj, created = Subscription.all_objects.update_or_create( manga=self, user=user, defaults={ 'language': language, 'issues_per_day': issues_per_day, 'paused': paused, 'deleted': False, }) return obj def is_subscribed(self, user): """Check if an user is subscribed to this manga.""" return self.subscription(user).exists() def subscription(self, user): """Return the users' subscription of this manga.""" return self.subscription_set.filter(user=user) def languages(self): """Return the number of issues per language.""" return self.issue_set\ .values('language')\ .order_by('language')\ .annotate(Count('language')) class AltName(TimeStampedModel): name = models.CharField(max_length=200) manga = models.ForeignKey(Manga, on_delete=models.CASCADE) def __str__(self): return self.name class Issue(TimeStampedModel): name = models.CharField(max_length=200) number = models.CharField(max_length=10) order = models.IntegerField() language = models.CharField(max_length=2, choices=SourceLanguage.LANGUAGE_CHOICES) release = models.DateField() url = models.URLField(unique=True, max_length=255) manga = models.ForeignKey(Manga, on_delete=models.CASCADE) class Meta: ordering = ('order', 'name') def __str__(self): return self.name def is_sent(self, user): """Check if an user has received this issue.""" return self.result(user, status=Result.SENT).exists() def create_result_if_needed(self, user, status, set_send_date=True): """Create `Result` if is new with a status.""" defaults = {'status': status} if set_send_date: defaults['send_date'] = timezone.now() subscription = Subscription.objects.get( manga=self.manga, user=user) result, _ = Result.objects.update_or_create( issue=self, subscription=subscription, defaults=defaults) return result def result(self, user, status=None): """Return the Result for an user for this issue.""" # XXX TODO - Avoid filtering by subscription__deleted using # the Subscription manager. query = self.result_set.filter( subscription__user=user, subscription__deleted=False) if status: query = query.filter(status=status) return query def retry_if_failed(self, user): """Increment the retry field of `Result` if status is FAIL.""" self.result(user, status=Result.FAILED).update(retry=F('retry') + 1) class SubscriptionQuerySet(models.QuerySet): def latests(self, user): """Return the latests subscriptions with changes in Result.""" # See the notes from `MangaQuerySet.latests()` raw_query = ''' SELECT core_subscription.id, MAX(core_result.modified) AS result__modified__max FROM core_subscription LEFT OUTER JOIN core_result ON (core_subscription.id = core_result.subscription_id) WHERE core_subscription.deleted = false AND core_subscription.user_id = %s GROUP BY core_subscription.id ORDER BY result__modified__max DESC NULLS LAST, core_subscription.id ASC; ''' paged_query = ''' SELECT core_subscription.id, MAX(core_result.modified) AS result__modified__max FROM core_subscription LEFT OUTER JOIN core_result ON (core_subscription.id = core_result.subscription_id) WHERE core_subscription.deleted = false AND core_subscription.user_id = %s GROUP BY core_subscription.id ORDER BY result__modified__max DESC NULLS LAST, core_subscription.id ASC LIMIT %s OFFSET %s; ''' count_query = ''' SELECT COUNT(*) FROM core_subscription WHERE core_subscription.deleted = false AND core_subscription.user_id = %s; ''' return AdvRawQuerySet(raw_query=raw_query, paged_query=paged_query, count_query=count_query, model=self.model, params=[user.id], using=self.db) class SubscriptionManager(models.Manager): def get_queryset(self): """Exclude deleted subscriptions.""" return super(SubscriptionManager, self).get_queryset().exclude(deleted=True) class SubscriptionActiveManager(models.Manager): def get_queryset(self): """Exclude paused and deleted subscriptions.""" return super(SubscriptionActiveManager, self).get_queryset().exclude( Q(paused=True) | Q(deleted=True)) class Subscription(TimeStampedModel): # Number of retries before giving up in a FAILED result RETRY = 3 manga = models.ForeignKey(Manga, on_delete=models.CASCADE) user = models.ForeignKey(settings.AUTH_USER_MODEL, on_delete=models.CASCADE) language = models.CharField(max_length=2, choices=SourceLanguage.LANGUAGE_CHOICES) issues_per_day = models.IntegerField(default=4) paused = models.BooleanField(default=False) deleted = models.BooleanField(default=False) objects = SubscriptionManager.from_queryset(SubscriptionQuerySet)() actives = SubscriptionActiveManager.from_queryset(SubscriptionQuerySet)() all_objects = models.Manager() class Meta: unique_together = ('manga', 'user') def __str__(self): return '%s (%d per day)' % (self.manga, self.issues_per_day) def issues(self): """Return the list of issues in the language of the Subscription.""" return self.manga.issue_set.filter(language=self.language) def issues_to_send(self, retry=None): """Return the list of issues to send, ordered by number.""" if not retry: retry = Subscription.RETRY already_sent = Result.objects.processed_last_24hs(self.user, subscription=self) remains = max(0, self.issues_per_day-already_sent) return self.manga.issue_set.filter( language=self.language ).exclude( pk__in=self.result_set.filter( Q(status__in=(Result.PROCESSING, Result.SENT)) | (Q(status=Result.FAILED) & Q(retry__gt=retry)) ).values('issue__id') ).order_by('order')[:remains] def issues_to_retry(self, retry=None): """Return the list of issues to retry, ordered by number.""" # This method doesn't take care about the limits of the user if not retry: retry = Subscription.RETRY return self.manga.issue_set.filter( language=self.language, result__subscription=self, result__status=Result.FAILED, result__retry__lte=retry ).order_by('order') def add_sent(self, issue): """Add or update a Result to a Subscription.""" # XXX TODO - add_sent is deprecated, use # Issue.create_result_if_needed, or extend the features inside # Subscription. return Result.objects.update_or_create( issue=issue, subscription=self, defaults={ 'status': Result.SENT, 'send_date': timezone.now(), }) def latest_issues(self): """Return the list of issues ordered by modified result.""" return self.issues().filter( result__subscription=self ).annotate( models.Max('result__modified') ).order_by('-result__modified') class ResultQuerySet(models.QuerySet): TIME_DELTA = 2 def latests(self, status=None): query = self if status: query = query.filter(status=status) return query.order_by('-modified') def _processed_last_24hs(self, user, subscription=None): """Return the list of `Result` processed during the last 24 hours.""" today = timezone.now() yesterday = today - timezone.timedelta(days=1) # XXX TODO - Objects are created / modified always after time # T. If the send process is slow, the error margin can be # bigger than the one used here. yesterday += timezone.timedelta(hours=ResultQuerySet.TIME_DELTA) query = self.filter( subscription__user=user, send_date__range=[yesterday, today], ) if subscription: query = query.filter(subscription=subscription) return query def processed_last_24hs(self, user, subscription=None): """Return the number of `Result` processed during the last 24 hours.""" return self._processed_last_24hs(user, subscription).count() def pending(self): return self.latests(status=Result.PENDING) def processing(self): return self.latests(status=Result.PROCESSING) def sent(self): return self.latests(status=Result.SENT) def failed(self): return self.latests(status=Result.FAILED) class Result(TimeStampedModel): PENDING = 'PE' PROCESSING = 'PR' SENT = 'SE' FAILED = 'FA' STATUS_CHOICES = ( (PENDING, 'Pending'), (PROCESSING, 'Processing'), (SENT, 'Sent'), (FAILED, 'Failed'), ) issue = models.ForeignKey(Issue, on_delete=models.CASCADE) subscription = models.ForeignKey(Subscription, on_delete=models.CASCADE) status = models.CharField(max_length=2, choices=STATUS_CHOICES, default=PENDING) missing_pages = models.IntegerField(default=0) send_date = models.DateTimeField(null=True, blank=True) retry = models.IntegerField(default=0) objects = ResultQuerySet.as_manager() class Meta: unique_together = ('issue', 'subscription') def __str__(self): return '%s (%s)' % (self.issue, self.get_status_display()) def get_absolute_url(self): return reverse('result-detail', kwargs={'pk': self.pk}) def set_status(self, status): self.status = status # If the result is marked as FAILED, unset the `send_date`. # In this way, if the result is moved to PENDING is not # counted as SENT. Also if is not moved, the user can have # one more issue for this day. if status == Result.FAILED: self.send_date = None self.save() def is_pending(self): return self.status == Result.PENDING def is_processing(self): return self.status == Result.PROCESSING def is_sent(self): return self.status == Result.SENT def is_failed(self): return self.status == Result.FAILED
gpl-3.0
-7,570,314,442,123,775,000
32.632653
80
0.56334
false
4.111303
true
false
false
HingeChat/HingeChat
src/hingechat/qt/qChatWidget.py
1
8829
import re from PyQt5.QtCore import Qt from PyQt5.QtCore import QTimer from PyQt5.QtGui import QFontMetrics from PyQt5.QtWidgets import QHBoxLayout from PyQt5.QtWidgets import QMessageBox from PyQt5.QtWidgets import QLabel from PyQt5.QtWidgets import QPushButton from PyQt5.QtWidgets import QSplitter from PyQt5.QtWidgets import QTextBrowser from PyQt5.QtWidgets import QTextEdit from PyQt5.QtWidgets import QLineEdit from PyQt5.QtWidgets import QWidget from src.hingechat.qt import qtUtils from src.hinge.utils import * class QChatWidget(QWidget): def __init__(self, chat_window, nick, parent=None): QWidget.__init__(self, parent) self.chat_window = chat_window self.nick = nick self.disabled = False self.cleared = False self.url_regex = re.compile(URL_REGEX) self.chat_log = QTextBrowser() self.chat_log.setOpenExternalLinks(True) self.chat_input = QTextEdit() self.chat_input.textChanged.connect(self.chatInputTextChanged) self.send_button = QPushButton("Send") self.send_button.clicked.connect(self.sendMessage) # Set the min height for the chatlog and a matching fixed height for the send button chat_input_font_metrics = QFontMetrics(self.chat_input.font()) self.chat_input.setMinimumHeight(chat_input_font_metrics.lineSpacing() * 3) self.send_button.setFixedHeight(chat_input_font_metrics.lineSpacing() * 3) hbox = QHBoxLayout() hbox.addWidget(self.chat_input) hbox.addWidget(self.send_button) # Put the chatinput and send button in a wrapper widget so they may be added to the splitter chat_input_wrapper = QWidget() chat_input_wrapper.setLayout(hbox) chat_input_wrapper.setMinimumHeight(chat_input_font_metrics.lineSpacing() * 3.7) # Put the chat log and chat input into a splitter so the user can resize them at will splitter = QSplitter(Qt.Vertical) splitter.addWidget(self.chat_log) splitter.addWidget(chat_input_wrapper) splitter.setSizes([int(parent.height()), 1]) hbox = QHBoxLayout() hbox.addWidget(splitter) self.setLayout(hbox) self.typing_timer = QTimer() self.typing_timer.setSingleShot(True) self.typing_timer.timeout.connect(self.stoppedTyping) def setRemoteNick(self, nick): self.nick = nick def chatInputTextChanged(self): # Check if the text changed was the text box being cleared to avoid sending an invalid typing status if self.cleared: self.cleared = False return if str(self.chat_input.toPlainText())[-1:] == '\n': self.sendMessage() else: # Start a timer to check for the user stopping typing self.typing_timer.start(TYPING_TIMEOUT) self.sendTypingStatus(TYPING_START) def stoppedTyping(self): self.typing_timer.stop() if str(self.chat_input.toPlainText()) == '': self.sendTypingStatus(TYPING_STOP_WITHOUT_TEXT) else: self.sendTypingStatus(TYPING_STOP_WITH_TEXT) def sendMessage(self): if self.disabled: return else: pass self.typing_timer.stop() text = str(self.chat_input.toPlainText())[:-1] # Don't send empty messages if text == '': return # Convert URLs into clickable links text = self.__linkify(text) # Add the message to the message queue to be sent self.chat_window.client.getSession(self.remote_id).sendChatMessage(text) # Clear the chat input self.wasCleared = True self.chat_input.clear() self.appendMessage(text, MSG_SENDER) def sendTypingStatus(self, status): self.chat_window.client.getSession(self.remote_id).sendTypingMessage(status) def showNowChattingMessage(self, nick): self.nick = nick self.remote_id = self.chat_window.client.getClientId(self.nick) self.appendMessage("You are now securely chatting with " + self.nick + " :)", MSG_SERVICE, show_timestamp_and_nick=False) self.appendMessage("It's a good idea to verify the communcation is secure by selecting " "\"authenticate buddy\" in the options menu.", MSG_SERVICE, show_timestamp_and_nick=False) self.addNickButton = QPushButton('Add', self) self.addNickButton.setGeometry(584, 8, 31, 23) self.addNickButton.clicked.connect(self.addNickScreen) self.addNickButton.show() def addUser(self, user): nick = str(user.text()).lower() # Validate the given nick nickStatus = utils.isValidNick(nick) if nickStatus == errors.VALID_NICK: # TODO: Group chats pass elif nickStatus == errors.INVALID_NICK_CONTENT: QMessageBox.warning(self, errors.TITLE_INVALID_NICK, errors.INVALID_NICK_CONTENT) elif nickStatus == errors.INVALID_NICK_LENGTH: QMessageBox.warning(self, errors.TITLE_INVALID_NICK, errors.INVALID_NICK_LENGTH) elif nickStatus == errors.INVALID_EMPTY_NICK: QMessageBox.warning(self, errors.TITLE_EMPTY_NICK, errors.EMPTY_NICK) def addNickScreen(self): self.chat_log.setEnabled(False) self.chat_input.setEnabled(False) self.send_button.setEnabled(False) self.addNickButton.hide() self.addUserText = QLabel("Enter a username to add a user to the group chat.", self) self.addUserText.setGeometry(200, 20, 300, 100) self.addUserText.show() self.user = QLineEdit(self) self.user.setGeometry(200, 120, 240, 20) self.user.returnPressed.connect(self.addUser) self.user.show() self.addUserButton = QPushButton('Add User', self) self.addUserButton.setGeometry(250, 150, 150, 25) self.addUserButton.clicked.connect(lambda: self.addUser(self.user)) self.addUserButton.show() self.cancel = QPushButton('Cancel', self) self.cancel.setGeometry(298, 210, 51, 23) self.cancel.clicked.connect(lambda: self.chat_log.setEnabled(True)) self.cancel.clicked.connect(lambda: self.chat_input.setEnabled(True)) self.cancel.clicked.connect(lambda: self.send_button.setEnabled(True)) self.cancel.clicked.connect(self.addUserText.hide) self.cancel.clicked.connect(self.user.hide) self.cancel.clicked.connect(self.addUserButton.hide) self.cancel.clicked.connect(self.addNickButton.show) self.cancel.clicked.connect(self.cancel.hide) self.cancel.show() def appendMessage(self, message, source, show_timestamp_and_nick=True): color = self.__getColor(source) if show_timestamp_and_nick: timestamp = '<font color="' + color + '">(' + getTimestamp() + ') <strong>' + \ (self.chat_window.client.nick if source == MSG_SENDER else self.nick) + \ ':</strong></font> ' else: timestamp = '' # If the user has scrolled up (current value != maximum), do not move the scrollbar # to the bottom after appending the message shouldScroll = True scrollbar = self.chat_log.verticalScrollBar() if scrollbar.value() != scrollbar.maximum() and source != constants.SENDER: shouldScroll = False self.chat_log.append(timestamp + message) # Move the vertical scrollbar to the bottom of the chat log if shouldScroll: scrollbar.setValue(scrollbar.maximum()) def __linkify(self, text): matches = self.url_regex.findall(text) for match in matches: text = text.replace(match[0], '<a href="%s">%s</a>' % (match[0], match[0])) return text def __getColor(self, source): if source == MSG_SENDER: if qtUtils.is_light_theme: return '#0000CC' else: return '#6666FF' elif source == MSG_RECEIVER: if qtUtils.is_light_theme: return '#CC0000' else: return '#CC3333' else: if qtUtils.is_light_theme: return '#000000' else: return '#FFFFFF' def disable(self): self.disabled = True self.chat_input.setReadOnly(True) def enable(self): self.disabled = False self.chat_input.setReadOnly(False)
lgpl-3.0
7,082,114,969,052,042,000
36.220779
117
0.619209
false
3.998641
false
false
false
JiahuiZHONG/Internship_Thread
tests/scripts/thread-cert/Cert_5_6_08_ContextManagement.py
1
4303
#!/usr/bin/python # # Copyright (c) 2016, Nest Labs, Inc. # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are met: # 1. Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # 2. Redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in the # documentation and/or other materials provided with the distribution. # 3. Neither the name of the copyright holder nor the # names of its contributors may be used to endorse or promote products # derived from this software without specific prior written permission. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" # AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE # IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE # ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE # LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR # CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF # SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS # INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN # CONTRACT, STRICT LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) # ARISING IN ANY WAY OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE # POSSIBILITY OF SUCH DAMAGE. # import pexpect import time import unittest import node LEADER = 1 ROUTER = 2 ED = 3 class Cert_5_6_8_ContextManagement(unittest.TestCase): def setUp(self): self.nodes = {} for i in range(1,4): self.nodes[i] = node.Node(i) self.nodes[LEADER].set_panid(0xface) self.nodes[LEADER].set_mode('rsdn') self.nodes[LEADER].add_whitelist(self.nodes[ROUTER].get_addr64()) self.nodes[LEADER].add_whitelist(self.nodes[ED].get_addr64()) self.nodes[LEADER].enable_whitelist() self.nodes[LEADER].set_context_reuse_delay(10) self.nodes[ROUTER].set_panid(0xface) self.nodes[ROUTER].set_mode('rsdn') self.nodes[ROUTER].add_whitelist(self.nodes[LEADER].get_addr64()) self.nodes[ROUTER].enable_whitelist() self.nodes[ED].set_panid(0xface) self.nodes[ED].set_mode('rsn') self.nodes[ED].add_whitelist(self.nodes[LEADER].get_addr64()) self.nodes[ED].enable_whitelist() def tearDown(self): for node in self.nodes.itervalues(): node.stop() del self.nodes def test(self): self.nodes[LEADER].start() self.nodes[LEADER].set_state('leader') self.assertEqual(self.nodes[LEADER].get_state(), 'leader') self.nodes[ROUTER].start() time.sleep(3) self.assertEqual(self.nodes[ROUTER].get_state(), 'router') self.nodes[ED].start() time.sleep(3) self.assertEqual(self.nodes[ED].get_state(), 'child') self.nodes[ROUTER].add_prefix('2001::/64', 'pvcrs') self.nodes[ROUTER].register_netdata() time.sleep(2) addrs = self.nodes[LEADER].get_addrs() for addr in addrs: if addr[0:3] == '200': self.nodes[ED].ping(addr) self.nodes[ROUTER].remove_prefix('2001::/64') self.nodes[ROUTER].register_netdata() time.sleep(5) addrs = self.nodes[LEADER].get_addrs() for addr in addrs: if addr[0:3] == '200': self.nodes[ED].ping(addr) self.nodes[ROUTER].add_prefix('2002::/64', 'pvcrs') self.nodes[ROUTER].register_netdata() time.sleep(5) addrs = self.nodes[LEADER].get_addrs() for addr in addrs: if addr[0:3] == '200': self.nodes[ED].ping(addr) time.sleep(5) self.nodes[ROUTER].add_prefix('2003::/64', 'pvcrs') self.nodes[ROUTER].register_netdata() time.sleep(5) addrs = self.nodes[LEADER].get_addrs() for addr in addrs: if addr[0:3] == '200': self.nodes[ED].ping(addr) if __name__ == '__main__': unittest.main()
bsd-3-clause
-5,238,427,176,629,124,000
35.159664
78
0.647223
false
3.709483
false
false
false
scherroman/mugen
mugen/location_utility.py
1
2143
from typing import List, Tuple """ Module for Location & Interval manipulation """ def intervals_from_locations(locations: List[float]) -> List[float]: intervals = [] previous_location = None for index, location in enumerate(locations): if index == 0: intervals.append(location) else: intervals.append(location - previous_location) previous_location = location return intervals def locations_from_intervals(intervals: List[float]) -> List[float]: locations = [] running_duration = 0 for index, interval in enumerate(intervals): if index < len(intervals): running_duration += interval locations.append(running_duration) return locations def start_end_locations_from_locations(locations: List[float]) -> Tuple[List[float], List[float]]: """ Calculates the start and end times of each location Ex) 5, 10, 15 start_times == 5, 10, 15 end_times == 10, 15, 15 Returns ------- A tuple of start and end times """ start_locations = [] end_locations = [] for index, location in enumerate(locations): start_time = location if index == len(locations) - 1: end_time = location else: end_time = locations[index + 1] start_locations.append(start_time) end_locations.append(end_time) return start_locations, end_locations def start_end_locations_from_intervals(intervals: List[float]) -> Tuple[List[float], List[float]]: """ Calculates the start and end times of each interval Ex) 5, 10, 15 start_times == 0, 5, 10 end_times == 5, 10, 15 Returns ------- A tuple of start and end times """ start_locations = [] end_locations = [] running_duration = 0 for index, duration in enumerate(intervals): start_time = running_duration end_time = start_time + duration start_locations.append(start_time) end_locations.append(end_time) running_duration += duration return start_locations, end_locations
mit
7,078,705,883,654,456,000
23.918605
98
0.615492
false
4.268924
false
false
false
adbrebs/spynet
models/max_pool_3d.py
1
3198
from theano import tensor from theano.tensor.signal.downsample import DownsampleFactorMax def max_pool_3d(input, ds, ignore_border=False): """ Takes as input a N-D tensor, where N >= 3. It downscales the input by the specified factor, by keeping only the maximum value of non-overlapping patches of size (ds[0],ds[1],ds[2]) (depth, height, width) Arguments: input (N-D theano tensor of input images): input images. Max pooling will be done over the 3 last dimensions. ds (tuple of length 3): factor by which to downscale. (2,2,2) will halve the video in each dimension. ignore_border (boolean): When True, (5,5,5) input with ds=(2,2,2) will generate a (2,2,2) output. (3,3,3) otherwise. """ if input.ndim < 3: raise NotImplementedError('max_pool_3d requires a dimension >= 3') # extract nr dimensions vid_dim = input.ndim # max pool in two different steps, so we can use the 2d implementation of # downsamplefactormax. First maxpool frames as usual. # Then maxpool the depth dimension. Shift the depth dimension to the third # position, so rows and cols are in the back # extract dimensions frame_shape = input.shape[-2:] # count the number of "leading" dimensions, store as dmatrix batch_size = tensor.prod(input.shape[:-2]) batch_size = tensor.shape_padright(batch_size,1) # store as 4D tensor with shape: (batch_size,1,height,width) new_shape = tensor.cast(tensor.join(0, batch_size, tensor.as_tensor([1,]), frame_shape), 'int32') input_4D = tensor.reshape(input, new_shape, ndim=4) # downsample mini-batch of videos in rows and cols op = DownsampleFactorMax((ds[1],ds[2]), ignore_border) output = op(input_4D) # restore to original shape outshape = tensor.join(0, input.shape[:-2], output.shape[-2:]) out = tensor.reshape(output, outshape, ndim=input.ndim) # now maxpool depth # output (depth, rows, cols), reshape so that depth is in the back shufl = (list(range(vid_dim-3)) + [vid_dim-2]+[vid_dim-1]+[vid_dim-3]) input_depth = out.dimshuffle(shufl) # reset dimensions vid_shape = input_depth.shape[-2:] # count the number of "leading" dimensions, store as dmatrix batch_size = tensor.prod(input_depth.shape[:-2]) batch_size = tensor.shape_padright(batch_size,1) # store as 4D tensor with shape: (batch_size,1,width,depth) new_shape = tensor.cast(tensor.join(0, batch_size, tensor.as_tensor([1,]), vid_shape), 'int32') input_4D_depth = tensor.reshape(input_depth, new_shape, ndim=4) # downsample mini-batch of videos in depth op = DownsampleFactorMax((1,ds[0]), ignore_border) outdepth = op(input_4D_depth) # output # restore to original shape (xxx, rows, cols, depth) outshape = tensor.join(0, input_depth.shape[:-2], outdepth.shape[-2:]) shufl = (list(range(vid_dim-3)) + [vid_dim-1]+[vid_dim-3]+[vid_dim-2]) return tensor.reshape(outdepth, outshape, ndim=input.ndim).dimshuffle(shufl)
bsd-2-clause
608,790,142,119,456,300
42.821918
117
0.641026
false
3.468547
false
false
false
mikedh/trimesh
trimesh/path/exchange/load.py
1
2622
import os from .dxf import _dxf_loaders from .svg_io import svg_to_path from ..path import Path from . import misc from ... import util def load_path(file_obj, file_type=None, **kwargs): """ Load a file to a Path file_object. Parameters ----------- file_obj : One of the following: - Path, Path2D, or Path3D file_objects - open file file_object (dxf or svg) - file name (dxf or svg) - shapely.geometry.Polygon - shapely.geometry.MultiLineString - dict with kwargs for Path constructor - (n,2,(2|3)) float, line segments file_type : str Type of file is required if file file_object passed. Returns --------- path : Path, Path2D, Path3D file_object Data as a native trimesh Path file_object """ if isinstance(file_obj, Path): # we have been passed a Path file_object so # do nothing and return the passed file_object return file_obj elif util.is_file(file_obj): # for open file file_objects use loaders kwargs.update(path_loaders[file_type]( file_obj, file_type=file_type)) elif util.is_string(file_obj): # strings passed are evaluated as file file_objects with open(file_obj, 'rb') as file_file_obj: # get the file type from the extension file_type = os.path.splitext(file_obj)[-1][1:].lower() # call the loader kwargs.update(path_loaders[file_type]( file_file_obj, file_type=file_type)) elif util.is_instance_named(file_obj, 'Polygon'): # convert from shapely polygons to Path2D kwargs.update(misc.polygon_to_path(file_obj)) elif util.is_instance_named(file_obj, 'MultiLineString'): # convert from shapely LineStrings to Path2D kwargs.update(misc.linestrings_to_path(file_obj)) elif isinstance(file_obj, dict): # load as kwargs from ...exchange.load import load_kwargs return load_kwargs(file_obj) elif util.is_sequence(file_obj): # load as lines in space kwargs.update(misc.lines_to_path(file_obj)) else: raise ValueError('Not a supported object type!') from ...exchange.load import load_kwargs return load_kwargs(kwargs) def path_formats(): """ Get a list of supported path formats. Returns ------------ loaders : list of str Extensions of loadable formats, ie: ['svg', 'dxf'] """ return list(path_loaders.keys()) path_loaders = {'svg': svg_to_path} path_loaders.update(_dxf_loaders)
mit
7,173,151,525,337,611,000
29.847059
66
0.615179
false
3.78355
false
false
false
jakdot/pyactr
tutorials/u7_simplecompilation.py
1
1254
""" Testing a simple case of production compilation. The compilation also allows for utility learning, shown in the model below, as well. """ import warnings import pyactr as actr class Compilation1(object): """ Model testing compilation -- basic cases. """ def __init__(self, **kwargs): actr.chunktype("state", "starting ending") self.m = actr.ACTRModel(**kwargs) self.m.goal.add(actr.makechunk(nameofchunk="start", typename="state", starting=1)) self.m.productionstring(name="one", string=""" =g> isa state starting =x ending ~=x ==> =g> isa state ending =x""", utility=2) self.m.productionstring(name="two", string=""" =g> isa state starting =x ending =x ==> =g> isa state starting =x ending 4""") if __name__ == "__main__": warnings.simplefilter("ignore") mm = Compilation1(production_compilation=True, utility_learning=True) model = mm.m sim = model.simulation(realtime=True) sim.run(0.5) print(model.productions["one and two"])
gpl-3.0
8,944,572,004,527,267,000
24.591837
133
0.53429
false
4.045161
false
false
false
coyotevz/nobix-app
nbs/models/misc.py
1
3865
# -*- coding: utf-8 -*- from datetime import datetime from sqlalchemy.ext.declarative import declared_attr from nbs.models import db class TimestampMixin(object): created = db.Column(db.DateTime, default=datetime.now) modified = db.Column(db.DateTime, default=datetime.now, onupdate=datetime.now) @staticmethod def stamp_modified(mapper, connection, target): if db.object_session(target).is_modified(target): target.modified = datetime.now() @classmethod def __declare_last__(cls): db.event.listen(cls, 'before_update', cls.stamp_modified) class RefEntityMixin(object): @declared_attr def entity_id(cls): return db.Column('entity_id', db.Integer, db.ForeignKey('entity.id'), nullable=False) @declared_attr def entity(cls): name = cls.__name__.lower() return db.relationship('Entity', backref=db.backref(name, lazy='joined'), lazy='joined') class Address(RefEntityMixin, db.Model): """Stores addresses information""" __tablename__ = 'address' id = db.Column(db.Integer, primary_key=True) address_type = db.Column(db.Unicode) street = db.Column(db.Unicode(128), nullable=False) city = db.Column(db.Unicode(64)) province = db.Column(db.Unicode(32), nullable=False) postal_code = db.Column(db.Unicode(32)) def __str__(eslf): retval = self.street if self.city: retval += ", {}".format(self.city) retval += ", {}".format(self.province) if self.postal_code: retval += " ({})".format(self.postal_code) return retval def __repr__(self): return "<Address '{}' of '{}: {}'>".format( str(self), self.entity.entity_type, self.entity.full_name ) class Phone(RefEntityMixin, db.Model): """Model to store phone information""" __tablename__ = 'phone' id = db.Column(db.Integer, primary_key=True) phone_type = db.Column(db.Unicode) prefix = db.Column(db.Unicode(8)) number = db.Column(db.Unicode, nullable=False) extension = db.Column(db.Unicode(5)) def __str__(self): retval = self.phone_type+': ' if self.phone_type else '' if self.prefix: retval += "({})".format(self.prefix) retval += self.number if self.extension: retval += " ext: {}".format(self.extension) return retval def __repr__(self): return "<Phone '{}' of '{}: {}'>".format( str(self), self.entity.entity_type, self.entity.full_name ) class Email(RefEntityMixin, db.Model): """Model to store email information""" __tablename__ = 'email' id = db.Column(db.Integer, primary_key=True) email_type = db.Column(db.Unicode(50)) email = db.Column(db.Unicode(50), nullable=False) def __str__(self): retval = self.email_type + ': ' if self.email_type else '' retval += self.email return retval def __repr__(self): return "<Email '{}' of '{}: {}'>".format( str(self), self.entity.entity_type, self.entity.full_name ) class ExtraField(RefEntityMixin, db.Model): """Model to store information of additional data""" __tablename__ = 'extra_field' id = db.Column(db.Integer, primary_key=True) field_name = db.Column(db.Unicode(50), nullable=False) field_value = db.Column(db.Unicode(50), nullable=False) def __str__(self): return self.field_name + ': ' + self.field_value def __repr__(self): return "<ExtraField '{}' of '{}: {}'>".format( str(self), self.entity.entity_type, self.entity.full_name )
mit
6,016,156,342,892,989,000
28.280303
77
0.574386
false
3.789216
false
false
false
pablodiguerero/asterisk.api
migrations/versions/4_add_physical_users_.py
1
1968
"""empty message Revision ID: a374e36d0888 Revises: 4a6559da7594 Create Date: 2017-05-21 22:53:53.490856 """ from alembic import op import sqlalchemy as sa from sqlalchemy.orm import Session from models import physical from models import user # revision identifiers, used by Alembic. revision = '4_add_physical_users' down_revision = '3_modify_user_fields' branch_labels = None depends_on = None def upgrade(): # ### commands auto generated by Alembic - please adjust! ### op.create_table('crm_physical', sa.Column('id', sa.Integer(), nullable=False), sa.Column('fam', sa.String(length=255), nullable=True), sa.Column('name', sa.String(length=255), nullable=False), sa.Column('otch', sa.String(length=255), nullable=True), sa.PrimaryKeyConstraint('id') ) op.create_table('crm_users', sa.Column('id', sa.Integer(), nullable=False), sa.Column('login', sa.String(length=255), nullable=False), sa.Column('password', sa.LargeBinary(), nullable=False), sa.Column('access_level', sa.Integer(), server_default='10', nullable=False), sa.Column('is_active', sa.Boolean(), server_default='f', nullable=False), sa.ForeignKeyConstraint(['id'], ['crm_physical.id'], ondelete='CASCADE'), sa.PrimaryKeyConstraint('id'), sa.UniqueConstraint('login') ) op.add_column('crm_users', sa.Column('sip_id', sa.Integer(), nullable=True)) op.create_foreign_key(None, 'crm_users', 'asterisk_sip_users', ['sip_id'], ['id'], ondelete='SET NULL') # ### end Alembic commands ### bind = op.get_bind() session = Session(bind) phys = physical.Physical("Администратор") phys.user = user.User("admin", "admin") phys.user.access_level = user.User.BOSS session.add(phys) session.commit() def downgrade(): # ### commands auto generated by Alembic - please adjust! ### op.drop_table('crm_users') op.drop_table('crm_physical') # ### end Alembic commands ###
mit
1,240,968,507,135,020,300
31.583333
107
0.670588
false
3.347603
false
false
false
wesm/ibis
dev/merge-pr.py
1
8184
#!/usr/bin/env python # # Licensed to the Apache Software Foundation (ASF) under one or more # contributor license agreements. See the NOTICE file distributed with # this work for additional information regarding copyright ownership. # The ASF licenses this file to You under the Apache License, Version 2.0 # (the "License"); you may not use this file except in compliance with # the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # # Utility for creating well-formed pull request merges and pushing them to # Apache. # usage: ./apache-pr-merge.py (see config env vars below) # # Lightly modified from version of this script in incubator-parquet-format from __future__ import print_function from requests.auth import HTTPBasicAuth import requests import os import subprocess import sys import textwrap from six.moves import input import six IBIS_HOME = os.path.abspath(__file__).rsplit("/", 2)[0] PROJECT_NAME = 'ibis' print("IBIS_HOME = " + IBIS_HOME) # Remote name with the PR PR_REMOTE_NAME = os.environ.get("PR_REMOTE_NAME", "upstream") # Remote name where results pushed PUSH_REMOTE_NAME = os.environ.get("PUSH_REMOTE_NAME", "upstream") GITHUB_BASE = "https://github.com/cloudera/" + PROJECT_NAME + "/pull" GITHUB_API_BASE = "https://api.github.com/repos/cloudera/" + PROJECT_NAME # Prefix added to temporary branches BRANCH_PREFIX = "PR_TOOL" os.chdir(IBIS_HOME) auth_required = False if auth_required: GITHUB_USERNAME = os.environ['GITHUB_USER'] import getpass GITHUB_PASSWORD = getpass.getpass('Enter github.com password for %s:' % GITHUB_USERNAME) def get_json_auth(url): auth = HTTPBasicAuth(GITHUB_USERNAME, GITHUB_PASSWORD) req = requests.get(url, auth=auth) return req.json() get_json = get_json_auth else: def get_json_no_auth(url): req = requests.get(url) return req.json() get_json = get_json_no_auth def fail(msg): print(msg) clean_up() sys.exit(-1) def run_cmd(cmd): if isinstance(cmd, six.string_types): cmd = cmd.split(' ') try: output = subprocess.check_output(cmd) except subprocess.CalledProcessError as e: # this avoids hiding the stdout / stderr of failed processes print('Command failed: %s' % cmd) print('With output:') print('--------------') print(e.output) print('--------------') raise e if isinstance(output, six.binary_type): output = output.decode('utf-8') return output def continue_maybe(prompt): result = input("\n%s (y/n): " % prompt) if result.lower() != "y": fail("Okay, exiting") original_head = run_cmd("git rev-parse HEAD")[:8] def clean_up(): print("Restoring head pointer to %s" % original_head) run_cmd("git checkout %s" % original_head) branches = run_cmd("git branch").replace(" ", "").split("\n") for branch in filter(lambda x: x.startswith(BRANCH_PREFIX), branches): print("Deleting local branch %s" % branch) run_cmd("git branch -D %s" % branch) # merge the requested PR and return the merge hash def merge_pr(pr_num, target_ref): pr_branch_name = "%s_MERGE_PR_%s" % (BRANCH_PREFIX, pr_num) target_branch_name = "%s_MERGE_PR_%s_%s" % (BRANCH_PREFIX, pr_num, target_ref.upper()) run_cmd("git fetch %s pull/%s/head:%s" % (PR_REMOTE_NAME, pr_num, pr_branch_name)) run_cmd("git fetch %s %s:%s" % (PUSH_REMOTE_NAME, target_ref, target_branch_name)) run_cmd("git checkout %s" % target_branch_name) had_conflicts = False try: run_cmd(['git', 'merge', pr_branch_name, '--squash']) except Exception as e: msg = ("Error merging: %s\nWould you like to " "manually fix-up this merge?" % e) continue_maybe(msg) msg = ("Okay, please fix any conflicts and 'git add' " "conflicting files... Finished?") continue_maybe(msg) had_conflicts = True commit_authors = run_cmd(['git', 'log', 'HEAD..%s' % pr_branch_name, '--pretty=format:%an <%ae>']).split("\n") distinct_authors = sorted(set(commit_authors), key=lambda x: commit_authors.count(x), reverse=True) primary_author = distinct_authors[0] commits = run_cmd(['git', 'log', 'HEAD..%s' % pr_branch_name, '--pretty=format:%h [%an] %s']).split("\n\n") merge_message_flags = [] merge_message_flags += ["-m", title] if body is not None: merge_message_flags += ["-m", '\n'.join(textwrap.wrap(body))] authors = "\n".join(["Author: %s" % a for a in distinct_authors]) merge_message_flags += ["-m", authors] if had_conflicts: committer_name = run_cmd("git config --get user.name").strip() committer_email = run_cmd("git config --get user.email").strip() message = ("This patch had conflicts when merged, " "resolved by\nCommitter: %s <%s>" % (committer_name, committer_email)) merge_message_flags += ["-m", message] # The string "Closes #%s" string is required for GitHub to correctly close # the PR merge_message_flags += [ "-m", "Closes #%s from %s and squashes the following commits:" % (pr_num, pr_repo_desc)] for c in commits: merge_message_flags += ["-m", c] run_cmd(['git', 'commit', '--no-verify', # do not run commit hooks '--author="%s"' % primary_author] + merge_message_flags) continue_maybe("Merge complete (local ref %s). Push to %s?" % ( target_branch_name, PUSH_REMOTE_NAME)) try: run_cmd('git push %s %s:%s' % (PUSH_REMOTE_NAME, target_branch_name, target_ref)) except Exception as e: clean_up() fail("Exception while pushing: %s" % e) merge_hash = run_cmd("git rev-parse %s" % target_branch_name)[:8] clean_up() print("Pull request #%s merged!" % pr_num) print("Merge hash: %s" % merge_hash) return merge_hash branches = get_json("%s/branches" % GITHUB_API_BASE) branch_names = filter(lambda x: x.startswith("branch-"), [x['name'] for x in branches]) pr_num = input("Which pull request would you like to merge? (e.g. 34): ") pr = get_json("%s/pulls/%s" % (GITHUB_API_BASE, pr_num)) url = pr["url"] title = pr["title"] body = pr["body"] target_ref = pr["base"]["ref"] user_login = pr["user"]["login"] base_ref = pr["head"]["ref"] pr_repo_desc = "%s/%s" % (user_login, base_ref) if pr["merged"] is True: print("Pull request {0} has already been merged, assuming " "you want to backport".format(pr_num)) merge_commit_desc = run_cmd([ 'git', 'log', '--merges', '--first-parent', '--grep=pull request #%s' % pr_num, '--oneline']).split("\n")[0] if merge_commit_desc == "": fail("Couldn't find any merge commit for #{0}" ", you may need to update HEAD.".format(pr_num)) merge_hash = merge_commit_desc[:7] message = merge_commit_desc[8:] print("Found: %s" % message) sys.exit(0) if not bool(pr["mergeable"]): msg = ("Pull request {0} is not mergeable in its current form.\n" "Continue? (experts only!)".format(pr_num)) continue_maybe(msg) print("\n=== Pull Request #%s ===" % pr_num) print("title\t%s\nsource\t%s\ntarget\t%s\nurl\t%s" % ( title, pr_repo_desc, target_ref, url)) continue_maybe("Proceed with merging pull request #%s?" % pr_num) merged_refs = [target_ref] merge_hash = merge_pr(pr_num, target_ref)
apache-2.0
-6,758,902,495,747,892,000
31.86747
78
0.601417
false
3.487005
false
false
false
vinoth3v/In
In/core/valuator.py
1
7873
import re from In.core.object_meta import ObjectMetaBase class ValuatorContainer(dict): def __missing__(self, key): vcls = IN.register.get_class(key, 'Valuator') obj = vcls() self[key] = obj return obj class ValuatorEngine: '''Valuator class that valuate values based on validation rules. Instance available as IN.valuator ''' # dict of all Valuator instances valuators = ValuatorContainer() def validate(self, value, rule): # rule is ['type', args] or [[], [], []] ''' #TODO: allow per false error message rule = [ 'And', [ ['Length', '>', 6, 'The value length should be greater than 6.'], ['Not', [['Num']], ['Or', [ ['Email', 'Invalid email address.'], ['Domain'], ['Url', 'Invalid Url.'], ]], ]], ] ''' if not rule: # empty list return [True] try: firstitem = rule[0] item_type = type(firstitem) if item_type is str: # ['type', args] args = rule[1:] result = self.valuators[firstitem].validate(value, *args) if not result[0]: #return [False, args[-1]] # last item is error message return result elif item_type is list: # [[], [], []] for subrule in rule: result = self.validate(value, subrule) # recursive if not result[0]: return result except Exception as e: IN.logger.debug() return [False, str(e)] return [True] def __getattr__(self, key): self.key = self.valuators[key] return self.key class ValuatorMeta(ObjectMetaBase): __class_type_base_name__ = 'ValuatorBase' __class_type_name__ = 'Valuator' class ValuatorBase(dict, metaclass = ValuatorMeta): '''Base class of all IN ValuatorBase. ''' __allowed_children__ = None __default_child__ = None ops = { '=' : lambda l, al, ml: l == al, '==' : lambda l, al, ml: l == al, '!=' : lambda l, al, ml: l != al, '>' : lambda l, al, ml: l > al, '<' : lambda l, al, ml: l < al, '>=' : lambda l, al, ml: l >= al, '<=' : lambda l, al, ml: l <= al, '<>' : lambda l, al, ml: al < l > ml, '><' : lambda l, al, ml: al > l < ml, } def validate(self, value): '''return value should be a list like [False, 'Error message.'] or [True] ''' return [True] @IN.register('Valuator', type = 'Valuator') class Valuator(ValuatorBase): '''Base class of all IN ValuatorBase. ''' pass class And(Valuator): pass class Or(Valuator): pass class Not(Valuator): def validate(self, value, rule, message = ''): '''not validator''' result = IN.valuator.validate(value, rule[0]) not_result = not result[0] return [not_result, message] class Empty(Valuator): def validate(self, value, message = ''): # returning value itself makes it evaluates again return [False, message] if value else [True] class NotEmpty(Valuator): def validate(self, value, message = ''): # returning value itself makes it evaluates again return [False, message] if not value else [True] class Length(Valuator): def validate(self, value, length = 0, op = '=', mlength = 0, message = ''): try: # does multiple ifs are good? result = self.ops[op](len(value), length, mlength) result = [result or False, message] return result except KeyError: IN.logger.debug() return [False, message] # always false class Equal(Valuator): def validate(self, value, tvalue, op = '=', mvalue = 0, message = ''): try: # does multiple ifs are good? result = self.ops[op](value, tvalue, mvalue) result = [result or False, message] return result except KeyError: IN.logger.debug() return [False, message] # always false class Regx(Valuator): '''Valuator rule class that using regex''' re_compiled = {} # we dont want to compile again def get_regx(self, regx): try: return self.re_compiled[regx] except KeyError: self.re_compiled[regx] = re.compile(regx) return self.re_compiled[regx] def validate(self, value, regx, message = ''): result = self.get_regx(regx).match(value) return [result, message] class Domain(Regx): regex_host = r'(?:(?:[a-zA-Z0-9][a-zA-Z0-9\-]*)?[a-zA-Z0-9])' def validate(self, domain, message = ''): false_message = [False, message] dlen = len(domain) if dlen < 4 or dlen > 255 or domain.endswith('.') or '.' not in domain: return false_message try: domain = domain.encode('idna').decode('ascii') except Exception: return false_message try: domain.encode('ascii').decode('idna') except Exception: return false_message reg = self.regex_host + r'(?:\.' + self.regex_host + r')*' m = re.match(reg + "$", domain) if not m: return false_message return [True] class Email(Regx): regex = re.compile(r'^[A-Za-z0-9\.\+_-]') atext = r'a-zA-Z0-9_\.\-' # !#\$%&\'\*\+/=\?\^`\{\|\}~ atext_utf8 = atext + r"\u0080-\U0010FFFF" regex_local = re.compile(''.join(('[', atext, ']+(?:\\.[', atext, ']+)*$'))) regex_local_utf8 = re.compile(''.join(('[', atext_utf8, ']+(?:\\.[', atext_utf8, ']+)*$'))) def validate(self, value, message = ''): parts = value.split('@') if len(parts) != 2: return [False, message] local = self.validate_local(parts[0]) if not local: return [False, message] # check domain part domain_result = IN.valuator.validate(parts[1], ['Domain', message]) if not domain_result[0]: return domain_result return [True] # valid def validate_local(self, local): # check nabar name part if not local or len(local) > 64 or '..' in local: return False m = re.match(self.regex_local, local) # ASCII if m: # True return True else: # unicode m = re.match(self.regex_local_utf8, local) if m: return True else: return False class Url(Regx): def validate(self, value, message = ''): return True class Alpha(Valuator): def validate(self, value, message = ''): return [str.isalpha(value), message] class AlphaNum(Valuator): def validate(self, value, message = ''): return [str.isalnum(value), message] class Digit(Valuator): def validate(self, value, message = ''): return [str.isdigit(value), message] class Decimal(Valuator): def validate(self, value, message = ''): return [str.isdecimal(value), message] class Lower(Valuator): def validate(self, value, message = ''): return [str.islower(value), message] class Upper(Valuator): def validate(self, value, message = ''): return [str.isupper(value), message] class Numeric(Valuator): def validate(self, value, message = ''): return [str.isnumeric(value), message] class Space(Valuator): '''Is value has only non printable chars''' def validate(self, value, message = ''): return [str.isspace(value), message] class Startswith(Valuator): def validate(self, value, start, message = ''): return [str(value).startswith(start), message] class Endswith(Valuator): def validate(self, value, start, message = ''): return [str(value).endswith(start), message] class In(Valuator): def validate(self, value, itr, message = ''): return [value in itr, message] class INPath(Valuator): '''Check whether this string is a valid IN route.''' def validate(self, value, message = ''): return True class NabarRole(Valuator): '''Check whether nabar has this role.''' def validate(self, value, message = ''): return True class NabarAccess(Valuator): '''Check whether nabar has this access permissions.''' def validate(self, value): return True class Callback(Valuator): '''call the Callback to valuate.''' def validate(self, value, message = ''): return True #@IN.hook #def __In_app_init__(app): ### set the valuator #IN.valuator = ValuatorEngine()
apache-2.0
3,151,906,794,283,461,600
23.396774
92
0.61133
false
3.104495
false
false
false
plotly/plotly.py
packages/python/plotly/plotly/graph_objs/heatmapgl/legendgrouptitle/_font.py
1
8487
from plotly.basedatatypes import BaseTraceHierarchyType as _BaseTraceHierarchyType import copy as _copy class Font(_BaseTraceHierarchyType): # class properties # -------------------- _parent_path_str = "heatmapgl.legendgrouptitle" _path_str = "heatmapgl.legendgrouptitle.font" _valid_props = {"color", "family", "size"} # color # ----- @property def color(self): """ The 'color' property is a color and may be specified as: - A hex string (e.g. '#ff0000') - An rgb/rgba string (e.g. 'rgb(255,0,0)') - An hsl/hsla string (e.g. 'hsl(0,100%,50%)') - An hsv/hsva string (e.g. 'hsv(0,100%,100%)') - A named CSS color: aliceblue, antiquewhite, aqua, aquamarine, azure, beige, bisque, black, blanchedalmond, blue, blueviolet, brown, burlywood, cadetblue, chartreuse, chocolate, coral, cornflowerblue, cornsilk, crimson, cyan, darkblue, darkcyan, darkgoldenrod, darkgray, darkgrey, darkgreen, darkkhaki, darkmagenta, darkolivegreen, darkorange, darkorchid, darkred, darksalmon, darkseagreen, darkslateblue, darkslategray, darkslategrey, darkturquoise, darkviolet, deeppink, deepskyblue, dimgray, dimgrey, dodgerblue, firebrick, floralwhite, forestgreen, fuchsia, gainsboro, ghostwhite, gold, goldenrod, gray, grey, green, greenyellow, honeydew, hotpink, indianred, indigo, ivory, khaki, lavender, lavenderblush, lawngreen, lemonchiffon, lightblue, lightcoral, lightcyan, lightgoldenrodyellow, lightgray, lightgrey, lightgreen, lightpink, lightsalmon, lightseagreen, lightskyblue, lightslategray, lightslategrey, lightsteelblue, lightyellow, lime, limegreen, linen, magenta, maroon, mediumaquamarine, mediumblue, mediumorchid, mediumpurple, mediumseagreen, mediumslateblue, mediumspringgreen, mediumturquoise, mediumvioletred, midnightblue, mintcream, mistyrose, moccasin, navajowhite, navy, oldlace, olive, olivedrab, orange, orangered, orchid, palegoldenrod, palegreen, paleturquoise, palevioletred, papayawhip, peachpuff, peru, pink, plum, powderblue, purple, red, rosybrown, royalblue, rebeccapurple, saddlebrown, salmon, sandybrown, seagreen, seashell, sienna, silver, skyblue, slateblue, slategray, slategrey, snow, springgreen, steelblue, tan, teal, thistle, tomato, turquoise, violet, wheat, white, whitesmoke, yellow, yellowgreen Returns ------- str """ return self["color"] @color.setter def color(self, val): self["color"] = val # family # ------ @property def family(self): """ HTML font family - the typeface that will be applied by the web browser. The web browser will only be able to apply a font if it is available on the system which it operates. Provide multiple font families, separated by commas, to indicate the preference in which to apply fonts if they aren't available on the system. The Chart Studio Cloud (at https://chart- studio.plotly.com or on-premise) generates images on a server, where only a select number of fonts are installed and supported. These include "Arial", "Balto", "Courier New", "Droid Sans",, "Droid Serif", "Droid Sans Mono", "Gravitas One", "Old Standard TT", "Open Sans", "Overpass", "PT Sans Narrow", "Raleway", "Times New Roman". The 'family' property is a string and must be specified as: - A non-empty string Returns ------- str """ return self["family"] @family.setter def family(self, val): self["family"] = val # size # ---- @property def size(self): """ The 'size' property is a number and may be specified as: - An int or float in the interval [1, inf] Returns ------- int|float """ return self["size"] @size.setter def size(self, val): self["size"] = val # Self properties description # --------------------------- @property def _prop_descriptions(self): return """\ color family HTML font family - the typeface that will be applied by the web browser. The web browser will only be able to apply a font if it is available on the system which it operates. Provide multiple font families, separated by commas, to indicate the preference in which to apply fonts if they aren't available on the system. The Chart Studio Cloud (at https://chart-studio.plotly.com or on- premise) generates images on a server, where only a select number of fonts are installed and supported. These include "Arial", "Balto", "Courier New", "Droid Sans",, "Droid Serif", "Droid Sans Mono", "Gravitas One", "Old Standard TT", "Open Sans", "Overpass", "PT Sans Narrow", "Raleway", "Times New Roman". size """ def __init__(self, arg=None, color=None, family=None, size=None, **kwargs): """ Construct a new Font object Sets this legend group's title font. Parameters ---------- arg dict of properties compatible with this constructor or an instance of :class:`plotly.graph_objs.heatmapgl.lege ndgrouptitle.Font` color family HTML font family - the typeface that will be applied by the web browser. The web browser will only be able to apply a font if it is available on the system which it operates. Provide multiple font families, separated by commas, to indicate the preference in which to apply fonts if they aren't available on the system. The Chart Studio Cloud (at https://chart-studio.plotly.com or on- premise) generates images on a server, where only a select number of fonts are installed and supported. These include "Arial", "Balto", "Courier New", "Droid Sans",, "Droid Serif", "Droid Sans Mono", "Gravitas One", "Old Standard TT", "Open Sans", "Overpass", "PT Sans Narrow", "Raleway", "Times New Roman". size Returns ------- Font """ super(Font, self).__init__("font") if "_parent" in kwargs: self._parent = kwargs["_parent"] return # Validate arg # ------------ if arg is None: arg = {} elif isinstance(arg, self.__class__): arg = arg.to_plotly_json() elif isinstance(arg, dict): arg = _copy.copy(arg) else: raise ValueError( """\ The first argument to the plotly.graph_objs.heatmapgl.legendgrouptitle.Font constructor must be a dict or an instance of :class:`plotly.graph_objs.heatmapgl.legendgrouptitle.Font`""" ) # Handle skip_invalid # ------------------- self._skip_invalid = kwargs.pop("skip_invalid", False) self._validate = kwargs.pop("_validate", True) # Populate data dict with properties # ---------------------------------- _v = arg.pop("color", None) _v = color if color is not None else _v if _v is not None: self["color"] = _v _v = arg.pop("family", None) _v = family if family is not None else _v if _v is not None: self["family"] = _v _v = arg.pop("size", None) _v = size if size is not None else _v if _v is not None: self["size"] = _v # Process unknown kwargs # ---------------------- self._process_kwargs(**dict(arg, **kwargs)) # Reset skip_invalid # ------------------ self._skip_invalid = False
mit
5,632,017,995,005,265,000
36.387665
82
0.559797
false
4.001414
false
false
false
danhooper/sandbox
pinball/attract.py
1
2386
from procgame import * class Mode(game.Mode): def __init__(self, game): super(Mode, self).__init__(game, 1) highscore_categories = [] cat = highscore.HighScoreCategory() cat.game_data_key = "HighScores" cat.titles = [ "Grand Champion", "High Score 1", "High Score 2", "High Score 3", "High Score 4" ] highscore_categories.append(cat) for category in highscore_categories: category.load_from_game(game) frame_proc = dmd.Animation().load('dmd/P-ROC.dmd').frames[0] layer_proc = dmd.FrameLayer(opaque=True, frame=frame_proc) layer_th = dmd.TextLayer(128/2, 7, game.font_jazz, "center", opaque=True).set_text("Town Hall") layer_presents = dmd.TextLayer(128/2, 7, game.font_jazz, "center", opaque=True).set_text("Presents") layer_name = dmd.TextLayer(128/2, 7, game.font_jazz, "center", opaque=True).set_text("TBD") layer_high_scores = [] for frame in highscore.generate_highscore_frames(highscore_categories): layer_high_scores.append(dmd.FrameLayer(opaque=True, frame=frame)) self.layer = dmd.ScriptedLayer(128, 32, [ { "layer": None, "seconds": 10.0 }, { "layer": layer_proc, "seconds": 3.0 }, { "layer": layer_th, "seconds": 3.0 }, { "layer": layer_presents, "seconds": 3.0 }, { "layer": layer_name, "seconds": 3.0 }, { "layer": layer_high_scores[0], "seconds": 3.0 }, { "layer": layer_high_scores[1], "seconds": 3.0 }, { "layer": layer_high_scores[2], "seconds": 3.0 }, { "layer": layer_high_scores[3], "seconds": 3.0 }, { "layer": layer_high_scores[4], "seconds": 3.0 }, ]) def mode_stopped(self): self.layer.script_index = 0 self.frame_start_time = None self.is_new_script_item = True def sw_enter_active(self, sw): self.game.modes.add(self.game.service_mode) return True def sw_exit_active(self, sw): return True def sw_startButton_active(self, sw): self.game.modes.remove(self) self.game.modes.add(self.game.mode.base) return True
mit
-5,484,256,992,289,313,000
38.766667
79
0.536463
false
3.433094
false
false
false
userzimmermann/robotframework-python3
src/robot/utils/text.py
1
3235
# Copyright 2008-2014 Nokia Solutions and Networks # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. from .charwidth import get_char_width from .misc import seq2str2 from .unic import unic _MAX_ASSIGN_LENGTH = 200 _MAX_ERROR_LINES = 40 _MAX_ERROR_LINE_LENGTH = 78 _ERROR_CUT_EXPLN = ' [ Message content over the limit has been removed. ]' def cut_long_message(msg): lines = msg.splitlines() lengths = _count_line_lengths(lines) if sum(lengths) <= _MAX_ERROR_LINES: return msg start = _prune_excess_lines(lines, lengths) end = _prune_excess_lines(lines, lengths, from_end=True) return '\n'.join(start + [_ERROR_CUT_EXPLN] + end) def _prune_excess_lines(lines, lengths, from_end=False): if from_end: lines.reverse() lengths.reverse() ret = [] total = 0 # Use // (explicit int div) for Python 3 compatibility: limit = _MAX_ERROR_LINES//2 for line, length in zip(lines[:limit], lengths[:limit]): if total + length >= limit: ret.append(_cut_long_line(line, total, from_end)) break total += length ret.append(line) if from_end: ret.reverse() return ret def _cut_long_line(line, used, from_end): # Use // (explicit int div) for Python 3 compatibility: available_lines = _MAX_ERROR_LINES//2 - used available_chars = available_lines * _MAX_ERROR_LINE_LENGTH - 3 if len(line) > available_chars: if not from_end: line = line[:available_chars] + '...' else: line = '...' + line[-available_chars:] return line def _count_line_lengths(lines): return [ _count_virtual_line_length(line) for line in lines ] def _count_virtual_line_length(line): if not line: return 1 lines, remainder = divmod(len(line), _MAX_ERROR_LINE_LENGTH) return lines if not remainder else lines + 1 def format_assign_message(variable, value, cut_long=True): value = unic(value) if variable.startswith('$') else seq2str2(value) if cut_long and len(value) > _MAX_ASSIGN_LENGTH: value = value[:_MAX_ASSIGN_LENGTH] + '...' return '%s = %s' % (variable, value) def get_console_length(text): return sum(get_char_width(char) for char in text) def pad_console_length(text, width): if width < 5: width = 5 diff = get_console_length(text) - width if diff > 0: text = _lose_width(text, diff+3) + '...' return _pad_width(text, width) def _pad_width(text, width): more = width - get_console_length(text) return text + ' ' * more def _lose_width(text, diff): lost = 0 while lost < diff: lost += get_console_length(text[-1]) text = text[:-1] return text
apache-2.0
7,472,979,966,690,661,000
30.715686
77
0.643586
false
3.456197
false
false
false
onyxfish/votersdaily_web
api/couchdb/log_views.py
1
2166
import couchdb from couchdb.design import ViewDefinition """ This module defines a collection of functions which accept a CouchDB database as an argument, are named with a 'make_views_*' convention, and return a list of generated CouchDB ViewDefinitions. The 'syncviews' management command dynamically executes each method to compile a list of all Couchdb views. """ def make_views_all_documents(event_db): """ Generate a view that includes all documents. """ all_view_map_function = \ ''' function(doc) { emit(doc.access_datetime, doc) } ''' return [ViewDefinition('api', 'all', all_view_map_function)] def make_views_error_documents(event_db): """ Generate a view that includes all documents. """ error_view_map_function = \ ''' function(doc) { if (doc.result != "success") { emit(doc.access_datetime, doc) } } ''' return [ViewDefinition('api', 'errors', error_view_map_function)] def get_parser_list(event_db): """ Return a list of unique parser names in the database. """ parser_list_map_function = \ ''' function(doc) { emit(doc.parser_name, null); } ''' parser_list_reduce_function = \ ''' function(keys, values) { return null; } ''' return [ e.key for e in event_db.query( parser_list_map_function, parser_list_reduce_function, group=True)] def make_views_parser_lists(event_db): """ Return a list of views, one for each parser, using templated view functions. """ parser_names = get_parser_list(event_db) parser_view_map_function = \ ''' function(doc) { if (doc.parser_name == "%(parser_name)s") { emit(doc.parser_name, doc) } } ''' return [ ViewDefinition('api', name, parser_view_map_function % { 'parser_name': name }) for name in parser_names]
gpl-3.0
4,641,316,289,698,557,000
23.908046
78
0.548476
false
4.094518
false
false
false
pr-omethe-us/PyKED
pyked/chemked.py
1
44185
""" Main ChemKED module """ # Standard libraries from os.path import exists from collections import namedtuple from warnings import warn from copy import deepcopy import xml.etree.ElementTree as etree import xml.dom.minidom as minidom from itertools import chain import numpy as np # Local imports from .validation import schema, OurValidator, yaml, Q_ from .converters import datagroup_properties, ReSpecTh_to_ChemKED VolumeHistory = namedtuple('VolumeHistory', ['time', 'volume']) VolumeHistory.__doc__ = 'Time history of the volume in an RCM experiment. Deprecated, to be removed after PyKED 0.4' # noqa: E501 VolumeHistory.time.__doc__ = '(`~numpy.ndarray`): the time during the experiment' VolumeHistory.volume.__doc__ = '(`~numpy.ndarray`): the volume during the experiment' TimeHistory = namedtuple('TimeHistory', ['time', 'quantity', 'type']) TimeHistory.__doc__ = 'Time history of the quantity in an RCM experiment' TimeHistory.time.__doc__ = '(`~numpy.ndarray`): the time during the experiment' TimeHistory.quantity.__doc__ = '(`~numpy.ndarray`): the quantity of interest during the experiment' TimeHistory.type.__doc__ = """\ (`str`): the type of time history represented. Possible options are: * volume * temperature * pressure * piston position * light emission * OH emission * absorption """ RCMData = namedtuple( 'RCMData', ['compressed_pressure', 'compressed_temperature', 'compression_time', 'stroke', 'clearance', 'compression_ratio'] ) RCMData.__doc__ = 'Data fields specific to rapid compression machine experiments' RCMData.compressed_pressure.__doc__ = '(`~pint.Quantity`) The pressure at the end of compression' RCMData.compressed_temperature.__doc__ = """\ (`~pint.Quantity`) The temperature at the end of compression""" RCMData.compression_time.__doc__ = '(`~pint.Quantity`) The duration of the compression stroke' RCMData.stroke.__doc__ = '(`~pint.Quantity`) The length of the stroke' RCMData.clearance.__doc__ = """\ (`~pint.Quantity`) The clearance between piston face and end wall at the end of compression""" RCMData.compression_ratio.__doc__ = '(`~pint.Quantity`) The volumetric compression ratio' Reference = namedtuple('Reference', ['volume', 'journal', 'doi', 'authors', 'detail', 'year', 'pages']) Reference.__doc__ = 'Information about the article or report where the data can be found' Reference.volume.__doc__ = '(`str`) The journal volume' Reference.journal.__doc__ = '(`str`) The name of the journal' Reference.doi.__doc__ = '(`str`) The Digital Object Identifier of the article' Reference.authors.__doc__ = '(`list`) The list of authors of the article' Reference.detail.__doc__ = '(`str`) Detail about where the data can be found in the article' Reference.year.__doc__ = '(`str`) The year the article was published' Reference.pages.__doc__ = '(`str`) The pages in the journal where the article was published' Apparatus = namedtuple('Apparatus', ['kind', 'institution', 'facility']) Apparatus.__doc__ = 'Information about the experimental apparatus used to generate the data' Apparatus.kind.__doc__ = '(`str`) The kind of experimental apparatus' Apparatus.institution.__doc__ = '(`str`) The institution where the experiment is located' Apparatus.facility.__doc__ = '(`str`) The particular experimental facility at the location' Composition = namedtuple('Composition', 'species_name InChI SMILES atomic_composition amount') Composition.__doc__ = 'Detail of the initial composition of the mixture for the experiment' Composition.species_name.__doc__ = '(`str`) The name of the species' Composition.InChI.__doc__ = '(`str`) The InChI identifier for the species' Composition.SMILES.__doc__ = '(`str`) The SMILES identifier for the species' Composition.atomic_composition.__doc__ = '(`dict`) The atomic composition of the species' Composition.amount.__doc__ = '(`~pint.Quantity`) The amount of this species' class ChemKED(object): """Main ChemKED class. The ChemKED class stores information about the contents of a ChemKED database file. It stores each datapoint associated with the database and provides access the the reference information, versions, and file author. Arguments: yaml_file (`str`, optional): The filename of the YAML database in ChemKED format. dict_input (`dict`, optional): A dictionary with the parsed ouput of YAML file in ChemKED format. skip_validation (`bool`, optional): Whether validation of the ChemKED should be done. Must be supplied as a keyword-argument. Attributes: datapoints (`list`): List of `DataPoint` objects storing each datapoint in the database. reference (`~collections.namedtuple`): Attributes include ``volume``, ``journal``, ``doi``, ``authors``, ``detail``, ``year``, and ``pages`` describing the reference from which the datapoints are derived. apparatus (`~collections.namedtuple`): Attributes include ``kind`` of experimental apparatus, and the ``institution`` and ``facility`` where the experimental apparatus is located. chemked_version (`str`): Version of the ChemKED database schema used in this file. experiment_type (`str`): Type of exeperimental data contained in this database. file_author (`dict`): Information about the author of the ChemKED database file. file_version (`str`): Version of the ChemKED database file. _properties (`dict`): Original dictionary read from ChemKED database file, meant for internal use. """ def __init__(self, yaml_file=None, dict_input=None, *, skip_validation=False): if yaml_file is not None: with open(yaml_file, 'r') as f: self._properties = yaml.safe_load(f) elif dict_input is not None: self._properties = dict_input else: raise NameError("ChemKED needs either a YAML filename or dictionary as input.") if not skip_validation: self.validate_yaml(self._properties) self.datapoints = [] for point in self._properties['datapoints']: self.datapoints.append(DataPoint(point)) self.reference = Reference( volume=self._properties['reference'].get('volume'), journal=self._properties['reference'].get('journal'), doi=self._properties['reference'].get('doi'), authors=self._properties['reference'].get('authors'), detail=self._properties['reference'].get('detail'), year=self._properties['reference'].get('year'), pages=self._properties['reference'].get('pages'), ) self.apparatus = Apparatus( kind=self._properties['apparatus'].get('kind'), institution=self._properties['apparatus'].get('institution'), facility=self._properties['apparatus'].get('facility'), ) for prop in ['chemked-version', 'experiment-type', 'file-authors', 'file-version']: setattr(self, prop.replace('-', '_'), self._properties[prop]) @classmethod def from_respecth(cls, filename_xml, file_author='', file_author_orcid=''): """Construct a ChemKED instance directly from a ReSpecTh file. Arguments: filename_xml (`str`): Filename of the ReSpecTh-formatted XML file to be imported file_author (`str`, optional): File author to be added to the list generated from the XML file file_author_orcid (`str`, optional): ORCID for the file author being added to the list of file authors Returns: `ChemKED`: Instance of the `ChemKED` class containing the data in ``filename_xml``. Examples: >>> ck = ChemKED.from_respecth('respecth_file.xml') >>> ck = ChemKED.from_respecth('respecth_file.xml', file_author='Bryan W. Weber') >>> ck = ChemKED.from_respecth('respecth_file.xml', file_author='Bryan W. Weber', file_author_orcid='0000-0000-0000-0000') """ properties = ReSpecTh_to_ChemKED(filename_xml, file_author, file_author_orcid, validate=False) return cls(dict_input=properties) def validate_yaml(self, properties): """Validate the parsed YAML file for adherance to the ChemKED format. Arguments: properties (`dict`): Dictionary created from the parsed YAML file Raises: `ValueError`: If the YAML file cannot be validated, a `ValueError` is raised whose string contains the errors that are present. """ validator = OurValidator(schema) if not validator.validate(properties): for key, value in validator.errors.items(): if any(['unallowed value' in v for v in value]): print(('{key} has an illegal value. Allowed values are {values} and are case ' 'sensitive.').format(key=key, values=schema[key]['allowed'])) raise ValueError(validator.errors) def get_dataframe(self, output_columns=None): """Get a Pandas DataFrame of the datapoints in this instance. Arguments: output_columns (`list`, optional): List of strings specifying the columns to include in the output DataFrame. The default is `None`, which outputs all of the columns. Options include (not case sensitive): * ``Temperature`` * ``Pressure`` * ``Ignition Delay`` * ``Composition`` * ``Equivalence Ratio`` * ``Reference`` * ``Apparatus`` * ``Experiment Type`` * ``File Author`` * ``File Version`` * ``ChemKED Version`` In addition, specific fields from the ``Reference`` and ``Apparatus`` attributes can be included by specifying the name after a colon. These options are: * ``Reference:Volume`` * ``Reference:Journal`` * ``Reference:DOI`` * ``Reference:Authors`` * ``Reference:Detail`` * ``Reference:Year`` * ``Reference:Pages`` * ``Apparatus:Kind`` * ``Apparatus:Facility`` * ``Apparatus:Institution`` Only the first author is printed when ``Reference`` or ``Reference:Authors`` is selected because the whole author list may be quite long. Note: If the Composition is selected as an output type, the composition specified in the `DataPoint` is used. No attempt is made to convert to a consistent basis; mole fractions will remain mole fractions, mass fractions will remain mass fractions, and mole percent will remain mole percent. Therefore, it is possible to end up with more than one type of composition specification in a given column. However, if the composition is included in the resulting dataframe, the type of each composition will be specified by the "Kind" field in each row. Examples: >>> df = ChemKED(yaml_file).get_dataframe() >>> df = ChemKED(yaml_file).get_dataframe(['Temperature', 'Ignition Delay']) Returns: `~pandas.DataFrame`: Contains the information regarding each point in the ``datapoints`` attribute """ import pandas as pd valid_labels = [a.replace('_', ' ') for a in self.__dict__ if not (a.startswith('__') or a.startswith('_')) ] valid_labels.remove('datapoints') valid_labels.extend( ['composition', 'ignition delay', 'temperature', 'pressure', 'equivalence ratio'] ) ref_index = valid_labels.index('reference') valid_labels[ref_index:ref_index + 1] = ['reference:' + a for a in Reference._fields] app_index = valid_labels.index('apparatus') valid_labels[app_index:app_index + 1] = ['apparatus:' + a for a in Apparatus._fields] species_list = list(set(chain(*[list(d.composition.keys()) for d in self.datapoints]))) if output_columns is None or len(output_columns) == 0: col_labels = valid_labels comp_index = col_labels.index('composition') col_labels[comp_index:comp_index + 1] = species_list + ['Composition:Kind'] else: output_columns = [a.lower() for a in output_columns] col_labels = [] for col in output_columns: if col in valid_labels or col in ['reference', 'apparatus']: col_labels.append(col) else: raise ValueError('{} is not a valid output column choice'.format(col)) if 'composition' in col_labels: comp_index = col_labels.index('composition') col_labels[comp_index:comp_index + 1] = species_list + ['Composition:Kind'] if 'reference' in col_labels: ref_index = col_labels.index('reference') col_labels[ref_index:ref_index + 1] = ['reference:' + a for a in Reference._fields] if 'apparatus' in col_labels: app_index = col_labels.index('apparatus') col_labels[app_index:app_index + 1] = ['apparatus:' + a for a in Apparatus._fields] data = [] for d in self.datapoints: row = [] d_species = list(d.composition.keys()) for col in col_labels: if col in species_list: if col in d_species: row.append(d.composition[col].amount) else: row.append(Q_(0.0, 'dimensionless')) elif 'reference' in col or 'apparatus' in col: split_col = col.split(':') if split_col[1] == 'authors': row.append(getattr(getattr(self, split_col[0]), split_col[1])[0]['name']) else: row.append(getattr(getattr(self, split_col[0]), split_col[1])) elif col in ['temperature', 'pressure', 'ignition delay', 'equivalence ratio']: row.append(getattr(d, col.replace(' ', '_'))) elif col == 'file authors': row.append(getattr(self, col.replace(' ', '_'))[0]['name']) elif col == 'Composition:Kind': row.append(d.composition_type) else: row.append(getattr(self, col.replace(' ', '_'))) data.append(row) col_labels = [a.title() for a in col_labels] columns = pd.Index(col_labels) return pd.DataFrame(data=data, columns=columns) def write_file(self, filename, *, overwrite=False): """Write new ChemKED YAML file based on object. Arguments: filename (`str`): Filename for target YAML file overwrite (`bool`, optional): Whether to overwrite file with given name if present. Must be supplied as a keyword-argument. Raises: `NameError`: If ``filename`` is already present, and ``overwrite`` is not ``True``. Example: >>> dataset = ChemKED(yaml_file) >>> dataset.write_file(new_yaml_file) """ # Ensure file isn't already present if exists(filename) and not overwrite: raise OSError(filename + ' already present. Specify "overwrite=True" ' 'to overwrite, or rename.' ) with open(filename, 'w') as yaml_file: yaml.dump(self._properties, yaml_file) def convert_to_ReSpecTh(self, filename): """Convert ChemKED record to ReSpecTh XML file. This converter uses common information in a ChemKED file to generate a ReSpecTh XML file. Note that some information may be lost, as ChemKED stores some additional attributes. Arguments: filename (`str`): Filename for output ReSpecTh XML file. Example: >>> dataset = ChemKED(yaml_file) >>> dataset.convert_to_ReSpecTh(xml_file) """ root = etree.Element('experiment') file_author = etree.SubElement(root, 'fileAuthor') file_author.text = self.file_authors[0]['name'] # right now ChemKED just uses an integer file version file_version = etree.SubElement(root, 'fileVersion') major_version = etree.SubElement(file_version, 'major') major_version.text = str(self.file_version) minor_version = etree.SubElement(file_version, 'minor') minor_version.text = '0' respecth_version = etree.SubElement(root, 'ReSpecThVersion') major_version = etree.SubElement(respecth_version, 'major') major_version.text = '1' minor_version = etree.SubElement(respecth_version, 'minor') minor_version.text = '0' # Only ignition delay currently supported exp = etree.SubElement(root, 'experimentType') if self.experiment_type == 'ignition delay': exp.text = 'Ignition delay measurement' else: raise NotImplementedError('Only ignition delay type supported for conversion.') reference = etree.SubElement(root, 'bibliographyLink') citation = '' for author in self.reference.authors: citation += author['name'] + ', ' citation += (self.reference.journal + ' (' + str(self.reference.year) + ') ' + str(self.reference.volume) + ':' + self.reference.pages + '. ' + self.reference.detail ) reference.set('preferredKey', citation) reference.set('doi', self.reference.doi) apparatus = etree.SubElement(root, 'apparatus') kind = etree.SubElement(apparatus, 'kind') kind.text = self.apparatus.kind common_properties = etree.SubElement(root, 'commonProperties') # ChemKED objects have no common properties once loaded. Check for properties # among datapoints that tend to be common common = [] composition = self.datapoints[0].composition # Composition type *has* to be the same composition_type = self.datapoints[0].composition_type if not all(dp.composition_type == composition_type for dp in self.datapoints): raise NotImplementedError('Error: ReSpecTh does not support varying composition ' 'type among datapoints.' ) if all([composition == dp.composition for dp in self.datapoints]): # initial composition is common common.append('composition') prop = etree.SubElement(common_properties, 'property') prop.set('name', 'initial composition') for species_name, species in composition.items(): component = etree.SubElement(prop, 'component') species_link = etree.SubElement(component, 'speciesLink') species_link.set('preferredKey', species_name) if species.InChI is not None: species_link.set('InChI', species.InChI) amount = etree.SubElement(component, 'amount') amount.set('units', composition_type) amount.text = str(species.amount.magnitude) # If multiple datapoints present, then find any common properties. If only # one datapoint, then composition should be the only "common" property. if len(self.datapoints) > 1: for prop_name in datagroup_properties: attribute = prop_name.replace(' ', '_') quantities = [getattr(dp, attribute, False) for dp in self.datapoints] # All quantities must have the property in question and all the # values must be equal if all(quantities) and quantities.count(quantities[0]) == len(quantities): common.append(prop_name) prop = etree.SubElement(common_properties, 'property') prop.set('description', '') prop.set('name', prop_name) prop.set('units', str(quantities[0].units)) value = etree.SubElement(prop, 'value') value.text = str(quantities[0].magnitude) # Ignition delay can't be common, unless only a single datapoint. datagroup = etree.SubElement(root, 'dataGroup') datagroup.set('id', 'dg1') datagroup_link = etree.SubElement(datagroup, 'dataGroupLink') datagroup_link.set('dataGroupID', '') datagroup_link.set('dataPointID', '') property_idx = {} labels = {'temperature': 'T', 'pressure': 'P', 'ignition delay': 'tau', 'pressure rise': 'dP/dt', } for prop_name in datagroup_properties: attribute = prop_name.replace(' ', '_') # This can't be hasattr because properties are set to the value None # if no value is specified in the file, so the attribute always exists prop_indices = [i for i, dp in enumerate(self.datapoints) if getattr(dp, attribute) is not None ] if prop_name in common or not prop_indices: continue prop = etree.SubElement(datagroup, 'property') prop.set('description', '') prop.set('name', prop_name) units = str(getattr(self.datapoints[prop_indices[0]], attribute).units) prop.set('units', units) idx = 'x{}'.format(len(property_idx) + 1) property_idx[idx] = {'name': prop_name, 'units': units} prop.set('id', idx) prop.set('label', labels[prop_name]) # Need to handle datapoints with possibly different species in the initial composition if 'composition' not in common: for dp in self.datapoints: for species in dp.composition.values(): # Only add new property for species not already considered has_spec = any([species.species_name in d.values() for d in property_idx.values() ]) if not has_spec: prop = etree.SubElement(datagroup, 'property') prop.set('description', '') idx = 'x{}'.format(len(property_idx) + 1) property_idx[idx] = {'name': species.species_name} prop.set('id', idx) prop.set('label', '[' + species.species_name + ']') prop.set('name', 'composition') prop.set('units', self.datapoints[0].composition_type) species_link = etree.SubElement(prop, 'speciesLink') species_link.set('preferredKey', species.species_name) if species.InChI is not None: species_link.set('InChI', species.InChI) for dp in self.datapoints: datapoint = etree.SubElement(datagroup, 'dataPoint') for idx, val in property_idx.items(): # handle regular properties a bit differently than composition if val['name'] in datagroup_properties: value = etree.SubElement(datapoint, idx) quantity = getattr(dp, val['name'].replace(' ', '_')).to(val['units']) value.text = str(quantity.magnitude) else: # composition for item in dp.composition.values(): if item.species_name == val['name']: value = etree.SubElement(datapoint, idx) value.text = str(item.amount.magnitude) # See https://stackoverflow.com/a/16097112 for the None.__ne__ history_types = ['volume_history', 'temperature_history', 'pressure_history', 'piston_position_history', 'light_emission_history', 'OH_emission_history', 'absorption_history'] time_histories = [getattr(dp, p) for dp in self.datapoints for p in history_types] time_histories = list(filter(None.__ne__, time_histories)) if len(self.datapoints) > 1 and len(time_histories) > 1: raise NotImplementedError('Error: ReSpecTh files do not support multiple datapoints ' 'with a time history.') elif len(time_histories) > 0: for dg_idx, hist in enumerate(time_histories): if hist.type not in ['volume', 'temperature', 'pressure']: warn('The time-history type {} is not supported by ReSpecTh for ' 'ignition delay experiments'.format(hist.type)) continue datagroup = etree.SubElement(root, 'dataGroup') datagroup.set('id', 'dg{}'.format(dg_idx)) datagroup_link = etree.SubElement(datagroup, 'dataGroupLink') datagroup_link.set('dataGroupID', '') datagroup_link.set('dataPointID', '') # Time history has two properties: time and quantity. prop = etree.SubElement(datagroup, 'property') prop.set('description', '') prop.set('name', 'time') prop.set('units', str(hist.time.units)) time_idx = 'x{}'.format(len(property_idx) + 1) property_idx[time_idx] = {'name': 'time'} prop.set('id', time_idx) prop.set('label', 't') prop = etree.SubElement(datagroup, 'property') prop.set('description', '') prop.set('name', hist.type) prop.set('units', str(hist.quantity.units)) quant_idx = 'x{}'.format(len(property_idx) + 1) property_idx[quant_idx] = {'name': hist.type} prop.set('id', quant_idx) prop.set('label', 'V') for time, quantity in zip(hist.time, hist.quantity): datapoint = etree.SubElement(datagroup, 'dataPoint') value = etree.SubElement(datapoint, time_idx) value.text = str(time.magnitude) value = etree.SubElement(datapoint, quant_idx) value.text = str(quantity.magnitude) ign_types = [getattr(dp, 'ignition_type', False) for dp in self.datapoints] # All datapoints must have the same ignition target and type if all(ign_types) and ign_types.count(ign_types[0]) == len(ign_types): # In ReSpecTh files all datapoints must share ignition type ignition = etree.SubElement(root, 'ignitionType') if ign_types[0]['target'] in ['pressure', 'temperature']: ignition.set('target', ign_types[0]['target'][0].upper()) else: # options left are species ignition.set('target', self.datapoints[0].ignition_type['target']) if ign_types[0]['type'] == 'd/dt max extrapolated': ignition.set('type', 'baseline max intercept from d/dt') else: ignition.set('type', self.datapoints[0].ignition_type['type']) else: raise NotImplementedError('Different ignition targets or types for multiple datapoints ' 'are not supported in ReSpecTh.') et = etree.ElementTree(root) et.write(filename, encoding='utf-8', xml_declaration=True) # now do a "pretty" rewrite xml = minidom.parse(filename) xml_string = xml.toprettyxml(indent=' ') with open(filename, 'w') as f: f.write(xml_string) print('Converted to ' + filename) class DataPoint(object): """Class for a single datapoint. The `DataPoint` class stores the information associated with a single data point in the dataset parsed from the `ChemKED` YAML input. Arguments: properties (`dict`): Dictionary adhering to the ChemKED format for ``datapoints`` Attributes: composition (`list`): List of dictionaries representing the species and their quantities ignition_delay (pint.Quantity): The ignition delay of the experiment temperature (pint.Quantity): The temperature of the experiment pressure (pint.Quantity): The pressure of the experiment pressure_rise (pint.Quantity, optional): The amount of pressure rise during the induction period of a shock tube experiment. compression_time (pint.Quantity, optional): The compression time for an RCM experiment. compressed_pressure (pint.Quantity, optional): The pressure at the end of compression for an RCM experiment. compressed_temperature (pint.Quantity, optional): The temperature at the end of compression for an RCM experiment. first_stage_ignition_delay (pint.Quantity, optional): The first stage ignition delay of the experiment. compression_time (pint.Quantity, optional): The compression time for an RCM experiment. ignition_type (`dict`): Dictionary with the ignition target and type. volume_history (`~collections.namedtuple`, optional): The volume history of the reactor during an RCM experiment. pressure_history (`~collections.namedtuple`, optional): The pressure history of the reactor during an experiment. temperature_history (`~collections.namedtuple`, optional): The temperature history of the reactor during an experiment. piston_position_history (`~collections.namedtuple`, optional): The piston position history of the reactor during an RCM experiment. light_emission_history (`~collections.namedtuple`, optional): The light emission history of the reactor during an experiment. OH_emission_history (`~collections.namedtuple`, optional): The OH emission history of the reactor during an experiment. absorption_history (`~collections.namedtuple`, optional): The absorption history of the reactor during an experiment. """ value_unit_props = [ 'ignition-delay', 'first-stage-ignition-delay', 'temperature', 'pressure', 'pressure-rise', ] rcm_data_props = [ 'compressed-pressure', 'compressed-temperature', 'compression-time', 'stroke', 'clearance', 'compression-ratio' ] def __init__(self, properties): for prop in self.value_unit_props: if prop in properties: quant = self.process_quantity(properties[prop]) setattr(self, prop.replace('-', '_'), quant) else: setattr(self, prop.replace('-', '_'), None) if 'rcm-data' in properties: orig_rcm_data = properties['rcm-data'] rcm_props = {} for prop in self.rcm_data_props: if prop in orig_rcm_data: quant = self.process_quantity(orig_rcm_data[prop]) rcm_props[prop.replace('-', '_')] = quant else: rcm_props[prop.replace('-', '_')] = None self.rcm_data = RCMData(**rcm_props) else: self.rcm_data = None self.composition_type = properties['composition']['kind'] composition = {} for species in properties['composition']['species']: species_name = species['species-name'] amount = self.process_quantity(species['amount']) InChI = species.get('InChI') SMILES = species.get('SMILES') atomic_composition = species.get('atomic-composition') composition[species_name] = Composition( species_name=species_name, InChI=InChI, SMILES=SMILES, atomic_composition=atomic_composition, amount=amount) setattr(self, 'composition', composition) self.equivalence_ratio = properties.get('equivalence-ratio') self.ignition_type = deepcopy(properties.get('ignition-type')) if 'time-histories' in properties and 'volume-history' in properties: raise TypeError('time-histories and volume-history are mutually exclusive') if 'time-histories' in properties: for hist in properties['time-histories']: if hasattr(self, '{}_history'.format(hist['type'].replace(' ', '_'))): raise ValueError('Each history type may only be specified once. {} was ' 'specified multiple times'.format(hist['type'])) time_col = hist['time']['column'] time_units = hist['time']['units'] quant_col = hist['quantity']['column'] quant_units = hist['quantity']['units'] if isinstance(hist['values'], list): values = np.array(hist['values']) else: # Load the values from a file values = np.genfromtxt(hist['values']['filename'], delimiter=',') time_history = TimeHistory( time=Q_(values[:, time_col], time_units), quantity=Q_(values[:, quant_col], quant_units), type=hist['type'], ) setattr(self, '{}_history'.format(hist['type'].replace(' ', '_')), time_history) if 'volume-history' in properties: warn('The volume-history field should be replaced by time-histories. ' 'volume-history will be removed after PyKED 0.4', DeprecationWarning) time_col = properties['volume-history']['time']['column'] time_units = properties['volume-history']['time']['units'] volume_col = properties['volume-history']['volume']['column'] volume_units = properties['volume-history']['volume']['units'] values = np.array(properties['volume-history']['values']) self.volume_history = VolumeHistory( time=Q_(values[:, time_col], time_units), volume=Q_(values[:, volume_col], volume_units), ) history_types = ['volume', 'temperature', 'pressure', 'piston_position', 'light_emission', 'OH_emission', 'absorption'] for h in history_types: if not hasattr(self, '{}_history'.format(h)): setattr(self, '{}_history'.format(h), None) def process_quantity(self, properties): """Process the uncertainty information from a given quantity and return it """ quant = Q_(properties[0]) if len(properties) > 1: unc = properties[1] uncertainty = unc.get('uncertainty', False) upper_uncertainty = unc.get('upper-uncertainty', False) lower_uncertainty = unc.get('lower-uncertainty', False) uncertainty_type = unc.get('uncertainty-type') if uncertainty_type == 'relative': if uncertainty: quant = quant.plus_minus(float(uncertainty), relative=True) elif upper_uncertainty and lower_uncertainty: warn('Asymmetric uncertainties are not supported. The ' 'maximum of lower-uncertainty and upper-uncertainty ' 'has been used as the symmetric uncertainty.') uncertainty = max(float(upper_uncertainty), float(lower_uncertainty)) quant = quant.plus_minus(uncertainty, relative=True) else: raise ValueError('Either "uncertainty" or "upper-uncertainty" and ' '"lower-uncertainty" need to be specified.') elif uncertainty_type == 'absolute': if uncertainty: uncertainty = Q_(uncertainty) quant = quant.plus_minus(uncertainty.to(quant.units).magnitude) elif upper_uncertainty and lower_uncertainty: warn('Asymmetric uncertainties are not supported. The ' 'maximum of lower-uncertainty and upper-uncertainty ' 'has been used as the symmetric uncertainty.') uncertainty = max(Q_(upper_uncertainty), Q_(lower_uncertainty)) quant = quant.plus_minus(uncertainty.to(quant.units).magnitude) else: raise ValueError('Either "uncertainty" or "upper-uncertainty" and ' '"lower-uncertainty" need to be specified.') else: raise ValueError('uncertainty-type must be one of "absolute" or "relative"') return quant def get_cantera_composition_string(self, species_conversion=None): """Get the composition in a string format suitable for input to Cantera. Returns a formatted string no matter the type of composition. As such, this method is not recommended for end users; instead, prefer the `get_cantera_mole_fraction` or `get_cantera_mass_fraction` methods. Arguments: species_conversion (`dict`, optional): Mapping of species identifier to a species name. This argument should be supplied when the name of the species in the ChemKED YAML file does not match the name of the same species in a chemical kinetic mechanism. The species identifier (the key of the mapping) can be the name, InChI, or SMILES provided in the ChemKED file, while the value associated with a key should be the desired name in the Cantera format output string. Returns: `str`: String in the ``SPEC:AMT, SPEC:AMT`` format Raises: `ValueError`: If the composition type of the `DataPoint` is not one of ``'mass fraction'``, ``'mole fraction'``, or ``'mole percent'`` """ if self.composition_type in ['mole fraction', 'mass fraction']: factor = 1.0 elif self.composition_type == 'mole percent': factor = 100.0 else: raise ValueError('Unknown composition type: {}'.format(self.composition_type)) if species_conversion is None: comps = ['{!s}:{:.4e}'.format(c.species_name, c.amount.magnitude/factor) for c in self.composition.values()] else: comps = [] for c in self.composition.values(): amount = c.amount.magnitude/factor idents = [getattr(c, s, False) for s in ['species_name', 'InChI', 'SMILES']] present = [i in species_conversion for i in idents] if not any(present): comps.append('{!s}:{:.4e}'.format(c.species_name, amount)) else: if len([i for i in present if i]) > 1: raise ValueError('More than one conversion present for species {}'.format( c.species_name)) ident = idents[present.index(True)] species_replacement_name = species_conversion.pop(ident) comps.append('{!s}:{:.4e}'.format(species_replacement_name, amount)) if len(species_conversion) > 0: raise ValueError('Unknown species in conversion: {}'.format(species_conversion)) return ', '.join(comps) def get_cantera_mole_fraction(self, species_conversion=None): """Get the mole fractions in a string format suitable for input to Cantera. Arguments: species_conversion (`dict`, optional): Mapping of species identifier to a species name. This argument should be supplied when the name of the species in the ChemKED YAML file does not match the name of the same species in a chemical kinetic mechanism. The species identifier (the key of the mapping) can be the name, InChI, or SMILES provided in the ChemKED file, while the value associated with a key should be the desired name in the Cantera format output string. Returns: `str`: String of mole fractions in the ``SPEC:AMT, SPEC:AMT`` format Raises: `ValueError`: If the composition type is ``'mass fraction'``, the conversion cannot be done because no molecular weight information is known Examples: >>> dp = DataPoint(properties) >>> dp.get_cantera_mole_fraction() 'H2:4.4400e-03, O2:5.5600e-03, Ar:9.9000e-01' >>> species_conversion = {'H2': 'h2', 'O2': 'o2'} >>> dp.get_cantera_mole_fraction(species_conversion) 'h2:4.4400e-03, o2:5.5600e-03, Ar:9.9000e-01' >>> species_conversion = {'1S/H2/h1H': 'h2', '1S/O2/c1-2': 'o2'} >>> dp.get_cantera_mole_fraction(species_conversion) 'h2:4.4400e-03, o2:5.5600e-03, Ar:9.9000e-01' """ if self.composition_type == 'mass fraction': raise ValueError('Cannot get mole fractions from the given composition.\n' '{}'.format(self.composition)) else: return self.get_cantera_composition_string(species_conversion) def get_cantera_mass_fraction(self, species_conversion=None): """Get the mass fractions in a string format suitable for input to Cantera. Arguments: species_conversion (`dict`, optional): Mapping of species identifier to a species name. This argument should be supplied when the name of the species in the ChemKED YAML file does not match the name of the same species in a chemical kinetic mechanism. The species identifier (the key of the mapping) can be the name, InChI, or SMILES provided in the ChemKED file, while the value associated with a key should be the desired name in the Cantera format output string. Returns: `str`: String of mass fractions in the ``SPEC:AMT, SPEC:AMT`` format Raises: `ValueError`: If the composition type is ``'mole fraction'`` or ``'mole percent'``, the conversion cannot be done because no molecular weight information is known Examples: >>> dp = DataPoint(properties) >>> dp.get_cantera_mass_fraction() 'H2:2.2525e-04, O2:4.4775e-03, Ar:9.9530e-01' >>> species_conversion = {'H2': 'h2', 'O2': 'o2'} >>> dp.get_cantera_mass_fraction(species_conversion) 'h2:2.2525e-04, o2:4.4775e-03, Ar:9.9530e-01' >>> species_conversion = {'1S/H2/h1H': 'h2', '1S/O2/c1-2': 'o2'} >>> dp.get_cantera_mass_fraction(species_conversion) 'h2:2.2525e-04, o2:4.4775e-03, Ar:9.9530e-01' """ if self.composition_type in ['mole fraction', 'mole percent']: raise ValueError('Cannot get mass fractions from the given composition.\n' '{}'.format(self.composition) ) else: return self.get_cantera_composition_string(species_conversion)
bsd-3-clause
-6,256,631,093,448,223,000
48.701912
130
0.583388
false
4.368265
false
false
false
Anvil/maestro-ng
maestro/loader.py
1
2758
# Copyright (C) 2015 SignalFx, Inc. All rights reserved. # # Docker container orchestration utility. import jinja2 import os import sys import yaml from . import exceptions class MaestroYamlConstructor(yaml.constructor.Constructor): """A PyYAML object constructor that errors on duplicate keys in YAML mappings. Because for some reason PyYAML doesn't do that since 3.x.""" def construct_mapping(self, node, deep=False): if not isinstance(node, yaml.nodes.MappingNode): raise yaml.constructor.ConstructorError( None, None, "expected a mapping node, but found %s" % node.id, node.start_mark) keys = set() for key_node, value_node in node.value: key = self.construct_object(key_node, deep=deep) if key in keys: raise yaml.constructor.ConstructorError( "while constructing a mapping", node.start_mark, "found duplicate key (%s)" % key, key_node.start_mark) keys.add(key) return yaml.constructor.Constructor.construct_mapping(self, node, deep) class MaestroYamlLoader(yaml.reader.Reader, yaml.scanner.Scanner, yaml.parser.Parser, yaml.composer.Composer, MaestroYamlConstructor, yaml.resolver.Resolver): """A custom YAML Loader that uses the custom MaestroYamlConstructor.""" def __init__(self, stream): yaml.reader.Reader.__init__(self, stream) yaml.scanner.Scanner.__init__(self) yaml.parser.Parser.__init__(self) yaml.composer.Composer.__init__(self) MaestroYamlConstructor.__init__(self) yaml.resolver.Resolver.__init__(self) def load(filename): """Load a config from the given file. Args: filename (string): Path to the YAML environment description configuration file to load. Use '-' for stdin. Returns: A python data structure corresponding to the YAML configuration. """ env = jinja2.Environment( loader=jinja2.FileSystemLoader(os.path.dirname(filename)), extensions=['jinja2.ext.with_']) try: if filename == '-': template = env.from_string(sys.stdin.read()) else: template = env.get_template(os.path.basename(filename)) except jinja2.exceptions.TemplateNotFound: raise exceptions.MaestroException( 'Environment description file {} not found!'.format(filename)) except Exception as e: raise exceptions.MaestroException( 'Error reading environment description file {}: {}!' .format(filename, e)) return yaml.load(template.render(env=os.environ), Loader=MaestroYamlLoader)
apache-2.0
4,613,575,730,410,633,000
36.27027
79
0.638869
false
4.275969
false
false
false
bootstraponline/testdroid_device_finder
device_finder.py
1
4900
# -*- coding: utf-8 -*- # from: https://github.com/bitbar/testdroid-samples/blob/03fc043ba98235b9ea46a0ab8646f3b20dd1960e/appium/sample-scripts/python/device_finder.py import os, sys, requests, json, time, httplib from optparse import OptionParser from urlparse import urljoin from datetime import datetime class DeviceFinder: # Cloud URL (not including API path) url = None # Oauth access token access_token = None # Oauth refresh token refresh_token = None # Unix timestamp (seconds) when token expires token_expiration_time = None """ Full constructor with username and password """ def __init__(self, username=None, password=None, url="https://cloud.testdroid.com", download_buffer_size=65536): self.username = username self.password = password self.cloud_url = url self.download_buffer_size = download_buffer_size """ Get Oauth2 token """ def get_token(self): if not self.access_token: # TODO: refresh url = "%s/oauth/token" % self.cloud_url payload = { "client_id": "testdroid-cloud-api", "grant_type": "password", "username": self.username, "password": self.password } res = requests.post( url, data = payload, headers = { "Accept": "application/json" } ) if res.status_code != 200: print "FAILED: Authentication or connection failure. Check Testdroid Cloud URL and your credentials." sys.exit(-1) reply = res.json() self.access_token = reply['access_token'] self.refresh_token = reply['refresh_token'] self.token_expiration_time = time.time() + reply['expires_in'] elif self.token_expiration_time < time.time(): url = "%s/oauth/token" % self.cloud_url payload = { "client_id": "testdroid-cloud-api", "grant_type": "refresh_token", "refresh_token": self.refresh_token } res = requests.post( url, data = payload, headers = { "Accept": "application/json" } ) if res.status_code != 200: print "FAILED: Unable to get a new access token using refresh token" self.access_token = None return self.get_token() reply = res.json() self.access_token = reply['access_token'] self.refresh_token = reply['refresh_token'] self.token_expiration_time = time.time() + reply['expires_in'] return self.access_token """ Helper method for getting necessary headers to use for API calls, including authentication """ def _build_headers(self): return { "Authorization": "Bearer %s" % self.get_token(), "Accept": "application/json" } """ GET from API resource """ def get(self, path=None, payload={}, headers={}): if path.find('v2/') >= 0: cut_path = path.split('v2/') path = cut_path[1] url = "%s/api/v2/%s" % (self.cloud_url, path) headers = dict(self._build_headers().items() + headers.items()) res = requests.get(url, params=payload, headers=headers) if headers['Accept'] == 'application/json': return res.json() else: return res.text """ Returns list of devices """ def get_devices(self, limit=0): return self.get("devices?limit=%s" % (limit)) """ Find available free Android device """ def available_free_android_device(self, limit=0): print "Searching Available Free Android Device..." for device in self.get_devices(limit)['data']: if device['creditsPrice'] == 0 and device['locked'] == False and device['osType'] == "ANDROID" and device['softwareVersion']['apiLevel'] > 16: print "Found device '%s'" % device['displayName'] print "" return device['displayName'] print "No available device found" print "" return "" """ Find available free iOS device """ def available_free_ios_device(self, limit=0): print "Searching Available Free iOS Device..." for device in self.get_devices(limit)['data']: if device['creditsPrice'] == 0 and device['locked'] == False and device['osType'] == "IOS": print "Found device '%s'" % device['displayName'] print "" return device['displayName'] print "No available device found" print "" return ""
apache-2.0
-8,658,598,604,070,463,000
35.842105
154
0.546327
false
4.340124
false
false
false
redhat-cip/python-tripleo-wrapper
rdomhelper/ssh.py
1
11391
# -*- coding: utf-8 -*- # # Copyright (C) 2016 Red Hat, Inc # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import paramiko from paramiko import ssh_exception import io import logging import select import time LOG = logging.getLogger('__chainsaw__') class SshClient(object): """SSH client based on Paramiko. This class implements the following features: - run commands on a remote host - send file to a remote host - redirect connection to another ssh server so that every commands will be executed on the redirected host - send files - create remote files """ def __init__(self, hostname, user, key_filename=None, via_ip=None): """:param hostname: the host on which to connect :type hostname: str :param user: the user to use for the connection :type user: str :param key_filename: the private key path to use, by default it will use the system host keys :type key_filename: str :param redirect_to_host: the host on which to redirect, by default it will use the port 22 :type redirect_to_host: str """ assert hostname, 'hostname is defined.' assert user, 'user is defined.' self._hostname = hostname self._user = user self._key_filename = key_filename self.load_private_key(key_filename) self._client = paramiko.SSHClient() self._client.set_missing_host_key_policy(paramiko.AutoAddPolicy()) self._via_ip = via_ip self._transport = None self._started = False self.description = 'not started yet' self._environment_filenames = [] def load_private_key(self, priv_key): """Register the SSH private key.""" with open(priv_key) as fd: self._private_key = paramiko.RSAKey.from_private_key(fd) def _get_transport_via_ip(self): exception = None for i in range(60): try: channel = self._client.get_transport().open_channel( 'direct-tcpip', (self._hostname, 22), (self._via_ip, 0)) except ssh_exception.ChannelException as exception: LOG.debug('%s creating the direct-tcip connections' % self.description) time.sleep(1) else: transport = paramiko.Transport(channel) transport.start_client() transport.auth_publickey(self._user, self._private_key) return transport raise exception def _get_transport(self): if self._via_ip: transport = self._get_transport_via_ip() else: transport = self._client.get_transport() transport.set_keepalive(10) return transport def start(self): """Start the ssh client and connect to the host. It will wait until the ssh service is available during 90 seconds. If it doesn't succed to connect then the function will raise an SSHException. """ if self._via_ip: connect_to = self._via_ip self.description = '[%s@%s via %s]' % (self._user, self._hostname, self._via_ip) else: connect_to = self._hostname self.description = '[%s@%s]' % (self._user, self._hostname) for i in range(60): try: self._client.connect( connect_to, username=self._user, allow_agent=True, key_filename=self._key_filename) # NOTE(Gonéri): TypeError is in the list because of # https://github.com/paramiko/paramiko/issues/615 self._transport = self._get_transport() except (OSError, TypeError, ssh_exception.SSHException, ssh_exception.NoValidConnectionsError) as e: LOG.info('%s waiting for %s' % (self.description, connect_to)) LOG.debug("exception: '%s'" % str(e)) time.sleep(1) else: LOG.debug('%s connected' % self.description) self._started = True return _error = ("unable to connect to ssh service on '%s'" % self._hostname) LOG.error(_error) raise ssh_exception.SSHException(_error) def _check_started(self): if not self._started: _error = "ssh client not started, please start the client" LOG.error(_error) raise ssh_exception.SSHException(_error) def stop(self): """Close the ssh connection.""" self._started = False self._client.close() def run(self, cmd, sudo=False, ignore_error=False, success_status=(0,), error_callback=None, custom_log=None): """Run a command on the remote host. The command is run on the remote host, if there is a redirected host then the command will be run on that redirected host. See __init__. :param cmd: the command to run :type cmd: str :param sudo: True if the command should be run with sudo, this parameter disable the use of environment files. :type sudo: str :param success_status: the list of the possible success status :type success_status: list :param error_callback: if provided, the callback to call in case of a failure. it will be called with two args, the output of the command and the returned error code. :return: the tuple (output of the command, returned code) :rtype: tuple :param custom_log: a optional string to record in the log instead of the command. This is useful for example if you want to hide a password. :type custom_log: str """ self._check_started() cmd_output = io.StringIO() channel = self._get_channel() if sudo: cmd = "sudo %s" % cmd else: for filename in self._environment_filenames: cmd = '. %s; %s' % (filename, cmd) if not custom_log: custom_log = cmd LOG.info("%s run '%s'" % (self.description, custom_log)) channel.exec_command(cmd) while True: if channel.exit_status_ready(): break rl, _, _ = select.select([channel], [], [], 30) if rl: received = channel.recv(1024).decode('UTF-8', 'ignore').strip() if received: LOG.debug(received) cmd_output.write(received) cmd_output = cmd_output.getvalue() exit_status = channel.exit_status if ignore_error or channel.exit_status in success_status: return cmd_output, channel.exit_status elif error_callback: return error_callback(cmd_output, exit_status) else: _error = ("%s command %s has failed with, rc='%s'" % (self.description, custom_log, exit_status)) LOG.error(_error) raise ssh_exception.SSHException(_error) def _get_channel(self): """Returns a channel according to if there is a redirection to do or not. """ channel = self._transport.open_session() channel.set_combine_stderr(True) channel.get_pty() return channel def send_file(self, local_path, remote_path): """Send a file to the remote host. :param local_path: the local path of the file :type local_path: str :param remote_path: the remote path of the file :type remote_path: str :return: the file attributes :rtype: paramiko.sftp_attr.SFTPAttributes """ self._check_started() sftp = paramiko.SFTPClient.from_transport(self._transport) return sftp.put(local_path, remote_path) def create_file(self, path, content, mode='w'): """Create a file with a content. :param path: the path of the file. :type path: str :param content: the content of the file :type content: str :param mode: the mode of the file while opening it :type mode: str """ self._check_started() sftp = paramiko.SFTPClient.from_transport(self._transport) with sftp.open(path, mode) as remote_file: remote_file.write(content) remote_file.flush() def info(self): return {'hostname': self._hostname, 'user': self._user, 'key_filename': self._key_filename} def add_environment_file(self, filename): self._environment_filenames.append(filename) class PoolSshClient(object): def __init__(self): self._ssh_clients = {} def build_ssh_client(self, hostname, user, key_filename=None, via_ip=None): _ssh_client = SshClient(hostname, user, key_filename, via_ip) _ssh_client.start() self._ssh_clients[user] = _ssh_client def add_ssh_client(self, user, ssh_client): self._ssh_clients[user] = ssh_client def del_ssh_client(self, user): self._check_ssh_client(user) del self._ssh_clients[user] def get_client(self, user): self._check_ssh_client(user) return self._ssh_clients[user] def _check_ssh_client(self, user): if user not in self._ssh_clients.keys(): _error = "ssh client for user %s not existing" % user LOG.error(_error) raise ssh_exception.SSHException(_error) def run(self, user, cmd, sudo=False, ignore_error=False, success_status=(0,), error_callback=None, custom_log=None): self._check_ssh_client(user) return self._ssh_clients[user].run( cmd, sudo=sudo, ignore_error=ignore_error, success_status=success_status, error_callback=error_callback, custom_log=custom_log) def send_file(self, user, local_path, remote_path): self._check_ssh_client(user) return self._ssh_clients[user].send_file(local_path, remote_path) def create_file(self, user, path, content, mode='w'): self._check_ssh_client(user) return self._ssh_clients[user].create_file(path, content, mode) def stop_all(self): for ssh_client in self._ssh_clients.values(): ssh_client.stop() def add_environment_file(self, user, filename): self._check_ssh_client(user) self._ssh_clients[user].add_environment_file(filename)
apache-2.0
-2,446,650,625,284,174,300
35.623794
89
0.576207
false
4.251586
false
false
false
hermestrimegiste/patchtgtel
patchConnectionTogotelecom.py
1
2031
#-*- coding:utf-8 -*- __author__ = 'hermes' import socket from os import system from time import sleep from datetime import datetime global connectionName connectionName = 'TOGOTELECOM' # Definir le nom de votre reseau def is_connected(): # http://stackoverflow.com/questions/20913411/test-if-an-internet-connection-is-present-in-python try: #host = socket.gethostbyname("www.google.com") #socket.create_connection(('173.194.67.94', 80), 25) #methode 2 sans test de connection socket.gethostbyname("www.google.com") return True except: try: socket.create_connection(('173.194.67.94', 80), 15) return True except: pass pass return False def hardRestartNetwork(): system('nmcli nm enable false') system('nmcli nm enable true') sleep(5) system("nmcli con up id '%s'"% connectionName) def patchTogotelecom(): activeReseau = system('nmcli nm enable true') deconnectionSoft = system('nmcli dev disconnect iface ttyUSB0') sleep(5) if (deconnectionSoft == 0 or deconnectionSoft == 1536): activeTGTEL = system("nmcli con up id '%s'"% connectionName) if activeTGTEL == 768: # si Erreur : le délai d'attente de 90 sec a expiré. #system('modprobe --force-vermagic usb_wwan usbserial') hardRestartNetwork() else: # redemarrer le reseau si la methode soft ne marche pas hardRestartNetwork() if is_connected(): print(u'Connecté le %s '%str(datetime.now().strftime('%d-%m-%Y -> %H:%M:%S'))) else: print(u'Tentative echoué le %s '%str(datetime.now().strftime('%d-%m-%Y -> %H:%M:%S'))) # sleep(5) # debut de l execution du script #system('modprobe --force-vermagic usb_wwan usbserial') hardRestartNetwork() print(u'debut du script > %s '%str(datetime.now().strftime('%d-%m-%Y -> %H:%M:%S'))) sleep(5) while True: if is_connected(): sleep(60) else: print(u'Tentative de reconnexion le %s '%str(datetime.now().strftime('%d-%m-%Y -> %H:%M:%S'))) patchTogotelecom()
gpl-2.0
-6,435,792,570,533,313,000
26.378378
100
0.659427
false
3.165625
false
false
false
nigelb/SerialGrabber
serial_grabber/cli.py
1
2827
#!/usr/bin/env python # SerialGrabber reads data from a serial port and processes it with the # configured processor. # Copyright (C) 2012 NigelB # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 2 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License along # with this program; if not, write to the Free Software Foundation, Inc., # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. import signal import time from SerialGrabber_Storage import storage_cache from serial_grabber.commander import MultiProcessParameterFactory from serial_grabber.util import config_helper from serial_grabber.watchdog import running, counter, Watchdog from serial_grabber.processor import ProcessorManager class status: def __init__(self, logger): self.logger = logger def set_tooltip(self, tooltip): self.logger.info(tooltip) def register_handler(running, watchdog, reader, processor, command): def signal_handler(signal, frame): print 'You pressed Ctrl+C!' running.running = False if command: command.stop() watchdog.join() if reader: reader.close() exit(0) signal.signal(signal.SIGINT, signal_handler) def start(logger, reader, processor, command): try: si = status(logger) isRunning = running(True) c = counter(si) params = config_helper({ "counter": c, "running": isRunning }) if issubclass(command.__class__, MultiProcessParameterFactory): command.populate_parameters(params) if issubclass(reader.__class__, MultiProcessParameterFactory): reader.populate_parameters(params) if issubclass(processor.__class__, MultiProcessParameterFactory): processor.populate_parameters(params) watchdog = Watchdog(isRunning) register_handler(isRunning, watchdog, reader, processor, command) if reader: watchdog.start_thread(reader, (isRunning, c, params), "Runner") if processor: watchdog.start_thread(ProcessorManager(processor), (isRunning, c, params), "Processor") if command and reader: watchdog.start_thread(command, (isRunning, c, params), "Commander") while isRunning.running: time.sleep(1) finally: storage_cache.close_cache()
gpl-2.0
-6,709,110,638,634,718,000
34.3375
99
0.686594
false
4.263952
false
false
false
Hybrid-Cloud/badam
patches_tool/aws_patch/aws_deps/libcloud/compute/drivers/vultr.py
1
6023
# Licensed to the Apache Software Foundation (ASF) under one or more # contributor license agreements. See the NOTICE file distributed with # this work for additional information regarding copyright ownership. # The ASF licenses this file to You under the Apache License, Version 2.0 # (the "License"); you may not use this file except in compliance with # the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. """ Vultr Driver """ import time from libcloud.utils.py3 import httplib from libcloud.utils.py3 import urlencode from libcloud.common.base import ConnectionKey, JsonResponse from libcloud.compute.types import Provider, NodeState from libcloud.common.types import LibcloudError, InvalidCredsError from libcloud.compute.base import NodeDriver from libcloud.compute.base import Node, NodeImage, NodeSize, NodeLocation class VultrResponse(JsonResponse): def parse_error(self): if self.status == httplib.OK: body = self.parse_body() return body elif self.status == httplib.FORBIDDEN: raise InvalidCredsError(self.body) else: raise LibcloudError(self.body) class VultrConnection(ConnectionKey): """ Connection class for the Vultr driver. """ host = 'api.vultr.com' responseCls = VultrResponse def add_default_params(self, params): """ Add parameters that are necessary for every request This method add ``api_key`` to the request. """ params['api_key'] = self.key return params def encode_data(self, data): return urlencode(data) def get(self, url): return self.request(url) def post(self, url, data): headers = {'Content-Type': 'application/x-www-form-urlencoded'} return self.request(url, data=data, headers=headers, method='POST') class VultrNodeDriver(NodeDriver): """ VultrNode node driver. """ connectionCls = VultrConnection type = Provider.VULTR name = 'Vultr' website = 'https://www.vultr.com' NODE_STATE_MAP = {'pending': NodeState.PENDING, 'active': NodeState.RUNNING} def list_nodes(self): return self._list_resources('/v1/server/list', self._to_node) def list_locations(self): return self._list_resources('/v1/regions/list', self._to_location) def list_sizes(self): return self._list_resources('/v1/plans/list', self._to_size) def list_images(self): return self._list_resources('/v1/os/list', self._to_image) def create_node(self, name, size, image, location): params = {'DCID': location.id, 'VPSPLANID': size.id, 'OSID': image.id, 'label': name} result = self.connection.post('/v1/server/create', params) if result.status != httplib.OK: return False subid = result.object['SUBID'] retry_count = 3 created_node = None for i in range(retry_count): try: nodes = self.list_nodes() created_node = [n for n in nodes if n.id == subid][0] except IndexError: time.sleep(1) pass else: break return created_node def reboot_node(self, node): params = {'SUBID': node.id} res = self.connection.post('/v1/server/reboot', params) return res.status == httplib.OK def destroy_node(self, node): params = {'SUBID': node.id} res = self.connection.post('/v1/server/destroy', params) return res.status == httplib.OK def _list_resources(self, url, tranform_func): data = self.connection.get(url).object sorted_key = sorted(data) return [tranform_func(data[key]) for key in sorted_key] def _to_node(self, data): if 'status' in data: state = self.NODE_STATE_MAP.get(data['status'], NodeState.UNKNOWN) if state == NodeState.RUNNING and \ data['power_status'] != 'running': state = NodeState.STOPPED else: state = NodeState.UNKNOWN if 'main_ip' in data and data['main_ip'] is not None: public_ips = [data['main_ip']] else: public_ips = [] extra_keys = [] extra = {} for key in extra_keys: if key in data: extra[key] = data[key] node = Node(id=data['SUBID'], name=data['label'], state=state, public_ips=public_ips, private_ips=None, extra=extra, driver=self) return node def _to_location(self, data): return NodeLocation(id=data['DCID'], name=data['name'], country=data['country'], driver=self) def _to_size(self, data): extra = {'vcpu_count': int(data['vcpu_count'])} ram = int(data['ram']) disk = int(data['disk']) bandwidth = float(data['bandwidth']) price = float(data['price_per_month']) return NodeSize(id=data['VPSPLANID'], name=data['name'], ram=ram, disk=disk, bandwidth=bandwidth, price=price, extra=extra, driver=self) def _to_image(self, data): extra = {'arch': data['arch'], 'family': data['family']} return NodeImage(id=data['OSID'], name=data['name'], extra=extra, driver=self)
apache-2.0
-2,399,194,911,052,198,000
30.733696
78
0.584592
false
4.015333
false
false
false
YourCyborg/Sun-RPI
src/objects/admin.py
1
5428
# # This sets up how models are displayed # in the web admin interface. # from django import forms from django.conf import settings from django.contrib import admin from src.objects.models import ObjAttribute, ObjectDB, ObjectNick, Alias from src.utils.utils import mod_import class ObjAttributeInline(admin.TabularInline): model = ObjAttribute fields = ('db_key', 'db_value') extra = 0 class NickInline(admin.TabularInline): model = ObjectNick fields = ('db_nick', 'db_real', 'db_type') extra = 0 class AliasInline(admin.TabularInline): model = Alias fields = ("db_key",) extra = 0 class ObjectCreateForm(forms.ModelForm): "This form details the look of the fields" class Meta: model = ObjectDB db_key = forms.CharField(label="Name/Key", widget=forms.TextInput(attrs={'size':'78'}), help_text="Main identifier, like 'apple', 'strong guy', 'Elizabeth' etc. If creating a Character, check so the name is unique among characters!",) db_typeclass_path = forms.CharField(label="Typeclass",initial="Change to (for example) %s or %s." % (settings.BASE_OBJECT_TYPECLASS, settings.BASE_CHARACTER_TYPECLASS), widget=forms.TextInput(attrs={'size':'78'}), help_text="This defines what 'type' of entity this is. This variable holds a Python path to a module with a valid Evennia Typeclass. If you are creating a Character you should use the typeclass defined by settings.BASE_CHARACTER_TYPECLASS or one derived from that.") db_permissions = forms.CharField(label="Permissions", initial=settings.PERMISSION_PLAYER_DEFAULT, required=False, widget=forms.TextInput(attrs={'size':'78'}), help_text="a comma-separated list of text strings checked by certain locks. They are mainly of use for Character objects. Character permissions overload permissions defined on a controlling Player. Most objects normally don't have any permissions defined.") db_cmdset_storage = forms.CharField(label="CmdSet", initial=settings.CMDSET_DEFAULT, required=False, widget=forms.TextInput(attrs={'size':'78'}), help_text="Most non-character objects don't need a cmdset and can leave this field blank.") class ObjectEditForm(ObjectCreateForm): "Form used for editing. Extends the create one with more fields" db_lock_storage = forms.CharField(label="Locks", required=False, widget=forms.Textarea(attrs={'cols':'100', 'rows':'2'}), help_text="In-game lock definition string. If not given, defaults will be used. This string should be on the form <i>type:lockfunction(args);type2:lockfunction2(args);...") class ObjectDBAdmin(admin.ModelAdmin): list_display = ('id', 'db_key', 'db_location', 'db_player', 'db_typeclass_path') list_display_links = ('id', 'db_key') ordering = ['db_player', 'db_typeclass_path', 'id'] search_fields = ['^db_key', 'db_typeclass_path'] save_as = True save_on_top = True list_select_related = True list_filter = ('db_permissions', 'db_location', 'db_typeclass_path') # editing fields setup form = ObjectEditForm fieldsets = ( (None, { 'fields': (('db_key','db_typeclass_path'), ('db_permissions', 'db_lock_storage'), ('db_location', 'db_home'), 'db_destination','db_cmdset_storage' )}), ) #deactivated temporarily, they cause empty objects to be created in admin inlines = [AliasInline]#, ObjAttributeInline] # Custom modification to give two different forms wether adding or not. add_form = ObjectCreateForm add_fieldsets = ( (None, { 'fields': (('db_key','db_typeclass_path'), 'db_permissions', ('db_location', 'db_home'), 'db_destination','db_cmdset_storage' )}), ) def get_fieldsets(self, request, obj=None): if not obj: return self.add_fieldsets return super(ObjectDBAdmin, self).get_fieldsets(request, obj) def get_form(self, request, obj=None, **kwargs): """ Use special form during creation """ defaults = {} if obj is None: defaults.update({ 'form': self.add_form, 'fields': admin.util.flatten_fieldsets(self.add_fieldsets), }) defaults.update(kwargs) return super(ObjectDBAdmin, self).get_form(request, obj, **defaults) def save_model(self, request, obj, form, change): if not change: # adding a new object obj = obj.typeclass obj.basetype_setup() obj.basetype_posthook_setup() obj.at_object_creation() obj.at_init() admin.site.register(ObjectDB, ObjectDBAdmin)
bsd-3-clause
8,773,561,773,923,069,000
42.130081
306
0.573876
false
4.338929
false
false
false
hiatobr/midiacapoeira
modules/queries.py
1
1403
# -*- coding: utf-8 -*- from gluon import current def tagQuery(tags, ctbl, ttbl, query = 0, op = 'or', field = 'texto_id'): ''' Busca no banco de dados por conteúdo marcado pelas tags em <tags>. A operação é recursiva, tag por tag, juntando o resultado de uma busca ao resultado referente à tag anterior. Essa junção pode ser por intersecção (op = 'and') ou por união (op = 'or'). Esta implementação preza por generalidade, de modo que a função pode ser utilizada para buscar qualquer tipo de conteúdo, desde que a variável <field> seja corretamente preenchida na chamada da função. <ctbl> = tabela de conteúdo <ttbl> = tabela de tags ''' db = current.db try: # Escolhe uma tag e procura por índices de textos que a contêm tag_ref = db(ttbl.tag==tags.pop()).select(ttbl[field]).as_list() tag_ref = map(list.pop, map(dict.values, tag_ref)) if query and op == 'or': return tagQuery(tags, ctbl, ttbl, ctbl.id.belongs(tag_ref) | query) elif query and op == 'and': return tagQuery (tags, ctbl, ttbl, ctbl.id.belongs(tag_ref) & query) else: return tagQuery(tags, ctbl, ttbl, ctbl.id.belongs(tag_ref)) except IndexError: return db(query).select(ctbl.ALL).as_list()
gpl-3.0
3,060,283,172,362,273,000
34.435897
73
0.606368
false
3.098655
false
false
false
jsaponara/opentaxforms
opentaxforms/serve.py
1
3082
#!/usr/bin/env python from __future__ import print_function, absolute_import import flask_restless from argparse import ArgumentParser from flask import Flask from flask_sqlalchemy import SQLAlchemy from sqlalchemy.ext.declarative import declarative_base from sqlalchemy.orm import scoped_session, sessionmaker from .db import connect from .version import appname, apiVersion from .ut import Bag def createApi(app,**kw): db = SQLAlchemy(app) conn, engine, metadata, md = connect(appname, **kw) Base = declarative_base() Session = sessionmaker(autocommit=False, autoflush=False, bind=engine) mysession = scoped_session(Session) apimanager = flask_restless.APIManager(app, session=mysession) counts = {} for tabl in md: tablobj = md[tabl] counts[tabl] = tablobj.count().execute().fetchone()[0] attrs = dict( __table__=tablobj, # todo should flask_restless need __tablename__? __tablename__=str(tabl), ) attrs.update(dict( orgn=dict( form=db.relationship('Form'), ), form=dict( orgn=db.relationship('Orgn', back_populates='form'), slot=db.relationship('Slot', back_populates='form'), ), slot=dict( form=db.relationship('Form'), ), )[tabl]) tablcls = type(str(tabl).capitalize(), (Base, ), attrs) colsToAdd = dict( orgn=(), form=( 'orgn', 'orgn.code', ), slot=( 'form', 'form.code', ), )[tabl] colsToShow = [c.name for c in tablobj.columns] colsToShow.extend(colsToAdd) # print tabl,colsToShow apimanager.create_api( tablcls, url_prefix='/api/v%s' % (apiVersion, ), include_columns=colsToShow, ) return counts def parseCmdline(): '''Load command line arguments''' parser = ArgumentParser( description='Automates tax forms' ' and provides an API for new tax form interfaces' ) parser.add_argument( '-P', '--postgres', help='use postgres database [default=sqlite]', action="store_true") return parser.parse_args() def createApp(**kw): cmdline = kw.get('cmdline') verbose = kw.get('verbose') if 'cmdline' in kw: del kw['cmdline'] if 'verbose' in kw: del kw['verbose'] args = parseCmdline() if cmdline else Bag(dict(postgres=False)) app = Flask(appname) app.config['SQLALCHEMY_TRACK_MODIFICATIONS'] = False # to suppress warning counts = createApi(app,postgres=args.postgres, **kw) if verbose: print('serving {slot} slots in {form} forms from {orgn} orgns'.format( **counts)) return app def main(**kw): app = createApp(dbpath='sqlite:///opentaxforms.sqlite3', **kw) app.run() if __name__ == "__main__": main(cmdline=True, verbose=True)
agpl-3.0
2,853,290,267,090,020,000
30.131313
79
0.576249
false
3.926115
false
false
false
bbglab/wok
wok/core/flow/reader.py
1
6997
############################################################################### # # Copyright 2009-2011, Universitat Pompeu Fabra # # This file is part of Wok. # # Wok is free software: you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation, either version 3 of the License, or # (at your option) any later version. # # Wok is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License # along with this program. If not, see <http://www.gnu.org/licenses # ############################################################################### import os.path try: from lxml import etree except ImportError: try: # Python 2.5 import xml.etree.cElementTree as etree except ImportError: try: # Python 2.5+ import xml.etree.ElementTree as etree except ImportError: try: # normal cElementTree install import cElementTree as etree except ImportError: try: # normal ElementTree install import elementtree.ElementTree as etree except ImportError: import sys sys.stderr.write("Failed to import ElementTree from any known place\n") raise from wok.config.data import DataElement, Data from wok.core.flow.model import * def str_to_bool(s): s2b = { "0" : False, "1" : True, "no" : False, "yes" : True, "false" : False, "true" : True} if s in s2b: return s2b[s] else: return False class FlowReader(object): def __init__(self, source): if isinstance(source, basestring): self.path = os.path.abspath(source) self.fp = open(source, "r") else: self.path = None self.fp = source self.__doc = None def __read_doc(self): if self.__doc is None: self.__doc = etree.parse(self.fp) return self.__doc def read_meta(self): doc = self.__read_doc() root = doc.getroot() if root.tag != "flow": raise Exception("<flow> expected but <{}> found".format(xmle.tag)) name = root.attrib.get("name") library = root.attrib.get("library") version = root.attrib.get("version") return (name, library, version) def read(self): doc = self.__read_doc() root = doc.getroot() flow = self._parse_flow(root) if self.path: flow.path = self.path return flow def _parse_base_desc(self, xmle, obj): if "name" not in xmle.attrib: raise Exception("'name' attribute not found in tag <{}>".format(xmle.tag)) obj.name = xmle.attrib["name"] obj.title = xmle.findtext("title") obj.desc = xmle.findtext("desc") if "enabled" in xmle: obj.enabled = str_to_bool(xmle.attr["enabled"]) def _parse_base_port(self, xmle, obj): self._parse_base_desc(xmle, obj) if "serializer" in xmle.attrib: obj.serializer = xmle.attrib["serializer"] if "wsize" in xmle.attrib: try: obj.wsize = int(xmle.attrib["wsize"]) except: raise Exception("At {} {}: 'wsize' should be a number greater than 0".format(xmle.tag, obj.name)) if obj.wsize < 1: raise Exception("At {} {}: 'wsize' should be a number greater than 0".format(xmle.tag, obj.name)) def _parse_base_module(self, xmle, obj): self._parse_base_port(xmle, obj) if "maxpar" in xmle.attrib: try: obj.maxpar = int(xmle.attrib["maxpar"]) except: raise Exception("At {} {}: 'maxpar' should be a number greater than 0".format(xmle.tag, obj.name)) if obj.maxpar < 1: raise Exception("At {} {}: 'maxpar' should be a number greater than 0".format(xmle.tag, obj.name)) conf_xml = xmle.find("conf") if conf_xml is not None: obj.conf = self._parse_conf(conf_xml) res_xml = xmle.find("resources") if res_xml is not None: obj.resources = self._parse_conf(res_xml) for x in xmle.findall("param"): obj.params += [self._parse_param(x)] for x in xmle.findall("in"): obj.add_in_port(self._parse_port(x)) for x in xmle.findall("out"): obj.add_out_port(self._parse_port(x)) def _parse_flow(self, xmle): if xmle.tag != "flow": raise Exception("<flow> expected but <{}> found".format(xmle.tag)) flow = Flow(name = None) self._parse_base_module(xmle, flow) if "library" in xmle.attrib: flow.library = xmle.attrib["library"] if "version" in xmle.attrib: flow.version = xmle.attrib["version"] for xmle in xmle.findall("module"): module = self._parse_module(flow, xmle) # TODO check that there is no other module with the same name flow.add_module(module) return flow def _parse_module(self, flow, xmle): mod = Module(name = None) self._parse_base_module(xmle, mod) if "depends" in xmle.attrib: depends = [d.strip() for d in xmle.attrib["depends"].split(",")] mod.depends = [d for d in depends if len(d) > 0] exec_xml = xmle.find("exec") if exec_xml is None: run_xml = xmle.find("run") if run_xml is None: flow_ref_xml = xmle.find("flow") if flow_ref_xml is None: raise Exception("Missing either <exec>, <run> or <flow> in module {}".format(mod.name)) else: mod.flow_ref = self._parse_flow_ref(flow, mod, flow_ref_xml) else: mod.execution = self._parse_run(mod, run_xml) else: mod.execution = self._parse_exec(exec_xml) return mod def _parse_param(self, xmle): raise Exception("Unimplemented") def _parse_port(self, xmle): if xmle.tag == "in": mode = PORT_MODE_IN elif xmle.tag == "out": mode = PORT_MODE_OUT port = Port(name = None, mode = mode) self._parse_base_port(xmle, port) if "link" in xmle.attrib: link = [x.strip() for x in xmle.attrib["link"].split(",")] port.link = [l for l in link if len(l) > 0] return port def _parse_conf(self, xmle): return Data.from_xmle(xmle) def _parse_exec(self, xmle): execution = Exec() if "launcher" in xmle.attrib: execution.mode = xmle.attrib["launcher"].lower() if execution.mode == "python": execution.mode = "native" execution.conf = Data.from_xmle(xmle) return execution def _parse_run(self, mod, xmle): if xmle.text is None or len(xmle.text) == 0: raise Exception("Missing script name for <run> in module {}".format(mod.name)) execution = Exec() execution.mode = "native" execution.conf = DataElement() execution.conf["script_path"] = xmle.text return execution def _parse_flow_ref(self, flow, mod, xmle): if xmle.text is None or len(xmle.text) == 0: raise Exception("Missing flow name for <flow> in module {}".format(mod.name)) flow_ref = FlowRef() pos = xmle.text.rfind(".") if pos == -1 and flow.library is not None: flow_ref.canonical_name = "{}.{}".format(flow.library, xmle.text) else: flow_ref.canonical_name = xmle.text if "version" in xmle.attrib: flow_ref.version = xmle.attrib["version"] return flow_ref def close(self): self.fp.close()
gpl-3.0
6,454,725,803,999,862,000
26.225681
102
0.641561
false
3.003004
false
false
false
arruda/rmr
rmr/apps/accounts/migrations/0001_initial.py
1
4385
# -*- coding: utf-8 -*- import datetime from south.db import db from south.v2 import SchemaMigration from django.db import models class Migration(SchemaMigration): def forwards(self, orm): # Adding model 'UserProfile' db.create_table('accounts_userprofile', ( ('id', self.gf('django.db.models.fields.AutoField')(primary_key=True)), ('user', self.gf('django.db.models.fields.related.ForeignKey')(to=orm['auth.User'])), ('quota', self.gf('django.db.models.fields.DecimalField')(default='0', null=True, max_digits=10, decimal_places=2, blank=True)), )) db.send_create_signal('accounts', ['UserProfile']) def backwards(self, orm): # Deleting model 'UserProfile' db.delete_table('accounts_userprofile') models = { 'accounts.userprofile': { 'Meta': {'object_name': 'UserProfile'}, 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'quota': ('django.db.models.fields.DecimalField', [], {'default': "'0'", 'null': 'True', 'max_digits': '10', 'decimal_places': '2', 'blank': 'True'}), 'user': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['auth.User']"}) }, 'auth.group': { 'Meta': {'object_name': 'Group'}, 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '80'}), 'permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}) }, 'auth.permission': { 'Meta': {'ordering': "('content_type__app_label', 'content_type__model', 'codename')", 'unique_together': "(('content_type', 'codename'),)", 'object_name': 'Permission'}, 'codename': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'content_type': ('django.db.models.fields.related.ForeignKey', [], {'to': "orm['contenttypes.ContentType']"}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '50'}) }, 'auth.user': { 'Meta': {'object_name': 'User'}, 'date_joined': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'email': ('django.db.models.fields.EmailField', [], {'max_length': '75', 'blank': 'True'}), 'first_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'groups': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Group']", 'symmetrical': 'False', 'blank': 'True'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'is_active': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), 'is_staff': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'is_superuser': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'last_login': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'last_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'password': ('django.db.models.fields.CharField', [], {'max_length': '128'}), 'user_permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': "orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}), 'username': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '30'}) }, 'contenttypes.contenttype': { 'Meta': {'ordering': "('name',)", 'unique_together': "(('app_label', 'model'),)", 'object_name': 'ContentType', 'db_table': "'django_content_type'"}, 'app_label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'model': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '100'}) } } complete_apps = ['accounts']
mit
4,301,774,263,361,745,000
61.657143
182
0.560547
false
3.76072
false
false
false
Azure/azure-sdk-for-python
sdk/keyvault/azure-keyvault-keys/samples/backup_restore_operations_async.py
1
3785
# ------------------------------------ # Copyright (c) Microsoft Corporation. # Licensed under the MIT License. # ------------------------------------ import asyncio import os from azure.keyvault.keys.aio import KeyClient from azure.identity.aio import DefaultAzureCredential from azure.core.exceptions import HttpResponseError # ---------------------------------------------------------------------------------------------------------- # Prerequisites: # 1. An Azure Key Vault (https://docs.microsoft.com/en-us/azure/key-vault/quick-create-cli) # # 2. azure-keyvault-keys and azure-identity libraries (pip install these) # # 3. Set Environment variables AZURE_CLIENT_ID, AZURE_TENANT_ID, AZURE_CLIENT_SECRET, VAULT_URL # (See https://github.com/Azure/azure-sdk-for-python/tree/main/sdk/keyvault/azure-keyvault-keys#authenticate-the-client) # # ---------------------------------------------------------------------------------------------------------- # Sample - demonstrates the basic backup and restore operations on a vault(key) resource for Azure Key Vault # # 1. Create a key (create_key) # # 2. Backup a key (backup_key) # # 3. Delete a key (delete_key) # # 4. Purge a key (purge_deleted_key) # # 5. Restore a key (restore_key_backup) # ---------------------------------------------------------------------------------------------------------- async def run_sample(): # Instantiate a key client that will be used to call the service. # Notice that the client is using default Azure credentials. # To make default credentials work, ensure that environment variables 'AZURE_CLIENT_ID', # 'AZURE_CLIENT_SECRET' and 'AZURE_TENANT_ID' are set with the service principal credentials. VAULT_URL = os.environ["VAULT_URL"] credential = DefaultAzureCredential() client = KeyClient(vault_url=VAULT_URL, credential=credential) try: # Let's create a Key of type RSA. # if the key already exists in the Key Vault, then a new version of the key is created. print("\n.. Create Key") key = await client.create_key("keyName", "RSA") print("Key with name '{0}' created with key type '{1}'".format(key.name, key.key_type)) # Backups are good to have, if in case keys gets deleted accidentally. # For long term storage, it is ideal to write the backup to a file. print("\n.. Create a backup for an existing Key") key_backup = await client.backup_key(key.name) print("Backup created for key with name '{0}'.".format(key.name)) # The rsa key is no longer in use, so you delete it. deleted_key = await client.delete_key(key.name) print("Deleted key with name '{0}'".format(deleted_key.name)) # Purge the deleted key. # The purge will take some time, so wait before restoring the backup to avoid a conflict. print("\n.. Purge the key") await client.purge_deleted_key(key.name) await asyncio.sleep(60) print("Purged key with name '{0}'".format(deleted_key.name)) # In the future, if the key is required again, we can use the backup value to restore it in the Key Vault. print("\n.. Restore the key using the backed up key bytes") key = await client.restore_key_backup(key_backup) print("Restored key with name '{0}'".format(key.name)) except HttpResponseError as e: print("\nrun_sample has caught an error. {0}".format(e.message)) finally: print("\nrun_sample done") await credential.close() await client.close() if __name__ == "__main__": try: loop = asyncio.get_event_loop() loop.run_until_complete(run_sample()) loop.close() except Exception as e: print("Top level Error: {0}".format(str(e)))
mit
-6,305,333,877,761,251,000
43.011628
123
0.60317
false
3.988409
false
false
false
masschallenge/django-accelerator
accelerator/tests/contexts/judge_feedback_context.py
1
13749
from accelerator_abstract.models import ( FORM_ELEM_FEEDBACK_TO_MC, FORM_ELEM_FEEDBACK_TO_STARTUP, FORM_ELEM_OVERALL_RECOMMENDATION, ) from accelerator.models import ( ACTIVE_PROGRAM_STATUS, ASSIGNED_PANEL_ASSIGNMENT_STATUS, COMPLETE_PANEL_ASSIGNMENT_STATUS, FEEDBACK_DISPLAY_DISABLED as DISABLED, FEEDBACK_DISPLAY_ENABLED as ENABLED, IN_PERSON_JUDGING_ROUND_TYPE, ONLINE_JUDGING_ROUND_TYPE, JUDGING_FEEDBACK_STATUS_INCOMPLETE as INCOMPLETE, PREVIEW_PANEL_STATUS, SUBMITTED_APP_STATUS, UserRole, ) from accelerator.tests.factories import ( ApplicationAnswerFactory, ApplicationFactory, ApplicationPanelAssignmentFactory, ExpertFactory, JudgeApplicationFeedbackFactory, JudgeFeedbackComponentFactory, JudgePanelAssignmentFactory, JudgeRoundCommitmentFactory, JudgingFormElementFactory, PanelFactory, ProgramCycleFactory, ProgramRoleFactory, ProgramRoleGrantFactory, ScenarioFactory, StartupCycleInterestFactory, StartupProgramInterestFactory, ) from accelerator.tests.contexts.context_utils import get_user_role_by_name from .judging_round_context import JudgingRoundContext ELEMENT_NAMES = [ FORM_ELEM_OVERALL_RECOMMENDATION, FORM_ELEM_FEEDBACK_TO_STARTUP, FORM_ELEM_FEEDBACK_TO_MC, ] _round_type = {True: ONLINE_JUDGING_ROUND_TYPE, False: IN_PERSON_JUDGING_ROUND_TYPE} class JudgeFeedbackContext: def __init__(self, application=None, num_components=1, complete=True, panel_status=PREVIEW_PANEL_STATUS, display_feedback=False, merge_feedback_with=None, cycle_based_round=False, online_round=True, is_active=True, judge_capacity=10, program_status=ACTIVE_PROGRAM_STATUS): self.judging_capacity = 0 if application: self.application = application self.cycle = application.cycle else: self.cycle = ProgramCycleFactory() self.application = ApplicationFactory( application_status=SUBMITTED_APP_STATUS, application_type=self.cycle.default_application_type, cycle=self.cycle) self.application_type = self.application.application_type self.applications = [self.application] self.startup = self.application.startup self.industry = self.startup.primary_industry feedback_display = ENABLED if display_feedback else DISABLED jr_kwargs = { 'program__cycle': self.cycle, 'round_type': _round_type[online_round], 'feedback_display': feedback_display, 'cycle_based_round': cycle_based_round, 'application_type': self.application_type, 'is_active': False, 'program__program_status': program_status, } if merge_feedback_with: jr_kwargs['feedback_merge_with'] = merge_feedback_with self.judging_round = JudgingRoundContext(**jr_kwargs).judging_round self.program = self.judging_round.program self.panel = PanelFactory(status=panel_status, panel_time__judging_round=self.judging_round) self.scenario = ScenarioFactory(judging_round=self.judging_round) user_role = get_user_role_by_name(UserRole.JUDGE) self.judge_role = ProgramRoleFactory(program=self.program, user_role=user_role) self.judges = [] self.judge = self.add_judge(complete=complete, capacity=judge_capacity) self.feedback = JudgeApplicationFeedbackFactory( judge=self.judge, application=self.application, panel=self.panel, form_type=self.judging_round.judging_form) self.judging_form = self.feedback.form_type self.application_assignment = ApplicationPanelAssignmentFactory( application=self.application, panel=self.panel, scenario=self.scenario) cycle_interest = StartupCycleInterestFactory(cycle=self.program.cycle, startup=self.startup) StartupProgramInterestFactory(program=self.program, startup=self.startup, startup_cycle_interest=cycle_interest, applying=True, order=1) self.components = [] self.elements = [] self.application_questions = [] self.application_answers = [] for element_name in ELEMENT_NAMES: self.add_component(element_name=element_name) if complete: self.feedback.save() for _ in range(num_components): self.add_component() else: for _ in range(num_components): self.add_element() self.judging_round.is_active = is_active self.judging_round.save() def add_application_answer(self, question=None, answer_text=None): question = question or self.application_questions[0] kwargs = {"application_question": question, "application": self.application} if answer_text: kwargs["answer_text"] = answer_text app_answer = ApplicationAnswerFactory(**kwargs) self.application_answers.append(app_answer) return app_answer def add_component(self, element_name=None, feedback_element=None, add_answer=True, answer_text=None): factory_params = { "judge_feedback": self.feedback, } if feedback_element is None: app_type_key = "__".join(["feedback_element", "application_question", "application_type"]) factory_params.update( { "feedback_element__form_type": self.judging_form, "feedback_element__element_type": "feedback", "feedback_element__mandatory": True, "feedback_element__sharing": "share-with-startup", app_type_key: self.application_type} ) if element_name: factory_params['feedback_element__element_name'] = element_name else: factory_params.update({"feedback_element": feedback_element}) if answer_text: factory_params["answer_text"] = answer_text component = JudgeFeedbackComponentFactory( **factory_params) self.components.append(component) question = component.feedback_element.application_question self.application_questions.append(question) if add_answer: app_answer = ApplicationAnswerFactory( application_question=question, application=self.application) self.application_answers.append(app_answer) if feedback_element is None: self.elements.append(component.feedback_element) self.feedback.save() return component def add_element(self, feedback_type="", element_type="feedback", choice_layout="", mandatory=True, text_minimum=0, text_minimum_units="", answer_text=None, text_limit=0, text_limit_units=""): element = JudgingFormElementFactory( form_type=self.judging_form, mandatory=mandatory, element_type=element_type, feedback_type=feedback_type, choice_layout=choice_layout, sharing="share-with-startup", application_question__application_type=self.application_type, text_minimum=text_minimum, text_minimum_units=text_minimum_units, text_limit=text_limit, text_limit_units=text_limit_units, ) application_question = element.application_question self.application_questions.append(application_question) answer_kwargs = {"application_question": application_question, "application": self.application} if answer_text: answer_kwargs["answer_text"] = answer_text application_answer = ApplicationAnswerFactory(**answer_kwargs) self.application_answers.append(application_answer) self.elements.append(element) self.feedback.save() return element def add_extra_scenario(self): return ScenarioFactory(judging_round=self.judging_round) def add_panel(self): return PanelFactory( panel_time__judging_round=self.judging_round, panel_type__judging_round=self.judging_round, location__judging_round=self.judging_round) def add_assignment(self, judge=None, panel=None, scenario=None): scenario = scenario or self.scenario judge = judge or self.judge panel = panel or self.panel return JudgePanelAssignmentFactory( judge=judge, panel=panel, scenario=scenario) def add_feedback(self, application=None, judge=None, panel=None, feedback_status=INCOMPLETE): judge = judge or self.judge application = application or self.application panel = panel or self.panel if not panel.applicationpanelassignment_set.filter( application=application).exists(): ApplicationPanelAssignmentFactory( application=application, panel=panel, scenario=self.scenario) return JudgeApplicationFeedbackFactory( feedback_status=feedback_status, judge=judge, application=application, panel=panel, form_type=self.judging_round.judging_form) def add_application(self, application=None, field=None, option=None, program=None): program = program or self.program if application is None: fields = { "application_status": SUBMITTED_APP_STATUS, "application_type": self.application_type, } if field: fields[field] = option application = ApplicationFactory(**fields) self.applications.append(application) startup = application.startup cycle_interest = StartupCycleInterestFactory(cycle=program.cycle, startup=startup) StartupProgramInterestFactory(program=program, startup=startup, startup_cycle_interest=cycle_interest, applying=True, order=1) return application def add_applications(self, count, field=None, options=[], programs=[]): result = [] option_count = len(options) option = None program_count = len(programs) program = None for i in range(count): if option_count > 0: option = options[i % option_count] if program_count > 0: program = programs[i % program_count] result.append(self.add_application(field=field, option=option, program=program)) return result def add_judge(self, assigned=True, complete=True, judge=None, panel=None, capacity=10): if judge is None: judge = ExpertFactory( profile__primary_industry=self.industry, profile__home_program_family=self.program.program_family) ProgramRoleGrantFactory(person=judge, program_role=self.judge_role) self.judging_round.confirmed_judge_label.users.add(judge) JudgeRoundCommitmentFactory(judging_round=self.judging_round, judge=judge, capacity=10, commitment_state=True) self.judging_capacity += capacity if assigned: if complete: status = COMPLETE_PANEL_ASSIGNMENT_STATUS else: status = ASSIGNED_PANEL_ASSIGNMENT_STATUS JudgePanelAssignmentFactory( judge=judge, assignment_status=status, panel=panel or self.panel, scenario=self.scenario) self.judges.append(judge) return judge @classmethod def create_batch(cls, qty, *args, **kwargs): if 'merge_feedback' in kwargs: merge_feedback = kwargs.pop('merge_feedback') else: merge_feedback = False contexts = [cls(*args, **kwargs)] if merge_feedback: kwargs['merge_feedback_with'] = contexts[0].judging_round for _ in range(1, qty): contexts.append(cls(*args, **kwargs)) return contexts
mit
4,584,632,868,787,122,000
38.852174
79
0.56695
false
4.558687
false
false
false
superbatlc/dtailweb
phonegroups/migrations/0001_initial.py
1
1870
# -*- coding: utf-8 -*- from __future__ import unicode_literals from django.db import models, migrations class Migration(migrations.Migration): dependencies = [ ('systems', '0001_initial'), ('calls', '0001_initial'), ] operations = [ migrations.CreateModel( name='Phonegroup', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('name', models.CharField(max_length=255, verbose_name=b'Nome')), ('code', models.CharField(max_length=10, verbose_name=b'Codice')), ('parent', models.ForeignKey(related_name='child_phonegroup_set', blank=True, to='phonegroups.Phonegroup', help_text=b'The father of this group', null=True)), ], options={ }, bases=(models.Model,), ), migrations.CreateModel( name='PhonegroupCall', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('call', models.ForeignKey(to='calls.Call')), ('phonegroup', models.ForeignKey(to='phonegroups.Phonegroup')), ], options={ }, bases=(models.Model,), ), migrations.CreateModel( name='PhonegroupExtension', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('extension', models.CharField(max_length=4)), ('phonegroup', models.ForeignKey(to='phonegroups.Phonegroup')), ('system', models.ForeignKey(to='systems.System')), ], options={ }, bases=(models.Model,), ), ]
gpl-2.0
-5,535,782,326,201,843,000
36.4
174
0.536364
false
4.452381
false
false
false
hiraditya/fool
tensorflow/scaling-up-ml-using-cmle.py
1
6449
''' In this lab, you will learn how to: Package up TensorFlow model Run training locally Run training on cloud Deploy model to cloud Invoke model to carry out predictions ''' ''' Scaling up ML using Cloud ML Engine In this notebook, we take a previously developed TensorFlow model to predict taxifare rides and package it up so that it can be run in Cloud MLE. For now, we'll run this on a small dataset. The model that was developed is rather simplistic, and therefore, the accuracy of the model is not great either. However, this notebook illustrates how to package up a TensorFlow model to run it within Cloud ML. Later in the course, we will look at ways to make a more effective machine learning model. Environment variables for project and bucket Note that: Your project id is the unique string that identifies your project (not the project name). You can find this from the GCP Console dashboard's Home page. My dashboard reads: Project ID: cloud-training-demos Cloud training often involves saving and restoring model files. If you don't have a bucket already, I suggest that you create one from the GCP console (because it will dynamically check whether the bucket name you want is available). A common pattern is to prefix the bucket name by the project id, so that it is unique. Also, for cost reasons, you might want to use a single region bucket. Change the cell below to reflect your Project ID and bucket name. ''' import os PROJECT = 'cloud-training-demos' # REPLACE WITH YOUR PROJECT ID BUCKET = 'cloud-training-demos-ml' # REPLACE WITH YOUR BUCKET NAME REGION = 'us-central1' # REPLACE WITH YOUR BUCKET REGION e.g. us-central1 # for bash os.environ['PROJECT'] = PROJECT os.environ['BUCKET'] = BUCKET os.environ['REGION'] = REGION os.environ['TFVERSION'] = '1.7' # Tensorflow version %bash gcloud config set project $PROJECT gcloud config set compute/region $REGION %bash PROJECT_ID=$PROJECT AUTH_TOKEN=$(gcloud auth print-access-token) SVC_ACCOUNT=$(curl -X GET -H "Content-Type: application/json" \ -H "Authorization: Bearer $AUTH_TOKEN" \ https://ml.googleapis.com/v1/projects/${PROJECT_ID}:getConfig \ | python -c "import json; import sys; response = json.load(sys.stdin); \ print response['serviceAccount']") echo "Authorizing the Cloud ML Service account $SVC_ACCOUNT to access files in $BUCKET" gsutil -m defacl ch -u $SVC_ACCOUNT:R gs://$BUCKET gsutil -m acl ch -u $SVC_ACCOUNT:R -r gs://$BUCKET # error message (if bucket is empty) can be ignored gsutil -m acl ch -u $SVC_ACCOUNT:W gs://$BUCKET ''' Packaging up the code Take your code and put into a standard Python package structure. model.py and task.py contain the Tensorflow code from earlier (explore the directory structure). ''' !find taxifare !cat taxifare/trainer/model.py ''' Find absolute paths to your data Note the absolute paths below. /content is mapped in Datalab to where the home icon takes you ''' %bash echo $PWD rm -rf $PWD/taxi_trained head -1 $PWD/taxi-train.csv head -1 $PWD/taxi-valid.csv ''' Running the Python module from the command-line ''' %bash rm -rf taxifare.tar.gz taxi_trained export PYTHONPATH=${PYTHONPATH}:${PWD}/taxifare python -m trainer.task \ --train_data_paths="${PWD}/taxi-train*" \ --eval_data_paths=${PWD}/taxi-valid.csv \ --output_dir=${PWD}/taxi_trained \ --train_steps=1000 --job-dir=./tmp %bash ls $PWD/taxi_trained/export/exporter/ %writefile ./test.json {"pickuplon": -73.885262,"pickuplat": 40.773008,"dropofflon": -73.987232,"dropofflat": 40.732403,"passengers": 2} %bash model_dir=$(ls ${PWD}/taxi_trained/export/exporter) gcloud ml-engine local predict \ --model-dir=${PWD}/taxi_trained/export/exporter/${model_dir} \ --json-instances=./test.json ''' Running locally using gcloud ''' %bash rm -rf taxifare.tar.gz taxi_trained gcloud ml-engine local train \ --module-name=trainer.task \ --package-path=${PWD}/taxifare/trainer \ -- \ --train_data_paths=${PWD}/taxi-train.csv \ --eval_data_paths=${PWD}/taxi-valid.csv \ --train_steps=1000 \ --output_dir=${PWD}/taxi_trained ''' When I ran it (due to random seeds, your results will be different), the average_loss (Mean Squared Error) on the evaluation dataset was 187, meaning that the RMSE was around 13. ''' from google.datalab.ml import TensorBoard TensorBoard().start('./taxi_trained') for pid in TensorBoard.list()['pid']: TensorBoard().stop(pid) print 'Stopped TensorBoard with pid {}'.format(pid) ''' If the above step (to stop TensorBoard) appears stalled, just move on to the next step. You don't need to wait for it to return. ''' !ls $PWD/taxi_trained ''' Submit training job using gcloud First copy the training data to the cloud. Then, launch a training job. After you submit the job, go to the cloud console (http://console.cloud.google.com) and select Machine Learning | Jobs to monitor progress. Note: Don't be concerned if the notebook stalls (with a blue progress bar) or returns with an error about being unable to refresh auth tokens. This is a long-lived Cloud job and work is going on in the cloud. Use the Cloud Console link (above) to monitor the job. https://cloud.google.com/ml-engine/docs/tensorflow/getting-started-training-prediction ''' %bash echo $BUCKET gsutil -m rm -rf gs://${BUCKET}/taxifare/smallinput/ gsutil -m cp ${PWD}/*.csv gs://${BUCKET}/taxifare/smallinput/ %%bash OUTDIR=gs://${BUCKET}/taxifare/smallinput/taxi_trained JOBNAME=lab3a_$(date -u +%y%m%d_%H%M%S) echo $OUTDIR $REGION $JOBNAME gsutil -m rm -rf $OUTDIR gcloud ml-engine jobs submit training $JOBNAME \ --region=$REGION \ --module-name=trainer.task \ --package-path=${PWD}/taxifare/trainer \ --job-dir=$OUTDIR \ --staging-bucket=gs://$BUCKET \ --scale-tier=BASIC \ --runtime-version=$TFVERSION \ -- \ --train_data_paths="gs://${BUCKET}/taxifare/smallinput/taxi-train*" \ --eval_data_paths="gs://${BUCKET}/taxifare/smallinput/taxi-valid*" \ --output_dir=$OUTDIR \ --train_steps=10000 Job [lab3a_180607_192245] submitted successfully. Your job is still active. You may view the status of your job with the command (on google cloud consile) $ gcloud ml-engine jobs describe lab3a_180607_192245 or continue streaming the logs with the command $ gcloud ml-engine jobs stream-logs lab3a_180607_192245 Use the Cloud Console link to monitor the job and do NOT proceed until the job is done.
mit
2,726,381,697,759,011,000
36.71345
401
0.728485
false
3.317387
false
false
false
wangyixiaohuihui/spark2-annotation
python/pyspark/mllib/stat/_statistics.py
1
13703
# # Licensed to the Apache Software Foundation (ASF) under one or more # contributor license agreements. See the NOTICE file distributed with # this work for additional information regarding copyright ownership. # The ASF licenses this file to You under the Apache License, Version 2.0 # (the "License"); you may not use this file except in compliance with # the License. You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # import sys if sys.version >= '3': basestring = str from pyspark.rdd import RDD, ignore_unicode_prefix from pyspark.mllib.common import callMLlibFunc, JavaModelWrapper from pyspark.mllib.linalg import Matrix, _convert_to_vector from pyspark.mllib.regression import LabeledPoint from pyspark.mllib.stat.test import ChiSqTestResult, KolmogorovSmirnovTestResult __all__ = ['MultivariateStatisticalSummary', 'Statistics'] class MultivariateStatisticalSummary(JavaModelWrapper): """ Trait for multivariate statistical summary of a data matrix. """ def mean(self): return self.call("mean").toArray() def variance(self): return self.call("variance").toArray() def count(self): return int(self.call("count")) def numNonzeros(self): return self.call("numNonzeros").toArray() def max(self): return self.call("max").toArray() def min(self): return self.call("min").toArray() def normL1(self): return self.call("normL1").toArray() def normL2(self): return self.call("normL2").toArray() class Statistics(object): @staticmethod def colStats(rdd): """ Computes column-wise summary statistics for the input RDD[Vector]. :param rdd: an RDD[Vector] for which column-wise summary statistics are to be computed. :return: :class:`MultivariateStatisticalSummary` object containing column-wise summary statistics. >>> from pyspark.mllib.linalg import Vectors >>> rdd = sc.parallelize([Vectors.dense([2, 0, 0, -2]), ... Vectors.dense([4, 5, 0, 3]), ... Vectors.dense([6, 7, 0, 8])]) >>> cStats = Statistics.colStats(rdd) >>> cStats.mean() array([ 4., 4., 0., 3.]) >>> cStats.variance() array([ 4., 13., 0., 25.]) >>> cStats.count() 3 >>> cStats.numNonzeros() array([ 3., 2., 0., 3.]) >>> cStats.max() array([ 6., 7., 0., 8.]) >>> cStats.min() array([ 2., 0., 0., -2.]) """ cStats = callMLlibFunc("colStats", rdd.map(_convert_to_vector)) return MultivariateStatisticalSummary(cStats) @staticmethod def corr(x, y=None, method=None): """ Compute the correlation (matrix) for the input RDD(s) using the specified method. Methods currently supported: I{pearson (default), spearman}. If a single RDD of Vectors is passed in, a correlation matrix comparing the columns in the input RDD is returned. Use C{method=} to specify the method to be used for single RDD inout. If two RDDs of floats are passed in, a single float is returned. :param x: an RDD of vector for which the correlation matrix is to be computed, or an RDD of float of the same cardinality as y when y is specified. :param y: an RDD of float of the same cardinality as x. :param method: String specifying the method to use for computing correlation. Supported: `pearson` (default), `spearman` :return: Correlation matrix comparing columns in x. >>> x = sc.parallelize([1.0, 0.0, -2.0], 2) >>> y = sc.parallelize([4.0, 5.0, 3.0], 2) >>> zeros = sc.parallelize([0.0, 0.0, 0.0], 2) >>> abs(Statistics.corr(x, y) - 0.6546537) < 1e-7 True >>> Statistics.corr(x, y) == Statistics.corr(x, y, "pearson") True >>> Statistics.corr(x, y, "spearman") 0.5 >>> from math import isnan >>> isnan(Statistics.corr(x, zeros)) True >>> from pyspark.mllib.linalg import Vectors >>> rdd = sc.parallelize([Vectors.dense([1, 0, 0, -2]), Vectors.dense([4, 5, 0, 3]), ... Vectors.dense([6, 7, 0, 8]), Vectors.dense([9, 0, 0, 1])]) >>> pearsonCorr = Statistics.corr(rdd) >>> print(str(pearsonCorr).replace('nan', 'NaN')) [[ 1. 0.05564149 NaN 0.40047142] [ 0.05564149 1. NaN 0.91359586] [ NaN NaN 1. NaN] [ 0.40047142 0.91359586 NaN 1. ]] >>> spearmanCorr = Statistics.corr(rdd, method="spearman") >>> print(str(spearmanCorr).replace('nan', 'NaN')) [[ 1. 0.10540926 NaN 0.4 ] [ 0.10540926 1. NaN 0.9486833 ] [ NaN NaN 1. NaN] [ 0.4 0.9486833 NaN 1. ]] >>> try: ... Statistics.corr(rdd, "spearman") ... print("Method name as second argument without 'method=' shouldn't be allowed.") ... except TypeError: ... pass """ # Check inputs to determine whether a single value or a matrix is needed for output. # Since it's legal for users to use the method name as the second argument, we need to # check if y is used to specify the method name instead. if type(y) == str: raise TypeError("Use 'method=' to specify method name.") if not y: return callMLlibFunc("corr", x.map(_convert_to_vector), method).toArray() else: return callMLlibFunc("corr", x.map(float), y.map(float), method) @staticmethod @ignore_unicode_prefix def chiSqTest(observed, expected=None): """ If `observed` is Vector, conduct Pearson's chi-squared goodness of fit test of the observed data against the expected distribution, or againt the uniform distribution (by default), with each category having an expected frequency of `1 / len(observed)`. If `observed` is matrix, conduct Pearson's independence test on the input contingency matrix, which cannot contain negative entries or columns or rows that sum up to 0. If `observed` is an RDD of LabeledPoint, conduct Pearson's independence test for every feature against the label across the input RDD. For each feature, the (feature, label) pairs are converted into a contingency matrix for which the chi-squared statistic is computed. All label and feature values must be categorical. .. note:: `observed` cannot contain negative values :param observed: it could be a vector containing the observed categorical counts/relative frequencies, or the contingency matrix (containing either counts or relative frequencies), or an RDD of LabeledPoint containing the labeled dataset with categorical features. Real-valued features will be treated as categorical for each distinct value. :param expected: Vector containing the expected categorical counts/relative frequencies. `expected` is rescaled if the `expected` sum differs from the `observed` sum. :return: ChiSquaredTest object containing the test statistic, degrees of freedom, p-value, the method used, and the null hypothesis. >>> from pyspark.mllib.linalg import Vectors, Matrices >>> observed = Vectors.dense([4, 6, 5]) >>> pearson = Statistics.chiSqTest(observed) >>> print(pearson.statistic) 0.4 >>> pearson.degreesOfFreedom 2 >>> print(round(pearson.pValue, 4)) 0.8187 >>> pearson.method u'pearson' >>> pearson.nullHypothesis u'observed follows the same distribution as expected.' >>> observed = Vectors.dense([21, 38, 43, 80]) >>> expected = Vectors.dense([3, 5, 7, 20]) >>> pearson = Statistics.chiSqTest(observed, expected) >>> print(round(pearson.pValue, 4)) 0.0027 >>> data = [40.0, 24.0, 29.0, 56.0, 32.0, 42.0, 31.0, 10.0, 0.0, 30.0, 15.0, 12.0] >>> chi = Statistics.chiSqTest(Matrices.dense(3, 4, data)) >>> print(round(chi.statistic, 4)) 21.9958 >>> data = [LabeledPoint(0.0, Vectors.dense([0.5, 10.0])), ... LabeledPoint(0.0, Vectors.dense([1.5, 20.0])), ... LabeledPoint(1.0, Vectors.dense([1.5, 30.0])), ... LabeledPoint(0.0, Vectors.dense([3.5, 30.0])), ... LabeledPoint(0.0, Vectors.dense([3.5, 40.0])), ... LabeledPoint(1.0, Vectors.dense([3.5, 40.0])),] >>> rdd = sc.parallelize(data, 4) >>> chi = Statistics.chiSqTest(rdd) >>> print(chi[0].statistic) 0.75 >>> print(chi[1].statistic) 1.5 """ if isinstance(observed, RDD): if not isinstance(observed.first(), LabeledPoint): raise ValueError("observed should be an RDD of LabeledPoint") jmodels = callMLlibFunc("chiSqTest", observed) return [ChiSqTestResult(m) for m in jmodels] if isinstance(observed, Matrix): jmodel = callMLlibFunc("chiSqTest", observed) else: if expected and len(expected) != len(observed): raise ValueError("`expected` should have same length with `observed`") jmodel = callMLlibFunc("chiSqTest", _convert_to_vector(observed), expected) return ChiSqTestResult(jmodel) @staticmethod @ignore_unicode_prefix def kolmogorovSmirnovTest(data, distName="norm", *params): """ Performs the Kolmogorov-Smirnov (KS) test for data sampled from a continuous distribution. It tests the null hypothesis that the data is generated from a particular distribution. The given data is sorted and the Empirical Cumulative Distribution Function (ECDF) is calculated which for a given point is the number of points having a CDF value lesser than it divided by the total number of points. Since the data is sorted, this is a step function that rises by (1 / length of data) for every ordered point. The KS statistic gives us the maximum distance between the ECDF and the CDF. Intuitively if this statistic is large, the probabilty that the null hypothesis is true becomes small. For specific details of the implementation, please have a look at the Scala documentation. :param data: RDD, samples from the data :param distName: string, currently only "norm" is supported. (Normal distribution) to calculate the theoretical distribution of the data. :param params: additional values which need to be provided for a certain distribution. If not provided, the default values are used. :return: KolmogorovSmirnovTestResult object containing the test statistic, degrees of freedom, p-value, the method used, and the null hypothesis. >>> kstest = Statistics.kolmogorovSmirnovTest >>> data = sc.parallelize([-1.0, 0.0, 1.0]) >>> ksmodel = kstest(data, "norm") >>> print(round(ksmodel.pValue, 3)) 1.0 >>> print(round(ksmodel.statistic, 3)) 0.175 >>> ksmodel.nullHypothesis u'Sample follows theoretical distribution' >>> data = sc.parallelize([2.0, 3.0, 4.0]) >>> ksmodel = kstest(data, "norm", 3.0, 1.0) >>> print(round(ksmodel.pValue, 3)) 1.0 >>> print(round(ksmodel.statistic, 3)) 0.175 """ if not isinstance(data, RDD): raise TypeError("data should be an RDD, got %s." % type(data)) if not isinstance(distName, basestring): raise TypeError("distName should be a string, got %s." % type(distName)) params = [float(param) for param in params] return KolmogorovSmirnovTestResult( callMLlibFunc("kolmogorovSmirnovTest", data, distName, params)) def _test(): import doctest from pyspark.sql import SparkSession globs = globals().copy() spark = SparkSession.builder\ .master("local[4]")\ .appName("mllib.stat.statistics tests")\ .getOrCreate() globs['sc'] = spark.sparkContext (failure_count, test_count) = doctest.testmod(globs=globs, optionflags=doctest.ELLIPSIS) spark.stop() if failure_count: exit(-1) if __name__ == "__main__": _test()
apache-2.0
1,669,562,013,303,584,300
40.821875
95
0.583157
false
4.06376
true
false
false
googleapis/googleapis-gen
google/ads/googleads/v6/googleads-py/google/ads/googleads/v6/enums/types/lead_form_desired_intent.py
1
1209
# -*- coding: utf-8 -*- # Copyright 2020 Google LLC # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # import proto # type: ignore __protobuf__ = proto.module( package='google.ads.googleads.v6.enums', marshal='google.ads.googleads.v6', manifest={ 'LeadFormDesiredIntentEnum', }, ) class LeadFormDesiredIntentEnum(proto.Message): r"""Describes the desired level of intent of generated leads. """ class LeadFormDesiredIntent(proto.Enum): r"""Enum describing the desired level of intent of generated leads. """ UNSPECIFIED = 0 UNKNOWN = 1 LOW_INTENT = 2 HIGH_INTENT = 3 __all__ = tuple(sorted(__protobuf__.manifest))
apache-2.0
-8,953,890,120,698,834,000
29.225
74
0.687345
false
3.88746
false
false
false
praekelt/jmbo-twitter
jmbo_twitter/models.py
1
5204
import datetime, twitter from urllib2 import URLError import logging from django.db import models from django.core.cache import cache from django.utils.translation import ugettext_lazy as _ from django.conf import settings from jmbo.models import ModelBase logger = logging.getLogger('django') class Status(ModelBase): """Purely a wrapper that allows us to use jmbo-foundry's listings for tweets.""" def __init__(self, status): # Copy attributes over attrs = ('contributors', 'coordinates', 'created_at', \ 'created_at_in_seconds', 'favorited', 'geo', 'hashtags', 'id', \ 'in_reply_to_screen_name', 'in_reply_to_status_id', \ 'in_reply_to_user_id', 'location', 'now', 'place', \ 'relative_created_at', 'retweet_count', 'retweeted', \ 'retweeted_status', 'source', 'text', 'truncated', 'urls', 'user', \ 'user_mentions', 'created_at_datetime') for attr in attrs: setattr(self, attr, getattr(status, attr)) @property def as_leaf_class(self): return self def save(self): raise NotImplemented class StatusMixin(object): def get_statuses(self, api): raise NotImplemented def fetch(self, force=False): klass_name = self.__class__.__name__ cache_key = 'jmbo_twitter_%s_%s' % (klass_name, self.id) cached = cache.get(cache_key, None) if (cached is not None) and not force: return cached # Get and check settings di = getattr(settings, 'JMBO_TWITTER', {}) ck = di.get('consumer_key') cs = di.get('consumer_secret') atk = di.get('access_token_key') ats = di.get('access_token_secret') if not all([ck, cs, atk, ats]): logger.error( 'jmbo_twitter.models.%s.fetch - incomplete settings' \ % klass_name ) return [] # Query twitter taking care to handle network errors api = twitter.Api( consumer_key=ck, consumer_secret=cs, access_token_key=atk, access_token_secret=ats, requests_timeout=10 ) try: statuses = self.get_statuses(api) except (URLError, ValueError, twitter.TwitterError): statuses = [] except Exception, e: # All manner of things can go wrong with integration logger.error( 'jmbo_twitter.models.%s.fetch - %s' % (klass_name, e.message) ) statuses = [] for status in statuses: status.created_at_datetime = datetime.datetime.fromtimestamp( status.created_at_in_seconds ) if statuses: # Only set if there are statuses. Twitter may randomly throttle us # and destroy our cache without this check. Cache for a long time # incase Twitter goes down. cache.set(cache_key, statuses, 86400) # Legacy return return statuses @property def fetched(self): klass_name = self.__class__.__name__ cache_key = 'jmbo_twitter_%s_%s' % (klass_name, self.id) return cache.get(cache_key, []) @property def tweets(self): class MyList(list): """Slightly emulate QuerySet API so jmbo-foundry listings work""" @property def exists(self): return len(self) > 0 result = [] for status in self.fetched: result.append(Status(status)) return MyList(result) class Feed(ModelBase, StatusMixin): """A feed represents a twitter user account""" name = models.CharField( max_length=255, unique=True, help_text="A twitter account name, eg. johnsmith" ) profile_image_url = models.CharField( null=True, editable=False, max_length=255 ) twitter_id = models.CharField(max_length=255, default='', editable=False) def get_statuses(self, api): # Fall back to slug for historical reasons statuses = api.GetUserTimeline( screen_name=self.name or self.slug, include_rts=True ) return statuses def fetch(self, force=False): statuses = super(Feed, self).fetch(force=force) if statuses: # This is a convenient place to set the feed image url status = statuses[0] changed = False if status.user.profile_image_url != self.profile_image_url: self.profile_image_url = status.user.profile_image_url changed = True if status.user.name != self.title: self.title = status.user.name changed = True if changed: self.save() return statuses class Search(ModelBase, StatusMixin): """A search represents a twitter keyword search""" criteria = models.CharField( max_length=255, unique=True, help_text="Search string or a hashtag" ) class Meta: verbose_name_plural = _("Searches") def get_statuses(self, api): return api.GetSearch(self.criteria)
bsd-3-clause
148,431,581,819,713,100
30.349398
80
0.580515
false
4.071987
false
false
false
ronas/PythonGNF
Fabulao/PedidosCapa.py
1
3001
# -*- coding: latin -*- import sys #from PyQt5 import QtGui, QtCore, QtWidgets #, QTableWidget, QTableWidgetItem from PyQt5.QtWidgets import QApplication, QWidget, QTableWidget, QTableWidgetItem, QLineEdit, QLabel from PyQt5.QtCore import QSize, Qt import pymysql config = { 'host': 'localhost', 'port': 3306, 'database': 'LojaDB', 'user': 'root', 'password' : 'fbl1978' } class ClasseAPP(QWidget): def __init__(self): super(ClasseAPP, self).__init__() self.initUI() def initUI(self): self.setWindowTitle('Pedidos') self.resize(850, 400) self.move(300, 200) self.tabela = QTableWidget(3,5,self) self.tabela.setGeometry(20,20,760,300) self.tabela.setHorizontalHeaderLabels(('Numero Pedido','Data','Codigo Cliente','Telefone','Cond Pagamento')) self.dbBuscarPedidos() self.lblNumeroPedido = QLabel('Numero Pedido',self) self.lblNumeroPedido.setGeometry(20,330,130,25) self.lblData = QLabel('Data',self) self.lblData.setGeometry(100.360,50,25) #self.lblCodigoCliente = QLabel('Codigo Cliente',self) #self.lblCodigoCliente.setGeometry() #self.lblTelefone = QLabel('Telefone',self) #self.lblTelefone.setGeometry() #self.lblCondPagamento = QLabel('Cond Pagamento',self) #self.lblCondPagamento.setGeometry() self.txtNumeroPedido = QLineEdit(self) self.txtNumeroPedido.setGeometry(130,330,130,25) self.txtData = QLineEdit(self) self.txtData.setGeometry(130,360,50,25) #self.txtCodigoCliente = QLineEdit(self) #self.txtCOdigoCliente.setGeometry() #self.txtTelefone = QLineEdit(self) #self.txtTelefone.setGeometry() #self.txtCondPagamento = QLineEdit(self) #self.txtCondPagamento.setGeometry() self.tabela.resizeColumnsToContents() self.show() def dbBuscarPedidos(self): db = pymysql.connect(**config) cursor = db.cursor() comando = ('select * from LojaDB.Pedidos ') cursor.execute(comando ) self.tabela.setRowCount(0) registros = cursor.fetchall() for registro in registros: numerolinhas = self.tabela.rowCount() self.tabela.insertRow(numerolinhas) self.tabela.setItem(numerolinhas, 0, QTableWidgetItem( str(registro[0]) )) self.tabela.setItem(numerolinhas, 1, QTableWidgetItem( str(registro[1]) )) self.tabela.setItem(numerolinhas, 2, QTableWidgetItem( registro[2] )) self.tabela.setItem(numerolinhas, 3, QTableWidgetItem( str(registro[3]) )) self.tabela.setItem(numerolinhas, 4, QTableWidgetItem( registro[4] )) cursor.close() db.close() def main(): app = QApplication(sys.argv) MeuApp = ClasseAPP() sys.exit(app.exec_()) if __name__ == '__main__': main()
gpl-3.0
-1,464,602,394,802,016,300
29.632653
116
0.625125
false
3.286966
false
false
false
caronc/newsreap
newsreap/Logging.py
1
6395
# -*- coding: utf-8 -*- # # Common Logging Parameters and Defaults # # Copyright (C) 2015-2017 Chris Caron <[email protected]> # # This program is free software; you can redistribute it and/or modify it # under the terms of the GNU Lesser General Public License as published by # the Free Software Foundation; either version 3 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Lesser General Public License for more details. # The first part of the file defines all of the namespacing # used by this application import sys import logging # We intentionally import this module so it preconfigures it's logging # From there we can choose to manipulate it later without worrying about # it's configuration over-riding ours; This creates a lint warning # that we're importing a module we're not using; but this is intended. # do not comment out or remove this entry import sqlalchemy # The default logger identifier used for general logging NEWSREAP_LOGGER = 'newsreap' # The default logger which displays backend engine and # NNTP Server Interaction NEWSREAP_ENGINE = '%s.engine' % NEWSREAP_LOGGER # Codec Manipulation such as yEnc, uuencoded, etc NEWSREAP_CODEC = '%s.codec' % NEWSREAP_LOGGER # Users should utilize this for their hook logging NEWSREAP_HOOKS = '%s.hooks' % NEWSREAP_LOGGER # Command Line Interface Logger NEWSREAP_CLI = '%s.cli' % NEWSREAP_LOGGER # For a common reference point, we include the static logging # Resource at the time for this information was: # - http://docs.sqlalchemy.org/en/rel_1_0/core/engines.html#dbengine-logging # # namespaces used by SQLAlchemy SQLALCHEMY_LOGGER = 'sqlalchemy' # Defines the logger for the SQLAlchemy Engine SQLALCHEMY_ENGINE = '%s.engine' % SQLALCHEMY_LOGGER # Controls SQLAlchemy's connection pool logging. SQLALCHEMY_POOL = '%s.pool' % SQLALCHEMY_LOGGER # Controls SQLAlchemy's various Object Relational Mapping (ORM) logging. SQLALCHEMY_ORM = '%s.orm' % SQLALCHEMY_LOGGER # The number of bytes reached before automatically rotating the log file # if this option was specified # 5000000 bytes == 5 Megabytes LOG_ROTATE_FILESIZE_BYTES = 5000000 def add_handler(logger, sendto=True, backupCount=5): """ Add handler to idenfied logger sendto == None then logging is disabled sendto == True then logging is put to stdout sendto == False then logging is put to stderr sendto == <string> then logging is routed to the filename specified if sendto is a <string>, then backupCount defines the number of logs to keep around. Set this to 0 or None if you don't wish the python logger to backupCount the files ever. By default logs are rotated once they reach 5MB """ if sendto is True: # redirect to stdout handler = logging.StreamHandler(sys.stdout) elif sendto is False: # redirect to stderr handler = logging.StreamHandler(sys.stderr) elif sendto is None: # redirect to null try: handler = logging.NullHandler() except AttributeError: # Python <= v2.6 class NullHandler(logging.Handler): def emit(self, record): pass handler = NullHandler() # Set data to NOTSET just to eliminate the # extra checks done internally if logger.level != logging.NOTSET: logger.setLevel(logging.NOTSET) elif isinstance(sendto, basestring): if backupCount is None: handler = logging.FileHandler(filename=sendto) elif isinstance(backupCount, int): handler = logging.RotatingFileHandler( filename=sendto, maxBytes=LOG_ROTATE_FILESIZE_BYTES, backupCount=backupCount, ) else: # We failed to add a handler return False # Setup Log Format handler.setFormatter(logging.Formatter( '%(asctime)s %(levelname)s %(name)s %(message)s')) # Add Handler logger.addHandler(handler) return True def init(verbose=2, sendto=True, backupCount=5): """ Set's up some simple default handling to make it easier for those wrapping this library. You do not need to call this function if you don't wnat to; ideally one might want to set up things their own way. """ # Add our handlers at the parent level add_handler( logging.getLogger(SQLALCHEMY_LOGGER), sendto=True, backupCount=backupCount, ) add_handler( logging.getLogger(NEWSREAP_LOGGER), sendto=True, backupCount=backupCount, ) if verbose: set_verbosity(verbose=verbose) def set_verbosity(verbose): """ A simple function one can use to set the verbosity of the app. """ # Default logging.getLogger(SQLALCHEMY_LOGGER).setLevel(logging.ERROR) logging.getLogger(SQLALCHEMY_ENGINE).setLevel(logging.ERROR) logging.getLogger(NEWSREAP_LOGGER).setLevel(logging.ERROR) logging.getLogger(NEWSREAP_CLI).setLevel(logging.ERROR) logging.getLogger(NEWSREAP_CODEC).setLevel(logging.ERROR) logging.getLogger(NEWSREAP_HOOKS).setLevel(logging.ERROR) logging.getLogger(NEWSREAP_ENGINE).setLevel(logging.ERROR) # Handle Verbosity if verbose > 0: logging.getLogger(NEWSREAP_CLI).setLevel(logging.INFO) logging.getLogger(NEWSREAP_HOOKS).setLevel(logging.INFO) logging.getLogger(NEWSREAP_ENGINE).setLevel(logging.INFO) if verbose > 1: logging.getLogger(NEWSREAP_CLI).setLevel(logging.DEBUG) logging.getLogger(NEWSREAP_HOOKS).setLevel(logging.DEBUG) logging.getLogger(NEWSREAP_ENGINE).setLevel(logging.DEBUG) if verbose > 2: logging.getLogger(SQLALCHEMY_ENGINE).setLevel(logging.INFO) logging.getLogger(NEWSREAP_CODEC).setLevel(logging.INFO) if verbose > 3: logging.getLogger(NEWSREAP_CODEC).setLevel(logging.DEBUG) if verbose > 4: logging.getLogger(SQLALCHEMY_ENGINE).setLevel(logging.DEBUG) # set initial level to WARN. rootlogger = logging.getLogger(NEWSREAP_LOGGER) if rootlogger.level == logging.NOTSET: set_verbosity(-1)
gpl-3.0
3,607,045,367,080,225,300
31.794872
76
0.696638
false
3.89227
false
false
false
Mirantis/octane
octane/commands/sync_images.py
1
2791
# Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import tempfile from cliff import command as cmd from fuelclient.objects import environment as environment_obj from octane.helpers.sync_glance_images import sync_glance_images from octane.util import db from octane.util import env as env_util from octane.util import ssh def prepare(orig_id, seed_id): orig_env = environment_obj.Environment(orig_id) seed_env = environment_obj.Environment(seed_id) controller = env_util.get_one_controller(seed_env) with tempfile.NamedTemporaryFile() as temp: db.mysqldump_from_env(orig_env, ['keystone'], temp.name) db.mysqldump_restore_to_env(seed_env, temp.name) ssh.call(['keystone-manage', 'db_sync'], node=controller, parse_levels=True) for controller in env_util.get_controllers(seed_env): ssh.call(['service', 'memcached', 'restart'], node=controller) class SyncImagesCommand(cmd.Command): """Sync glance images between ORIG and SEED environments""" def get_parser(self, prog_name): parser = super(SyncImagesCommand, self).get_parser(prog_name) parser.add_argument( 'orig_id', type=int, metavar='ORIG_ID', help="ID of original environment") parser.add_argument( 'seed_id', type=int, metavar='SEED_ID', help="ID of seed environment") parser.add_argument( 'swift_ep', type=str, help="Endpoint's name where swift-proxy service is listening on") return parser def take_action(self, parsed_args): sync_glance_images(parsed_args.orig_id, parsed_args.seed_id, parsed_args.swift_ep) class SyncImagesPrepareCommand(cmd.Command): """Sync glance images between ORIG and SEED environments""" def get_parser(self, prog_name): parser = super(SyncImagesPrepareCommand, self).get_parser(prog_name) parser.add_argument( 'orig_id', type=int, metavar='ORIG_ID', help="ID of original environment") parser.add_argument( 'seed_id', type=int, metavar='SEED_ID', help="ID of seed environment") return parser def take_action(self, parsed_args): prepare(parsed_args.orig_id, parsed_args.seed_id)
apache-2.0
-4,300,452,264,042,446,300
36.716216
77
0.677893
false
3.860304
false
false
false
Wolnosciowiec/file-repository
client/bahub/bahubapp/handler/__init__.py
1
4733
from ..entity.definition import BackupDefinition from ..service.client import FileRepositoryClient from ..service.pipefactory import PipeFactory from ..exceptions import ReadWriteException from ..result import CommandExecutionResult from logging import Logger import string import random import subprocess from shutil import copyfileobj class BackupHandler: """ Manages the process of backup and restore, interacts with different sources of backup data using adapters """ _client = None # type: FileRepositoryClient _pipe_factory = None # type: PipeFactory _logger = None # type: Logger _definition = None def __init__(self, _client: FileRepositoryClient, _pipe_factory: PipeFactory, _logger: Logger, _definition: BackupDefinition): self._client = _client self._pipe_factory = _pipe_factory self._logger = _logger self._definition = _definition def perform_backup(self): self._validate() self._validate_running_command() response = self._read() if response.return_code != 0 and response.return_code is not None: raise ReadWriteException('Backup source read error, use --debug and retry to investigate') upload_response = self._client.send(response.stdout, self._get_definition()) response.process.wait(15) response.stdout.close() return upload_response def perform_restore(self, version: str): response = self._write( self._read_from_storage(version) ) response.process.wait() self._logger.info('Waiting for process to finish') if response.return_code is not None and response.return_code > 0: raise ReadWriteException('Cannot write files to disk while restoring from backup. Errors: ' + str(response.stderr.read().decode('utf-8'))) self._logger.info('No errors found, sending success information') return '{"status": "OK"}' def close(self): self._logger.info('Finishing the process') self._close() def _get_definition(self) -> BackupDefinition: return self._definition def _execute_command(self, command: str, stdin=None) -> CommandExecutionResult: """ Executes a command on local machine, returning stdout as a stream, and streaming in the stdin (optionally) """ self._logger.debug('shell(' + command + ')') process = subprocess.Popen(command, stdout=subprocess.PIPE, stderr=subprocess.PIPE, stdin=subprocess.PIPE if stdin else None, executable='/bin/bash', shell=True) if stdin: self._logger.info('Copying stdin to process') try: copyfileobj(stdin, process.stdin) except BrokenPipeError: raise ReadWriteException( 'Cannot write to process, broken pipe occurred, probably a tar process died. ' + str(process.stdin.read()) + str(process.stderr.read()) ) process.stdin.close() return CommandExecutionResult(process.stdout, process.stderr, process.returncode, process) def _validate_running_command(self): """ Validate if the command really exports the data, does not end up with an error """ response = self._read() response.stdout.read(1024) response.process.kill() response.process.wait(15) if response.process.returncode > 0: raise ReadWriteException( 'The process exited with incorrect code, try to verify the command in with --debug switch' ) def _validate(self): raise Exception('_validate() not implemented for handler') def _read(self) -> CommandExecutionResult: """ TAR output or file stream buffered from ANY source for example """ raise Exception('_read() not implemented for handler') def _write(self, stream) -> CommandExecutionResult: """ A file stream or tar output be written into the storage. May be OpenSSL encoded, depends on definition """ raise Exception('_write() not implemented for handler') def _read_from_storage(self, version: str): return self._client.fetch(version, self._get_definition()) def _close(self): pass @staticmethod def generate_id(size=6, chars=string.ascii_uppercase + string.digits): return ''.join(random.choice(chars) for _ in range(size))
lgpl-3.0
-7,351,242,393,543,664,000
35.129771
118
0.616734
false
4.761569
false
false
false
aerokappa/SantaClaus
handCodedOptimum_v4.py
1
2216
import numpy as np import pandas as pd from processInput import processInput def handCodedOptimum_v4 ( ): fileName = 'gifts.csv' giftList, giftListSummary = processInput( fileName ) packedBags = [] for i in np.arange(1000): print i currentBag = [] if (i< 333): itemCount = np.array([0 ,3 ,0 ,0 ,0 ,0 ,0 ,3 ,0]) elif ((i>=333) & (i<458)): itemCount = np.array([8, 0, 0, 0, 0, 0, 0, 0, 0]) elif ((i>=458) & (i<583)): itemCount = np.array([0, 0, 0, 0, 0, 0, 8, 0, 0]) elif ((i>=583) & (i<916)): itemCount = np.array([0, 0, 0, 3, 0, 2, 0, 0, 0]) elif ((i>=916) & (i<924)): itemCount = np.array([ 0, 0, 0, 0, 0, 0, 0, 0, 25]) elif ((i>=924) & (i<928)): itemCount = np.array([ 0, 23, 0, 0, 0, 0, 0, 0, 0]) elif ((i>=928) & (i<938)): itemCount = np.array([ 0, 0, 0, 0, 0, 19, 0, 0, 0]) elif ((i>=938) & (i<939)): itemCount = np.array([ 0, 0, 0, 0, 0, 11, 0, 1, 0]) elif ((i>=939) & (i<940)): itemCount = np.array([0, 9, 0, 1, 0, 0, 0, 0, 0]) else: itemCount = np.array([0, 0, 1, 0, 0, 5, 0, 0, 0]) for i in np.arange(len(itemCount)): if (itemCount[i] <= giftListSummary['nGiftsNotPacked'][i]): for j in np.arange(itemCount[i]): giftName = giftListSummary['GiftType'][i] currGiftID = giftListSummary['nGiftsPacked'][i] currentBag.append(giftName+'_'+str(currGiftID)) giftListSummary['nGiftsPacked'][i] += 1 giftListSummary['nGiftsNotPacked'][i] -= 1 packedBags.append(currentBag) # Write to File 'submission.csv' subFile = open('submission_5.csv','w') subFile.write('Gifts\n') for currentBag in packedBags: subFile.write(currentBag[0]) for currentItem in currentBag[1:]: subFile.write(' ') subFile.write(currentItem) subFile.write('\n') subFile.close() return packedBags
mit
-6,132,476,382,293,829,000
35.344262
73
0.476083
false
3.014966
false
false
false
Jbonnett/Mutagen-flo
mutagen/ogg.py
1
17770
# Copyright 2006 Joe Wreschnig # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License version 2 as # published by the Free Software Foundation. # # $Id: ogg.py 3975 2007-01-13 21:51:17Z piman $ """Read and write Ogg bitstreams and pages. This module reads and writes a subset of the Ogg bitstream format version 0. It does *not* read or write Ogg Vorbis files! For that, you should use mutagen.oggvorbis. This implementation is based on the RFC 3533 standard found at http://www.xiph.org/ogg/doc/rfc3533.txt. """ import struct import sys import zlib from cStringIO import StringIO from mutagen import FileType from mutagen._util import cdata, insert_bytes, delete_bytes, WrappedFileobj class error(IOError): """Ogg stream parsing errors.""" pass class OggPage(object): """A single Ogg page (not necessarily a single encoded packet). A page is a header of 26 bytes, followed by the length of the data, followed by the data. The constructor is givin a file-like object pointing to the start of an Ogg page. After the constructor is finished it is pointing to the start of the next page. Attributes: version -- stream structure version (currently always 0) position -- absolute stream position (default -1) serial -- logical stream serial number (default 0) sequence -- page sequence number within logical stream (default 0) offset -- offset this page was read from (default None) complete -- if the last packet on this page is complete (default True) packets -- list of raw packet data (default []) Note that if 'complete' is false, the next page's 'continued' property must be true (so set both when constructing pages). If a file-like object is supplied to the constructor, the above attributes will be filled in based on it. """ version = 0 __type_flags = 0 position = 0L serial = 0 sequence = 0 offset = None complete = True def __init__(self, fileobj=None): self.packets = [] if fileobj is None: return self.offset = fileobj.tell() header = fileobj.read(27) if len(header) == 0: raise EOFError try: (oggs, self.version, self.__type_flags, self.position, self.serial, self.sequence, crc, segments) = struct.unpack( "<4sBBqIIiB", header) except struct.error: raise error("unable to read full header; got %r" % header) if oggs != "OggS": raise error("read %r, expected %r, at 0x%x" % ( oggs, "OggS", fileobj.tell() - 27)) if self.version != 0: raise error("version %r unsupported" % self.version) total = 0 lacings = [] lacing_bytes = fileobj.read(segments) if len(lacing_bytes) != segments: raise error("unable to read %r lacing bytes" % segments) for c in map(ord, lacing_bytes): total += c if c < 255: lacings.append(total) total = 0 if total: lacings.append(total) self.complete = False self.packets = map(fileobj.read, lacings) if map(len, self.packets) != lacings: raise error("unable to read full data") def __eq__(self, other): """Two Ogg pages are the same if they write the same data.""" try: return (self.write() == other.write()) except AttributeError: return False __hash__ = object.__hash__ def __repr__(self): attrs = ['version', 'position', 'serial', 'sequence', 'offset', 'complete', 'continued', 'first', 'last'] values = ["%s=%r" % (attr, getattr(self, attr)) for attr in attrs] return "<%s %s, %d bytes in %d packets>" % ( type(self).__name__, " ".join(values), sum(map(len, self.packets)), len(self.packets)) def write(self): """Return a string encoding of the page header and data. A ValueError is raised if the data is too big to fit in a single page. """ data = [ struct.pack("<4sBBqIIi", "OggS", self.version, self.__type_flags, self.position, self.serial, self.sequence, 0) ] lacing_data = [] for datum in self.packets: quot, rem = divmod(len(datum), 255) lacing_data.append("\xff" * quot + chr(rem)) lacing_data = "".join(lacing_data) if not self.complete and lacing_data.endswith("\x00"): lacing_data = lacing_data[:-1] data.append(chr(len(lacing_data))) data.append(lacing_data) data.extend(self.packets) data = "".join(data) # Python's CRC is swapped relative to Ogg's needs. crc = ~zlib.crc32(data.translate(cdata.bitswap), -1) # Although we're using to_int_be, this actually makes the CRC # a proper le integer, since Python's CRC is byteswapped. crc = cdata.to_int_be(crc).translate(cdata.bitswap) data = data[:22] + crc + data[26:] return data def __size(self): size = 27 # Initial header size for datum in self.packets: quot, rem = divmod(len(datum), 255) size += quot + 1 if not self.complete and rem == 0: # Packet contains a multiple of 255 bytes and is not # terminated, so we don't have a \x00 at the end. size -= 1 size += sum(map(len, self.packets)) return size size = property(__size, doc="Total frame size.") def __set_flag(self, bit, val): mask = 1 << bit if val: self.__type_flags |= mask else: self.__type_flags &= ~mask continued = property( lambda self: cdata.test_bit(self.__type_flags, 0), lambda self, v: self.__set_flag(0, v), doc="The first packet is continued from the previous page.") first = property( lambda self: cdata.test_bit(self.__type_flags, 1), lambda self, v: self.__set_flag(1, v), doc="This is the first page of a logical bitstream.") last = property( lambda self: cdata.test_bit(self.__type_flags, 2), lambda self, v: self.__set_flag(2, v), doc="This is the last page of a logical bitstream.") def renumber(klass, fileobj, serial, start): """Renumber pages belonging to a specified logical stream. fileobj must be opened with mode r+b or w+b. Starting at page number 'start', renumber all pages belonging to logical stream 'serial'. Other pages will be ignored. fileobj must point to the start of a valid Ogg page; any occuring after it and part of the specified logical stream will be numbered. No adjustment will be made to the data in the pages nor the granule position; only the page number, and so also the CRC. If an error occurs (e.g. non-Ogg data is found), fileobj will be left pointing to the place in the stream the error occured, but the invalid data will be left intact (since this function does not change the total file size). """ number = start while True: try: page = OggPage(fileobj) except EOFError: break else: if page.serial != serial: # Wrong stream, skip this page. continue # Changing the number can't change the page size, # so seeking back based on the current size is safe. fileobj.seek(-page.size, 1) page.sequence = number fileobj.write(page.write()) fileobj.seek(page.offset + page.size, 0) number += 1 renumber = classmethod(renumber) def to_packets(klass, pages, strict=False): """Construct a list of packet data from a list of Ogg pages. If strict is true, the first page must start a new packet, and the last page must end the last packet. """ serial = pages[0].serial sequence = pages[0].sequence packets = [] if strict: if pages[0].continued: raise ValueError("first packet is continued") if not pages[-1].complete: raise ValueError("last packet does not complete") elif pages and pages[0].continued: packets.append("") for page in pages: if serial != page.serial: raise ValueError("invalid serial number in %r" % page) elif sequence != page.sequence: raise ValueError("bad sequence number in %r" % page) else: sequence += 1 if page.continued: packets[-1] += page.packets[0] else: packets.append(page.packets[0]) packets.extend(page.packets[1:]) return packets to_packets = classmethod(to_packets) def from_packets(klass, packets, sequence=0, default_size=4096, wiggle_room=2048): """Construct a list of Ogg pages from a list of packet data. The algorithm will generate pages of approximately default_size in size (rounded down to the nearest multiple of 255). However, it will also allow pages to increase to approximately default_size + wiggle_room if allowing the wiggle room would finish a packet (only one packet will be finished in this way per page; if the next packet would fit into the wiggle room, it still starts on a new page). This method reduces packet fragmentation when packet sizes are slightly larger than the default page size, while still ensuring most pages are of the average size. Pages are numbered started at 'sequence'; other information is uninitialized. """ chunk_size = (default_size // 255) * 255 pages = [] page = OggPage() page.sequence = sequence for packet in packets: page.packets.append("") while packet: data, packet = packet[:chunk_size], packet[chunk_size:] if page.size < default_size and len(page.packets) < 255: page.packets[-1] += data else: # If we've put any packet data into this page yet, # we need to mark it incomplete. However, we can # also have just started this packet on an already # full page, in which case, just start the new # page with this packet. if page.packets[-1]: page.complete = False if len(page.packets) == 1: page.position = -1L else: page.packets.pop(-1) pages.append(page) page = OggPage() page.continued = not pages[-1].complete page.sequence = pages[-1].sequence + 1 page.packets.append(data) if len(packet) < wiggle_room: page.packets[-1] += packet packet = "" if page.packets: pages.append(page) return pages from_packets = classmethod(from_packets) def replace(klass, fileobj, old_pages, new_pages): """Replace old_pages with new_pages within fileobj. old_pages must have come from reading fileobj originally. new_pages are assumed to have the 'same' data as old_pages, and so the serial and sequence numbers will be copied, as will the flags for the first and last pages. fileobj will be resized and pages renumbered as necessary. As such, it must be opened r+b or w+b. """ # Number the new pages starting from the first old page. first = old_pages[0].sequence for page, seq in zip(new_pages, range(first, first + len(new_pages))): page.sequence = seq page.serial = old_pages[0].serial new_pages[0].first = old_pages[0].first new_pages[0].last = old_pages[0].last new_pages[0].continued = old_pages[0].continued new_pages[-1].first = old_pages[-1].first new_pages[-1].last = old_pages[-1].last new_pages[-1].complete = old_pages[-1].complete if not new_pages[-1].complete and len(new_pages[-1].packets) == 1: new_pages[-1].position = -1L new_data = "".join(map(klass.write, new_pages)) # Make room in the file for the new data. delta = len(new_data) fileobj.seek(old_pages[0].offset, 0) insert_bytes(fileobj, delta, old_pages[0].offset) fileobj.seek(old_pages[0].offset, 0) fileobj.write(new_data) new_data_end = old_pages[0].offset + delta # Go through the old pages and delete them. Since we shifted # the data down the file, we need to adjust their offsets. We # also need to go backwards, so we don't adjust the deltas of # the other pages. old_pages.reverse() for old_page in old_pages: adj_offset = old_page.offset + delta delete_bytes(fileobj, old_page.size, adj_offset) # Finally, if there's any discrepency in length, we need to # renumber the pages for the logical stream. if len(old_pages) != len(new_pages): fileobj.seek(new_data_end, 0) serial = new_pages[-1].serial sequence = new_pages[-1].sequence + 1 klass.renumber(fileobj, serial, sequence) replace = classmethod(replace) def find_last(klass, fileobj, serial): """Find the last page of the stream 'serial'. If the file is not multiplexed this function is fast. If it is, it must read the whole the stream. This finds the last page in the actual file object, or the last page in the stream (with eos set), whichever comes first. """ # For non-muxed streams, look at the last page. try: fileobj.seek(-256*256, 2) except IOError: # The file is less than 64k in length. fileobj.seek(0) data = fileobj.read() try: index = data.rindex("OggS") except ValueError: raise error("unable to find final Ogg header") stringobj = StringIO(data[index:]) best_page = None try: page = OggPage(stringobj) except error: pass else: if page.serial == serial: if page.last: return page else: best_page = page else: best_page = None # The stream is muxed, so use the slow way. fileobj.seek(0) try: page = OggPage(fileobj) while not page.last: page = OggPage(fileobj) while page.serial != serial: page = OggPage(fileobj) best_page = page return page except error: return best_page except EOFError: return best_page find_last = classmethod(find_last) class OggFileType(FileType): """An generic Ogg file.""" _Info = None _Tags = None _Error = None _mimes = ["application/ogg", "application/x-ogg"] def load(self, filename): """Load file information from a filename.""" self.filename = filename fileobj = WrappedFileobj(filename, "rb") try: try: self.info = self._Info(fileobj) self.tags = self._Tags(fileobj, self.info) if self.info.length: # The streaminfo gave us real length information, # don't waste time scanning the Ogg. return last_page = OggPage.find_last(fileobj, self.info.serial) samples = last_page.position try: denom = self.info.sample_rate except AttributeError: denom = self.info.fps self.info.length = samples / float(denom) except error, e: raise self._Error, e, sys.exc_info()[2] except EOFError: raise self._Error, "no appropriate stream found" finally: fileobj.close() def delete(self, filename=None): """Remove tags from a file. If no filename is given, the one most recently loaded is used. """ if filename is None: filename = self.filename self.tags.clear() fileobj = WrappedFileobj(filename, "rb+") try: try: self.tags._inject(fileobj) except error, e: raise self._Error, e, sys.exc_info()[2] except EOFError: raise self._Error, "no appropriate stream found" finally: fileobj.close() def save(self, filename=None): """Save a tag to a file. If no filename is given, the one most recently loaded is used. """ if filename is None: filename = self.filename fileobj = WrappedFileobj(filename, "rb+") try: try: self.tags._inject(fileobj) except error, e: raise self._Error, e, sys.exc_info()[2] except EOFError: raise self._Error, "no appropriate stream found" finally: fileobj.close()
gpl-2.0
-2,453,146,239,836,660,000
34.54
79
0.570568
false
4.24105
false
false
false
arcticfoxnv/slackminion
slackminion/plugin/base.py
1
4847
from six import string_types from builtins import object import logging import threading from slackminion.slack import SlackChannel, SlackIM, SlackUser, SlackRoom class BasePlugin(object): def __init__(self, bot, **kwargs): self.log = logging.getLogger(type(self).__name__) self._bot = bot self._dont_save = False # By default, we want to save a plugin's state during save_state() self._state_handler = False # State storage backends should set this to true self._timer_callbacks = {} self.config = {} if 'config' in kwargs: self.config = kwargs['config'] def on_load(self): """ Executes when a plugin is loaded. Override this if your plugin needs to do initialization when loading. Do not use this to restore runtime changes to variables -- they will be overwritten later on by PluginManager.load_state() """ return True def on_unload(self): """ Executes when a plugin is unloaded. Override this if your plugin needs to do cleanup when unloading. """ return True def on_connect(self): """ Executes immediately after connecting to slack. Will not fire on reconnects. """ return True def send_message(self, channel, text, thread=None, reply_broadcast=False): """ Used to send a message to the specified channel. * channel - can be a channel or user * text - message to send * thread - thread to reply in * reply_broadcast - whether or not to also send the message to the channel """ self.log.debug('Sending message to channel {} of type {}'.format(channel, type(channel))) if isinstance(channel, SlackIM) or isinstance(channel, SlackUser): self._bot.send_im(channel, text) elif isinstance(channel, SlackRoom): self._bot.send_message(channel, text, thread, reply_broadcast) elif isinstance(channel, string_types): if channel[0] == '@': self._bot.send_im(channel[1:], text) elif channel[0] == '#': self._bot.send_message(channel[1:], text, thread, reply_broadcast) else: self._bot.send_message(channel, text, thread, reply_broadcast) else: self._bot.send_message(channel, text, thread, reply_broadcast) def start_timer(self, duration, func, *args): """ Schedules a function to be called after some period of time. * duration - time in seconds to wait before firing * func - function to be called * args - arguments to pass to the function """ self.log.info("Scheduling call to %s in %ds: %s", func.__name__, duration, args) if self._bot.runnable: t = threading.Timer(duration, self._timer_callback, (func, args)) self._timer_callbacks[func] = t self._bot.timers.append(t) t.start() self.log.info("Scheduled call to %s in %ds", func.__name__, duration) else: self.log.warning("Not scheduling call to %s in %ds because we're shutting down.", func.__name__, duration) def stop_timer(self, func): """ Stops a timer if it hasn't fired yet * func - the function passed in start_timer """ self.log.debug('Stopping timer {}'.format(func.__name__)) if func in self._timer_callbacks: t = self._timer_callbacks[func] self._bot.timers.remove(t) t.cancel() del self._timer_callbacks[func] def _timer_callback(self, func, args): self.log.debug('Executing timer function {}'.format(func.__name__)) try: func(*args) except Exception: self.log.exception("Caught exception executing timer function: {}".format(func.__name__)) def get_user(self, username): """ Utility function to query slack for a particular user :param username: The username of the user to lookup :return: SlackUser object or None """ if hasattr(self._bot, 'user_manager'): user = self._bot.user_manager.get_by_username(username) if user: return user user = SlackUser.get_user(self._bot.sc, username) self._bot.user_manager.set(user) return user return SlackUser.get_user(self._bot.sc, username) def get_channel(self, channel): """ Utility function to query slack for a particular channel :param channel: The channel name or id of the channel to lookup :return: SlackChannel object or None """ return SlackChannel.get_channel(self._bot.sc, channel)
mit
-3,488,926,449,185,535,000
36
118
0.595007
false
4.27425
false
false
false
linxdcn/iS3
IS3Py/is3.py
2
7512
# Copyright (C) 2015 iS3 Software Foundation # Author: Xiaojun Li # Contact: [email protected] import sys import clr import System # Load System.Windows.Media in PresentationCore.dll sys.path.append('C:\\Program Files (x86)\\Reference Assemblies\\Microsoft\\Framework\\.NETFramework\\v4.5') prcore = clr.LoadAssemblyFromFile('PresentationCore.dll') clr.AddReference(prcore) # Import classes in System from System import Func,Action from System.Windows.Media import Colors from System.Collections.ObjectModel import ObservableCollection from System.Threading.Tasks import Task # Load IS3 namespaces iS3Core = clr.LoadAssemblyFromFile('IS3.Core.dll') clr.AddReference(iS3Core) # Import classes in IS3 from IS3.Core import (Globals, Runtime, ErrorReport, ErrorReportTarget, DGObject, DGObjects, ProjectDefinition, Project, EngineeringMap, EngineeringMapType, DrawShapeType, IView, LayerDef, Domain, DomainType, ToolTreeItem) from IS3.Core.Geometry import * from IS3.Core.Graphics import * def output(text): print(text) # Redirect ErrorReport to python cosole ErrorReport.target = ErrorReportTarget.DelegateConsole ErrorReport.consoleDelegate = output # In Windows, UI thread vars and functions are restricted to other threads. # So, be caution with python calls to functions in UI thread. # Classes in the main UI thread include: mainframe, view, layer, ... # Therefore, calling to functions in mainframe, view, layer etc. are restricted. mainframe = Globals.mainframe # Global var: mainframe prj = mainframe.prj # Global var: prj dispatcher = mainframe.Dispatcher # Global var: dispatcher -> UI thread manager graphicsEngine = Runtime.graphicEngine # Global var: graphics Engine geometryEngine = Runtime.geometryEngine # Global var: geometry Engine class MainframeWrapper(): "Define thread safe calls to mainframe methods" @staticmethod def addView(emap, canClose = True): "A thread safe call to -> mainframe.addView(emap, canclose)" if (Globals.isThreadUnsafe()): func = Func[EngineeringMap, bool, Task[IView]](mainframe.addView) view = dispatcher.Invoke(func, emap, canClose) else: view = mainframe.addView(emap, canClose) viewWrapper = ViewWrapper(view.Result) return viewWrapper @staticmethod def loadDomainPanels(): "A thread safe call to -> mainframe.loadDomainPanels()" if (Globals.isThreadUnsafe()): dispatcher.Invoke(mainframe.loadDomainPanels) else: mainframe.loadDomainPanels() class ViewWrapper(): "Define thread safe calls to IS3View methods" def __init__(self, view): self.view = view def addLayer(self, layer): "A thread safe call to -> IS3View.addLayer" if (Globals.isThreadUnsafe()): func = Action[IGraphicsLayer](self.view.addLayer) dispatcher.Invoke(func, layer) else: self.view.addLayer(layer) def addLocalTiledLayer(self, file, id): "A thread safe call to -> IS3View.addLocalTiledLayer" if (Globals.isThreadUnsafe()): func = Action[str, str](self.view.addLocalTiledLayer) dispatcher.Invoke(func, file, id) else: self.view.addLocalTiledLayer(file, id) def addGdbLayer(self, layerDef, gdbFile, start = 0, maxFeatures = 0): "A thread safe call to -> IS3View.addGdbLayer" if (Globals.isThreadUnsafe()): func = Func[LayerDef, str, int, int, Task[IGraphicsLayer]](self.view.addGdbLayer) layer = dispatcher.Invoke(func, layerDef, gdbFile, start, maxFeatures) else: layer = self.view.addGdbLayer(layerDef, gdbFile, start, maxFeatures) layerWrapper = GraphicsLayerWrapper(layer.Result) return layerWrapper def addShpLayer(self, layerDef, shpFile, start = 0, maxFeatures = 0): "A thread safe call to -> IS3View.addShpLayer" if (Globals.isThreadUnsafe()): func = Func[LayerDef, str, int, int, Task[IGraphicsLayer]](self.view.addShpLayer) layer = dispatcher.Invoke(func, layerDef, shpFile, start, maxFeatures) else: self.view.addShpLayer(layerDef, shpFile, start, maxFeatures) layerWrapper = GraphicsLayerWrapper(layer.Result) return layerWrapper def selectByRect(self): "A thread safe call to -> IS3View.selectByRect" if (Globals.isThreadUnsafe()): dispatcher.Invoke(self.view.selectByRect) else: self.view.selectByRect() class GraphicsLayerWrapper(): "Define thread safe calls to IS3GraphicsLayer methods" def __init__(self, glayer): self.layer = glayer def setRenderer(self, renderer): "A thread safe call to -> IS3GraphicsLayer.setRenderer" if (Globals.isThreadUnsafe()): func = Action[IRenderer](self.layer.setRenderer) dispatcher.Invoke(func, renderer) else: self.layer.setRenderer(renderer) def addGraphic(self, graphic): "A thread safe call to -> IS3GraphicsLayer.addGraphic" if (Globals.isThreadUnsafe()): func = Action[IGraphic](self.layer.addGraphic) dispatcher.Invoke(func, graphic) else: self.layer.addGraphic(graphic) def newGraphicsLayer(id, displayName): layer = graphicsEngine.newGraphicsLayer(id, displayName) layerWrapper = GraphicsLayerWrapper(layer) return layerWrapper def addView3d(id, file): map3d = EngineeringMap() map3d.MapID = id map3d.MapType = EngineeringMapType.Map3D map3d.LocalMapFileName = file view3d = MainframeWrapper.addView(map3d, True) return view3d def addGdbLayer(viewWrapper, layerDef, gdbFile = None, start = 0, maxFeatures = 0): prj = Globals.project layerWrapper = viewWrapper.addGdbLayer(layerDef, gdbFile, start, maxFeatures) if (layerWrapper.layer == None): print('addGdbFileELayer failed: ' + layerDef.Name) return None else: print('addGdbFileELayer succeeded: ' + layerDef.Name) objs = prj.findObjects(layerDef.Name) if (objs == None): print('Layer ' + layerDef.Name + ' has no corresponding objects in the project.') else: count = layerWrapper.layer.syncObjects(objs) print('Sync with ' + str(count) + ' objects for layer ' + layerDef.Name) return layerWrapper def addGdbLayerLazy(view, name, type, gdbFile = None, start = 0, maxFeatures = 0): layerDef = LayerDef() layerDef.Name = name layerDef.GeometryType = type layerWrapper = addGdbLayer(view, layerDef, gdbFile, start, maxFeatures) return layerWrapper def addShpLayer(viewWrapper, layerDef, shpfile, start = 0, maxFeatures = 0): prj = Globals.project layerWrapper = viewWrapper.addShpLayer(layerDef, shpfile, start, maxFeatures) if (layerWrapper.layer == None): print('addShpFileELayer failed: ' + layerDef.Name) return None else: print('addShpFileELayer succeeded: ' + layerDef.Name) objs = prj.findObjects(layerDef.Name) if (objs == None): print('Layer ' + layerDef.Name + ' has no corresponding objects in the project.') else: count = layerWrapper.layer.syncObjects(objs) print('Sync with ' + str(count) + ' objects for layer ' + layerDef.Name) return layerWrapper
lgpl-3.0
-7,984,074,763,647,838,000
37.523077
107
0.676384
false
3.729891
false
false
false
abendig/django-mailchimp
mailchimp/models.py
1
9678
from django.db import models import json as simplejson from django.contrib.contenttypes.models import ContentType from django.contrib.contenttypes import generic from django.core.urlresolvers import reverse from django.shortcuts import get_object_or_404 from django.utils.translation import ugettext_lazy as _ from mailchimp.utils import get_connection class QueueManager(models.Manager): def queue(self, campaign_type, contents, list_id, template_id, subject, from_email, from_name, to_email, folder_id=None, tracking_opens=True, tracking_html_clicks=True, tracking_text_clicks=False, title=None, authenticate=False, google_analytics=None, auto_footer=False, auto_tweet=False, segment_options=False, segment_options_all=True, segment_options_conditions=[], type_opts={}, obj=None, extra_info=[]): """ Queue a campaign """ kwargs = locals().copy() kwargs['segment_options_conditions'] = simplejson.dumps(segment_options_conditions) kwargs['type_opts'] = simplejson.dumps(type_opts) kwargs['contents'] = simplejson.dumps(contents) kwargs['extra_info'] = simplejson.dumps(extra_info) for thing in ('template_id', 'list_id'): thingy = kwargs[thing] if hasattr(thingy, 'id'): kwargs[thing] = thingy.id del kwargs['self'] del kwargs['obj'] if obj: kwargs['object_id'] = obj.pk kwargs['content_type'] = ContentType.objects.get_for_model(obj) return self.create(**kwargs) def dequeue(self, limit=None): if limit: qs = self.filter(locked=False)[:limit] else: qs = self.filter(locked=False) for obj in qs: yield obj.send() def get_or_404(self, *args, **kwargs): return get_object_or_404(self.model, *args, **kwargs) class Queue(models.Model): """ A FIFO queue for async sending of campaigns """ campaign_type = models.CharField(max_length=50) contents = models.TextField() list_id = models.CharField(max_length=50) template_id = models.PositiveIntegerField() subject = models.CharField(max_length=255) from_email = models.EmailField() from_name = models.CharField(max_length=255) to_email = models.EmailField() folder_id = models.CharField(max_length=50, null=True, blank=True) tracking_opens = models.BooleanField(default=True) tracking_html_clicks = models.BooleanField(default=True) tracking_text_clicks = models.BooleanField(default=False) title = models.CharField(max_length=255, null=True, blank=True) authenticate = models.BooleanField(default=False) google_analytics = models.CharField(max_length=100, blank=True, null=True) auto_footer = models.BooleanField(default=False) generate_text = models.BooleanField(default=False) auto_tweet = models.BooleanField(default=False) segment_options = models.BooleanField(default=False) segment_options_all = models.BooleanField(default=False) segment_options_conditions = models.TextField() type_opts = models.TextField() content_type = models.ForeignKey(ContentType, null=True, blank=True) object_id = models.PositiveIntegerField(null=True, blank=True) content_object = generic.GenericForeignKey('content_type', 'object_id') extra_info = models.TextField(null=True) locked = models.BooleanField(default=False) objects = QueueManager() def send(self): """ send (schedule) this queued object """ # check lock if self.locked: return False # aquire lock self.locked = True self.save() # get connection and send the mails c = get_connection() tpl = c.get_template_by_id(self.template_id) content_data = dict([(str(k), v) for k,v in simplejson.loads(self.contents).items()]) built_template = tpl.build(**content_data) tracking = {'opens': self.tracking_opens, 'html_clicks': self.tracking_html_clicks, 'text_clicks': self.tracking_text_clicks} if self.google_analytics: analytics = {'google': self.google_analytics} else: analytics = {} segment_opts = {'match': 'all' if self.segment_options_all else 'any', 'conditions': simplejson.loads(self.segment_options_conditions)} type_opts = simplejson.loads(self.type_opts) title = self.title or self.subject camp = c.create_campaign(self.campaign_type, c.get_list_by_id(self.list_id), built_template, self.subject, self.from_email, self.from_name, self.to_email, self.folder_id, tracking, title, self.authenticate, analytics, self.auto_footer, self.generate_text, self.auto_tweet, segment_opts, type_opts) if camp.send_now_async(): self.delete() kwargs = {} if self.content_type and self.object_id: kwargs['content_type'] = self.content_type kwargs['object_id'] = self.object_id if self.extra_info: kwargs['extra_info'] = simplejson.loads(self.extra_info) return Campaign.objects.create(camp.id, segment_opts, **kwargs) # release lock if failed self.locked = False self.save() return False def get_dequeue_url(self): return reverse('mailchimp_dequeue', kwargs={'id': self.id}) def get_cancel_url(self): return reverse('mailchimp_cancel', kwargs={'id': self.id}) def get_list(self): return get_connection().lists[self.list_id] @property def object(self): """ The object might have vanished until now, so triple check that it's there! """ if self.object_id: model = self.content_type.model_class() try: return model.objects.get(id=self.object_id) except model.DoesNotExist: return None return None def get_object_admin_url(self): if not self.object: return '' name = 'admin:%s_%s_change' % (self.object._meta.app_label, self.object._meta.module_name) return reverse(name, args=(self.object.pk,)) def can_dequeue(self, user): if user.is_superuser: return True if not user.is_staff: return False if callable(getattr(self.object, 'mailchimp_can_dequeue', None)): return self.object.mailchimp_can_dequeue(user) return user.has_perm('mailchimp.can_send') and user.has_perm('mailchimp.can_dequeue') class CampaignManager(models.Manager): def create(self, campaign_id, segment_opts, content_type=None, object_id=None, extra_info=[]): con = get_connection() camp = con.get_campaign_by_id(campaign_id) extra_info = simplejson.dumps(extra_info) obj = self.model(content=camp.content, campaign_id=campaign_id, name=camp.title, content_type=content_type, object_id=object_id, extra_info=extra_info) obj.save() segment_opts = dict([(str(k), v) for k,v in segment_opts.items()]) for email in camp.list.filter_members(segment_opts): Reciever.objects.create(campaign=obj, email=email) return obj def get_or_404(self, *args, **kwargs): return get_object_or_404(self.model, *args, **kwargs) class DeletedCampaign(object): subject = u'<deleted from mailchimp>' class Campaign(models.Model): sent_date = models.DateTimeField(auto_now_add=True) campaign_id = models.CharField(max_length=50) content = models.TextField() name = models.CharField(max_length=255) content_type = models.ForeignKey(ContentType, null=True, blank=True) object_id = models.PositiveIntegerField(null=True, blank=True) content_object = generic.GenericForeignKey('content_type', 'object_id') extra_info = models.TextField(null=True) objects = CampaignManager() class Meta: ordering = ['-sent_date'] permissions = [('can_view', 'Can view Mailchimp information'), ('can_send', 'Can send Mailchimp newsletters')] verbose_name = _('Mailchimp Log') verbose_name_plural = _('Mailchimp Logs') def get_absolute_url(self): return reverse('mailchimp_campaign_info', kwargs={'campaign_id': self.campaign_id}) def get_object_admin_url(self): if not self.object: return '' name = 'admin:%s_%s_change' % (self.object._meta.app_label, self.object._meta.module_name) return reverse(name, args=(self.object.pk,)) def get_extra_info(self): if self.extra_info: return simplejson.loads(self.extra_info) return [] @property def object(self): """ The object might have vanished until now, so triple check that it's there! """ if self.object_id: model = self.content_type.model_class() try: return model.objects.get(id=self.object_id) except model.DoesNotExist: return None return None @property def mc(self): try: if not hasattr(self, '_mc'): self._mc = get_connection().get_campaign_by_id(self.campaign_id) return self._mc except: return DeletedCampaign() class Reciever(models.Model): campaign = models.ForeignKey(Campaign, related_name='recievers') email = models.EmailField()
bsd-3-clause
-397,447,282,722,257,540
37.712
93
0.626886
false
3.8712
false
false
false
bashu/fluentcms-filer
fluentcms_filer/file/south_migrations/0001_initial.py
1
10131
# -*- coding: utf-8 -*- from south.utils import datetime_utils as datetime from south.db import db from south.v2 import SchemaMigration from django.db import models class Migration(SchemaMigration): def forwards(self, orm): # Adding model 'FilerFileItem' db.create_table(u'contentitem_file_filerfileitem', ( (u'contentitem_ptr', self.gf('django.db.models.fields.related.OneToOneField')(to=orm['fluent_contents.ContentItem'], unique=True, primary_key=True)), ('file', self.gf('django.db.models.fields.related.ForeignKey')(to=orm['filer.File'])), ('name', self.gf('django.db.models.fields.CharField')(max_length=255, null=True, blank=True)), ('target', self.gf('django.db.models.fields.CharField')(default='', max_length=100, blank=True)), )) db.send_create_signal(u'file', ['FilerFileItem']) def backwards(self, orm): # Deleting model 'FilerFileItem' db.delete_table(u'contentitem_file_filerfileitem') models = { u'auth.group': { 'Meta': {'object_name': 'Group'}, u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '80'}), 'permissions': ('django.db.models.fields.related.ManyToManyField', [], {'to': u"orm['auth.Permission']", 'symmetrical': 'False', 'blank': 'True'}) }, u'auth.permission': { 'Meta': {'ordering': "(u'content_type__app_label', u'content_type__model', u'codename')", 'unique_together': "((u'content_type', u'codename'),)", 'object_name': 'Permission'}, 'codename': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'content_type': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['contenttypes.ContentType']"}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '50'}) }, u'auth.user': { 'Meta': {'object_name': 'User'}, 'date_joined': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'email': ('django.db.models.fields.EmailField', [], {'max_length': '75', 'blank': 'True'}), 'first_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'groups': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'related_name': "u'user_set'", 'blank': 'True', 'to': u"orm['auth.Group']"}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'is_active': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), 'is_staff': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'is_superuser': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), 'last_login': ('django.db.models.fields.DateTimeField', [], {'default': 'datetime.datetime.now'}), 'last_name': ('django.db.models.fields.CharField', [], {'max_length': '30', 'blank': 'True'}), 'password': ('django.db.models.fields.CharField', [], {'max_length': '128'}), 'user_permissions': ('django.db.models.fields.related.ManyToManyField', [], {'symmetrical': 'False', 'related_name': "u'user_set'", 'blank': 'True', 'to': u"orm['auth.Permission']"}), 'username': ('django.db.models.fields.CharField', [], {'unique': 'True', 'max_length': '30'}) }, u'contenttypes.contenttype': { 'Meta': {'ordering': "('name',)", 'unique_together': "(('app_label', 'model'),)", 'object_name': 'ContentType', 'db_table': "'django_content_type'"}, 'app_label': ('django.db.models.fields.CharField', [], {'max_length': '100'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'model': ('django.db.models.fields.CharField', [], {'max_length': '100'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '100'}) }, u'file.filerfileitem': { 'Meta': {'ordering': "('placeholder', 'sort_order')", 'object_name': 'FilerFileItem', 'db_table': "u'contentitem_file_filerfileitem'", '_ormbases': ['fluent_contents.ContentItem']}, u'contentitem_ptr': ('django.db.models.fields.related.OneToOneField', [], {'to': "orm['fluent_contents.ContentItem']", 'unique': 'True', 'primary_key': 'True'}), 'file': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['filer.File']"}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), 'target': ('django.db.models.fields.CharField', [], {'default': "''", 'max_length': '100', 'blank': 'True'}) }, u'filer.file': { 'Meta': {'object_name': 'File'}, '_file_size': ('django.db.models.fields.IntegerField', [], {'null': 'True', 'blank': 'True'}), 'description': ('django.db.models.fields.TextField', [], {'null': 'True', 'blank': 'True'}), 'file': ('django.db.models.fields.files.FileField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), 'folder': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "u'all_files'", 'null': 'True', 'to': u"orm['filer.Folder']"}), 'has_all_mandatory_data': ('django.db.models.fields.BooleanField', [], {'default': 'False'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'is_public': ('django.db.models.fields.BooleanField', [], {'default': 'True'}), 'modified_at': ('django.db.models.fields.DateTimeField', [], {'auto_now': 'True', 'blank': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'default': "u''", 'max_length': '255', 'blank': 'True'}), 'original_filename': ('django.db.models.fields.CharField', [], {'max_length': '255', 'null': 'True', 'blank': 'True'}), 'owner': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "u'owned_files'", 'null': 'True', 'to': u"orm['auth.User']"}), 'polymorphic_ctype': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "u'polymorphic_filer.file_set+'", 'null': 'True', 'to': u"orm['contenttypes.ContentType']"}), 'sha1': ('django.db.models.fields.CharField', [], {'default': "u''", 'max_length': '40', 'blank': 'True'}), 'uploaded_at': ('django.db.models.fields.DateTimeField', [], {'auto_now_add': 'True', 'blank': 'True'}) }, u'filer.folder': { 'Meta': {'ordering': "(u'name',)", 'unique_together': "((u'parent', u'name'),)", 'object_name': 'Folder'}, 'created_at': ('django.db.models.fields.DateTimeField', [], {'auto_now_add': 'True', 'blank': 'True'}), u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), u'level': ('django.db.models.fields.PositiveIntegerField', [], {'db_index': 'True'}), u'lft': ('django.db.models.fields.PositiveIntegerField', [], {'db_index': 'True'}), 'modified_at': ('django.db.models.fields.DateTimeField', [], {'auto_now': 'True', 'blank': 'True'}), 'name': ('django.db.models.fields.CharField', [], {'max_length': '255'}), 'owner': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "u'filer_owned_folders'", 'null': 'True', 'to': u"orm['auth.User']"}), 'parent': ('django.db.models.fields.related.ForeignKey', [], {'blank': 'True', 'related_name': "u'children'", 'null': 'True', 'to': u"orm['filer.Folder']"}), u'rght': ('django.db.models.fields.PositiveIntegerField', [], {'db_index': 'True'}), u'tree_id': ('django.db.models.fields.PositiveIntegerField', [], {'db_index': 'True'}), 'uploaded_at': ('django.db.models.fields.DateTimeField', [], {'auto_now_add': 'True', 'blank': 'True'}) }, 'fluent_contents.contentitem': { 'Meta': {'ordering': "('placeholder', 'sort_order')", 'object_name': 'ContentItem'}, u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'language_code': ('django.db.models.fields.CharField', [], {'default': "''", 'max_length': '15', 'db_index': 'True'}), 'parent_id': ('django.db.models.fields.IntegerField', [], {'null': 'True'}), 'parent_type': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['contenttypes.ContentType']"}), 'placeholder': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'contentitems'", 'null': 'True', 'on_delete': 'models.SET_NULL', 'to': "orm['fluent_contents.Placeholder']"}), 'polymorphic_ctype': ('django.db.models.fields.related.ForeignKey', [], {'related_name': "'polymorphic_fluent_contents.contentitem_set+'", 'null': 'True', 'to': u"orm['contenttypes.ContentType']"}), 'sort_order': ('django.db.models.fields.IntegerField', [], {'default': '1', 'db_index': 'True'}) }, 'fluent_contents.placeholder': { 'Meta': {'unique_together': "(('parent_type', 'parent_id', 'slot'),)", 'object_name': 'Placeholder'}, u'id': ('django.db.models.fields.AutoField', [], {'primary_key': 'True'}), 'parent_id': ('django.db.models.fields.IntegerField', [], {'null': 'True'}), 'parent_type': ('django.db.models.fields.related.ForeignKey', [], {'to': u"orm['contenttypes.ContentType']", 'null': 'True', 'blank': 'True'}), 'role': ('django.db.models.fields.CharField', [], {'default': "'m'", 'max_length': '1'}), 'slot': ('django.db.models.fields.SlugField', [], {'max_length': '50'}), 'title': ('django.db.models.fields.CharField', [], {'max_length': '255', 'blank': 'True'}) } } complete_apps = ['file']
apache-2.0
-6,681,037,321,661,970,000
82.04918
210
0.566183
false
3.562236
false
false
false
WilliamDiakite/ExperimentationsACA
processing/lsa.py
1
3364
import os import sys import itertools import operator import nltk import numpy as np import matplotlib.pyplot as plt from nltk.util import ngrams from collections import Counter from spell_checker import SpellChecker from sklearn.decomposition import TruncatedSVD from sklearn.pipeline import make_pipeline from sklearn.preprocessing import Normalizer sys.path.insert(0, '/Users/diakite_w/Documents/Dev/ExperimentationsACA/FrenchLefffLemmatizer') from FrenchLefffLemmatizer import FrenchLefffLemmatizer def extract_ngrams(documents, n): ''' Return list of n-grams ''' chained_documents = list(itertools.chain.from_iterable(documents)) return Counter(ngrams(chained_documents, n)) def tokenize(text): fll = FrenchLefffLemmatizer() splck = SpellChecker() contracted_pronouns = ["l'", "m'", "n'", "d'", "c'", "j'", "qu'", "s'"] dictionnary = [] stopwords = [w.rstrip() for w in open('stopwords-fr.txt')] # Put everything to lower case text = text.lower() # Tokenize text tokens = nltk.tokenize.word_tokenize(text) print('Nombre de tokens dans le texte :', len(tokens)) #tokens = [splck.correct(t) if t not in dictionnary else t for t in tokens] # Remove contacted pronous from tokens tokens = [t[2:] if t[:2] in contracted_pronouns else t for t in tokens] tokens = [t for t in tokens if len(t) > 2] tokens = [t for t in tokens if t not in stopwords] tokens = [fll.lemmatize(t) for t in tokens] print('Nombre de tokens apres traitement :', len(tokens), '\n') return tokens def tokens_to_vec(tokens): vec = np.zeros(len(word_index_map)) for token in tokens: idx = word_index_map[token] vec[idx] = 1 return vec def read_txt(textfile): with open(textfile, 'r') as f: text = f.read() text = text.replace('\n', ' ') text = text.replace('- ', '') text = text.replace('.', '') text = text.replace('-', '') text = text.replace("‘l'", 'ï') return text def get_all_doc(directory): ''' Read all txt documents and append them in string ''' documents = [] counter = 1 for filename in os.listdir(directory): if filename.endswith('.txt'): print('\n[...] Reading document', counter) filename = 'data/' + filename documents.append(read_txt(filename)) counter += 1 return documents documents = get_all_doc('data/') all_tokens = [tokenize(doc) for doc in documents] vocabulary = list(set(itertools.chain.from_iterable(all_tokens))) print ('\nVocab size:', len(vocabulary)) # Computing n-grams bigrams = extract_ngrams(all_tokens, 2) trigrams = extract_ngrams(all_tokens, 3) [print(t) for t in trigrams.most_common(5)] print('\n') [print(t) for t in bigrams.most_common(10)] ''' # Key: word - value: index word_index_map = {j: i for i, j in enumerate(vocabulary)} # Key: index - value: word index_word_map = sorted(word_index_map.items(), key=operator.itemgetter(1)) index_word_map = [t[0] for t in index_word_map] N = len(documents) D = len(word_index_map) X = np.zeros((D,N)) i = 0 for tokens in all_tokens: X[:,i] = tokens_to_vec(tokens) i += 1 print(X.shape) svd = TruncatedSVD() Z = svd.fit_transform(X) print('Z shape', Z.shape) plt.scatter(Z[:,0], Z[:,1]) print('D:', D) for i in range(D): plt.annotate(s=index_word_map[i], xy=(Z[i,0], Z[i,1])) plt.show() '''
mit
-8,408,729,182,994,486,000
20.96732
94
0.664683
false
2.995544
false
false
false
babble/babble
include/jython/Lib/asyncore.py
1
17033
# -*- Mode: Python -*- # Id: asyncore.py,v 2.51 2000/09/07 22:29:26 rushing Exp # Author: Sam Rushing <[email protected]> # ====================================================================== # Copyright 1996 by Sam Rushing # # All Rights Reserved # # Permission to use, copy, modify, and distribute this software and # its documentation for any purpose and without fee is hereby # granted, provided that the above copyright notice appear in all # copies and that both that copyright notice and this permission # notice appear in supporting documentation, and that the name of Sam # Rushing not be used in advertising or publicity pertaining to # distribution of the software without specific, written prior # permission. # # SAM RUSHING DISCLAIMS ALL WARRANTIES WITH REGARD TO THIS SOFTWARE, # INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS, IN # NO EVENT SHALL SAM RUSHING BE LIABLE FOR ANY SPECIAL, INDIRECT OR # CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM LOSS # OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, # NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF OR IN # CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE. # ====================================================================== """Basic infrastructure for asynchronous socket service clients and servers. There are only two ways to have a program on a single processor do "more than one thing at a time". Multi-threaded programming is the simplest and most popular way to do it, but there is another very different technique, that lets you have nearly all the advantages of multi-threading, without actually using multiple threads. it's really only practical if your program is largely I/O bound. If your program is CPU bound, then pre-emptive scheduled threads are probably what you really need. Network servers are rarely CPU-bound, however. If your operating system supports the select() system call in its I/O library (and nearly all do), then you can use it to juggle multiple communication channels at once; doing other work while your I/O is taking place in the "background." Although this strategy can seem strange and complex, especially at first, it is in many ways easier to understand and control than multi-threaded programming. The module documented here solves many of the difficult problems for you, making the task of building sophisticated high-performance network servers and clients a snap. """ import exceptions import select import socket import sys import time import os from errno import EALREADY, EINPROGRESS, EWOULDBLOCK, ECONNRESET, \ ENOTCONN, ESHUTDOWN, EINTR, EISCONN try: socket_map except NameError: socket_map = {} class ExitNow(exceptions.Exception): pass def read(obj): try: obj.handle_read_event() except ExitNow: raise except: obj.handle_error() def write(obj): try: obj.handle_write_event() except ExitNow: raise except: obj.handle_error() def readwrite(obj, flags): try: if flags & select.POLLIN: obj.handle_read_event() if flags & select.POLLOUT: obj.handle_write_event() except ExitNow: raise except: obj.handle_error() def poll(timeout=0.0, map=None): if map is None: map = socket_map if map: r = []; w = []; e = [] for fd, obj in map.items(): if obj.readable(): r.append(fd) if obj.writable(): w.append(fd) if [] == r == w == e: time.sleep(timeout) else: try: r, w, e = select.select(r, w, e, timeout) except select.error, err: if err[0] != EINTR: raise else: return for fd in r: obj = map.get(fd) if obj is None: continue read(obj) for fd in w: obj = map.get(fd) if obj is None: continue write(obj) def poll2(timeout=0.0, map=None): import poll if map is None: map = socket_map if timeout is not None: # timeout is in milliseconds timeout = int(timeout*1000) if map: l = [] for fd, obj in map.items(): flags = 0 if obj.readable(): flags = poll.POLLIN if obj.writable(): flags = flags | poll.POLLOUT if flags: l.append((fd, flags)) r = poll.poll(l, timeout) for fd, flags in r: obj = map.get(fd) if obj is None: continue readwrite(obj, flags) def poll3(timeout=0.0, map=None): # Use the poll() support added to the select module in Python 2.0 if map is None: map = socket_map if timeout is not None: # timeout is in milliseconds timeout = int(timeout*1000) pollster = select.poll() if map: for fd, obj in map.items(): flags = 0 if obj.readable(): flags = select.POLLIN if obj.writable(): flags = flags | select.POLLOUT if flags: pollster.register(fd, flags) try: r = pollster.poll(timeout) except select.error, err: if err[0] != EINTR: raise r = [] for fd, flags in r: obj = map.get(fd) if obj is None: continue readwrite(obj, flags) def loop(timeout=30.0, use_poll=0, map=None): if map is None: map = socket_map if use_poll: if hasattr(select, 'poll'): poll_fun = poll3 else: poll_fun = poll2 else: poll_fun = poll while map: poll_fun(timeout, map) class dispatcher: debug = 0 connected = 0 accepting = 0 closing = 0 addr = None def __init__(self, sock=None, map=None): if sock: self.set_socket(sock, map) # I think it should inherit this anyway self.socket.setblocking(0) self.connected = 1 # XXX Does the constructor require that the socket passed # be connected? try: self.addr = sock.getpeername() except socket.error: # The addr isn't crucial pass else: self.socket = None def __repr__(self): status = [self.__class__.__module__+"."+self.__class__.__name__] if self.accepting and self.addr: status.append('listening') elif self.connected: status.append('connected') if self.addr is not None: try: status.append('%s:%d' % self.addr) except TypeError: status.append(repr(self.addr)) # On some systems (RH10) id() can be a negative number. # work around this. MAX = 2L*sys.maxint+1 return '<%s at %#x>' % (' '.join(status), id(self)&MAX) def add_channel(self, map=None): #self.log_info('adding channel %s' % self) if map is None: if hasattr(self, '_map'): map = self._map del self._map else: map = socket_map if not hasattr(self, '_fileno'): self._fileno = self.socket.fileno() map[self._fileno] = self def del_channel(self, map=None): fd = self._fileno if map is None: map = socket_map if map.has_key(fd): #self.log_info('closing channel %d:%s' % (fd, self)) del map[fd] def create_socket(self, family, type): self.family_and_type = family, type self.socket = socket.socket(family, type) self.socket.setblocking(0) def set_socket(self, sock, map=None): self.socket = sock ## self.__dict__['socket'] = sock if sock.fileno(): self.add_channel(map) else: self._map = map def set_reuse_addr(self): # try to re-use a server port if possible try: self.socket.setsockopt( socket.SOL_SOCKET, socket.SO_REUSEADDR, self.socket.getsockopt(socket.SOL_SOCKET, socket.SO_REUSEADDR) | 1 ) except socket.error: pass # ================================================== # predicates for select() # these are used as filters for the lists of sockets # to pass to select(). # ================================================== def readable(self): return True if os.name == 'mac': # The macintosh will select a listening socket for # write if you let it. What might this mean? def writable(self): return not self.accepting else: def writable(self): return True # ================================================== # socket object methods. # ================================================== def listen(self, num): self.accepting = 1 if os.name == 'nt' and num > 5: num = 1 ret = self.socket.listen(num) self.add_channel() return ret def bind(self, addr): self.addr = addr return self.socket.bind(addr) def connect(self, address): self.connected = 0 err = self.socket.connect_ex(address) # XXX Should interpret Winsock return values if err in (EINPROGRESS, EALREADY, EWOULDBLOCK): return if err in (0, EISCONN): self.add_channel() self.addr = address self.connected = 1 self.handle_connect() else: raise socket.error, err def accept(self): # XXX can return either an address pair or None try: conn, addr = self.socket.accept() self.add_channel() return conn, addr except socket.error, why: if why[0] == EWOULDBLOCK: pass else: raise socket.error, why def send(self, data): try: result = self.socket.send(data) return result except socket.error, why: if why[0] == EWOULDBLOCK: return 0 else: raise socket.error, why return 0 def recv(self, buffer_size): try: data = self.socket.recv(buffer_size) if not data: # a closed connection is indicated by signaling # a read condition, and having recv() return 0. self.handle_close() return '' else: return data except socket.error, why: # winsock sometimes throws ENOTCONN if why[0] in [ECONNRESET, ENOTCONN, ESHUTDOWN]: self.handle_close() return '' else: raise socket.error, why def close(self): self.del_channel() self.socket.close() # cheap inheritance, used to pass all other attribute # references to the underlying socket object. def __getattr__(self, attr): return getattr(self.socket, attr) # log and log_info may be overridden to provide more sophisticated # logging and warning methods. In general, log is for 'hit' logging # and 'log_info' is for informational, warning and error logging. def log(self, message): sys.stderr.write('log: %s\n' % str(message)) def log_info(self, message, type='info'): if __debug__ or type != 'info': print '%s: %s' % (type, message) def handle_read_event(self): if self.accepting: # for an accepting socket, getting a read implies # that we are connected if not self.connected: self.connected = 1 self.handle_accept() elif not self.connected: self.handle_connect() self.connected = 1 self.handle_read() else: self.handle_read() def handle_write_event(self): # getting a write implies that we are connected if not self.connected: self.handle_connect() self.connected = 1 self.handle_write() def handle_expt_event(self): self.handle_expt() def handle_error(self): nil, t, v, tbinfo = compact_traceback() # sometimes a user repr method will crash. try: self_repr = repr(self) except: self_repr = '<__repr__(self) failed for object at %0x>' % id(self) self.log_info( 'uncaptured python exception, closing channel %s (%s:%s %s)' % ( self_repr, t, v, tbinfo ), 'error' ) self.close() def handle_expt(self): self.log_info('unhandled exception', 'warning') def handle_read(self): self.log_info('unhandled read event', 'warning') def handle_write(self): self.log_info('unhandled write event', 'warning') def handle_connect(self): self.log_info('unhandled connect event', 'warning') def handle_accept(self): self.log_info('unhandled accept event', 'warning') def handle_close(self): self.log_info('unhandled close event', 'warning') self.close() # --------------------------------------------------------------------------- # adds simple buffered output capability, useful for simple clients. # [for more sophisticated usage use asynchat.async_chat] # --------------------------------------------------------------------------- class dispatcher_with_send(dispatcher): def __init__(self, sock=None): dispatcher.__init__(self, sock) self.out_buffer = '' def initiate_send(self): num_sent = 0 num_sent = dispatcher.send(self, self.out_buffer[:512]) self.out_buffer = self.out_buffer[num_sent:] def handle_write(self): self.initiate_send() def writable(self): return (not self.connected) or len(self.out_buffer) def send(self, data): if self.debug: self.log_info('sending %s' % repr(data)) self.out_buffer = self.out_buffer + data self.initiate_send() # --------------------------------------------------------------------------- # used for debugging. # --------------------------------------------------------------------------- def compact_traceback(): t, v, tb = sys.exc_info() tbinfo = [] assert tb # Must have a traceback while tb: tbinfo.append(( tb.tb_frame.f_code.co_filename, tb.tb_frame.f_code.co_name, str(tb.tb_lineno) )) tb = tb.tb_next # just to be safe del tb file, function, line = tbinfo[-1] info = ' '.join(['[%s|%s|%s]' % x for x in tbinfo]) return (file, function, line), t, v, info def close_all(map=None): if map is None: map = socket_map for x in map.values(): x.socket.close() map.clear() # Asynchronous File I/O: # # After a little research (reading man pages on various unixen, and # digging through the linux kernel), I've determined that select() # isn't meant for doing asynchronous file i/o. # Heartening, though - reading linux/mm/filemap.c shows that linux # supports asynchronous read-ahead. So _MOST_ of the time, the data # will be sitting in memory for us already when we go to read it. # # What other OS's (besides NT) support async file i/o? [VMS?] # # Regardless, this is useful for pipes, and stdin/stdout... if os.name == 'posix': import fcntl class file_wrapper: # here we override just enough to make a file # look like a socket for the purposes of asyncore. def __init__(self, fd): self.fd = fd def recv(self, *args): return os.read(self.fd, *args) def send(self, *args): return os.write(self.fd, *args) read = recv write = send def close(self): return os.close(self.fd) def fileno(self): return self.fd class file_dispatcher(dispatcher): def __init__(self, fd): dispatcher.__init__(self) self.connected = 1 # set it to non-blocking mode flags = fcntl.fcntl(fd, fcntl.F_GETFL, 0) flags = flags | os.O_NONBLOCK fcntl.fcntl(fd, fcntl.F_SETFL, flags) self.set_file(fd) def set_file(self, fd): self._fileno = fd self.socket = file_wrapper(fd) self.add_channel()
apache-2.0
6,117,678,477,258,131,000
29.361854
78
0.540422
false
4.155404
false
false
false
pjh/vm-analyze
analyze/ip_to_fn.py
1
21352
# Virtual memory analysis scripts. # Developed 2012-2014 by Peter Hornyack, [email protected] # Copyright (c) 2012-2014 Peter Hornyack and University of Washington # This file contains methods that implement a wrapper around the # binutils "addr2line" utility, which can be used to look up instruction # pointer values in executable files and shared object files to find # the function (and sometimes the source code file + line number) that # contains the ip. # Note that each instance of "addr2line -e /path/to/binary..." will load # that entire binary into memory while it runs; this is annoying for # enormous binaries like firefox's libxul.so. from util.pjh_utils import * from analyze.vm_mapping_class import UNKNOWN_FN import fcntl import os import shlex import subprocess import sys import time cache_addr2line_lookups = True # With caching disabled, less memory will be consumed, but it will take # 14 minutes to analyze the function lookups of a firefox trace. With # caching enabled, the analysis only takes 2 minutes. addr2line_prog = '/usr/bin/addr2line' file_prog = '/usr/bin/file' linux_code_startaddr = int("0x400000", 16) # On x86_64 Linux anyway, all non-relocatable executables are loaded # into virtual address space at this address, I believe. # Given the filename of an executable file or a shared object file, # determines if the file is relocatable. All shared object files should # be relocatable, and most executable files are non-relocatable, but it # is possible to build "position independent executables" (see the "-fpic" # and "-pie" flags in gcc(1)). # # This method is intended to be used when determining function names # from instruction pointers using addr2line: if the file is relocatable, # then an absolute ip should have the address of the file's memory mapping # subtracted from it before passing it to addr2line. If the file is not # relocatable, then the absolute ip can be passed directly to addr2line. # Note that this method must create a child subprocess to check the file, # so try not to call it too often. # # Returns: True/False if object file is relocatable or not, or None if an # error occurred. def is_objfile_relocatable(name): tag = 'is_objfile_relocatable' global file_prog # Command line that I think makes sense: # file -e apptype -e ascii -e encoding -e tokens -e cdf -e elf -e tar # -bn <filename> # This should return one of the following strings, indicating that the # file is relocatable or not: # ELF 64-bit LSB shared object, x86-64, version 1 (SYSV) # ELF 64-bit LSB executable, x86-64, version 1 (SYSV) # (even position-independent executables will be described as "shared # object"). filecmd = ("{} -e apptype -e ascii -e encoding -e tokens -e cdf " "-e elf -e tar -bn {}").format(file_prog, name) # don't use -p flag, so that output will *always* have two lines fileargs = shlex.split(filecmd) print_debug(tag, ("fileargs: {}").format(fileargs)) p = subprocess.Popen(fileargs, stdout=subprocess.PIPE, stderr=subprocess.STDOUT) if not p: print_error(tag, "Popen failed for command {}".format(filecmd)) return None # communicate() will wait for the process to terminate and will # read its output. A "timeout" arg was added for Python 3.3, but # verbena is only running 3.2.3 right now, so hope that the process # will always terminate. (out, err) = p.communicate() #retcode = p.poll() # unnecessary, I think #retcode = p.wait() # unnecessary, I think retcode = p.returncode if retcode is None: print_error(tag, ("unexpected: got a None retcode - subprocess " "has not terminated yet?!").format()) return None elif retcode != 0: print_error(tag, ("file command returned a non-zero error code: " "{}").format(retcode)) return None if out: # Convert from bytes back to string: out = out.decode('utf-8').strip() else: print_error(tag, "got no output from file subprocess") return None if err: err = err.decode('utf-8').strip() else: err = '' print_debug(tag, ("call to file subprocess succeeded, got stdout " "{} and stderr {}").format(out, err)) # It's probably not necessary to define the expected output strings # so strictly here, but this will cause an error if we ever e.g. # move to a different architecture, at which point we can double- # check this code to make sure it makes sense for non-x86-64. # Ah, I already found one thing that's not consistent: some files # are "version 1 (SYSV)", others are "version 1 (GNU/Linux)". reloc_str = 'ELF 64-bit LSB shared object, x86-64, version 1' nonreloc_str = 'ELF 64-bit LSB executable, x86-64, version 1' if reloc_str in out: print_debug(tag, ("relocatable: {}").format(reloc_str)) return True elif nonreloc_str in out: print_debug(tag, ("nonrelocatable: {}").format(nonreloc_str)) return False print_error(tag, ("unexpected output \"{}\", doesn't match " "expected output from file command").format(out)) print_error(tag, ("output: {}").format(repr(out))) print_error(tag, ("reloc_str: {}").format(repr(reloc_str))) print_error(tag, ("nonreloc_str: {}").format(repr(nonreloc_str))) return None ############################################################################## # Creates an addr2line instance (subprocess) for a particular code module # (executable file or shared object file). # This class probably shouldn't be used directly; use the ip_to_fn_converter # class below instead. class addr2line_module: tag = 'addr2line_module' # Members: objname = None relocatable = None a2l = None # Popen class instance representing an addr2line subprocess cache = None def __init__(self, objname): tag = "{}.__init__".format(self.tag) if not objname: print_error_exit(tag, "must provide an object name") self.objname = objname self.tag = "addr2line_module-{}".format(objname) self.relocatable = is_objfile_relocatable(objname) if self.relocatable is None: #print_error_exit(tag, ("is_objfile_relocatable() returned " # "error, not sure how to handle gracefully inside of " # "this constructor so aborting.").format()) print_error(tag, ("is_objfile_relocatable() returned " "error, not sure how to handle gracefully inside of " "this constructor so aborting...").format()) return None elif self.relocatable is True: print_debug(tag, ("determined that object file {} is " "relocatable, will subtract vma_start_addr from ips " "passed to this addr2line_module").format(objname)) else: print_debug(tag, ("determined that object file {} is " "not relocatable, will use absolute ips that are passed " "to this addr2line_module").format(objname)) ret = self.start_addr2line() if ret != 0: print_error_exit(tag, ("failed to start addr2line " "subprocess").format()) self.cache = dict() return # Returns: the fn corresponding to this ip if it is found in the # cache map, or None if not found. def cache_lookup(self, ip): tag = "{}.cache_lookup".format(self.tag) try: fn = self.cache[ip] except KeyError: return None return fn # Inserts the specified ip, fn pair into the addr2line "cache" for # this module. # "Cache" isn't quite the right term, as nothing is ever evicted; # it's just a dictionary... def cache_insert(self, ip, fn): tag = "{}.cache_insert".format(self.tag) try: fn = self.cache[ip] print_error_exit(tag, ("unexpected: already a cache entry " "for ip {} -> {}").format(hex(ip), fn)) except KeyError: self.cache[ip] = fn print_debug(tag, ("cache insert {} -> {}").format(hex(ip), fn)) return # Passes the specified ip to addr2line and returns the function that # it corresponds to, if found. # ip should be a base-10 integer! # Returns: the function name if addr2line was able to lookup the ip # successfully, or '' if addr2line was unsuccessful. Returns None # on error. def ip_to_fn(self, ip, vma_start_addr): tag = "{}.ip_to_fn".format(self.tag) global linux_code_startaddr global cache_addr2line_lookups if not self.a2l: print_debug(tag, ("self.a2l is None, addr2line subprocess " "is already terminated (or was never started)").format()) return None if type(ip) != int: print_error(tag, ("ip argument {} is not an int").format(ip)) return None if vma_start_addr is None or type(vma_start_addr) != int: print_error(tag, ("invalid vma_start_addr: {}").format( vma_start_addr)) return None # For relocatable object files, we must subtract the vma start # addr (the address where the file was mapped into the process' # address space) from the ip, which is assumed to be an absolute # ip from an execution's userstacktrace. For non-relocatable # executables, we directly use the absolute ip. if self.relocatable: #print_debug(tag, ("file {} is relocatable, so subtracting " # "vma_start_addr {} from absolute ip {} to get ip for " # "addr2line function lookup: {}").format(self.objname, # hex(vma_start_addr), hex(ip), hex(ip - vma_start_addr))) if vma_start_addr > ip: print_error_exit(tag, ("unexpected: vma_start_addr {} " "> ip {}").format(hex(vma_start_addr), hex(ip))) ip -= vma_start_addr else: #print_debug(tag, ("file {} is not relocatable, so directly " # "using absolute ip {} and ignoring vma_start_addr " # "{}").format(self.objname, hex(ip), hex(vma_start_addr))) if vma_start_addr != linux_code_startaddr: print_error_exit(tag, ("file is non-relocatable, but " "its start addr {} doesn't match expected value for " "64-bit Linux, {} - is this expected?").format( hex(vma_start_addr), hex(linux_code_startaddr))) # See if we've already looked up this ip for this module. # Important: this must come after the ip is offset for relocatable # modules; ip must not change between now and when it is inserted # into the cache below. if cache_addr2line_lookups: cache_lookup_ip = ip # for sanity checking fn = self.cache_lookup(ip) if fn: print_debug(tag, ("cache hit: ip {} -> fn '{}'").format( hex(ip), fn)) else: print_debug(tag, ("cache miss: ip {}").format(hex(ip))) # Communicate with addr2line process if cache lookups are disabled # or the cache lookup just missed. if not cache_addr2line_lookups or fn is None: # Stupidly, it appears that Python's subprocess module can't # be used to communicate multiple times with an interactive # subprocess. # http://docs.python.org/3/library/subprocess.html#subprocess.Popen.communicate # http://stackoverflow.com/questions/3065060/communicate-multiple-times-with-a-process-without-breaking-the-pipe # http://stackoverflow.com/questions/375427/non-blocking-read-on-a-subprocess-pipe-in-python # http://stackoverflow.com/questions/11457931/running-an-interactive-command-from-within-python # It appears that the subprocess' stdin and stdout can just be # written and read directly instead. It appears that the input # string written to stdin must be converted to bytes first, and # then any output read from stdout must be converted from a byte # string back to a standard str as well. #print_debug(tag, ("addr2line: lookup ip {} in object file " # "{}").format(hex(ip), self.objname)) ip_input = """{} """.format(hex(ip)) # send Enter keypress: to enter in vim insert mode, hit # Ctrl-v first self.a2l.stdin.write(bytearray(ip_input, 'utf-8')) #print_debug(tag, "a2l.stdin.write returned") # Read the output from addr2line: # http://docs.python.org/3/tutorial/inputoutput.html#methods-of-file-objects # If self.a2l.stdout.readline() is used to read lines of output # here, then after reading all of the lines, the next call to # readline() will block forever. A possible workaround is to # always just call readline() exactly twice, since that's what # we expect addr2line's output to be, but this seems fragile. # Instead, can we just call read(), which will read "the entire # contents of the file"? This will block as well, since there # is no EOF at the end of the output. According to some stack # overflow answer for providing non-blocking reads in Python, # we may be able to use the fcntl module to mark file # descriptors as non-blocking. # http://stackoverflow.com/a/1810703/1230197 # This seems to work a little better, although now the problem # is that after writing to stdin, the python script here will # likely attempt to read stdout before addr2line has had a # chance to write to it. The problem is that we want to block # <a little bit>, but not forever... # Fragile but working solution: keep reading until two newlines # have been encountered, or until the process has terminated. # As far as I can tell addr2line will always return two lines # of output when started with the "-Cif" flags, even if # gibberish input is provided. # $ addr2line -e test-programs/hello-world -Cif # 1234 # ?? # ??:0 # 0x4006d9 # _start # ??:0 fd = self.a2l.stdout.fileno() flags = fcntl.fcntl(fd, fcntl.F_GETFL) fcntl.fcntl(fd, fcntl.F_SETFL, flags | os.O_NONBLOCK) output = "" linecount = 0 loopcount = 0 while linecount < 2: # In practice, it looks like this loop may run one or more # times (e.g. 41 times) without reading anything from # self.a2l.stdout, but then when there is data available # for reading, it is all available at once (both lines that # we expect). bytestr = self.a2l.stdout.read() if bytestr and len(bytestr) > 0: buf = bytestr.decode('utf-8') output += buf linecount = len(output.splitlines()) if False: # When this code is enabled and stderr is set to # subprocess.PIPE when self.a2l if Popen'd, it # didn't seem to help - stderr.read() here never # ever returns. bytestrerr = self.a2l.stderr.read() if bytestrerr and len(bytestrerr) > 0: buf = bytestrerr.decode('utf-8') output += buf linecount = len(output.splitlines()) print_error_exit(tag, ("stderr.read(): output={}, " "linecount={}").format(output, linecount)) print_error_exit(tag, ("BUMMER: this code was broken for " "some reason after upgrading from Ubuntu 12.04 to 13.04 " "(or something else broke it, but I'm not sure what); " "perhaps due to python3 upgrade, or maybe a change to " "addr2line. In the loop below, the stdout.read() never " "actually returns anything, and we will just loop " "here forever.").format()) loopcount += 1 if loopcount % 50000 == 0: # Lookup time appears to depend on the size of the object # file, which makes sense I guess; for a test lookup in # my version of libc, I saw loopcount up to 10,000. #print_debug(tag, ("loopcount is {}, checking if " # "addr2line is still alive").format(loopcount)) self.a2l.poll() if self.a2l.returncode: print_error(tag, ("addr2line subprocess has " "terminated with retcode {}, returning error " "from this fn").format(self.a2l.returncode)) return None else: print_debug(tag, ("addr2line subprocess is still " "alive, will keep looping; output buffer so far " "is {}").format(output)) pass lines = output.splitlines() # Ok, now, if addr2line was able to lookup the function name, it # should be found in the first line of output; if not, then it # should have printed "??". fn = lines[0].strip() if cache_addr2line_lookups: if ip != cache_lookup_ip: print_error_exit(tag, ("cache_insert ip {} doesn't match " "cache_lookup_ip {}").format(hex(ip), hex(cache_lookup_ip))) self.cache_insert(ip, fn) # This needs to happen for both the cache hit case and the # just-looked-it-up case. if '?' in fn: #print_debug(tag, ("got unknown fn '{}' returned from addr2line, " # "will return empty string from this fn").format(fn)) fn = '' else: #print_debug(tag, ("got fn '{}' from addr2line output {}").format( # fn, output.replace('\n', ''))) pass return fn # The user should try to remember to call this function explicitly # when done using the instance of the class, but if the user forgets, # then the destructor (__del__) should eventually perform the same # cleanup operations (i.e. terminating the addr2line process). def close(self): tag = "{}.close".format(self.tag) self.stop_addr2line() self.objname = None self.relocatable = None self.cache = None return # "private" method: # Starts an instance of the addr2line program for converting ips into # function names. Returns: 0 on success, -1 on error. def start_addr2line(self): tag = "{}.start_addr2line".format(self.tag) global addr2line_prog a2lcmd = ("{} -e {} -Cif").format(addr2line_prog, self.objname) # don't use -p flag, so that output will *always* have two lines a2largs = shlex.split(a2lcmd) print_debug(tag, ("a2largs: {}").format(a2largs)) self.a2l = subprocess.Popen(a2largs, stdin=subprocess.PIPE, stdout=subprocess.PIPE, stderr=subprocess.STDOUT) #stdout=subprocess.PIPE, stderr=subprocess.PIPE) if not self.a2l: print_error(tag, "Popen failed for command {}".format(a2lcmd)) return -1 retcode = self.a2l.poll() if retcode: print_error(tag, ("addr2line subprocess already " "terminated, this is unexpected").format()) retcode = self.a2l.wait() self.a2l = None return -1 print_debug(tag, ("started addr2line subprocess with pid " "{}").format(self.a2l.pid)) return 0 # "private" method: def stop_addr2line(self): tag = "{}.stop_addr2line".format(self.tag) if not self.a2l: print_debug(tag, ("self.a2l is None, addr2line subprocess " "is already terminated (or was never started)").format()) return # http://docs.python.org/3/library/subprocess.html#subprocess.Popen.communicate print_debug(tag, ("sending Ctrl-d to addr2line subprocess {} to " "terminate it").format(self.a2l.pid)) stop_input = '' # Ctrl-d: hit Ctrl-v first in vim insert mode to 'type' this # special key #(out, err) = self.a2l.communicate(input=stop_input) (out, err) = self.a2l.communicate( input=bytearray(stop_input, 'utf-8')) # does stop_input need to be converted to bytes?? Docs appear to # say so, but code examples don't... if self.a2l.returncode is None: print_error_exit(tag, ("communicate() returned, but returncode " "is not set yet!").format()) elif self.a2l.returncode != 0: print_warning(tag, ("terminated addr2line subprocess returned " "error code {}").format(self.a2l.returncode)) else: print_debug(tag, ("addr2line subprocess terminated " "successfully").format()) self.a2l = None return def __del__(self): tag = "{}.__del__".format(self.tag) if self.a2l: self.stop_addr2line() return ############################################################################## # Converts instruction pointers to function names. # Uses one addr2line_module object per file that we perform lookups in. class ip_to_fn_converter: tag = 'ip_to_fn_converter' # Members: a2lmap = None def __init__(self): tag = "{}.__init__".format(self.tag) self.a2lmap = dict() return # Attempts to lookup the specified instruction pointer in the specified # file (executable file or shared object file). vma_start_addr should # be the address (as an int) where the file was mapped into the address # space when the ip was captured. If this address is unknown, then # setting it to 0 will likely still work for non-relocatable executable # files, but the lookup will likely fail (or worse, succeed incorrectly) # for relocatable object files or position-independent executables. # Returns: function name on success, empty string '' if the lookup # failed, or None if there was an error. def lookup(self, objname, ip, vma_start_addr): tag = "{}.lookup".format(self.tag) if (not objname or not ip or type(objname) != str or type(ip) != int or len(objname) == 0 or vma_start_addr is None or type(vma_start_addr) != int): print_error(tag, ("invalid argument: objname {} must be a " "non-empty string, ip {} must be an int, vma_start_addr " "must be an int").format(objname, ip, vma_start_addr)) return None # We keep one addr2line_module object per file: try: a2l = self.a2lmap[objname] print_debug(tag, ("got an existing addr2line instance for " "objname {}").format(objname)) except KeyError: print_debug(tag, ("creating a new addr2line instance for " "objname {}").format(objname)) a2l = addr2line_module(objname) if not a2l: print_error(tag, ("addr2line_module constructor " "failed, just returning {}").format(UNKNOWN_FN)) return UNKNOWN_FN self.a2lmap[objname] = a2l return a2l.ip_to_fn(ip, vma_start_addr) def close(self): tag = "{}.close".format(self.tag) for a2l in self.a2lmap.values(): a2l.close() self.a2lmap = None return def __del__(self): tag = "{}.__del__".format(self.tag) if self.a2lmap: self.close() return if __name__ == '__main__': print("Cannot run stand-alone") sys.exit(1)
bsd-3-clause
8,448,444,619,364,010,000
37.747731
117
0.678344
false
3.225865
true
false
false
lampertb/RPIAFIB
Software/afib_lib.py
1
4157
import sys import numpy as np from scipy import signal # For testing import csv defaultWindowSize=120 defaultMinSNR=2 defaultNoisePercentage=10 defaultSampleRate=250 #The find peaks function takes in an array of data #It returns an array of the peak locations after running the wavelet transform def findPeaks(dataArray, windowSize=defaultWindowSize): peakIndex=signal.find_peaks_cwt(dataArray, np.arange(1, windowSize), min_snr=defaultMinSNR, noise_perc=defaultNoisePercentage) #print peakIndex return peakIndex #Calcuate the time interval between samples def getRR(peakIndex, sampleRate=defaultSampleRate): rr_data = [] for i in range(0, len(peakIndex)-1): diff = peakIndex[i+1]-peakIndex[i] #print "peak1 {0} - peak2 {1} Diff {2}".format(peakIndex[i+1], peakIndex[i], diff) timeDelay = diff/float(sampleRate) #Get the time difference between samples rr_data.append(timeDelay) #sum+=timeDelay #create an average #print "Sum {0}, len {1}".format(sum, len(peakIndex)) return rr_data #AFib Detection Algorithm from scipy.stats import norm def Fib_Detection( x , seglen = 128): N = len(x) tprmean = 0.65625; tprvar = 0.001369222 # TPR mean and variance from rozinn database afstats = {}; afstats['avg'] = []; afstats['rmssd'] = []; afstats['tpr'] = []; afstats['se'] = []; afstats['tprstat'] = []; afstats['count'] = []; for i in range (0,N-seglen+1): perc = i/N*100 j = 0 segment = x[i:i+seglen] #******************** Remove 16 outlier ******************************** #* In the outlier removal, 8 maximum and 8 minimum values are discarded #*********************************************************************** segment_outlier = segment[:] for j in range (0,8): segment_outlier.remove(max(segment_outlier)) segment_outlier.remove(min(segment_outlier)) #print segment #print segment_outlier # Get mean afstats['avg'].append(np.mean(segment)) # RMSSD difference = np.subtract(segment_outlier[2:seglen-16], segment_outlier[1:seglen-17]) afstats['rmssd'].append(np.sqrt(np.sum(np.power(difference, 2))/(seglen-17))/afstats['avg'][i-1]) # TPR j = 0 for k in range (1,seglen-1): if ((segment[k]-segment[k-1])*(segment[k]-segment[k+1])>0): j = j+1 afstats['tpr'].append(j/(seglen-2.0)) # Shannon Entropy seg_max = np.max(segment_outlier) seg_min = np.min(segment_outlier) step = (seg_max-seg_min)/16.0; entropy = 0; if (step!=0): group1 = [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0] for j in range(0,112): z = int(np.around((segment_outlier[j]-seg_min)/step)) group1[z] = group1[z]+1 group1 = np.divide(group1,np.sum(group1)+0.0) for j in range (0,16): if (group1[j]>0): entropy = entropy+group1[j]*np.log(group1[j]) afstats['se'].append(entropy/-2.7726) # Compute the afstats afstats['tprstat'].append(norm.cdf(afstats['tpr'][i-1], tprmean, np.sqrt(tprvar))); if(afstats['rmssd'][i-1]>=0.1 and afstats['tprstat'][i-1]>0.0001 and afstats['tprstat'][i-1] <= 0.9999 and afstats['se'][i-1] >=0.7): afstats['count'].append(1) else: afstats['count'].append(0) return afstats #AFib Detection from ECG file def afib_dect(): inputFile="0403_Normal_tiny.csv" ECG=[] with open(inputFile,'rb') as csvfile: reader = csv.DictReader(csvfile) for row in reader: ECG.append(float(row['ECG'])) data=np.asarray(ECG) peakIndex=findPeaks(data, 200) rr_data = getRR(peakIndex) afstats = Fib_Detection(rr_data) # Print result to result.txt file outputFile = "result.txt" result = "%d"%sum(afstats['count']); fp = open(outputFile, 'r+') fp.write(result); fp.close() return sum(afstats['count']) > 1 afib_dect();
mit
1,566,503,293,678,278,400
32.256
141
0.577099
false
3.212519
false
false
false
eubr-bigsea/tahiti
migrations/versions/38745782554d_adding_missing_port_interfaces.py
1
5671
# -*- coding: utf-8 -*-} """Adding missing port interfaces Revision ID: 38745782554d Revises: b2b823fe47b1 Create Date: 2017-06-07 15:16:30.224298 """ from alembic import op from sqlalchemy import Integer, String from sqlalchemy.sql import table, column, text # revision identifiers, used by Alembic. revision = '38745782554d' down_revision = 'b2b823fe47b1' branch_labels = None depends_on = None data = [ (34, 5), (55, 1), (56, 1), (57, 11), (37, 2), (37, 18), # (46, 2), # (46, 18), (63, 1), (64, 1), (73, 19), (100, 2), (100, 19), (161, 17) ] def upgrade(): try: op.execute(text('START TRANSACTION')) insert_operation_port_interface() insert_operation_port_interface_translation() insert_operation_port_interface_operation_port() insert_operation_platform() insert_operation_translation() except: op.execute(text('ROLLBACK')) raise def insert_operation_translation(): tb = table( 'operation_translation', column('id', Integer), column('locale', String), column('name', String), column('description', String), ) columns = ('id', 'locale', 'name', 'description') rows_data = [ (73, 'en', 'Regression Model', 'Regression Model'), (73, 'pt', 'Modelo de Regressão', 'Modelo de Regressão'), (74, 'en', 'Isotonic Regression', 'Isotonic Regression'), (74, 'pt', 'Regressão Isotônica', 'Regressão Isotônica'), (75, 'en', 'One Hot Encoder', 'One hot encoding transforms categorical ' 'features to a format that works better with ' 'classification and regression algorithms.'), (75, 'pt', 'One Hot Encoder', 'One Hot encoding é uma transformação que fazemos nos ' 'dados para representarmos uma variável categórica de ' 'forma binária (indica presença ou ausência de um valor).'), (76, 'en', 'AFT Survival Regression', 'Accelerated Failure Time (AFT) Model Survival Regression'), (76, 'pt', 'Regressão AFT Survival', 'Accelerated Failure Time (AFT) Model Survival Regression'), (77, 'en', 'GBT Regressor', 'Gradient-Boosted Trees (GBTs) learning algorithm for ' 'regression. It supports both continuous and categorical featur'), (77, 'pt', 'Regressor GBT', 'Gradient-Boosted Trees (GBTs) learning algorithm for ' 'regression. It supports both continuous and categorical feature'), (78, 'en', 'Random Forest Regressor', 'Random Forest learning algorithm for regression. ' 'It supports both continuous and categorical features.'), (78, 'pt', 'Regressor Random Forest', 'Random Forest learning algorithm for regression. ' 'It supports both continuous and categorical features.'), (79, 'en', 'Generalized Linear Regressor', 'Generalized Linear Regressor'), (79, 'pt', 'Regressor Linear Generalizado', 'Regressor Linear Generalizado'), ] rows = [dict(list(zip(columns, row))) for row in rows_data] op.bulk_insert(tb, rows) def insert_operation_platform(): tb = table( 'operation_platform', column('operation_id', Integer), column('platform_id', Integer), ) columns = ('operation_id', 'platform_id') rows_data = [ (73, 1), (74, 1), (75, 1), (76, 1), (77, 1), (78, 1), (79, 1), ] rows = [dict(list(zip(columns, row))) for row in rows_data] op.bulk_insert(tb, rows) def insert_operation_port_interface(): tb = table( 'operation_port_interface', column('id', Integer), column('color', String), ) columns = ('id', 'color') interface_data = [ (19, '#AACC22') ] rows = [dict(list(zip(columns, row))) for row in interface_data] op.bulk_insert(tb, rows) def insert_operation_port_interface_translation(): tb = table( 'operation_port_interface_translation', column('id', Integer), column('locale', String), column('name', String), ) columns = ('id', 'locale', 'name') interface_data = [ (19, 'pt', 'Visualização'), (19, 'en', 'Visualization'), ] rows = [dict(list(zip(columns, row))) for row in interface_data] op.bulk_insert(tb, rows) def insert_operation_port_interface_operation_port(): tb = table( 'operation_port_interface_operation_port', column('operation_port_id', Integer), column('operation_port_interface_id', Integer), ) columns = ('operation_port_id', 'operation_port_interface_id') rows = [dict(list(zip(columns, row))) for row in data] op.bulk_insert(tb, rows) def downgrade(): try: for d in data: op.execute( text('DELETE FROM ' 'operation_port_interface_operation_port ' 'WHERE operation_port_id = {} ' ' AND operation_port_interface_id = {}'.format(*d))) op.execute(text('DELETE FROM operation_port_interface_translation ' 'WHERE id = 19')) op.execute(text('DELETE FROM operation_port_interface ' 'WHERE id = 19')) op.execute(text('DELETE FROM operation_platform ' 'WHERE operation_id BETWEEN 73 AND 79')) op.execute(text('DELETE FROM operation_translation ' 'WHERE id BETWEEN 73 AND 79')) except: op.execute(text('ROLLBACK')) raise
apache-2.0
7,238,215,253,415,339,000
28.915344
76
0.582773
false
3.744371
false
false
false
Barrog/C4-Datapack
data/jscript/quests/329_CuriosityOfDwarf/__init__.py
1
2487
# Made by Mr. - Version 0.3 by DrLecter import sys from net.sf.l2j.gameserver.model.quest import State from net.sf.l2j.gameserver.model.quest import QuestState from net.sf.l2j.gameserver.model.quest.jython import QuestJython as JQuest GOLEM_HEARTSTONE = 1346 BROKEN_HEARTSTONE = 1365 ADENA = 57 class Quest (JQuest) : def __init__(self,id,name,descr): JQuest.__init__(self,id,name,descr) def onEvent (self,event,st) : htmltext = event if event == "7437-03.htm" : st.set("cond","1") st.setState(STARTED) st.playSound("ItemSound.quest_accept") elif event == "7437-06.htm" : st.exitQuest(1) st.playSound("ItemSound.quest_finish") return htmltext def onTalk (Self,npc,st) : npcId = npc.getNpcId() htmltext = "<html><head><body>I have nothing to say you</body></html>" id = st.getState() if id == CREATED : st.set("cond","0") if int(st.get("cond"))==0 : if st.getPlayer().getLevel() >= 33 : htmltext = "7437-02.htm" else: htmltext = "7437-01.htm" st.exitQuest(1) else : heart=st.getQuestItemsCount(GOLEM_HEARTSTONE) broken=st.getQuestItemsCount(BROKEN_HEARTSTONE) if broken+heart>0 : st.giveItems(ADENA,50*broken+1000*heart) st.takeItems(BROKEN_HEARTSTONE,-1) st.takeItems(GOLEM_HEARTSTONE,-1) htmltext = "7437-05.htm" else: htmltext = "7437-04.htm" return htmltext def onKill (self,npc,st): npcId = npc.getNpcId() n = st.getRandom(100) if npcId == 85 : if n<5 : st.giveItems(GOLEM_HEARTSTONE,1) st.playSound("ItemSound.quest_itemget") elif n<58 : st.giveItems(BROKEN_HEARTSTONE,1) st.playSound("ItemSound.quest_itemget") elif npcId == 83 : if n<6 : st.giveItems(GOLEM_HEARTSTONE,1) st.playSound("ItemSound.quest_itemget") elif n<56 : st.giveItems(BROKEN_HEARTSTONE,1) st.playSound("ItemSound.quest_itemget") return QUEST = Quest(329,"329_CuriosityOfDwarf","Curiosity Of Dwarf") CREATED = State('Start', QUEST) STARTED = State('Started', QUEST) COMPLETED = State('Completed', QUEST) QUEST.setInitialState(CREATED) QUEST.addStartNpc(7437) CREATED.addTalkId(7437) STARTED.addTalkId(7437) STARTED.addKillId(83) STARTED.addKillId(85) STARTED.addQuestDrop(85,BROKEN_HEARTSTONE,1) STARTED.addQuestDrop(85,GOLEM_HEARTSTONE,1) print "importing quests: 329: Curiosity Of Dwarf"
gpl-2.0
4,741,307,329,138,383,000
27.918605
74
0.650985
false
2.729967
false
false
false
skuda/client-python
kubernetes/client/models/v1beta1_role_ref.py
1
4581
# coding: utf-8 """ Kubernetes No description provided (generated by Swagger Codegen https://github.com/swagger-api/swagger-codegen) OpenAPI spec version: v1.6.1 Generated by: https://github.com/swagger-api/swagger-codegen.git """ from pprint import pformat from six import iteritems import re class V1beta1RoleRef(object): """ NOTE: This class is auto generated by the swagger code generator program. Do not edit the class manually. """ def __init__(self, api_group=None, kind=None, name=None): """ V1beta1RoleRef - a model defined in Swagger :param dict swaggerTypes: The key is attribute name and the value is attribute type. :param dict attributeMap: The key is attribute name and the value is json key in definition. """ self.swagger_types = { 'api_group': 'str', 'kind': 'str', 'name': 'str' } self.attribute_map = { 'api_group': 'apiGroup', 'kind': 'kind', 'name': 'name' } self._api_group = api_group self._kind = kind self._name = name @property def api_group(self): """ Gets the api_group of this V1beta1RoleRef. APIGroup is the group for the resource being referenced :return: The api_group of this V1beta1RoleRef. :rtype: str """ return self._api_group @api_group.setter def api_group(self, api_group): """ Sets the api_group of this V1beta1RoleRef. APIGroup is the group for the resource being referenced :param api_group: The api_group of this V1beta1RoleRef. :type: str """ if api_group is None: raise ValueError("Invalid value for `api_group`, must not be `None`") self._api_group = api_group @property def kind(self): """ Gets the kind of this V1beta1RoleRef. Kind is the type of resource being referenced :return: The kind of this V1beta1RoleRef. :rtype: str """ return self._kind @kind.setter def kind(self, kind): """ Sets the kind of this V1beta1RoleRef. Kind is the type of resource being referenced :param kind: The kind of this V1beta1RoleRef. :type: str """ if kind is None: raise ValueError("Invalid value for `kind`, must not be `None`") self._kind = kind @property def name(self): """ Gets the name of this V1beta1RoleRef. Name is the name of resource being referenced :return: The name of this V1beta1RoleRef. :rtype: str """ return self._name @name.setter def name(self, name): """ Sets the name of this V1beta1RoleRef. Name is the name of resource being referenced :param name: The name of this V1beta1RoleRef. :type: str """ if name is None: raise ValueError("Invalid value for `name`, must not be `None`") self._name = name def to_dict(self): """ Returns the model properties as a dict """ result = {} for attr, _ in iteritems(self.swagger_types): value = getattr(self, attr) if isinstance(value, list): result[attr] = list(map( lambda x: x.to_dict() if hasattr(x, "to_dict") else x, value )) elif hasattr(value, "to_dict"): result[attr] = value.to_dict() elif isinstance(value, dict): result[attr] = dict(map( lambda item: (item[0], item[1].to_dict()) if hasattr(item[1], "to_dict") else item, value.items() )) else: result[attr] = value return result def to_str(self): """ Returns the string representation of the model """ return pformat(self.to_dict()) def __repr__(self): """ For `print` and `pprint` """ return self.to_str() def __eq__(self, other): """ Returns true if both objects are equal """ return self.__dict__ == other.__dict__ def __ne__(self, other): """ Returns true if both objects are not equal """ return not self == other
apache-2.0
-5,183,765,010,237,596,000
25.633721
105
0.531107
false
4.237743
false
false
false
DarthMaulware/EquationGroupLeaks
Leak #5 - Lost In Translation/windows/Resources/Python/Core/Lib/multiprocessing/queues.py
1
9842
# uncompyle6 version 2.9.10 # Python bytecode 2.7 (62211) # Decompiled from: Python 3.6.0b2 (default, Oct 11 2016, 05:27:10) # [GCC 6.2.0 20161005] # Embedded file name: queues.py __all__ = [ 'Queue', 'SimpleQueue', 'JoinableQueue'] import sys import os import threading import collections import time import atexit import weakref from Queue import Empty, Full import _multiprocessing from multiprocessing import Pipe from multiprocessing.synchronize import Lock, BoundedSemaphore, Semaphore, Condition from multiprocessing.util import debug, info, Finalize, register_after_fork from multiprocessing.forking import assert_spawning class Queue(object): def __init__(self, maxsize=0): if maxsize <= 0: maxsize = _multiprocessing.SemLock.SEM_VALUE_MAX self._maxsize = maxsize self._reader, self._writer = Pipe(duplex=False) self._rlock = Lock() self._opid = os.getpid() if sys.platform == 'win32': self._wlock = None else: self._wlock = Lock() self._sem = BoundedSemaphore(maxsize) self._after_fork() if sys.platform != 'win32': register_after_fork(self, Queue._after_fork) return def __getstate__(self): assert_spawning(self) return ( self._maxsize, self._reader, self._writer, self._rlock, self._wlock, self._sem, self._opid) def __setstate__(self, state): self._maxsize, self._reader, self._writer, self._rlock, self._wlock, self._sem, self._opid = state self._after_fork() def _after_fork(self): debug('Queue._after_fork()') self._notempty = threading.Condition(threading.Lock()) self._buffer = collections.deque() self._thread = None self._jointhread = None self._joincancelled = False self._closed = False self._close = None self._send = self._writer.send self._recv = self._reader.recv self._poll = self._reader.poll return def put(self, obj, block=True, timeout=None): if not self._sem.acquire(block, timeout): raise Full self._notempty.acquire() try: if self._thread is None: self._start_thread() self._buffer.append(obj) self._notempty.notify() finally: self._notempty.release() return def get(self, block=True, timeout=None): if block and timeout is None: self._rlock.acquire() try: res = self._recv() self._sem.release() return res finally: self._rlock.release() else: if block: deadline = time.time() + timeout if not self._rlock.acquire(block, timeout): raise Empty try: if not self._poll(block and deadline - time.time() or 0.0): raise Empty res = self._recv() self._sem.release() return res finally: self._rlock.release() return def qsize(self): return self._maxsize - self._sem._semlock._get_value() def empty(self): return not self._poll() def full(self): return self._sem._semlock._is_zero() def get_nowait(self): return self.get(False) def put_nowait(self, obj): return self.put(obj, False) def close(self): self._closed = True self._reader.close() if self._close: self._close() def join_thread(self): debug('Queue.join_thread()') if self._jointhread: self._jointhread() def cancel_join_thread(self): debug('Queue.cancel_join_thread()') self._joincancelled = True try: self._jointhread.cancel() except AttributeError: pass def _start_thread(self): debug('Queue._start_thread()') self._buffer.clear() self._thread = threading.Thread(target=Queue._feed, args=( self._buffer, self._notempty, self._send, self._wlock, self._writer.close), name='QueueFeederThread') self._thread.daemon = True debug('doing self._thread.start()') self._thread.start() debug('... done self._thread.start()') created_by_this_process = self._opid == os.getpid() if not self._joincancelled and not created_by_this_process: self._jointhread = Finalize(self._thread, Queue._finalize_join, [ weakref.ref(self._thread)], exitpriority=-5) self._close = Finalize(self, Queue._finalize_close, [ self._buffer, self._notempty], exitpriority=10) @staticmethod def _finalize_join(twr): debug('joining queue thread') thread = twr() if thread is not None: thread.join() debug('... queue thread joined') else: debug('... queue thread already dead') return @staticmethod def _finalize_close(buffer, notempty): debug('telling queue thread to quit') notempty.acquire() try: buffer.append(_sentinel) notempty.notify() finally: notempty.release() @staticmethod def _feed(buffer, notempty, send, writelock, close): debug('starting thread to feed data to pipe') from .util import is_exiting nacquire = notempty.acquire nrelease = notempty.release nwait = notempty.wait bpopleft = buffer.popleft sentinel = _sentinel if sys.platform != 'win32': wacquire = writelock.acquire wrelease = writelock.release else: wacquire = None try: while 1: nacquire() try: if not buffer: nwait() finally: nrelease() try: while 1: obj = bpopleft() if obj is sentinel: debug('feeder thread got sentinel -- exiting') close() return if wacquire is None: send(obj) else: wacquire() try: send(obj) finally: wrelease() except IndexError: pass except Exception as e: try: if is_exiting(): info('error in queue thread: %s', e) else: import traceback traceback.print_exc() except Exception: pass return _sentinel = object() class JoinableQueue(Queue): def __init__(self, maxsize=0): Queue.__init__(self, maxsize) self._unfinished_tasks = Semaphore(0) self._cond = Condition() def __getstate__(self): return Queue.__getstate__(self) + (self._cond, self._unfinished_tasks) def __setstate__(self, state): Queue.__setstate__(self, state[:-2]) self._cond, self._unfinished_tasks = state[-2:] def put(self, obj, block=True, timeout=None): if not self._sem.acquire(block, timeout): raise Full self._notempty.acquire() self._cond.acquire() try: if self._thread is None: self._start_thread() self._buffer.append(obj) self._unfinished_tasks.release() self._notempty.notify() finally: self._cond.release() self._notempty.release() return def task_done(self): self._cond.acquire() try: if not self._unfinished_tasks.acquire(False): raise ValueError('task_done() called too many times') if self._unfinished_tasks._semlock._is_zero(): self._cond.notify_all() finally: self._cond.release() def join(self): self._cond.acquire() try: if not self._unfinished_tasks._semlock._is_zero(): self._cond.wait() finally: self._cond.release() class SimpleQueue(object): def __init__(self): self._reader, self._writer = Pipe(duplex=False) self._rlock = Lock() if sys.platform == 'win32': self._wlock = None else: self._wlock = Lock() self._make_methods() return def empty(self): return not self._reader.poll() def __getstate__(self): assert_spawning(self) return ( self._reader, self._writer, self._rlock, self._wlock) def __setstate__(self, state): self._reader, self._writer, self._rlock, self._wlock = state self._make_methods() def _make_methods(self): recv = self._reader.recv racquire, rrelease = self._rlock.acquire, self._rlock.release def get(): racquire() try: return recv() finally: rrelease() self.get = get if self._wlock is None: self.put = self._writer.send else: send = self._writer.send wacquire, wrelease = self._wlock.acquire, self._wlock.release def put(obj): wacquire() try: return send(obj) finally: wrelease() self.put = put return
unlicense
1,957,727,825,150,317,600
28.47006
106
0.517578
false
4.356795
false
false
false
HackerEarth/django-allauth
allauth/socialaccount/providers/twitter/views.py
1
1820
from django.utils import simplejson from allauth.socialaccount.providers.oauth.client import OAuth from allauth.socialaccount.providers.oauth.views import (OAuthAdapter, OAuthLoginView, OAuthCallbackView) from allauth.socialaccount.models import SocialLogin, SocialAccount from allauth.utils import get_user_model from provider import TwitterProvider User = get_user_model() class TwitterAPI(OAuth): """ Verifying twitter credentials """ url = 'https://api.twitter.com/1.1/account/verify_credentials.json' def get_user_info(self): user = simplejson.loads(self.query(self.url)) return user class TwitterOAuthAdapter(OAuthAdapter): provider_id = TwitterProvider.id request_token_url = 'https://api.twitter.com/oauth/request_token' access_token_url = 'https://api.twitter.com/oauth/access_token' # Issue #42 -- this one authenticates over and over again... # authorize_url = 'https://api.twitter.com/oauth/authorize' authorize_url = 'https://api.twitter.com/oauth/authenticate' def complete_login(self, request, app, token): client = TwitterAPI(request, app.key, app.secret, self.request_token_url) extra_data = client.get_user_info() uid = extra_data['id'] user = User(username=extra_data['screen_name']) account = SocialAccount(user=user, uid=uid, provider=TwitterProvider.id, extra_data=extra_data) return SocialLogin(account) oauth_login = OAuthLoginView.adapter_view(TwitterOAuthAdapter) oauth_callback = OAuthCallbackView.adapter_view(TwitterOAuthAdapter)
mit
985,280,656,928,123,300
36.916667
75
0.636813
false
4.193548
false
false
false
skibaa/smart-sweeper
game/dbext.py
1
2811
import logging from google.appengine.ext import db from google.appengine.api import datastore_errors import cPickle logger=logging.getLogger("smartSweeper.dbext") class PickledProperty(db.Property): data_type = db.Blob def __init__(self, force_type=None, *args, **kw): self.force_type=force_type super(PickledProperty, self).__init__(*args, **kw) def validate(self, value): value = super(PickledProperty, self).validate(value) if value is not None and self.force_type and \ not isinstance(value, self.force_type): raise datastore_errors.BadValueError( 'Property %s must be of type "%s".' % (self.name, self.force_type)) return value def get_value_for_datastore(self, model_instance): value = self.__get__(model_instance, model_instance.__class__) if value is not None: return db.Text(cPickle.dumps(value)) def make_value_from_datastore(self, value): if value is not None: return cPickle.loads(str(value)) class CachedReferenceProperty(db.ReferenceProperty): def __property_config__(self, model_class, property_name): super(CachedReferenceProperty, self).__property_config__(model_class, property_name) #Just carelessly override what super made setattr(self.reference_class, self.collection_name, _CachedReverseReferenceProperty(model_class, property_name, self.collection_name)) class _CachedReverseReferenceProperty(db._ReverseReferenceProperty): def __init__(self, model, prop, collection_name): super(_CachedReverseReferenceProperty, self).__init__(model, prop) self.__prop=prop self.__collection_name = collection_name def __get__(self, model_instance, model_class): if model_instance is None: return self logger.debug("cached reverse trying") if self.__collection_name in model_instance.__dict__:# why does it get here at all? return model_instance.__dict__[self.__collection_name] logger.info("cached reverse miss %s",self.__collection_name) query=super(_CachedReverseReferenceProperty, self).__get__(model_instance, model_class) #replace the attribute on the instance res=[] for c in query: resolved_name='_RESOLVED_'+self.__prop #WARNING: using internal setattr(c, resolved_name, model_instance) res += [c] model_instance.__dict__[self.__collection_name]=res return res def __delete__ (self, model_instance): if model_instance is not None: del model_instance.__dict__[self.__collection_name]
apache-2.0
-9,060,400,630,525,390,000
37.506849
91
0.626467
false
4.291603
false
false
false
allynt/tings
T/tings/views/api/views_api_users.py
1
1138
from rest_framework import generics, permissions from django.contrib.auth.models import User # from T.tings.models.models_users import TUserProfile from T.tings.serializers.serializers_users import TUserSerializer class TUserPermission(permissions.BasePermission): """ Custom permission to only allow owners of an object to edit it. """ def has_object_permission(self, request, view, obj): # anybody can submit GET, HEAD or OPTIONS requests... if request.method in permissions.SAFE_METHODS: return True # only the admin or collection owners can submit PUT, POST, or DELETE requests... user = request.user return user.is_superuser or user == obj class TUserList(generics.ListCreateAPIView): queryset = User.objects.all() serializer_class = TUserSerializer permission_classes = (permissions.IsAuthenticatedOrReadOnly, TUserPermission,) class TUserDetail(generics.RetrieveUpdateDestroyAPIView): queryset = User.objects.all() serializer_class = TUserSerializer permission_classes = (permissions.IsAuthenticatedOrReadOnly, TUserPermission,)
mit
8,404,409,644,057,363,000
33.484848
89
0.742531
false
4.428016
false
false
false
akx/gentry
gore/api/handlers/store.py
1
1862
import base64 import json import logging import zlib from datetime import datetime from django.conf import settings from django.db import transaction from django.http import JsonResponse from django.utils.encoding import force_str from django.utils.timezone import make_aware from pytz import UTC from gore.auth import validate_auth_header from gore.excs import InvalidAuth from gore.models import Event from gore.signals import event_received from gore.utils.event_grouper import group_event logger = logging.getLogger(__name__) def store_event(request, project): try: auth_header = validate_auth_header(request, project) except InvalidAuth as ia: return JsonResponse({'error': str(ia)}, status=401) body = request.body if request.META.get('HTTP_CONTENT_ENCODING') == 'deflate': body = zlib.decompress(body) elif auth_header.get('sentry_version') == '5': # Support older versions of Raven body = zlib.decompress(base64.b64decode(body)).decode('utf8') body = json.loads(force_str(body)) timestamp = make_aware(datetime.fromtimestamp(float(auth_header['sentry_timestamp'])), timezone=UTC) with transaction.atomic(): event = Event.objects.create_from_raven(project_id=project, body=body, timestamp=timestamp) try: with transaction.atomic(): group = group_event(event.project, event) group.archived = False group.cache_values() group.save() except: # pragma: no cover logger.warning('event with ID %s could not be grouped' % event.id, exc_info=True) try: event_received.send(sender=event) except: # pragma: no cover logger.warning('event_received signal handling failed', exc_info=True) if settings.DEBUG: raise return JsonResponse({'id': event.id}, status=201)
mit
4,651,106,081,188,272,000
33.481481
104
0.6971
false
3.936575
false
false
false
django-stars/dash2011
presence/apps/shout/views.py
1
2081
import logging import json from django.shortcuts import render_to_response from django.http import Http404 from django.template import RequestContext from django.http import HttpResponse from django.http import HttpResponseRedirect from django.http import HttpResponseForbidden from django.shortcuts import redirect from django.contrib.auth.decorators import login_required from django.core.urlresolvers import reverse from django.conf import settings from django.utils.translation import ugettext_lazy as _ from shout.models import Shout from shout.forms import ShoutForm logger = logging.getLogger("presence.%s" % __name__) @login_required def shout_new(request): if request.method == "POST": form = ShoutForm(request.POST) if form.is_valid(): shout = form.save(user=request.user) logger.info('New %s shout from "%s"' % (('public', 'private')[shout.is_private], shout.user.username)) if request.is_ajax(): return HttpResponse(json.dumps({'response': 'OK'}), mimetype='application/json') return HttpResponseRedirect(reverse('shout-list')) else: if request.is_ajax(): return HttpResponse(json.dumps({'response': 'ERR', 'reason': 'Shout text is required!'}), mimetype='application/json') else: form = ShoutForm() data = { 'form': form, } return render_to_response('shout/new.html', data, RequestContext(request)) @login_required def shout_list(request): #custom manager to get non provat or privat but my shouts = Shout.objects.filter_for_user(user=request.user) data = { 'shouts': shouts, } return render_to_response('shout/list.html', data, RequestContext(request)) @login_required def shout_detail(request, shout_id): try: shout = Shout.objects.get_for_user(user=request.user, id=shout_id) except Shout.DoesNotExist: raise Http404 data = { 'shout': shout, } return render_to_response('shout/detail.html', data, RequestContext(request))
bsd-3-clause
7,593,957,745,665,859,000
31.515625
134
0.682845
false
3.882463
false
false
false
JaviMerino/lisa
libs/utils/analysis/frequency_analysis.py
1
24894
# SPDX-License-Identifier: Apache-2.0 # # Copyright (C) 2015, ARM Limited and contributors. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # """ Frequency Analysis Module """ import matplotlib.gridspec as gridspec import matplotlib.pyplot as plt import pandas as pd import pylab as pl import operator from trappy.utils import listify from devlib.utils.misc import memoized from collections import namedtuple from analysis_module import AnalysisModule # Configure logging import logging NON_IDLE_STATE = 4294967295 ResidencyTime = namedtuple('ResidencyTime', ['total', 'active']) ResidencyData = namedtuple('ResidencyData', ['label', 'residency']) class FrequencyAnalysis(AnalysisModule): """ Support for plotting Frequency Analysis data :param trace: input Trace object :type trace: :mod:`libs.utils.Trace` """ def __init__(self, trace): super(FrequencyAnalysis, self).__init__(trace) ############################################################################### # DataFrame Getter Methods ############################################################################### def _dfg_cpu_frequency_residency(self, cpu, total=True): """ Get per-CPU frequency residency, i.e. amount of time CPU `cpu` spent at each frequency. :param cpu: CPU ID :type cpu: int :param total: if true returns the "total" time, otherwise the "active" time is returned :type total: bool :returns: :mod:`pandas.DataFrame` - "total" or "active" time residency at each frequency. """ residency = self._getCPUFrequencyResidency(cpu) if not residency: return None if total: return residency.total return residency.active def _dfg_cluster_frequency_residency(self, cluster, total=True): """ Get per-Cluster frequency residency, i.e. amount of time CLUSTER `cluster` spent at each frequency. :param cluster: this can be either a single CPU ID or a list of CPU IDs belonging to a cluster or the cluster name as specified in the platform description :type cluster: str or int or list(int) :param total: if true returns the "total" time, otherwise the "active" time is returned :type total: bool :returns: :mod:`pandas.DataFrame` - "total" or "active" time residency at each frequency. """ residency = self._getClusterFrequencyResidency(cluster) if not residency: return None if total: return residency.total return residency.active ############################################################################### # Plotting Methods ############################################################################### def plotClusterFrequencies(self, title='Clusters Frequencies'): """ Plot frequency trend for all clusters. If sched_overutilized events are available, the plots will also show the intervals of time where the cluster was overutilized. :param title: user-defined plot title :type title: str """ if not self._trace.hasEvents('cpu_frequency'): logging.warn('Events [cpu_frequency] not found, plot DISABLED!') return df = self._dfg_trace_event('cpu_frequency') pd.options.mode.chained_assignment = None # Extract LITTLE and big clusters frequencies # and scale them to [MHz] if len(self._platform['clusters']['little']): lfreq = df[df.cpu == self._platform['clusters']['little'][-1]] lfreq['frequency'] = lfreq['frequency']/1e3 else: lfreq = [] if len(self._platform['clusters']['big']): bfreq = df[df.cpu == self._platform['clusters']['big'][-1]] bfreq['frequency'] = bfreq['frequency']/1e3 else: bfreq = [] # Compute AVG frequency for LITTLE cluster avg_lfreq = 0 if len(lfreq) > 0: lfreq['timestamp'] = lfreq.index lfreq['delta'] = (lfreq['timestamp'] -lfreq['timestamp'].shift()).fillna(0).shift(-1) lfreq['cfreq'] = (lfreq['frequency'] * lfreq['delta']).fillna(0) timespan = lfreq.iloc[-1].timestamp - lfreq.iloc[0].timestamp avg_lfreq = lfreq['cfreq'].sum()/timespan # Compute AVG frequency for big cluster avg_bfreq = 0 if len(bfreq) > 0: bfreq['timestamp'] = bfreq.index bfreq['delta'] = (bfreq['timestamp'] - bfreq['timestamp'].shift()).fillna(0).shift(-1) bfreq['cfreq'] = (bfreq['frequency'] * bfreq['delta']).fillna(0) timespan = bfreq.iloc[-1].timestamp - bfreq.iloc[0].timestamp avg_bfreq = bfreq['cfreq'].sum()/timespan pd.options.mode.chained_assignment = 'warn' # Setup a dual cluster plot fig, pltaxes = plt.subplots(2, 1, figsize=(16, 8)) plt.suptitle(title, y=.97, fontsize=16, horizontalalignment='center') # Plot Cluster frequencies axes = pltaxes[0] axes.set_title('big Cluster') if avg_bfreq > 0: axes.axhline(avg_bfreq, color='r', linestyle='--', linewidth=2) axes.set_ylim( (self._platform['freqs']['big'][0] - 100000)/1e3, (self._platform['freqs']['big'][-1] + 100000)/1e3 ) if len(bfreq) > 0: bfreq['frequency'].plot(style=['r-'], ax=axes, drawstyle='steps-post', alpha=0.4) else: logging.warn('NO big CPUs frequency events to plot') axes.set_xlim(self._trace.x_min, self._trace.x_max) axes.set_ylabel('MHz') axes.grid(True) axes.set_xticklabels([]) axes.set_xlabel('') self._trace.analysis.status.plotOverutilized(axes) axes = pltaxes[1] axes.set_title('LITTLE Cluster') if avg_lfreq > 0: axes.axhline(avg_lfreq, color='b', linestyle='--', linewidth=2) axes.set_ylim( (self._platform['freqs']['little'][0] - 100000)/1e3, (self._platform['freqs']['little'][-1] + 100000)/1e3 ) if len(lfreq) > 0: lfreq['frequency'].plot(style=['b-'], ax=axes, drawstyle='steps-post', alpha=0.4) else: logging.warn('NO LITTLE CPUs frequency events to plot') axes.set_xlim(self._trace.x_min, self._trace.x_max) axes.set_ylabel('MHz') axes.grid(True) self._trace.analysis.status.plotOverutilized(axes) # Save generated plots into datadir figname = '{}/{}cluster_freqs.png'\ .format(self._trace.plots_dir, self._trace.plots_prefix) pl.savefig(figname, bbox_inches='tight') logging.info('LITTLE cluster average frequency: %.3f GHz', avg_lfreq/1e3) logging.info('big cluster average frequency: %.3f GHz', avg_bfreq/1e3) return (avg_lfreq/1e3, avg_bfreq/1e3) def plotCPUFrequencyResidency(self, cpus=None, pct=False, active=False): """ Plot per-CPU frequency residency. big CPUs are plotted first and then LITTLEs. Requires the following trace events: - cpu_frequency - cpu_idle :param cpus: List of cpus. By default plot all CPUs :type cpus: list(str) :param pct: plot residencies in percentage :type pct: bool :param active: for percentage plot specify whether to plot active or total time. Default is TOTAL time :type active: bool """ if not self._trace.hasEvents('cpu_frequency'): logging.warn('Events [cpu_frequency] not found, plot DISABLED!') return if not self._trace.hasEvents('cpu_idle'): logging.warn('Events [cpu_idle] not found, plot DISABLED!') return if cpus is None: # Generate plots only for available CPUs cpufreq_data = self._dfg_trace_event('cpu_frequency') _cpus = range(cpufreq_data.cpu.max()+1) else: _cpus = listify(cpus) # Split between big and LITTLE CPUs ordered from higher to lower ID _cpus.reverse() big_cpus = [c for c in _cpus if c in self._platform['clusters']['big']] little_cpus = [c for c in _cpus if c in self._platform['clusters']['little']] _cpus = big_cpus + little_cpus # Precompute active and total time for each CPU residencies = [] xmax = 0.0 for cpu in _cpus: res = self._getCPUFrequencyResidency(cpu) residencies.append(ResidencyData('CPU{}'.format(cpu), res)) max_time = res.total.max().values[0] if xmax < max_time: xmax = max_time self._plotFrequencyResidency(residencies, 'cpu', xmax, pct, active) def plotClusterFrequencyResidency(self, clusters=None, pct=False, active=False): """ Plot the frequency residency in a given cluster, i.e. the amount of time cluster `cluster` spent at frequency `f_i`. By default, both 'big' and 'LITTLE' clusters data are plotted. Requires the following trace events: - cpu_frequency - cpu_idle :param clusters: name of the clusters to be plotted (all of them by default) :type clusters: str ot list(str) :param pct: plot residencies in percentage :type pct: bool :param active: for percentage plot specify whether to plot active or total time. Default is TOTAL time :type active: bool """ if not self._trace.hasEvents('cpu_frequency'): logging.warn('Events [cpu_frequency] not found, plot DISABLED!') return if not self._trace.hasEvents('cpu_idle'): logging.warn('Events [cpu_idle] not found, plot DISABLED!') return # Assumption: all CPUs in a cluster run at the same frequency, i.e. the # frequency is scaled per-cluster not per-CPU. Hence, we can limit the # cluster frequencies data to a single CPU if not self._trace.freq_coherency: logging.warn('Cluster frequency is not coherent, plot DISABLED!') return # Sanitize clusters if clusters is None: _clusters = self._platform['clusters'].keys() else: _clusters = listify(clusters) # Precompute active and total time for each cluster residencies = [] xmax = 0.0 for cluster in _clusters: res = self._getClusterFrequencyResidency( self._platform['clusters'][cluster.lower()]) residencies.append(ResidencyData('{} Cluster'.format(cluster), res)) max_time = res.total.max().values[0] if xmax < max_time: xmax = max_time self._plotFrequencyResidency(residencies, 'cluster', xmax, pct, active) ############################################################################### # Utility Methods ############################################################################### @memoized def _getCPUActiveSignal(self, cpu): """ Build a square wave representing the active (i.e. non-idle) CPU time, i.e.: cpu_active[t] == 1 if at least one CPU is reported to be non-idle by CPUFreq at time t cpu_active[t] == 0 otherwise :param cpu: CPU ID :type cpu: int """ if not self._trace.hasEvents('cpu_idle'): logging.warn('Events [cpu_idle] not found, ' 'cannot compute CPU active signal!') return None idle_df = self._dfg_trace_event('cpu_idle') cpu_df = idle_df[idle_df.cpu_id == cpu] cpu_active = cpu_df.state.apply( lambda s: 1 if s == NON_IDLE_STATE else 0 ) start_time = 0.0 if not self._trace.ftrace.normalized_time: start_time = self._trace.ftrace.basetime if cpu_active.index[0] != start_time: entry_0 = pd.Series(cpu_active.iloc[0] ^ 1, index=[start_time]) cpu_active = pd.concat([entry_0, cpu_active]) return cpu_active @memoized def _getClusterActiveSignal(self, cluster): """ Build a square wave representing the active (i.e. non-idle) cluster time, i.e.: cluster_active[t] == 1 if at least one CPU is reported to be non-idle by CPUFreq at time t cluster_active[t] == 0 otherwise :param cluster: list of CPU IDs belonging to a cluster :type cluster: list(int) """ cpu_active = {} for cpu in cluster: cpu_active[cpu] = self._getCPUActiveSignal(cpu) active = pd.DataFrame(cpu_active) active.fillna(method='ffill', inplace=True) # Cluster active is the OR between the actives on each CPU # belonging to that specific cluster cluster_active = reduce( operator.or_, [cpu_active.astype(int) for _, cpu_active in active.iteritems()] ) return cluster_active @memoized def _getClusterFrequencyResidency(self, cluster): """ Get a DataFrame with per cluster frequency residency, i.e. amount of time spent at a given frequency in each cluster. :param cluster: this can be either a single CPU ID or a list of CPU IDs belonging to a cluster or the cluster name as specified in the platform description :type cluster: str or int or list(int) :returns: namedtuple(ResidencyTime) - tuple of total and active time dataframes :raises: KeyError """ if not self._trace.hasEvents('cpu_frequency'): logging.warn('Events [cpu_frequency] not found, ' 'frequency residency computation not possible!') return None if not self._trace.hasEvents('cpu_idle'): logging.warn('Events [cpu_idle] not found, ' 'frequency residency computation not possible!') return None if isinstance(cluster, str): try: _cluster = self._platform['clusters'][cluster.lower()] except KeyError: logging.warn('%s cluster not found!', cluster) return None else: _cluster = listify(cluster) freq_df = self._dfg_trace_event('cpu_frequency') # Assumption: all CPUs in a cluster run at the same frequency, i.e. the # frequency is scaled per-cluster not per-CPU. Hence, we can limit the # cluster frequencies data to a single CPU. This assumption is verified # by the Trace module when parsing the trace. if len(_cluster) > 1 and not self._trace.freq_coherency: logging.warn('Cluster frequency is NOT coherent,' 'cannot compute residency!') return None cluster_freqs = freq_df[freq_df.cpu == _cluster[0]] # Compute TOTAL Time time_intervals = cluster_freqs.index[1:] - cluster_freqs.index[:-1] total_time = pd.DataFrame({ 'time': time_intervals, 'frequency': [f/1000.0 for f in cluster_freqs.iloc[:-1].frequency] }) total_time = total_time.groupby(['frequency']).sum() # Compute ACTIVE Time cluster_active = self._getClusterActiveSignal(_cluster) # In order to compute the active time spent at each frequency we # multiply 2 square waves: # - cluster_active, a square wave of the form: # cluster_active[t] == 1 if at least one CPU is reported to be # non-idle by CPUFreq at time t # cluster_active[t] == 0 otherwise # - freq_active, square wave of the form: # freq_active[t] == 1 if at time t the frequency is f # freq_active[t] == 0 otherwise available_freqs = sorted(cluster_freqs.frequency.unique()) new_idx = sorted(cluster_freqs.index.tolist() + cluster_active.index.tolist()) cluster_freqs = cluster_freqs.reindex(new_idx, method='ffill') cluster_active = cluster_active.reindex(new_idx, method='ffill') nonidle_time = [] for f in available_freqs: freq_active = cluster_freqs.frequency.apply( lambda x: 1 if x == f else 0 ) active_t = cluster_active * freq_active # Compute total time by integrating the square wave nonidle_time.append(self._trace.integrate_square_wave(active_t)) active_time = pd.DataFrame({'time': nonidle_time}, index=[f/1000.0 for f in available_freqs]) active_time.index.name = 'frequency' return ResidencyTime(total_time, active_time) def _getCPUFrequencyResidency(self, cpu): """ Get a DataFrame with per-CPU frequency residency, i.e. amount of time CPU `cpu` spent at each frequency. Both total and active times will be computed. :param cpu: CPU ID :type cpu: int :returns: namedtuple(ResidencyTime) - tuple of total and active time dataframes """ return self._getClusterFrequencyResidency(cpu) def _plotFrequencyResidencyAbs(self, axes, residency, n_plots, is_first, is_last, xmax, title=''): """ Private method to generate frequency residency plots. :param axes: axes over which to generate the plot :type axes: matplotlib.axes.Axes :param residency: tuple of total and active time dataframes :type residency: namedtuple(ResidencyTime) :param n_plots: total number of plots :type n_plots: int :param is_first: if True this is the first plot :type is_first: bool :param is_last: if True this is the last plot :type is_last: bool :param xmax: x-axes higher bound :param xmax: double :param title: title of this subplot :type title: str """ yrange = 0.4 * max(6, len(residency.total)) * n_plots residency.total.plot.barh(ax=axes, color='g', legend=False, figsize=(16, yrange)) residency.active.plot.barh(ax=axes, color='r', legend=False, figsize=(16, yrange)) axes.set_xlim(0, 1.05*xmax) axes.set_ylabel('Frequency [MHz]') axes.set_title(title) axes.grid(True) if is_last: axes.set_xlabel('Time [s]') else: axes.set_xticklabels([]) if is_first: # Put title on top of the figure. As of now there is no clean way # to make the title appear always in the same position in the # figure because figure heights may vary between different # platforms (different number of OPPs). Hence, we use annotation legend_y = axes.get_ylim()[1] axes.annotate('OPP Residency Time', xy=(0, legend_y), xytext=(-50, 45), textcoords='offset points', fontsize=18) axes.annotate('GREEN: Total', xy=(0, legend_y), xytext=(-50, 25), textcoords='offset points', color='g', fontsize=14) axes.annotate('RED: Active', xy=(0, legend_y), xytext=(50, 25), textcoords='offset points', color='r', fontsize=14) def _plotFrequencyResidencyPct(self, axes, residency_df, label, n_plots, is_first, is_last, res_type): """ Private method to generate PERCENTAGE frequency residency plots. :param axes: axes over which to generate the plot :type axes: matplotlib.axes.Axes :param residency_df: residency time dataframe :type residency_df: :mod:`pandas.DataFrame` :param label: label to be used for percentage residency dataframe :type label: str :param n_plots: total number of plots :type n_plots: int :param is_first: if True this is the first plot :type is_first: bool :param is_first: if True this is the last plot :type is_first: bool :param res_type: type of residency, either TOTAL or ACTIVE :type title: str """ # Compute sum of the time intervals duration = residency_df.time.sum() residency_pct = pd.DataFrame( {label: residency_df.time.apply(lambda x: x*100/duration)}, index=residency_df.index ) yrange = 3 * n_plots residency_pct.T.plot.barh(ax=axes, stacked=True, figsize=(16, yrange)) axes.legend(loc='lower center', ncol=7) axes.set_xlim(0, 100) axes.grid(True) if is_last: axes.set_xlabel('Residency [%]') else: axes.set_xticklabels([]) if is_first: legend_y = axes.get_ylim()[1] axes.annotate('OPP {} Residency Time'.format(res_type), xy=(0, legend_y), xytext=(-50, 35), textcoords='offset points', fontsize=18) def _plotFrequencyResidency(self, residencies, entity_name, xmax, pct, active): """ Generate Frequency residency plots for the given entities. :param residencies: :type residencies: namedtuple(ResidencyData) - tuple containing: 1) as first element, a label to be used as subplot title 2) as second element, a namedtuple(ResidencyTime) :param entity_name: name of the entity ('cpu' or 'cluster') used in the figure name :type entity_name: str :param xmax: upper bound of x-axes :type xmax: double :param pct: plot residencies in percentage :type pct: bool :param active: for percentage plot specify whether to plot active or total time. Default is TOTAL time :type active: bool """ n_plots = len(residencies) gs = gridspec.GridSpec(n_plots, 1) fig = plt.figure() figtype = "" for idx, data in enumerate(residencies): if data.residency is None: plt.close(fig) return axes = fig.add_subplot(gs[idx]) is_first = idx == 0 is_last = idx+1 == n_plots if pct and active: self._plotFrequencyResidencyPct(axes, data.residency.active, data.label, n_plots, is_first, is_last, 'ACTIVE') figtype = "_pct_active" continue if pct: self._plotFrequencyResidencyPct(axes, data.residency.total, data.label, n_plots, is_first, is_last, 'TOTAL') figtype = "_pct_total" continue self._plotFrequencyResidencyAbs(axes, data.residency, n_plots, is_first, is_last, xmax, title=data.label) figname = '{}/{}{}_freq_residency{}.png'\ .format(self._trace.plots_dir, self._trace.plots_prefix, entity_name, figtype) pl.savefig(figname, bbox_inches='tight') # vim :set tabstop=4 shiftwidth=4 expandtab
apache-2.0
-7,015,758,231,730,057,000
37.180982
98
0.555676
false
4.189498
false
false
false
cburmeister/flask-bones
app/commands.py
1
1163
from faker import Faker import click from app.database import db from app.user.models import User @click.option('--num_users', default=5, help='Number of users.') def populate_db(num_users): """Populates the database with seed data.""" fake = Faker() users = [] for _ in range(num_users): users.append( User( username=fake.user_name(), email=fake.email(), password=fake.word() + fake.word(), remote_addr=fake.ipv4() ) ) users.append( User( username='cburmeister', email='[email protected]', password='test123', remote_addr=fake.ipv4(), active=True, is_admin=True ) ) for user in users: db.session.add(user) db.session.commit() def create_db(): """Creates the database.""" db.create_all() def drop_db(): """Drops the database.""" if click.confirm('Are you sure?', abort=True): db.drop_all() def recreate_db(): """Same as running drop_db() and create_db().""" drop_db() create_db()
mit
-36,645,924,411,596,520
21.803922
64
0.536543
false
3.788274
false
false
false
rbuffat/pyidf
tests/test_shadingsite.py
1
2163
import os import tempfile import unittest import logging from pyidf import ValidationLevel import pyidf from pyidf.idf import IDF from pyidf.thermal_zones_and_surfaces import ShadingSite log = logging.getLogger(__name__) class TestShadingSite(unittest.TestCase): def setUp(self): self.fd, self.path = tempfile.mkstemp() def tearDown(self): os.remove(self.path) def test_create_shadingsite(self): pyidf.validation_level = ValidationLevel.error obj = ShadingSite() # alpha var_name = "Name" obj.name = var_name # real var_azimuth_angle = 180.0 obj.azimuth_angle = var_azimuth_angle # real var_tilt_angle = 90.0 obj.tilt_angle = var_tilt_angle # real var_starting_x_coordinate = 4.4 obj.starting_x_coordinate = var_starting_x_coordinate # real var_starting_y_coordinate = 5.5 obj.starting_y_coordinate = var_starting_y_coordinate # real var_starting_z_coordinate = 6.6 obj.starting_z_coordinate = var_starting_z_coordinate # real var_length = 7.7 obj.length = var_length # real var_height = 8.8 obj.height = var_height idf = IDF() idf.add(obj) idf.save(self.path, check=False) with open(self.path, mode='r') as f: for line in f: log.debug(line.strip()) idf2 = IDF(self.path) self.assertEqual(idf2.shadingsites[0].name, var_name) self.assertAlmostEqual(idf2.shadingsites[0].azimuth_angle, var_azimuth_angle) self.assertAlmostEqual(idf2.shadingsites[0].tilt_angle, var_tilt_angle) self.assertAlmostEqual(idf2.shadingsites[0].starting_x_coordinate, var_starting_x_coordinate) self.assertAlmostEqual(idf2.shadingsites[0].starting_y_coordinate, var_starting_y_coordinate) self.assertAlmostEqual(idf2.shadingsites[0].starting_z_coordinate, var_starting_z_coordinate) self.assertAlmostEqual(idf2.shadingsites[0].length, var_length) self.assertAlmostEqual(idf2.shadingsites[0].height, var_height)
apache-2.0
-7,739,266,213,189,500,000
31.787879
101
0.645862
false
3.581126
false
false
false
mitmedialab/MediaCloud-Web-Tools
server/views/topics/topiccreate.py
1
3535
import logging from flask import jsonify, request import flask_login import mediacloud.error from server import app, mc from server.auth import user_mediacloud_client from server.util.request import form_fields_required, api_error_handler, json_error_response, arguments_required from server.views.topics.topic import topic_summary logger = logging.getLogger(__name__) VERSION_1 = 1 COLLECTION_US_TOP_ONLINE = 58722749 @app.route('/api/topics/create', methods=['PUT']) @flask_login.login_required @form_fields_required('name', 'description', 'solr_seed_query', 'start_date', 'end_date') @api_error_handler def topic_create(): user_mc = user_mediacloud_client() name = request.form['name'] description = request.form['description'] solr_seed_query = request.form['solr_seed_query'] start_date = request.form['start_date'] end_date = request.form['end_date'] optional_args = { 'max_iterations': request.form['max_iterations'] if 'max_iterations' in request.form and request.form['max_iterations'] != 'null' else None, 'max_stories': request.form['max_stories'] if 'max_stories' in request.form and request.form['max_stories'] != 'null' else flask_login.current_user.profile['limits']['max_topic_stories'], } try: topic_result = user_mc.topicCreate(name=name, description=description, solr_seed_query=solr_seed_query, start_date=start_date, end_date=end_date, media_tags_ids=[COLLECTION_US_TOP_ONLINE], # HACK: can't save without one of these in place (for now) **optional_args, )['topics'][0] topics_id = topic_result['topics_id'] logger.info("Created new topic \"{}\" as {}".format(name, topics_id)) # if this includes any of the US-centric collections, add the retweet partisanship subtopic by default # client will either make a empty snapshot, or a spidering one return topic_summary(topics_id) except mediacloud.error.MCException as e: logging.error("Topic creation failed {}".format(name)) logging.exception(e) return json_error_response(e.message, e.status_code) except Exception as e: logging.error("Topic creation failed {}".format(name)) logging.exception(e) return json_error_response(str(e), 500) @app.route('/api/topics/name-exists', methods=['GET']) @flask_login.login_required @arguments_required('searchStr') @api_error_handler def topic_name_exists(): # Check if topic with name exists already # Have to do this in a unique method, instead of in topic_search because we need to use an admin connection # to media cloud to list all topics, but we don't want to return topics a user can't see to them. # :return: boolean indicating if topic with this name exists for not (case insensive check) search_str = request.args['searchStr'] topics_id = int(request.args['topicId']) if 'topicId' in request.args else None matching_topics = mc.topicList(name=search_str, limit=15) if topics_id: matching_topic_names = [t['name'].lower().strip() for t in matching_topics['topics'] if t['topics_id'] != topics_id] else: matching_topic_names = [t['name'].lower().strip() for t in matching_topics['topics']] name_in_use = search_str.lower() in matching_topic_names return jsonify({'nameInUse': name_in_use})
apache-2.0
-6,057,934,450,072,376,000
48.788732
195
0.660255
false
3.748674
false
false
false
jeffsilverm/presentation
whats_new_in_python_3.6/type_hints_complicated.py
1
1308
#! /usr/bin/python3.6 # -*- coding: utf-8 -*- import time import sys assert sys.version_info.major == 3 and sys.version_info.minor == 6, "Not running python 3.6, running {}".format( sys.version_info) class A(object): def __init__(self, instance_mark) -> None: self.instance_mark_A = instance_mark def af_A(self, input): return input * 2 def afo_A(self, input): return input * 4 class AA(A): def __init__(self, instance_marker) -> None: super() self.instance_marker = instance_marker def aaf_AA(self, method_input): return method_input * 20 def afo_A(self, method_input): return method_input ** 2 class B(object): def __init__(self): pass def bf_B(self, method_input): return method_input * 9 a = A("marker a") aa = AA("marker aa") print("a.af_A(4) ", a.af_A(4)) print("a.afo_A(4) ", a.afo_A(4)) print("aa.aaf_AA(4) ", aa.aaf_AA(4)) print("aa.afo_A(4) ", aa.afo_A(4)) print("a.af_A('4') ", a.af_A('4')) print("a.afo_A('4') ", a.afo_A('4')) print("aa.aaf_AA('4') ", aa.aaf_AA('4'), flush=True) try: print("aa.afo_A('4') ", aa.afo_A('4')) except TypeError as t: time.sleep(1) print("Exception TypeError was raised, as expected, when calling aa.afo_A('4'))", file=sys.stderr)
gpl-2.0
859,038,877,987,351,700
22.357143
112
0.58104
false
2.730689
false
false
false
Crowdcomputer/CC
crowdcomputer/init_db.py
1
1613
''' Created on Nov 26, 2012 @author: stefanotranquillini ''' from django.contrib.auth.models import User, Group from rest_framework.authtoken.models import Token from general.models import Application from uuid import uuid4 def init(): initAppsAndCC() def initAppsAndCC(): try: user, c = User.objects.get_or_create(username='crowdcomputer',email="[email protected]",password="this.is.spam") user.save() print "%s %s"%(user.username,c) app, c = Application.objects.get_or_create(name="crowdcomputer",url="http://www.crowdcomputer.org",user=user) if c: app.token=str(uuid4()).replace('-','') app.save() print "%s %s" %(app.name, app.token) app, c = Application.objects.get_or_create(name="bpmn",url="http://www.crowdcomputer.org",user=user) if c: app.token=str(uuid4()).replace('-','') print "%s %s" %(app.name, app.token) app.save() bpmn, c = Group.objects.get_or_create(name='bpmn') bpmn.save() except Exception, e: print e print 'exception' def createAdmin(username,password,email): try: admin, c = User.objects.get_or_create(email=email) if c: admin.set_password(password) admin.username=username admin.is_superuser = True admin.is_staff = True admin.save() print 'creato' else: admin.set_password(password) admin.save() print 'aggiornato' except Exception: print 'exception'
apache-2.0
-2,273,612,954,416,833,300
28.345455
126
0.588965
false
3.506522
false
false
false
DailyActie/Surrogate-Model
01-codes/numpy-master/numpy/matrixlib/defmatrix.py
1
34262
from __future__ import division, absolute_import, print_function __all__ = ['matrix', 'bmat', 'mat', 'asmatrix'] import sys import numpy.core.numeric as N from numpy.core.numeric import concatenate, isscalar, binary_repr, identity, asanyarray from numpy.core.numerictypes import issubdtype # make translation table _numchars = '0123456789.-+jeEL' if sys.version_info[0] >= 3: class _NumCharTable: def __getitem__(self, i): if chr(i) in _numchars: return chr(i) else: return None _table = _NumCharTable() def _eval(astr): str_ = astr.translate(_table) if not str_: raise TypeError("Invalid data string supplied: " + astr) else: return eval(str_) else: _table = [None] * 256 for k in range(256): _table[k] = chr(k) _table = ''.join(_table) _todelete = [] for k in _table: if k not in _numchars: _todelete.append(k) _todelete = ''.join(_todelete) del k def _eval(astr): str_ = astr.translate(_table, _todelete) if not str_: raise TypeError("Invalid data string supplied: " + astr) else: return eval(str_) def _convert_from_string(data): rows = data.split(';') newdata = [] count = 0 for row in rows: trow = row.split(',') newrow = [] for col in trow: temp = col.split() newrow.extend(map(_eval, temp)) if count == 0: Ncols = len(newrow) elif len(newrow) != Ncols: raise ValueError("Rows not the same size.") count += 1 newdata.append(newrow) return newdata def asmatrix(data, dtype=None): """ Interpret the input as a matrix. Unlike `matrix`, `asmatrix` does not make a copy if the input is already a matrix or an ndarray. Equivalent to ``matrix(data, copy=False)``. Parameters ---------- data : array_like Input data. dtype : data-type Data-type of the output matrix. Returns ------- mat : matrix `data` interpreted as a matrix. Examples -------- >>> x = np.array([[1, 2], [3, 4]]) >>> m = np.asmatrix(x) >>> x[0,0] = 5 >>> m matrix([[5, 2], [3, 4]]) """ return matrix(data, dtype=dtype, copy=False) def matrix_power(M, n): """ Raise a square matrix to the (integer) power `n`. For positive integers `n`, the power is computed by repeated matrix squarings and matrix multiplications. If ``n == 0``, the identity matrix of the same shape as M is returned. If ``n < 0``, the inverse is computed and then raised to the ``abs(n)``. Parameters ---------- M : ndarray or matrix object Matrix to be "powered." Must be square, i.e. ``M.shape == (m, m)``, with `m` a positive integer. n : int The exponent can be any integer or long integer, positive, negative, or zero. Returns ------- M**n : ndarray or matrix object The return value is the same shape and type as `M`; if the exponent is positive or zero then the type of the elements is the same as those of `M`. If the exponent is negative the elements are floating-point. Raises ------ LinAlgError If the matrix is not numerically invertible. See Also -------- matrix Provides an equivalent function as the exponentiation operator (``**``, not ``^``). Examples -------- >>> from numpy import linalg as LA >>> i = np.array([[0, 1], [-1, 0]]) # matrix equiv. of the imaginary unit >>> LA.matrix_power(i, 3) # should = -i array([[ 0, -1], [ 1, 0]]) >>> LA.matrix_power(np.matrix(i), 3) # matrix arg returns matrix matrix([[ 0, -1], [ 1, 0]]) >>> LA.matrix_power(i, 0) array([[1, 0], [0, 1]]) >>> LA.matrix_power(i, -3) # should = 1/(-i) = i, but w/ f.p. elements array([[ 0., 1.], [-1., 0.]]) Somewhat more sophisticated example >>> q = np.zeros((4, 4)) >>> q[0:2, 0:2] = -i >>> q[2:4, 2:4] = i >>> q # one of the three quaternion units not equal to 1 array([[ 0., -1., 0., 0.], [ 1., 0., 0., 0.], [ 0., 0., 0., 1.], [ 0., 0., -1., 0.]]) >>> LA.matrix_power(q, 2) # = -np.eye(4) array([[-1., 0., 0., 0.], [ 0., -1., 0., 0.], [ 0., 0., -1., 0.], [ 0., 0., 0., -1.]]) """ M = asanyarray(M) if len(M.shape) != 2 or M.shape[0] != M.shape[1]: raise ValueError("input must be a square array") if not issubdtype(type(n), int): raise TypeError("exponent must be an integer") from numpy.linalg import inv if n == 0: M = M.copy() M[:] = identity(M.shape[0]) return M elif n < 0: M = inv(M) n *= -1 result = M if n <= 3: for _ in range(n - 1): result = N.dot(result, M) return result # binary decomposition to reduce the number of Matrix # multiplications for n > 3. beta = binary_repr(n) Z, q, t = M, 0, len(beta) while beta[t - q - 1] == '0': Z = N.dot(Z, Z) q += 1 result = Z for k in range(q + 1, t): Z = N.dot(Z, Z) if beta[t - k - 1] == '1': result = N.dot(result, Z) return result class matrix(N.ndarray): """ matrix(data, dtype=None, copy=True) Returns a matrix from an array-like object, or from a string of data. A matrix is a specialized 2-D array that retains its 2-D nature through operations. It has certain special operators, such as ``*`` (matrix multiplication) and ``**`` (matrix power). Parameters ---------- data : array_like or string If `data` is a string, it is interpreted as a matrix with commas or spaces separating columns, and semicolons separating rows. dtype : data-type Data-type of the output matrix. copy : bool If `data` is already an `ndarray`, then this flag determines whether the data is copied (the default), or whether a view is constructed. See Also -------- array Examples -------- >>> a = np.matrix('1 2; 3 4') >>> print(a) [[1 2] [3 4]] >>> np.matrix([[1, 2], [3, 4]]) matrix([[1, 2], [3, 4]]) """ __array_priority__ = 10.0 def __new__(subtype, data, dtype=None, copy=True): if isinstance(data, matrix): dtype2 = data.dtype if (dtype is None): dtype = dtype2 if (dtype2 == dtype) and (not copy): return data return data.astype(dtype) if isinstance(data, N.ndarray): if dtype is None: intype = data.dtype else: intype = N.dtype(dtype) new = data.view(subtype) if intype != data.dtype: return new.astype(intype) if copy: return new.copy() else: return new if isinstance(data, str): data = _convert_from_string(data) # now convert data to an array arr = N.array(data, dtype=dtype, copy=copy) ndim = arr.ndim shape = arr.shape if (ndim > 2): raise ValueError("matrix must be 2-dimensional") elif ndim == 0: shape = (1, 1) elif ndim == 1: shape = (1, shape[0]) order = 'C' if (ndim == 2) and arr.flags.fortran: order = 'F' if not (order or arr.flags.contiguous): arr = arr.copy() ret = N.ndarray.__new__(subtype, shape, arr.dtype, buffer=arr, order=order) return ret def __array_finalize__(self, obj): self._getitem = False if (isinstance(obj, matrix) and obj._getitem): return ndim = self.ndim if (ndim == 2): return if (ndim > 2): newshape = tuple([x for x in self.shape if x > 1]) ndim = len(newshape) if ndim == 2: self.shape = newshape return elif (ndim > 2): raise ValueError("shape too large to be a matrix.") else: newshape = self.shape if ndim == 0: self.shape = (1, 1) elif ndim == 1: self.shape = (1, newshape[0]) return def __getitem__(self, index): self._getitem = True try: out = N.ndarray.__getitem__(self, index) finally: self._getitem = False if not isinstance(out, N.ndarray): return out if out.ndim == 0: return out[()] if out.ndim == 1: sh = out.shape[0] # Determine when we should have a column array try: n = len(index) except: n = 0 if n > 1 and isscalar(index[1]): out.shape = (sh, 1) else: out.shape = (1, sh) return out def __mul__(self, other): if isinstance(other, (N.ndarray, list, tuple)): # This promotes 1-D vectors to row vectors return N.dot(self, asmatrix(other)) if isscalar(other) or not hasattr(other, '__rmul__'): return N.dot(self, other) return NotImplemented def __rmul__(self, other): return N.dot(other, self) def __imul__(self, other): self[:] = self * other return self def __pow__(self, other): return matrix_power(self, other) def __ipow__(self, other): self[:] = self ** other return self def __rpow__(self, other): return NotImplemented def __repr__(self): s = repr(self.__array__()).replace('array', 'matrix') # now, 'matrix' has 6 letters, and 'array' 5, so the columns don't # line up anymore. We need to add a space. l = s.splitlines() for i in range(1, len(l)): if l[i]: l[i] = ' ' + l[i] return '\n'.join(l) def __str__(self): return str(self.__array__()) def _align(self, axis): """A convenience function for operations that need to preserve axis orientation. """ if axis is None: return self[0, 0] elif axis == 0: return self elif axis == 1: return self.transpose() else: raise ValueError("unsupported axis") def _collapse(self, axis): """A convenience function for operations that want to collapse to a scalar like _align, but are using keepdims=True """ if axis is None: return self[0, 0] else: return self # Necessary because base-class tolist expects dimension # reduction by x[0] def tolist(self): """ Return the matrix as a (possibly nested) list. See `ndarray.tolist` for full documentation. See Also -------- ndarray.tolist Examples -------- >>> x = np.matrix(np.arange(12).reshape((3,4))); x matrix([[ 0, 1, 2, 3], [ 4, 5, 6, 7], [ 8, 9, 10, 11]]) >>> x.tolist() [[0, 1, 2, 3], [4, 5, 6, 7], [8, 9, 10, 11]] """ return self.__array__().tolist() # To preserve orientation of result... def sum(self, axis=None, dtype=None, out=None): """ Returns the sum of the matrix elements, along the given axis. Refer to `numpy.sum` for full documentation. See Also -------- numpy.sum Notes ----- This is the same as `ndarray.sum`, except that where an `ndarray` would be returned, a `matrix` object is returned instead. Examples -------- >>> x = np.matrix([[1, 2], [4, 3]]) >>> x.sum() 10 >>> x.sum(axis=1) matrix([[3], [7]]) >>> x.sum(axis=1, dtype='float') matrix([[ 3.], [ 7.]]) >>> out = np.zeros((1, 2), dtype='float') >>> x.sum(axis=1, dtype='float', out=out) matrix([[ 3.], [ 7.]]) """ return N.ndarray.sum(self, axis, dtype, out, keepdims=True)._collapse(axis) # To update docstring from array to matrix... def squeeze(self, axis=None): """ Return a possibly reshaped matrix. Refer to `numpy.squeeze` for more documentation. Parameters ---------- axis : None or int or tuple of ints, optional Selects a subset of the single-dimensional entries in the shape. If an axis is selected with shape entry greater than one, an error is raised. Returns ------- squeezed : matrix The matrix, but as a (1, N) matrix if it had shape (N, 1). See Also -------- numpy.squeeze : related function Notes ----- If `m` has a single column then that column is returned as the single row of a matrix. Otherwise `m` is returned. The returned matrix is always either `m` itself or a view into `m`. Supplying an axis keyword argument will not affect the returned matrix but it may cause an error to be raised. Examples -------- >>> c = np.matrix([[1], [2]]) >>> c matrix([[1], [2]]) >>> c.squeeze() matrix([[1, 2]]) >>> r = c.T >>> r matrix([[1, 2]]) >>> r.squeeze() matrix([[1, 2]]) >>> m = np.matrix([[1, 2], [3, 4]]) >>> m.squeeze() matrix([[1, 2], [3, 4]]) """ return N.ndarray.squeeze(self, axis=axis) # To update docstring from array to matrix... def flatten(self, order='C'): """ Return a flattened copy of the matrix. All `N` elements of the matrix are placed into a single row. Parameters ---------- order : {'C', 'F', 'A', 'K'}, optional 'C' means to flatten in row-major (C-style) order. 'F' means to flatten in column-major (Fortran-style) order. 'A' means to flatten in column-major order if `m` is Fortran *contiguous* in memory, row-major order otherwise. 'K' means to flatten `m` in the order the elements occur in memory. The default is 'C'. Returns ------- y : matrix A copy of the matrix, flattened to a `(1, N)` matrix where `N` is the number of elements in the original matrix. See Also -------- ravel : Return a flattened array. flat : A 1-D flat iterator over the matrix. Examples -------- >>> m = np.matrix([[1,2], [3,4]]) >>> m.flatten() matrix([[1, 2, 3, 4]]) >>> m.flatten('F') matrix([[1, 3, 2, 4]]) """ return N.ndarray.flatten(self, order=order) def mean(self, axis=None, dtype=None, out=None): """ Returns the average of the matrix elements along the given axis. Refer to `numpy.mean` for full documentation. See Also -------- numpy.mean Notes ----- Same as `ndarray.mean` except that, where that returns an `ndarray`, this returns a `matrix` object. Examples -------- >>> x = np.matrix(np.arange(12).reshape((3, 4))) >>> x matrix([[ 0, 1, 2, 3], [ 4, 5, 6, 7], [ 8, 9, 10, 11]]) >>> x.mean() 5.5 >>> x.mean(0) matrix([[ 4., 5., 6., 7.]]) >>> x.mean(1) matrix([[ 1.5], [ 5.5], [ 9.5]]) """ return N.ndarray.mean(self, axis, dtype, out, keepdims=True)._collapse(axis) def std(self, axis=None, dtype=None, out=None, ddof=0): """ Return the standard deviation of the array elements along the given axis. Refer to `numpy.std` for full documentation. See Also -------- numpy.std Notes ----- This is the same as `ndarray.std`, except that where an `ndarray` would be returned, a `matrix` object is returned instead. Examples -------- >>> x = np.matrix(np.arange(12).reshape((3, 4))) >>> x matrix([[ 0, 1, 2, 3], [ 4, 5, 6, 7], [ 8, 9, 10, 11]]) >>> x.std() 3.4520525295346629 >>> x.std(0) matrix([[ 3.26598632, 3.26598632, 3.26598632, 3.26598632]]) >>> x.std(1) matrix([[ 1.11803399], [ 1.11803399], [ 1.11803399]]) """ return N.ndarray.std(self, axis, dtype, out, ddof, keepdims=True)._collapse(axis) def var(self, axis=None, dtype=None, out=None, ddof=0): """ Returns the variance of the matrix elements, along the given axis. Refer to `numpy.var` for full documentation. See Also -------- numpy.var Notes ----- This is the same as `ndarray.var`, except that where an `ndarray` would be returned, a `matrix` object is returned instead. Examples -------- >>> x = np.matrix(np.arange(12).reshape((3, 4))) >>> x matrix([[ 0, 1, 2, 3], [ 4, 5, 6, 7], [ 8, 9, 10, 11]]) >>> x.var() 11.916666666666666 >>> x.var(0) matrix([[ 10.66666667, 10.66666667, 10.66666667, 10.66666667]]) >>> x.var(1) matrix([[ 1.25], [ 1.25], [ 1.25]]) """ return N.ndarray.var(self, axis, dtype, out, ddof, keepdims=True)._collapse(axis) def prod(self, axis=None, dtype=None, out=None): """ Return the product of the array elements over the given axis. Refer to `prod` for full documentation. See Also -------- prod, ndarray.prod Notes ----- Same as `ndarray.prod`, except, where that returns an `ndarray`, this returns a `matrix` object instead. Examples -------- >>> x = np.matrix(np.arange(12).reshape((3,4))); x matrix([[ 0, 1, 2, 3], [ 4, 5, 6, 7], [ 8, 9, 10, 11]]) >>> x.prod() 0 >>> x.prod(0) matrix([[ 0, 45, 120, 231]]) >>> x.prod(1) matrix([[ 0], [ 840], [7920]]) """ return N.ndarray.prod(self, axis, dtype, out, keepdims=True)._collapse(axis) def any(self, axis=None, out=None): """ Test whether any array element along a given axis evaluates to True. Refer to `numpy.any` for full documentation. Parameters ---------- axis : int, optional Axis along which logical OR is performed out : ndarray, optional Output to existing array instead of creating new one, must have same shape as expected output Returns ------- any : bool, ndarray Returns a single bool if `axis` is ``None``; otherwise, returns `ndarray` """ return N.ndarray.any(self, axis, out, keepdims=True)._collapse(axis) def all(self, axis=None, out=None): """ Test whether all matrix elements along a given axis evaluate to True. Parameters ---------- See `numpy.all` for complete descriptions See Also -------- numpy.all Notes ----- This is the same as `ndarray.all`, but it returns a `matrix` object. Examples -------- >>> x = np.matrix(np.arange(12).reshape((3,4))); x matrix([[ 0, 1, 2, 3], [ 4, 5, 6, 7], [ 8, 9, 10, 11]]) >>> y = x[0]; y matrix([[0, 1, 2, 3]]) >>> (x == y) matrix([[ True, True, True, True], [False, False, False, False], [False, False, False, False]], dtype=bool) >>> (x == y).all() False >>> (x == y).all(0) matrix([[False, False, False, False]], dtype=bool) >>> (x == y).all(1) matrix([[ True], [False], [False]], dtype=bool) """ return N.ndarray.all(self, axis, out, keepdims=True)._collapse(axis) def max(self, axis=None, out=None): """ Return the maximum value along an axis. Parameters ---------- See `amax` for complete descriptions See Also -------- amax, ndarray.max Notes ----- This is the same as `ndarray.max`, but returns a `matrix` object where `ndarray.max` would return an ndarray. Examples -------- >>> x = np.matrix(np.arange(12).reshape((3,4))); x matrix([[ 0, 1, 2, 3], [ 4, 5, 6, 7], [ 8, 9, 10, 11]]) >>> x.max() 11 >>> x.max(0) matrix([[ 8, 9, 10, 11]]) >>> x.max(1) matrix([[ 3], [ 7], [11]]) """ return N.ndarray.max(self, axis, out, keepdims=True)._collapse(axis) def argmax(self, axis=None, out=None): """ Indexes of the maximum values along an axis. Return the indexes of the first occurrences of the maximum values along the specified axis. If axis is None, the index is for the flattened matrix. Parameters ---------- See `numpy.argmax` for complete descriptions See Also -------- numpy.argmax Notes ----- This is the same as `ndarray.argmax`, but returns a `matrix` object where `ndarray.argmax` would return an `ndarray`. Examples -------- >>> x = np.matrix(np.arange(12).reshape((3,4))); x matrix([[ 0, 1, 2, 3], [ 4, 5, 6, 7], [ 8, 9, 10, 11]]) >>> x.argmax() 11 >>> x.argmax(0) matrix([[2, 2, 2, 2]]) >>> x.argmax(1) matrix([[3], [3], [3]]) """ return N.ndarray.argmax(self, axis, out)._align(axis) def min(self, axis=None, out=None): """ Return the minimum value along an axis. Parameters ---------- See `amin` for complete descriptions. See Also -------- amin, ndarray.min Notes ----- This is the same as `ndarray.min`, but returns a `matrix` object where `ndarray.min` would return an ndarray. Examples -------- >>> x = -np.matrix(np.arange(12).reshape((3,4))); x matrix([[ 0, -1, -2, -3], [ -4, -5, -6, -7], [ -8, -9, -10, -11]]) >>> x.min() -11 >>> x.min(0) matrix([[ -8, -9, -10, -11]]) >>> x.min(1) matrix([[ -3], [ -7], [-11]]) """ return N.ndarray.min(self, axis, out, keepdims=True)._collapse(axis) def argmin(self, axis=None, out=None): """ Indexes of the minimum values along an axis. Return the indexes of the first occurrences of the minimum values along the specified axis. If axis is None, the index is for the flattened matrix. Parameters ---------- See `numpy.argmin` for complete descriptions. See Also -------- numpy.argmin Notes ----- This is the same as `ndarray.argmin`, but returns a `matrix` object where `ndarray.argmin` would return an `ndarray`. Examples -------- >>> x = -np.matrix(np.arange(12).reshape((3,4))); x matrix([[ 0, -1, -2, -3], [ -4, -5, -6, -7], [ -8, -9, -10, -11]]) >>> x.argmin() 11 >>> x.argmin(0) matrix([[2, 2, 2, 2]]) >>> x.argmin(1) matrix([[3], [3], [3]]) """ return N.ndarray.argmin(self, axis, out)._align(axis) def ptp(self, axis=None, out=None): """ Peak-to-peak (maximum - minimum) value along the given axis. Refer to `numpy.ptp` for full documentation. See Also -------- numpy.ptp Notes ----- Same as `ndarray.ptp`, except, where that would return an `ndarray` object, this returns a `matrix` object. Examples -------- >>> x = np.matrix(np.arange(12).reshape((3,4))); x matrix([[ 0, 1, 2, 3], [ 4, 5, 6, 7], [ 8, 9, 10, 11]]) >>> x.ptp() 11 >>> x.ptp(0) matrix([[8, 8, 8, 8]]) >>> x.ptp(1) matrix([[3], [3], [3]]) """ return N.ndarray.ptp(self, axis, out)._align(axis) def getI(self): """ Returns the (multiplicative) inverse of invertible `self`. Parameters ---------- None Returns ------- ret : matrix object If `self` is non-singular, `ret` is such that ``ret * self`` == ``self * ret`` == ``np.matrix(np.eye(self[0,:].size)`` all return ``True``. Raises ------ numpy.linalg.LinAlgError: Singular matrix If `self` is singular. See Also -------- linalg.inv Examples -------- >>> m = np.matrix('[1, 2; 3, 4]'); m matrix([[1, 2], [3, 4]]) >>> m.getI() matrix([[-2. , 1. ], [ 1.5, -0.5]]) >>> m.getI() * m matrix([[ 1., 0.], [ 0., 1.]]) """ M, N = self.shape if M == N: from numpy.dual import inv as func else: from numpy.dual import pinv as func return asmatrix(func(self)) def getA(self): """ Return `self` as an `ndarray` object. Equivalent to ``np.asarray(self)``. Parameters ---------- None Returns ------- ret : ndarray `self` as an `ndarray` Examples -------- >>> x = np.matrix(np.arange(12).reshape((3,4))); x matrix([[ 0, 1, 2, 3], [ 4, 5, 6, 7], [ 8, 9, 10, 11]]) >>> x.getA() array([[ 0, 1, 2, 3], [ 4, 5, 6, 7], [ 8, 9, 10, 11]]) """ return self.__array__() def getA1(self): """ Return `self` as a flattened `ndarray`. Equivalent to ``np.asarray(x).ravel()`` Parameters ---------- None Returns ------- ret : ndarray `self`, 1-D, as an `ndarray` Examples -------- >>> x = np.matrix(np.arange(12).reshape((3,4))); x matrix([[ 0, 1, 2, 3], [ 4, 5, 6, 7], [ 8, 9, 10, 11]]) >>> x.getA1() array([ 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11]) """ return self.__array__().ravel() def ravel(self, order='C'): """ Return a flattened matrix. Refer to `numpy.ravel` for more documentation. Parameters ---------- order : {'C', 'F', 'A', 'K'}, optional The elements of `m` are read using this index order. 'C' means to index the elements in C-like order, with the last axis index changing fastest, back to the first axis index changing slowest. 'F' means to index the elements in Fortran-like index order, with the first index changing fastest, and the last index changing slowest. Note that the 'C' and 'F' options take no account of the memory layout of the underlying array, and only refer to the order of axis indexing. 'A' means to read the elements in Fortran-like index order if `m` is Fortran *contiguous* in memory, C-like order otherwise. 'K' means to read the elements in the order they occur in memory, except for reversing the data when strides are negative. By default, 'C' index order is used. Returns ------- ret : matrix Return the matrix flattened to shape `(1, N)` where `N` is the number of elements in the original matrix. A copy is made only if necessary. See Also -------- matrix.flatten : returns a similar output matrix but always a copy matrix.flat : a flat iterator on the array. numpy.ravel : related function which returns an ndarray """ return N.ndarray.ravel(self, order=order) def getT(self): """ Returns the transpose of the matrix. Does *not* conjugate! For the complex conjugate transpose, use ``.H``. Parameters ---------- None Returns ------- ret : matrix object The (non-conjugated) transpose of the matrix. See Also -------- transpose, getH Examples -------- >>> m = np.matrix('[1, 2; 3, 4]') >>> m matrix([[1, 2], [3, 4]]) >>> m.getT() matrix([[1, 3], [2, 4]]) """ return self.transpose() def getH(self): """ Returns the (complex) conjugate transpose of `self`. Equivalent to ``np.transpose(self)`` if `self` is real-valued. Parameters ---------- None Returns ------- ret : matrix object complex conjugate transpose of `self` Examples -------- >>> x = np.matrix(np.arange(12).reshape((3,4))) >>> z = x - 1j*x; z matrix([[ 0. +0.j, 1. -1.j, 2. -2.j, 3. -3.j], [ 4. -4.j, 5. -5.j, 6. -6.j, 7. -7.j], [ 8. -8.j, 9. -9.j, 10.-10.j, 11.-11.j]]) >>> z.getH() matrix([[ 0. +0.j, 4. +4.j, 8. +8.j], [ 1. +1.j, 5. +5.j, 9. +9.j], [ 2. +2.j, 6. +6.j, 10.+10.j], [ 3. +3.j, 7. +7.j, 11.+11.j]]) """ if issubclass(self.dtype.type, N.complexfloating): return self.transpose().conjugate() else: return self.transpose() T = property(getT, None) A = property(getA, None) A1 = property(getA1, None) H = property(getH, None) I = property(getI, None) def _from_string(str, gdict, ldict): rows = str.split(';') rowtup = [] for row in rows: trow = row.split(',') newrow = [] for x in trow: newrow.extend(x.split()) trow = newrow coltup = [] for col in trow: col = col.strip() try: thismat = ldict[col] except KeyError: try: thismat = gdict[col] except KeyError: raise KeyError("%s not found" % (col,)) coltup.append(thismat) rowtup.append(concatenate(coltup, axis=-1)) return concatenate(rowtup, axis=0) def bmat(obj, ldict=None, gdict=None): """ Build a matrix object from a string, nested sequence, or array. Parameters ---------- obj : str or array_like Input data. Names of variables in the current scope may be referenced, even if `obj` is a string. ldict : dict, optional A dictionary that replaces local operands in current frame. Ignored if `obj` is not a string or `gdict` is `None`. gdict : dict, optional A dictionary that replaces global operands in current frame. Ignored if `obj` is not a string. Returns ------- out : matrix Returns a matrix object, which is a specialized 2-D array. See Also -------- matrix Examples -------- >>> A = np.mat('1 1; 1 1') >>> B = np.mat('2 2; 2 2') >>> C = np.mat('3 4; 5 6') >>> D = np.mat('7 8; 9 0') All the following expressions construct the same block matrix: >>> np.bmat([[A, B], [C, D]]) matrix([[1, 1, 2, 2], [1, 1, 2, 2], [3, 4, 7, 8], [5, 6, 9, 0]]) >>> np.bmat(np.r_[np.c_[A, B], np.c_[C, D]]) matrix([[1, 1, 2, 2], [1, 1, 2, 2], [3, 4, 7, 8], [5, 6, 9, 0]]) >>> np.bmat('A,B; C,D') matrix([[1, 1, 2, 2], [1, 1, 2, 2], [3, 4, 7, 8], [5, 6, 9, 0]]) """ if isinstance(obj, str): if gdict is None: # get previous frame frame = sys._getframe().f_back glob_dict = frame.f_globals loc_dict = frame.f_locals else: glob_dict = gdict loc_dict = ldict return matrix(_from_string(obj, glob_dict, loc_dict)) if isinstance(obj, (tuple, list)): # [[A,B],[C,D]] arr_rows = [] for row in obj: if isinstance(row, N.ndarray): # not 2-d return matrix(concatenate(obj, axis=-1)) else: arr_rows.append(concatenate(row, axis=-1)) return matrix(concatenate(arr_rows, axis=0)) if isinstance(obj, N.ndarray): return matrix(obj) mat = asmatrix
mit
-4,329,534,605,734,874,600
26.38769
89
0.471222
false
3.861377
false
false
false
Septima/qgis-qlrbrowser
src/QlrBrowser/mysettings/qgissettingmanager/types/bool.py
1
3112
#----------------------------------------------------------- # # QGIS setting manager is a python module to easily manage read/write # settings and set/get corresponding widgets. # # Copyright : (C) 2013 Denis Rouzaud # Email : [email protected] # #----------------------------------------------------------- # # licensed under the terms of GNU GPL 2 # # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 2 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. # # You should have received a copy of the GNU General Public License along # with this progsram; if not, write to the Free Software Foundation, Inc., # 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA. # #--------------------------------------------------------------------- from PyQt5.QtWidgets import QCheckBox from qgis.core import QgsProject from ..setting import Setting from ..setting_widget import SettingWidget from ..setting_manager import Debug class Bool(Setting): def __init__(self, name, scope, default_value, options={}): Setting.__init__(self, name, scope, default_value, bool, QgsProject.instance().readBoolEntry, QgsProject.instance().writeEntryBool, options) def check(self, value): if type(value) != bool: raise NameError("Setting %s must be a boolean." % self.name) def config_widget(self, widget): if type(widget) == QCheckBox: return CheckBoxBoolWidget(self, widget, self.options) elif hasattr(widget, "isCheckable") and widget.isCheckable(): return CheckableBoolWidget(self, widget, self.options) else: print(type(widget)) raise NameError("SettingManager does not handle %s widgets for booleans at the moment (setting: %s)" % (type(widget), self.name)) class CheckBoxBoolWidget(SettingWidget): def __init__(self, setting, widget, options): signal = widget.stateChanged SettingWidget.__init__(self, setting, widget, options, signal) def set_widget_value(self, value): if Debug: print("Bool: set_widget_value: {0}{1}".format(value, self.setting.name)) self.widget.setChecked(value) def widget_value(self): return self.widget.isChecked() class CheckableBoolWidget(SettingWidget): def __init__(self, setting, widget, options): signal = widget.clicked SettingWidget.__init__(self, setting, widget, options, signal) def set_widget_value(self, value): self.widget.setChecked(value) def widget_value(self): return self.widget.isChecked() def widget_test(self, value): print('cannot test checkable groupbox at the moment') return False
gpl-2.0
4,159,583,462,942,297,000
36.506024
148
0.643959
false
4.316227
false
false
false
vhernandez/pygtksheet
examples/complex_test.py
1
11754
import sys sys.path += ['/usr/local/lib/python2.6/dist-packages/gtk-2.0'] import gtk from gtk import gdk import pango import gtksheet from bordercombo import BorderCombo #from gtkextra import BorderCombo #import gtkextra class TestSheet(gtksheet.Sheet): def __init__(self): gtksheet.Sheet.__init__(self, 20, 20, "Test") colormap = gdk.colormap_get_system() self.default_bg_color = colormap.alloc_color("light yellow") self.default_fg_color = colormap.alloc_color("black") self.set_background(self.default_bg_color) self.set_grid(colormap.alloc_color("light blue")) for column in xrange(self.get_columns_count()): name = chr(ord("A") + column) self.column_button_add_label(column, name) self.set_column_title(column, name) self.default_font = self.style.font_desc class TestWindow(gtk.Window): def __init__(self): gtk.Window.__init__(self) status_box = gtk.HBox(spacing=1) status_box.set_border_width(0) self.location = gtk.Label("") (width, height) = self.location.size_request() self.location.set_size_request(160, height) status_box.pack_start(self.location, False) self.entry = gtk.Entry() self.entry.connect("changed", self._show_sheet_entry_cb) status_box.pack_start(self.entry) t = gtk.Toolbar() ttips = gtk.Tooltips() def add_widget_to_toolbar(widget, separator=True, tooltip=None): ti = gtk.ToolItem() ti.add(widget) if tooltip is not None: ti.set_tooltip(ttips, tooltip) t.insert(ti, -1) if separator: t.insert(gtk.SeparatorToolItem(), -1) fontbutton = gtk.FontButton() fontbutton.connect("font-set", self._font_changed_cb) add_widget_to_toolbar(fontbutton, tooltip="Change the font of the selected cells"); self.fontbutton = fontbutton items = \ (("justleft", None, "Justify selected cells to the left", gtk.STOCK_JUSTIFY_LEFT, self._justification_cb, gtk.JUSTIFY_LEFT), ("justcenter", None, "Justify selected cells to the center", gtk.STOCK_JUSTIFY_CENTER, self._justification_cb, gtk.JUSTIFY_CENTER), ("justright", None, "Justify selected cells to the right", gtk.STOCK_JUSTIFY_RIGHT, self._justification_cb, gtk.JUSTIFY_RIGHT)) for name, label, tooltip, stock_id, cb, cb_params in items: ti = gtk.Action(name, label, tooltip, stock_id) ti.connect("activate", cb, cb_params) t.insert(ti.create_tool_item(), -1) bordercombo = BorderCombo() bordercombo.connect("changed", self._border_changed_cb) add_widget_to_toolbar(bordercombo, tooltip="Change the border of the selected cells") colormap = gdk.colormap_get_system() colorbtn = gtk.ColorButton(colormap.alloc_color("black")) colorbtn.connect("color-set", self._color_changed_cb, "f") add_widget_to_toolbar(colorbtn, separator=False, tooltip="Change the foreground color of the selected cells") self.fgcolorbtn = colorbtn colorbtn = gtk.ColorButton(colormap.alloc_color("light yellow")) colorbtn.connect("color-set", self._color_changed_cb, "b") add_widget_to_toolbar(colorbtn, tooltip="Change the background color of the selected cells"); self.bgcolorbtn = colorbtn self.sheet = TestSheet() self.sheet.connect("activate", self._activate_sheet_cell_cb) self.sheet.get_entry().connect("changed", self._show_entry_cb) self.sheet.connect("changed", self._sheet_changed_cb) ws = gtk.ScrolledWindow() ws.add(self.sheet) fd = self.sheet.default_font fontbutton.set_font_name(fd.to_string()) vbox = gtk.VBox() vbox.pack_start(t, False, False, 0) vbox.pack_start(status_box, False, False, 0) vbox.pack_start(ws, True, True, 0) self.add(vbox) self.set_size_request(500,400) self.show_all() def _sheet_changed_cb(self, sheet, row, column): print "Sheet change at row: %d, column: %d" % (row, column) def _show_sheet_entry_cb(self, entry): if not entry.flags() & gtk.HAS_FOCUS: return sheet_entry = self.sheet.get_entry() text = entry.get_text() sheet_entry.set_text(text) def _show_entry_cb(self, sheet_entry, *args): if not sheet_entry.flags() & gtk.HAS_FOCUS: return text = sheet_entry.get_text() self.entry.set_text(text) def _activate_sheet_cell_cb(self, sheet, row, column): title = sheet.get_column_title(column) if title: cell = " %s:%d " % (title, row) else: cell = " ROW: %d COLUMN: %d " % (row, column) self.location.set_text(cell) # Set attributes attributes = sheet.get_attributes(row, column) if attributes: fd = attributes.font_desc if attributes.font_desc else self.sheet.default_font fgcolor = attributes.foreground bgcolor = attributes.background else: fd = self.sheet.default_font fgcolor = self.sheet.default_fg_color bgcolor = self.sheet.default_bg_color self.fontbutton.set_font_name(fd.to_string()) self.fgcolorbtn.set_color(fgcolor) self.bgcolorbtn.set_color(bgcolor) # Set entry text sheet_entry = sheet.get_entry() self.entry.props.max_length = sheet_entry.props.max_length text = sheet.cell_get_text(row, column) if text: self.entry.set_text(text) else: self.entry.set_text("") print self.sheet.props.active_cell def _font_changed_cb(self, widget): r = self.sheet.props.selected_range fd = pango.FontDescription(widget.get_font_name()) self.sheet.range_set_font(r, fd) def _justification_cb(self, widget, data=None): if data is None: return r = self.sheet.props.selected_range if r: self.sheet.range_set_justification(r, data) def _border_changed_cb(self, widget): border = widget.get_active() range = self.sheet.props.selected_range border_width = 3 self.sheet.range_set_border(range, 0, 0) if border == 1: border_mask = gtksheet.SHEET_TOP_BORDER range.rowi = range.row0 self.sheet.range_set_border(range, border_mask, border_width) elif border == 2: border_mask = gtksheet.SHEET_BOTTOM_BORDER range.row0 = range.rowi self.sheet.range_set_border(range, border_mask, border_width) elif border == 3: border_mask = gtksheet.SHEET_RIGHT_BORDER range.col0 = range.coli self.sheet.range_set_border(range, border_mask, border_width) elif border == 4: border_mask = gtksheet.SHEET_LEFT_BORDER range.coli = range.col0 self.sheet.range_set_border(range, border_mask, border_width) elif border == 5: if range.col0 == range.coli: border_mask = gtksheet.SHEET_LEFT_BORDER | gtksheet.SHEET_RIGHT_BORDER self.sheet.range_set_border(range, border_mask, border_width) else: border_mask = gtksheet.SHEET_LEFT_BORDER auxcol = range.coli range.coli = range.col0 self.sheet.range_set_border(range, border_mask, border_width) border_mask = gtksheet.SHEET_RIGHT_BORDER range.col0 = range.coli = auxcol self.sheet.range_set_border(range, border_mask, border_width) elif border == 6: if range.row0 == range.rowi: border_mask = gtksheet.SHEET_TOP_BORDER | gtksheet.SHEET_BOTTOM_BORDER self.sheet.range_set_border(range, border_mask, border_width) else: border_mask = gtksheet.SHEET_TOP_BORDER auxrow = range.rowi range.rowi = range.row0 self.sheet.range_set_border(range, border_mask, border_width) border_mask = gtksheet.SHEET_BOTTOM_BORDER range.row0 = range.rowi = auxrow self.sheet.range_set_border(range, border_mask, border_width) elif border == 7: border_mask = gtksheet.SHEET_RIGHT_BORDER | gtksheet.SHEET_LEFT_BORDER self.sheet.range_set_border(range, border_mask, border_width) elif border == 8: border_mask = gtksheet.SHEET_BOTTOM_BORDER | gtksheet.SHEET_TOP_BORDER self.sheet.range_set_border(range, border_mask, border_width) elif border == 9: self.sheet.range_set_border(range, 15, border_width) for i in xrange(range.row0, range.rowi + 1): for j in xrange(range.col0, range.coli + 1): border_mask = 15 auxrange = sheet.SheetRange(i, j, i, j) if i == range.rowi: border_mask = border_mask ^ gtksheet.SHEET_BOTTOM_BORDER if i == range.row0: border_mask = border_mask ^ gtksheet.SHEET_TOP_BORDER if j == range.coli: border_mask = border_mask ^ gtksheet.SHEET_RIGHT_BORDER if j == range.col0: border_mask = border_mask ^ gtksheet.SHEET_LEFT_BORDER if border_mask != 15: self.sheet.range_set_border(auxrange, border_mask, border_width) elif border == 10: for i in xrange(range.row0, range.rowi + 1): for j in xrange(range.col0, range.coli + 1): border_mask = 0 auxrange = gtksheet.SheetRange(i, j, i, j) if i == range.rowi: border_mask = border_mask | gtksheet.SHEET_BOTTOM_BORDER if i == range.row0: border_mask = border_mask | gtksheet.SHEET_TOP_BORDER if j == range.coli: border_mask = border_mask | gtksheet.SHEET_RIGHT_BORDER if j == range.col0: border_mask = border_mask | gtksheet.SHEET_LEFT_BORDER if border_mask != 0: self.sheet.range_set_border(auxrange, border_mask, border_width) elif border == 11: border_mask = 15 self.sheet.range_set_border(range, border_mask, border_width) def _color_changed_cb(self, widget, data=None): # Bug in GtkSheet?: the color must be allocated with the system's # colormap, else it is ignored if data is None: return color = widget.get_color() _range = self.sheet.props.selected_range if data == "f": self.sheet.range_set_foreground(_range, color) else: self.sheet.range_set_background(_range, color) def main(): w = TestWindow() w.connect("delete-event", lambda x,y: gtk.main_quit()) gtk.main() if __name__=='__main__': main()
gpl-2.0
9,136,060,946,695,285,000
39.253425
90
0.561766
false
3.80758
false
false
false
nash-x/hws
nova/huawei/scheduler/filters/disk_filter.py
1
2145
# Copyright (c) 2012 OpenStack Foundation # All Rights Reserved. # # Licensed under the Apache License, Version 2.0 (the "License"); you may # not use this file except in compliance with the License. You may obtain # a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, WITHOUT # WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. See the # License for the specific language governing permissions and limitations # under the License. import copy from nova.openstack.common.gettextutils import _ from nova.openstack.common import log as logging from nova.scheduler.filters import disk_filter from nova.huawei import utils as h_utils LOG = logging.getLogger(__name__) class HuaweiDiskFilter(disk_filter.DiskFilter): """Disk Filter with over subscription flag.""" def host_passes(self, host_state, filter_properties): """Filter based on disk usage.""" #deep copy a filter properties to avoid changing filter_properties_tmp = copy.deepcopy(filter_properties) context = filter_properties_tmp['context'] instance = filter_properties_tmp['request_spec']['instance_properties'] if h_utils.is_boot_from_volume(context, instance): # just process local disk(ephemeral and swap), so set # root_gb to zero filter_properties_tmp.get('instance_type')['root_gb'] = 0 # if the request disk size is zero, we should return true. # In negative free disk size condition, the instance booted volume # is not create successfully. instance_type = filter_properties.get('instance_type') requested_disk = (1024 * (instance_type['ephemeral_gb']) + instance_type['swap']) if requested_disk == 0: return True return super(HuaweiDiskFilter, self).host_passes(host_state, filter_properties_tmp)
apache-2.0
-566,471,726,499,216,700
39.471698
79
0.660606
false
4.41358
false
false
false
pglomski/shopnotes
drill_speed_chart.py
1
2778
#!/usr/bin/env python # -*- coding: UTF-8 -*- '''Produce a custom twist drill plot''' import numpy as np import matplotlib as mpl import matplotlib.pyplot as plt plt.rc('text', usetex=True) # set some rcParams mpl.rcParams['font.weight'] = 'bold' mpl.rcParams['xtick.major.pad'] = 10 mpl.rcParams['xtick.direction'] = 'inout' mpl.rcParams['xtick.labelsize'] = 26 mpl.rcParams['ytick.direction'] = 'inout' mpl.rcParams['ytick.labelsize'] = 20 # define the constants for our chart materials = [ ('Acrylic' , 650 , 'c' , '-' ) , ('Aluminum' , 300 , 'b' , '-' ) , ('Brass' , 200 , 'g' , '-' ) , ('LC Steel' , 110 , 'k' , '-' ) , ('Wood' , 100 , 'brown' , '-' ) , ('MC Steel' , 80 , 'darkgray' , '-' ) , ('HC Steel' , 60 , 'lightgray' , '-' ) , ('Stainless' , 50 , 'purple' , '-' ) , ] drill_speeds = [250, 340, 390, 510, 600, 650, 990, 1550, 1620, 1900, 2620, 3100] #rpm speed_lims = (200., 4000.) # rpm max_in = 1. # in. incr = 1./16. # in. im_sz = 25. # in. ratio = 8.5/11. fig = plt.figure(figsize=(im_sz,ratio * im_sz), dpi=600) fig.patch.set_alpha(0) # generate a vector of drill bit diameter x = np.array([float(i) * incr for i in range(1,int(max_in/incr) + 1)]) # in. # calculate the drill speed curve for each material type and plot the curve for name, speed, color, linestyle in materials: plt.loglog(x, 12/np.pi/x*speed, label=name, linewidth=5, color=color, linestyle=linestyle) ax = plt.gca() # adjust the axis tick locators to match drill press speeds ax.yaxis.set_major_locator(mpl.ticker.FixedLocator(drill_speeds)) ax.yaxis.set_major_formatter(mpl.ticker.FormatStrFormatter('%4d')) ax.yaxis.set_minor_locator(mpl.ticker.NullLocator()) ax.set_ylim(speed_lims) # set the drill diameter locators and format the ticks with LaTeX ax.xaxis.set_major_locator(mpl.ticker.MultipleLocator(base=incr)) ax.xaxis.set_minor_locator(mpl.ticker.NullLocator()) ax.set_xlim((incr, max_in)) ticks = ['0', r'$$\frac{1}{16}$$' , r'$$\frac{1}{8}$$' , r'$$\frac{3}{16}$$' , r'$$\frac{1}{4}$$' , r'$$\frac{5}{16}$$' , r'$$\frac{3}{8}$$' , r'$$\frac{7}{16}$$' , r'$$\frac{1}{2}$$' , r'$$\frac{9}{16}$$' , r'$$\frac{5}{8}$$' , r'$$\frac{11}{16}$$' , r'$$\frac{3}{4}$$' , r'$$\frac{13}{16}$$' , r'$$\frac{7}{8}$$' , r'$$\frac{15}{16}$$' , r'$$1$$' ] ax.xaxis.set_ticklabels(ticks) # Add the Texts plt.xlabel('Bit Diameter (in.)', fontsize=26) plt.ylabel('Drill Speed (rpm)' , fontsize=26) plt.title('Twist Drill Speeds' , fontsize=50) plt.legend(ncol=2, loc=3, fontsize=40) plt.grid('on') plt.savefig('drill_speed_chart.png')
agpl-3.0
6,025,454,394,184,277,000
35.077922
102
0.569114
false
2.603561
false
false
false
crmorse/weewx-waterflow
bin/weedb/mysql.py
1
9153
# # Copyright (c) 2012 Tom Keffer <[email protected]> # # See the file LICENSE.txt for your full rights. # # $Revision$ # $Author$ # $Date$ # """Driver for the MySQL database""" import decimal import MySQLdb import _mysql_exceptions from weeutil.weeutil import to_bool import weedb def connect(host='localhost', user='', password='', database='', driver='', **kwargs): """Connect to the specified database""" return Connection(host=host, user=user, password=password, database=database, **kwargs) def create(host='localhost', user='', password='', database='', driver='', **kwargs): """Create the specified database. If it already exists, an exception of type weedb.DatabaseExists will be thrown.""" # Open up a connection w/o specifying the database. try: connect = MySQLdb.connect(host = host, user = user, passwd = password, **kwargs) cursor = connect.cursor() # An exception will get thrown if the database already exists. try: # Now create the database. cursor.execute("CREATE DATABASE %s" % (database,)) except _mysql_exceptions.ProgrammingError: # The database already exists. Change the type of exception. raise weedb.DatabaseExists("Database %s already exists" % (database,)) finally: cursor.close() except _mysql_exceptions.OperationalError, e: raise weedb.OperationalError(e) def drop(host='localhost', user='', password='', database='', driver='', **kwargs): """Drop (delete) the specified database.""" # Open up a connection try: connect = MySQLdb.connect(host = host, user = user, passwd = password, **kwargs) cursor = connect.cursor() try: cursor.execute("DROP DATABASE %s" % database) except _mysql_exceptions.OperationalError: raise weedb.NoDatabase("""Attempt to drop non-existent database %s""" % (database,)) finally: cursor.close() except _mysql_exceptions.OperationalError, e: raise weedb.OperationalError(e) class Connection(weedb.Connection): """A wrapper around a MySQL connection object.""" def __init__(self, host='localhost', user='', password='', database='', **kwargs): """Initialize an instance of Connection. Parameters: host: IP or hostname with the mysql database (required) user: User name (required) password: The password for the username (required) database: The database to be used. (required) kwargs: Any extra arguments you may wish to pass on to MySQL (optional) If the operation fails, an exception of type weedb.OperationalError will be raised. """ try: connection = MySQLdb.connect(host=host, user=user, passwd=password, db=database, **kwargs) except _mysql_exceptions.OperationalError, e: # The MySQL driver does not include the database in the # exception information. Tack it on, in case it might be useful. raise weedb.OperationalError(str(e) + " while opening database '%s'" % (database,)) weedb.Connection.__init__(self, connection, database, 'mysql') # Allowing threads other than the main thread to see any transactions # seems to require an isolation level of READ UNCOMMITTED. self.query("SET TRANSACTION ISOLATION LEVEL READ UNCOMMITTED") def cursor(self): """Return a cursor object.""" # The implementation of the MySQLdb cursor is lame enough that we are # obliged to include a wrapper around it: return Cursor(self) def tables(self): """Returns a list of tables in the database.""" table_list = list() try: # Get a cursor directly from MySQL cursor = self.connection.cursor() cursor.execute("""SHOW TABLES;""") while True: row = cursor.fetchone() if row is None: break # Extract the table name. In case it's in unicode, convert to a regular string. table_list.append(str(row[0])) finally: cursor.close() return table_list def genSchemaOf(self, table): """Return a summary of the schema of the specified table. If the table does not exist, an exception of type weedb.OperationalError is raised.""" try: # Get a cursor directly from MySQL: cursor = self.connection.cursor() # MySQL throws an exception if you try to show the columns of a # non-existing table try: cursor.execute("""SHOW COLUMNS IN %s;""" % table) except _mysql_exceptions.ProgrammingError, e: # Table does not exist. Change the exception type: raise weedb.OperationalError(e) irow = 0 while True: row = cursor.fetchone() if row is None: break # Append this column to the list of columns. colname = str(row[0]) if row[1].upper()=='DOUBLE': coltype = 'REAL' elif row[1].upper().startswith('INT'): coltype = 'INTEGER' elif row[1].upper().startswith('CHAR'): coltype = 'STR' else: coltype = str(row[1]).upper() is_primary = True if row[3] == 'PRI' else False yield (irow, colname, coltype, to_bool(row[2]), row[4], is_primary) irow += 1 finally: cursor.close() def columnsOf(self, table): """Return a list of columns in the specified table. If the table does not exist, an exception of type weedb.OperationalError is raised.""" column_list = [row[1] for row in self.genSchemaOf(table)] return column_list def begin(self): """Begin a transaction.""" self.query("START TRANSACTION") def commit(self): try: weedb.Connection.commit(self) except _mysql_exceptions.OperationalError, e: raise weedb.OperationalError(e) def rollback(self): try: weedb.Connection.rollback(self) except _mysql_exceptions.OperationalError, e: raise weedb.OperationalError(e) def query(self, *args, **kwargs): try: self.connection.query(*args, **kwargs) except _mysql_exceptions.OperationalError, e: raise weedb.OperationalError(e) class Cursor(object): """A wrapper around the MySQLdb cursor object""" def __init__(self, connection): """Initialize a Cursor from a connection. connection: An instance of db.mysql.Connection""" # Get the MySQLdb cursor and store it internally: self.cursor = connection.connection.cursor() def execute(self, sql_string, sql_tuple=() ): """Execute a SQL statement on the MySQL server. sql_string: A SQL statement to be executed. It should use ? as a placeholder. sql_tuple: A tuple with the values to be used in the placeholders.""" # MySQL uses '%s' as placeholders, so replace the ?'s with %s mysql_string = sql_string.replace('?','%s') try: # Convert sql_tuple to a plain old tuple, just in case it actually # derives from tuple, but overrides the string conversion (as is the # case with a TimeSpan object): self.cursor.execute(mysql_string, tuple(sql_tuple)) except (_mysql_exceptions.OperationalError, _mysql_exceptions.ProgrammingError), e: raise weedb.OperationalError(e) return self def fetchone(self): # Get a result from the MySQL cursor, then run it through the massage # filter below return massage(self.cursor.fetchone()) def close(self): try: self.cursor.close() del self.cursor except: pass # # Supplying functions __iter__ and next allows the cursor to be used as an iterator. # def __iter__(self): return self def next(self): result = self.fetchone() if result is None: raise StopIteration return result # # This is a utility function for converting a result set that might contain # longs or decimal.Decimals (which MySQLdb uses) to something containing just ints. # def massage(seq): # Return the massaged sequence if it exists, otherwise, return None if seq is not None: return [int(i) if isinstance(i, long) or isinstance(i,decimal.Decimal) else i for i in seq]
gpl-3.0
4,721,289,113,010,788,000
36.979253
102
0.579919
false
4.629742
false
false
false
papaloizouc/peacehack
peacehack/theapp/migrations/0001_initial.py
1
5492
# -*- coding: utf-8 -*- from __future__ import unicode_literals from django.db import models, migrations class Migration(migrations.Migration): dependencies = [ ] operations = [ migrations.CreateModel( name='CrazyObject', fields=[ ('id', models.AutoField(verbose_name='ID', serialize=False, auto_created=True, primary_key=True)), ('ActionGeo_ADM1Code', models.CharField(max_length=10, null=True, blank=True)), ('ActionGeo_CountryCode', models.CharField(max_length=4, null=True, blank=True)), ('ActionGeo_FeatureID', models.CharField(max_length=4, null=True, blank=True)), ('ActionGeo_FullName', models.CharField(max_length=200, null=True, blank=True)), ('ActionGeo_Lat', models.CharField(max_length=4, null=True, blank=True)), ('ActionGeo_Long', models.TextField(null=True, blank=True)), ('ActionGeo_Type', models.TextField(null=True, blank=True)), ('Actor1Code', models.TextField(null=True, blank=True)), ('Actor1CountryCode', models.TextField(null=True, blank=True)), ('Actor1EthnicCode', models.TextField(null=True, blank=True)), ('Actor1Geo_ADM1Code', models.TextField(null=True, blank=True)), ('Actor1Geo_CountryCode', models.IntegerField(null=True, blank=True)), ('Actor1Geo_FeatureID', models.IntegerField(null=True, blank=True)), ('Actor1Geo_FullName', models.TextField(null=True, blank=True)), ('Actor1Geo_Lat', models.TextField(null=True, blank=True)), ('Actor1Geo_Long', models.TextField(null=True, blank=True)), ('Actor1Geo_Type', models.IntegerField(null=True, blank=True)), ('Actor1KnownGroupCode', models.CharField(max_length=4, null=True, blank=True)), ('Actor1Name', models.TextField(null=True, blank=True)), ('Actor1Religion1Code', models.CharField(max_length=4, null=True, blank=True)), ('Actor1Religion2Code', models.CharField(max_length=4, null=True, blank=True)), ('Actor1Type1Code', models.CharField(max_length=4, null=True, blank=True)), ('Actor1Type2Code', models.CharField(max_length=4, null=True, blank=True)), ('Actor1Type3Code', models.CharField(max_length=4, null=True, blank=True)), ('Actor2Code', models.CharField(max_length=4, null=True, blank=True)), ('Actor2CountryCode', models.CharField(max_length=4, null=True, blank=True)), ('Actor2EthnicCode', models.CharField(max_length=4, null=True, blank=True)), ('Actor2Geo_ADM1Code', models.CharField(max_length=4, null=True, blank=True)), ('Actor2Geo_CountryCode', models.CharField(max_length=4, null=True, blank=True)), ('Actor2Geo_FeatureID', models.IntegerField(null=True, blank=True)), ('Actor2Geo_FullName', models.TextField(null=True, blank=True)), ('Actor2Geo_Lat', models.TextField(null=True, blank=True)), ('Actor2Geo_Long', models.TextField(null=True, blank=True)), ('Actor2Geo_Type', models.IntegerField(null=True, blank=True)), ('Actor2KnownGroupCode', models.CharField(max_length=4, null=True, blank=True)), ('Actor2Name', models.TextField(null=True, blank=True)), ('Actor2Religion1Code', models.CharField(max_length=4, null=True, blank=True)), ('Actor2Religion2Code', models.CharField(max_length=4, null=True, blank=True)), ('Actor2Type1Code', models.CharField(max_length=4, null=True, blank=True)), ('Actor2Type2Code', models.CharField(max_length=4, null=True, blank=True)), ('Actor2Type3Code', models.CharField(max_length=4, null=True, blank=True)), ('AvgTone', models.TextField(null=True, blank=True)), ('DATEADDED', models.IntegerField(null=True, blank=True)), ('EventBaseCode', models.IntegerField(null=True, blank=True)), ('EventCode', models.IntegerField(null=True, blank=True)), ('EventRootCode', models.IntegerField(null=True, blank=True)), ('FractionDate', models.TextField(null=True, blank=True)), ('GLOBALEVENTID', models.IntegerField(null=True, blank=True)), ('GoldsteinScale', models.TextField(null=True, blank=True)), ('IsRootEvent', models.IntegerField(null=True, blank=True)), ('MonthYear', models.IntegerField(null=True, blank=True)), ('NumArticles', models.IntegerField(null=True, blank=True)), ('NumMentions', models.IntegerField(null=True, blank=True)), ('NumSources', models.IntegerField(null=True, blank=True)), ('QuadClass', models.IntegerField(null=True, blank=True)), ('SOURCEURL', models.TextField(null=True, blank=True)), ('SQLDATE', models.IntegerField(null=True, blank=True)), ('Year', models.IntegerField(null=True, blank=True)), ('Day', models.IntegerField(null=True, blank=True)), ('Month', models.IntegerField(null=True, blank=True)), ], options={ }, bases=(models.Model,), ), ]
gpl-2.0
5,515,570,037,667,942,000
65.97561
114
0.599417
false
3.922857
false
false
false
ashishtilokani/Cloaking-Detection-Tool
googleBot/googleBot/spiders/scrape2.py
1
1236
from scrapy.selector import HtmlXPathSelector from scrapy.spider import Spider import html2text import re import os.path class scrape(Spider): name = "googleBot2" start_urls = [] with open('/home/ashish/Desktop/CloakingDetectionTool/url.txt','r') as f: for line in f: l=line.replace("/", "_") try: f=open('/home/ashish/Desktop/CloakingDetectionTool/c2/'+ l + '.txt','r') f.close() except: start_urls.append(line) def parse(self, response): regex = re.compile('[^A-Za-z0-9_]') #First parameter is the replacement, second parameter is your input string d={} l=(response.url).replace("/", "_") f=open('/home/ashish/Desktop/CloakingDetectionTool/c2/'+ l + '.txt','w') terms=[] terms = (response.body).split() c=0 for word in terms: word=regex.sub('', word) if word not in d: d[word]=1 f.write(word) f.write(' ') c=1 if c==0: #empty f.write(' ') f.write('\n') f.close()
mit
-6,094,454,040,259,034,000
29.146341
88
0.486246
false
3.92381
false
false
false
mprinc/McMap
src/scripts/CSN_Archive/check_object_names.py
1
4677
#!/usr/bin/env python # Copyright (c) 2015, Scott D. Peckham #------------------------------------------------------ # S.D. Peckham # July 9, 2015 # # Tool to extract the object part of every CSDMS Standard # Variable Name and generate a list of objects that # includes those as well as all parent objects. # # Example of use at a Unix prompt: # # % ./check_object_names.py CSN_VarNames_v0.82.txt #------------------------------------------------------ # # Functions: # check_objects() # #------------------------------------------------------ import os.path import sys #------------------------------------------------------ def check_objects( in_file='CSN_VarNames_v0.82.txt' ): #-------------------------------------------------- # Open input file that contains copied names table #-------------------------------------------------- try: in_unit = open( in_file, 'r' ) except: print 'SORRY: Could not open TXT file named:' print ' ' + in_file #------------------------- # Open new CSV text file #------------------------- ## pos = in_file.rfind('.') ## prefix = in_file[0:pos] ## out_file = prefix + '.ttl' out_file = 'All_Object_Names.txt' #------------------------------------------- OUT_EXISTS = os.path.exists( out_file ) if (OUT_EXISTS): print 'SORRY, A text file with the name' print ' ' + out_file print ' already exists.' return out_unit = open( out_file, 'w' ) #--------------------------- # Parse all variable names #--------------------------- n_objects = 0 object_list1 = list() object_list2 = list() while (True): #------------------------------ # Read data line from in_file #------------------------------ line = in_unit.readline() if (line == ''): break #-------------------------------------------------- # Write object and quantity fullnames to TTL file #-------------------------------------------------- line = line.strip() # (strip leading/trailing white space) main_parts = line.split('__') object_fullname = main_parts[0] # quantity_fullname = main_parts[1] #------------------------------------ # Append object name to object_list #------------------------------------ object_list1.append( object_fullname ) object_list2.append( object_fullname ) #------------------------------------------------ # Append all parent object names to object_list #------------------------------------------------ object_name = object_fullname while (True): pos = object_name.rfind('_') if (pos < 0): break object_name = object_name[:pos] object_list2.append( object_name ) #--------------------------------------------- # Create sorted lists of unique object names # Not fastest method, but simple. #--------------------------------------------- old_list = sorted( set(object_list1) ) new_list = sorted( set(object_list2) ) n_objects1 = len( old_list ) n_objects2 = len( new_list ) #-------------------------------------------- # Write complete object list to output file #-------------------------------------------- for k in xrange( n_objects2 ): out_unit.write( new_list[k] + '\n' ) #---------------------- # Close the input file #---------------------- in_unit.close() #---------------------------- # Close the TXT output file #---------------------------- out_unit.close() print 'Finished checking all object names.' print 'Number of old object names =', n_objects1, '.' print 'Number of new object names =', n_objects2, '.' print ' ' # check_objects() #------------------------------------------------------ if (__name__ == "__main__"): #----------------------------------------------------- # Note: First arg in sys.argv is the command itself. #----------------------------------------------------- n_args = len(sys.argv) if (n_args < 2): print 'ERROR: This tool requires an input' print ' text file argument.' print 'sys.argv =', sys.argv print ' ' elif (n_args == 2): check_objects( sys.argv[1] ) else: print 'ERROR: Invalid number of arguments.' #-----------------------------------------------------------------------
mit
-1,015,613,779,617,027,700
32.407143
94
0.383579
false
4.753049
false
false
false
PrFalken/exaproxy
lib/exaproxy/icap/response.py
1
2403
class ICAPResponse (object): def __init__ (self, version, code, status, headers, icap_header, http_header): self.version = version self.code = code self.status = status self.headers = headers icap_len = len(icap_header) http_len = len(http_header) icap_end = icap_len if http_header: http_len_string = '%x\n' % http_len http_string = http_len_string + http_header + '0\n' http_offset = icap_end + len(http_len_string) http_end = http_offset + http_len else: http_string = http_header http_offset = icap_end http_end = icap_end self.response_view = memoryview(icap_header + http_string) self.icap_view = self.response_view[:icap_end] self.http_view = self.response_view[http_offset:http_end] @property def response_string (self): return self.response_view.tobytes() @property def icap_header (self): return self.icap_view.tobytes() @property def http_header (self): return self.http_view.tobytes() @property def pragma (self): return self.headers.get('pragma', {}) @property def is_permit (self): return False @property def is_modify (self): return False @property def is_content (self): return False @property def is_intercept (self): return False class ICAPRequestModification (ICAPResponse): def __init__ (self, version, code, status, headers, icap_header, http_header, intercept_header=None): ICAPResponse.__init__(self, version, code, status, headers, icap_header, http_header) self.intercept_header = intercept_header @property def is_permit (self): return self.code == 304 @property def is_modify (self): return self.code == 200 and self.intercept_header is None @property def is_intercept (self): return self.code == 200 and self.intercept_header is not None class ICAPResponseModification (ICAPResponse): @property def is_content (self): return self.code == 200 class ICAPResponseFactory: def __init__ (self, configuration): self.configuration = configuration def create (self, version, code, status, headers, icap_header, request_header, response_header, intercept_header=None): if response_header: response = ICAPResponseModification(version, code, status, headers, icap_header, response_header) else: response = ICAPRequestModification(version, code, status, headers, icap_header, request_header, intercept_header=intercept_header) return response
bsd-2-clause
-2,532,343,003,033,045,000
23.520408
133
0.714524
false
3.128906
false
false
false
yoe/veyepar
dj/scripts/enc.py
1
23477
#!/usr/bin/python """ assembles raw cuts into final, titles, tweaks audio, encodes to format for upload. """ import re import os import sys import subprocess import xml.etree.ElementTree from mk_mlt import mk_mlt import pprint from process import process from main.models import Client, Show, Location, Episode, Raw_File, Cut_List class enc(process): ready_state = 2 def mk_title_svg(self, raw_svg, texts): """ Make a title slide by filling in a pre-made svg with name/authors. return: svg """ tree = xml.etree.ElementTree.XMLID(raw_svg) for key in texts: if self.options.verbose: print("looking for:", key) # tollerate template where tokens have been removed if key in tree[1]: if key == "license": # CC license image if self.options.verbose: print("found in svg:", tree[1][key]) print("replacing with:", texts[key]) t = tree[1][key] # import code; code.interact(local=locals()) if texts[key] is None: # del(tree[1][key]) # print tree[1].has_key(key) tree[1][key].clear() else: t.set('{http://www.w3.org/1999/xlink}href', texts[key]) elif key == "date": if self.options.verbose: print("found in svg:", tree[1][key].text) print("replacing with:", re.split(',',texts[key])[0]) # .encode() tree[1][key].text = re.split(',',texts[key])[0] else: if self.options.verbose: print("found in svg:", tree[1][key].text) print("replacing with:", texts[key]) # .encode() tree[1][key].text = texts[key] # cooked_svg = xml.etree.ElementTree.tostring(tree[0]) # print "testing...", "license" in cooked_svg if 'presenternames' in tree[1]: # some people like to add spiffy text near the presenter name(s) if texts['authors']: # prefix = u"Featuring" if "," in texts['authors'] else "By" # tree[1]['presenternames'].text=u"%s %s" % (prefix,texts['authors']) tree[1]['presenternames'].text = texts['authors'] else: # remove the text (there is a placholder to make editing sane) tree[1]['presenternames'].text = "" cooked_svg = xml.etree.ElementTree.tostring(tree[0]).decode('ascii') return cooked_svg def get_title_text(self, episode): # lets try putting (stuff) on a new line title = episode.name authors = episode.authors if episode.show.slug == 'write_docs_na_2016': title = title.upper() authors = authors.upper() if False and episode.show.slug != 'pygotham_2015' and len(title) > 80: # crazy long titles need all the lines title2 = '' elif ": " in title: # the space keeps 9:00 from breaking pos = title.index(":") + 1 title, title2 = title[:pos], title[pos:].strip() elif " - " in title: # error if there is more than 1. title, title2 = title.split(' - ') elif " -- " in title: # error if there is more than 1. title, title2 = title.split(' -- ') elif " (" in title: pos = title.index(" (") # +1 skip space in " (" title, title2 = title[:pos], title[pos + 1:] elif " using " in title: pos = title.index(" using ") title, title2 = title[:pos], title[pos + 1:] elif ";" in title: pos = title.index(";") + 1 title, title2 = title[:pos], title[pos:].strip() elif "? " in title: # ?(space) to not break on 'can you?' pos = title.index("?") + 1 title, title2 = title[:pos], title[pos:].strip() elif ". " in title: pos = title.index(". ") + 1 title, title2 = title[:pos], title[pos:].strip() else: title2 = "" if episode.license: license = "cc/{}.svg".format(episode.license.lower()) else: license = None if episode.tags: tags = episode.tags.split(',') tag1 = tags[0] else: tags = [] tag1 = '' """ # split authors over two objects # breaking on comma, not space. if ',' in authors: authors = authors.split(', ') author2 = ', '.join(authors[1:]) authors = authors[0].strip() else: author2 = '' """ author2 = '' date = episode.start.strftime("%B %-d, %Y") # DebConf style # date = episode.start.strftime("%Y-%m-%-d") texts = { 'client': episode.show.client.name, 'show': episode.show.name, 'title': title, 'title2': title2, 'tag1': tag1, 'authors': authors, 'author2': author2, 'presentertitle': "", 'twitter_id': episode.twitter_id, 'date': date, 'time': episode.start.strftime("%H:%M"), 'license': license, 'room': episode.location.name, } return texts def svg2png(self, svg_name, png_name, episode): """ Make a title slide png file. melt uses librsvg which doesn't support flow, wich is needed for long titles, so render it to a .png using inkscape """ # create png file # inkscape does not return an error code on failure # so clean up previous run and # check for the existance of a new png if os.path.exists(png_name): os.remove(png_name) cmd = ["inkscape", svg_name, "--export-png", png_name, # "--export-width", "720", ] ret = self.run_cmds(episode, [cmd]) ret = os.path.exists(png_name) # if self.options.verbose: print cooked_svg if self.options.verbose: print(png_name) if not ret: print("svg:", svg_name) png_name = None return png_name def mk_title(self, episode): # make a title slide # if we find titles/custom/(slug).svg, use that # else make one from the tempalte custom_svg_name = os.path.join( "..", "custom", "titles", episode.slug + ".svg") if self.options.verbose: print("custom:", custom_svg_name) abs_path = os.path.join( self.show_dir, "tmp", custom_svg_name ) if os.path.exists(abs_path): # cooked_svg_name = custom_svg_name cooked_svg_name = abs_path else: svg_name = episode.show.client.title_svg print(svg_name) template = os.path.join( os.path.split(os.path.abspath(__file__))[0], "bling", svg_name) raw_svg = open(template).read() # happy_filename = episode.slug.encode('utf-8') happy_filename = episode.slug # happy_filename = ''.join([c for c in happy_filename if c.isalpha()]) # title_base = os.path.join(self.show_dir, "titles", happy_filename) title_base = os.path.join("..", "titles", happy_filename) texts = self.get_title_text(episode) cooked_svg = self.mk_title_svg(raw_svg, texts) # save svg to a file # strip 'broken' chars because inkscape can't handle the truth # output_base=''.join([ c for c in output_base if c.isalpha()]) # output_base=''.join([ c for c in output_base if ord(c)<128]) # output_base=output_base.encode('utf-8','ignore') cooked_svg_name = os.path.join( self.show_dir, "titles", '{}.svg'.format(episode.slug)) open(cooked_svg_name, 'w').write(cooked_svg) png_name = os.path.join( "..", "titles", '{}.png'.format(episode.slug)) abs_path = os.path.join( self.show_dir, "tmp", png_name ) title_img = self.svg2png(cooked_svg_name, abs_path, episode) if title_img is None: print("missing title png") return False return png_name def get_params(self, episode, rfs, cls): """ assemble a dict of params to send to mk_mlt mlt template, title screen image, filter parameters (currently just audio) and cutlist+raw filenames """ def get_title(episode): # if we find show_dir/custom/titles/(slug).svg, use that # else make one from the tempalte custom_png_name = os.path.join( self.show_dir, "custom", "titles", episode.slug + ".png") print("custom:", custom_png_name) if os.path.exists(custom_png_name): title_img = custom_png_name else: title_img = self.mk_title(episode) return title_img def get_foot(episode): credits_img = episode.show.client.credits credits_pathname = os.path.join("..", "assets", credits_img ) return credits_pathname def get_clips(rfs, ep): """ return list of possible input files this may get the files and store them localy. start/end segments are under get_cuts. ps. this is not used for encoding, just shows in ShotCut for easy dragging onto the timeline. """ clips = [] for rf in rfs: clip = {'id': rf.id } # if rf.filename.startswith('\\'): # rawpathname = rf.filename # else: raw_pathname = os.path.join( "../dv", rf.location.slug, rf.filename) # self.episode_dir, rf.filename) # check for missing input file # typically due to incorrect fs mount abs_path = os.path.join( self.show_dir, "tmp", raw_pathname) if not os.path.exists(abs_path): print(( 'raw_pathname not found: "{}"'.format( abs_path))) return False clip['filename']=raw_pathname # trim start/end based on episode start/end if rf.start < ep.start < rf.end: # if the ep start falls durring this clip, # trim it d = ep.start - rf.start clip['in']="00:00:{}".format(d.total_seconds()) else: clip['in']=None # if "mkv" in rf.filename: # import code; code.interact(local=locals()) if rf.start < ep.end < rf.end: # if the ep end falls durring this clip, d = ep.end - rf.start clip['out']="00:00:{}".format(d.total_seconds()) else: clip['out']=None pprint.pprint(clip) clips.append(clip) return clips def get_cuts(cls): """ gets the list of cuts. input file, start, end, filters ps, does not reference the clips above. """ def hms_to_clock(hms): """ Converts what media players show h:m:s to the mlt time format h:m:s.s for more on this: http://mltframework.blogspot.com/2012/04/time-properties.html """ if not hms: return None if ":" not in hms: hms = "0:" + hms if "." not in hms: hms = hms + ".0" return hms cuts = [] for cl in cls: cut = {} cut['id'] = cl.id rawpathname = os.path.join( "../dv", cl.raw_file.location.slug, cl.raw_file.filename) # self.episode_dir, cl.raw_file.filename) # print(rawpathname) cut['filename'] = rawpathname # set start/end on the clips if they are set in the db # else None cut['in']=hms_to_clock(cl.start) cut['out']=hms_to_clock(cl.end) cut['length'] = cl.duration() if cl.episode.channelcopy: cut['channelcopy'] = cl.episode.channelcopy else: cut['channelcopy']='01' if cl.episode.normalise: cut['normalize'] = cl.episode.normalise else: cut['normalize']='-12.0' cut['video_delay']='0.0' cuts.append(cut) return cuts params = {} params['title_img'] = get_title(episode) params['foot_img'] = get_foot(episode) params['clips'] = get_clips(rfs, episode) params['cuts'] = get_cuts(cls) return params def enc_all(self, mlt_pathname, episode): def enc_one(ext): out_pathname = os.path.join( self.show_dir, ext, "%s.%s" % (episode.slug, ext)) if ext == 'webm': parms = { 'dv_format': self.options.dv_format, 'mlt': mlt_pathname, 'out': out_pathname, 'threads': self.options.threads, 'test': '', } # cmds=["melt %s -profile dv_ntsc -consumer avformat:%s progress=1 acodec=libvorbis ab=128k ar=44100 vcodec=libvpx minrate=0 b=600k aspect=@4/3 maxrate=1800k g=120 qmax=42 qmin=10"% (mlt_pathname,out_pathname,)] cmds = [ "melt -profile %(dv_format)s %(mlt)s force_aspect_ratio=@64/45 -consumer avformat:%(out)s progress=1 threads=0 ab=256k vb=2000k quality=good deadline=good deinterlace=1 deinterlace_method=yadif" % parms] if ext == 'flv': cmds = [ "melt %(mlt)s -progress -profile %(dv_format)s -consumer avformat:%(out)s progressive=1 acodec=libfaac ab=96k ar=44100 vcodec=libx264 b=110k vpre=/usr/share/ffmpeg/libx264-hq.ffpreset" % parms] if ext == 'flac': # 16kHz/mono cmds = ["melt -verbose -progress %s -consumer avformat:%s ar=16000" % (mlt_pathname, out_pathname)] if ext == 'mp3': cmds = ["melt -verbose -progress %s -consumer avformat:%s" % (mlt_pathname, out_pathname)] if ext == 'mp4': # High Quality Master 720x480 NTSC parms = { 'dv_format': self.options.dv_format, 'mlt': mlt_pathname, 'out': out_pathname, 'threads': self.options.threads, 'test': '', } cmd = "melt -verbose -progress "\ "-profile %(dv_format)s %(mlt)s "\ "-consumer avformat:%(out)s "\ "threads=%(threads)s "\ "progressive=1 "\ "strict=-2 "\ "properties=x264-high "\ "ab=256k "\ % parms cmd = cmd.split() # 2 pass causes no video track, so dumping this. # need to figure out how to switch between good and fast if False: cmds = [cmd + ['pass=1'], cmd + ['pass=2']] if True: # even faster! cmds[0].append('fastfirstpass=1') else: cmds = [cmd] # cmds.append( ["qt-faststart", tmp_pathname, out_pathname] ) if self.options.rm_temp: cmds.append(["rm", tmp_pathname]) if ext == 'm4v': # iPhone tmp_pathname = os.path.join( self.tmp_dir, "%s.%s" % (episode.slug, ext)) # combine settings from 2 files ffpreset = open( '/usr/share/ffmpeg/libx264-default.ffpreset').read().split('\n') ffpreset.extend( open('/usr/share/ffmpeg/libx264-ipod640.ffpreset').read().split('\n')) ffpreset = [i for i in ffpreset if i] cmd = "melt %(mlt)s -progress -profile %(dv_format)s -consumer avformat:%(tmp)s s=432x320 aspect=@4/3 progressive=1 acodec=libfaac ar=44100 ab=128k vcodec=libx264 b=70k" % parms cmd = cmd.split() cmd.extend(ffpreset) cmds = [cmd] cmds.append(["qt-faststart", tmp_pathname, out_pathname]) if self.options.rm_temp: cmds.append(["rm", tmp_pathname]) if ext == 'dv': out_pathname = os.path.join( self.tmp_dir, "%s.%s" % (episode.slug, ext)) cmds = ["melt -verbose -progress %s -consumer avformat:%s pix_fmt=yuv411p progressive=1" % (mlt_pathname, out_pathname)] if ext == 'ogv': # melt/ffmpeg ogv encoder is loopy, # so make a .dv and pass it to ffmpeg2theora ret = enc_one("dv") if ret: dv_pathname = os.path.join( self.tmp_dir, "%s.dv" % (episode.slug,)) cmds = [ "ffmpeg2theora --videoquality 5 -V 600 --audioquality 5 --channels 1 %s -o %s" % (dv_pathname, out_pathname)] if self.options.rm_temp: cmds.append(["rm", dv_pathname]) else: return ret # run encoder: if self.options.noencode: print("sorce files generated, skipping encode.") if self.options.melt: self.run_cmd(['melt', mlt_pathname]) ret = False else: ret = self.run_cmds(episode, cmds, ) if ret and not os.path.exists(out_pathname): print("melt returned %ret, but no output: %s" % \ (ret, out_pathname)) ret = False return ret ret = True # create all the formats for uploading for ext in self.options.upload_formats: print("encoding to %s" % (ext,)) ret = enc_one(ext) and ret """ if self.options.enc_script: cmd = [self.options.enc_script, self.show_dir, episode.slug] ret = ret and self.run_cmds(episode, [cmd]) """ return ret def dv2theora(self, episode, dv_path_name, cls, rfs): """ Not used any more. transcode dv to ogv """ oggpathname = os.path.join( self.show_dir, "ogv", "%s.ogv" % episode.slug) # cmd="ffmpeg2theora --videoquality 5 -V 600 --audioquality 5 --speedlevel 0 --optimize --keyint 256 --channels 1".split() cmd = "ffmpeg2theora --videoquality 5 -V 600 --audioquality 5 --keyint 256 --channels 1".split() cmd += ['--output', oggpathname] cmd += [dv_path_name] return cmd def process_ep(self, episode): ret = False cls = Cut_List.objects.filter( episode=episode, apply=True).order_by('sequence') if cls: # get list of raw footage for this episode rfs = Raw_File.objects. \ filter(cut_list__episode=episode).\ exclude(trash=True).distinct() # get a .mlt file for this episode (mlt_pathname) # look for custom/slug.mlt and just use it, # else build one from client.template_mlt mlt_pathname = os.path.join( self.show_dir, "custom", "{}.mlt".format(episode.slug)) if os.path.exists(mlt_pathname): print(("found custom/slug.mlt:\n{}".format( mlt_pathname ))) ret = True else: template_mlt = episode.show.client.template_mlt mlt_pathname = os.path.join(self.show_dir, "mlt", "%s.mlt" % episode.slug) params = self.get_params(episode, rfs, cls ) pprint.pprint(params) print((2, mlt_pathname)) ret = mk_mlt( template_mlt, mlt_pathname, params ) if not ret: episode.state = 0 episode.comment += "\nenc.py mlt = self.mkmlt_1 failed.\n" episode.save() return False # do the final encoding: # using melt ret = self.enc_all(mlt_pathname, episode) if self.options.load_temp and self.options.rm_temp: cmds = [] for rf in rfs: dst_path = os.path.join( self.tmp_dir, episode.slug, os.path.dirname(rf.filename)) rawpathname = os.path.join( self.tmp_dir, episode.slug, rf.filename) cmds.append(['rm', rawpathname]) cmds.append(['rmdir', dst_path]) dst_path = os.path.join(self.tmp_dir, episode.slug) cmds.append(['rmdir', dst_path]) self.run_cmds(episode, cmds) else: err_msg = "No cutlist found." episode.state = 0 episode.comment += "\nenc error: %s\n" % (err_msg,) episode.save() print(err_msg) return False if self.options.test: ret = False # save the episode so the test suite can get the slug self.episode = episode return ret def add_more_options(self, parser): parser.add_option('--enc-script', help='encode shell script') parser.add_option('--noencode', action="store_true", help="don't encode, just make svg, png, mlt") parser.add_option('--melt', action="store_true", help="call melt slug.melt (only w/noencode)") parser.add_option('--load-temp', action="store_true", help='copy .dv to temp files') parser.add_option('--rm-temp', help='remove large temp files') parser.add_option('--threads', help='thread parameter passed to encoder') def add_more_option_defaults(self, parser): parser.set_defaults(threads=0) if __name__ == '__main__': p = enc() p.main()
mit
2,883,326,822,299,327,000
35.06298
226
0.481407
false
4.092922
false
false
false
GoodCloud/johnny-cache
johnny/backends/memcached.py
1
1842
#!/usr/bin/env python # -*- coding: utf-8 -*- """Infinite caching memcached class. Caches forever when passed a timeout of 0. For Django >= 1.3, this module also provides ``MemcachedCache`` and ``PyLibMCCache``, which use the backends of their respective analogs in django's default backend modules. """ from django.core.cache.backends import memcached from django.utils.encoding import smart_str import django class CacheClass(memcached.CacheClass): """By checking ``timeout is None`` rather than ``not timeout``, this cache class allows for non-expiring cache writes on certain backends, notably memcached.""" def _get_memcache_timeout(self, timeout=None): if timeout == 0: return 0 #2591999 return super(CacheClass, self)._get_memcache_timeout(timeout) if django.VERSION[:2] > (1, 2): class MemcachedCache(memcached.MemcachedCache): """Infinitely Caching version of django's MemcachedCache backend.""" def _get_memcache_timeout(self, timeout=None): if timeout == 0: return 0 #2591999 return super(MemcachedCache, self)._get_memcache_timeout(timeout) class PyLibMCCache(memcached.PyLibMCCache): """PyLibMCCache version that interprets 0 to mean, roughly, 30 days. This is because `pylibmc interprets 0 to mean literally zero seconds <http://sendapatch.se/projects/pylibmc/misc.html#differences-from-python-memcached>`_ rather than "infinity" as memcached itself does. The maximum timeout memcached allows before treating the timeout as a timestamp is just under 30 days.""" def _get_memcache_timeout(self, timeout=None): # pylibmc doesn't like our definition of 0 if timeout == 0: return 2591999 return super(PyLibMCCache, self)._get_memcache_timeout(timeout)
mit
-7,832,698,847,422,093,000
46.230769
93
0.701412
false
3.978402
false
false
false
freifunk-darmstadt/tools
update-telemetry.py
1
8987
#!/usr/bin/env python3 import psutil import os import json import re import itertools from contextlib import contextmanager import pprint import time import socket import subprocess import logging logger = logging.getLogger(__name__) def pairwise(iterable): "s -> (s0,s1), (s2,s3), (s4, s5), ..." a = iter(iterable) return zip(a, a) @contextmanager def get_socket(host, port): sock = socket.socket() sock.settimeout(1) sock.connect((host, port)) yield sock sock.close() @contextmanager def get_unix_socket(filename): sock = socket.socket(socket.AF_UNIX, socket.SOCK_STREAM) sock.settimeout(1) sock.connect(filename) yield sock sock.close() def write_to_graphite(data, prefix='freifunk', hostname=socket.gethostname()): if '.' in hostname: hostname = hostname.split('.')[0] now = time.time() with get_socket('stats.darmstadt.freifunk.net', 2013) as s: for key, value in data.items(): line = "%s.%s.%s %s %s\n" % (prefix, hostname, key, value, now) s.sendall(line.encode('latin-1')) def write_to_node_collector(filename, data, patterns, prefix='freifunk'): patterns = [re.compile(exp) for exp in patterns] print(data) updates = [] for metric, value in data.items(): for pattern in patterns: m = pattern.match(metric) if m: groups = m.groupdict() if all(key in groups for key in ['key']): updates.append([groups, value]) break content = [] for update, value in updates: key = update['key'].replace('.', '_') sub_key = update.pop('sub_key', None) if prefix: key = '{}_{}'.format(prefix, key) if sub_key: key += '_' + sub_key params =update.copy() params.pop('key') params = ','.join(['{}={}'.format(k, v) for k, v in params.items()]) params = '{%s}' % (params) content.append('{key}{params} {value}'.format(key=key, params=params, value=value)) with open(filename, 'w') as fh: fh.write('\n'.join(content)) def read_from_fastd_socket(filename): with get_unix_socket(filename) as client: try: strings = [] while True: s = client.recv(8096) if not s: break strings.append(s.decode('utf-8')) data = json.loads(''.join(strings)) #pprint.pprint(data['statistics']) online_peers = len([None for name, d in data['peers'].items() if d['connection']]) return { 'peers.count': len(data['peers']), 'peers.online': online_peers, 'rx.packets': data['statistics']['rx']['packets'], 'rx.bytes': data['statistics']['rx']['bytes'], 'rx.reordered.bytes': data['statistics']['rx_reordered']['bytes'], 'rx.reordered.packets': data['statistics']['rx_reordered']['packets'], 'tx.bytes': data['statistics']['tx']['bytes'], 'tx.packets': data['statistics']['tx']['packets'], 'tx.dropped.bytes': data['statistics']['tx_dropped']['bytes'], 'tx.dropped.packets': data['statistics']['tx_dropped']['packets'], } except Exception as e: print(e) return {} def get_fastd_process_stats(): for proc in psutil.process_iter(): if proc.name() == 'fastd': # 11905: 00000000000000000000000001000000:0035 00000000000000000000000000000000:0000 07 00000000:00000000 00:00000000 00000000 0 0 4469598 2 ffff880519be5100 0 drop_count = 0 for proto in ['udp', 'udp6']: with open('/proc/{}/net/{}'.format(proc.pid, proto), 'r') as fh: for line in (line.strip() for line in fh.read().split('\n')): if not line: continue if line.startswith('sl'): continue parts = line.split(' ') drop_count += int(parts[-1]) return drop_count return None def get_neighbour_table_states(family=socket.AF_INET6): if family is socket.AF_INET: family = '-4' elif family is socket.AF_INET6: family = '-6' else: return response = subprocess.check_output( ['/bin/ip', family, 'neigh', 'show', 'nud', 'all'] ).decode() states = {'PERMANENT': 0, 'NOARP': 0, 'REACHABLE': 0, 'STALE': 0, 'NONE': 0, 'INCOMPLETE': 0, 'DELAY': 0, 'PROBE': 0, 'FAILED': 0} for neigh_entry in response.split('\n'): if not neigh_entry: continue state = neigh_entry.split()[-1] if state not in states: continue states[state] += 1 return states def main(): fastd_sockets = ( ('0', '/run/fastd-ffda-vpn.sock'), ('1', '/run/fastd-ffda-vpn1.sock'), ) device_name_mapping = { 'freifunk': 'ffda-br', 'bat0': 'ffda-bat', 'mesh-vpn': 'ffda-vpn' } device_whitelist = [ 'eth0', 'ffda-vpn', 'ffda-vpn-1280', 'ffda-vpn-1312', 'ffda-bat', 'ffda-br', 'ffda-transport', 'services', ] fields = [ 'bytes', 'packets', 'errs', 'drop', 'fifo', 'frame', 'compressed', 'multicast', ] field_format = '(?P<{direction}_{field}>\d+)' pattern = re.compile( '^\s*(?P<device_name>[\w-]+):\s+' + '\s+'.join( itertools.chain.from_iterable((field_format.format(direction=direction, field=field) for field in fields) for direction in ['rx', 'tx']) ) ) update = {} with open('/proc/net/dev') as fh: lines = fh.readlines() for line in lines: m = pattern.match(line) if m: groupdict = m.groupdict() device_name = groupdict.pop('device_name') device_name = device_name_mapping.get(device_name, device_name) if device_name in device_whitelist or device_name.endswith('-vpn') or \ device_name.endswith('-bat') or \ device_name.endswith('-br') or \ device_name.endswith('-transport'): for key, value in groupdict.items(): direction, metric = key.split('_') update['%s.%s.%s' % (device_name, direction, metric)] = value with open('/proc/loadavg', 'r') as fh: line = fh.read() values = line.split(' ', 3) update['load.15'] = values[0] update['load.5'] = values[1] update['load.1'] = values[2] for key in ['count', 'max']: try: with open('/proc/sys/net/netfilter/nf_conntrack_%s' % key, 'r') as fh: update['netfilter.%s' % key] = fh.read().strip() except IOError as e: pass with open('/proc/net/snmp6', 'r') as fh: for line in fh.readlines(): key, value = line.split(' ', 1) value = value.strip() update['ipv6.%s' % key] = value with open('/proc/net/snmp', 'r') as fh: for heading, values in pairwise(fh.readlines()): section, headings = heading.split(':') headings = headings.strip().split(' ') _, values = values.split(':') values = values.strip().split(' ') for key, value in zip(headings, values): update['ipv4.%s.%s' % (section, key)] = value for af, prefix in [(socket.AF_INET, 'ipv4.Neigh'), (socket.AF_INET6, 'ipv6.Neigh')]: for state, count in get_neighbour_table_states(af).items(): update['{0}.{1}'.format(prefix, state.lower())] = count with open('/proc/stat', 'r') as fh: for line in fh.readlines(): key, value = line.split(' ', 1) if key == 'ctxt': update['context_switches'] = value.strip() break for name, filename in fastd_sockets: if not os.path.exists(filename): continue data = read_from_fastd_socket(filename) if len(data) > 0: update.update({'fastd.%s.%s' % (name, key): value for (key, value) in data.items()}) fastd_drops = get_fastd_process_stats() if fastd_drops: update['fastd.drops'] = fastd_drops #pprint.pprint(update) write_to_graphite(update) write_to_node_collector('/dev/shm/telemetry.prom', update, patterns=[ # '^(?P<interface>[^.]+)\.(?P<key>(rx|tx).+)', '^(?P<key>fastd)\.(?P<fast_instance>.+)\.(?P<sub_key>.+)', # '^(?P<key>load)\.(?P<period>\d+)' ], prefix='ffda_') if __name__ == "__main__": main()
agpl-3.0
6,942,988,969,528,593,000
31.327338
182
0.516858
false
3.766555
false
false
false
maferelo/saleor
saleor/account/migrations/0001_initial.py
3
19366
# -*- coding: utf-8 -*- from __future__ import unicode_literals import django.db.models.deletion import django.utils.timezone from django.db import migrations, models class Migration(migrations.Migration): dependencies = [("auth", "0006_require_contenttypes_0002")] replaces = [("userprofile", "0001_initial")] operations = [ migrations.CreateModel( name="User", fields=[ ( "id", models.AutoField( verbose_name="ID", serialize=False, auto_created=True, primary_key=True, ), ), ( "is_superuser", models.BooleanField( default=False, help_text=( "Designates that this user has all permissions " "without explicitly assigning them." ), verbose_name="superuser status", ), ), ("email", models.EmailField(unique=True, max_length=254)), ( "is_staff", models.BooleanField(default=False, verbose_name="staff status"), ), ( "is_active", models.BooleanField(default=False, verbose_name="active"), ), ( "password", models.CharField( verbose_name="password", max_length=128, editable=False ), ), ( "date_joined", models.DateTimeField( default=django.utils.timezone.now, verbose_name="date joined", editable=False, ), ), ( "last_login", models.DateTimeField( default=django.utils.timezone.now, verbose_name="last login", editable=False, ), ), ], options={"db_table": "userprofile_user", "abstract": False}, ), migrations.CreateModel( name="Address", fields=[ ( "id", models.AutoField( verbose_name="ID", serialize=False, auto_created=True, primary_key=True, ), ), ( "first_name", models.CharField(max_length=256, verbose_name="first name"), ), ( "last_name", models.CharField(max_length=256, verbose_name="last name"), ), ( "company_name", models.CharField( max_length=256, verbose_name="company or organization", blank=True, ), ), ( "street_address_1", models.CharField(max_length=256, verbose_name="address"), ), ( "street_address_2", models.CharField( max_length=256, verbose_name="address", blank=True ), ), ("city", models.CharField(max_length=256, verbose_name="city")), ( "postal_code", models.CharField(max_length=20, verbose_name="postal code"), ), ( "country", models.CharField( max_length=2, verbose_name="country", choices=[ ("AF", "Afghanistan"), ("AX", "\xc5land Islands"), ("AL", "Albania"), ("DZ", "Algeria"), ("AS", "American Samoa"), ("AD", "Andorra"), ("AO", "Angola"), ("AI", "Anguilla"), ("AQ", "Antarctica"), ("AG", "Antigua And Barbuda"), ("AR", "Argentina"), ("AM", "Armenia"), ("AW", "Aruba"), ("AU", "Australia"), ("AT", "Austria"), ("AZ", "Azerbaijan"), ("BS", "Bahamas"), ("BH", "Bahrain"), ("BD", "Bangladesh"), ("BB", "Barbados"), ("BY", "Belarus"), ("BE", "Belgium"), ("BZ", "Belize"), ("BJ", "Benin"), ("BM", "Bermuda"), ("BT", "Bhutan"), ("BO", "Bolivia"), ("BQ", "Bonaire, Saint Eustatius And Saba"), ("BA", "Bosnia And Herzegovina"), ("BW", "Botswana"), ("BV", "Bouvet Island"), ("BR", "Brazil"), ("IO", "British Indian Ocean Territory"), ("BN", "Brunei Darussalam"), ("BG", "Bulgaria"), ("BF", "Burkina Faso"), ("BI", "Burundi"), ("KH", "Cambodia"), ("CM", "Cameroon"), ("CA", "Canada"), ("CV", "Cape Verde"), ("KY", "Cayman Islands"), ("CF", "Central African Republic"), ("TD", "Chad"), ("CL", "Chile"), ("CN", "China"), ("CX", "Christmas Island"), ("CC", "Cocos (Keeling) Islands"), ("CO", "Colombia"), ("KM", "Comoros"), ("CG", "Congo"), ("CD", "Congo, The Democratic Republic of the"), ("CK", "Cook Islands"), ("CR", "Costa Rica"), ("CI", "C\xf4te D'Ivoire"), ("HR", "Croatia"), ("CU", "Cuba"), ("CW", "Cura\xe7o"), ("CY", "Cyprus"), ("CZ", "Czech Republic"), ("DK", "Denmark"), ("DJ", "Djibouti"), ("DM", "Dominica"), ("DO", "Dominican Republic"), ("EC", "Ecuador"), ("EG", "Egypt"), ("SV", "El Salvador"), ("GQ", "Equatorial Guinea"), ("ER", "Eritrea"), ("EE", "Estonia"), ("ET", "Ethiopia"), ("FK", "Falkland Islands (Malvinas)"), ("FO", "Faroe Islands"), ("FJ", "Fiji"), ("FI", "Finland"), ("FR", "France"), ("GF", "French Guiana"), ("PF", "French Polynesia"), ("TF", "French Southern Territories"), ("GA", "Gabon"), ("GM", "Gambia"), ("GE", "Georgia"), ("DE", "Germany"), ("GH", "Ghana"), ("GI", "Gibraltar"), ("GR", "Greece"), ("GL", "Greenland"), ("GD", "Grenada"), ("GP", "Guadeloupe"), ("GU", "Guam"), ("GT", "Guatemala"), ("GG", "Guernsey"), ("GN", "Guinea"), ("GW", "Guinea-Bissau"), ("GY", "Guyana"), ("HT", "Haiti"), ("HM", "Heard Island And Mcdonald Islands"), ("VA", "Holy See (Vatican City State)"), ("HN", "Honduras"), ("HK", "Hong Kong"), ("HU", "Hungary"), ("IS", "Iceland"), ("IN", "India"), ("ID", "Indonesia"), ("IR", "Iran, Islamic Republic of"), ("IQ", "Iraq"), ("IE", "Ireland"), ("IM", "Isle of Man"), ("IL", "Israel"), ("IT", "Italy"), ("JM", "Jamaica"), ("JP", "Japan"), ("JE", "Jersey"), ("JO", "Jordan"), ("KZ", "Kazakhstan"), ("KE", "Kenya"), ("KI", "Kiribati"), ("KP", "Korea, Democratic People's Republic of"), ("KR", "Korea, Republic of"), ("KW", "Kuwait"), ("KG", "Kyrgyzstan"), ("LA", "Lao People's Democratic Republic"), ("LV", "Latvia"), ("LB", "Lebanon"), ("LS", "Lesotho"), ("LR", "Liberia"), ("LY", "Libya"), ("LI", "Liechtenstein"), ("LT", "Lithuania"), ("LU", "Luxembourg"), ("MO", "Macao"), ("MK", "Macedonia, The Former Yugoslav Republic of"), ("MG", "Madagascar"), ("MW", "Malawi"), ("MY", "Malaysia"), ("MV", "Maldives"), ("ML", "Mali"), ("MT", "Malta"), ("MH", "Marshall Islands"), ("MQ", "Martinique"), ("MR", "Mauritania"), ("MU", "Mauritius"), ("YT", "Mayotte"), ("MX", "Mexico"), ("FM", "Micronesia, Federated States of"), ("MD", "Moldova, Republic of"), ("MC", "Monaco"), ("MN", "Mongolia"), ("ME", "Montenegro"), ("MS", "Montserrat"), ("MA", "Morocco"), ("MZ", "Mozambique"), ("MM", "Myanmar"), ("NA", "Namibia"), ("NR", "Nauru"), ("NP", "Nepal"), ("NL", "Netherlands"), ("NC", "New Caledonia"), ("NZ", "New Zealand"), ("NI", "Nicaragua"), ("NE", "Niger"), ("NG", "Nigeria"), ("NU", "Niue"), ("NF", "Norfolk Island"), ("MP", "Northern Mariana Islands"), ("NO", "Norway"), ("OM", "Oman"), ("PK", "Pakistan"), ("PW", "Palau"), ("PS", "Palestinian Territory, Occupied"), ("PA", "Panama"), ("PG", "Papua New Guinea"), ("PY", "Paraguay"), ("PE", "Peru"), ("PH", "Philippines"), ("PN", "Pitcairn"), ("PL", "Poland"), ("PT", "Portugal"), ("PR", "Puerto Rico"), ("QA", "Qatar"), ("RE", "R\xe9union"), ("RO", "Romania"), ("RU", "Russian Federation"), ("RW", "Rwanda"), ("BL", "Saint Barth\xe9lemy"), ("SH", "Saint Helena, Ascension And Tristan Da Cunha"), ("KN", "Saint Kitts And Nevis"), ("LC", "Saint Lucia"), ("MF", "Saint Martin (French Part)"), ("PM", "Saint Pierre And Miquelon"), ("VC", "Saint Vincent And the Grenadines"), ("WS", "Samoa"), ("SM", "San Marino"), ("ST", "Sao Tome And Principe"), ("SA", "Saudi Arabia"), ("SN", "Senegal"), ("RS", "Serbia"), ("SC", "Seychelles"), ("SL", "Sierra Leone"), ("SG", "Singapore"), ("SX", "Sint Maarten (Dutch Part)"), ("SK", "Slovakia"), ("SI", "Slovenia"), ("SB", "Solomon Islands"), ("SO", "Somalia"), ("ZA", "South Africa"), ("GS", "South Georgia and the South Sandwich Islands"), ("ES", "Spain"), ("LK", "Sri Lanka"), ("SD", "Sudan"), ("SR", "Suriname"), ("SJ", "Svalbard and Jan Mayen"), ("SZ", "Swaziland"), ("SE", "Sweden"), ("CH", "Switzerland"), ("SY", "Syria"), ("TW", "Taiwan"), ("TJ", "Tajikistan"), ("TZ", "Tanzania"), ("TH", "Thailand"), ("TL", "Timor-Leste"), ("TG", "Togo"), ("TK", "Tokelau"), ("TO", "Tonga"), ("TT", "Trinidad And Tobago"), ("TN", "Tunisia"), ("TR", "Turkey"), ("TM", "Turkmenistan"), ("TC", "Turks And Caicos Islands"), ("TV", "Tuvalu"), ("UG", "Uganda"), ("UA", "Ukraine"), ("AE", "United Arab Emirates"), ("GB", "United Kingdom"), ("US", "United States"), ("UM", "United States Minor Outlying Islands"), ("UY", "Uruguay"), ("UZ", "Uzbekistan"), ("VU", "Vanuatu"), ("VE", "Venezuela"), ("VN", "Viet Nam"), ("VG", "Virgin Islands, British"), ("VI", "Virgin Islands, U.S."), ("WF", "Wallis And Futuna"), ("EH", "Western Sahara"), ("YE", "Yemen"), ("ZM", "Zambia"), ("ZW", "Zimbabwe"), ], ), ), ( "country_area", models.CharField( max_length=128, verbose_name="state or province", blank=True ), ), ( "phone", models.CharField( max_length=30, verbose_name="phone number", blank=True ), ), ], options={"db_table": "userprofile_address"}, ), migrations.AddField( model_name="user", name="addresses", field=models.ManyToManyField(to="account.Address"), ), migrations.AddField( model_name="user", name="default_billing_address", field=models.ForeignKey( related_name="+", on_delete=django.db.models.deletion.SET_NULL, verbose_name="default billing address", blank=True, to="account.Address", null=True, ), ), migrations.AddField( model_name="user", name="default_shipping_address", field=models.ForeignKey( related_name="+", on_delete=django.db.models.deletion.SET_NULL, verbose_name="default shipping address", blank=True, to="account.Address", null=True, ), ), migrations.AddField( model_name="user", name="groups", field=models.ManyToManyField( related_query_name="user", related_name="user_set", to="auth.Group", blank=True, help_text=( "The groups this user belongs to. " "A user will get all permissions granted to each of their groups." ), verbose_name="groups", ), ), migrations.AddField( model_name="user", name="user_permissions", field=models.ManyToManyField( related_query_name="user", related_name="user_set", to="auth.Permission", blank=True, help_text="Specific permissions for this user.", verbose_name="user permissions", ), ), ]
bsd-3-clause
2,425,811,758,527,500,300
42.617117
86
0.291748
false
5.11381
false
false
false
ag-sc/QALD
4/scripts/Evaluation.py
1
26257
#!/usr/bin/env python # -*- coding: utf-8 -*- import xml.dom.minidom as dom import xml.dom from decimal import * import sys import os import datetime #from Numeric import * # Dokument erzeugen implement = xml.dom.getDOMImplementation() ###################Globale Variablen################### task=None choosen_tag={} system_time=0 filename_out_html = None filename_out_txt = None system_name=None configuration=None testing=False ###################Funktionen########################## def set_system_name(name): global system_name system_name=name def set_configuration(name): global configuration configuration=name def _ausgabe_(ausgabe): print ausgabe def set_filename_txt_out(time): global filename_out_txt filename_out_txt="upload/out"+str(time)+".txt" def set_filename_out(time): global filename_out_html filename_out_html="upload/out"+str(time)+".html" def _knoten_auslesen(knoten): try: string = knoten.firstChild.data.strip().encode("utf-8") # print "knoten_auslesen: "+string return string except: # print "Unexpected error:", sys.exc_info()[0] pass #def _knoten_auslesen(knoten): # return eval("%s('%s')" % (knoten.getAttribute("typ"), # knoten.firstChild.data.strip())) def lade_musterloesung(dateiname): d = {} global choosen_tag #baum = dom.parse(dateiname.encode( "utf-8" )) baum = dom.parse(dateiname) zaehler=1 for eintrag in baum.firstChild.childNodes: if eintrag.nodeName == "question": id=(eintrag.attributes["id"]).value question_text = query = None answer=[] for knoten in eintrag.childNodes: if knoten.nodeName == "text" or knoten.nodeName == "string": if (knoten.attributes["lang"]).value == "en": question_text = _knoten_auslesen(knoten) elif (knoten.attributes["lang"]).value == "de": question_text = _knoten_auslesen(knoten) elif (knoten.attributes["lang"]).value == "es": question_text = _knoten_auslesen(knoten) elif (knoten.attributes["lang"]).value == "it": question_text = _knoten_auslesen(knoten) elif (knoten.attributes["lang"]).value == "fr": question_text = _knoten_auslesen(knoten) elif (knoten.attributes["lang"]).value == "nl": question_text = _knoten_auslesen(knoten) # elif knoten.nodeName == "query": # query=knoten.firstChild.data.strip() if knoten.nodeName=="answers": answer_elem_1=[] for knoten_answer in knoten.childNodes: #here i have to check for optional. if knoten_answer.nodeName=="answer": answer_elem=[] for knoten_answer1 in knoten_answer.childNodes: for id_loesung,tag_loesung in choosen_tag.iteritems(): if(id==id_loesung): ########################### # # # In QALD3 only uri/boolean/number and date are allowed, so string is "turned off" # # ########################### if knoten_answer1.nodeName == "string" and choosen_tag[id]=="string": try: answer_elem.append(knoten_answer1.firstChild.data.strip()) except Exception: answer_elem.append(" ") if knoten_answer1.nodeName == "boolean" and choosen_tag[id]=="boolean": try: answer_elem.append(knoten_answer1.firstChild.data.strip()) except Exception: answer_elem.append(" ") if knoten_answer1.nodeName == "number"and choosen_tag[id]=="number": try: answer_elem.append(knoten_answer1.firstChild.data.strip()) except Exception: answer_elem.append(" ") if knoten_answer1.nodeName == "date" and choosen_tag[id]=="date": try: answer_elem.append(knoten_answer1.firstChild.data.strip()) except Exception: answer_elem.append(" ") if knoten_answer1.nodeName == "uri" and choosen_tag[id]=="uri": try: answer_elem.append(knoten_answer1.firstChild.data.strip()) except Exception: answer_elem.append(" ") answer_elem_1.append(answer_elem) answer.append(answer_elem_1) # print(answer) d[id] = [query,question_text,answer] # print str(d) return d def bearbeite_baum(dateiname): #setze Zeielnumbrueche, damit der Parser spaeter besser mit dem Dokument zurecht kommt fobj = open(dateiname, "r") string="" for line1 in fobj: line=str(line1) line=line.replace('<question','\n<question') #line=line.replace('<string>','\n<string>') line=line.replace('</string>','</string>\n') line=line.replace('</keywords>','</keywords>\n') line=line.replace('</query>','</query>\n') line=line.replace('<answers>','<answers>\n') line=line.replace('<answer>','<answer>\n') line=line.replace('</answer>','</answer>\n') line=line.replace('</answers>','</answers>\n') line=line.replace('</uri>','</uri>\n') line=line.replace('</boolean>','</boolean>\n') line=line.replace('</number>','</number>\n') line=line.replace('</date>','</date>\n') #line=line.replace('&','&amp;') string+=line fobj.close() # print string fobj = open(dateiname, "w") fobj.write(string) fobj.close() def lade_baum(dateiname): d = {} bearbeite_baum(dateiname) global choosen_tag global testing # print "after bearbeite baum" baum = dom.parse(dateiname.encode( "utf-8" )) zaehler=1 # print "after parsing baum" for eintrag in baum.firstChild.childNodes: if(zaehler==1): knoten_id=((eintrag.parentNode).attributes["id"]).value zaehler=2 # print "after 1" if eintrag.nodeName == "question": # print "in question" id=(eintrag.attributes["id"]).value # print "id: "+str(id) question_text = query = None answer=[] for knoten in eintrag.childNodes: # # print "in for knoten in eintrag.childNodes: " if knoten.nodeName == "text" or knoten.nodeName == "string": if (knoten.attributes["lang"]).value == "en": question_text = _knoten_auslesen(knoten) elif (knoten.attributes["lang"]).value == "de": question_text = _knoten_auslesen(knoten) elif (knoten.attributes["lang"]).value == "es": question_text = _knoten_auslesen(knoten) elif (knoten.attributes["lang"]).value == "it": question_text = _knoten_auslesen(knoten) elif (knoten.attributes["lang"]).value == "fr": question_text = _knoten_auslesen(knoten) elif (knoten.attributes["lang"]).value == "nl": question_text = _knoten_auslesen(knoten) # print str(question_txt) # elif knoten.nodeName == "query": # query=knoten.firstChild.data.strip() elif knoten.nodeName=="answers": try: answer_elem_1=[] for knoten_answer in knoten.childNodes: if knoten_answer.nodeName=="answer": answer_elem=[] ########################### # # # In QALD3 only uri/boolean/number and date are allowed, so string is "turned off" # # ########################### mehr_als_ein_typ=False eins=zwei=None eins=((knoten_answer.childNodes).item(1)).nodeName if((knoten_answer.childNodes).item(3)): zwei=((knoten_answer.childNodes).item(3)).nodeName else: zwei= None if(eins==zwei or zwei==None): mehr_als_ein_typ=False choosen_tag[id]=((knoten_answer.childNodes).item(1)).nodeName else: mehr_als_ein_typ=True #choosen_tag[id]="string" choosen_tag[id]="uri" for knoten_answer1 in knoten_answer.childNodes: if(knoten_answer1.nodeName!="#text"): if knoten_answer1.nodeName == "string" and mehr_als_ein_typ==False: try: answer_elem.append(knoten_answer1.firstChild.data.strip()) except Exception: answer_elem.append(" ") if knoten_answer1.nodeName == "boolean" and mehr_als_ein_typ==False: try: answer_elem.append(knoten_answer1.firstChild.data.strip()) except Exception: answer_elem.append(" ") if knoten_answer1.nodeName == "number" and mehr_als_ein_typ==False: try: answer_elem.append(knoten_answer1.firstChild.data.strip()) except Exception: answer_elem.append(" ") if knoten_answer1.nodeName == "date" and mehr_als_ein_typ==False: try: answer_elem.append(knoten_answer1.firstChild.data.strip()) except Exception: answer_elem.append(" ") if knoten_answer1.nodeName == "uri" and mehr_als_ein_typ==False: try: answer_elem.append(knoten_answer1.firstChild.data.strip()) except Exception: answer_elem.append(" ") #if knoten_answer1.nodeName == choosen_tag[id] and mehr_als_ein_typ==True: # try: # answer_elem.append(knoten_answer1.firstChild.data.strip()) # except Exception: # answer_elem.append(" ") answer_elem_1.append(answer_elem) except Exception as inst: error= "<!doctype html> <html> <head> <title>ERROR</title></head> <body> <p>"+str(type(inst))+"</p><p>"+str(inst.args)+"</p><p>"+str(inst)+"</p><p>"+id+"</p><p>PLEASE CHECK YOUR XML FILE</p></body></html>" outfile=open(filename_out_html,"w") # _ausgabe_(filename_out_html) outfile.write(error) outfile.close() choosen_tag[id]="string" answer_elem_1.append("ERROR IN FILE") # print "Unexpected error:", sys.exc_info()[0] # print "9" answer.append(answer_elem_1) d[question_text] = [query,id,answer] # print str(d) return d def sortedDictValues2(adict): keys = adict.keys() keys.sort() return [dict[key] for key in keys] def _evaluation(loesung, musterloesung, task): anzahl_bearbeiteter_fragen=0 anzahl_korrekter_antworten=0 anzahl_falscher_antworten=0 falsche_antworten=[] anzahl_bearbeiteter_fragen=len(loesung) bewertung_ausgabe={} #number_answers_goldstandard = 0 number_answers_user = 0 #for question_text, query_loesung in musterloesung.iteritems(): # gold_loesung1=query_loesung[2] # gold_loesung=gold_loesung1[0] # number_answer_goldstandard += len(gold_loesung) for question_text, query_loesung in loesung.iteritems(): anzahl_falscher_frageelemente=anzahl_richtiger_frageelemente=0 R=P=F=0 # print question_text # print # print str(query_loesung[2]) answer_loesung1=query_loesung[2] answer_loesung=answer_loesung1[0] number_answers_user += len(answer_loesung) loesung_id=query_loesung[1] answer_musterloesung1=musterloesung[loesung_id] answer_musterloesung2=answer_musterloesung1[2] answer_musterloesung=answer_musterloesung2[0] #print "user: "+str(answer_loesung) #print "gold: "+str(answer_musterloesung) if len(answer_musterloesung) == len(answer_loesung) and len(answer_loesung) == 0: bewertung_ausgabe[loesung_id]=[question_text,str(1.0),str(1.0),str(1.0)] anzahl_korrekter_antworten+=1 elif(len(answer_loesung)==0): # anzahl_falscher_fragen+=1 anzahl_falscher_antworten+=1 falsche_antworten.append(loesung_id) R=P=F=0 bewertung_ausgabe[loesung_id]=[question_text,str(R),str(P),str(F)] else: if(len(answer_musterloesung)>len(answer_loesung)): anzahl_falscher_antworten+=1 anzahl_falscher_frageelemente+=(len(answer_musterloesung)-len(answer_loesung)) falsche_antworten.append(loesung_id) for i in range(0,len(answer_loesung)): for j in range(0,len(answer_musterloesung)): if(answer_loesung[i]==answer_musterloesung[j]): anzahl_richtiger_frageelemente+=1 break if(anzahl_richtiger_frageelemente==0): R=F=P=0 else: R1=Decimal(anzahl_richtiger_frageelemente) R2=Decimal(len(answer_musterloesung)) R=round((R1/R2),5) P1=R1 P2=Decimal(len(answer_loesung)) P=round((P1/P2),5) F=round(((2*P*R)/(R+P)),5) bewertung_ausgabe[loesung_id]=[question_text,str(R),str(P),str(F)] else: for i in range(0,len(answer_loesung)): for j in range(0,len(answer_musterloesung)): if(answer_loesung[i]==answer_musterloesung[j]): anzahl_richtiger_frageelemente+=1 break if(anzahl_richtiger_frageelemente==len(answer_loesung)): anzahl_korrekter_antworten+=1 else: anzahl_falscher_antworten+=1 falsche_antworten.append(loesung_id) if(anzahl_richtiger_frageelemente==0): R=F=P=0 else: R1=Decimal(anzahl_richtiger_frageelemente) R2=Decimal(len(answer_musterloesung)) R=round((R1/R2),5) P1=R1 P2=Decimal(len(answer_loesung)) P=round((P1/P2),5) F=round(((2*P*R)/(R+P)),5) bewertung_ausgabe[loesung_id]=[question_text,str(R),str(P),str(F)] if(anzahl_korrekter_antworten==0): fmeasure=recall=precision=0 else: wert1=Decimal(anzahl_korrekter_antworten) wert2=Decimal(anzahl_bearbeiteter_fragen) recall=round(((wert1/len(musterloesung))),5) precision=round(((wert1/wert2)),5) fmeasure=round(((2*recall*precision)/(recall+precision)),5) recall=str(recall) precision=str(precision) fmeasure=str(fmeasure) number_correct_user_answers = anzahl_bearbeiteter_fragen anzahl_bearbeiteter_fragen=str(anzahl_bearbeiteter_fragen) anzahl_korrekter_antworten=str(anzahl_korrekter_antworten) anzahl_falscher_antworten=str(anzahl_falscher_antworten) ############################################################################################ # # #Recall = Overall numbers of correct answers / overall number of goldstandard answers # #Precision = Overall numbers of correct answers / overall number of all answers(given xml) #F-Measure = (2*Recall*Precision)/(Recall+Precision) # # ############################################################################################ global_precision=0.0 global_recall=0.0 global_fmeasure=0.0 for id,value in bewertung_ausgabe.iteritems(): tmp = id +";" x = value[0] x = x.decode("ascii","ignore") tmp += x +";" tmp += str(value[2])+";" tmp += str(value[1])+";" tmp += str(value[3])+";" #print"tmp: "+ tmp #tmp = (id+";"+str(value[0])+";"+str(value[2])+";"+str(value[1])+";"+str(value[3])+"\n").encode("utf-8") string = "qald-4_" if task == 1: string += "multilingual" if task == 2: string += "biomedical" if task == 3: string += "hybrid" string += tmp global_precision += float(value[2]) global_recall += float(value[1]) if global_recall == 0.0 or global_precision == 0.0: global_precision = str(0) global_recall = str(0) global_fmeasure = str(0) else: global_precision = global_precision/len(musterloesung) global_recall = global_recall/len(musterloesung) global_fmeasure=str((2*global_recall*global_precision)/(global_precision + global_recall)) global_precision = str(global_precision) global_recall = str(global_recall) write_html(string,anzahl_falscher_antworten,anzahl_korrekter_antworten,anzahl_bearbeiteter_fragen,global_fmeasure,global_precision,global_recall,bewertung_ausgabe,falsche_antworten) def write_txt(anzahl_falscher_antworten,anzahl_korrekter_antworten,anzahl_bearbeiteter_fragen,fmeasure,precision,recall,bewertung_ausgabe,falsche_antworten): #global system_name, configuration bla="" bla=system_name+";"+configuration+"\n" globale_uebersicht_txt= anzahl_bearbeiteter_fragen+";"+anzahl_korrekter_antworten+";"+anzahl_falscher_antworten+";"+recall+";"+precision+";"+fmeasure+"\n" string="" for id,answer in bewertung_ausgabe.iteritems(): question = answer[0] question = question.decode("ascii","ignore") string += id+";"+question+";"+answer[1]+";"+answer[2]+";"+answer[3]+"\n" outfile=open(filename_out_txt,"w") outfile.write(bla+globale_uebersicht_txt+string) outfile.close() _ausgabe_(filename_out_txt) def write_html(string,anzahl_falscher_antworten,anzahl_korrekter_antworten,anzahl_bearbeiteter_fragen,fmeasure,precision,recall,bewertung_ausgabe,falsche_antworten): tabelle3="<table class=\"eval\" border=\"1\"><tr><th>Failed questions (IDs)</th></tr>" string_question ="<tr>" for i in range(0,len(falsche_antworten)): string_question+="<td>"+str(falsche_antworten[i])+"</td></tr>" end_tabelle3="</table>" start_table= "<!doctype html> <html> <head> <title>Evaluation of "+string+"</title></head> <body> <p>Evaluation</p><p>Skript Version 5.5</p>" space="<p></p><p></p><p></p><p></p><p></p>" tabelle1="<table class=\"eval\" border=\"1\"><tr><th>ID</th><th>Question</th><th>Recall</th><th>Precision</th><th>F-Measure</th></tr>" tabelle2="<table class=\"eval\" border=\"1\"><tr><th>Number of constructed Queries</th><th>Number of correct Answers</th><th>Number of wrong Answers</th><th>Global Recall</th><th>Global Precision</th><th>Global F-Measure</th></tr>" inhalt_tabelle2="<tr><td>"+anzahl_bearbeiteter_fragen+"</td><td>"+anzahl_korrekter_antworten+"</td><td>"+anzahl_falscher_antworten+"</td><td>"+recall+"</td><td>"+precision+"</td><td>"+fmeasure+"</td></tr>" end_tabelle2="</table>" end_tabelle1="</table>" ende="</body> </html>" string="" for id,answer in bewertung_ausgabe.iteritems(): question = answer[0] question = question.decode("ascii","ignore") string_bla="<tr><td>"+id+"</td><td>"+question+"</td><td>"+answer[1]+"</td><td>"+answer[2]+"</td><td>"+answer[3]+"</td></tr>" string+=string_bla outfile=open(filename_out_html,"w") outfile.write(start_table+space+tabelle2+inhalt_tabelle2+end_tabelle2+space+tabelle1+string+end_tabelle1+space+tabelle3+string_question+end_tabelle3+ende) outfile.close() _ausgabe_(filename_out_html) ################### MAIN ################################################## def main(): global system_time, testing, task system_time = datetime.datetime.now() set_filename_out(system_time) set_filename_txt_out(system_time) #print system_time #print filename_out_html # Train or Test if sys.argv[2] == "test": testing = True else: testing = False # Task task = sys.argv[3] # Set gold standard gold = '../data/qald-4_' if task == '1': gold += 'multilingual' elif task == '2': gold += 'biomedical' elif task == '3': gold += 'hybrid' if testing: gold += '_test' else: gold += '_train' gold += '_withanswers.xml' import urllib dateiname=sys.argv[1] if (len(sys.argv)>=6): set_system_name(sys.argv[4]) set_configuration(sys.argv[5]) else: set_system_name("None") set_configuration("None") loesung=None try: loesung=lade_baum(dateiname) except Exception as inst: error= "<!doctype html> <html> <head> <title>ERROR</title></head> <body> <p>"+str(type(inst))+"</p><p>"+str(inst.args)+"</p><p>"+str(inst)+"</p><p>PLEASE CHECK YOUR XML FILE</p></body></html>" outfile=open(filename_out_html,"w") outfile.write(error) outfile.close() _ausgabe_(filename_out_html) # print "Unexpected error:", sys.exc_info()[0] # print "8" gstandard_importet=True try: musterloesung=lade_musterloesung(urllib.urlopen(gold)) except Exception as inst: error= "<!doctype html> <html> <head> <title>ERROR</title></head> <body> <p>"+str(type(inst))+"</p><p>"+str(inst.args)+"</p><p>"+str(inst)+"</p></body></html>" write_error(error) # print "Unexpected error:", sys.exc_info()[0] # print "7" else: _evaluation(loesung,musterloesung,task) # print "Unexpected error:", sys.exc_info()[0] # print "6" def write_error(error): global filename_out_html outfile=open(filename_out_html,"w") outfile.write(error) outfile.close() _ausgabe_(filename_out_html) if __name__ == "__main__": main()
mit
-724,464,349,123,768,700
42.688852
235
0.473778
false
3.872143
false
false
false
Re4son/Kali-Pi
Menus/menu_pause.py
1
1785
#!/usr/bin/env python import pygame, os, sys, subprocess, time import RPi.GPIO as GPIO from pygame.locals import * from subprocess import * if "TFT" in os.environ and os.environ["TFT"] == "0": # No TFT screen SCREEN=0 pass elif "TFT" in os.environ and os.environ["TFT"] == "2": # TFT screen with mouse SCREEN=2 os.environ["SDL_FBDEV"] = "/dev/fb1" elif "TFT" in os.environ and os.environ["TFT"] == "3": # HDMI touchscreen SCREEN=3 os.environ["SDL_FBDEV"] = "/dev/fb0" os.environ["SDL_MOUSEDEV"] = "/dev/input/touchscreen" os.environ["SDL_MOUSEDRV"] = "TSLIB" elif "TFT" in os.environ and os.environ["TFT"] == "4": # Raspberry Pi 7" touchscreen SCREEN=4 from ft5406 import Touchscreen os.environ["SDL_FBDEV"] = "/dev/fb0" ts = Touchscreen() else: # TFT touchscreen SCREEN=1 os.environ["SDL_FBDEV"] = "/dev/fb1" os.environ["SDL_MOUSEDEV"] = "/dev/input/touchscreen" os.environ["SDL_MOUSEDRV"] = "TSLIB" # Initialize pygame modules individually (to avoid ALSA errors) and hide mouse pygame.font.init() pygame.display.init() pygame.mouse.set_visible(0) # Initialise GPIO GPIO.setwarnings(False) #While loop to manage touch screen inputs state = [False for x in range(10)] while 1: if SCREEN==4: for touch in ts.poll(): if state[touch.slot] != touch.valid: if touch.valid: sys.exit() else: for event in pygame.event.get(): if event.type == pygame.MOUSEBUTTONDOWN: sys.exit() #Debug: #ensure there is always a safe way to end the program if the touch screen fails ##if event.type == KEYDOWN: ## if event.key == K_ESCAPE: ## sys.exit() time.sleep(0.4)
gpl-3.0
3,545,909,162,319,380,500
28.262295
87
0.614566
false
3.142606
false
false
false
foobarbazblarg/stayclean
stayclean-2016-april/serve-signups-with-flask.py
1
8086
#!/usr/bin/python import subprocess import praw from hashlib import sha1 from flask import Flask from flask import Response from flask import request from cStringIO import StringIO from base64 import b64encode from base64 import b64decode from ConfigParser import ConfigParser import OAuth2Util import os import markdown import bleach # encoding=utf8 import sys from participantCollection import ParticipantCollection reload(sys) sys.setdefaultencoding('utf8') # Edit Me! # Each day after you post a signup post, copy its 6-character ID to this array. signupPageSubmissionIds = [ '4bvb7i', '4c1crs', '4c5lvg', '4ca9ff', '4cf91t', '4ckta7', '4cp4ir' ] flaskport = 8883 app = Flask(__name__) app.debug = True commentHashesAndComments = {} def loginAndReturnRedditSession(): config = ConfigParser() config.read("../reddit-password-credentials.cfg") user = config.get("Reddit", "user") password = config.get("Reddit", "password") # TODO: password auth is going away, and we will soon need to do oauth. redditSession = praw.Reddit(user_agent='Test Script by /u/foobarbazblarg') redditSession.login(user, password, disable_warning=True) # submissions = redditSession.get_subreddit('pornfree').get_hot(limit=5) # print [str(x) for x in submissions] return redditSession def loginOAuthAndReturnRedditSession(): redditSession = praw.Reddit(user_agent='Test Script by /u/foobarbazblarg') o = OAuth2Util.OAuth2Util(redditSession, print_log=True, configfile="../reddit-oauth-credentials.cfg") o.refresh(force=True) return redditSession def getSubmissionsForRedditSession(redditSession): submissions = [redditSession.get_submission(submission_id=submissionId) for submissionId in signupPageSubmissionIds] for submission in submissions: submission.replace_more_comments(limit=None, threshold=0) return submissions def getCommentsForSubmissions(submissions): comments = [] for submission in submissions: comments += praw.helpers.flatten_tree(submission.comments) return comments def retireCommentHash(commentHash): with open("retiredcommenthashes.txt", "a") as commentHashFile: commentHashFile.write(commentHash + '\n') def retiredCommentHashes(): with open("retiredcommenthashes.txt", "r") as commentHashFile: # return commentHashFile.readlines() return commentHashFile.read().splitlines() @app.route('/moderatesignups.html') def moderatesignups(): global commentHashesAndComments commentHashesAndComments = {} stringio = StringIO() stringio.write('<html>\n<head>\n</head>\n\n') # redditSession = loginAndReturnRedditSession() redditSession = loginOAuthAndReturnRedditSession() submissions = getSubmissionsForRedditSession(redditSession) flat_comments = getCommentsForSubmissions(submissions) retiredHashes = retiredCommentHashes() i = 1 stringio.write('<iframe name="invisibleiframe" style="display:none;"></iframe>\n') stringio.write("<h3>") stringio.write(os.getcwd()) stringio.write("<br>\n") for submission in submissions: stringio.write(submission.title) stringio.write("<br>\n") stringio.write("</h3>\n\n") stringio.write('<form action="copydisplayduringsignuptoclipboard.html" method="post" target="invisibleiframe">') stringio.write('<input type="submit" value="Copy display-during-signup.py stdout to clipboard">') stringio.write('</form>') for comment in flat_comments: # print comment.is_root # print comment.score i += 1 commentHash = sha1() commentHash.update(comment.permalink) commentHash.update(comment.body.encode('utf-8')) commentHash = commentHash.hexdigest() if commentHash not in retiredHashes: commentHashesAndComments[commentHash] = comment authorName = str(comment.author) # can be None if author was deleted. So check for that and skip if it's None. stringio.write("<hr>\n") stringio.write('<font color="blue"><b>') stringio.write(authorName) # can be None if author was deleted. So check for that and skip if it's None. stringio.write('</b></font><br>') if ParticipantCollection().hasParticipantNamed(authorName): stringio.write(' <small><font color="green">(member)</font></small>') # if ParticipantCollection().participantNamed(authorName).isStillIn: # stringio.write(' <small><font color="green">(in)</font></small>') # else: # stringio.write(' <small><font color="red">(out)</font></small>') else: stringio.write(' <small><font color="red">(not a member)</font></small>') stringio.write('<form action="takeaction.html" method="post" target="invisibleiframe">') stringio.write('<input type="submit" name="actiontotake" value="Signup" style="color:white;background-color:green">') # stringio.write('<input type="submit" name="actiontotake" value="Signup and checkin">') # stringio.write('<input type="submit" name="actiontotake" value="Relapse">') # stringio.write('<input type="submit" name="actiontotake" value="Reinstate">') stringio.write('<input type="submit" name="actiontotake" value="Skip comment">') stringio.write('<input type="submit" name="actiontotake" value="Skip comment and don\'t upvote">') stringio.write('<input type="hidden" name="username" value="' + b64encode(authorName) + '">') stringio.write('<input type="hidden" name="commenthash" value="' + commentHash + '">') stringio.write('<input type="hidden" name="commentpermalink" value="' + comment.permalink + '">') stringio.write('</form>') stringio.write(bleach.clean(markdown.markdown(comment.body.encode('utf-8')), tags=['p'])) stringio.write("\n<br><br>\n\n") stringio.write('</html>') pageString = stringio.getvalue() stringio.close() return Response(pageString, mimetype='text/html') @app.route('/takeaction.html', methods=["POST"]) def takeaction(): username = b64decode(request.form["username"]) commentHash = str(request.form["commenthash"]) # commentPermalink = request.form["commentpermalink"] actionToTake = request.form["actiontotake"] # print commentHashesAndComments comment = commentHashesAndComments[commentHash] # print "comment: " + str(comment) if actionToTake == 'Signup': print "signup - " + username subprocess.call(['./signup.py', username]) comment.upvote() retireCommentHash(commentHash) # if actionToTake == 'Signup and checkin': # print "signup and checkin - " + username # subprocess.call(['./signup-and-checkin.sh', username]) # comment.upvote() # retireCommentHash(commentHash) # elif actionToTake == 'Relapse': # print "relapse - " + username # subprocess.call(['./relapse.py', username]) # comment.upvote() # retireCommentHash(commentHash) # elif actionToTake == 'Reinstate': # print "reinstate - " + username # subprocess.call(['./reinstate.py', username]) # comment.upvote() # retireCommentHash(commentHash) elif actionToTake == 'Skip comment': print "Skip comment - " + username comment.upvote() retireCommentHash(commentHash) elif actionToTake == "Skip comment and don't upvote": print "Skip comment and don't upvote - " + username retireCommentHash(commentHash) return Response("hello", mimetype='text/html') @app.route('/copydisplayduringsignuptoclipboard.html', methods=["POST"]) def copydisplayduringsignuptoclipboard(): print "TODO: Copy display to clipboard" subprocess.call(['./display-during-signup.py']) return Response("hello", mimetype='text/html') if __name__ == '__main__': app.run(host='127.0.0.1', port=flaskport)
mit
8,488,130,493,691,722,000
40.255102
129
0.67351
false
3.771455
true
false
false
zhibolau/webApp
www/models.py
1
1589
#!/usr/bin/env python # -*- coding: utf-8 -*- __author__ = 'Zhibo Liu' import time,uuid from transwarp.db import next_id # 直接from Import会出错 必须在那个目录下建立__init__.py 文件!!!!!!!! from transwarp.orm import Model, StringField, BooleanField, FloatField, TextField class User(Model): __table__ = 'users' id = StringField(primary_key=True, default=next_id, ddl='varchar(50)') email = StringField(updatable=False, ddl='varchar(50)') password = StringField(ddl='varchar(50)') admin = BooleanField() name = StringField(ddl='varchar(50)') image = StringField(ddl='varchar(500)') created_at = FloatField(updatable=False, default=time.time) class Blog(Model): __table__ = 'blogs' id = StringField(primary_key=True, default=next_id, ddl='varchar(50)') user_id = StringField(updatable=False, ddl='varchar(50)') user_name = StringField(ddl='varchar(50)') user_image = StringField(ddl='varchar(500)') name = StringField(ddl='varchar(50)') summary = StringField(ddl='varchar(200)') content = TextField() created_at = FloatField(updatable=False, default=time.time) class Comment(Model): __table__ = 'comments' id = StringField(primary_key=True, default=next_id, ddl='varchar(50)') blog_id = StringField(updatable=False, ddl='varchar(50)') user_id = StringField(updatable=False, ddl='varchar(50)') user_name = StringField(ddl='varchar(50)') user_image = StringField(ddl='varchar(500)') content = TextField() created_at = FloatField(updatable=False, default=time.time)
gpl-2.0
-8,860,960,697,945,917,000
35.162791
86
0.67717
false
3.206186
false
false
false
thomaserlang/XenBackup
src/xenbackup/XenAPI.py
1
9750
# Copyright (c) Citrix Systems, Inc. # All rights reserved. # # Redistribution and use in source and binary forms, with or without # modification, are permitted provided that the following conditions are # met: # # 1) Redistributions of source code must retain the above copyright # notice, this list of conditions and the following disclaimer. # # 2) Redistributions in binary form must reproduce the above copyright # notice, this list of conditions and the following disclaimer in # the documentation and/or other materials provided with the # distribution. # # THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS # "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT # LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR # A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT # HOLDER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, # SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT # LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, # DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY # THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT # (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE # OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. # -------------------------------------------------------------------- # Parts of this file are based upon xmlrpclib.py, the XML-RPC client # interface included in the Python distribution. # # Copyright (c) 1999-2002 by Secret Labs AB # Copyright (c) 1999-2002 by Fredrik Lundh # # By obtaining, using, and/or copying this software and/or its # associated documentation, you agree that you have read, understood, # and will comply with the following terms and conditions: # # Permission to use, copy, modify, and distribute this software and # its associated documentation for any purpose and without fee is # hereby granted, provided that the above copyright notice appears in # all copies, and that both that copyright notice and this permission # notice appear in supporting documentation, and that the name of # Secret Labs AB or the author not be used in advertising or publicity # pertaining to distribution of the software without specific, written # prior permission. # # SECRET LABS AB AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH REGARD # TO THIS SOFTWARE, INCLUDING ALL IMPLIED WARRANTIES OF MERCHANT- # ABILITY AND FITNESS. IN NO EVENT SHALL SECRET LABS AB OR THE AUTHOR # BE LIABLE FOR ANY SPECIAL, INDIRECT OR CONSEQUENTIAL DAMAGES OR ANY # DAMAGES WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, # WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS # ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR PERFORMANCE # OF THIS SOFTWARE. # -------------------------------------------------------------------- import gettext import xmlrpclib import httplib import socket import sys import ssl translation = gettext.translation('xen-xm', fallback = True) API_VERSION_1_1 = '1.1' API_VERSION_1_2 = '1.2' class Failure(Exception): def __init__(self, details): self.details = details def __str__(self): try: return str(self.details) except Exception, exn: import sys print >>sys.stderr, exn return "Xen-API failure: %s" % str(self.details) def _details_map(self): return dict([(str(i), self.details[i]) for i in range(len(self.details))]) # Just a "constant" that we use to decide whether to retry the RPC _RECONNECT_AND_RETRY = object() class UDSHTTPConnection(httplib.HTTPConnection): """HTTPConnection subclass to allow HTTP over Unix domain sockets. """ def connect(self): path = self.host.replace("_", "/") self.sock = socket.socket(socket.AF_UNIX, socket.SOCK_STREAM) self.sock.connect(path) class UDSHTTP(httplib.HTTP): _connection_class = UDSHTTPConnection class UDSTransport(xmlrpclib.Transport): def __init__(self, use_datetime=0): self._use_datetime = use_datetime self._extra_headers=[] def add_extra_header(self, key, value): self._extra_headers += [ (key,value) ] def make_connection(self, host): # Python 2.4 compatibility if sys.version_info[0] <= 2 and sys.version_info[1] < 6: return UDSHTTP(host) else: return UDSHTTPConnection(host) def send_request(self, connection, handler, request_body): connection.putrequest("POST", handler) for key, value in self._extra_headers: connection.putheader(key, value) class Session(xmlrpclib.ServerProxy): """A server proxy and session manager for communicating with xapi using the Xen-API. Example: session = Session('http://localhost/') session.login_with_password('me', 'mypassword') session.xenapi.VM.start(vm_uuid) session.xenapi.session.logout() """ def __init__(self, uri, transport=None, encoding=None, verbose=0, allow_none=1): try: xmlrpclib.ServerProxy.__init__(self, uri, transport, encoding, verbose, allow_none, context=ssl._create_unverified_context()) except AttributeError: xmlrpclib.ServerProxy.__init__(self, uri, transport, encoding, verbose, allow_none) self.transport = transport self._session = None self.last_login_method = None self.last_login_params = None self.API_version = API_VERSION_1_1 def xenapi_request(self, methodname, params): if methodname.startswith('login'): self._login(methodname, params) return None elif methodname == 'logout' or methodname == 'session.logout': self._logout() return None else: retry_count = 0 while retry_count < 3: full_params = (self._session,) + params result = _parse_result(getattr(self, methodname)(*full_params)) if result is _RECONNECT_AND_RETRY: retry_count += 1 if self.last_login_method: self._login(self.last_login_method, self.last_login_params) else: raise xmlrpclib.Fault(401, 'You must log in') else: return result raise xmlrpclib.Fault( 500, 'Tried 3 times to get a valid session, but failed') def _login(self, method, params): result = _parse_result(getattr(self, 'session.%s' % method)(*params)) if result is _RECONNECT_AND_RETRY: raise xmlrpclib.Fault( 500, 'Received SESSION_INVALID when logging in') self._session = result self.last_login_method = method self.last_login_params = params self.API_version = self._get_api_version() def _logout(self): try: if self.last_login_method.startswith("slave_local"): return _parse_result(self.session.local_logout(self._session)) else: return _parse_result(self.session.logout(self._session)) finally: self._session = None self.last_login_method = None self.last_login_params = None self.API_version = API_VERSION_1_1 def _get_api_version(self): pool = self.xenapi.pool.get_all()[0] host = self.xenapi.pool.get_master(pool) major = self.xenapi.host.get_API_version_major(host) minor = self.xenapi.host.get_API_version_minor(host) return "%s.%s"%(major,minor) def __getattr__(self, name): if name == 'handle': return self._session elif name == 'xenapi': return _Dispatcher(self.API_version, self.xenapi_request, None) elif name.startswith('login') or name.startswith('slave_local'): return lambda *params: self._login(name, params) else: return xmlrpclib.ServerProxy.__getattr__(self, name) def xapi_local(): return Session("http://_var_xapi_xapi/", transport=UDSTransport()) def _parse_result(result): if type(result) != dict or 'Status' not in result: raise xmlrpclib.Fault(500, 'Missing Status in response from server' + result) if result['Status'] == 'Success': if 'Value' in result: return result['Value'] else: raise xmlrpclib.Fault(500, 'Missing Value in response from server') else: if 'ErrorDescription' in result: if result['ErrorDescription'][0] == 'SESSION_INVALID': return _RECONNECT_AND_RETRY else: raise Failure(result['ErrorDescription']) else: raise xmlrpclib.Fault( 500, 'Missing ErrorDescription in response from server') # Based upon _Method from xmlrpclib. class _Dispatcher: def __init__(self, API_version, send, name): self.__API_version = API_version self.__send = send self.__name = name def __repr__(self): if self.__name: return '<XenAPI._Dispatcher for %s>' % self.__name else: return '<XenAPI._Dispatcher>' def __getattr__(self, name): if self.__name is None: return _Dispatcher(self.__API_version, self.__send, name) else: return _Dispatcher(self.__API_version, self.__send, "%s.%s" % (self.__name, name)) def __call__(self, *args): return self.__send(self.__name, args)
mit
-7,467,321,875,946,531,000
38.156627
101
0.628205
false
4.263227
false
false
false
mohseniaref/PySAR-1
pysar/pysarApp.py
1
21751
#! /usr/bin/env python ############################################################################### # # Project: PySAR # Purpose: Python Module for InSAR Time-series Analysis # Author: Heresh Fattahi # Created: July 2013 # Modified: Yunjun Zhang, Feb 2015 ############################################################################### # Copyright (c) 2013, Heresh Fattahi # # Permission is hereby granted, free of charge, to any person obtaining a # copy of this software and associated documentation files (the "Software"), # to deal in the Software without restriction, including without limitation # the rights to use, copy, modify, merge, publish, distribute, sublicense, # and/or sell copies of the Software, and to permit persons to whom the # Software is furnished to do so, subject to the following conditions: # # The above copyright notice and this permission notice shall be included # in all copies or substantial portions of the Software. # # THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS # OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, # FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL # THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER # LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING # FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER # DEALINGS IN THE SOFTWARE. ############################################################################### import os import sys import glob import time import _readfile as readfile import h5py import subprocess from pysar._pysar_utilities import check_variable_name def radar_Or_geo(igramFile): h5file=h5py.File(igramFile,'r') igramList=h5file['interferograms'].keys() if 'X_FIRST' in h5file['interferograms'][igramList[0]].attrs.keys(): rdr_geo='geo' else: rdr_geo='radar' h5file.close() return rdr_geo def Usage(): print ''' ******************************************************* ******************************************************* ******************************************************* ******************************************************* ********* OOOOO OOOOO O OOOO ********* ********* O O O O O O O O O ********* ********* OOOOO OOO OOOOO OOOOO OOOO ********* ********* O O O O O O O ********* ********* O OOO OOOOO O O O O ********* ********* ********* ******************************************************* ******************************************************* ******************************************************* ******************************************************* A Python Module for InSAR time-series analysis. PySAR v1.0 July 2013, InSAR Lab, RSMAS, University of Miami usage: pysarApp.py TEMPLATEFILE example: pysarApp.py /nethome/hfattahi/SanAndreasT356EnvD.template pysarApp.py $TE/SanAndreasT356EnvD.template ******************************************************* Template file options: pysar.inputdata=/scratch/hfattahi/PROCESS/SanAndreasT356EnvD/DONE/IFG*/filt*0*c10.unw pysar.CorFiles = /scratch/hfattahi/PROCESS/SanAndreasT356EnvD/DONE/IFG*/filt*0*.cor pysar.wraped = /scratch/hfattahi/PROCESS/SanAndreasT356EnvD/DONE/IFG*/filt*0*.int pysar.geomap = /scratch/hfattahi/PROCESS/SanAndreasT356EnvD/GEO/geomap_12/geomap_8rlks.trans pysar.dem = /scratch/hfattahi/PROCESS/SanAndreasT356EnvD/DONE/IFG_20050102_20070809/radar_8lks.hgt pysar.subset.yx = 1800:2000,700:800 pysar.seed.ll=31.5, 67 or pysar.seed.yx=257 , 151 pysar.unwrap_error = yes [no] pysar.tropospheric_delay = yes ['no'] pysar.tropospheric_delay.method = pyaps ['height-correlation'] pysar.Numerical_Weather_Model = ECMWF ['MERRA', 'NARR'] pysar.acquisition_time = 00:00 ['06:00', '12:00', '18:00'] pysar.topo_error = yes [no] pysar.orbit_error = yes [np] pysar.orbit_error.method = plane ['quadratic', 'plane', 'quardatic_range', 'quadratic_azimiuth', 'plane_range', 'plane_azimuth','baselineCor','BaseTropCor'] pysar.mask=yes pysar.mask.threshold = 0.7 pysar.geocode = yes ******************************************************* ''' ######################################### def main(argv): try: templateFile = argv[1] except: Usage();sys.exit(1) projectName = os.path.basename(templateFile.partition('.')[0]) try: tssarProjectDir = os.getenv('TSSARDIR') +'/'+projectName except: tssarProjectDir = os.getenv('SCRATCHDIR') + '/' + projectName + "/TSSAR" # FA 7/2015: adopted for new directory structure print "QQ " + tssarProjectDir if not os.path.isdir(tssarProjectDir): os.mkdir(tssarProjectDir) os.chdir(tssarProjectDir) igramFile = 'LoadedData.h5' Modified_igramFile = 'Modified_LoadedData.h5' if os.path.isfile(Modified_igramFile): print Modified_igramFile + ' already exists.' igramFile=Modified_igramFile template = readfile.read_template(templateFile) Rlooks = template['Rlooks_unw'] ######################################### # Loading interferograms ######################################### print '******************************************' print'' if os.path.isfile(igramFile): print igramFile + ' already exists.' else: loadCmd='load_data.py ' + templateFile print loadCmd os.system(loadCmd) # copyDemCmd='copy_dem_trans.py ' + templateFile # print copyDemCmd # os.system(copyDemCmd) print'' print '******************************************' ######################################### # Check the subset ######################################### try: subset= template['pysar.subset.yx'].split(',') print subset print subset[0] subsetOutName='subset_'+igramFile subsetCmd='subset.py -f '+ igramFile + ' -y '+subset[0]+' -x '+subset[1] + ' -o ' + subsetOutName print '*****************************************' print 'Subset the area ...' print subsetCmd os.system(subsetCmd) igramFile=subsetOutName print '*****************************************' except: print '*****************************************' print 'No Subset selected. Processing the whole area' print '*****************************************' ######################################### #Referencing all interferograms to the same pixel ######################################### rdr_or_geo=radar_Or_geo(igramFile) print '******************************************' print'' if os.path.isfile('Seeded_'+igramFile): igramFile = 'Seeded_'+igramFile print igramFile + ' already exists.' else: print 'referncing all interferograms to the same pixel.' if 'pysar.seed.ll' in template.keys(): 'Checking the lat/lon refernce point' lat= template['pysar.seed.ll'].split(',')[0] lon= template['pysar.seed.ll'].split(',')[1] seedCmd= 'SeedData.py -f ' + igramFile + ' -l ' +lat+ ' -L '+lon elif 'pysar.seed.yx' in template.keys(): 'Checking y/x reference point' y= template['pysar.seed.yx'].split(',')[0] x= template['pysar.seed.yx'].split(',')[1] seedCmd= 'seed_data.py -f ' + igramFile + ' -y ' +y+ ' -x '+x else: seedCmd= 'seed_data.py -f ' + igramFile igramFile = 'Seeded_'+igramFile print seedCmd os.system(seedCmd) print'' print '******************************************' ############################################ #unwrapping error correction based on the # consistency of triplets of interferograms ############################################ print '******************************************' print'' try: template['pysar.unwrap_error'] if template['pysar.unwrap_error'] in ('y','yes','Yes','YES'): print 'unwrapping error correction might take a while depending on the size of your data set! ' unwCmd='unwrap_error.py '+igramFile os.system(unwCmd) igramFile=igramFile.split('.')[0]+'_unwCor.h5' else: print 'No unwrapping error correction.' except: print 'No unwrapping error correction.' print'' print '******************************************' ######################################### # inversion of interferograms ######################################## print '******************************************' print'' if os.path.isfile(igramFile.split('.')[0]+'_unwCor.h5'): igramFile = igramFile.split('.')[0]+'_unwCor.h5' print igramFile + ' exists.' if os.path.isfile('timeseries.h5'): print 'timeseries.h5 already exists, inversion is not needed.' else: invertCmd = 'igram_inversion.py '+ igramFile print invertCmd os.system(invertCmd) timeseriesFile='timeseries.h5' print'' print '******************************************' ############################################## #temporal coherence: #A parameter to evaluate the consistency of # timeseries with the interferograms ############################################## print '******************************************' print'' # if os.path.isfile('temporal_coherence.h5'): # print 'temporal_coherence.h5 already exists.' # else: # tempcohCmd='temporal_coherence.py '+igramFile+' '+timeseriesFile # print tempcohCmd # os.system(tempcohCmd) tempcohCmd='temporal_coherence.py '+igramFile+' '+timeseriesFile print tempcohCmd os.system(tempcohCmd) print'' print '******************************************' ############################################## #update Mask based on temporal coherence # add by Yunjun Feb 15, 2015 ############################################## print '******************************************' print'' try: template['pysar.mask'] if template['pysar.mask'] in ('yes','Yes','YES','y'): print 'Updating mask according to temporal coherence' cohT=template['pysar.mask.threshold'] maskCmd='generate_mask.py -f temporal_coherence.h5 -m '+ cohT +' -M 1.0 -o Mask.h5' print maskCmd os.system(maskCmd) else: print 'No update for mask.' except: print 'No update for mask.' print'' print '******************************************' ############################################## # Generate incident angle # add by Yunjun Feb 15, 2015 ############################################## print '******************************************' print'' inciCmd='incidence_angle.py -f timeseries.h5' print inciCmd os.system(inciCmd) print'' print '******************************************' ############################################## #If Satellite is Envisat and if Coordinate #system is radar then LOD correction ############################################## print '******************************************' print'' h5file=h5py.File(timeseriesFile,'r') if rdr_or_geo =='radar': if h5file['timeseries'].attrs['PLATFORM']=='ENVISAT': LODcmd='lod.py '+timeseriesFile print LODcmd os.system(LODcmd) timeseriesFile=timeseriesFile.split('.')[0]+'_LODcor.h5' print'' print '******************************************' ############################################## # Tropospheric Correction ############################################## print '******************************************' print'' try: if (template['pysar.tropospheric_delay'] in ('y','yes','Yes','YES')) and template['pysar.orbit_error.method']=='BaseTropCor': print ''' +++++++++++++++++++++++++++++++++++++++++++++++++++ WARNING: Orbital error correction was BaseTropCor. Tropospheric correction was already applied simultaneous with baseline error correction. Tropospheric correction can not be applied again. To apply the tropospheric correction separate from baseline error correction, chhose other existing options for orbital error correction. +++++++++++++++++++++++++++++++++++++++++++++++++++ ''' template['pysar.tropospheric_delay']='no' except: print 'Checking the tropospheric delay correction ...' if template['pysar.tropospheric_delay'] in ('y','yes','Yes','YES'): # demFile='radar_'+Rlooks+'rlks.hgt' demFile=template['pysar.dem'] demFile=check_variable_name(demFile) # print 'DEM file: '+demFile if not os.path.isfile(demFile): print '++++++++++++++++++++++++++++++++++++++++++++++' print 'Error:' print 'DEM (radar_*rlks.hgt file) was not found!' print 'Continue without tropospheric correction ...' print '++++++++++++++++++++++++++++++++++++++++++++++' else: if template['pysar.tropospheric_delay.method'] in ['height-correlation','height_correlation','Height-Correlation','Height_Correlation']: print 'tropospheric delay correction with height-correlation approach' try: polyOrder=template['pysar.trop.polyOrder'] except: print 'Deafult polynomial order for troposphreic correction = 1' polyOrder='1' cmdTrop='tropospheric_correction.py'+ ' -f '+ timeseriesFile + ' -d '+ demfile + ' -p '+ polyOrder os.system(cmdTrop) timeseriesFile=timeseriesFile.split('.')[0]+'_tropCor.h5' elif template['pysar.tropospheric_delay.method']=='pyaps': print 'Atmospheric correction using Numerical Weather Models (using PyAPS software)' print 'reading DEM, source of NWM and acquisition time from template file' source_of_NWM=template['pysar.Numerical_Weather_Model'] print 'Numerical Weather Model: '+source_of_NWM acquisition_time=template['pysar.acquisition_time'] print 'acquisition time: '+acquisition_time # cmdTrop = ["tropcor_pyaps.py -f ",timeseriesFile," -d ",demFile," -s ",source_of_NWM," -h ",acquisition_time," -i incidence_angle.h5"] cmdTrop = 'tropcor_pyaps.py -f '+timeseriesFile+ ' -d '+ demFile +' -s ' + source_of_NWM + ' -h '+ acquisition_time + ' -i incidence_angle.h5' print cmdTrop os.system(cmdTrop) # subprocess.Popen(cmdTrop).wait() timeseriesFile=timeseriesFile.split('.')[0]+'_'+source_of_NWM+'.h5' else: print 'Atmospheric correction method not recognized.' else: print 'No atmospheric delay correction.' print'' print '******************************************' ############################################## #topographic residuals ############################################## print '******************************************' print'' try: template['pysar.topo_error'] if template['pysar.topo_error'] in ('yes','Yes','YES','y'): print 'Correcting topographic residuals' topoCmd='dem_error.py '+ timeseriesFile +' '+ igramFile print topoCmd os.system(topoCmd) timeseriesFile=timeseriesFile.split('.')[0]+'_demCor.h5' else: print 'No correction for topographic residuals.' except: print 'No correction for topographic residuals.' print'' print '******************************************' ############################################## #Orbit correction ############################################## print '******************************************' print'' try: template['pysar.orbit_error'] if template['pysar.orbit_error'] in ('yes','Yes','YES','y'): try: orbit_error_method=template['pysar.orbit_error.method'] print 'orbit error correction method : '+orbit_error_method if orbit_error_method in ['quadratic', 'plane', 'quardatic_range', 'quadratic_azimiuth', 'plane_range', 'plane_azimuth']: orbitCmd='remove_plane.py '+timeseriesFile+' '+template['pysar.orbit_error.method'] #+ ' Mask.h5' timeseriesFile=timeseriesFile.split('.')[0]+'_'+template['pysar.orbit_error.method']+'.h5' print orbitCmd os.system(orbitCmd) elif orbit_error_method == 'baselineCor': orbitCmd='baseline_error.py ' +timeseriesFile #+ ' Mask.h5' print orbitCmd try: h5file=h5py.File(timeseriesFile,'r') daz=float(h5file['timeseries'].attrs['AZIMUTH_PIXEL_SIZE']) os.system(orbitCmd) timeseriesFile=timeseriesFile.split('.')[0]+'_'+template['pysar.orbit_error.method']+'.h5' except: print 'WARNING!' print 'Skipping orbital error correction.' print 'baselineCor method can only be applied in radar coordinate' elif orbit_error_method =='BaseTropCor': demfile=template['pysar.dem'] demfile=check_variable_name(demfile) try: polyOrder=template['pysar.trop.polyOrder'] except: print 'Deafult polynomial order for troposphreic correction = 1' polyOrder=1 try: h5file=h5py.File(timeseriesFile,'r') daz=float(h5file['timeseries'].attrs['AZIMUTH_PIXEL_SIZE']) orbitCmd='baseline_trop.py '+timeseriesFile+' '+ demfile +' '+ polyOrder +'range_and_azimuth' print 'Joint estimation of Baseline error and tropospheric delay [height-correlation approach]' print orbitCmd os.system(orbitCmd) timeseriesFile=timeseriesFile.split('.')[0]+'_'+template['pysar.orbit_error.method']+'.h5' except: print 'WARNING!' print 'Skipping orbital error correction.' print 'baselineCor method can only be applied in radar coordinate' else: print '+++++++++++++++++++++++++++++++++++++++++++++++++++++++' print 'WARNING!' print 'Orbital error correction method was not recognized!' print 'Possible options are:' print 'quadratic, plane, quardatic_range, quadratic_azimiuth, plane_range, plane_azimuth,baselineCor,BaseTropCor' print 'Continue without orbital errors correction...' print '+++++++++++++++++++++++++++++++++++++++++++++++++++++++' except: print 'No orbital errors correction.' else: print 'No orbital errors correction.' except: print 'No orbital errors correction.' print'' print '******************************************' ############################################# #Velocity and rmse maps ############################################# print '******************************************' print'' velCmd='timeseries2velocity.py '+timeseriesFile print velCmd os.system(velCmd) print'' print '******************************************' ############################################# #Masking the velocity based on the temporal #coherence or rmse if it's specified ############################################# print '******************************************' print'' try: template['pysar.mask'] if template['pysar.mask'] in ('yes','Yes','YES','y'): try: template['pysar.mask.threshold'] maskCmd='masking.py -f velocity.h5 -m temporal_coherence.h5 -t '+template['pysar.mask.threshold'] print 'Masking the velocity file using the temporal coherence with the threshold of '+template['pysar.mask.threshold'] except: maskCmd='Masking.py -f velocity.h5 -m temporal_coherence.h5 -t 0.7' print 'Masking the velocity file using the temporal coherence with the threshold of 0.7' os.system(maskCmd) # rmCmd='rm velocity.h5' # os.system(rmCmd) # mvCmd='mv velocity_masked.h5 velocity.h5' # os.system(mvCmd) else: print 'No masking applied' except: print 'No masking applied' print'' print '******************************************' ############################################ #Geocoding ############################################ print '******************************************' print'' try: template['pysar.geocode'] if template['pysar.geocode'] in ('y','yes','Yes','YES'): geomapFile='geomap_'+Rlooks+'rlks.trans' # geoCmd = 'geocode.py '+timeseriesFile+' '+geomapFile # print geoCmd # os.system(geoCmd) geoCmd = 'geocode.py velocity.h5 '+geomapFile print geoCmd os.system(geoCmd) geoCmd = 'geocode.py Mask.h5 '+geomapFile print geoCmd os.system(geoCmd) # maskCmd = 'Masking.py -f geo_'+timeseriesFile+' -m geo_Mask.h5' # print maskCmd # os.system(maskCmd) maskCmd = 'masking.py -f geo_velocity.h5 -m geo_Mask.h5' print maskCmd os.system(maskCmd) else: print 'No geocoding applied' except: print 'No geocoding applied' print'' print '******************************************' ############################################# # PySAR v1.0 # ############################################# print'' print '###############################################' print '' print 'End of PySAR processing.' print '' print '################################################' if __name__ == '__main__': main(sys.argv[:])
mit
6,423,405,613,165,199,000
37.841071
157
0.507379
false
3.978599
false
false
false
qbuat/rootpy
rootpy/tree/model.py
1
5162
# Copyright 2012 the rootpy developers # distributed under the terms of the GNU General Public License from __future__ import absolute_import import inspect from cStringIO import StringIO import types import ROOT from .. import log; log = log[__name__] from .treetypes import Column from .treebuffer import TreeBuffer __all__ = [ 'TreeModel', ] class TreeModelMeta(type): """ Metaclass for all TreeModels Addition/subtraction of TreeModels is handled as set union and difference of class attributes """ def __new__(cls, name, bases, dct): for attr, value in dct.items(): TreeModelMeta.checkattr(attr, value) return type.__new__(cls, name, bases, dct) def __add__(cls, other): return type('_'.join([cls.__name__, other.__name__]), (cls, other), {}) def __iadd__(cls, other): return cls.__add__(other) def __sub__(cls, other): attrs = dict(set(cls.get_attrs()).difference(set(other.get_attrs()))) return type('_'.join([cls.__name__, other.__name__]), (TreeModel,), attrs) def __isub__(cls, other): return cls.__sub__(other) def __setattr__(cls, attr, value): TreeModelMeta.checkattr(attr, value) type.__setattr__(cls, attr, value) @classmethod def checkattr(metacls, attr, value): """ Only allow class attributes that are instances of rootpy.types.Column, ROOT.TObject, or ROOT.ObjectProxy """ if not isinstance(value, ( types.MethodType, types.FunctionType, classmethod, staticmethod, property)): if attr in dir(type('dummy', (object,), {})) + \ ['__metaclass__']: return if attr.startswith('_'): raise SyntaxError( "TreeModel attribute `{0}` " "must not start with `_`".format(attr)) if not inspect.isclass(value): if not isinstance(value, Column): raise TypeError( "TreeModel attribute `{0}` " "must be an instance of " "`rootpy.tree.treetypes.Column`".format(attr)) return if not issubclass(value, (ROOT.TObject, ROOT.ObjectProxy)): raise TypeError( "TreeModel attribute `{0}` must inherit " "from `ROOT.TObject` or `ROOT.ObjectProxy`".format( attr)) def prefix(cls, name): """ Create a new TreeModel where class attribute names are prefixed with ``name`` """ attrs = dict([(name + attr, value) for attr, value in cls.get_attrs()]) return TreeModelMeta( '_'.join([name, cls.__name__]), (TreeModel,), attrs) def suffix(cls, name): """ Create a new TreeModel where class attribute names are suffixed with ``name`` """ attrs = dict([(attr + name, value) for attr, value in cls.get_attrs()]) return TreeModelMeta( '_'.join([cls.__name__, name]), (TreeModel,), attrs) def get_attrs(cls): """ Get all class attributes ordered by definition """ ignore = dir(type('dummy', (object,), {})) + ['__metaclass__'] attrs = [ item for item in inspect.getmembers(cls) if item[0] not in ignore and not isinstance( item[1], ( types.FunctionType, types.MethodType, classmethod, staticmethod, property))] # sort by idx and use attribute name to break ties attrs.sort(key=lambda attr: (getattr(attr[1], 'idx', -1), attr[0])) return attrs def to_struct(cls, name=None): """ Convert the TreeModel into a compiled C struct """ if name is None: name = cls.__name__ basic_attrs = dict([(attr_name, value) for attr_name, value in cls.get_attrs() if isinstance(value, Column)]) if not basic_attrs: return None src = 'struct {0} {{'.format(name) for attr_name, value in basic_attrs.items(): src += '{0} {1};'.format(value.type.typename, attr_name) src += '};' if ROOT.gROOT.ProcessLine(src) != 0: return None return getattr(ROOT, name, None) def __repr__(cls): out = StringIO() for name, value in cls.get_attrs(): print >> out, '{0} -> {1}'.format(name, value) return out.getvalue()[:-1] def __str__(cls): return repr(cls) class TreeModel(object): __metaclass__ = TreeModelMeta def __new__(cls): """ Return a TreeBuffer for this TreeModel """ treebuffer = TreeBuffer() for name, attr in cls.get_attrs(): treebuffer[name] = attr() return treebuffer
gpl-3.0
1,867,577,259,396,475,100
31.465409
79
0.518016
false
4.45
false
false
false
jolid/script.module.donnie
lib/donnie/furk.py
1
6496
import urllib2, urllib, sys, os, re, random, copy from BeautifulSoup import BeautifulSoup, Tag, NavigableString import xbmc,xbmcplugin,xbmcgui,xbmcaddon from t0mm0.common.net import Net from t0mm0.common.addon import Addon from scrapers import CommonScraper net = Net() try: import json except: # pre-frodo and python 2.4 import simplejson as json ''' ########################################################### Usage and helper functions ############################################################''' class FurkServiceSracper(CommonScraper): def __init__(self, settingsid, DB=None, REG=None): if DB: self.DB=DB if REG: self.REG=REG self.addon_id = 'script.module.donnie' self.service='furk' self.name = 'furk.net' self.raiseError = False self.referrer = 'http://www.furk.net/' self.base_url = 'https://api.furk.net/api/' self.user_agent = 'Mozilla/5.0 (Windows; U; Windows NT 5.1; en-GB; rv:1.9.0.3) Gecko/2008092417 Firefox/3.0.3' self.provides = [] self.settingsid = settingsid self._loadsettings() self.settings_addon = self.addon def _getShows(self, silent=False): self.log('Do Nothing here') def _getRecentShows(self, silent=False): self.log('Do Nothing here') def _getEpisodes(self, showid, show, url, pDialog, percent, silent): self.log('Do Nothing here') def _getMovies(self, silent=False): self.log('Do Nothing here') def _getRecentMovies(self, silent): self.log('Do Nothing here') def _setKey(self, api_key): xbmcaddon.Addon(id='script.module.donnie').setSetting('furk-apikey', api_key) def _getKey(self): api_key = xbmcaddon.Addon(id='script.module.donnie').getSetting('furk-apikey') if api_key == '': return None return api_key def cleanQuery(self, query): self.log('Cleaning furk search string') cleaned = query if re.search('\\(\\d\\d\\d\\d\\)$', cleaned): cleaned = cleaned[0:len(cleaned)-7] cleaned = cleaned.replace(":", '') cleaned = cleaned.replace("'", '') cleaned = cleaned.replace("-", ' ') cleaned = cleaned.replace("_", ' ') print cleaned return cleaned def _login(self): api_key = self._getKey() if api_key: self.log('Using cached api key') return api_key loginurl = "%slogin/login" % self.base_url login = self.getSetting('furk-username') password = self.getSetting('furk-password') post_dict = {"login": login, "pwd": password} cookiejar = os.path.join(self.cookie_path,'furk.lwp') try: response = net.http_POST(loginurl, post_dict).content data = json.loads(response) status = data['status'] api_key = data['api_key'] self._setKey(api_key) self.log("Furk response: %s", response) if status=="ok": net.save_cookies(cookiejar) else: print 'Furk Account: login failed' return api_key except Exception, e: print '**** Furk Error: %s' % e pass def _getStreams(self, episodeid=None, movieid=None): api_key = self._login() query = "" if episodeid: row = self.DB.query("SELECT rw_shows.showname, season, episode FROM rw_episodes JOIN rw_shows ON rw_shows.showid=rw_episodes.showid WHERE episodeid=?", [episodeid]) name = row[0].replace("'", "") if re.search('\\(\\d\\d\\d\\d\\)$', row[0]): name = name[0:len(name)-7] season = row[1].zfill(2) episode = row[2].zfill(2) query = str("%s S%sE%s" % (name, season, episode)) elif movieid: row = self.DB.query("SELECT movie, year FROM rw_movies WHERE imdb=? LIMIT 1", [movieid]) movie = self.cleanQuery(row[0]) query = "%s %s" %(movie, row[1]) streams = [] url = "%splugins/metasearch" % self.base_url params = {"type": "video", "filter": "cached", "api_key": api_key, "q": query} pagedata = net.http_POST(url, params).content if pagedata=='': return False data = json.loads(pagedata) try: files = data['files'] for f in files: if f['type'] == 'video': raw_url = f['id'] name = f['name'] size = int(f['size']) / (1024 * 1024) if size > 2000: size = size / 1024 unit = 'GB' else : unit = 'MB' self.getStreamByPriority('Furk - %s ([COLOR blue]%s %s[/COLOR])' %(name, size, unit), self.service + '://' + raw_url) except Exception, e: self.log("********Donnie Error: %s, %s" % (self.service, e)) self.DB.commit() def getStreamByPriority(self, link, stream): self.log(link) host = 'furk.net' SQL = "INSERT INTO rw_stream_list(stream, url, priority, machineid) " \ "SELECT ?, ?, priority, ? " \ "FROM rw_providers " \ "WHERE mirror=? and provider=?" self.DB.execute(SQL, [link, stream, self.REG.getSetting('machine-id'), host, self.service]) def _getServicePriority(self, link): self.log(link) host = 'furk.net' row = self.DB.query("SELECT priority FROM rw_providers WHERE mirror=? and provider=?", [host, self.service]) return row[0] def _resolveStream(self, stream): raw_url = stream.replace(self.service + '://', '') resolved_url = '' t_files = [] t_options = [] sdialog = xbmcgui.Dialog() api_key = self._getKey() params = {"type": "video", "id": raw_url, "api_key": api_key, 't_files': 1} url = "%sfile/get" % self.base_url pagedata = net.http_POST(url, params).content if pagedata=='': return False #print pagedata data = json.loads(str(pagedata)) try: files = data['files'][0]['t_files'] for f in files: if re.search('^video/', f['ct']): size = int(f['size']) / (1024 * 1024) if size > 2000: size = size / 1024 unit = 'GB' else : unit = 'MB' t_files.append("%s ([COLOR blue]%s %s[/COLOR])" %(f['name'], size, unit)) t_options.append(f['url_dl']) file_select = sdialog.select('Select Furk Stream', t_files) if file_select < 0: return resolved_url resolved_url = str(t_options[file_select]) except Exception, e: self.log("********Donnie Error: %s, %s" % (self.service, e)) self.log("Furk retruned: %s", resolved_url, level=0) return resolved_url def _resolveIMDB(self, uri): #Often needed if a sites movie index does not include imdb links but the movie page does imdb = '' print uri pagedata = self.getURL(uri, append_base_url=True) if pagedata=='': return imdb = re.search('http://www.imdb.com/title/(.+?)/', pagedata).group(1) return imdb def whichHost(self, host): #Sometimes needed table = { 'Watch Blah' : 'blah.com', 'Watch Blah2' : 'blah2.com', } try: host_url = table[host] return host_url except: return 'Unknown'
gpl-2.0
5,660,529,019,860,364,000
28.935484
167
0.622229
false
2.852877
false
false
false
twitterdev/twitter-leaderboard
services/migrations/0001_initial.py
1
1248
# -*- coding: utf-8 -*- # Generated by Django 1.9.1 on 2016-01-28 08:34 from __future__ import unicode_literals from django.conf import settings from django.db import migrations, models import django.db.models.deletion class Migration(migrations.Migration): initial = True dependencies = [ migrations.swappable_dependency(settings.AUTH_USER_MODEL), ] operations = [ migrations.CreateModel( name='UserProfile', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('timezone', models.CharField(blank=True, max_length=100, null=True)), ('curator_auth_token', models.CharField(blank=True, max_length=40, null=True)), ('twitter_id', models.CharField(blank=True, max_length=25, null=True)), ('twitter_access_token', models.CharField(blank=True, max_length=75, null=True)), ('twitter_access_token_secret', models.CharField(blank=True, max_length=75, null=True)), ('user', models.OneToOneField(on_delete=django.db.models.deletion.CASCADE, related_name='profile', to=settings.AUTH_USER_MODEL)), ], ), ]
mit
-8,509,788,362,144,956,000
39.258065
145
0.63141
false
3.961905
false
false
false
jayrumi/walmart-reviews
setup.py
1
1197
#!/usr/bin/env python # -*- coding: utf-8 -*- from setuptools import setup, find_packages from codecs import open from os import path here = path.abspath(path.dirname(__file__)) with open(path.join(here, 'README.rst'), encoding='utf-8') as f: long_description = f.read() setup( name = 'walmart-reviews', version = '1.2.0.dev1', packages = find_packages(), requires = ['python (>= 3.5)'], #install_requires = ['random', 'requests', 'lxml', 'datetime', 'time'], description = 'Parsing reviews from Walmart.com without using API', long_description = long_description, #'A package for parsing reviews and all information about reviewers from walmart.com for specific item. For more information read README.rst', #open('README.rst').read(), author = 'Yauheni Rumiantsau', author_email = '[email protected]', url = 'https://github.com/jayrumi/walmart-reviews', #download_url = '', license = 'MIT License', keywords = 'walmart parsing', classifiers = [ 'Intended Audience :: Developers', 'Programming Language :: Python :: 3.5', 'Programming Language :: Python :: 3.6', ], )
mit
8,552,747,381,099,799,000
34.205882
211
0.634085
false
3.5
false
false
false
harrylewis/python-uinames
uinames/models.py
1
1384
from utils import PropertyUnavailable class People(object): """ A collection of people, represented by the Person class. """ def __init__(self, json=None): self._json = json or {} self.data = [Person(identity) for identity in self._json] def __str__(self): return self.__unicode__() def __unicode__(self): return "<People instance: {} Persons>".format(len(self.data)) class Person(object): """ A representation of a person identity, generated from the UINames API. """ def __init__(self, json=None): self._json = json or {} def __getattr__(self, item): try: obj = self._json[item] # determine if string or dict if isinstance(obj, str) or isinstance(obj, unicode): return obj.encode("utf-8") return obj except KeyError: raise PropertyUnavailable( "Property '{}' is does not exist or is not available for this " "Person.".format(item)) def __str__(self): return self.__unicode__() def __unicode__(self): return "<Person instance: {} {} from {}>".format(self.name, self.surname, self.region) if __name__ == "__main__": pass
mit
8,602,743,123,588,186,000
26.68
79
0.510116
false
4.644295
false
false
false
digwanderlust/pants
tests/python/pants_test/base/test_payload_field.py
1
10723
# coding=utf-8 # Copyright 2014 Pants project contributors (see CONTRIBUTORS.md). # Licensed under the Apache License, Version 2.0 (see LICENSE). from __future__ import (absolute_import, division, generators, nested_scopes, print_function, unicode_literals, with_statement) from hashlib import sha1 from pants.backend.jvm.targets.exclude import Exclude from pants.backend.jvm.targets.jar_dependency import IvyArtifact, JarDependency from pants.backend.python.python_requirement import PythonRequirement from pants.base.payload import Payload from pants.base.payload_field import (ExcludesField, FileField, FingerprintedField, FingerprintedMixin, JarsField, PrimitiveField, PythonRequirementsField, SourcesField, TargetListField) from pants_test.base_test import BaseTest class PayloadTest(BaseTest): def test_excludes_field(self): empty = ExcludesField() empty_fp = empty.fingerprint() self.assertEqual(empty_fp, empty.fingerprint()) normal = ExcludesField([Exclude('com', 'foozle'), Exclude('org')]) normal_fp = normal.fingerprint() self.assertEqual(normal_fp, normal.fingerprint()) normal_dup = ExcludesField([Exclude('com', 'foozle'), Exclude('org')]) self.assertEqual(normal_fp, normal_dup.fingerprint()) self.assertNotEqual(empty_fp, normal_fp) def test_jars_field_order(self): jar1 = JarDependency('com', 'foo', '1.0.0') jar2 = JarDependency('org', 'baz') self.assertNotEqual( JarsField([jar1, jar2]).fingerprint(), JarsField([jar2, jar1]).fingerprint(), ) def test_jars_field_artifacts(self): jar1 = JarDependency('com', 'foo', '1.0.0').with_artifact('com', 'baz') jar2 = JarDependency('com', 'foo', '1.0.0') self.assertNotEqual( JarsField([jar1]).fingerprint(), JarsField([jar2]).fingerprint(), ) def test_jars_field_artifacts_arg(self): jar1 = JarDependency('com', 'foo', '1.0.0', artifacts=[IvyArtifact('com', 'baz')]) jar2 = JarDependency('com', 'foo', '1.0.0') self.assertNotEqual( JarsField([jar1]).fingerprint(), JarsField([jar2]).fingerprint(), ) def test_jars_field_artifacts_arg_vs_method(self): jar1 = JarDependency('com', 'foo', '1.0.0', artifacts=[IvyArtifact('com', 'baz')]) jar2 = JarDependency('com', 'foo', '1.0.0').with_artifact('com', 'baz') self.assertEqual( JarsField([jar1]).fingerprint(), JarsField([jar2]).fingerprint(), ) def test_jars_field_artifacts(self): jar1 = (JarDependency('com', 'foo', '1.0.0') .with_artifact('com', 'baz') .with_artifact('org', 'bat')) jar2 = (JarDependency('com', 'foo', '1.0.0') .with_artifact('org', 'bat') .with_artifact('com', 'baz')) jar3 = (JarDependency('com', 'foo', '1.0.0') .with_artifact('org', 'bat')) jar4 = JarDependency('com', 'foo', '1.0.0') self.assertEqual( JarsField([jar1]).fingerprint(), JarsField([jar2]).fingerprint(), ) self.assertNotEqual( JarsField([jar1]).fingerprint(), JarsField([jar3]).fingerprint(), ) self.assertNotEqual( JarsField([jar1]).fingerprint(), JarsField([jar4]).fingerprint(), ) self.assertNotEqual( JarsField([jar3]).fingerprint(), JarsField([jar4]).fingerprint(), ) def test_jars_field_artifacts_ordering(self): """JarDependencies throw away ordering information about their artifacts in the cache key. But they do not throw it away in their internal representation! In the future, this should be fixed: either they should sort them as they are added and keep a canonical representation, or the order information should be preserved. """ jar1 = (JarDependency('com', 'foo', '1.0.0') .with_artifact('com', 'baz') .with_artifact('org', 'bat')) jar2 = (JarDependency('com', 'foo', '1.0.0') .with_artifact('org', 'bat') .with_artifact('com', 'baz')) self.assertEqual( JarsField([jar1]).fingerprint(), JarsField([jar2]).fingerprint(), ) def test_deprecated_jars_field_methods(self): """with_sources() and with_docs() are now no-ops. This test shows they don't affect fingerprinting. """ jar1 = (JarDependency('com', 'foo', '1.0.0')) jar2 = (JarDependency('com', 'foo', '1.0.0') .with_sources() .with_docs()) self.assertEqual( JarsField([jar1]).fingerprint(), JarsField([jar2]).fingerprint(), ) def test_jars_field_apidocs(self): """apidocs are not properly rolled into the cache key right now. Is this intentional?""" jar1 = JarDependency('com', 'foo', '1.0.0', apidocs='pantsbuild.github.io') jar2 = JarDependency('com', 'foo', '1.0.0', apidocs='someother.pantsbuild.github.io') self.assertEqual( JarsField([jar1]).fingerprint(), JarsField([jar2]).fingerprint(), ) def test_python_requirements_field(self): req1 = PythonRequirement('foo==1.0') req2 = PythonRequirement('bar==1.0') self.assertNotEqual( PythonRequirementsField([req1]).fingerprint(), PythonRequirementsField([req2]).fingerprint(), ) def test_python_requirements_field_version_filter(self): """version_filter is a lambda and can't be hashed properly. Since in practice this is only ever used to differentiate between py3k and py2, it should use a tuple of strings or even just a flag instead. """ req1 = PythonRequirement('foo==1.0', version_filter=lambda py, pl: False) req2 = PythonRequirement('foo==1.0') self.assertEqual( PythonRequirementsField([req1]).fingerprint(), PythonRequirementsField([req2]).fingerprint(), ) def test_primitive_field(self): self.assertEqual( PrimitiveField({'foo': 'bar'}).fingerprint(), PrimitiveField({'foo': 'bar'}).fingerprint(), ) self.assertEqual( PrimitiveField(['foo', 'bar']).fingerprint(), PrimitiveField(('foo', 'bar')).fingerprint(), ) self.assertEqual( PrimitiveField(['foo', 'bar']).fingerprint(), PrimitiveField(('foo', 'bar')).fingerprint(), ) self.assertEqual( PrimitiveField('foo').fingerprint(), PrimitiveField(b'foo').fingerprint(), ) self.assertNotEqual( PrimitiveField('foo').fingerprint(), PrimitiveField('bar').fingerprint(), ) def test_excludes_field(self): self.assertEqual( ExcludesField([Exclude('com', 'foo')]).fingerprint(), ExcludesField([Exclude('com', 'foo')]).fingerprint(), ) self.assertEqual( ExcludesField([]).fingerprint(), ExcludesField().fingerprint(), ) self.assertNotEqual( ExcludesField([Exclude('com', 'foo')]).fingerprint(), ExcludesField([Exclude('com')]).fingerprint(), ) self.assertNotEqual( ExcludesField([Exclude('com', 'foo'), Exclude('org', 'bar')]).fingerprint(), ExcludesField([Exclude('org', 'bar'), Exclude('com', 'foo')]).fingerprint(), ) def test_sources_field(self): self.create_file('foo/bar/a.txt', 'a_contents') self.create_file('foo/bar/b.txt', 'b_contents') self.assertNotEqual( SourcesField( sources_rel_path='foo/bar', sources=['a.txt'], ).fingerprint(), SourcesField( sources_rel_path='foo/bar', sources=['b.txt'], ).fingerprint(), ) self.assertEqual( SourcesField( sources_rel_path='foo/bar', sources=['a.txt'], ).fingerprint(), SourcesField( sources_rel_path='foo/bar', sources=['a.txt'], ).fingerprint(), ) self.assertEqual( SourcesField( sources_rel_path='foo/bar', sources=['a.txt'], ).fingerprint(), SourcesField( sources_rel_path='foo/bar', sources=['a.txt'], ).fingerprint(), ) self.assertEqual( SourcesField( sources_rel_path='foo/bar', sources=['a.txt', 'b.txt'], ).fingerprint(), SourcesField( sources_rel_path='foo/bar', sources=['b.txt', 'a.txt'], ).fingerprint(), ) fp1 = SourcesField( sources_rel_path='foo/bar', sources=['a.txt'], ).fingerprint() self.create_file('foo/bar/a.txt', 'a_contents_different') fp2 = SourcesField( sources_rel_path='foo/bar', sources=['a.txt'], ).fingerprint() self.assertNotEqual(fp1, fp2) def test_fingerprinted_field(self): class TestValue(FingerprintedMixin): def __init__(self, test_value): self.test_value = test_value def fingerprint(self): hasher = sha1() hasher.update(self.test_value) return hasher.hexdigest() field1 = TestValue('field1') field1_same = TestValue('field1') field2 = TestValue('field2') self.assertEquals(field1.fingerprint(), field1_same.fingerprint()) self.assertNotEquals(field1.fingerprint(), field2.fingerprint()) fingerprinted_field1 = FingerprintedField(field1) fingerprinted_field1_same = FingerprintedField(field1_same) fingerprinted_field2 = FingerprintedField(field2) self.assertEquals(fingerprinted_field1.fingerprint(), fingerprinted_field1_same.fingerprint()) self.assertNotEquals(fingerprinted_field1.fingerprint(), fingerprinted_field2.fingerprint()) def test_unimplemented_fingerprinted_field(self): class TestUnimplementedValue(FingerprintedMixin): pass with self.assertRaises(NotImplementedError): FingerprintedField(TestUnimplementedValue()).fingerprint() def test_file_field(self): fp1 = FileField(self.create_file('foo/bar.config', contents='blah blah blah')).fingerprint() fp2 = FileField(self.create_file('foo/bar.config', contents='meow meow meow')).fingerprint() fp3 = FileField(self.create_file('spam/egg.config', contents='blah blah blah')).fingerprint() self.assertNotEquals(fp1, fp2) self.assertNotEquals(fp1, fp3) self.assertNotEquals(fp2, fp3) def test_target_list_field(self): specs = [':t1', ':t2', ':t3'] payloads = [Payload() for i in range(3)] for i, (s, p) in enumerate(zip(specs, payloads)): p.add_field('foo', PrimitiveField(i)) self.make_target(s, payload=p) s1, s2, s3 = specs context = self.context() fp1 = TargetListField([s1, s2]).fingerprint_with_context(context) fp2 = TargetListField([s2, s1]).fingerprint_with_context(context) fp3 = TargetListField([s1, s3]).fingerprint_with_context(context) self.assertEquals(fp1, fp2) self.assertNotEquals(fp1, fp3)
apache-2.0
7,316,399,254,146,659,000
32.61442
98
0.633498
false
3.665983
true
false
false
pinax/pinax-eventlog
pinax/eventlog/migrations/0001_initial.py
1
1443
# Generated by Django 3.1 on 2020-08-15 10:08 from django.conf import settings import django.core.serializers.json from django.db import migrations, models import django.db.models.deletion import django.utils.timezone from ..compat import JSONField class Migration(migrations.Migration): initial = True dependencies = [ ('contenttypes', '0002_remove_content_type_name'), migrations.swappable_dependency(settings.AUTH_USER_MODEL), ] operations = [ migrations.CreateModel( name='Log', fields=[ ('id', models.AutoField(auto_created=True, primary_key=True, serialize=False, verbose_name='ID')), ('timestamp', models.DateTimeField(db_index=True, default=django.utils.timezone.now)), ('action', models.CharField(db_index=True, max_length=50)), ('object_id', models.PositiveIntegerField(blank=True, null=True)), ('extra', JSONField(blank=True, encoder=django.core.serializers.json.DjangoJSONEncoder)), ('content_type', models.ForeignKey(blank=True, null=True, on_delete=django.db.models.deletion.SET_NULL, to='contenttypes.contenttype')), ('user', models.ForeignKey(null=True, on_delete=django.db.models.deletion.SET_NULL, to=settings.AUTH_USER_MODEL)), ], options={ 'ordering': ['-timestamp'], }, ), ]
mit
8,742,902,873,296,838,000
38
152
0.634789
false
4.182609
false
false
false
NitrousPG/forkbot
server_events.py
1
4992
# LICENSE # This program is free software; you can redistribute it and/or modify # it under the terms of the GNU General Public License as published by # the Free Software Foundation; either version 3 of the License, or # (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU General Public License for more details. """server message handler""" # Numerics aggregated from https://www.alien.net.au/irc/irc2numerics.html class Server_Events: """handles events""" def __init__(self, forkbot): self.forkbot = forkbot self.server_msg = "" self.server_msg_info = "" self.num_switch = { #misc "NOTICE": self.not_implemented, # start-up "001": self.rpl_welcome, # welcome information "002": self.rpl_yourhost, # server information "004": self.not_implemented, # RPL_MYINFO, TODO "005": self.not_implemented, # RPL_BOUNCE # server info "251": self.not_implemented, "252": self.not_implemented, "253": self.not_implemented, "254": self.not_implemented, "255": self.not_implemented, "265": self.not_implemented, "266": self.not_implemented, # channel info "315": self.rpl_synirc_who_end, # end of WHO "332": self.rpl_topic, # topic of channel "333": self.not_implemented, # ?? "352": self.rpl_synirc_who, # response to WHO "353": self.rpl_namreply, # user list "366": self.rpl_endofnames, # end of user list # motd "372": self.motd, # motd start/continuation "375": self.not_implemented, "376": self.motd, # end of motd } def not_implemented(self): """000""" #placeholder function pass def motd(self): """372, 376""" # for right now we do not # care about the MOTD pass def rpl_welcome(self): """001""" self.forkbot.log("welcome recieved") self.forkbot.hostmask = self.server_msg.split(" ")[-1].replace("\r", "") self.forkbot.log("hostmask is " + self.forkbot.hostmask) def rpl_yourhost(self): """002""" pass def rpl_synirc_who_end(self): """find out what this numeric for this is""" pass def rpl_topic(self): """332""" channel = self.server_msg_info[-1] topic = self.server_msg[:-1] self.forkbot.channel_topics.update({channel: topic}) def rpl_synirc_who(self): """who request handler""" msg_info = self.server_msg_info host = msg_info[5] nick = msg_info[7] self.forkbot.users.hostmask.update({nick: host}) def rpl_namreply(self): """353""" names = self.server_msg.split(" ")[:-1] channel = self.server_msg_info[-1] for name in names: name = "".join([x for x in name if x not in "@+~"]) self.forkbot.users.add_user(channel, name) for name in names: op_type = "" if name.startswith("~"): op_type = "owner" elif name.startswith("@"): op_type = "operator" elif name.startswith("&"): op_type = "admin" elif name.startswith("+"): op_type = "voice" if op_type != "": self.forkbot.users.add_op(channel, "".join( [x for x in name if x not in "@+&~"]), op_type) def rpl_endofnames(self): """366""" pass def process(self, msg_info, msg): """processes and delegates the server event to the correct function""" self.server_msg_info = msg_info self.server_msg = msg # find the key given by the server, and # execute the function that deals with that key try: self.num_switch[msg_info[1]]() except KeyError as ex: self.forkbot.log(f"Unsupported Numeric: {ex}") def find_ops(self, nicks): """parse the list of nicks given by the server and register the ops""" owner, operator, voice, none = [], [], [], [] for nick in nicks: if nick.startswith("~"): owner.append(nick[1:]) elif nick.startswith("@"): operator.append(nick[1:]) elif nick.startswith("+"): voice.append(nick[1:]) else: none.append(nick) ops = { "owner": owner, "operator": operator, "voice": voice, "none": none } return ops
gpl-3.0
-7,410,502,775,914,562,000
29.625767
80
0.527244
false
3.924528
false
false
false
Pragmatismo/TimelapsePi-EasyControl
webcamcap_show_numpy.py
1
8684
#!/usr/bin/python import time import os import sys import pygame import numpy from PIL import Image, ImageDraw, ImageChops print("") print("") print(" USE l=3 to take a photo every 3 somethings, try a 1000 or 2") print(" t to take triggered photos ") print(" cap=/home/pi/folder/ to set caps path other than current dir") print(" ") pi_paper = False #updates pi wall paper, use -nopaper to turn it off. s_val = "10" c_val = "2" g_val = "10" b_val = "15" x_dim = 1600 y_dim = 896 additonal_commands = "-d/dev/video1 -w" try: cappath = os.getcwd() cappath += "/" except: print(" COULD NOT GET CURRENT DIR SET WITH A FLAG ") cappath = "./" print(" COULD NOT GET CURRENT DIR SET WITH A FLAG ") loc_settings = "./camera_settings.txt" try: with open(loc_settings, "r") as f: for line in f: s_item = line.split("=") if s_item[0] == "s_val": s_val = s_item[1].split("\n")[0] elif s_item[0] == "c_val": c_val = s_item[1].split("\n")[0] elif s_item[0] == "g_val": g_val = s_item[1].split("\n")[0] elif s_item[0] == "b_val": b_val = s_item[1].split("\n")[0] elif s_item[0] == "x_dim": x_dim = s_item[1].split("\n")[0] elif s_item[0] == "y_dim": y_dim = s_item[1].split("\n")[0] elif s_item[0] == "additonal_commands": additonal_commands = s_item[1].split("\n")[0] except: print("No config file for camera, using default") print("Run cam_config.py to create one") def photo(): # take and save photo timenow = time.time() timenow = str(timenow)[0:10] filename= "cap_"+str(timenow)+".jpg" #os.system("uvccapture "+additonal_commands+" -S"+s_val+" -C" + c_val + " -G"+ g_val +" -B"+ b_val +" -x"+str(x_dim)+" -y"+str(y_dim)+" -v -t0 -o"+cappath+filename) cmd = str("uvccapture "+additonal_commands+" -x"+str(x_dim)+" -y"+str(y_dim)+" -v -t0 -o"+cappath+filename) print("####") print("####") print cmd print("####") print("####") os.system(cmd) print("Image taken and saved to "+cappath+filename) if pi_paper == True: os.system("export DISPLAY=:0 && pcmanfm --set-wallpaper "+cappath+filename) return filename if 'wp' in sys.argv or 'wallpaper' in sys.argv: pi_paper = True print(" Going to try changing wall paper") loop = False trig = False for argu in sys.argv[1:]: try: thearg = str(argu).split('=')[0] except: thearg = str(argu) if thearg == 'cap' or thearg =='cappath': cappath = str(argu).split('=')[1] elif thearg == 'l' or thearg == 'looped': try: num = int(str(argu).split('=')[1]) except: print("No speed supplied, taking every 10") num = 10 loop = True elif thearg == 't' or thearg == 'TRIGGERED': trig = True print(" Saving files to, " + str(cappath)) pygame.init() display_width = x_dim display_height = y_dim gameDisplay = pygame.display.set_mode((display_width,display_height)) pygame.display.set_caption('Most recent image') black = (0,0,0) white = (255,255,255) clock = pygame.time.Clock() crashed = False import matplotlib.pyplot as plt def show_pic(imgtaken, x=0,y=0): gameDisplay.blit(imgtaken, (x,y)) gameDisplay.fill(white) c_photo = photo() pil_c_photo = Image.open(c_photo) numpy_pic = numpy.array(pil_c_photo) b_photo = photo() pil_b_photo = Image.open(b_photo) numpy_pic_b = numpy.array(pil_b_photo) mask = numpy_pic_b > numpy_pic + 30 #the +30 gets rid of noise mask2 = numpy_pic_b < numpy_pic - 30 lol = mask + mask2 e_pic = numpy_pic.copy() num = 0 while not crashed: for event in pygame.event.get(): if event.type == pygame.QUIT: crashed = True timenow = time.time() e_photo = str(timenow).split(".")[0] e_photo= "numpy_"+str(timenow)+".jpg" num = num + 1 b_photo = c_photo c_photo = photo() numpy_pic_b = numpy_pic.copy() pil_c_photo = Image.open(c_photo) numpy_pic = numpy.array(pil_c_photo) print numpy_pic.size #print len(numpy_pic[3]) print "###" #print numpy_pic[1:,1,1] #a = np.arange(100) print "##########" #numpy_pic[1:500, range(0, len(numpy_pic[2]), 10), 1] = 0 #for x in numpy_pic[1:500, range(0, len(numpy_pic[2])), 1]: # if x >= 100: # x = 255 #for x in range(10,170,10): # mask = numpy_pic < x # numpy_pic[mask] = 255-x #numpy_pic[mask] + numpy_pic[mask] #for x in range(200,255,5): # mask = numpy_pic > x # numpy_pic[mask] = 0+(x/10) # numpy_pic[mask] / numpy_pic[mask]+(numpy_pic[mask]/numpy_pic[mask]) #print numpy_pic[1:,1,1] #print numpy_pic.min() print "###" #print numpy_pic.shape #Array dimensions #print numpy_pic.ndim #Number of array dimensions #print numpy_pic.dtype #Data type of array elements #print numpy_pic.dtype.name #Name of data type #print numpy_pic.mean() #print numpy_pic.max() #print numpy_pic.min() #print numpy.info(numpy.ndarray.dtype) #print numpy_pic.astype(int) #mask = numpy_pic > numpy_pic_b #mask = numpy_pic[:, :, 2] > 150 #numpy_pic[mask] = [0, 0, 255] #lol = numpy_pic + #mask = numpy_pic_b > numpy_pic + 30 #the +30 gets rid of noise #mask2 = numpy_pic_b < numpy_pic - 30 margin = 20 maskr = numpy_pic[:, :, 0] < numpy_pic_b[:, :, 0] - margin maskg = numpy_pic[:, :, 1] < numpy_pic_b[:, :, 1] - margin maskb = numpy_pic[:, :, 2] < numpy_pic_b[:, :, 2] - margin maskr2 = numpy_pic[:, :, 0] > numpy_pic_b[:, :, 0] + margin maskg2 = numpy_pic[:, :, 1] > numpy_pic_b[:, :, 1] + margin maskb2 = numpy_pic[:, :, 2] > numpy_pic_b[:, :, 2] + margin #numpy_pic[mask] = [0, 0, 255] #lol_old = lol #lol = mask + mask2 #lol = lol + lol_old persist = 'ohhh' if persist == 'True': numpy_pic[maskr] = [255, 0, 0] numpy_pic[maskg] = [0, 255, 0] numpy_pic[maskb] = [0, 0, 255] numpy_pic[maskb2] = [0, 0, 100] numpy_pic[maskr2] = [100, 0, 0] numpy_pic[maskg2] = [0, 100, 0] Image.fromarray(numpy_pic).save(e_photo) elif persist == 'False': old_e = e_pic e_pic = numpy_pic.copy() e_pic[maskr] = [255, 0, 0] e_pic[maskg] = [0, 255, 0] e_pic[maskb] = [0, 0, 255] e_pic[maskr2] = [100, 0, 0] e_pic[maskg2] = [0, 100, 0] e_pic[maskb2] = [0, 0, 100] show1 = 'waa' if show1 == '1': e_pic = ((e_pic/4) - (numpy_pic))*3 e_pic = e_pic / 3 + old_e / 2 elif show1 == 'tripsy': e_pic = ((e_pic/4) - (numpy_pic))*3 e_pic = e_pic - old_e / 2 elif show1 == 'waa': e_pic = ((e_pic/4) - (numpy_pic))*3 #e_pic = old_e * 0.8 + e_pic * 0.2 Image.fromarray(e_pic).save(e_photo) elif persist == 'ohhh': old_e = e_pic.copy() mask_b_pic = numpy_pic.copy() mask_d_pic = numpy_pic.copy() mask_b_pic[maskr] = [255, 255, 255] mask_b_pic[maskg] = [255, 255, 255] mask_b_pic[maskb] = [255, 255, 255] mask_d_pic[maskr2] = [0, 0, 0] mask_d_pic[maskg2] = [0, 0, 0] mask_d_pic[maskb2] = [0, 0, 0] #e_pic = e_pic/6 + old_e e_pic = [200, 200, 0] #e_pic = e_pic/2 - ((mask_d_pic) + (mask_b_pic)) #e_pic = e_pic/2 + ((mask_d_pic) + (mask_b_pic)) #choose one of the following #e_pic = mask_d_pic #shows when pixel is darker than it was #e_pic = mask_b_pic #shows when pixel is lighter than prior e_pic = mask_d_pic - mask_b_pic #black execpt for movement e_pic = mask_b_pic / (mask_d_pic / 100) #black execpt for movement #e_pic = mask_d_pic + mask_b_pic #looks odd Image.fromarray(e_pic).save(e_photo) #plt.imshow(lol) #plt.show() #Image.fromarray(numpy_pic).save(e_photo) onscreen = pygame.image.load(e_photo) gameDisplay.blit(onscreen, (0,0)) pygame.display.update() if trig == True: print("Waiting for input before taking next image...") tp = raw_input("press return to take picture; ") if tp == "q": print("---bye!") exit() clock.tick(20) if loop == True: pygame.time.wait(num) clock.tick(20) elif trig == False and loop == False: crashed = True #while True: #pygame.time.wait(1000) #clock.tick(20) pygame.quit() quit()
gpl-2.0
-2,106,105,906,145,419,300
30.23741
168
0.539843
false
2.838836
false
false
false
mbj4668/pyang
pyang/xpath.py
1
12087
from . import xpath_lexer from . import xpath_parser from .error import err_add from .util import prefix_to_module, search_data_node, data_node_up from .syntax import re_identifier core_functions = { 'last': ([], 'number'), 'position': ([], 'number'), 'count': (['node-set'], 'number'), 'id': (['object'], 'node-set'), 'local-name': (['node-set', '?'], 'string'), 'namespace-uri': (['node-set', '?'], 'string'), 'name': (['node-set', '?'], 'string'), 'string': (['object'], 'string'), 'concat': (['string', 'string', '*'], 'string'), 'starts-with': (['string', 'string'], 'boolean'), 'contains': (['string', 'string'], 'boolean'), 'substring-before': (['string', 'string'], 'string'), 'substring-after': (['string', 'string'], 'string'), 'substring': (['string', 'number', 'number', '?'], 'string'), 'string-length': (['string', '?'], 'number'), 'normalize-space': (['string', '?'], 'string'), 'translate': (['string', 'string', 'string'], 'string'), 'boolean': (['object'], 'boolean'), 'not': (['boolean'], 'boolean'), 'true': ([], 'boolean'), 'false': ([], 'boolean'), 'lang': (['string'], 'boolean'), 'number': (['object'], 'number'), 'sum': (['node-set'], 'number'), 'floor': (['number'], 'number'), 'ceiling': (['number'], 'number'), 'round': (['number'], 'number'), } yang_xpath_functions = { 'current': ([], 'node-set') } yang_1_1_xpath_functions = { 'bit-is-set': (['node-set', 'string'], 'boolean'), 'enum-value': (['string'], 'number'), 'deref': (['node-set'], 'node-set'), 'derived-from': (['node-set', 'qstring'], 'boolean'), 'derived-from-or-self': (['node-set', 'qstring'], 'boolean'), 're-match': (['string', 'string'], 'boolean'), } extra_xpath_functions = { 'deref': (['node-set'], 'node-set'), # pyang extension for 1.0 } def add_extra_xpath_function(name, input_params, output_param): extra_xpath_functions[name] = (input_params, output_param) def add_prefix(prefix, s): "Add `prefix` to all unprefixed names in `s`" # tokenize the XPath expression toks = xpath_lexer.scan(s) # add default prefix to unprefixed names toks2 = [_add_prefix(prefix, tok) for tok in toks] # build a string of the patched expression ls = [x.value for x in toks2] return ''.join(ls) def _add_prefix(prefix, tok): if tok.type == 'name': m = xpath_lexer.re_ncname.match(tok.value) if m.group(2) is None: tok.value = prefix + ':' + tok.value return tok ## TODO: validate must/when after deviate # node is the initial context node or None if it is not known def v_xpath(ctx, stmt, node): try: if hasattr(stmt, 'i_xpath') and stmt.i_xpath is not None: q = stmt.i_xpath else: q = xpath_parser.parse(stmt.arg) stmt.i_xpath = q chk_xpath_expr(ctx, stmt.i_orig_module, stmt.pos, node, node, q, None) except xpath_lexer.XPathError as e: err_add(ctx.errors, stmt.pos, 'XPATH_SYNTAX_ERROR', e.msg) stmt.i_xpath = None except SyntaxError as e: err_add(ctx.errors, stmt.pos, 'XPATH_SYNTAX_ERROR', e.msg) stmt.i_xpath = None # mod is the (sub)module where the stmt is defined, which we use to # resolve prefixes. def chk_xpath_expr(ctx, mod, pos, initial, node, q, t): if isinstance(q, list): chk_xpath_path(ctx, mod, pos, initial, node, q) elif isinstance(q, tuple): if q[0] == 'absolute': chk_xpath_path(ctx, mod, pos, initial, 'root', q[1]) elif q[0] == 'relative': chk_xpath_path(ctx, mod, pos, initial, node, q[1]) elif q[0] == 'union': for qa in q[1]: chk_xpath_path(ctx, mod, pos, initial, node, qa) elif q[0] == 'comp': chk_xpath_expr(ctx, mod, pos, initial, node, q[2], None) chk_xpath_expr(ctx, mod, pos, initial, node, q[3], None) elif q[0] == 'arith': chk_xpath_expr(ctx, mod, pos, initial, node, q[2], None) chk_xpath_expr(ctx, mod, pos, initial, node, q[3], None) elif q[0] == 'bool': chk_xpath_expr(ctx, mod, pos, initial, node, q[2], None) chk_xpath_expr(ctx, mod, pos, initial, node, q[3], None) elif q[0] == 'negative': chk_xpath_expr(ctx, mod, pos, initial, node, q[1], None) elif q[0] == 'function_call': chk_xpath_function(ctx, mod, pos, initial, node, q[1], q[2]) elif q[0] == 'path_expr': chk_xpath_expr(ctx, mod, pos, initial, node, q[1], t) elif q[0] == 'path': # q[1] == 'filter' chk_xpath_expr(ctx, mod, pos, initial, node, q[2], None) chk_xpath_expr(ctx, mod, pos, initial, node, q[3], None) elif q[0] == 'var': # NOTE: check if the variable is known; currently we don't # have any variables in YANG xpath expressions err_add(ctx.errors, pos, 'XPATH_VARIABLE', q[1]) elif q[0] == 'literal': # kind of hack to detect qnames, and mark the prefixes # as being used in order to avoid warnings. s = q[1] if s[0] == s[-1] and s[0] in ("'", '"'): s = s[1:-1] i = s.find(':') # make sure there is just one : present # FIXME: more colons should possibly be reported, instead if i != -1 and s.find(':', i + 1) == -1: prefix = s[:i] tag = s[i + 1:] if (re_identifier.search(prefix) is not None and re_identifier.search(tag) is not None): # we don't want to report an error; just mark the # prefix as being used. my_errors = [] prefix_to_module(mod, prefix, pos, my_errors) for pos0, code, arg in my_errors: if code == 'PREFIX_NOT_DEFINED' and t == 'qstring': # we know for sure that this is an error err_add(ctx.errors, pos0, 'PREFIX_NOT_DEFINED', arg) else: # this may or may not be an error; # report a warning err_add(ctx.errors, pos0, 'WPREFIX_NOT_DEFINED', arg) def chk_xpath_function(ctx, mod, pos, initial, node, func, args): signature = None if func in core_functions: signature = core_functions[func] elif func in yang_xpath_functions: signature = yang_xpath_functions[func] elif mod.i_version != '1' and func in yang_1_1_xpath_functions: signature = yang_1_1_xpath_functions[func] elif ctx.strict and func in extra_xpath_functions: err_add(ctx.errors, pos, 'STRICT_XPATH_FUNCTION', func) return None elif not ctx.strict and func in extra_xpath_functions: signature = extra_xpath_functions[func] if signature is None: err_add(ctx.errors, pos, 'XPATH_FUNCTION', func) return None # check that the number of arguments are correct nexp = len(signature[0]) nargs = len(args) if nexp == 0: if nargs != 0: err_add(ctx.errors, pos, 'XPATH_FUNC_ARGS', (func, nexp, nargs)) elif signature[0][-1] == '?': if nargs != (nexp - 1) and nargs != (nexp - 2): err_add(ctx.errors, pos, 'XPATH_FUNC_ARGS', (func, "%s-%s" % (nexp - 2, nexp - 1), nargs)) elif signature[0][-1] == '*': if nargs < (nexp - 1): err_add(ctx.errors, pos, 'XPATH_FUNC_ARGS', (func, "at least %s" % (nexp - 1), nargs)) elif nexp != nargs: err_add(ctx.errors, pos, 'XPATH_FUNC_ARGS', (func, nexp, nargs)) # FIXME implement checks from check_function() # check the arguments - FIXME check type i = 0 args_signature = signature[0][:] for arg in args: chk_xpath_expr(ctx, mod, pos, initial, node, arg, args_signature[i]) if args_signature[i] == '*': args_signature.append('*') i = i + 1 return signature[1] def chk_xpath_path(ctx, mod, pos, initial, node, path): if len(path) == 0: return head = path[0] if head[0] == 'var': # check if the variable is known as a node-set # currently we don't have any variables, so this fails err_add(ctx.errors, pos, 'XPATH_VARIABLE', head[1]) elif head[0] == 'function_call': func = head[1] args = head[2] rettype = chk_xpath_function(ctx, mod, pos, initial, node, func, args) if rettype is not None: # known function, check that it returns a node set if rettype != 'node-set': err_add(ctx.errors, pos, 'XPATH_NODE_SET_FUNC', func) if func == 'current': chk_xpath_path(ctx, mod, pos, initial, initial, path[1:]) elif head[0] == 'step': axis = head[1] nodetest = head[2] preds = head[3] node1 = None if axis == 'self': pass elif axis == 'child' and nodetest[0] == 'name': prefix = nodetest[1] name = nodetest[2] if prefix is None: if initial is None: pmodule = None elif initial.keyword == 'module': pmodule = initial else: pmodule = initial.i_module else: pmodule = prefix_to_module(mod, prefix, pos, ctx.errors) # if node and initial are None, it means we're checking an XPath # expression when it is defined in a grouping or augment, i.e., # when the full tree is not expanded. in this case we can't check # the paths if pmodule is not None and node is not None and initial is not None: if node == 'root': children = pmodule.i_children else: children = getattr(node, 'i_children', None) or [] child = search_data_node(children, pmodule.i_modulename, name) if child is None and node == 'root': err_add(ctx.errors, pos, 'XPATH_NODE_NOT_FOUND2', (pmodule.i_modulename, name, pmodule.arg)) elif child is None and node.i_module is not None: err_add(ctx.errors, pos, 'XPATH_NODE_NOT_FOUND1', (pmodule.i_modulename, name, node.i_module.i_modulename, node.arg)) elif child is None: err_add(ctx.errors, pos, 'XPATH_NODE_NOT_FOUND2', (pmodule.i_modulename, name, node.arg)) elif (getattr(initial, 'i_config', None) is True and getattr(child, 'i_config', None) is False): err_add(ctx.errors, pos, 'XPATH_REF_CONFIG_FALSE', (pmodule.i_modulename, name)) else: node1 = child elif axis == 'parent' and nodetest == ('node_type', 'node'): if node is None: pass elif node == 'root': err_add(ctx.errors, pos, 'XPATH_PATH_TOO_MANY_UP', ()) else: p = data_node_up(node) if p is None: err_add(ctx.errors, pos, 'XPATH_PATH_TOO_MANY_UP', ()) else: node1 = p else: # we can't validate the steps on other axis, but we can validate # functions etc. pass for p in preds: chk_xpath_expr(ctx, mod, pos, initial, node1, p, None) chk_xpath_path(ctx, mod, pos, initial, node1, path[1:])
isc
-2,654,624,637,892,220,000
41.410526
80
0.514933
false
3.653869
false
false
false
simone-campagna/zapper
lib/python/zapper/lock_file.py
1
1913
#!/usr/bin/env python3 # # Copyright 2013 Simone Campagna # # Licensed under the Apache License, Version 2.0 (the "License"); # you may not use this file except in compliance with the License. # You may obtain a copy of the License at # # http://www.apache.org/licenses/LICENSE-2.0 # # Unless required by applicable law or agreed to in writing, software # distributed under the License is distributed on an "AS IS" BASIS, # WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. # See the License for the specific language governing permissions and # limitations under the License. # __author__ = 'Simone Campagna' import os import time import errno import fcntl import contextlib @contextlib.contextmanager def Lock(filename, mode="r", blocking=True, timeout=10): # enter lock_op = fcntl.LOCK_EX if not blocking: lock_op += fcntl.LOCK_NB count = 0 interval = 0.1 if timeout is not None: count = int(round(timeout/interval, 0)) if count <= 0: count = 1 with open(filename, mode) as f: for i in range(count): try: #fcntl.fcntl(self.fileno(), lock_op, os.O_NDELAY) fcntl.lockf(f.fileno(), lock_op) except IOError as e: if e.errno in (errno.EACCES, errno.EAGAIN): if timeout: time.sleep(interval) continue except: import traceback traceback.print_exc() time.sleep(interval) yield f #exit fcntl.lockf(f.fileno(), fcntl.LOCK_UN) if __name__ == "__main__": import sys with Lock('a.lock', 'a') as f_out: for arg in sys.argv: f_out.write(arg + '\n') f_out.flush() print("sleeping...") time.sleep(10) print("done.") f_out.write("finito!\n")
apache-2.0
7,631,584,786,992,049,000
27.132353
74
0.590173
false
3.833667
false
false
false
LinguList/server
app/settings/sound_classes/asjp/asjp.py
1
3293
#! /usr/bin/env python from __future__ import division,print_function from lingpy.data.derive import compile_model from scipy.spatial.distance import squareform from time import sleep from pickle import dump asjp = {} score = open('score','r').read() score = score.split('\n') del score[-1] dicto = {} for line in score: lin = line.split('\t') dicto[lin[0]] = lin[1:] letters = [] for i in range(len(score)): score[i] = score[i].split('\t') letters.append(score[i][0]) del score[i][0] matrix = [] for i in range(len(score)): for l in letters: if i < len(dicto[l]): matrix.append(float(dicto[l][i])) matrix = squareform(matrix) consonants = ['p'] + letters consonant_matrix = matrix.copy() score = open('vows_score','r').read() score = score.split('\n') del score[-1] dicto = {} for line in score: lin = line.split('\t') dicto[lin[0]] = lin[1:] letters = [] for i in range(len(score)): score[i] = score[i].split('\t') letters.append(score[i][0]) del score[i][0] matrix = [] for i in range(len(score)): for l in letters: if i < len(dicto[l]): matrix.append(float(dicto[l][i])) matrix = squareform(matrix) vowel_matrix = matrix.copy() vowels = ['i'] + letters for i in range(len(vowel_matrix)): vowel_matrix[i][i] = 40 for i in range(len(consonant_matrix)): consonant_matrix[i][i] = 40 for i in range(31): for j in range(31): asjp[consonants[i],consonants[j]] = consonant_matrix[i][j] for i in range(7): for j in range(7): asjp[vowels[i],vowels[j]] = vowel_matrix[i][j] for l in vowels: asjp[l,'X'] = 0 asjp['X',l] = 0 for l in consonants: asjp[l,'X'] = 0 asjp['X',l] = 0 asjp['X','X'] = 0 for v in vowels: for c in consonants: asjp[v,c] = -20 asjp[c,v] = -20 for key in asjp.keys(): if asjp[key] == 0: asjp[key] = 0 else: asjp[key] = int(asjp[key]+0.5) for v1 in vowels: for v2 in vowels: asjp[v1,v2] = int(asjp[v1,v2] * 0.25 + 0.5) + 10 asjp['i','y'] = -2 asjp['y','i'] = -2 asjp['u','w'] = -2 asjp['w','u'] = -2 asjp['u','v'] = -4 asjp['v','u'] = -4 asjp['u','f'] = -6 asjp['f','u'] = -6 keys = [] for keyA,keyB in asjp.keys(): keys.append((keyA,keyB)) for keyA,keyB in keys: asjp[keyA,'+'] = -20 asjp['+',keyB] = -20 asjp[keyA,'0'] = 0 asjp['0',keyB] = 0 asjp['X','+'] = -5 asjp['+','X'] = -5 asjp['+','+'] = 0 # swaps asjp['0','0'] = 0 # missing values asjp['X','0'] = 0 asjp['0','X'] = 0 for i in '0123456': for j in '0123456': if i == j: asjp[i,j] = 10 else: asjp[i,j] = 5 keys = [] for keyA,keyB in asjp.keys(): keys.append((keyA,keyB)) for keyA,keyB in keys: for i in '123456': if keyA not in '123456' and keyB not in '123456': asjp[keyA,i] = -20 asjp[i,keyB] = -20 asjp[keyA,'_'] = -50 asjp['_',keyB] = -50 asjp['_','_'] = 0 for x in asjp.keys(): asjp[x] = asjp[x] / 4.0 if asjp[x] > 0 and asjp[x] != 10: asjp[x] += 0.75 * asjp[x] elif asjp[x] < 0: asjp[x] += 0.75 * asjp[x] out = open('scorer.bin','wb') dump(asjp,out) out.close() compile_model('asjp') print("[i] Compilation of the ASJP model was successful!") sleep(1)
gpl-2.0
3,162,807,456,613,274,600
19.710692
66
0.54631
false
2.485283
false
false
false
wevoice/wesub
dev_settings_test.py
1
2112
# Amara, universalsubtitles.org # # Copyright (C) 2013 Participatory Culture Foundation # # This program is free software: you can redistribute it and/or modify # it under the terms of the GNU Affero General Public License as # published by the Free Software Foundation, either version 3 of the # License, or (at your option) any later version. # # This program is distributed in the hope that it will be useful, # but WITHOUT ANY WARRANTY; without even the implied warranty of # MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the # GNU Affero General Public License for more details. # # You should have received a copy of the GNU Affero General Public License # along with this program. If not, see # http://www.gnu.org/licenses/agpl-3.0.html. from dev_settings import * INSTALLED_APPS += ( 'django_nose', ) DATABASES = { 'default': { 'ENGINE': 'django.db.backends.sqlite3', 'NAME': ':memory:', 'USER': '', 'PASSWORD': '', 'HOST': '', 'PORT': '', } } CACHE_PREFIX = "testcache" CACHE_TIMEOUT = 60 TEST_RUNNER = 'django_nose.NoseTestSuiteRunner' NOSE_PLUGINS = ['utils.test_utils.plugin.UnisubsTestPlugin'] CELERY_ALWAYS_EAGER = True YOUTUBE_CLIENT_ID = 'test-youtube-id' YOUTUBE_CLIENT_SECRET = 'test-youtube-secret' YOUTUBE_API_KEY = 'test-youtube-api-key' API_ALWAYS_USE_FUTURE = True # Use MD5 password hashing, other algorithms are purposefully slow to increase # security. Also include the SHA1 hasher since some of the tests use it. PASSWORD_HASHERS = ( 'django.contrib.auth.hashers.MD5PasswordHasher', 'django.contrib.auth.hashers.SHA1PasswordHasher', ) # Let the nose CaptureLogging plugin handle logging. It doesn't display # logging at all, except if there's a test failure. del LOGGING NOSE_ARGS = ['--logging-filter=test_steps, -remote_connection, ' '-selenium.webdriver.remote.remote_connection', '--with-xunit', '--logging-level=ERROR', '--xunit-file=nosetests.xml', ] try: from dev_settings_test_local import * except ImportError: pass
agpl-3.0
-7,629,318,859,687,858,000
30.058824
78
0.69697
false
3.622642
true
false
false
robotican/ric
ric_board/scripts/RiCConfigurator/GUI/SimulationWindow.py
1
5700
import GUI.MainWindow __author__ = 'tom' from PyQt4.QtGui import * from GUI.Schemes.gazeboGui import Ui_gazebo_gui from BAL.Interface.DeviceFrame import SERVO, BATTERY, SWITCH, IMU, PPM, GPS, RELAY, URF, CLOSE_LOP_ONE, CLOSE_LOP_TWO, \ OPEN_LOP, DIFF_CLOSE, DIFF_OPEN, EX_DEV, HOKUYO, OPRNNI, USBCAM, DIFF_CLOSE_FOUR, ROBOT_MODEL, SLAM, Keyboard, \ JOYSTICK, SMOOTHER import rospkg import pickle from PyQt4.QtCore import Qt from lxml.etree import Element, SubElement class SimulationWindow(QDialog, Ui_gazebo_gui): def __init__(self, parent=None): super(SimulationWindow, self).__init__(parent) self.setupUi(self) self._devs = [] self.loadButton.clicked.connect(self.loadEvent) self.launchButton.clicked.connect(self.launchEvent) self.devList.itemClicked.connect(self.listChangeEvent) self.loadFile() self.showSimDetail() def listChangeEvent(self, item): dev = self._devs[self.devList.row(item)] if item.checkState() > 0: dev[1] = True else: dev[1] = False def loadFile(self): self._devs = [] pkg = rospkg.RosPack().get_path('ric_board') fileName = QFileDialog.getOpenFileName(self, self.tr("Open file"), "%s/DATA" % pkg, self.tr("RiC File (*.RIC)")) if fileName == '': return devices = pickle.load(open(fileName))[2] self.arrangeDevices(devices) def arrangeDevices(self, devices): for dev in devices: if dev['type'] in [DIFF_CLOSE, IMU, OPRNNI, HOKUYO, USBCAM, URF]: self._devs.append([dev, True]) def showSimDetail(self): for dev in self._devs: if dev[0]['type'] == OPRNNI: listItem = QListWidgetItem('OpenniCamera') else: listItem = QListWidgetItem(dev[0]['name']) listItem.setCheckState(Qt.Checked) self.devList.addItem(listItem) def clearLst(self): size = self.devList.count() for i in xrange(size): self.devList.takeItem(0) def loadEvent(self): self.loadFile() self.clearLst() self.showSimDetail() def launchEvent(self): root = Element('launch') SubElement(root, 'arg', { 'name': 'paused', 'default': 'false' }) SubElement(root, 'arg', { 'name': 'use_sim_time', 'default': 'true' }) SubElement(root, 'arg', { 'name': 'gui', 'default': 'true' }) SubElement(root, 'arg', { 'name': 'headless', 'default': 'false' }) SubElement(root, 'arg', { 'name': 'debug', 'default': 'false' }) world = SubElement(root, 'include', dict(file='$(find gazebo_ros)/launch/empty_world.launch')) SubElement(world, 'arg', { 'name': 'debug', 'value': '$(arg debug)' }) SubElement(world, 'arg', { 'name': 'gui', 'value': '$(arg gui)' }) SubElement(world, 'arg', { 'name': 'paused', 'value': '$(arg paused)' }) SubElement(world, 'arg', { 'name': 'use_sim_time', 'value': '$(arg use_sim_time)' }) SubElement(world, 'arg', { 'name': 'headless', 'value': '$(arg headless)' }) SubElement(root, 'param', { 'name': 'robot_description', 'command': "$(find xacro)/xacro.py '$(find ric_gazebo)/robots/komodo/komodo.xacro' ns:='init' color_name:='Grey'" }) haveCam = 'false' haveOpenNi = 'false' haveLaser = 'false' haveUrf = 'false' haveDiff = 'false' haveImu = 'false' for dev in self._devs: if dev[1]: if dev[0]['type'] == DIFF_CLOSE: haveDiff = 'true' if dev[0]['type'] == IMU: haveImu = 'true' if dev[0]['type'] == OPRNNI: haveOpenNi = 'true' if dev[0]['type'] == HOKUYO: haveLaser = 'true' if dev[0]['type'] == USBCAM: haveCam = 'true' if dev[0]['type'] == URF: haveUrf = 'true' amount = self.numberOfRobotsSpinBox.value() for i in xrange(amount): robotFile = SubElement(root, 'include', {'file': '$(find ric_gazebo)/launch/spawn_komodo.launch'}) SubElement(robotFile, 'arg', dict(name='name', value='komodo_%d' % (i + 1))) SubElement(robotFile, 'arg', dict(name='color', value='White')) SubElement(robotFile, 'arg', dict(name='x', value='0.0')) SubElement(robotFile, 'arg', dict(name='y', value='%d.0' % i)) SubElement(robotFile, 'arg', dict(name='z', value='0.1')) SubElement(robotFile, 'arg', dict(name='R', value='0.0')) SubElement(robotFile, 'arg', dict(name='P', value='0.0')) SubElement(robotFile, 'arg', dict(name='Y', value='0.0')) SubElement(robotFile, 'arg', dict(name='arm_camera', value='true')) SubElement(robotFile, 'arg', dict(name='front_camera', value=haveCam)) SubElement(robotFile, 'arg', dict(name='isDiff', value=haveDiff)) SubElement(robotFile, 'arg', dict(name='depth_camera', value=haveOpenNi)) SubElement(robotFile, 'arg', dict(name='laser_scanner', value=haveLaser)) SubElement(robotFile, 'arg', dict(name='urf', value=haveUrf)) SubElement(robotFile, 'arg', dict(name='imu', value=haveImu)) open('/home/tom/test.launch', 'w').write(GUI.MainWindow.prettify(root))
bsd-3-clause
-2,762,979,084,064,864,000
35.538462
126
0.542632
false
3.490508
false
false
false
andrey-yemelyanov/competitive-programming
cp-book/ch1/adhoc/chess/10849_MoveTheBishop.py
1
1456
# Problem name: 10849 Move the bishop # Problem url: https://uva.onlinejudge.org/external/108/10849.pdf # Author: Andrey Yemelyanov import sys import math WHITE, BLACK = 0, 1 INFINITY = -1 def main(): n_test_cases = int(sys.stdin.readline().strip()) for i in range(n_test_cases): sys.stdin.readline() n_tests = int(sys.stdin.readline().strip()) N = int(sys.stdin.readline().strip()) for j in range(n_tests): from_row, from_col, to_row, to_col = [int(t) for t in sys.stdin.readline().split()] n_moves = count_bishop_moves(from_row, from_col, to_row, to_col) if n_moves == INFINITY: print("no move") else: print(n_moves) def count_bishop_moves(from_row, from_col, to_row, to_col): if from_row == to_row and from_col == to_col: return 0; elif square_color(from_row, from_col) != square_color(to_row, to_col): return INFINITY elif on_the_same_diagonal(from_row, from_col, to_row, to_col): return 1 else: return 2 def on_the_same_diagonal(row1, col1, row2, col2): return abs(row1 - row2) == abs(col1 - col2) def square_color(row, col): if row % 2 == 0: if col % 2 == 0: return WHITE else: return BLACK else: if col % 2 == 0: return BLACK else: return WHITE if __name__=="__main__": main()
mit
-4,838,296,833,532,812,000
27
95
0.56044
false
3.137931
false
false
false
zfrxiaxia/Code-zfr
计蒜客/比赛/2015/light.py
1
1148
# -*- coding: utf-8 -*- """ Created on Sat May 28 19:17:42 2016 @author: AtoZ """ N,M = raw_input().split() N,M = int(N),int(M) while(1): i0 = 0 while(i0<2**(M*N)): bit = [0]*M*N t_bit = bin(i0) lt_bit = len(t_bit) for j0 in range(lt_bit-2): bit[j0] = int(t_bit[j0+2]) i0 +=1 print bit """ N,M = raw_input().split() N,M = int(N),int(M) L0 = [] L = [] time = 0 def change(h,l): global time time += 1 if h == N-1: pass else: L[h*M+l] = not L[h*M+l] L[(h+1)*M+l] = not L[(h+1)*M+l] if l != 0: L[(h+1)*M+l-1] = not L[(h+1)*M+l-1] if l != M-1: L[(h+1)*M+l+1] = not L[(h+1)*M+l+1] if h != N-2: L[(h+2)*M+l] = not L[(h+2)*M+l] while(1): try: temp = raw_input() L0.append(temp.split()) except: break for i in range(N): for j in range(M): L.append(int(L0[i][j])) LL = [1]*N*M j = 0 while(j<N): for i in range(M): ii = i+j*M if L[ii]==0: change(j,i) j += 1 if L==LL: print time else: print "no solution" """
gpl-3.0
7,432,343,685,599,265,000
16.953125
47
0.419861
false
2.314516
false
false
false